Accept Refuse

EUR-Lex Access to European Union law

This document is an excerpt from the EUR-Lex website

Document 32002D0113

Komisijas Lēmums (2002. gada 23. janvāris), ar ko groza Komisijas Lēmumu 1999/217/EK par pārtikas produktos vai uz tiem lietojamo aromatizējošu vielu reģistru (izziņots ar numuru C(2002) 88)Dokuments attiecas uz EEZ.

OJ L 49, 20.2.2002, p. 1–160 (ES, DA, DE, EL, EN, FR, IT, NL, PT, FI, SV)
Special edition in Czech: Chapter 13 Volume 029 P. 108 - 266
Special edition in Estonian: Chapter 13 Volume 029 P. 108 - 266
Special edition in Latvian: Chapter 13 Volume 029 P. 108 - 266
Special edition in Lithuanian: Chapter 13 Volume 029 P. 108 - 266
Special edition in Hungarian Chapter 13 Volume 029 P. 108 - 266
Special edition in Maltese: Chapter 13 Volume 029 P. 108 - 266
Special edition in Polish: Chapter 13 Volume 029 P. 108 - 266
Special edition in Slovak: Chapter 13 Volume 029 P. 108 - 266
Special edition in Slovene: Chapter 13 Volume 029 P. 108 - 266
Special edition in Bulgarian: Chapter 13 Volume 035 P. 3 - 162
Special edition in Romanian: Chapter 13 Volume 035 P. 3 - 162
Special edition in Croatian: Chapter 13 Volume 022 P. 3 - 162

No longer in force, Date of end of validity: 21/04/2013; Atcelts ar 32012R0872

ELI: http://data.europa.eu/eli/dec/2002/113(1)/oj

32002D0113



Oficiālais Vēstnesis L 049 , 20/02/2002 Lpp. 0001 - 0160


Komisijas Lēmums

(2002. gada 23. janvāris),

ar ko groza Komisijas Lēmumu 1999/217/EK par pārtikas produktos vai uz tiem lietojamo aromatizējošu vielu reģistru

(izziņots ar numuru C(2002) 88)

(Dokuments attiecas uz EEZ)

(2002/113/EK)

EIROPAS KOPIENU KOMISIJA,

ņemot vērā Eiropas Kopienas dibināšanas līgumu,

ņemot vērā Eiropas Parlamenta un Padomes 1996. gada 28. oktobra Regulu (EK) Nr. 2232/96, ar ko paredz Kopienas procedūru attiecībā uz aromatizējošām vielām, kuras lieto vai kuras paredzētas lietošanai pārtikas produktos vai uz tiem [1], un jo īpaši tās 3. panta 1. punktu,

tā kā:

(1) Saskaņā ar Regulas (EK) Nr. 2232/96 3. panta 2. punktu Komisija ar Lēmumu 1999/217/EK [2], kurā grozījumi izdarīti ar Lēmumu 2000/489/EK [3], ir pieņēmusi pārtikas produktos vai uz tiem lietojamo aromatizējošo vielu reģistru.

(2) Saskaņā ar Komisijas 2000. gada 18. jūlija Regulu (EK) Nr. 1565/2000, kura izklāsta pasākumus, kas vajadzīgi, lai pieņemtu novērtēšanas programmu, piemērojot Regulu (EK) Nr. 2232/96 [4], katrai aromatizējošai vielai ir jāpiešķir jauni numuri, tā sauktie "FL numuri". Turklāt visas reģistra aromatizējošās vielas ir sīkāk jāiedala radniecīgu vielu grupās saskaņā ar minētajā regulā noteikto grupu sarakstu. Šai informācijai jābūt pieejamai personām, kas vielu laiž tirgū, tā lai tās varētu izpildīt pienākumus saskaņā ar Regulu (EK) Nr. 1565/2000. Aromatizējošo vielu reģistram tādēļ jāsniedz jaunie FL numuri un grupu numuri.

(3) Lēmumam 1999/217/EK, kurā grozījumi izdarīti ar Lēmumu 2000/489/EK, pievienotā reģistra 1., 2. un 3. daļa ir jāapvieno vienā daļā, A daļā, un vielas jāuzskaita saskaņā ar to FL numuriem. Reģistra 4. daļa ir jāaizstāj ar reģistra B daļas tekstu, kas pievienots šim lēmumam.

(4) Dalībvalstu izziņoto un Lēmumā 1999/217/EK noteikto vielu rūpīga pārbaude ir atklājusi vairākas ķīmisko numuru, nosaukumu, sinonīmu un sistemātisko nosaukumu neatbilstības un uzrādījusi vairākus gadījumus, kad vienas un tās pašas vielas ir parādījušās reģistrā ar dažādiem nosaukumiem. Šīs neatbilstības ir jāizlabo. Attiecībā uz tām neatbilstībām, par kurām šajā posmā nav izdarāms gala slēdziens, vismaz ir jāmin iespējamas neatbilstības fakts.

(5) Dažas dalībvalstis ir atsaukušas savus attiecīgos paziņojumus par vairākām Lēmumā 1999/217/EK minētām vielām, iekļaujot konfidenciāli izziņotas vielas. Šīs vielas no reģistra ir jāsvītro. Līdzīgi, dalībvalstis ir izziņojušas jaunas vielas, kas saskaņā ar Regulas (EK) Nr. 2232/96 5. panta 2. punktu ir jāiekļauj vērtēšanas programmā un tādēļ ir jāiekļauj reģistrā.

(6) Saskaņā ar Regulas (EK) Nr. 2232/96 4. panta 3. punktu viela no reģistra ir jāsvītro, ja pēc novērtēšanas ir redzams, ka aromatizējošā viela neatbilst vispārējiem lietošanas kritērijiem, kas sniegti minētās regulas pielikumā. Pārtikas zinātniskā komiteja savā 2001. gada 26. septembra atzinumā secināja, ka 4-alil-1, 2-dimetoksibenzols (metileigenols) un 1-alil-4-metoksibenzols (estragols) ir genotoksisks. Šīs vielas no reģistra ir jāsvītro.

(7) Tādēļ atbilstīgi jāgroza Lēmums 1999/217/EK.

(8) Šajā direktīvā paredzētie pasākumi ir saskaņā ar Pārtikas produktu pastāvīgās komitejas atzinumu,

IR PIEŅĒMUSI ŠO LĒMUMU.

1. pants

Lēmumam 1999/217/EK pievienoto reģistru aizstāj ar šā lēmuma pielikuma tekstu.

2. pants

Šis lēmums ir adresēts dalībvalstīm.

Briselē, 2002. gada 23. janvārī

Komisijas vārdā —

Komisijas loceklis

David Byrne

[1] OV L 299, 23.11.1996., 1. lpp.

[2] OV L 84, 27.3.1999., 1. lpp.

[3] OV L 197, 3.8.2000., 53. lpp.

[4] OV L 180, 19.7.2000., 8. lpp.

--------------------------------------------------

PIELIKUMS

"

To aromatizējošo vielu reģistrs, kuras dalībvalstis izziņo saskaņā ar Eiropas Parlamenta un Padomes 1996. gada 28. oktobra Regulas (EK) Nr. 2232/96, ar ko nosaka Kopienas procedūru aromatizējošām vielām, kuras lieto vai kuras paredzētas lietošanai pārtikas produktos vai uz tiem, 3. panta 1. punktu

Ķīmiski definētu aromatizējošu vielu reģistrs ir iedalīts divās atšķirīgās daļās. A daļā ir uzskaitītas vielas saskaņā ar to FL numuriem. B daļā ir uzskaitītas tās vielas, par kurām dalībvalsts ir lūgusi konfidencialitāti, lai aizsargātu ražotāja intelektuālā īpašuma tiesības.

A daļā ir norādīti CAS [1], EINECS [2], CoE [3] un FEMA [4] numuri, ja tie ir pieejami.

Numurs ailē "komentāri" attiecas uz vienu no šādām piezīmēm:

1. Viela, ko neatkarīgi no tās aromatizējošajām īpašībām izmanto citiem mērķiem pārtikas produktos vai uz tiem un uz ko tādēļ var attiekties papildu tiesību normas.

2. Viela, kuras lietošana dažās dalībvalstīs pakļauta ierobežojošiem vai aizliedzošiem pasākumiem.

3. Viela, kam jāpiešķir prioritāte Regulā (EK) Nr. 1565/2000 noteiktajā vērtēšanas programmā.

4. Viela, par kuru jāiesniedz papildu informācija.

5. Nosaukums, sinonīmi, sistemātiskie nosaukumi, CAS, EINECS, CoE vai FEMA numurs var saturēt neatbilstības.

Īpašs ierosinātais jautājums attiecās uz rīkošanos ar sāļiem un citiem no pamatvielas atvasinātiem savienojumiem. Dažas vielas bija izziņotas ar lielu precizitātes pakāpi. Citām vielām šī sīki izstrādātā informācija trūkst. Vairākām skābēm vai bāzēm nav doti īpaši norādījumi par to atvasināto sāļu iekļaušanu. Ir iepriekš pieņemts, bet tikai šā reģistra mērķiem, ka amonija, nātrija, kālija un kalcija sāļi, kā arī hlorīdi, karbonāti un sulfāti ir iekļauti pamatvielā ar noteikumu, ka tiem ir aromatizējošas īpašības. Tomēr galīgā akceptēšana būs atkarīga no rezultātiem vērtēšanā, kurā šajos gadījumos ir rūpīgi jāpārbauda šādas iekļaušanas precizitāte.

A DAĻA

AROMATIZĒJOŠAS VIELAS

(sakārtotas pēc FL numuriem)

FL Nr. | Ķīmisko vielu grupa | CAS | Nosaukums | Fema | CoE | EINECS | FL Nr. | Sinonīmi | Sistemātiskais nosaukums | Komentāri |

01.001 | 31 | 138–86–3 | limonēns | 2633 | 491 | 205–341–0 | 01.001 | 1,8(9)- p-mentadiēns; p-menta-1,8-diēns; 1-metil-4-izopropenil-1-cikloheksēns; dipentēns; karvēns; cinēns; citrēns | | 5 |

01.002 | 31 | 99–87–6 | 1-izopropil-4-metilbenzols | 2356 | 620 | 202–796–7 | 01.002 | p-cimēns; cimēns; p-metilizopropilbenzols; 4-izopropil-1-metilbenzols; cimols; 4-metil-1-izopropilbenzols; 1-metil-4-izopropilbenzols | | |

01.003 | 31 | 127–91–3 | pin-2(10)-ēns | 2903 | 2114 | 204–872–5 | 01.003 | β-pinens | 6,6-dimetil-2-metilēnbiciklo[3.1.1]heptāns | |

01.004 | 31 | 80–56–8 | pin-2(3)-ēns | 2902 | 2113 | 201–291–9 | 01.004 | α-pinens | 2,6,6-trimetilbiciklo[3.1.1]hept-2-ēns | |

01.005 | 31 | 586–62–9 | terpinolēns | 3046 | 2115 | 209–578–0 | 01.005 | p-menta-1,4(8)-diēns; 1-metil-4-izopropilidēn-1-cikloheksēns; 1,4(8)-terpadiēns | p-menta-1,4(8)-diēns; | |

01.006 | 31 | 99–83–2 | α-felandrens | 2856 | 2117 | 202–792–5 | 01.006 | felandrēns; 2-metil-5-izopropil-1,3-cikloheksadiēns; 4-izopropil-1-metil-1,5-cikloheksadiēns | p-menta-1,5-diēns | |

01.007 | 31 | 87–44–5 | β-kariofilens | 2252 | 2118 | 201–746–1 | 01.007 | kariofilēns; 2-metilēn-6,10,10-trimetilbiciklo[7.2.0]undec-5-ēns | 4,11,11-trimetil-8-metilēnbiciklo[7.2.0]undec-4-( trans)-ēns | |

01.008 | 31 | 123–35–3 | mircēns | 2762 | 2197 | 204–622–5 | 01.008 | 7-metil-3-metilēn-1,6-oktadiēns | 7-metil-3-metilēn-1,6-oktadiēns | |

01.009 | 31 | 79–92–5 | kamfēns | 2229 | 2227 | 201–234–8 | 01.009 | 3,3-dimetil-2-metilēnnorkamfēns; 2,2-dimetil-3-metilēnnorbornāns | | |

01.010 | 31 | 1195–32–0 | 1-izopropenil-4-metilbenzols | 3144 | 2260 | 214–795–9 | 01.010 | 4, α-dimetilstirols; p-izopropeniltoluols; 1-metil-4-izopropenilbenzols; 2- p-tolilpropēns | | |

01.011 | 31 | 644–08–6 | 4-metil-1,1′ - bifenils | 3186 | 2292 | 211–409–0 | 01.011 | p-metildifenils p-metilfenilbenzols; fenil- p-tolils; p-feniltoluols | | |

01.013 | 31 | 92–52–4 | bifenils | 3129 | 10978 | 202–163–5 | 01.013 | difenils; fenilbenzols | | 4 |

01.014 | 31 | 90–12–0 | 1-metilnaftalīns | 3193 | 11009 | 201–966–8 | 01.014 | α-metilnaftalins | | |

01.015 | 31 | 100–42–5 | vinilbenzols | 3233 | 11022 | 202–851–5 | 01.015 | stirols; vinilbenzols; feniletēns; feniletilēns | | 2, 3 |

01.016 | 31 | 495–62–5 | 1,4(8),12-bisabolatriēns | 3331 | 10979 | 207–805–8 | 01.016 | γ-bisabolens; γ-bisabolens; 1-metil-4-(1,5-dimetil-1, 4-heksadienil)- 1-cikloheksēns | 6-metil-2-(4-metilcikloheks-3-enilidēn)hept-5-ēns | |

01.017 | 31 | 4630–07–3 | valencēns | 3443 | 11030 | 225–047–6 | 01.017 | 1,2,3,5,6,7,8a-oktahidro-1,8a-dimetil-7-izopropenilnaftalīns | 1,2-dimetil-9-izopropilēnbi-ciklo[4.4.0]dec-5-ēns | |

01.018 | 31 | 13877–91–3 | β-ocimens | 3539 | 11015 | 237–641–2 | 01.018 | trans-β-ocimens; 1,3,6-oktatriēns, 3,7-dimetil-; | 3,7-dimetilokta-1,3-( trans), 6-triēns | |

01.019 | 31 | 99–86–5 | α-terpinens | 3558 | 11023 | 202–795–1 | 01.019 | 1-izopropil-4-metil-1,3-cikloheksadiēns | p-menta-1,3-diēns | |

01.020 | 31 | 99–85–4 | γ-terpinens | 3559 | 11025 | 202–794–6 | 01.020 | 1-metil-4-izopropil-1,4-cikloheksadiēns; moslēns; kritmēns | p-menta-1,4-diēns | |

01.021 | 31 | 29350–73–0 | δ-kadinens | | 10982 | 249–580–9 | 01.021 | α-, β-, γ-, ε-, δ-kadiens | 2,3,4,7,8,10-heksahidro-1,6-dimetil-4-izopropilnaftalīns | |

01.022 | 31 | 469–61–4 | α-cedrens | | 10985 | 207–418–4 | 01.022 | | 2,6,6, 8-tetrametiltriciklo[5.3.1.0(1.5)]undec-8-ēns | |

01.023 | 31 | 3691–12–1 | 1(5),11-gvajadiēns | | 11003 | 201–860–1 | 01.023 | 1,4-dimetil-7-izopropenil-δ-9,10-oktahidroazulens; α-gvajens | 2,8-dimetil-5-izopropenilbiciklo[5.3.0]dec-1(7)-ēns | |

01.024 | 31 | 5208–59–3 | β-burbonens | | 11931 | | 01.024 | | 2-metil-8-metilēn-5-izopropiltri-ciklo[5.3.0.0(2.6)]dekāns | |

01.025 | 31 | 30640–46–1 | 2-metil-1,3-cikloheksadiēns | | 11797 | 250–269–5 | 01.025 | dihidrotoluols-(1,3) | | |

01.026 | 31 | 88–84–6 | 1(5),7(11)-gvajadiēns | | | 201–860–1 | 01.026 | β-gvajens; (1S- cis)- 1,2,3,4,5,6,7,8-oktahidro-7-izopropilidēn-1,4-dimetilazulēns | 2,8-dimetil-5-izopropilidēnbiciklo[5.3.0]dec-1(7)-ēns | |

01.027 | 31 | 17627–44–0 | bisabola-1,8,12-triēns | | | 241–610–9 | 01.027 | α-bisabolens | 6-metil-2-(4-metilcikloheks-3-enil)hepta-2,5-diēns | |

01.028 | 31 | 495–61–4 | β-bisabolens | | | | 01.028 | | | |

01.029 | 31 | 13466–78–9 | δ-3-karens | 3821 | 10983 | 236–719–3 | 01.029 | 3-karēns; izodiprēns; d-3-karēns; kar-3-ēns; 4,7,7-trimetil-3-norkarēns; 3,7,7-trimetilbiciklo[4.1.0]hept-3-ēns | 3,7,7-trimetilbiciklo[4.1.0]hept-3-ēns | |

01.030 | 31 | 13744–15–5 | β-kubebens | | 10989 | | 01.030 | | 10-metil-4-metilēn-7-izopropiltriciklo[4.4.0.0.(1.5)]dekāns | |

01.031 | 31 | 30364–38–6 | 1,2-dihidro-1,1,6-trimetilnaftalīns | | | 250–150–8 | 01.031 | dehidrojonēns | | |

01.032 | 31 | 7681–88–1 | 2,3-dihidrofarnezēns | | | | 01.032 | | | |

01.033 | 31 | 590–73–8 | 2,2-dimetilheksāns | | | 209–689–4 | 01.033 | | | |

01.034 | 31 | 589–43–5 | 2,4-dimetilheksāns | | | 209–649–6 | 01.034 | | | |

01.035 | 31 | 673–84–7 | 2,6-dimetilokta-2,4,6-triēns | | | 211–614–5 | 01.035 | allo-ocimēns; allocimēns | | |

01.036 | 31 | 101–81–5 | difenilmetāns | | 11847 | 202–978–6 | 01.036 | benzilbenzols; fenilbenzils; 1,1′-metilēn- bis-benzols | | |

01.037 | 31 | 112–41–4 | dodec-1-ēns | | 10992 | 203–968–4 | 01.037 | 1-dodecēns dodecilēns | | |

01.038 | 31 | 112–40–3 | dodekāns | | | 203–967–9 | 01.038 | n-dodekāns | | |

01.039 | 31 | 20307–84–0 | δ-elemens | | 10996 | | 01.039 | | 3 -izopropenil-1-izopropil-4-metil-4-vinilcikloheks-1-ēns | |

01.040 | 31 | 502–61–4 | α-farnezens | 3839 | 10998 | 207–948–6 | 01.040 | 1,3,6,10-dodekatetraēns, 3,7,11-trimetil (?-izomērs) | 3,7,11-trimetildodeka-1,3,6,10-tetraēns | 5 |

01.041 | 31 | 18794–84–8 | β-farnezens | 3839 | 10999 | 242–582–0 | 01.041 | 3,7,11-trimetil-1,3,6,10-dodekatetraēns; 2,6,10-trimetil-2,6,9,11-dodekatetraēns | 7,11-dimetil-3-metilēn-1,6,10-dodekatriēns | 5 |

01.042 | 31 | 23986–74–5 | germakra-1(10), 4(14), 5-triēns | | | | 01.042 | germakrēns D | 3-izopropil-6-metil-10-metilēnciklodeka-1,6-diēns | |

01.043 | 31 | 6753–98–6 | 3,7,10-humulatriēns | | 11004 | 229–816–7 | 01.043 | α-humulatriēns; α-kariofilens | 1,5,5,8-tetrametilcikloundeka-3,7,10-triēns | |

01.044 | 31 | 1135–66–6 | izolongifolēns | | | 214–494–2 | 01.044 | | 2,2,7,7-tetrametiltriciklo[6.2.1(1.8).0(1.6)]undec-5-ēns | |

01.045 | 31 | 5989–27–5 | D-limonēns | 2633 | 491 | 227–813–5 | 01.045 | | p-menta-1,8-diēns | |

01.046 | 31 | 5989–54–8 | L-limonēns | 2633 | 491 | 227–815–6 | 01.046 | levolimonēns | | 5 |

01.047 | 31 | 475–20–7 | longifolēns | | | 207–491–2 | 01.047 | | dekahidro-4,8,8-trimetil-9-metilēn-1, 4-metanoazulēns | |

01.049 | 31 | 78–79–5 | 2-metilbuta-1,3-diēns | | | 201–143–3 | 01.049 | izoprēns 2-metil-1, 3-butadiēns β-metilbivinils; izopentadiēns | | |

01.050 | 31 | 589–34–4 | 3-metilheksāns | | | 209–643–3 | 01.050 | | | |

01.051 | 31 | 91–57–6 | 2-metilnaftalīns | | 11010 | 202–078–3 | 01.051 | β-metilnaftalins | | |

01.052 | 31 | 10208–80–7 | α-muurolens | | 11011 | | 01.052 | | 2,8-dimetilēn-5-izopropil-biciklo[4.4.0]dekāns | |

01.053 | 31 | 91–20–3 | naftalīns | | 11014 | 202–049–5 | 01.053 | naftēns; darvas kampars | | |

01.054 | 31 | 629–62–9 | pentadekāns | | | 211–098–1 | 01.054 | n-pentadekāns; | | |

01.055 | 31 | 555–10–2 | β-felandrens | | 11017 | 209–081–9 | 01.055 | | p-menta-1(7),2-diēns | |

01.056 | 31 | 512–61–8 | α-santalens | | | | 01.056 | | 1,7-dimetil-7-(4-metil-3-pentenil)triciklo[2.2.1.0 (2.6)]heptāns | |

01.057 | 31 | 629–59–4 | tetradekāns | | | 211–096–0 | 01.057 | n-tetradekāns | | |

01.058 | 31 | 475–03–6 | 1,2,3,4-tetrahidro-1,1,6-trimetilnaftalīns | | | 207–490–7 | 01.058 | jonēns; 1,1,6-trimetiltetralīns; frambilēns | | |

01.059 | 31 | 3387–41–5 | 4(10)-tujēns | | 11018 | 222–212–4 | 01.059 | | 4-metilēn-1-izopropilbiciklo[3.1.0]heksāns | |

01.060 | 31 | 508–32–7 | 1,1,7-trimetiltriciklo[2.2.1.0.(2.6)]heptāns | | | 208–083–7 | 01.060 | triciklēns | | |

01.061 | 31 | 16356–11–9 | undeka-1,3,5-triēns | 3795 | | 240–416–1 | 01.061 | | | |

01.062 | 31 | 98–83–9 | (1-metiletenil)benzols | | | 202–792–5 | 01.062 | 2-fenilpropēns; β-fenilpropēns; α-metilstirols; izopropilfeniletilēns; metilstirols | | |

01.064 | 31 | 3338–55–4 | cis- 3,7-dimetil-1,3,6-oktatriēns | | | 222–081–3 | 01.064 | | | |

01.065 | 31 | 4221–98–1 | (R)- 5-(1-metiletil)- 2-metil-1,3-cikloheksadiēns | 2856 | 2117 | 224–167–6 | 01.065 | | | 5 |

01.066 | 31 | | 2-cedrēns | | | | 01.066 | | 2,2,4,8-tetrametiltriciklo[5.3.1(3.7).0(1.7)]undec-8(9)-ēns | |

01.067 | 31 | | 8(14)-cedrēns | | | | 01.067 | β-cedrēns | 2,2,4,8-tetrametiltriciklo[5.3.1(3.7).0(1.7)]undec-4(14)-ēns | |

01.068 | 31 | 592–98–3 | 3-oktēns | | | | 01.068 | | | |

01.069 | 31 | 38533–54–9 | 1,3,5,8-undekatetraēns | | | | 01.069 | | | |

02.001 | 02 | 78–83–1 | 2-metilpropan-1-ols | 2179 | 49 | 201–148–0 | 02.001 | izobutanols; izopropilkarbinols | | |

02.002 | 01 | 71–23–8 | propan-1-ols | 2928 | 50 | 200–746–9 | 02.002 | propilspirts | | |

02.003 | 02 | 123–51–3 | izopentanols | 2057 | 51 | 204–633–5 | 02.003 | izoamilspirts; izopentilspirts; izoamilalkohols; 3-metil-1-butanols; izopentilalkohols; izobutilkarbinols | 3-metilbutān-1-ols | |

02.004 | 01 | 71–36–3 | butan-1-ols | 2178 | 52 | 200–751–6 | 02.004 | propilkarbinols; hidroksibutāns; butilspirts | | 4 |

02.005 | 01 | 111–27–3 | heksan-1-ols | 2567 | 53 | 203–852–3 | 02.005 | C-6 spirts; n-heksilspirts; amilkarbinols; n-heksanols | | |

02.006 | 01 | 111–87–5 | oktan-1-ols | 2800 | 54 | 203–917–6 | 02.006 | C-8 spirts; n-oktilspirts; heptilkarbinols; kaprililalkohols; kaprilspirts; pirmējais oktilspirts | | |

02.007 | 01 | 143–08–8 | nonan-1-ols | 2789 | 55 | 205–583–7 | 02.007 | C-9 spirts; pelargonspirts; nonalols; oktilkarbinols; izononilspirts; n-nonilspirts | | |

02.008 | 01 | 112–53–8 | dodekan-1-ols | 2617 | 56 | 203–982–0 | 02.008 | C-12 spirts; laurilspirts; laurspirts; dodecilspirts; 1-dodekanols; undecilkarbinols | | |

02.009 | 01 | 36653–82–4 | dekaheksan-1-ols | 2554 | 57 | 253–149–0 | 02.009 | cetilspirts; C-16 spirts; n-heksadecilspirts; palmitilspirts | | |

02.010 | 23 | 100–51–6 | benzilspirts | 2137 | 58 | 202–859–9 | 02.010 | α-hidroksitoluols; fenilkarbinols; fenilmetanols; fenilmetilspirts | | 1 |

02.011 | 04 | 106–22–9 | citronelols | 2309 | 59 | 203–375–0 | 02.011 | | 3,7-dimetilokt-6-ēn-1-ols | |

02.012 | 03 | 106–24–1 | geraniols | 2507 | 60 | 203–377–1 | 02.012 | 2,6-dimetil-2, 6-oktadiēn-8-ols; trans- 3,7-dimetil-2, 6-oktadiēn-8-ols | 3,7-dimetilokta-2-( trans), 6-diēn-1-ols | |

02.013 | 06 | 78–70–6 | linalools | 2635 | 61 | 201–134–4 | 02.013 | 2,6-dimetiloktadiēn-2,7-ols-6; 2,6-dimetil-2,7-oktadiēn-6-ols; linalools; likareols; koriandrols | 3,7-dimetilokta-1,6-diēn-3-ols | |

02.014 | 06 | 98–55–5 | α-terpineols | 3045 | 62 | 202–680–6 | 02.014 | α-terpineols; 1-metil-4-izopropil-1-cikloheksēn-8-ols; α-terpilenols; Terpineol schlechthin | p-ment-1-ēn-8-ols | |

02.015 | 08 | 89–78–1 | mentols | 2665 | 63 | 201–939–0 | 02.015 | 2-izopropil-5-metilcikloheksanols; heksahidrotimols; 5-metil-2-izopropilheksahidrofenols; 5-metil-2-izopropilcikloheksanols | cis-(1,3)- trans-(1,4)-mentān-3-ols | 5 |

02.016 | 08 | 507–70–0 | borneols | 2157 | 64 | 208–080–0 | 02.016 | kamfols; baross; d-kamfanols; 2-hidroksikamfāns; 2-kamfanols; bornilspirts; borneokampars | 1,7,7-trimetilbiciklo[2.2.1]heptān-2-ols | |

02.017 | 22 | 104–54–1 | kanēļspirts | 2294 | 65 | 203–212–3 | 02.017 | kanēļspirts; γ-fenilalilspirts; 3-fenil-2-propēn-1-ols | 3-fenilprop-2-enols | |

02.018 | 06 | 7212–44–4 | nerolidols | 2772 | 67 | 230–597–5 | 02.018 | 3.7.11-trimetil-1.6.10-dodekatriēn-3-ols; peruviols; dodekatriēns; melaleikols | 3,7,11-trimetil-1,6-( cis), 10-dodekatriēn-3-ols | 5 |

02.019 | 15 | 60–12–8 | 2-fenilētān-1-ols | 2858 | 68 | 200–456–2 | 02.019 | fenetilspirts; β-fenetilspirts; 1-fenil-2-etanols; 2-feniletilspirts; benzilkarbinols | | |

02.020 | 03 | 2305–21–7 | heks-2-ēn-1-ols | 2562 | 69 | 218–972–1 | 02.020 | 2-heksenols; 3-propilalilspirts | | |

02.021 | 01 | 111–70–6 | heptān-1-ols | 2548 | 70 | 203–897–9 | 02.021 | heptilspirts; C-7 spirts; hidroksiheptāns; enantilspirts; enantspirts; pirmējais-heptilspirts; heksilkarbinols; hidroksiheptāns; | | |

02.022 | 05 | 123–96–6 | oktān-2-ols | 2801 | 71 | 204–667–0 | 02.022 | sek-oktilspirts; metilheksilkarbinols; sek-kaprilspirts; heksilmetilkarbinols | | |

02.023 | 05 | 3391–86–4 | okt-1-ēn-3-ols | 2805 | 72 | 222–226–0 | 02.023 | amilvinilkarbinols; ( Amylvinylcarbinol); Matsutake spirts; Matsuka spirts; n-pentilvinilkarbinols | | |

02.024 | 01 | 112–30–1 | dekān-1-ols | 2365 | 73 | 203–956–9 | 02.024 | C-10 spirts; n-decilspirts; nonilkarbinols; decilspirts; kaprilspirts; | | |

02.026 | 02 | 106–21–8 | 3,7-dimetiloktān-1-ols | 2391 | 75 | 203–374–5 | 02.026 | tetrahidrogeraniols; dihidrocitronelols | | |

02.027 | 04 | 141–25–3 | rodinols | 2980 | 76 | 205–473–9 | 02.027 | α-citronelols; 2,6-dimetil-1-oktēn-8-ols | 3,7-dimetilokt-7-ēn-1-ols | |

02.028 | 06 | 78–69–3 | 3,7-dimetiloktān-3-ols | 3060 | 77 | 201–133–9 | 02.028 | tetrahidrolinalools; 1-etil-1,5-dimetilheksanols | | |

02.029 | 03 | 4602–84–0 | 3,7,11-trimetildodeka-2,6,10-triēn-1-ols | 2478 | 78 | 225–004–1 | 02.029 | farnesols; 2,6,10-trimetil-2,6,10-dodekatriēn-12-ols | | |

02.030 | 22 | 101–85–9 | α-pentilcinamilspirts | 2065 | 79 | 202–982–8 | 02.030 | n-amilkanēļspirts; 2-amil-3-fenil-2-propēn-1-ols; 2-benzilidēnheptanols | 2-pentil-3-fenilprop-2-enols | |

02.031 | 22 | 122–97–4 | 3-fenilpropān-1-ols | 2885 | 80 | 204–587–6 | 02.031 | benziletilspirts; hidrocinamilspirts; fenilpropilspirts; dihidrocinamilspirts | | |

02.033 | 21 | 93–54–9 | 1-fenilpropān-1-ols | 2884 | 82 | 202–256–0 | 02.033 | feniletilkarbinols; 1-fenilpropilspirts; α-etilbenzilspirts; etilfenilkarbinols | | |

02.034 | 21 | 705–73–7 | 1-fenilpentān-2-ols | 2953 | 83 | 211–887–0 | 02.034 | α-propilfenetilspirts; benzilpropilkarbinols; benzilbutilspirts; benzilpropilkarbinols; n-propilbenzilkarbinols | | |

02.035 | 06 | 100–86–7 | 2-metil-1-fenilpropān-2-ols | 2393 | 84 | 202–896–0 | 02.035 | 2-benzil-2-propanols; 2-hidroksi-2-metil-1-fenilpropanons; benzildimetilkarbinols | | |

02.036 | 21 | 2344–70–9 | 4-fenilbutān-2-ols | 2879 | 85 | 219–055–9 | 02.036 | feniletilmetilkarbinols; metil-2-feniletilkarbinols | | |

02.037 | 06 | 10415–87–9 | 3-metil-1-fenilpentān-3-ols | 2883 | 86 | 233–889–0 | 02.037 | feniletilmetiletilkarbinols; 3-metil-1-fenil-3-pentanols | | |

02.038 | 08 | 1632–73–1 | fenhilspirts | 2480 | 87 | 216–639–5 | 02.038 | 2-fenhanols; α-fenhols; 1,3,3-trimetil-2-norbornanols; 1,3,3-trimetilbiciklo[2.2.1]heptān-2-ols | 1,3,3-trimetilbiciklo[2.2.1]heptān-2-ols | |

02.039 | 23 | 536–60–7 | 4-izopropilbenzilspirts | 2933 | 88 | 208–640–4 | 02.039 | kuminols; p-cimēn-7-ols; kuminilspirts; kumīnspirts; p-cimēn-7-ols | | |

02.040 | 01 | 71–41–0 | pentān-1-ols | 2056 | 514 | 200–752–1 | 02.040 | amilspirts; pentilspirts; n-butilkarbinols | | |

02.041 | 06 | 75–85–4 | 2-metilbutān-2-ols | | 515 | 200–908–9 | 02.041 | terc-amilspirts | | |

02.042 | 06 | 1197–01–9 | 2-(4-metilfenil)propān-2-ols | 3242 | 530 | 214–817–7 | 02.042 | p-cimēn-8-ols; p-α, α-trimetilbenzilspirts; 2- p-tolil-2-propanols; 8-hidroksi- p-cimēns; dimetil- p-tolilkarbinols | | |

02.043 | 02 | 97–95–0 | 2-etilbutān-1-ols | | 543 | 202–621–4 | 02.043 | | | |

02.044 | 05 | 589–82–2 | heptān-3-ols | 3547 | 544 | 209–661–1 | 02.044 | n-butiletilkarbinols; etilbutilkarbinols | | |

02.045 | 05 | 543–49–7 | heptān-2-ols | 3288 | 554 | 208–844–3 | 02.045 | 2-hidroksiheptāns; amilmetilkarbinols; sek-heptilspirts; metilamilkarbinols | | |

02.046 | 05 | 589–55–9 | heptān-4-ols | | 555 | 209–651–7 | 02.046 | | | |

02.047 | 09 | 107–74–4 | 3,7-dimetiloktān-1,7-diols | 2586 | 559 | 203–517–1 | 02.047 | hidroksicitronelols; 7-hidroksi-3,7-dimetiloktān-1-ols; hidroksidihidrocitronelols | | |

02.049 | 03 | 7786–44–9 | nona-2, 6-diēn-1-ols | 2780 | 589 | 232–097–2 | 02.049 | nonadienols; vijolīšu lapu spirts | | |

02.050 | 03 | 20273–24–9 | pent-2-ēn-1-ols | | 665 | 2164157 | 02.050 | | | |

02.051 | 22 | 10521–91–2 | 5-fenilpentān-1-ols | 3618 | 674 | 234–064–8 | 02.051 | fenilamilspirts | | |

02.052 | 06 | 75–65–0 | 2-metilpropān-2-ols | | 698 | 200–889–7 | 02.052 | 1,1-dimetiletanols; terc-butanols; terc-butanols-1; 1-dimetiletanols terc-butilspirts | | |

02.053 | 22 | 3360–41–6 | 4-fenilbutān-1-ols | | 699 | 222–128–8 | 02.053 | | | |

02.054 | 06 | 80–53–5 | p-mentān-1,8-diols | | 701 | 201–288–2 | 02.054 | terpīnhidrāts 4-hidroksi-α, α, 4-trimetilcikloheksanmetanols; dipentēna glikols | | |

02.055 | 02 | 3452–97–9 | 3,5,5-trimetilheksān-1-ols | 3324 | 702 | 222–376–7 | 02.055 | trimetilheksilspirts; izononanols | | |

02.056 | 04 | 928–96–1 | heks-3-( cis)-ēn-1-ols | 2563 | 750 | 213–192–8 | 02.056 | lapu spirts; β, γ-heksenols; cis-3-heksenols; Blatteralkohol; heks-3-ēn-1-ols | | 5 |

02.057 | 01 | 112–42–5 | undekān-1-ols | 3097 | 751 | 203–970–5 | 02.057 | C-11 1spirts; undecilspirts; decilkarbinols; 1-hendekanols | | |

02.058 | 03 | 106–25–2 | nerols | 2770 | 2018 | 203–378–7 | 02.058 | nerolols; neraniols; nerosols; cis- 3,7-dimetil-2,6-oktadiēn-1-ols; alerols; cis- 2,6-dimetil-2,6-oktadiēn-8-ols; nerodols | 3,7-dimetil-2-( cis), 6-oktadiēn-1-ols | |

02.059 | 08 | 124–76–5 | izoborneols | 2158 | 2020 | 204–712–4 | 02.059 | izokamfols; borneols(izo); (izo)-kamfols; izobornilspirts; ekso- 2-kamfanols; ekso-2-bornanol; bornān-2-ols | 1,7,7-trimetilbiciklo[2.2.1]heptān-2-ols | |

02.060 | 07 | 536–59–4 | p-menta-1, 8-diēn-7-ols | 2664 | 2024 | 208–639–9 | 02.060 | perilspirts; perililspirts; 1-hidroksimetil-4-izopropenil-1-cikloheksēns; dihidrokumīnspirts | | |

02.061 | 08 | 619–01–2 | dihidrokarveols | 2379 | 2025 | 210–575–1 | 02.061 | 8- p-mentēn-2-ols; 6-metil-3-izopropenilcikloheksanols | p-ment-8-ēn-8-ols | |

02.062 | 08 | 99–48–9 | karveols | 2247 | 2027 | 202–757–4 | 02.062 | p-menta-6,8-diēn-2-ols 1-metil-4-izopropenil-6-cikloheksēn-2-ols | p-menta-1,8-diēn-2-ols | |

02.063 | 08 | 2216–52–6 | D-neomentols | 2666 | 2028 | 218–691–4 | 02.063 | 2-propilizo-5-metilcikloheksanols; 2-izopropil-5-metilcikloheksanols | [1S-(1-α, 2-α, 5-β]- 2-izopropil-5-metilcikloheksanols | |

02.064 | 21 | 98–85–1 | 1-feniletān-1-ols | 2685 | 2030 | 202–707–1 | 02.064 | α-metilbenzilspirts; metilfenilkarbinols; stiralilspirts; 1-fenil-1-hidroksietāns | | |

02.065 | 21 | 7779–78–4 | 4-metil-1-fenilpentān-2-ols | 2208 | 2031 | 231–939–6 | 02.065 | benzilizobutilkarbinols; α-izobutilfenetilspirts; 2-metilpropilbenzilkarbinols; 4-metil-1-fenil-2-pentanols | | |

02.066 | 21 | 17488–65–2 | 4-fenilbut-3-ēn-2-ols | 2880 | 2032 | 241–501–6 | 02.066 | metilstirilkarbinols; α-metilcinamilspirts | | |

02.067 | 05 | 89–79–2 | izopulegols | 2962 | 2033 | 201–940–6 | 02.067 | 1-metil-4-izopropenilcikloheksān-3-ols; p-ment-8(9)-ēn-3-ols | p-ment-8-ēn-3-ols | |

02.068 | 03 | 107–18–6 | prop-2-ēn-1-ols | | 2136 | 203–470–7 | 02.068 | alilspirts; 2-propēn-1-ols; 1-propenols-3; vinilkarbinols | | |

02.070 | 08 | 108–93–0 | cikloheksanols | | 2138 | 203–630–6 | 02.070 | heksalīns; heksahidrofenols; hidroksicikloheksāns | | |

02.071 | 08 | 499–69–4 | p-mentān-2-ols | 3562 | 2228 | 207–885–4 | 02.071 | heksahidrokarvakrols; 3-izopropil-6-metilcikloheksanols; karvomentols; 1-metil-4-izopropil-2-cikloheksanols | | 5 |

02.072 | 06 | 562–74–3 | 4-terpinenols | 2248 | 2229 | 209–235–5 | 02.072 | 4-karvomentenols; 1-metil-4-izopropilcikloheks-1-ēn-4-ols; 1- p-mentēn-4-ols; origanols; 1-metil-4-izopropils | p-ment-1-ēn-4-ols | |

02.073 | 22 | 1123–85–9 | 2-fenilpropān-1-ols | 2732 | 2257 | 214–379–7 | 02.073 | hidratropspirts; hidratropilspirts; 2-fenilpropilspirts | | |

02.074 | 04 | 6126–50–7 | heks-4-ēn-1-ols | 3430 | 2295 | | 02.074 | | | |

02.075 | 08 | 18675–34–8 | neodihidrokarveols | | 2296 | | 02.075 | | p-ment-8-ēn-8-ols | |

02.076 | 02 | 137–32–6 | 2-metilbutān-1-ols | | 2346 | 205–289–9 | 02.076 | | | |

02.077 | 05 | 584–02–1 | pentān-3-ols | | 2349 | 209–526–7 | 02.077 | dietilkarbinols | | |

02.078 | 01 | 64–17–5 | etanols | 2419 | 11891 | 200–578–6 | 02.078 | metilkarbinols; Punctilious (USI); absolūtais spirts bezūdens spirts; dehidrēts spirts; etilhidrāts; etilhidroksīds | | 1 |

02.079 | 05 | 67–63–0 | izopropanols | 2929 | | 200–661–7 | 02.079 | izopropilspirts; propān-2-ols; izopropanols; dimetilkarbinols; izopropilalkohols; propanols (izo); petrohols; sek-propilspirts | | 1 |

02.080 | 21 | 536–50–5 | 1-( p-tolil)etān-1-ols | 3139 | 10197 | 208–637–8 | 02.080 | p-α-dimetilbenzilspirts; p-tolilmetilkarbinols; 1- p-toli)- 1-etanols; 4-toluols; p-tolilmetilkarbinols | 1-(4-metilfenil)etān-1-ols | |

02.081 | 05 | 108–82–7 | 2,6-dimetilheptān-4-ols | 3140 | 11719 | 203–619–6 | 02.081 | di-izobutilkarbinols; diizobutilkarbinols | | |

02.082 | 02 | 104–76–7 | 2-etilheksān-1-ols | 3151 | 11763 | 203–234–3 | 02.082 | 2-etilheksilspirts | | |

02.083 | 08 | 491–04–3 | p-ment-1-ēn-3-ols | 3179 | 10248 | 207–725–3 | 02.083 | piperitols | | |

02.085 | 08 | 546–79–2 | sabinēna hidrāts | 3239 | 10309 | 208–911–7 | 02.085 | sabinēnhidrāts; tujān-4-ols | 1-izopropil-4-metilbiciklo[3.1.0]heksān-4-ols | |

02.086 | 05 | 1653–30–1 | undekān-2-ols | 3246 | 11826 | 216–722–6 | 02.086 | sek-undecilspirts; metilnonilkarbinols | | |

02.087 | 05 | 628–99–9 | nonān-2-ols | 3315 | 11803 | 211–065–1 | 02.087 | metil-n-heptilkarbinols; sek-n-nonanols; metilheptilkarbinols | | |

02.088 | 05 | 6032–29–7 | pentān-2-ols | 3316 | 11696 | 227–907–6 | 02.088 | sek-amilspirts; α-metilbutanols; metil-n-propilkarbinols; metil-n-propilkarbinols; propilmetilkarbinols | | |

02.089 | 05 | 623–37–0 | heksān-3-ols | 3351 | 11775 | 210–790–0 | 02.089 | etilpropilkarbinols | | |

02.090 | 03 | 31502–14–4 | non-2-( trans)-ēn-1-ols | 3379 | 10292 | 250–662–1 | 02.090 | | | 5 |

02.091 | 07 | 515–00–4 | mirtenols | 3439 | 10285 | 208–193–5 | 02.091 | 6,6-dimetil-2-oksometilbiciklo[1.3.3]hept-2-ēns; 10-hidroksi-2-pinēns; 2-pinēn-10-ols | 2-hidroksimetil-6,6-dimetilbiciklo[3.1.1]hept-2-ēns | |

02.092 | 08 | 57069–86–0 | dehidrodihidrojonols | 3446 | 10195 | | 02.092 | α, 2,6,6-tetrametil-1, 3-cikloheksadien-1-propanols | 4-(2,6,6-trimetil-1,3-cikloheksadienil)butān-2-ols | |

02.093 | 04 | 35854–86–5 | non-6-ēn-1-ols | 3465 | 10294 | 252–764–1 | 02.093 | cis- 6-nonenols | | 5 |

02.094 | 04 | 20125–84–2 | okt-3-ēn-1-ols | 3467 | 10296 | 243–533–6 | 02.094 | cis- 3-oktenols | | 5 |

02.095 | 06 | 18368–91–7 | 2-etilfenhols | 3491 | 10208 | 242–243–7 | 02.095 | 2-etil-1,3,3-trimetil-2-norbornanols | 2-etil-1,3,3-trimetilbiciklo[2.2.1]heptān-2-ols | |

02.096 | 06 | 586–82–3 | 1-terpinenols | 3563 | 10252 | 209–585–9 | 02.096 | 4-izopropil-1-metil-3-cikloheksēn-1-ols; 1-metil-4-izopropil-3-cikloheksēn-1-ols; p-mentēn-1-ols; p- 3-mentenols-1 | p-ment-3-ēn-1-ols | |

02.097 | 06 | 138–87–4 | β-terpineols | 3564 | 10254 | 205–342–6 | 02.097 | 1-metil-4-izopropenilcikloheksān-1-ols; 4-izopropenil-1-metil-1-cikloheksanols | p-ment-8(10)-ēn-1-ols | |

02.098 | 05 | 589–98–0 | oktān-3-ols | 3581 | 11715 | 209–667–4 | 02.098 | etil-n-amilkarbinols; amiletilkarbinols; d-n-oktanols; amiletilkarbinols | | |

02.099 | 05 | 616–25–1 | pent-1-ēn-3-ols | 3584 | 11717 | 210–472–1 | 02.099 | B-pentenols; viniletilkarbinols; etilvinilkarbinols | | |

02.100 | 08 | 5947–36–4 | pinokarveols | 3587 | 10303 | 227–705–8 | 02.100 | 2(10)-pinēn-3-ols; 6,6-dimetil-3-hidroksi-2-metilēnbiciklo[3.1.1]heptāns; 2(10)-pinenols-3 | 3-hidroksi-6,6-dimetil-2-metilēnbiciklo[3.1.1]heptāns | |

02.101 | 08 | 473–67–6 | pin-2-ēn-4-ols | 3594 | 10304 | 207–470–8 | 02.101 | verbenols; 4-hidroksi-2,6,6-trimetilbiciklo[3.1.1]hept-2-ēns; d-verbenols; 2-pinenols-4 | 4,6,6-trimetilbiciklo[3.1.1]hept-3-ēn-2-ons | |

02.102 | 05 | 76649–14–4 | okt-3-ēn-2-ols | 3602 | | 278–508–9 | 02.102 | trans-3-oktēn-2-ols | | |

02.103 | 05 | 1565–81–7 | dekān-3-ols | 3605 | 10194 | | 02.103 | heptiletilkarbinols; etilheptilkarbinols | | |

02.104 | 05 | 4798–44–1 | heks-1-ēn-3-ols | 3608 | 10220 | 225–355–0 | 02.104 | 1-vinilbutān-1-ols; vinilpropilkarbinols; propilvinilkarbinols | | |

02.105 | 08 | 25312–34–9 | 4-(2,6,6-trimetil-2-cikloheksenil)but-3-ēn-2-ols | 3624 | | 246–815–7 | 02.105 | α-jonols | | |

02.106 | 08 | 22029–76–1 | 4-(2,6,6-trimetil-1-cikloheksenil)but-3-ēn-1-ols | 3625 | | 244–735–7 | 02.106 | β-jonols | | |

02.107 | 08 | 3293–47–8 | dihidro-β-jonols | 3627 | | 221–957–2 | 02.107 | β-dihidrojonols | 4-(2,2,6-trimetilcikloheks-1-enil)butān-2-ols | |

02.108 | 06 | 103–05–9 | 2-metil-4-fenilbutān-2-ols | 3629 | 10281 | 203–074–4 | 02.108 | feniletildimetilkarbinols; 1,1-dimetil-3-fenil-1-propanols; dimetilfeniletilkarbinols | | |

02.10 | 03 | 556–82–1 | 3-metilbut-2-ēn-1-ols | 3647 | 11795 | 209–141–4 | 02.10 | prenols | | |

02.110 | 04 | 36806–46–9 | 2,6-dimetilhept-6-ēn-1-ols | 3663 | | 253–223–2 | 02.110 | | | |

02.111 | 05 | 598–75–4 | 3-metilbutān-2-ols | 3703 | | 209–950–2 | 02.111 | metilizopropilkarbinols; izopropilmetilkarbinols | | |

02.112 | 03 | 41453–56–9 | non-2-( cis)-ēn-1-ols | 3720 | 10292 | 255–376–0 | 02.112 | z-2-nonēn-1-ols | | 5 |

02.113 | 04 | 64275–73–6 | okt-5-( cis)-ēn-1-ols | 3722 | | 264–764–9 | 02.113 | z-5-oktēn-1-ols | | |

02.114 | 07 | 1901–38–8 | 2-(2,2,3-trimetilciklopent-3-enil)etān-1-ols | 3741 | | 217–600–5 | 02.114 | α-kamfolenspirts; 2-(2,3,3-trimetilciklopent-3-ēn-1-il)etanols | | |

02.115 | 02 | 589–35–5 | 3-metilpentān-1-ols | 3762 | 10275 | 209–644–9 | 02.115 | 2-etil-4-butanols | | |

02.118 | 06 | 472–97–9 | β-kariofilenspirts | | 10188 | 207–458–2 | 02.118 | kariolān-1-ols; izokarifilēns | 4,4,8-trimetiltriciklo[6.3.1.0(2.5)]dodekān-1-ols | |

02.119 | 07 | 28231–03–0 | cedrenols | | 10189 | 248–917–7 | 02.119 | | 2,6,6-trimetil[5.3.1.0(1.5)]undec-8-ēn-8-ilmetanols | |

02.120 | 06 | 77–53–2 | cedrols | | 10190 | 201–035–6 | 02.120 | ciedru eļļas spirts; oktahidro-3,6,8,8-tetrametil-1H-3a, 7-metanoazulēn-6-ols; 8βH-cedran-8-ols | 2,6,6, 8-tetrametiltriciklo[5.3.1.0(1.5)]undekān-8-ols | |

02.121 | 05 | 78–92–2 | butān-2-ols | | 11735 | 201–158–5 | 02.121 | 2-hidroksibutāns; butilēna hidrāts; metiletilkarbinols; sek-butilspirts | | 1, 4 |

02.122 | 07 | 3269–90–7 | p-menta-1,8(10)-diēn-9-ols | | 10239 | 221–889–3 | 02.122 | p-menta-1,8-diēn-10-ols | | |

02.123 | 06 | 115–18–4 | 2-metilbut-3-ēn-2-ols | | 11794 | 204–068–4 | 02.123 | | | |

02.124 | 05 | 1569–60–4 | 6-metilhept-5-ēn-2-ols | | 10264 | 216–377–1 | 02.124 | | | |

02.125 | 04 | 112–43–6 | undec-10-ēn-1-ols | | 10319 | 203–971–0 | 02.125 | undecēn-1-ols; C 11 spirts; undecilēnspirts | | |

02.126 | 01 | 112–72–1 | tetradekān-1-ols | | 10314 | 204–000–3 | 02.126 | miristīnspirts; miristilspirts; C 14 spirts | | |

02.128 | 23 | 105–13–5 | p-anizilspirts | 2099 | 66 | 203–273–6 | 02.128 | anizīnspirts; anīsa spirts | 4-metoksibenzilspirts | |

02.129 | 06 | 515–69–5 | bisabola-1,12-diēn-8-ols | | 10178 | 208–205–9 | 02.129 | α-bisabolols | 6-metil-2-(4-metilcikloheks-3-enil)hept-5-ēn-2-ols | |

02.130 | 03 | 6117–91–5 | but-2-ēn-1-ols | | 11737 | 228–086–7 | 02.130 | | | |

02.131 | 05 | 598–32–3 | but-3-ēn-2-ols | | | 209–929–8 | 02.131 | | | |

02.132 | 09 | 107–88–0 | butān-1,3-diols | | | 203–529–7 | 02.132 | 1,3-butilēnglikols | | |

02.133 | 10 | 513–85–9 | butān-2,3-diols | | 10181 | 208–173–6 | 02.133 | 2,3-butilēnglikols; dimetiletilēnglikols | | |

02.134 | 07 | 4442–79–9 | 2-cikloheksiletān-1-ols | | | 224–672–1 | 02.134 | | | |

02.135 | 08 | 96–41–3 | ciklopentanols | | 10193 | 202–504–8 | 02.135 | ciklopentilspirts | | |

02.136 | 05 | 51100–54–0 | dec-1-ēn-3-ols | 3824 | | 256–967–6 | 02.136 | | | |

02.137 | 03 | 22104–80–9 | dec-2-ēn-1-ols | | 11750 | 244–784–4 | 02.137 | | | |

02.138 | 04 | 13019–22–2 | dec-9-ēn-1-ols | | | 235–878–6 | 02.138 | ω-decenols; decilēnspirts | | |

02.139 | 03 | 18409–21–7 | deka-2,4-diēn-1-ols | 3911 | 11748 | 242–291–9 | 02.139 | | | 5 |

02.140 | 06 | 2270–57–7 | 1,2-dihidrolinalools | | | | 02.140 | | 3,7-dimetilokt-6-ēn-3-ols | |

02.141 | 07 | 128–50–7 | 2-(6,6-dimetilbiciklo[3.1.1]hept-2-ēn-2-il)etān-1-ols | 3938 | | 204–890–3 | 02.141 | nopols; 6,6-dimetil-2-norpinēn-2-etanols; 2-hidroksietil-6, 6-dimetilbiciklo[3.1.1]hept-2-ēns | | |

02.142 | 05 | 464–07–3 | 3,3-dimetilbutān-2-ols | | | 207–347–9 | 02.142 | pinakolilspirts; 3,3-dimetil-2-butanols; terc-butilmetilkarbinols | | |

02.143 | 10 | 76–09–5 | 2,3-dimetilbutān-2,3-diols | | | 200–933–5 | 02.143 | pinakols; pinakons; 2,3-dimetil-2,3-butāndiols | | |

02.144 | 06 | 18479–58–8 | 2,6-dimetilokt-7-ēn-2-ols | | | 242–362–4 | 02.144 | dihidromircenols; dihidromircenāts; mircetols; dimircetāls | | |

02.145 | 05 | 29414–56–0 | 2,6-dimetilokta-1,5,7-triēn-3-ols | | | 249–613–7 | 02.145 | notrienols | | |

02.146 | 06 | 29957–43–5 | 3,7-dimetilokta-1,5,7-triēn-3-ols | 3830 | 10202 | 249–975–6 | 02.146 | | | 5 |

02.147 | 06 | 151–19–9 | 3,6-dimetiloktān-3-ols | | | 205–787–6 | 02.147 | | | |

02.148 | 05 | 10203–28–8 | dodekān-2-ols | | 11760 | 233–500–4 | 02.148 | | | |

02.149 | 06 | 639–99–6 | elemols | | 10205 | 211–360–5 | 02.149 | | 2-(4-metil-3-izopropilēn-4-vinilcikloheksil)propān-2-ols | |

02.150 | 06 | 1113–21–9 | geranillinalools | | | 214–201–8 | 02.150 | | 3,7,11,15-tetrametilheksadeka-1, 6,10,14-tetraēn-3-ols | |

02.151 | 03 | 33467–76–4 | hept-2-ēn-1-ols | | 11773 | 251–534–8 | 02.151 | | | 5 |

02.152 | 04 | 10606–47–0 | hept-3-ēn-1-ols | | 10219 | | 02.152 | | | |

02.153 | 03 | 33467–79–7 | hepta-2,4-diēn-1-ols | | | 251–535–3 | 02.153 | | | |

02.154 | 01 | 1454–85–9 | heptadekān-1-ols | | | | 02.154 | | | |

02.155 | 05 | 4938–52–7 | 1-heptēn-3-ols | | 10218 | 225–579–9 | 02.155 | | | |

02.156 | 03 | 928–94–9 | heks-2-( cis)-ēn-1-ols | 3924 | 69 | 213–190–7 | 02.156 | 2-heksenols | | 5 |

02.157 | 03 | 2305–21–7 | heks-2-( trans)-ēn-1-ols | 2562 | 69 | 213–191–2 | 02.157 | 2-heksenols | | |

02.158 | 04 | 928–97–2 | heks-3-( trans)-ēn-1-ols | 2563 | 750 | 213–193–3 | 02.158 | lapu spirts; β, γ, -heksenols | | 5 |

02.159 | 04 | 544–12–7 | heks-3-ēn-1-ols | 2563 | 750 | 213–193–3 | 02.159 | lapu spirts; β, γ-heksenols; cis-3-heksenols | | 5 |

02.160 | 04 | 928–91–6 | heks-4-( cis)-ēn-1-ols | | | 213–187–0 | 02.160 | | | |

02.161 | 04 | 928–92–7 | heks-4-( trans)-ēn-1-ols | | | 213–188–6 | 02.161 | | | |

02.162 | 03 | 111–28–4 | heksa-2,4-diēn-1-ols | 3922 | | 203–853–9 | 02.162 | sorbīnspirts; 1-hidroksi-2,4-heksadiēns; sorbilspirts | | |

02.163 | 05 | 626–93–7 | heksān-2-ols | | 11774 | 210–971–4 | 02.163 | | | |

02.164 | 23 | 530–56–3 | 4-hidroksi-3, 5-dimetoksibenzilspirts | | | 208–485–2 | 02.164 | siringilalkohols | | |

02.165 | 23 | 623–05–2 | 4-hidroksibenzilspirts | | | 210–768–0 | 02.165 | 4-hidroksibenzolmetanols | | |

02.166 | 15 | 501–94–0 | 2-(4-hidroksifenil)etān-1-ols | | 10226 | 207–930–8 | 02.166 | 4-hidroksifenetilspirts; 4-hidroksibenzoletanols | | |

02.167 | 08 | 18675–35–9 | izodihidrokarveols | | | | 02.167 | | izo- p-ment-8-ēn-8-ols | |

02.168 | 06 | 505–32–8 | izofitols | | 10233 | 208–008–8 | 02.168 | | 3,7,11,15-tetrametilheksadec-1-ēn-3-ols | |

02.169 | 08 | 4621–04–9 | 4-izopropilcikloheksān-1-ols | | | 225–035–0 | 02.169 | | | |

02.170 | 04 | 498–16–8 | lavandulols | | | | 02.170 | 2-izopropenil-5-metil-4-heksēn-1-ols | 5-metil-2-(1-metilēnetil)heks-4-ēn-1-ols | |

02.171 | 06 | 498–81–7 | p-mentān-8-ols | | | 207–871–8 | 02.171 | dihidro-α-terpineols; p-mentān-8-ols; 1-metil-4-izopropilcikloheksān-8-ols | | |

02.173 | 22 | 5406–18–8 | 3-(4-metiloksifenil)propān-1-ols | | | 226–463–0 | 02.173 | | | |

02.174 | 03 | 4675–87–0 | 2-metilbut-2-ēn-1-ols | | 10258 | 225–127–0 | 02.174 | | | |

02.175 | 04 | 4516–90–9 | 2-metilbut-3-ēn-1-ols | | 10259 | | 02.175 | | | |

02.176 | 04 | 763–32–6 | 3-metilbut-3-ēn-1-ols | | 10260 | 212–110–8 | 02.176 | | | |

02.177 | 05 | 617–29–8 | 2-metilheksān-3-ols | | 10266 | 210–508–6 | 02.177 | | | |

02.178 | 02 | 818–81–5 | 2-metiloktān-1-ols | | | 212–457–5 | 02.178 | | | |

02.179 | 02 | 105–30–6 | 2-metilpentān-1-ols | | 10273 | 203–285–1 | 02.179 | | | |

02.180 | 02 | 626–89–1 | 4-metilpentān-1-ols | | 10278 | 210–969–3 | 02.180 | izoheksanols | | |

02.181 | 06 | 590–36–3 | 2-metilpentān-2-ols | | 10274 | 209–681–0 | 02.181 | 2-metil-2-pentanols | | |

02.182 | 05 | 565–60–6 | 3-metilpentān-2-ols | | 10276 | 209–281–6 | 02.182 | | | |

02.183 | 05 | 108–11–2 | 4-metilpentān-2-ols | | 10279 | 203–551–7 | 02.183 | metilamilspirts; sek-heksilspirts; metilizobutilkarbinols | | |

02.184 | 06 | 77–74–7 | 3-metilpentān-3-ols | | 10277 | 201–053–4 | 02.184 | | | |

02.185 | 06 | 543–39–5 | mircenols | | | 208–843–8 | 02.185 | | 7-metil-3-metilēnokt-1-ēn-7-ols | |

02.186 | 07 | 514–99–8 | mirtanols | | | 208–191–4 | 02.186 | | 2-hidroksimetil-6,6-dimetilbiciklo[3.1.1]heptāns | |

02.187 | 05 | 21964–44–3 | non-1-ēn-3-ols | | 10291 | 244–686–1 | 02.187 | n-heksilvinilkarbinols | | |

02.188 | 03 | 62488–56–6 | nona-2,4-diēn-1-ols | 3951 | 11802 | 263–571–7 | 02.188 | | | |

02.189 | 04 | 76649–25–7 | nona-3,6-diēn-1-ols | 3885 | 10289 | 278–518–3 | 02.189 | | | 5 |

02.190 | 05 | 624–51–1 | nonān-3-ols | | 10290 | 210–850–6 | 02.190 | heksiletilkarbinols; 3-nonanols; etil-n-heksilkarbinols | | |

02.191 | 06 | 5986–38–9 | ocimenols | | | 227–806–7 | 02.191 | | 2,6-dimetilokta-5,7-diēn-2-ols | |

02.192 | 03 | 22104–78–5 | okt-2-ēn-1-ols | 3887 | 11804 | | 02.192 | | | 5 |

02.193 | 05 | 4798–61–2 | okt-2-ēn-4-ols | 3888 | | 225–357–1 | 02.193 | 2-oktēn-4-ols | | 5 |

02.194 | 05 | 83861–74–9 | okta-1,5-diēn-3-ols | | | | 02.194 | | | |

02.195 | 04 | 70664–96–9 | okta-3,5-diēn-1-ols | | | | 02.195 | | | |

02.196 | 01 | 112–92–5 | oktadekān-1-ols | | | 204–017–6 | 02.196 | stearilspirts; oktadekanols; oktadecilspirts; n-oktadekanols | | |

02.197 | 06 | 41199–19–3 | 1,2,3,4,4a,5,6,7-oktahidro-2,5,5-trimetilnaftalīn-2-ols | | 10173 | 255–256–8 | 02.197 | ambrinols; 2,5,5-trimetil-2-hidroksioktalīns | | |

02.198 | 09 | 23433–05–8 | oktān-1,3-diols | | | | 02.198 | 1,3-oktāndiols | | |

02.199 | 06 | 5986–55–0 | pačulols | | | 227–807–2 | 02.199 | pačuliju spirts | oktahidro-4,8a, 9,9-tetrametil-1,6-metanonaftalīn-1(2H)-ols | 5 |

02.201 | 04 | 821–09–0 | pent-4-ēn-1-ols | | | 212–473–2 | 02.201 | 4-pentēn-1-ols | | |

02.202 | 01 | 629–76–5 | pentadekān-1-ols | | | 211–107–9 | 02.202 | | | |

02.203 | 06 | 617–94–7 | 2-fenilpropān-2-ols | | 11704 | 210–539–5 | 02.203 | dimetilfenilkarbinols; fenilizopropanols; fenildimetilkarbinols; benzolmetanols | | |

02.204 | 03 | 150–86–7 | fitols | | 10302 | 205–776–6 | 02.204 | | 3,7,11,15-tetrametilheksadec-2-ēn-1-ols | |

02.205 | 23 | 495–76–1 | piperonilspirts | | 10306 | 207–808–4 | 02.205 | heliospirts; 1,3-benzodioksol-5-metanols | 3,4-metilēndioksibenzilspirts | |

02.206 | 06 | 515–03–7 | sklareols | | 10311 | 208–194–0 | 02.206 | labd-14-ēn-8,13-diols | 4,6,10,10-tetrametil-5-(3,3-dimetilpent-4-enil)biciklo[4.4.0]dekān-4-ols | |

02.207 | 08 | 21653–20–3 | tujilspirts | | | 244–504–0 | 02.207 | | 1-izopropil-4-metilbiciklo[3.1.0]heksān-3-ols | 5 |

02.209 | 08 | 116–02–9 | 3,3,5-trimetilcikloheksān-1-ols | 3962 | | 204–122–7 | 02.209 | ciklonols; homomentol | | |

02.210 | 03 | 37617–03–1 | undec-2-ēn-1-ols | | | 253–569–4 | 02.210 | | | |

02.211 | 05 | 56722–23–7 | undeka-1,5-diēn-3-ols | | | | 02.211 | | | |

02.213 | 23 | 498–00–0 | vanililspirts | 3737 | 690 | 207–852–4 | 02.213 | | 4-hidroksi-3-metoksibenzilspirts | |

02.214 | 08 | 89–88–3 | vetiverols | | 10321 | 201–949–5 | 02.214 | vetivenols; vetivols | 2-hidroksimetil-6-metil-9-(1-metilēnetil)biciklo[5.3.0]dekāns un 2-hidroksimetilizoprop-5-eniltriciklo[6.2.1.0(3.7)]undekāns | |

02.215 | 06 | 552–02–3 | viridoflorols | | 10322 | 209–003–3 | 02.215 | | 2,6,6,9-tetrametiltriciklo[6.3.0.0(5.7)]undekān-2-ols | |

02.216 | 07 | 77–42–9 | 12-β-santalen-14-ols | 3006 | 74 | 201–027–2 | 02.216 | β-santalols | | 4, 5 |

02.217 | 07 | 115–71–9 | 12-α-santalen-14-ols | 3006 | 74 | 204–102–8 | 02.217 | α-santalols | | 4, 5 |

02.218 | 08 | 1490–04–6 | DL-mentols | 2665 | 63 | 216–074–4 | 02.218 | | | 5 |

02.219 | 06 | 13254–34–7 | 2,6-dimetil-2-heptanols | | | 236–244–1 | 02.219 | | | |

02.220 | 08 | 20752–34–5 | neomentols | 2666 | 2028 | | 02.220 | | | 5 |

02.222 | 04 | 39161–19–8 | 3-pentenols-1 | | 10298 | | 02.222 | | | |

02.224 | 30 | 87061–04–9 | 3-(1-mentoksi)propān-1,2-diols | 3784 | | 289–296–2 | 02.224 | | | |

02.225 | 09 | 111–45–5 | 2-(2-propeniloksi)etanols | | | 203–871–7 | 02.225 | etilēnglikola monoalilēteris | | |

02.226 | 06 | 142–50–7 | [S-( cis)- 3,7,11-trimetil-1,6,10-dodekatriēn-3-ols | | 67 | 205–540–2 | 02.226 | | | 5 |

02.228 | 04 | 6812–78–8 | (S)- 3,7-dimetil-7-oktēn-1-ols | 2980 | 76 | 229–887–4 | 02.228 | | | 5 |

02.229 | 04 | 7540–51–4 | (-)- 3,7-dimetil-6-oktēn-1-ols | 2309 | 59 | 231–415–7 | 02.229 | | | 5 |

02.230 | 06 | 8000–41–7 | terpineols | | | 232–268–1 | 02.230 | terpēnspirts | | 5 |

02.231 | 03 | 28069–72–9 | trans- 2, cis- 6-nonadiēn-1-ols | 2780 | 589 | 248–816–8 | 02.231 | | | 5 |

02.232 | 06 | 40716–66–3 | trans- 3,7,11-trimetildodeka-1,6,10-triēn-3-ols | | | 255–053–4 | 02.232 | (E)-nerolidols | | |

02.234 | 04 | 10340–23–5 | 3-nonēn-1-ols | | 10293 | | 02.234 | | | 5 |

02.237 | 06 | 19700–21–1 | geosmīns | | 10216 | 243–239–8 | 02.237 | 2,6-dimetildekahidronaftalīn-1 ols | 2,6-dimetilbiciklo[4.4.0]dekān-1-ols | |

02.238 | 08 | | 2-cedrēn-15-ols | | | | 02.238 | | 8-metoksi-2,2,4-trimetiltriciklo[5.3.1(3.7).0(1.7)]undec-8(9)-ēns | |

02.241 | 08 | 2102–59–2 | (1R- cis)- 2-metil-5-(1-metiletenil)- 2-cikloheksēn-1-ols | | | 218–270–5 | 02.241 | | | 5 |

02.242 | 09 | 111–76–2 | 2-butoksietān-1-ols | | 10182 | 203–905–0 | 02.242 | etilēnglikola monobutilēteris | | |

03.001 | 16 | 470–82–6 | 1,8-cineols | 2465 | 182 | 207–431–5 | 03.001 | eikaliptols; 1,8-oksido- p-mentāns; 1,3,3-trimetil-2-oksabiciklo[2.2.2]oktāns | 1,8-epoksi- p-mentāns | |

03.003 | 26 | 539–30–0 | benziletilēteris | 2144 | 521 | 208–714–6 | 03.003 | etilbenzilēteris | | |

03.004 | 26 | 103–50–4 | dibenzilēteris | 2371 | 11856 | 203–118–2 | 03.004 | benzilēteris; benziloksīds | | |

03.005 | 16 | 2679–87–0 | 2-butiletilēteris | 3131 | 10911 | 220–234–9 | 03.005 | ēteris, sek-butiletil-; etil- sek-butiletilēteris | | |

03.006 | 26 | 3558–60–9 | 2-metoksietilbenzols | 3198 | 11812 | 222–619–7 | 03.006 | metilfenetilēteris; fenetilmetilēteris; feniletilmetilēteris | | |

03.007 | 16 | 470–67–7 | 1,4-cineols | 3658 | 11225 | 207–428–9 | 03.007 | | 1,4-epoksi- p-mentāns | |

03.008 | 16 | 57709–95–2 | 2-acetoksi-1,8-cineols | | | | 03.008 | | 2-acetoksi-1,8-epoksi- p-mentāns | |

03.010 | 26 | 588–67–0 | benzlibutilēteris | 2139 | 520 | 209–626–0 | 03.010 | | | |

03.011 | 26 | 538–86–3 | benzilmetilēteris | | 10910 | 208–705–7 | 03.011 | | | |

03.012 | 26 | 54852–64–1 | benziloktilēteris | | | | 03.012 | | | |

03.015 | 16 | 40267–72–9 | etilgeranilēteris | | | 254–867–7 | 03.015 | geraniletilēteris | 1-etoksi-3,7-dimetilokta-2-( trans), 6-diēns | |

03.016 | 16 | 4747–07–3 | heksilmetilēteris | | | 225–263–0 | 03.016 | | | |

03.018 | 16 | 1634–04–4 | 2-metoksi-2-metilpropāns | | | 216–653–1 | 03.018 | trešējais metilbutilēteris; metil- terc-butilēteris | | |

03.019 | 16 | 22094–00–4 | preniletilēteris | 3777 | | | 03.019 | etil-3-metilbut-2-enilēteris | 1-etoksi-3-metilbut-2-ēns | |

03.020 | 16 | 14576–08–0 | 6-etoksiprop-3-enilfenols | | | 238–620–0 | 03.020 | 4-(1-metoksi-1-metiletil)- 1-metilcikloheksēns | p-ment-1-ēn-8-ilmetilēteris | |

04.002 | 25 | 94–86–0 | α-terpinilmetileteris | 2922 | 170 | 202–370–0 | 04.002 | l-etoksi-2-hidroksi-4-propenilbenzols; 5-propenilgvajetols; 3-propenil-6-etoksifenols; hidroksimetilanetols | | |

04.003 | 18 | 97–53–0 | eigenols | 2467 | 171 | 202–589–1 | 04.003 | 4-alilgvajakols; 2-metoksi-4-prop-2-enilfenols; 1-hidroksi-2-metoksi-4-alilbenzols; 1-hidroksi-2-metoksi-4-propenilbenzols | 4-alil-2-metoksifenols | |

04.004 | 17 | 97–54–1 | izoeigenols | 2468 | 172 | 202–590–7 | 04.004 | 4-propenilgvajakols; 2-metoksi-4-propenilfenols; 1-hidroksi-2-metoksi-4-propēn-1-ilbenzols | 2-metoksi-4-(prop-1-enil)fenols | |

04.005 | 25 | 90–05–1 | 2-metoksifenols | 2532 | 173 | 201–964–7 | 04.005 | gvajakols; o-metilkatehols; 1-hidroksi-2-metoksibenzols; o-metoksifenols; 1-oksi-2-metoksibenzols | | |

04.006 | 25 | 89–83–8 | timols | 3066 | 174 | 201–944–8 | 04.006 | 1-metil-3-hidroksi-4-izopropilbenzols; 3-hidroksi- p-cimēns; α-cimofenols | 2-izopropil-5-metilfenols | |

04.007 | 25 | 93–51–6 | 2-metoksi-4-metilfenols | 2671 | 175 | 202–252–9 | 04.007 | 4-metilgvajakols; l-hidroksi-2-metoksi-4-metilbenzols; 3-metoksi-4-hidroksitoluols; kreozols | | |

04.008 | 25 | 2785–89–9 | 4-etilgvajakols | 2436 | 176 | 220–500–4 | 04.008 | 1-hidroksi-2-metoksi-4-etilbenzols; 2-metoksi-2-etilfenols; homokreozols | 4-etil-2-metoksifenols | |

04.009 | 25 | 7786–61–0 | 2-metoksi-4-vinilfenols | 2675 | 177 | 232–101–2 | 04.009 | vinilgvajakols; 4-hidroksi-3-metoksistirols; p-vinilkatehol-O-metilēteris; p-vinilgvajakols | | |

04.010 | 30 | 4180–23–8 | 1-metoksi-4-(prop-1-( trans)-enil)benzols | 2086 | 183 | 224–052–0 | 04.010 | trans-anetols; izoestragols; 1-metoksi-4-propenilbenzols; 1-propēns, 1-(4-metoksifenil)-; 4-metoksi-1-propenilbenzols; anīsa kampars | | 5 |

04.013 | 26 | 93–16–3 | 1,2-dimetoksi-4-(prop-1-enil)benzols | 2476 | 186 | 202–224–6 | 04.013 | metilizoeigenols; 1,2-dimetoksi-4-propenilbenzols; 4-propenilveratrols; 1,2-dimetoksi-4-propēns | | |

04.014 | 26 | 578–58–5 | 1-metoksi-2-metilbenzols | 2680 | 187 | 209–426–3 | 04.014 | o-metilanizols; o-krezilmetilēteris; 2-metoksitoluols; o-metoksitoluols; metil- o-tolilēteris | | |

04.015 | 26 | 104–93–8 | 1-metoksi-4-metilbenzols | 2681 | 188 | 203–253–7 | 04.015 | p-metilanizols; o-metil- p-krezols; 4-metoksitoluols; metil- p-tolilēteris; p-krezilmetilēteris; p-metoksitoluols | | |

04.016 | 26 | 151–10–0 | 1,3-dimetoksibenzols | 2385 | 189 | 205–783–4 | 04.016 | m-dimetoksibenzols; rezorcīna dimetilēteris; dimetilrezorcīns | | |

04.017 | 30 | 7784–67–0 | 1-etoksi-2-metoksi-4-(prop-1-enil)benzols | 2472 | 190 | 232–072–6 | 04.017 | etilizoeigenilēteris; l-etoksi-2-metoksi-4-benzols; 2-etoksi-5-propenilanizols; etilizoeigenols | | |

04.018 | 26 | 120–11–6 | benzilizoeigenilēteris | 3698 | 522 | 204–370–6 | 04.018 | benzilizoeigenols; izoeigenilbenzilēteris; benzil-2-metoksi-4-propenilfenilēteris; l-benziloksi-2-metoksi-4-propenilbenzols | benzil-2-metoksi-4-prop-1-enilfenilēteris | |

04.019 | 25 | 95–87–4 | 2,5-dimetilfenols | 3595 | 537 | 202–461–5 | 04.019 | 1-hidroksi-2,5-dimetilbenzols | | |

04.020 | 25 | 108–68–9 | 3,5-dimetilfenols | | 538 | 203–606–5 | 04.020 | | | |

04.021 | 25 | 620–17–7 | 3-etilfenols | | 549 | 210–627–3 | 04.021 | | | |

04.022 | 25 | 123–07–9 | 4-etilfenols | 3156 | 550 | 204–598–6 | 04.022 | 4-hidroksietilbenzols | | |

04.026 | 25 | 108–39–4 | 3-metilfenols | 3530 | 617 | 203–577–9 | 04.026 | m-krezols; 1-hidroksi-3-metilbenzols; 1-metil-3-hidoksibenzols; m-metilfenols | | |

04.027 | 25 | 95–48–7 | 2-metilfenols | 3480 | 618 | 202–423–8 | 04.027 | o-krezols; 1-hidroksi-2-metilbenzols; 2-hidroksi-1-metilbenzols; o-krezilskābe; o-hidroksitoluols; o-metilfenols | | |

04.028 | 25 | 106–44–5 | 4-metilfenols | 2337 | 619 | 203–398–6 | 04.028 | p-krezols; 4-hidroksitoluols; 1-metil-4-hidroksibenzols; 1-hidroksi-4-metilbenzols; 4-krezols; p-krezilskābe | | |

04.029 | 25 | 120–80–9 | benzol-1,2-diols | | 680 | 204–427–5 | 04.029 | katehols | | |

04.031 | 25 | 499–75–2 | karvakrols | 2245 | 2055 | 207–889–6 | 04.031 | 2- p-cimenols; 2-hidroksi- p-cimenols; 2-cikloheksēn-1-ons, 6-metil-3-(1-metiletil)-; 2-hidroksi- p-cimēns; 2-metil-5-izopropilfenols | 5-izopropil-2-metilfenols | |

04.032 | 26 | 100–66–3 | anizols | 2097 | 2056 | 202–876–1 | 04.032 | metilfenilēteris; fenilmetilēteris | metoksibenzols | |

04.033 | 26 | 93–18–5 | β-naftiletilēteris | 2768 | 2058 | 202–226–7 | 04.033 | 2-etoksinaftalīns; etil-2-naftilēteris; etil-β-naftileteris; nerolīns; nerolīns II | | |

04.034 | 26 | 150–78–7 | 1,4-dimetoksibenzols | 2386 | 2059 | 205–771–9 | 04.034 | p-dimetoksibenzols; hidrohinona dimetilēteris; dimetilhidrohinons; 4-metoksifenilmetilēteris | | |

04.035 | 26 | 101–84–8 | difenilēteris | 3667 | 2201 | 202–981–2 | 04.035 | difeniloksīds; fenilēteris | | |

04.036 | 25 | 91–10–1 | 2,6-dimetoksifenols | 3137 | 2233 | 202–041–1 | 04.036 | 2-hidroksi-1,3-dimetoksibenzols; pirogallola dimetilēteris; siringols | | |

04.037 | 25 | 622–62–8 | 4-etoksifenols | 3695 | 2258 | 210–748–1 | 04.037 | hidrohinona monoetilēteris; 1-etoksi-4-hidroksibenzols; p-etoksifenols | | |

04.038 | 26 | 4732–13–2 | karvakriletilēteris | 2246 | 11840 | 225–238–4 | 04.038 | 2-etoksi- p-cimēns; etilkarvakrilēteris | 2-etoksi-4-izopropil-1-metilbenzols | |

04.039 | 26 | 104–45–0 | 1-metoksi-4-propilbenzols | 2930 | 11835 | 203–203–4 | 04.039 | p-propilanizols; dihidroanetols; p-n-propilanizols; 4-propilmetoksibenzols | | |

04.040 | 30 | 6380–23–0 | 1,2-dimetoksi-4-vinilbenzols | 3138 | 11228 | 228–962–9 | 04.040 | 3,4-dimetoksistirols | | |

04.041 | 25 | 108–95–2 | fenols | 3223 | 11811 | 203–632–7 | 04.041 | karbolskābe; hidroksibenzols; benzenols; fenilhidroksīds | | |

04.042 | 25 | 576–26–1 | 2,6-dimetilfenols | 3249 | 11261 | 209–400–1 | 04.042 | 2,6-ksilenols; 2-hidroksi-1,3-dimetilbenzols | | |

04.043 | 26 | 1076–56–8 | 1-izopropil-2-metoksi-4-metilbenzols | 3436 | 11245 | 214–063–9 | 04.043 | timola metilēteris; 3-metoksi- p-cimēns; 3-metoksi-para-cimēns timols, metilēteris | | |

04.044 | 25 | 88–69–7 | 2-izopropilfenols | 3461 | 11234 | 201–852–8 | 04.044 | fenols, 2-(1-metiletil)-; 1-hidroksi-2-izopropilbenzols; o-kumenols; o-izopropilfenols | | |

04.045 | 25 | 20920–83–6 | 2-(etoksimetil)fenols | 3485 | 11905 | | 04.045 | | | |

04.046 | 25 | 644–35–9 | 2-propilfenols | 3522 | 11908 | 211–415–3 | 04.046 | 1-2-hidroksifenil)propāns | | |

04.047 | 25 | 108–46–3 | benzol-1,3-diols | 3589 | 11250 | 203–585–2 | 04.047 | rezorcīns; 1,3-dihidroksibenzols; m-dihidroksibenzols | | |

04.048 | 25 | 95–65–8 | 3,4-dimetilfenols | 3596 | 11262 | 202–439–5 | 04.048 | 3,4-ksilenols; 1-hidroksi-3,4-dimetilbenzols | | |

04.049 | 25 | 2785–87–7 | 2-metoksi-4-propilfenols | 3598 | | 220–499–0 | 04.049 | 4-propil-orto-metoksifenols; 4-propilgvajakols; 5-propil-orto-hidroksianizols; dihidroeigenols | | |

04.050 | 25 | 645–56–7 | 4-propilfenols | 3649 | | 211–446–2 | 04.050 | | | |

04.051 | 18 | 6627–88–9 | 4-alil-2,6-dimetoksifenols | 3655 | 11214 | 229–600–2 | 04.051 | fenols, 2,6-dimetoksi-4-(2-propenil)-; 4-alilsiringols; 4-metoksieigenols | | |

04.052 | 25 | 14059–92–8 | 4-etil-2,6-dimetoksifenols | 3671 | 11231 | | 04.052 | 4-etilsiringols | | |

04.053 | 25 | 6638–05–7 | 4-metil-2,6-dimetoksifenols | 3704 | | 229–641–6 | 04.053 | 4-metilsiringols; 2,6-dimetoksi- p-krezols | | |

04.054 | 26 | 2173–57–1 | izobutil-β-naftilēteris | 3719 | 11886 | 218–529–2 | 04.054 | 2-izobutoksinaftalīns; fragarols | 2-metilpropil-β-naftileteris | |

04.055 | 17 | 20675–95–0 | 2,6-dimetoksi-4-prop-1-enilfenols | 3728 | | | 04.055 | 4-propenilsiringols; 6-metoksiizoeigenols | | |

04.056 | 25 | 6766–82–1 | 2,6-dimetoksi-4-propilfenols | 3729 | | | 04.056 | 4-propilsiringols | | |

04.057 | 25 | 2628–17–3 | 4-vinilfenols | 3739 | 11257 | 220–103–6 | 04.057 | 4-etenilfenols; 4-hidroksistirols | | |

04.058 | 18 | 501–92–8 | 4-alilfenols | | 11218 | 207–929–2 | 04.058 | p-alilfenols | | |

04.059 | 26 | 6379–73–3 | karvakrilmetilēteris | | 11224 | 228–959–2 | 04.059 | 5-izopropil-2-metilmetoksibenzols | 4-izopropil-2-metoksi-1-metilbenzols | |

04.060 | 26 | 494–99–5 | 1,2-dimetoksi-4-metilbenzols | | | 207–796–0 | 04.060 | homoveratrols; 3,4-dimetoksitoluols | | |

04.061 | 25 | 28343–22–8 | 2,6-dimetoksi-4-vinilfenols | | 11229 | | 04.061 | | | |

04.062 | 26 | 91–16–7 | 1,2-dimetoksibenzols | 3799 | 10320 | 202–045–3 | 04.062 | veratrols; o-dimetoksibenzols | | |

04.063 | 26 | 6738–23–4 | 1,3-dimetil-4-metoksibenzols | 3828 | | 229–794–9 | 04.063 | 2,4-dimetil-1-metoksibenzols | | |

04.064 | 25 | 98–54–4 | 4-(1,1-dimetiletil)fenols | 3918 | | 202–679–0 | 04.064 | 4- terc-butilfenols; 1-hidroksi-4- terc-butilbenzols; Ukarbutilfenols | | |

04.065 | 25 | 526–75–0 | 2,3-dimetilfenols | | 11258 | 208–395–3 | 04.065 | 2,3-ksilenols; 1-hidroksi-2,3-dimetilbenzols | | |

04.066 | 25 | 105–67–9 | 2,4-dimetilfenols | | 11259 | 203–321–6 | 04.066 | 2,4-ksilenols; 1-hidroksi-2,4-dimetilbenzols; 4,6-dimetilfenols | | |

04.067 | 26 | 17600–72–5 | 1-etoksi-2-metoksibenzols | | | 241–571–8 | 04.067 | etilgvajakols | | |

04.068 | 26 | 5076–72–2 | 1-etoksi-4-metoksibenzols | | | 225–786–4 | 04.068 | aniziletilēteris | | |

04.069 | 26 | 1515–95–3 | 1-etil-4-metoksibenzols | | | | 04.069 | 4-etilanizols | | |

04.070 | 25 | 90–00–6 | 2-etilfenols | | 11232 | 201–958–4 | 04.070 | florols; 1-etil-2-hidroksibenzols | | |

04.071 | 17 | 115422–59–8 | izoeigenilbutilēteris | | 11857 | | 04.071 | | 1-butoksi-2-metoksi-4-(prop-1-enil)benzols | |

04.072 | 25 | 618–45–1 | 3-izopropilfenols | | | 210–551–0 | 04.072 | | | |

04.073 | 25 | 99–89–8 | 4-izopropilfenols | | | 202–798–8 | 04.073 | | | |

04.074 | 26 | 93–04–9 | 2-metoksinaftalīns | | | 202–213–6 | 04.074 | jara-jara; β-naftilmetileteris | | |

04.075 | 26 | 2216–69–5 | 1-metoksinaftalīns | | | 218–696–1 | 04.075 | | | |

04.076 | 25 | 150–19–6 | 3-metoksifenols | | | 205–754–6 | 04.076 | m-hidroksianizols | | |

04.077 | 25 | 150–76–5 | 4-metoksifenols | | 11241 | 205–769–8 | 04.077 | p-hidroksianizols; hidrohinona monometilēteris | | |

04.078 | 25 | 88–60–8 | 5-metil-2-( terc-butil)fenols | | | 201–842–3 | 04.078 | 6- terc-butil- m-krezols | 5-metil-2-(1,1-dimetiletil)fenols | |

04.079 | 26 | 1515–81–7 | metil-4-metoksibenzilēteris | | | 216–161–7 | 04.079 | | | |

04.080 | 25 | 533–31–3 | 3,4-metilēndioksifenols | | | 208–561–5 | 04.080 | | | |

04.081 | 25 | 1195–09–1 | 5-metilgvajakols | | 11243 | 214–791–7 | 04.081 | l-hidroksi-2-metoksi-5-metilbenzols | 2-metoksi-5-metilfenols | |

04.083 | 25 | 123–31–9 | hinols | | 11249 | 204–617–8 | 04.083 | hidrohinons; 1,4-benzoldiols; para-hidroksifenols | 1,4-dihidroksibenzols | |

04.084 | 26 | 634–36–6 | 1,2,3-trimetoksibenzols | | | 211–207–2 | 04.084 | | | |

04.085 | 25 | 2416–94–6 | 2,3,6-trimetilfenols | 3963 | | 219–330–3 | 04.085 | 3-hidropseidokumols | | |

04.088 | 30 | 104–46–1 | l-metoksi-4-(1-propenil)benzols | 2086 | 183 | 203–205–5 | 04.088 | anetols; p-propilanizols; izoestragols; p-propilfenilmetilēteris; propenilanizols | | 5 |

04.091 | 25 | 57726–26–8 | etil-4-hidroksibenzilēteris | | | 260–918–4 | 04.091 | | | |

04.092 | 25 | 5355–17–9 | 4-hidroksibenzilmetilēteris | | | 226–334–9 | 04.092 | | | |

04.093 | 23 | 82654–98–6 | butilvanililēteris | 3796 | | | 04.093 | 4-(butoksimetil)-2-metoksifenols | butil-4-hidroksi-3-metoksibenzilēteris | |

04.094 | 25 | 13184–86–6 | etil-4-hidroksi-3-metoksibenzilēteris | 3815 | | 236–136–4 | 04.094 | | etil-4-hidroksi-3-metoksibenzilēteris | |

05.001 | 01 | 75–07–0 | acetaldehīds | 2003 | 89 | 200–836–8 | 05.001 | etanāls; etiķskābes aldehīds | | |

05.002 | 01 | 123–38–6 | propanāls | 2923 | 90 | 204–623–0 | 05.002 | propionaldehīds; propilaldehīds; metilacetaldehīds; propān-1-āls; C-3 aldehīds | | |

05.003 | 01 | 123–72–8 | butanāls | 2219 | 91 | 204–646–6 | 05.003 | n-butiraldehīds; butilaldehīds; sviestskābes aldehīds; n-butanāls; butān-1-āls; n-butilaldehīds | | |

05.004 | 02 | 78–84–2 | 2-metilpropanāls | 2220 | 92 | 201–149–6 | 05.004 | izobutanāls; izobutiraldehīds; butiraldehīds (izo); butilizoaldehīds; izosviestskābes aldehīds; izobutilaldehīds; sviestskābes izoaldehīds | | |

05.005 | 01 | 110–62–3 | pentanāls | 3098 | 93 | 203–784–4 | 05.005 | valeraldehīds; n-baldriānskābes aldehīds; amilaldehīds; baldriānskābes aldehīds; valerāls; pentān-1-āls; C 5 aldehīds | | |

05.006 | 02 | 590–86–3 | 3-metilbutanāls | 2692 | 94 | 209–691–5 | 05.006 | izovaleraldehīds; 3-metilbutilaldehīds; izoamilaldehīds; amilizoaldehīds; izobaldriānskābes aldehīds; izovaleraldehīds; izovalerāls | | |

05.007 | 02 | 97–96–1 | 2-etilbutanāls | 2426 | 95 | 202–623–5 | 05.007 | 2-etilbutiraldehīds; dietilacetaldehīds | | |

05.008 | 01 | 66–25–1 | heksanāls | 2557 | 96 | 200–624–5 | 05.008 | C-6 aldehīds; heksaldehīds; heksānskābes aldehīds; kapronskābes aldehīds; kaproaldehīds; n-heksaldehīds | | |

05.009 | 01 | 124–13–0 | oktanāls | 2797 | 97 | 204–683–8 | 05.009 | C-8 aldehīds; oktilaldehīds; kaprilskābes aldehīds; kaprilaldehīds; oktilaldehīds; n-oktilaldehīds | | |

05.010 | 01 | 112–31–2 | dekanāls | 2362 | 98 | 203–957–4 | 05.010 | C-10 aldehīds; decilaldehīds; kapraldehīds; kaprīnskābes aldehīds; n-decilaldehīds | | |

05.011 | 01 | 112–54–9 | dodekanāls | 2615 | 99 | 203–983–6 | 05.011 | C-12 aldehīds; laurīnskābes aldehīds; laurilaldehīds; n-dodecilaldehīds; duodecilaldehīds; lauraldehīds; dodekān-1-āls | | |

05.012 | 09 | 107–75–5 | 3,7-dimetil-7-hidroksioktanāls | 2583 | 100 | 203–518–7 | 05.012 | hidroksicitronelāls; 7-hidroksi-3,7-dimetiloktān-1-āls; laurīns; citronelālhidrāts | | |

05.013 | 23 | 100–52–7 | benzaldehīds | 2127 | 101 | 202–860–4 | 05.013 | benzolmetilāls; benzolkarbonāls; benzoskābes aldehīds; benzolkarboksaldehīds | | |

05.014 | 22 | 104–55–2 | cinamaldehīds | 2286 | 102 | 203–213–9 | 05.014 | kanēļskābes aldehīds; fenilakroleīns; cinamāls; 3-fenilpropenāls; 3-fenil-2-propēn-1-āls; β-fenilakroleins | 3-fenilprop-2-enāls | |

05.015 | 23 | 123–11–5 | 4-metoksibenzaldehīds | 2670 | 103 | 204–602–6 | 05.015 | p-anīsaldehīds; aubepīns; anīsskābes aldehīds; šķidrais aubepīns | | |

05.016 | 23 | 120–57–0 | piperonāls | 2911 | 104 | 204–409–7 | 05.016 | heliotropīns; piperonilaldehīds; dioksometilēnprotokatehīnaldehīds | 3,4-metilēndioksibenzaldehīds | |

05.017 | 23 | 120–14–9 | veratraldehīds | 3109 | 106 | 204–373–2 | 05.017 | o-metilvanilīns; p-veratrskābes aldehīds; dimetilētera protokatehīnaldehīds; 3,4-dimetoksibenzolkarbonāls | 3,4-dimetoksibenzaldehīds | |

05.018 | 23 | 121–33–5 | vanilīns | 3107 | 107 | 204–465–2 | 05.018 | metilprotokatehīnaldehīds; protokatehīnaldehīda-3-metilēteris; vanilīnskābes aldehīds; | 4-hidroksi-3-metoksibenzaldehīds | |

05.019 | 23 | 121–32–4 | etilvanilīns | 2464 | 108 | 204–464–7 | 05.019 | burbonāls; etilprotāls; 3-etoksiprotokatehīnaldehīds | 3-etoksi-4-metoksibenzaldehīds | |

05.020 | 03 | 5392–40–5 | citrāls | 2303 | 109 | 226–394–6 | 05.020 | lemaroms; geraniāls; 3,7-dimetil-2,6-oktadienāls; nerāls | 3,7-dimetilokta-2,6-dienāls | |

05.021 | 04 | 106–23–0 | citronelāls | 2307 | 110 | 203–376–6 | 05.021 | 3,7-dimetil-6-oktenāls; rodināls | 3,7-dimetilokt-6-enāls | |

05.022 | 23 | 122–03–2 | 4-izopropilbenzaldehīds | 2341 | 111 | 204–516–9 | 05.022 | kumīnaldehīds; p-izopropilbenzaldehīds; kumīnskābes aldehīds; kumināls; kumaldehīds; p-propilizobenzaldehīds | | |

05.023 | 02 | 7779–07–9 | 2,6-dimetiloktanāls | 2390 | 112 | 215–328–1 | 05.023 | izodecilaldehīds; deciladehīds(izo) | | |

05.024 | 02 | 7786–29–0 | 2-metiloktanāls | 2727 | 113 | 232–093–0 | 05.024 | metilheksilacetaldehīds; | | |

05.025 | 01 | 124–19–6 | nonanāls | 2782 | 114 | 204–688–5 | 05.025 | pelargonskābes aldehīds; C 9 aldehīds; pelargonaldehīds; nonānskābes aldehīds | | |

05.026 | 23 | 529–20–4 | o-toluilaldehīds | 3068 | 115 | 208–452–2 | 05.026 | | 2-metilbenzaldehīds | 5 |

05.027 | 23 | 1334–78–7 | toluilaldehīds | 3068 | 115 | 215–615–1 | 05.027 | toluilskābes aldehīds (2,3,4 maisījums) | 2-,3-,4-metilbenzaldehīds | |

05.028 | 23 | 620–23–5 | m-toluilaldehīds | 3068 | 115 | 210–632–0 | 05.028 | | 3-metilbenzaldehīds | 5 |

05.029 | 23 | 104–87–0 | p-toluilaldehīds | 3068 | 115 | 203–246–9 | 05.029 | | 4-metilbenzaldehīds | 5 |

05.030 | 15 | 122–78–1 | fenilacetaldehīds | 2874 | 116 | 204–574–5 | 05.030 | α-toluilaldehīds; α-tolualdehīds; hiacintīns; feniletiķskābes aldehīds; benzilkarboksialdehīds; 1-okso-2-feniletāns | | |

05.031 | 01 | 111–71–7 | heptanāls | 2540 | 117 | 203–898–4 | 05.031 | C-7 aldehīds; n-heptaldehīds; heptilaldehīds; heptaldehīds; enantaldehīds; enantāls; Aldehyde Heptan-1-alc-7; | | |

05.032 | 01 | 124–25–4 | tetradekanāls | 2763 | 118 | 204–692–7 | 05.032 | miristaldehīds; C-14 aldehīds; miristīnskābes aldehīds; tetradecilaldehīds; C-14 aldehīds (miristīn-); tetradekān-1-āls | | |

05.033 | 03 | 10031–88–6 | 2-etilhept-2-enāls | 2438 | 120 | | 05.033 | 2-etil-3-butilakroleīns | | |

05.034 | 01 | 112–44–7 | undekanāls | 3092 | 121 | 203–972–6 | 05.034 | undekānskābes aldehīds; undecilskābes aldehīds; hendekanāls; C-1 1 aldehīds, undecil-; n-undecilaldehīds; undekān-1-āls | | |

05.035 | 04 | 112–45–8 | undec-10-enāls | 3095 | 122 | 203–973–1 | 05.035 | undecilēnskābes aldehīds (izomēru maisījums); undecenāls; Intrelevenas aldehīds; C-1 1 aldehīds | | |

05.036 | 04 | 143–14–6 | undec-9-enāls | 3094 | 123 | 205–586–3 | 05.036 | undecilēnskābes aldehīds; hendecēn-9-āls; C-1 1 aldehīds, undecilēnskābes; 9-undecilēnskābes aldehīds | | |

05.037 | 03 | 4826–62–4 | 2-dodecenāls | 2402 | 124 | 225–402–5 | 05.037 | 3-nonilakroleīns; dodec-2-enāls | | |

05.038 | 22 | 93–53–8 | 2-fenilpropanāls | 2886 | 126 | 202–255–5 | 05.038 | 2-fenilpropionaldehīds; hidratropaldehīds; α-metiltolualdehids; α-metilfenilacetaldehids; α-fenilpropionaldehids | | |

05.039 | 22 | 7492–44–6 | α-butilcinamaldehids | 2191 | 127 | 231–320–0 | 05.039 | 2-benzilidēnheksanāls; butilkanēļskābes aldehīds; α-butil-β-fenilakroleins | 2-butil-3-fenilprop-2-enāls | |

05.040 | 22 | 122–40–7 | α-pentilcinamaldehīds | 2061 | 128 | 204–541–5 | 05.040 | α-amilcinamaldehids; amilkanēļskābes aldehīds; α-amil-β-fenilakroleins; 2-benzilidēnheptanāls; α-pentilcinamaldehids | 2-pentil-3-fenilprop-2-enāls | |

05.041 | 22 | 101–86–0 | α-heksilcinamaldehids | 2569 | 129 | 202–983–3 | 05.041 | 2-benzilidēnoktanols; α-n-heksilkaneļskābes aldehīds; α-n-heksil-β-fenilakroleins | 2-benzilidēnoktanāls | |

05.042 | 15 | 104–09–6 | p-tolilacetaldehīds | 3071 | 130 | 203–173–2 | 05.042 | | 4-metilfenilacetaldehīds | |

05.043 | 22 | 99–72–9 | 2-( p-tolil)propionaldehīds | 3078 | 131 | 202–782–0 | 05.043 | p-metil-α-metilfenilacetaldehids; p-metilhidratropaldehīds | 2-(4-metilfenil)propanāls | |

05.044 | 15 | 4395–92–0 | p-izopropilfenilacetaldehīds | 2954 | 132 | 224–522–5 | 05.044 | kumilacetaldehīds; 2-( p-izopropilfenil)acetaldehīds; korteksāls; kumilaldehīds; p-kumol-7-karboksaldehīds; p-propilfenilacetaldehīds | | |

05.045 | 22 | 103–95–7 | 3-( p-kumenil)- 2-metilpropionaldehīds | 2743 | 133 | 203–161–7 | 05.045 | ciklamenaldehīds; p-izopropil-α-metilhidrocinamaldehids; ciklamāls; ciklaviols; ciklazāls; α-metil- p-izopropilhidrocinamaldehīds | 2-metil-3-(4-izopropilfenil)propanāls | |

05.046 | 22 | 40654–82–8 | 2-metil-4-fenilbutiraldehīds | 2737 | 134 | 255–022–5 | 05.046 | 2-metil-4-fenilbutanāls | | |

05.047 | 23 | 123–08–0 | 4-hidroksibenzaldehīds | | 558 | 204–599–1 | 05.047 | p-hidroksibenzaldehīds | | |

05.048 | 22 | 1504–74–1 | 2-metoksicinamaldehīds | 3181 | 571 | 216–131–3 | 05.048 | β- o-metoksifenilakroleīns; 3- o-metoksifenil-2-propenāls | 3-(2-metoksifenil)prop-2-enāls | |

05.049 | 02 | 96–17–3 | 2-metilbutiraldehīds | 2691 | 575 | 202–485–6 | 05.049 | 2-metilbutanāls; metiletilacetaldehīds; α-metilbutiraldehīds; 2-metilbutanāls-1 | | |

05.050 | 22 | 101–39–3 | α-metilcinamaldehīds | 2697 | 578 | 202–938–8 | 05.050 | 2-metilcinamaldehīds; α-metilkaneļskābes aldehīds; α-metilcinamals; α-metilkanēļskābes aldehīds | 2-metil-3-fenilprop-2-enāls | |

05.051 | 22 | 65405–67–6 | 3-(4-metoksifenil)- 2-metilprop-2-enāls | 3182 | 584 | 265–737–4 | 05.051 | α-metil- p-metoksicinamaldehīds; 3-( p-metoksifenil)- 2-metil-2-propenāls | | |

05.052 | 22 | 41496–43–9 | 2-metil-3-( p-tolil)propionaldehīds | 2748 | 587 | 255–410–4 | 05.052 | 2-metil-3-(4-metilfenil)propanāls | | 5 |

05.053 | 01 | 123–63–7 | 2,4,6-trimetil-1,3,5-trioksāns | | 594 | 204–639–8 | 05.053 | paraldehīds; paracetaldehīds | | |

05.054 | 22 | 1009–62–7 | 2,2-dimetil-3-fenilpropionaldehīds | | 598 | 213–771–5 | 05.054 | 3-fenilpropildimetilaldehīds | | |

05.055 | 23 | 90–02–8 | salicilaldehīds | 3004 | 605 | 201–961–0 | 05.055 | salicilskābes aldehīds; o-hidroksibenzaldehīds; salicilāls | 2-hidroksibenzaldehīds | |

05.056 | 23 | 10031–82–0 | 4-etoksibenzaldehīds | 2413 | 626 | 233–093–3 | 05.056 | homoanīsaldehīds | | |

05.057 | 03 | 142–83–6 | heksa-2-( trans), 4-( trans)-dienāls | 3429 | 640 | 205–564–3 | 05.057 | 2-propilēnakroleīns; sorbīnskābes aldehīds; heksa-2,4-dienāls | | 5 |

05.058 | 03 | 557–48–2 | nona-2-( trans), 6-( cis)-dienāls | 3377 | 659 | 209–178–6 | 05.058 | 2,6-nonadienāls; gurķu aldehīds; nona-2,6-dienāls | | |

05.059 | 04 | 2277–19–2 | non-6-( cis)-enāls | 3580 | 661 | 218–900–9 | 05.059 | cis- 6-nonēn-1-āls; non-6-enāls | | |

05.060 | 03 | 2363–89–5 | okt-2-enāls | 3215 | 663 | 219–115–4 | 05.060 | α-amilakroleins; 2-pentilakroleīns | | |

05.061 | 04 | 63826–25–5 | okt-6-enāls | | 664 | | 05.061 | | | |

05.062 | 22 | 4411–89–6 | 2-fenilkrotonaldehīds | 3224 | 670 | 224–567–0 | 05.062 | 2-fenilbut-2-ēn-1-āls | 2-fenilbut-2-( trans)-enāls | |

05.064 | 03 | 13552–96–0 | trideka-2-( trans), 4-( cis), 7-( cis)-trienāls | 3638 | 685 | 236–936–3 | 05.064 | trideka-2,4,7-trienāls | | |

05.066 | 23 | 120–25–2 | 4-etoksi-3-metoksibenzaldehīds | | 703 | 204–382–1 | 05.066 | vanilīna etilēteris | | |

05.068 | 23 | 4748–78–1 | 4-etilbenzaldehīds | 3756 | 705 | 225–268–8 | 05.068 | p-etilbenzaldehīds | | |

05.069 | 02 | 123–15–9 | 2-metilpentanāls | 3413 | 706 | 204–605–2 | 05.069 | 2-metilvaleraldehīds | | |

05.070 | 03 | 2463–63–0 | 2-heptenāls | 3165 | 730 | 219–563–0 | 05.070 | 3-butilakroleīns; β-butilakroleins; hept-2-enāls; trans-hept-2-enāls | | 5 |

05.071 | 03 | 6750–03–4 | nona-2,4-dienāls | 3212 | 732 | 229–810–4 | 05.071 | | | |

05.072 | 03 | 18829–56–6 | trans- 2-nonenāls | 3213 | 733 | 242–609–6 | 05.072 | 3-heksil-2-propenāls; non-2-enāls; 3 vai β-heksilakroleins; heptilicēnacetaldehīds | | 5 |

05.073 | 03 | 6728–26–3 | heks-2-( trans)-enāls | 2560 | 748 | 229–778–1 | 05.073 | β-propilakroleins; lapu aldehīds; trans-heks-2-enāls | | 5 |

05.074 | 04 | 106–72–9 | 2,6-dimetilhepta-5-enāls | 2389 | 2006 | 203–427–2 | 05.074 | melonāls; 2,6-dimetil-2-heptēn-7-āls | | |

05.075 | 04 | 6789–80–6 | heks-3-( cis)-enāls | 2561 | 2008 | 229–854–4 | 05.075 | cis-β, γ-heksilenskābes aldehīds; heks-3-enāls | | |

05.076 | 03 | 3913–71–1 | dec-2-enāls | 2366 | 2009 | 223–472–1 | 05.076 | decēnaldehīds; 3-heptilakroleīns; decilēnskābes aldehīds; dec-2-enāls; 2-decēn-1-āls | | |

05.077 | 02 | 110–41–8 | 2-metilundekanāls | 2749 | 2010 | 203–765–0 | 05.077 | metilnonilacetaldehīds; C-12 aldehīds; MNA; 2-metilhendekanāls; metilnonilacetaldehīds | | |

05.078 | 03 | 7774–82–5 | tridec-2-enāls | 3082 | 2011 | 231–883–2 | 05.078 | 3-decilakroleīns | | |

05.079 | 09 | 7492–67–3 | citroneliloksiacetaldehīds | 2310 | 2012 | 231–324–2 | 05.079 | citroneloksiacetaldehīds; 6,10-dimetil-3-oksa-9-undecenāls | 6,10-dimetil-3-oksaundec-9-enāls | |

05.080 | 22 | 104–53–0 | 3-fenilpropanāls | 2887 | 2013 | 203–211–8 | 05.080 | 3-fenilpropionaldehīds; hidrocinamaldehīds; fenilpropiladlehīds; benzilacetaldehīds; β-fenilpropionaldehids | | |

05.081 | 03 | 2363–88–4 | 2,4-dekadienāls | 3135 | 2120 | 219–114–9 | 05.081 | deka-2,4-dienāls | | 5 |

05.082 | 04 | 13553–09–8 | dodeka-3,6-dienāls | | 2121 | | 05.082 | | | |

05.084 | 03 | 4313–03–5 | hepta-2,4-dienāls | 3164 | 729 | 224–328–0 | 05.084 | | | 5 |

05.085 | 04 | 6728–31–0 | hept-4-enāls | 3289 | 2124 | 229–779–7 | 05.085 | cis- 4-heptēn-1-āls; cis- 4-etilidēnbutiraldehīds; n-propilidēnbutiraldehīds | | 5 |

05.086 | 04 | 929–22–6 | trans- 4-heptenāls | 3289 | 2125 | 213–198–0 | 05.086 | trans-hept-4-enāls; 4-heptēn-1-āls; n-propilidēnbutiraldehīds | | |

05.090 | 03 | 623–36–9 | 2-metilpent-2-enāls | 3194 | 2129 | 210–789–5 | 05.090 | α-metil-β-etilakroleins; 2,4-dimetilkrotonaldehīds | | |

05.091 | 23 | 698–27–1 | 2-hidroksi-4-metilbenzaldehīds | 3697 | 2130 | 211–813–7 | 05.091 | 4-metilsalicilaldehīds; 4-metilsalicilskābes aldehīds; 2,4-krezotaldehīds | | |

05.094 | 22 | 7775–00–0 | 3-(4-izopropilfenil) propionaldehīds | 2957 | 2261 | 231–885–3 | 05.094 | kuminilacetaldehīds; p-kumilpropanāls; p-izopropilhidrocinamaldehīds; p-propilhidrocinamaldehīds | | |

05.095 | 03 | 497–03–0 | 2-metilkrotonaldehīds | 3407 | 2281 | 207–833–0 | 05.095 | | 2-metilbut-2-( trans)-enāls | 5 |

05.096 | 04 | 30390–50–2 | 4-decenāls | 3264 | 2297 | 244–514–5 | 05.096 | decēnaldehīds, ( cis)dec-4-enāls | | 5 |

05.097 | 22 | 2439–44–3 | 3-metil-2-fenilbutiraldehīds | 2738 | 135 | 219–461–6 | 05.097 | 3-metil-2-fenilbutanāls; α-izopropilfenilacetaldehīds; α-izopropilfenilacetaldehīds | | |

05.098 | 07 | 29548–14–9 | p-ment-1-ēn-9-ols | 3178 | 10347 | 249–688–6 | 05.098 | karvomentenāls | | |

05.099 | 22 | 21834–92–4 | 5-metil-2-fenilheks-2-enāls | 3199 | 10365 | 244–602–3 | 05.099 | 2-fenil-5-metil-2-heksenāls | | |

05.100 | 22 | 26643–91–4 | 4-metil-2-fenilpent-2-enāls | 3200 | 10366 | 247–869–4 | 05.100 | | | |

05.101 | 03 | 764–40–9 | penta-2,4-dienāls | 3217 | 11695 | | 05.101 | | | |

05.102 | 03 | 764–39–6 | pent-2-enāls | 3218 | 10375 | 212–120–2 | 05.102 | 3-etilakroleīns | | |

05.103 | 22 | 939–21–9 | 3-fenilpent-4-enāls | 3318 | 10378 | 213–356–9 | 05.103 | β-vinilhidrocinamaldehīds; 3-fenil-3-vinilpropionaldehīds | | |

05.104 | 07 | 116–26–7 | 2,6,6-trimetilcikloheksa-1,3-diēn-1-karbaldehīds | 3389 | 10383 | 204–133–7 | 05.104 | safranāls; dehidro-β-ciklocitrāls; 1,1,3-trimetil-2-formilcikloheksa-2, 4-diēns | | |

05.105 | 03 | 25409–08–9 | 2-butilbut-2-enāls | 3392 | 10324 | 246–950–1 | 05.105 | 2-etilidīnheksanāls; 2-etilidēnheksanāls | | |

05.106 | 07 | 564–94–3 | mirtenāls | 3395 | 10379 | 209–274–8 | 05.106 | pin-2-ēn-10-āls; benihināls | 2-formil-6,6-dimetilbiciklo[3.1.1]hept-2-ēns | |

05.107 | 03 | 35158–25–9 | 2-izopropil-5-metilheks-2-enāls | 3406 | 10361 | 252–406–4 | 05.107 | 2-izopropil-5-metil-2-heksenāls | | |

05.108 | 03 | 13162–46–4 | undeka-2,4-dienāls | 3422 | 10385 | | 05.108 | | | 5 |

05.109 | 03 | 2463–77–6 | 2-undecenāls | 3423 | 11827 | 219–564–6 | 05.109 | 2-undecēn-1-āls | | |

05.110 | 23 | 15764–16–6 | 2,4-dimetilbenzaldehīds | 3427 | | 239–856–7 | 05.110 | 2,4-ksililaldehīds; 1-formil-2,4-dimetilbenzols | | |

05.111 | 03 | 56767–18–1 | okta-2-( trans), 6-( trans)-dienāls | 3466 | 10371 | 260–372–7 | 05.111 | | | |

05.112 | 07 | 472–66–2 | 2,6,6-trimetilcikloheks-1-ēn-1-acetaldehīds | 3474 | 10338 | 207–454–0 | 05.112 | β-homociklocitrāls | | |

05.113 | 04 | 4634–89–3 | heks-4-enāls | 3496 | 10337 | 225–058–6 | 05.113 | | | 5 |

05.114 | 03 | 5362–56–1 | 4-metilpent-2-enāls | 3510 | 10364 | 226–348–5 | 05.114 | | | |

05.115 | 22 | 24401–36–3 | 2-fenilpent-4-enāls | 3519 | 10377 | 246–224–4 | 05.115 | | | |

05.116 | 02 | 5435–64–3 | 3,5,5-trimetilheksenāls | 3524 | 10384 | 226–603–0 | 05.116 | izononilaldehīds; terc-butilizopentanāls | | |

05.117 | 07 | 2111–75–3 | p-menta-1,8-diēn-7-āls | 3557 | 11788 | 218–302–8 | 05.117 | perilaldehīds; 4-izopropenil-1-cikloheksēn-1-karboksaldehīds; perilaldehīds | | |

05.118 | 22 | 1963–36–6 | 4-metoksicinamaldehīds | 3567 | 11919 | 217–807–0 | 05.118 | 3-(4-metoksifenil)- 2-propenāls | 3-(4-metoksifenil)prop-2-enāls | |

05.119 | 07 | 4501–58–0 | 2,2,3-trimetilciklopent-3-ēn-1-ilacetaldehīds | 3592 | 10325 | 224–815–8 | 05.119 | α-kamfolenaldehīds; (2,3,3-trimetilciklopent-3-ēn-1-il-2)acetaldehīds | | |

05.120 | 03 | 21662–13–5 | dodeka-2,6-dienāls | 3637 | | 244–515–0 | 05.120 | | | 5 |

05.121 | 07 | 432–25–7 | 2,6,6-trimetil-1-cikloheksēn-1-karboksaldehīds | 3639 | 2133 | 207–081–3 | 05.121 | | 1-cikloheksēn-1-karboksaldehīds, 2,6,6-trimetil- | 5 |

05.122 | 22 | 1504–75–2 | p-metilcinamaldehīds | 3640 | 10352 | | 05.122 | 3- p-tolilpropenāls; 3- p-metilfenilpropenāls | 3-(4-metilfenil)prop-2-enāls | |

05.123 | 07 | 55253–28–6 | 5-izopropenil-2-metilciklopentānkarboksaldehīds | 3645 | | | 05.123 | fotocitrāls A; cis- 2-metil- cis- 5-izopropenilciklopentān-1-karboksaldehīds | 5-(1-metilēnetil)- 2-metilciklopentānkarboksaldehīds | |

05.124 | 03 | 107–86–8 | 3-metilkrotonaldehīds | 3646 | 10354 | 203–527–6 | 05.124 | 3-metilbut-2-enāls; prenāls; senecialdehīds | 3-metilbut-2-( trans)-enāls | |

05.125 | 03 | 21662–16–8 | dodeka-2,4-dienāls | 3670 | 11758 | 244–517–1 | 05.125 | E, E-2,4-dodekadienāls | | 5 |

05.126 | 03 | 49576–57–0 | 2-metilokt-2-enāls | 3711 | 10363 | 256–386–8 | 05.126 | | | 5 |

05.127 | 03 | 30361–28–5 | okta-2-( trans), 4-( trans)-dienāls | 3721 | 11805 | 250–147–1 | 05.127 | E, E-2,4-oktadienāls | | |

05.128 | 04 | 41547–22–2 | okt-5-( cis)-enāls | 3749 | | | 05.128 | (Z)-5-oktenāls | | |

05.129 | 23 | 135–02–4 | 2-metoksibenzaldehīds | | 10350 | 205–171–7 | 05.129 | o-metoksibenzaldehīds; o-anīsaldehīds | | |

05.130 | 03 | 17909–77–2 | α-sinensals | 3141 | 10380 | 241–854–6 | 05.130 | 2,6-dimetil-10-metilēn-2,6,11-dodekatrienāls | 2,6-dimetil-10-metilēndodeka-2,6,11-trienāls | 5 |

05.133 | 07 | | p-menta-1,3-diēn-7-āls | | 10344 | | 05.133 | | | |

05.134 | 22 | | 2-metil-3-tolipropionaldehīds ( o-, m-, p-maisījums) | 2748 | 587 | | 05.134 | 2-metil-3-tolilpropanāls | 2-metil-3-(2,3 vai 4-metilfenil)propanāls | 5 |

05.135 | 03 | 123–73–9 | but-2-enāls | | 11736 | 204–647–1 | 05.135 | krotonaldehīds | | |

05.137 | 04 | 21662–09–9 | dec-4-( cis)-enāls | 3264 | 2297 | 244–514–5 | 05.137 | | | 5 |

05.138 | 04 | 65405–70–1 | dec-4-( cis)-enāls | | | 265–741–6 | 05.138 | | | |

05.139 | 04 | 39770–05–3 | dec-9-enāls | 3912 | | 254–624–5 | 05.139 | | | |

05.140 | 03 | 25152–84–5 | deka-2-( trans), 4-( trans)-dienāls | 3135 | 2120 | 246–668–9 | 05.140 | 2,4-dekadienāls; deka-2,4-dienāls; heptenilakroleīns | | 5 |

05.141 | 03 | 51325–37–2 | deka-2,4,7-trienāls | | | | 05.141 | | | |

05.142 | 23 | 139–85–5 | 3,4-dihidroksibenzaldehīds | | 10328 | 205–377–7 | 05.142 | | | |

05.143 | 04 | 56134–05–5 | 2,5-dimetil-2-vinilheks-4-enāls | | | 260–006–6 | 05.143 | nerolaldehīds | | |

05.144 | 03 | 20407–84–5 | dodec-2-( trans)-enāls | 2402 | 124 | | 05.144 | | | 5 |

05.145 | 09 | 107–22–2 | etāndiāls | | | 203–474–9 | 05.145 | glioksāls | | |

05.147 | 02 | 123–05–7 | 2-etilheksanāls | | 10331 | 204–596–5 | 05.147 | 2-etilheksaldehīds; butiletilacetaldehīds; α-etilkaproaldehīds | | |

05.148 | 03 | 19317–11–4 | farnezāls | | | 242–957–9 | 05.148 | | 3,7,11-trimetildodeka-2,6,10-triēn-1-ons | |

05.149 | 09 | 111–30–8 | glutāraldehīds | | | 203–856–5 | 05.149 | glutārskābes dialdehīds; 1,3-diformilpropāns; 1,5-pentadiāls | pentān-1, 5-diāls | |

05.150 | 03 | 18829–55–5 | hept-2-( trans)-enāls | 3165 | 730 | 242–608–0 | 05.150 | (E)- 2-heptēn-1-āls; 2-heptenāls; β-butilakroleins; trans-hept-2-ēn-1-āls | | |

05.151 | 04 | 69112–21–6 | heks-3-( trans)-enāls | 3923 | | 273–874–6 | 05.151 | | | 5 |

05.152 | 01 | 629–80–1 | heksadekanāls | | 10336 | 211–111–0 | 05.152 | | | |

05.153 | 23 | 134–96–3 | 4-hidroksi-3,5-dimetoksibenzaldehīds | | 10340 | 205–167–5 | 05.153 | | | |

05.154 | 22 | 4206–58–0 | 4-hidroksi-3,5-dimetoksicinamaldehīds | | 10341 | | 05.154 | sinapaldehīds | 3-(4-hidroksi-3,5-dimetoksifenil)prop-2-enāls | |

05.155 | 22 | 458–36–6 | 4-hidroksi-3-metoksicinamaldehīds | | 10342 | 207–278–4 | 05.155 | | 3-(4-hidroksi-3-metoksifenil)prop-2-enāls | |

05.156 | 22 | 80638–48–8 | 3-(4-hidroksi-3-metoksifenil)propanāls | | | 279–524–9 | 05.156 | dihidrokoniferaldehīds | | |

05.157 | 07 | 1335–66–6 | izociklocitrāls | | | 215–638–7 | 05.157 | | 1,3,5-trimetilcikloheks-3-ēn-1-karbaldehīds | |

05.158 | 23 | 591–31–1 | 3-metoksibenzaldehīds | | 10351 | 209–712–8 | 05.158 | | | |

05.159 | 15 | 5703–26–4 | p-metoksifenilacetaldehīds | | | 227–191–5 | 05.159 | | | |

05.160 | 02 | 19009–56–4 | 2-metildekanāls | | | 242–745–6 | 05.160 | | | |

05.161 | 02 | 116854–43–4 | 10-metildodekanāls | | | | 05.161 | | | |

05.162 | 02 | 92168–98–4 | 11-metildodekanāls | | | | 05.162 | | | |

05.163 | 02 | 93815–50–0 | 14-metilheksadekanāls | | | | 05.163 | | | |

05.164 | 02 | 925–54–2 | 2-metilheksanāls | | | 213–118–4 | 05.164 | | | |

05.165 | 02 | 19269–28–4 | 3-metilheksanāls | | | | 05.165 | | | |

05.166 | 02 | 1119–16–0 | 4-metilpentanāls | | 10369 | 214–273–0 | 05.166 | 4-metilvaleraldehīds | | |

05.167 | 02 | 75853–50–8 | 12-metiltetradekanāls | | | | 05.167 | | | |

05.168 | 02 | 75853–51–9 | 13-metiltetradekanāls | | | | 05.168 | | | |

05.169 | 02 | 75853–49–5 | 12-metiltridekanāls | | | | 05.169 | | | |

05.170 | 03 | 106–26–3 | nerāls | 2303 | 109 | 203–379–2 | 05.170 | | 3,7-dimetil-2-( cis), 6-oktadienāls | 5 |

05.171 | 03 | 2463–53–8 | non-2-enāls | 3213 | 733 | 219–562–5 | 05.171 | β-heksilakroleins; α-nonelilaldehids; nonilēnskābes aldehīds | | 5 |

05.172 | 03 | 17587–33–6 | nona-2-( trans), 6-( trans)-dienāls | 3766 | | 241–557–1 | 05.172 | | | |

05.173 | 03 | 57018–53–8 | nona-2,4,6-trienāls | | | | 05.173 | | | |

05.174 | 04 | 2100–17–6 | pent-4-enāls | | | 218–265–8 | 05.174 | | | |

05.175 | 22 | 3491–63–2 | 2-fenilpent-2-enāls | | | | 05.175 | | | |

05.176 | 03 | 107–02–8 | prop-2-enāls | | | 203–453–4 | 05.176 | | | |

05.177 | 07 | 1726–47–2 | pseidociklocitrāls | | 11849 | | 05.177 | | 2,6,6-trimetilcikloheks-3-ēnkarbaldehīds | 5 |

05.178 | 03 | 60066–88–8 | β-sinensals | | 10381 | 262–043–3 | 05.178 | | 2,6-dimetil-10-metilēndodeka-2,6,11-trienāls | |

05.179 | 03 | 51534–36–2 | tetradec-2-enāls | | | | 05.179 | | | |

05.181 | 01 | 10486–19–8 | tridekanāls | | 10382 | 234–004–0 | 05.181 | | | |

05.182 | 07 | 432–24–6 | 2,6,6-trimetilcikloheks-2-ēn-1-karboksaldehīds | 3639 | 10326 | 207–080–8 | 05.182 | β-ciklocitrals | | 5 |

05.183 | 07 | 65405–84–7 | 4-(2,6,6-trimetilcikloheksenil)- 2-metilbutanāls | | | 265–747–9 | 05.183 | α, 2,6,6-tetrametilcikloheksenbutanāls | | |

05.184 | 03 | 53448–07–0 | undec-2-( trans)-enāls | 3423 | 11827 | 258–559–3 | 05.184 | | | 5 |

05.186 | 03 | 5577–44–6 | 2,4-oktadienāls | 3721 | 11805 | 250–147–1 | 05.186 | | | 5 |

05.188 | 03 | 141–27–5 | trans- 3,4-dimetilokta-2,6-dienāls | 2303 | 109 | 205–476–5 | 05.188 | geraniāls | | 5 |

05.189 | 03 | 505–57–7 | 2-heksenāls | 2560 | 748 | 208–014–0 | 05.189 | | | 5 |

05.190 | 03 | 2548–87–0 | trans- 2-oktenāls | 3215 | 663 | 219–833–8 | 05.190 | | | 5 |

05.191 | 03 | 3913–81–3 | trans- 2-decenāls | 2366 | 2009 | 223–474–2 | 05.191 | | | 5 |

05.192 | 04 | 4440–65–7 | 3-heksenāls | 3923 | | 224–659–0 | 05.192 | | | 5 |

05.194 | 03 | 5910–87–2 | trans-2, trans-4-nonadienāls | 3212 | 732 | 227–629–5 | 05.194 | | | 5 |

05.195 | 03 | 7069–41–2 | trans-2-tridecenāls | 3082 | 2011 | 230–362–7 | 05.195 | | | 5 |

05.196 | 03 | 30361–29–6 | trans-2, trans- 4-undekadienāls | 3422 | 10385 | 250–148–7 | 05.196 | | | 5 |

05.198 | 07 | 58102–02–6 | α-metiljonāls | | | 261–121–4 | 05.198 | | 2-metil-4-(2,6,6-trimetilcikloheks-2-enil)but-3-enāls | |

05.200 | 03 | | trans-2, trans-4, cis-7-dekatrienāls | | | | 05.200 | | | |

05.203 | 04 | 5090–41–5 | 9-oktadecenāls | | | | 05.203 | | | |

05.206 | 02 | 93815–51–1 | 15-metilheksadekanāls | | | | 05.206 | | | |

06.001 | 01 | 105–57–7 | 1,1-dietoksietāns | 2002 | 35 | 203–310–6 | 06.001 | dietilacetāls; acetaldehīda dietilacetāls; etilidīna dietilēteris; 1,1-dietoksietāns | | |

06.002 | 23 | 1319–88–6 | 5-hidroksi-2-fenil-1,3-dioksāns | 2129 | 36 | 215–294–8 | 06.002 | benzaldehīda glicerilacetāls; 5-hidroksi-2-fenil-1,3-dioksāns 2-fenil- m-dioksān-5-ols; 4-hidroksimetil-2-fenil-1,3-dioksolāns; benzālglicerīns | | |

06.003 | 23 | 1125–88–8 | α, α-dimetoksitoluols | 2128 | 37 | 214–413–0 | 06.003 | benzaldehīda dimetilacetāls; 1,1-dimetoksifenilmetāns | | |

06.004 | 03 | 7492–66–2 | citrāla dietilacetāls | 2304 | 38 | 231–323–7 | 06.004 | 3,7-dimetil-2,6-oktadienāla dietilacetāls; 1,1-dietoksi-3,7-dimetil-2,6-oktadiēns | 1,1-dietoksi-3,7-dimetilokta-2, 6-diēns | |

06.005 | 03 | 7549–37–3 | citrāla dimetilacetāls | 2305 | 39 | 231–434–0 | 06.005 | 3,7-dimetil-2,6-oktadienāla dimetilacetāls; 1,1-dimetoksi-3,7-dimetil-2,6-oktadiēns | 1,1-dimetoksi-3,7-dimetilokta-2,6-diēns | |

06.006 | 15 | 101–48–4 | 1,1-dimetoksi-2-feniletāns | 2876 | 40 | 202–945–6 | 06.006 | α-tolilaldehīda dimetilacetāls; fenilacetaldehīda dimetilacetāls | | |

06.007 | 15 | 29895–73–6 | fenilacetaldehīda glicerilacetāls | 2877 | 41 | 249–934–2 | 06.007 | 5-hidroksi-2-benzil-1,3-dioksāns; 5-hidroksimetil-2-benzil-1,3-dioksolāns | 2-benzil-4-hidroksi-1, 3-dioksāns un 2-benzil-4-hidroksimetil-1,3-diksolāns (maisījums) | |

06.008 | 01 | 10022–28–3 | 1,1-dimetoksioktāns | 2798 | 42 | 233–018–4 | 06.008 | oktanāla dimetilacetāls; C 8-dimetilacetāls; kaprilaldehīda dimetilacetāls; oktaldehīda dimetilacetāls; rezedilacetāls | | |

06.009 | 01 | 7779–41–1 | 10,10-dimetoksidekāns | 2363 | 43 | 231–928–6 | 06.009 | dekanāla dimetilacetāls; decilaldehīds DMA; C 10 aldehīda dimetilacetāls; 1,1-dimetoksidekāns; decilaldehīda dimetilacetāls | | |

06.010 | 02 | 7779–94–4 | 1,1-dietoksi-3,7-dimetiloktān-7-ols | 2584 | 44 | 231–945–9 | 06.010 | hidroksictronelāla dietilacetāls; 1,1-dietoksi-3,7-dimetil-7-oktanols; 8,8-dietoksi-2,6-dimetil-2-oktanols; 7-hidroksi-1,1-dietoksi-3,7-dimetiloktāns | | |

06.011 | 02 | 141–92–4 | 1,1-dimetoksi-3,7-dimetiloktān-7-ols | 2585 | 45 | 205–510–9 | 06.011 | hidroksictronelāla dimetilacetāls; 8,8-dimetoksi-2,6-dimetil-2-oktanols; 1,1-dimetoksi-3,7-dimetil-7-oktanols | | |

06.012 | 23 | 1333–09–1 | toluilaldehīda glicerilacetāls | 3067 | 46 | | 06.012 | 2-( o-, m-, p-krezil)- 5-hidroksidioksāns; 2-(metilfenil)- 1,3-dioksān-5-ols; 2,5-hidroksimetildioksolāns | 2-(2,3 un 4-metilfenil)- 5-hidroksi-1,3-dioksāns un 2-(2,3 un 4-metilfenil)- 5-hidroksimetil-1,3-dioksolāns (maisījums) | |

06.013 | 22 | 91–87–2 | α-pentilcinamaldehida dimetilacetāls | 2062 | 47 | 202–104–3 | 06.013 | α-n-amil-β-fenilakroleindimetilacetāls; 1,1-dimetoksi-2-amil-3-fenil-2-propēns | 1,1-dimetoksi-2-pentil-3-fenilprop-2-ēns | |

06.014 | 22 | 5660–60–6 | cinamaldehīda etilēnglikolacetāls | 2287 | 48 | 227–110–3 | 06.014 | 2-stiril- m-dioksolāns; 2-stiril-1,3-dioksolāns; kanēļskābes aldehīda etilēnglikolacetāls | 2-(2-feniletilēn)- 1,3-dioksolāns | |

06.015 | 01 | 534–15–6 | 1,1-dimetoksietāns | 3426 | 510 | 208–589–8 | 06.015 | acetaldehīda dimetilacetāls; dimetilacetāls; etilidēndimetilēteris | | |

06.016 | 15 | 7493–57–4 | 1-feniletoksi-1-propoksietāns | 2004 | 511 | 231–327–9 | 06.016 | acetaldehīda fenetilpropilacetāls; [2-(1-propoksietoksi)etil]benzols; 1-fenetoksi-1-propoksietāns; propilfenetilacetāls; benzols, 2-(1-propoksietoksi)etil-; acetāls R; pepitāls | | |

06.017 | 23 | 774–48–1 | (dietoksimetil)benzols | | 517 | 212–265–1 | 06.017 | benzaldehīda dietilacetāls; 1,1-dietoksifenilmetāns; fenildietoksimetāns; 1,1-dietoksitoluols | | |

06.019 | 23 | 7492–39–9 | 1-benziloksi-1-(2-metoksietoksi)etāns | 2148 | 523 | | 06.019 | acetaldehīda benzilmetoksietilacetāls; acetaldehīda benzil-?-metoksietilacetāls; 1-benzoil-1-(2-metoksietoksi)etāns | | |

06.020 | 01 | 34764–02–8 | 1,1-dietoksidekāns | | 531 | 252–202–5 | 06.020 | dekanāla dietilacetāls; dekān-1-āla dietilacetāls; decilskābes aldehīda dietilacetāls | | |

06.021 | 01 | 688–82–4 | 1,1-dietoksiheptāns | | 553 | 211–707–0 | 06.021 | heptanāla dietilacetāls; enantāla dietilacetāls | | |

06.023 | 01 | 3658–93–3 | 1,1-dietoksiheksāns | | 557 | 222–911–4 | 06.023 | heksanāla dietilacetāls; heksilaldehīda dietilacetāls | | |

06.024 | 15 | 68345–22–2 | 1,1-diizobutoksi-2-feniletāns | 3384 | 595 | 269–851–5 | 06.024 | fenilacetaldehīda diizobutilacetāls | 1,1-di-(2-metilpropoksi)- 2-feniletāns | |

06.025 | 03 | 67674–36–6 | 1,1-dietoksinona-2,6-diēns | 3378 | 660 | 266–874–2 | 06.025 | nonadienildietilacetāls | | 5 |

06.027 | 15 | 5468–06–4 | 4,5-dimetil-2-benzil-1,3-dioksolāns | 2875 | 669 | | 06.027 | fenilacetaldehīda 2,3-butilēnglikola acetāls | | |

06.028 | 01 | 10032–05–0 | 1,1-dimetoksiheptāns | 2541 | 2015 | 233–103–6 | 06.028 | heptanāla dimetilacetāls; C-7 aldehīda dimetilacetāls; heptaldehīda dimetilacetāls; enantāla dimetilacetāls | | |

06.029 | 09 | 72854–42–3 | heptanāla glicerilacetāls (1,2-un 1,3-acetālu maisījums) | 2542 | 2016 | 276–947–0 | 06.029 | 2-heksil-4-hidroksimetil-1,3-dioksāns un 2-heksil-5-hidroksi-1,3-dioksāns; 2-heksil-4-hidroksi-1, 3-dioksāns | | |

06.030 | 22 | 90–87–9 | 1,1-dimetoksi-2-fenilpropāns | 2888 | 2017 | 202–022–8 | 06.030 | fenilpropanāla dimetilacetāls; hidratropskābes aldehīda dimetilacetāls; 2-fenilpropionaldehīda dimetilacetāls | | |

06.031 | 03 | 54306–00–2 | 1,1-dietoksiheks-2-ēns | | 2135 | 259–086–5 | 06.031 | 2-heksenāla dietilacetāls | | |

06.032 | 23 | 2568–25–4 | 4-metil-2-fenil-1,3-dioksolāns | 2130 | 2226 | 219–906–4 | 06.032 | benzaldehīda propilēnglikolacetāls; 4-metil-2-fenil- m-dioksolāns; 4-metil-2-fenil-1,3-dioksolāns; benzaldehīda propilēnglikola cikliskais acetāls | | |

06.033 | 01 | 871–22–7 | 1,1-dibutoksietāns | | 2341 | 212–804–0 | 06.033 | acetaldehīda dibutilacetāls | | |

06.034 | 01 | 105–82–8 | 1,1-dipropoksietāns | | 2342 | 203–335–2 | 06.034 | n-propilacetāls; dipropilacetāls; acetaldehīda dipropilacetāls | | |

06.035 | 03 | 10444–50–5 | citrāla propilēnglikolacetāls | | 2343 | 233–929–7 | 06.035 | | 2-(2,6-dimetilhepta-1,5-dienil)- 4-metil-1,3-dioksolāns | |

06.036 | 15 | 64577–91–9 | 1-butoksi-1-(2-feniletoksi)etāns | 3125 | 10007 | 264–948–9 | 06.036 | acetaldehīda butilfenetilacetāls; 2-butoksi-2-feniletoksietāns | | |

06.037 | 04 | 18492–65–4 | 1,1-dietoksihept-4-ēns ( cis un trans) | 3349 | 10011 | 242–376–0 | 06.037 | 4-heptenāla dietilacetāls | | 5 |

06.038 | 09 | 5436–21–5 | 4,4-dimetoksibutān-2-ons | 3381 | 10029 | 226–605–1 | 06.038 | acetaldehīda dimetilacetāls; 3-oksobutanāla dimetilacetāls; 3-ketobutiraldehīda dimetilacetāls | | |

06.039 | 30 | 67715–79–1 | 1,2-di-((1′-etoksi)-etoksi)propāns | 3534 | | 266–979–3 | 06.039 | 4,6,9-trimetil-3,5,8,10-tetraoksododekāns; 3,5,8, 10-tetraoksodekāns, 4,6,9-trimetil- | | |

06.040 | 09 | 67715–82–6 | 1,2,3- tris-([1′-etoksi]-etoksi)propāns | 3593 | 11930 | | 06.040 | 3,5,9,11-tetraoksatridekāns, 7-(1-etoksietoksi)- 4,10-dimetil- | | |

06.041 | 02 | | 1-izobutoksi-1-etoksi-2-metilpropāns | | 10055 | | 06.041 | izobutanāla etilizobutilacetāls; 2-metilpropanāla etilizobutilacetāls | 1-etoksi-2-metil-1-(2-metilpropoksi)propāns | |

06.042 | 02 | | 1-izobutoksi-1-etoksi-3-metilbutāns | | 10057 | | 06.042 | izovaleraldehīda etilizobutilacetāls; 3-metilbutanāla etilizobutilacetāls | 1-etoksi-3-metil-1-(2-metilpropoksi)butāns | |

06.043 | 01 | | 1-izoamiloksi-1-etoksipropāns | | 10038 | | 06.043 | propanāla etil-3-metilbutilacetāls | 1-etoksi-1-(2-metilpropoksi)etāns | |

06.044 | 01 | | 1-izobutoksi-1-etoksipropāns | | 10058 | | 06.044 | propanāla etilizobutilacetāls | 1-etoksi-1-(2-metilpropoksi)propāns | |

06.045 | 02 | | 1-izobutoksi-1-izopentiloksi-2-metilpropāns | | 10061 | | 06.045 | izobutanāla izobutilizoamilacetāls; 2-metilpropanāla izobutil-3-metilbutilacetāls | 2-metil-1-(3-metilbutoksi)- 1-(2-metilpropoksi)propāns | |

06.046 | 02 | | 1-izobutoksi-1-izopentiloksi-3-metilbutāns | | 10060 | | 06.046 | izovaleraldehīda izoamilizobutilacetāls; 3-metilbutanāla izobutil-3-metilbutilacetāls | 3-metil-1-(3-metilbutoksi)- 1-(2-metilpropoksi)butāns | |

06.047 | 01 | | 1-izopentiloksi-1-propoksietāns | | 10065 | | 06.047 | acetaldehīda 3-metilbutilpropilacetāls | 1-(3-metilbutoksi)-1-propoksietāns | |

06.048 | 01 | | 1-izopentiloksi-1-propoksipropāns | | 10066 | | 06.048 | propanāla 3-metilbutilpropilacetāls | 1-(3-metilbutoksi)-1-propoksipropāns | |

06.049 | 01 | 77249–20–8 | 1-butoksi-1-(2-metilbutoksi)etāns | | | | 06.049 | acetaldehīda butil-2-metilbutilacetāls | | |

06.050 | 01 | 57006–87–8 | 1-butoksi-1-etoksietāns | | 10003 | | 06.050 | acetaldehīda butiletilacetāls | | |

06.051 | 01 | 13535–43–8 | 1,1-di-(2-metilbutoksi)etāns | | | | 06.051 | acetaldehīda di-(2-metilbutil)acetāls | | |

06.052 | 02 | 13262–24–3 | 1,1-diizobutoksi-2-metilpropāns | | 10025 | | 06.052 | izobutanāla diizobutilacetāls; 2-metilpropanāla diizobutilacetāls | 1,1-di-(2-metilpropoksi)-2-metilpropāns | |

06.053 | 01 | 5669–09–0 | 1,1-diizobutoksietāns | | 10023 | 227–129–7 | 06.053 | acetaldehīda diizobutilacetāls | 1,1-di-(2-metilpropoksi)etāns | |

06.054 | 01 | 13262–27–6 | 1,1-diizobutoksipentāns | | 10026 | | 06.054 | valeraldehīda diizobutilacetāls; pentanāla diizobutilacetāls | 1,1-di-(2-metilpropoksi)pentāns | |

06.055 | 01 | 13002–09–0 | 1,1-diizopentiloksietāns | | 10028 | 235–839–3 | 06.055 | acetaldehīda diizoamilacetāls; acetaldehīda di-(3-metilbutil)acetāls | 1,1-di-(3-metilbutoksi)etāns | |

06.056 | 01 | 4285–59–0 | 1,1-diizopropiloksietāns | | | | 06.056 | acetaldehīda diizopropilacetāls | | 5 |

06.057 | 02 | 3658–94–4 | 1,1-dietoksi-2-metilbutāns | | 10013 | | 06.057 | 2-metilbutanāla dietilacetāls | | |

06.058 | 02 | 1741–41–9 | 1,1-dietoksi-2-metilpropāns | | 10015 | 217–107–5 | 06.058 | izobutanāla dietilacetāls; 2-metilpropanāla dietilacetāls | | |

06.059 | 02 | 3842–03–3 | 1,1-dietoksi-3-metilbutāns | | 10014 | 223–335–6 | 06.059 | izovaleraldehīda dietilacetāls; 3-metilbutanāla dietilacetāls | | |

06.060 | 03 | 10602–34–3 | 1,1-dietoksibut-2 ēns | | | 234–224–7 | 06.060 | 2-butenāla dietilacetāls | | |

06.061 | 01 | 3658–95–5 | 1,1-dietoksibutāns | | 10009 | 222–913–5 | 06.061 | butanāla dietilacetāls | | |

06.062 | 01 | 53405–98–4 | 1,1-dietoksidodekāns | | | 258–541–5 | 06.062 | dodekanāla dietilacetāls | | |

06.063 | 04 | 73545–18–3 | 1,1-dietoksiheks-3 ēns | | | 277–532–7 | 06.063 | 3-heksenāla dietilacetāls | | 5 |

06.064 | 01 | 462–95–3 | dietoksimetāns | | 10012 | 207–330–6 | 06.064 | formaldehīda dietilacetāls | | |

06.065 | 01 | 54815–13–3 | 1,1-dietoksinonāns | | 10016 | 259–360–4 | 06.065 | nonanāla dietilacetāls | | |

06.066 | 01 | 54889–48–4 | 1,1-dietoksioktāns | | | 259–385–0 | 06.066 | oktanāla dietilacetāls | | |

06.067 | 01 | 3658–79–5 | 1,1-dietoksipentāns | | 10017 | 222–909–3 | 06.067 | valeraldehīda dietilacetāls; pentanāla dietilacetāls | | |

06.068 | 03 | 3054–95–3 | 1,1-dietoksiprop-2 ēns | | 10020 | 221–276–0 | 06.068 | 2-propenāla dietilacetāls | | |

06.069 | 01 | 4744–08–5 | 1,1-dietoksipropāns | | 10018 | 225–257–8 | 06.069 | propanāla dietilacetāls | | |

06.070 | 01 | 53405–97–3 | 1,1-dietoksiundekāns | | | 258–539–4 | 06.070 | undekanāla dietilacetāls | | |

06.071 | 01 | 5405–58–3 | 1,1-diheksiloksietāns | | 10022 | 226–458–3 | 06.071 | acetaldehīda dietilacetāls | | |

06.072 | 03 | 18318–83–7 | 1,1-dimetoksiheks-2-( trans)-ēns | | | 242–204–4 | 06.072 | trans- 2-heksenāla dimetilacetāls | | |

06.073 | 01 | 1599–47–9 | 1,1-dimetoksiheksāns | | | 216–488–5 | 06.073 | heksanāla dimetilacetāls | | |

06.074 | 01 | 109–87–5 | dimetoksimetāns | | 10031 | 203–714–2 | 06.074 | formaldehīda dimetilacetāls; metilāls | | |

06.075 | 01 | 26450–58–8 | 1,1-dimetoksipentāns | | | 247–716–1 | 06.075 | pentanāla dimetilacetāls | | |

06.076 | 01 | 4744–10–9 | 1,1-dimetoksipropāns | | | 225–258–3 | 06.076 | propanāla dimetilacetāls | | |

06.077 | 01 | 3390–12–3 | 2,4-dimetil-1,3-dioksolāns | | | 222–221–3 | 06.077 | | | |

06.078 | 15 | 122–71–4 | 1,1-difenetoksietāns | | | 204–568–2 | 06.078 | acetaldehīda difenetilacetāls | | |

06.079 | 01 | 13602–09–0 | 1-etoksi-1-(2-metilbutoksi)etāns | | 10040 | | 06.079 | acetaldehīda etil-2-metilbutilacetāls | | |

06.080 | 15 | 2556–10–7 | 1-etoksi-1-(2-feniletoksi)etāns | | 10049 | 219–868–9 | 06.080 | acetaldehīda etil-2-feniletilacetāls | | |

06.081 | 04 | 28069–74–1 | 1-etoksi-1-(3-hekseniloksi)etāns | 3775 | 10034 | 248–817–3 | 06.081 | etil- cis- 3-heksenilacetāls; acetaldehīda etil-3-heksenilacetāls | | 5 |

06.082 | 01 | 54484–73–0 | 1-etoksi-1-heksiloksietāns | | 11948 | 259–184–8 | 06.082 | acetaldehīda etilheksilacetāls; 1-(1-etoksietoksi)heksāns | | |

06.083 | 01 | 13442–90–5 | 1-etoksi-1-izopentiloksietāns | | 10037 | 236–581–4 | 06.083 | acetaldehīda etil-3-metilbutilacetāls | 1-etoksi-1-(3-metilbutoksi)etāns | |

06.084 | 01 | 10471–14–4 | 1-etoksi-1-metoksietāns | | 10039 | 233–959–0 | 06.084 | acetaldehīda etilmetilacetāls | | |

06.085 | 01 | 59184–43–9 | 1-etoksi-1-pentiloksietāns | | 10046 | | 06.085 | acetaldehīda etilamilacetāls; acetaldehīda etilpentilacetāls | | |

06.086 | 01 | 20680–10–8 | 1-etoksi-1-propoksietāns | | 10050 | 243–963–4 | 06.086 | acetaldehīda etilpropilacetāls | | |

06.087 | 10 | 6290–17–1 | etil-2,4-dimetil-1,3-dioksolān-2-acetāts | | | 228–536–2 | 06.087 | etilacetoacetāta propilēnglikolketāls | | |

06.088 | 01 | 4359–46–0 | 2-etil-4-metil-1,3-dioksolāns | | | 224–435–2 | 06.088 | | | |

06.089 | 01 | 6454–22–4 | 2-heksil-4,5-dimetil-1,3-dioksolāns | | | 229–261–0 | 06.089 | | | |

06.090 | 09 | 3674–21–3 | 4-hidroksimetil-2-metil-1,3-dioksolāns | | | | 06.090 | | | |

06.091 | 01 | 6986–51–2 | 1-izobutoksi-1-etoksietāns | | 10054 | 230–251–3 | 06.091 | acetaldehīda etilizobutilacetāls | 1-etoksi-1-(2-metilpropoksi)etāns | |

06.092 | 01 | 75048–15–6 | 1-izobutoksi-1-izopentiloksietāns | | 10059 | 278–063–0 | 06.092 | acetaldehīda izobutilizoamilacetāls; acetaldehīda izobutil-3-metilbutilacetāls | 1-(3-metilbutoksi)-1-(2-metilpropoksi)etāns | |

06.093 | 02 | 67879–60–1 | 2-izopropil-4-metil-1,3-dioksolāns | | | 267–550–3 | 06.093 | | | |

06.094 | 01 | 1599–49–1 | 4-metil-2-pentil-1,3-dioksolāns | 3630 | | 247–807–6 | 06.094 | | | |

06.095 | 01 | 4352–99–2 | 4-metil-2-propil-1,3-dioksolāns | | | 224–420–0 | 06.095 | | | |

06.096 | 01 | 122–51–0 | trietoksimetāns | | 10903 | 204–550–4 | 06.096 | trietilortoformiāts; etilortoformiāts | | |

06.097 | 09 | 7789–92–6 | 1,1,3-trietoksipropāns | | 10075 | 232–193–4 | 06.097 | 3-etoksipropanāla dietilacetāls | | |

06.098 | 05 | 1193–11–9 | 2,2,4-trimetil-1,3-dioksolāns | 3441 | 11423 | 214–766–0 | 06.098 | | | |

06.099 | 23 | 4359–31–3 | vanilīna butilēnglikolacetāls | | | | 06.099 | 4-hidroksi-3-metoksibenzaldehīda 2,3-butāndiilacetāls | 4-etil-2-(4-hidroksi-3-metoksifenil)- 1,3-dioksolāns | |

06.100 | 01 | 13002–08–9 | acetaldehīda dipentilacetāts | | 10032 | 235–838–8 | 06.100 | | | |

06.102 | 09 | 1708–36–7 | 2-heksil-5-hidroksi-1,3-dioksāns | | 2016 | 216–961–6 | 06.102 | | | |

06.104 | 23 | 68527–74–2 | vanilīna propilēnglikolacetāls | 3905 | | | 06.104 | 4-etil-2-(4-hidroksi-3-metoksifenil)- 1,3-dioksolāns | | |

06.105 | 02 | 13285–51–3 | 3-metil-1,1-diizopentiloksibutāns | | 10070 | | 06.105 | izovaleraldehīda diizoamilacetāls; 3-metilbutanāla di-(3-metilbutil)acetāls | 3-metil-1,1-di-(3-metilbutoksi)butāns | |

06.106 | 02 | 13112–63–5 | 2-metil-1,1-diizopentiloksipropāns | | 10071 | | 06.106 | | 2-metil-1,1-di-(3-metilbutoksi)propāns | |

06.107 | 01 | 13548–84–0 | 1-(2-metilbutoksi)-1-izopentiloksietāns | | 10068 | | 06.107 | metilbutilacetāls | 1-(2-metilbutoksi)-1-(3-metilbutoksi)etāns | |

06.108 | 23 | | anīsaldehīda butān-2,3-diolacetāls | | | | 06.108 | | 4,5-dimetil-2-(4-metoksifenil)-1,3 -dioksolāns | |

06.109 | 04 | | 1,1-dietoksi-3,7-dimetilokt-6-ēns | | | | 06.109 | citronelāla dietilacetāls; 3,7-dimetil-6-oktenāla dietilacetāls | | |

06.110 | 01 | | 1-etoksi-1-izopentiloksiheksāns | | | | 06.110 | heksanāla etil-3-metilbutilacetāls | 1-etoksi-1-(3-metilbutoksi)heksāns | |

06.111 | 01 | | 1-etoksi-1-metoksipropāns | | | | 06.111 | propanāla etilmetilacetāls | | |

06.112 | 01 | | 1-etoksi-1-propoksiheksāns | | | | 06.112 | heksanāla etilpropilacetāls | | |

06.113 | 23 | | heliotropīna butān-2,3-diolacetāls | | | | 06.113 | piperonāla butān-2,3-diolacetāls | 4,5-dimetil-2-(3,4-metilēndioksifenil)- 1,3-dioksolāns | |

06.114 | 01 | | 1-heksiloksi-1-izopentiloksietāns | | | | 06.114 | acetaldehīda heksilizoamilacetāls; acetaldehīda heksil-3-metilbutilacetāls | 1-heksoksi-1-(3-metilbutoksi)etāns | |

06.115 | 01 | | 1-izopentiloksi-1-pentiloksietāns | | | | 06.115 | acetaldehīda 3-metilbutilpentilacetāls | 1-(3-metilbutoksi)- 1-pentiloksietāns | |

06.120 | 08 | | DL-mentona 1,2-glicerīnketāls | 3808 | | | 06.120 | | | |

06.123 | 01 | | 1-butoksi-1-izopentiloksietāns | | 10004 | | 06.123 | acetaldehīda butilizoamilacetāls | 1-butoksi-1-(3-metilbutoksi)etāns | |

06.124 | 02 | | 1,1-diizobutoksi-3-metilbutāns | | 10024 | | 06.124 | izovaleraldehīda diizobutilacetāls; 3-metilbutanāla diizobutilacetāls | 1,1-di-(2-metilpropoksi)-3-metilbutāns | |

06.125 | 01 | | 1,1-diizobutoksipropāns | | 10027 | | 06.125 | propanāla diizobutilacetāls | 1,1-di-(2-metilpropoksi)propāns | |

06.127 | 01 | | 1-etoksi-1-izopentiloksipropāns | | 10036 | | 06.127 | butanāla etilizoamilacetāls; butanāla etil-3-metilbutilacetāls | 1-etoksi-1-(3-metilbutoksi)propāns | |

06.128 | 01 | | 1-etoksi-1-pentiloksibutāns | | 10045 | | 06.128 | butanāla etilamilacetāls; 2,3-butilēnglikols; dimetiletilēnglikols | | |

06.129 | 02 | | 1-etoksi-1-metil-1-izopentiloksipropāns | | 10043 | | 06.129 | izobutanāla etilizoamilacetāls; 2-metilpropanāla etil-3-metilbutilacetāls | 1-etoksi-2-metil-1-(3-metilbutoksi)butāns | |

06.130 | 02 | | 1-etoksi-2-metil-1-propoksipropāns | | 10044 | | 06.130 | izobutanāla etilpropilacetāls; 2-metilpropanāla etilpropilacetāls | | |

06.131 | 02 | | 1-etoksi-3-metil-1-izopentiloksibutāns | | 10042 | | 06.131 | izovaleraldehīda etilizoamilacetāls; 3-metilbutanāla etil-3-metilbutilacetāls | 1-etoksi-3-metil-1-(3-metilbutoksi)butāns | |

07.001 | 09 | 78–98–8 | 2-oksopropanāls | 2969 | 105 | 201–164–8 | 07.001 | piruvaldehīds; 2-ketopropionaldehīds; acetilformaldehīds; metilglioksāls; piruvskābes aldehīds; propān-2-on-1-āls | | |

07.002 | 05 | 110–43–0 | heptān-2-ons | 2544 | 136 | 203–767–1 | 07.002 | C-7 ketons; metilamilketons; amilmetilketons | | |

07.003 | 05 | 106–35–4 | heptān-3-ons | 2545 | 137 | 203–388–1 | 07.003 | etilbutilketons; butiletilketons | | |

07.004 | 21 | 98–86–2 | acetofenons | 2009 | 138 | 202–708–7 | 07.004 | metilfenilketons; acetilbenzols; benzoilmetīds; fenilmetilketons | | |

07.005 | 21 | 122–48–5 | vanililacetons | 3124 | 139 | 204–548–3 | 07.005 | zingerons; 3-metoksi-4-hidroksibenzilacetons; 2-etilmetilketons; 3-metoksi-4-metoksibenzilacetons; vanililacetons | 4-(4-hidroksi-3-metoksifenil)butān-2-ols | |

07.006 | 08 | 76–22–2 | d-kampars | 2230 | 140 | 200–945–0 | 07.006 | 2-kamfanons; 2-bornanons; 2-keto-1,7,7-trimetilnorkamfāns; 1,7,7-trimetilbiciklo[2.2.1]- 2-heptanons | DL-bornān-2-ons | 5 |

07.007 | 08 | 127–41–3 | α-jonons | 2594 | 141 | 204–841–6 | 07.007 | | 4-(2,6,6-trimetil-2-cikloheksēn-1-il)- 3-butēn-2-ons | |

07.008 | 08 | 14901–07–6 | β-jonons | 2595 | 142 | 238–969–9 | 07.008 | β-irisons; 4-(2,6,6-trimetil-1-cikloheksēn-1-il)- 3-butēn-2-ons; β-ciklocitrilidenacetons | 4-(2,6,6-trimetilcikloheks-1-enil)but-3-ēn-2-ons | 5 |

07.009 | 08 | 7779–30–8 | metil-α-jonons | 2711 | 143 | 204–842–1 | 07.009 | α-cetons; 5-(2,6,6-trimetil-2-cikloheksēn-1-il)- 4-pentēn-3-ons raldeīns; α-ciklocitrilidēnmetiletilketons | 1-(2,6,6-trimetilcikloheks-2-enil)pent-1-ēn-3-ons | |

07.010 | 08 | 127–43–5 | metil-β-jonons | 2712 | 144 | 204–843–7 | 07.010 | 5-(2,6,6-trimetil-1-cikloheksēn-1-il)- 4-pentēn-3-ons; raldeīns; β-ciklocitrilidenbutanons; β-metiljonons; β-iraldeins | 1-(2,6,6-trimetilcikloheks-1-enil)pent-1-ēn-3-ons | |

07.011 | 08 | 79–69–6 | 4-(2,5,6,6-tetrametil-2-cikloheksenil)-3-butēn-2-ons | 2597 | 145 | 201–219–6 | 07.011 | α-irons; 6-metiljonons; 4-(2,5,6,6-tetrametil-2-cikloheksēn-1-il)-3-butēn-2-ons | | |

07.012 | 08 | 99–49–0 | karvons | 2249 | 146 | 202–759–5 | 07.012 | karvols; 1-metil-4-izopropenil-6-cikloheksēn-2-ons | p-menta-1,8-diēn-2-ons | |

07.013 | 21 | 93–08–3 | metil-2-naftilketons | 2723 | 147 | 202–216–2 | 07.013 | 2-acetonaftons; 2-acetilnaftalīns; apelsīnkoka kristāli; β-metilnaftilketons; β-acetonaftons | | |

07.014 | 12 | 118–71–8 | maltols | 2656 | 148 | 204–271–8 | 07.014 | veltols (Ficera); Corps praline; 4H-pirān-4-ons, 3-hidroksi-2-metil-; 3-hidroksi-2-metil-(1,4-pirāns); 2-metilpiromekonskābe | 3-hidroksi-2-metil-4-pirons | |

07.015 | 05 | 110–93–0 | 6-metilhept-5-ēn-2-ons | 2707 | 149 | 203–816–7 | 07.015 | metilheptenons; 2-metil-2-heptēn-6-ons; 2-metilheptenons; metilheksenilketons | | |

07.016 | 05 | 112–12–9 | undekān-2-ons | 3093 | 150 | 203–937–5 | 07.016 | metilnonilketons; 2-hendekanons; undekanons-2; 2-oksoundekāns; nonilmetilketons | | |

07.017 | 05 | 108–10–1 | 4-metilpentān-2-ons | 2731 | 151 | 203–550–1 | 07.017 | metilizobutilketons; izobutilmetilketons; izopropilacetons; izoheksanons; heksons | | |

07.018 | 10 | 3848–24–6 | heksān-2,3-dions | 2558 | 152 | 223–350–8 | 07.018 | metilpropildiketons; acetilbutirils; acetil-n-butirils | | |

07.019 | 05 | 111–13–7 | oktān-2-ons | 2802 | 153 | 203–837–1 | 07.019 | metilheksilketons; n-heksilmetilketons; heksilmetilketons; oktān-2-ons | | |

07.020 | 05 | 821–55–6 | nonān-2-ons | 2785 | 154 | 212–480–0 | 07.020 | metilheptilketons | | |

07.021 | 10 | 7493–59–6 | undeka-2,3-dions | 3090 | 155 | 231–330–5 | 07.021 | acetilnonanils; acetilnonanoils; acetilpelargonils | | |

07.022 | 21 | 122–00–9 | 4-metilacetofenons | 2677 | 156 | 204–514–8 | 07.022 | p-metilacetofenons; metil- p-tolilketons; 1-acetil-4-metilbenzols; 1-metil-4-acetilbenzols | | |

07.023 | 21 | 89–74–7 | 2,4-dimetilacetofenons | 2387 | 157 | 201–935–9 | 07.023 | acetil- m-ksilols; metil-2,4-dimetilfenilketons | | |

07.024 | 21 | 122–57–6 | 4-fenilbut-3-ēn-2-ons | 2881 | 158 | 204–555–1 | 07.024 | benzilidēnacetons; cinamilmetilketons; metilstirilketons; acetocinamons; benzālacetons | | |

07.025 | 21 | 5349–62–2 | 4-metil-1-fenilpentān-2-ons | 2740 | 159 | 226–316–0 | 07.025 | benzilizobutilketons; izobutilbenzilketons | | |

07.026 | 21 | 7774–79–0 | 4-( p-tolil)butān-2-ons | 3074 | 160 | | 07.026 | | 4-(4-metilfenil)butān-2-ons | |

07.027 | 21 | 1901–26–4 | 3-metil-4-fenilbut-3-ēn-2-ons | 2734 | 161 | 217–599–1 | 07.027 | benzilidēnmetilacetons; 1-metil-1-benzilidēnacetons; 3-benzilidēn-2-butanons; α-metil-α-benzālaceotns | | |

07.028 | 21 | 119–53–9 | benzoīns | 2132 | 162 | 204–331–3 | 07.028 | benzoilfenilkarbinols; α-hidroksi-α-fenilacetofenons; 2-hidroksi-1, 2-difeniletāns | 2-hidroksi-2-fenilacetofenons | |

07.029 | 21 | 104–20–1 | 4-(4-metoksifenil)butān-2-ons | 2672 | 163 | 203–184–2 | 07.029 | anizilacetons; p-metoksifenilbutanons; 2-butanons, 4-(4-metoksimetil)-; aveņu ketons; metiloksanons; p-metoksibenzilacetons | | |

07.030 | 21 | 104–27–8 | 1-(4-metoksifenil)pent-1-ēn-3-ons | 2673 | 164 | 203–190–5 | 07.030 | etons; α-metilanizalacetons; α-metilanizilidenacetons; p-metoksistiriletilketons | | |

07.031 | 21 | 55418–52–5 | piperonilacetons | 2701 | 165 | 259–630–1 | 07.031 | 2-butanons, 4-(1,3-benzdioksol-5-il)-; dulcinils; heliotropilacetons | 4-(3,4-metilēndioksifenil)butān-2-ons | |

07.032 | 21 | 119–61–9 | benzofenons | 2134 | 166 | 204–337–6 | 07.032 | benzoilbenzols; difenilketons; difenilmetanons; α-oksodifenilmetans | | |

07.033 | 08 | 95–41–0 | izožasmons | 3552 | 167 | 202–417–5 | 07.033 | | 2-heksilciklopent-2-ēn-1-ons un 2-heksilidēnciklopentanons | 5 |

07.034 | 08 | 17373–89–6 | 2-heksilidēnciklopentān-1-ons | 2573 | 167 | 241–411–7 | 07.034 | α-heksilidenciklopentanons | | 5 |

07.035 | 08 | 17369–60–7 | tetrametiletilcikloheksenons (izomēru maisījums) | 3061 | 168 | 241–403–3 | 07.035 | | | 5 |

07.036 | 08 | 127–51–5 | α-izometiljonons | 2714 | 169 | 204–846–3 | 07.036 | 4-(2,6,6-trimetil-2-cikloheksēn-1-il)-3-metil-3-butēn-2-ons metil-γ-jonons; izometiljonons; γ-metiljonons | 4-(2,6,6-trimetilcikloheks-2-enil)-3-metilpent-3-ēn-3-ons | |

07.037 | 08 | 1195–79–5 | fenhons | 2479 | 551 | 225–160–0 | 07.037 | d-1, 3,3-trimetil-2-norbornanons; d-1, 3,3-trimetil-2-norkamfanons | | 5 |

07.038 | 21 | 100–06–1 | 4-metoksiacetofenons | 2005 | 570 | 202–815–9 | 07.038 | acetanizols; p-acetilanizols p-acetilanizols | | |

07.039 | 09 | 7786–52–9 | oktān-3-on-1-ols | 2804 | 592 | | 07.039 | 3-okso-1-oktanols; kaproiletanoāts; heksanoiletanoāts; metilolmetilamilketons; 1-hidroksioktān-3-ons | | |

07.040 | 21 | 93–55–0 | 1-fenilpropān-1-ons | 3469 | 599 | 202–257–6 | 07.040 | propiofenons; fenilmetilketons; propionilbenzols | | |

07.041 | 08 | 79–89–0 | β-izometiljonons | | 650 | 201–231–1 | 07.041 | izometil-β-jonons | 3-metil-4-(2,6,6-trimetilcikloheks-1-enil)but-3-ēn-2-ons | |

07.042 | 21 | 645–13–6 | 4-izopropilacetofenons | 2927 | 651 | 211–433–1 | 07.042 | metil- p-izopropilfenilketons; p-acetilkumols; p-propilacetofenons | | |

07.044 | 05 | 625–33–2 | pent-3-ēn-2-ons | 3417 | 666 | 210–888–3 | 07.044 | | | |

07.045 | 08 | 2408–37–9 | 2,2,6-trimetilcikloheksanons | 3473 | 686 | 219–309–9 | 07.045 | | | |

07.046 | 21 | 1080–12–2 | vanililidēnacetons | 3738 | 691 | 214–096–9 | 07.046 | metil-3-metoksi-4-hidroksistirilketons; dihidrozingerons | 4-(4-hidroksi-3-metoksifenil)but-3-ēn-2-ons | |

07.047 | 12 | 4940–11–8 | etilmaltols | 3487 | 692 | 225–582–5 | 07.047 | veltols-plus; 2-etilpiromekonskābe; 3-hidroksi-2-etil-4-pirons; 2-etil-3-ol-4H-pirān-4-ons | 2-etil-3-hidroksi-4-pirons | |

07.048 | 05 | 2497–21–4 | 4-heksēn-3-ons | 3352 | 718 | 219–681–2 | 07.048 | 2-heksēn-4-ons; heks-2-ēn-4-ons; propilēnetilketons | | |

07.049 | 21 | 103–13–9 | 1-(4-metoksifenil)- 4-metilpent-1-ēn-3-ons | 3760 | 719 | | 07.049 | metoksistirilizopropilketons; izopropil-4-metiloksistirilketons | | |

07.050 | 05 | 67–64–1 | acetons | 3326 | 737 | 200–662–2 | 07.050 | propān-2-ons; dimetilketons; 2-oksopropāns; β-ketopropans; piroetiķskābes ēteris | | 1 |

07.051 | 10 | 513–86–0 | 3-hidroksibutān-2-ons | 2008 | 749 | 208–174–1 | 07.051 | acetoīns; AMK; acetilmetilkarbinols; 2,3-butanolons; dimetilketols; 3-hidroksi-2-butanons; γ-hidroksi-β-oksobutans | | |

07.052 | 10 | 431–03–8 | diacetils | 2370 | 752 | 207–069–8 | 07.052 | dimetildiketons; biacetils; 2,3-diketobutāns; 2,3-butāndions; dimetilglioksāls | butān-2,3-dions | |

07.053 | 05 | 78–93–3 | butān-2-ons | 2170 | 753 | 201–159–0 | 07.053 | etilmetilketons; metiletilketons; C-4 ketons | | |

07.054 | 05 | 107–87–9 | pentān-2-ons | 2842 | 754 | 203–528–1 | 07.054 | etilacetons; metilpropilketons; propilmetilketons; pentān-2-ons | | |

07.055 | 21 | 5471–51–2 | 4-( p-hidroksifenil)butān-2-ons | 2588 | 755 | 226–806–4 | 07.055 | p-hidroksibenzilacetons; oksifenalons; frambinons; 1- p-hidroksifenil-3-butanons; p-hidrobenzilacetons; p-hidroksibenzilacetons | | |

07.056 | 30 | 80–71–7 | 3-metilciklopentān-1,2-dions | 2700 | 758 | 201–303–2 | 07.056 | 2-hidroksi-3-metilciklopent-2-ēn-1-ons; metilciklopentenolons; 3-metilciklopentān-1,2-dions; ciklotēns; korilons; 3-metil-2-ciklopentēn-2-ol-1-ons | | |

07.057 | 30 | 21835–01–8 | 3-etilciklopentān-1,2-dions | 3152 | 759 | 244–606–5 | 07.057 | 2-hidroksi-3-etil-2-ciklopentēn-1-ons; etilciklopentenolons; etilciklopentalons; 3-etil-2-ciklopentēn-2-ol-1-ons | | |

07.058 | 05 | 123–19–3 | heptān-4-ons | 2546 | 2034 | 204–608–9 | 07.058 | dipropilketons; butirons | | |

07.059 | 08 | 10458–14–7 | p-mentān-3-ons | 2667 | 2035 | 233–944–9 | 07.059 | 2-izopropil-5-metilcikloheksanons; 4-izopropil-1-metilcikloheksān-3-ons | | |

07.060 | 10 | 600–14–6 | pentān-2,3-dions | 2841 | 2039 | 209–984–8 | 07.060 | acetilpropionils | | |

07.061 | 08 | 79–78–7 | alil-α-jonons | 2033 | 2040 | 201–225–9 | 07.061 | 1-(2,6,6-trimetil-2-cikloheksēn-1-il)- 1,6-heptadiēn-3-ons; alilciklocitrilidēnacetons; α-aliljonons S | 1-(2,6,6-trimetilcikloheks-2-enil)- 1,6-heptadiēn-3-ons | |

07.062 | 05 | 106–68–3 | oktān-3-ons | 2803 | 2042 | 203–423–0 | 07.062 | etilamilketons; amiletilketons | | |

07.063 | 10 | 7493–58–5 | 4-metilpentān-2,3-dions | 2730 | 2043 | 231–328–4 | 07.063 | acetilizobutirils | | |

07.064 | 10 | 96–04–8 | heksān-2,3-dions | 2543 | 2044 | 202–472–5 | 07.064 | acetilpentanoils; acetilvalerils; valerilacetils | | |

07.065 | 10 | 496–77–5 | 5-hidroksioktān-4-ons | 2587 | 2045 | 207–830–4 | 07.065 | butiroīns; 5-oktanol-4-ons | | |

07.067 | 08 | 29606–79–9 | izopulegons | 2964 | 2051 | 249–725–6 | 07.067 | 1-metil-4-izopropenilcikloheksān-3-ons; 1-metil-4-izopropenil-3-cikloheksanons; 1-izopropil-4-metil-2-cikloheksanons | p-ment-8-ēn-8-ons | 5 |

07.069 | 05 | 4433–36–7 | tetrahidropseidojonons | 3059 | 2053 | 224–634–4 | 07.069 | 6,10-dimetil-9-undecēn-2-ons; dihidrogeranilacetons | 6,10-metilundec-9-ēn-2-ons | |

07.070 | 21 | 7492–37–7 | 3-benzilheptān-4-ons | 2146 | 2140 | 231–317–4 | 07.070 | | | |

07.071 | 10 | 5455–24–3 | oktān-4, 5-dions | | 2141 | | 07.071 | dibutirils | | |

07.072 | 05 | 624–42–0 | 6-metilheptān-3-ons | | 2143 | 210–844–3 | 07.072 | izoamiletilketons | | |

07.073 | 05 | 110–12–3 | 5-metilheksān-2-ons | | 2144 | 203–737–8 | 07.073 | izoamilmetilketons | | |

07.075 | 30 | 13494–06–9 | 3,4-dimetilciklopentān-1,2-dions | 3268 | 2234 | 236–810–8 | 07.075 | 2-hidroksi-3,4-dimetil-2-ciklopentēn-1-ons | | |

07.076 | 30 | 13494–07–0 | 3,5-dimetilciklopentān-1,2-dions | 3269 | 2235 | 236–811–3 | 07.076 | | | |

07.077 | 10 | 4437–51–8 | heksān-3, 4-dions | 3168 | 2255 | 224–651–7 | 07.077 | dipropionils; 3,4-dioksoheksāns; dietil-α,β-diketons | | |

07.078 | 08 | 491–07–6 | DL-izomentons | 3460 | 2259 | 207–727–4 | 07.078 | cis-1-metil-4-izopropil-3-cikloheksanons; cis- p-mentān-3-ons | cis- p-mentān-3-ons | |

07.079 | 30 | 579–07–7 | 1-fenilpropān-1,2-dions | 3226 | 2275 | 209–435–2 | 07.079 | acetilbenzoils; metilfenildiketons; metilfenilglioksāls; fenilmetildiketons | | |

07.080 | 30 | 3008–43–3 | 3-metilcikloheksān-1,2-dions | 3305 | 2311 | 221–122–2 | 07.080 | 3-metil-1,2-cikloheksāndions; 2-metil-3,4-cikloheksāndions | | |

07.081 | 05 | 4312–99–6 | okt-1-ēn-3-ons | 3515 | 2312 | 224–327–5 | 07.081 | vinilamilketons; amilvinilketons | | |

07.082 | 05 | 4643–27–0 | okt-2-ēn-4-ons | 3603 | 2313 | 225–071–7 | 07.082 | butilpropenilketons; propenilbutilketons | | |

07.083 | 08 | 23726–92–3 | β-damaskons | 3243 | 2340 | 245–843–7 | 07.083 | | 1-(2,6,6-trimetilcikloheks-1-enil)but-2-ēn-1-ons | 5 |

07.084 | 05 | 96–22–0 | pentān-3-ons | | 2350 | 202–490–3 | 07.084 | dimetilacetons; dietilketons; dimetilacetons; propions; metacetons | | |

07.086 | 21 | 102–04–5 | 1,3-difenilpropān-2-ons | 2397 | 11839 | 203–000–0 | 07.086 | dibenzilketons; α,α-difenilketons; benzilketons | | |

07.087 | 21 | 122–84–9 | 4-metoksifenilacetons | 2674 | 11836 | 204–578–7 | 07.087 | anizilmetilketons; 3-(4-metoksifenil)propān-2-ons; p-metoksifenilacetons; anīsketons; anīsskābes ketons | | |

07.088 | 08 | 7784–98–7 | metil-δ-jonons | 2713 | 11852 | 232–074–7 | 07.088 | 5-(2,6,6-trimetil-3-cikloheksēn-1-il)- 4-pentēn-3-ons | 1-(2,6,6-trimetilcikloheks-3-enil)pent-1-ēn-3-ons | |

07.089 | 08 | 4674–50–4 | nūtkatons | 3166 | 11164 | 225–124–4 | 07.089 | 5,6-dimetil-8-izopropenilbiciklo[4.4.0]dec-1-ēn-3-ons 4,4a,5,6,7,8-heksahidro-6-izopropenil-4,4a-dimetil-2(3H)-naftalīns | 4,4a,5,6,7,8-heksahidro-4,4a-dimetil-6-(1-metilēnetil)- 2(3H)-naftalinons | |

07.090 | 09 | 5077–67–8 | 1-hidroksibutān-2-ons | 3173 | 11102 | 225–790–6 | 07.090 | 2-okso-1-butanols; propionilkarbinols; etilhidroksimetilketons; 1-butanol-2-ons | | |

07.091 | 08 | 79–76–5 | γ-jonons | 3175 | | 201–223–8 | 07.091 | 4-(2,2-dimetil-6-metilēncikloheksil)- 3-butēn-2-ons; 4-(2-metilēn-6, 6-dimetilcikloheksil)- 3-butēn-2-ons | 4-(2,2-dimetil-6-metilēncikloheksil)but-3-ēn-2-ons | |

07.092 | 08 | 499–70–7 | p-mentān-2-ons | 3176 | 11128 | 207–887–5 | 07.092 | karvomentons; tetrahidromentons; tetrahidrokarvons | | |

07.093 | 10 | 13706–86–0 | 5-metilheksān-2,3-dions | 3190 | 11148 | 237–241–8 | 07.093 | 2-metil-4, 5-heksāndions; acetilizovalerils; izobutilmetildiketons; izobutilmetilglioksāls | | |

07.094 | 08 | 488–10–8 | 3-metil-2-(pent-2-( cis)-enil)ciklopent-2-ēn-1-ons | 3196 | 11786 | 207–668–4 | 07.094 | cis-jasmons | | 5 |

07.095 | 08 | 14765–30–1 | 2-( sek-butil)cikloheksanons | 3261 | 11044 | 238–830–2 | 07.095 | 2-but-2-ilcikloheksanons | 2-(1-metilpropil)cikloheksanons | |

07.096 | 05 | 589–38–8 | heksān-3-ons | 3290 | 11097 | 209–645–4 | 07.096 | etilpropilketons | | |

07.097 | 10 | 59191–78–5 | 3-(hidroksimetil)oktān-2-ons | 3292 | 11113 | 261–652–1 | 07.097 | | | |

07.098 | 08 | 1193–18–6 | 3-metilcikloheks-2-ēn-1-ons | 3360 | 11134 | 214–769–7 | 07.098 | 1-metil-1-cikloheksenons-3 | | |

07.099 | 05 | 1604–28–0 | 6-metilhepta-3,5-diēn-2-ons | 3363 | 11143 | 216–507–7 | 07.099 | 2-metilhepta-2,4-diēn-6-ons; metilheptadienons | | |

07.100 | 05 | 3240–09–3 | 5-metilheks-5-ēn-2-ons | 3365 | 11150 | 221–807–6 | 07.100 | 2-metilalilacetons; 2-metil-1-heksēn-5-ons; 2-metilalilacetons | | |

07.101 | 05 | 141–79–7 | 4-metilpent-3-ēn-2-ons | 3368 | 11853 | 205–502–5 | 07.101 | mezitiloksīds; metilizobutenilketons; izopropilidēnacetons | | |

07.102 | 05 | 1629–58–9 | pent-1-ēn-3-ons | 3382 | 11179 | 216–624–3 | 07.102 | etilvinilketons | | |

07.103 | 05 | 593–08–8 | tridekān-2-ons | 3388 | 11194 | 209–784–0 | 07.103 | metilundecilketons; hendecilmetilketons | | |

07.104 | 05 | 4643–25–8 | hept-2-ēn-4-ons | 3399 | 11093 | 225–070–1 | 07.104 | | | |

07.105 | 05 | 1119–44–4 | hept-3-ēn-2-ons | 3400 | 11094 | 214–278–8 | 07.105 | metilpentenilketons; butilidēnacetons; n-butilidēnacetons | | |

07.106 | 05 | 5166–53–0 | 5-metilheks-3-ēn-2-ons | 3409 | 11149 | 225–950–5 | 07.106 | izobutilidēnacetons | | |

07.107 | 05 | 1669–44–9 | okt-3-ēn-2-ons | 3416 | 11170 | 216–793–3 | 07.107 | | | |

07.108 | 08 | 23696–85–7 | β-damascenons | 3420 | 11197 | 245–833–2 | 07.108 | 4-(2,6,6-trimetilcikloheksa-1,3-dienil)but-2-ēn-4-ons | 1-(2,6,6-trimetilcikloheksa-1,3-dienil)but-2-ēn-1-ons | |

07.109 | 30 | 1125–21–9 | 2,6,6-trimetilcikloheks-2-ēn-1, 4-dions | 3421 | 11200 | 214–406–2 | 07.109 | 3,5,5-trimetilcikloheks-2-ēn-1, 4-dions; 2-cikloheksēndions-1,4,3,5,5-trimetil- | | |

07.110 | 08 | 542–46–1 | cikloheptadec-9-ēn-1-ons | 3425 | 11744 | 208–813–4 | 07.110 | civetons | | 5 |

07.111 | 08 | 541–91–3 | 3-metilciklopentadekān-1-ons | 3434 | 11135 | 208–795–8 | 07.111 | muskons; metileksaltons | | |

07.112 | 08 | 2758–18–1 | 3-metil-2-ciklopentēn-1-ons | 3435 | 11137 | 220–421–5 | 07.112 | 1-metil-1-ciklopentēn-3-ons | | |

07.113 | 05 | 925–78–0 | nonān-3-ons | 3440 | 11160 | 213–125–2 | 07.113 | etilheksilketons | | |

07.114 | 05 | 762–29–8 | 6,10,14-trimetilpentadeka-5,9,13-triēn-2-ons | 3442 | 11206 | 212–097–9 | 07.114 | farnezilacetons; 2,6,10-trimetil-2,6,10-pentadekatriēn-14-ons; 6,10,14-trimetil-5,9,13-pentadekatriēn-2-ons | | |

07.115 | 08 | 20483–36–7 | 3,4-dehidrodihidro-β-jonons | 3447 | 11057 | 243–847–3 | 07.115 | dehidrodihidrojonons; 4-(2,6,6-trimetilcikloheksadiēn-1-il)-2-butanons | 4-(2,6,6-trimetil-1,3-cikloheksadienil)butān-2-ons | |

07.116 | 08 | 43219–68–7 | 1-(1,4-dimetilcikloheks-3-ēn-1-il)etān-1-ons | 3449 | 11062 | 256–150–4 | 07.116 | 4-acetil-1,4-dimetilcikloheks-1-ēns | | |

07.117 | 30 | 42348–12–9 | 3-etil-2-hidroksi-4-metilciklopent-2-ēn-1-ons | 3453 | 11077 | 255–767–6 | 07.117 | 3-etil-4-metilciklotēns; etilciklopentenolons; 3-etil-2-ciklopentēn-2-ol-1-ons | | |

07.118 | 30 | 53263–58–4 | 5-etil-2-hidroksi-3-metilciklopent-2-ēn-1-ons | 3454 | 11078 | 258–451–6 | 07.118 | 5-etil-3-metilciklotēns | | |

07.119 | 30 | 10316–66–2 | 2-hidroksicikloheks-2-ēn-1-ons | 3458 | 11046 | | 07.119 | cikloheksān-1,2-dions | | |

07.120 | 30 | 4883–60–7 | 2-hidroksi-3,5,5-trimetilcikloheks-2-ēn-1-ons | 3459 | 11198 | | 07.120 | 3,5,5-trimetilcikloheksān-1,2-dions; 3,5,5-trimetil-1,2-cikloheksāndions | | |

07.121 | 05 | 10519–33–2 | dec-3-ēn-2-ons | 3532 | 11751 | 234–059–0 | 07.121 | heptilidēnacetons; enantilidēnacetons | | |

07.122 | 05 | 108–83–8 | 2,6-dimetilheptān-4-ons | 3537 | 11914 | 203–620–1 | 07.122 | diizobutilketons; izobutilketons; izononanons; izovalerons | | |

07.123 | 05 | 3796–70–1 | geranilacetons | 3542 | 11088 | 223–269–8 | 07.123 | α, β-dihidropseidojonons | 6,10-dimetil-5-( trans),9-undekadiēn-2-ons | |

07.124 | 21 | 118–93–4 | 2-hidroksiacetofenons | 3548 | 11784 | 204–288–0 | 07.124 | etanons, 1-(2-hidroksifenil)-; o-acetilfenols | | |

07.125 | 10 | 3142–66–3 | 3-hidroksipentān-2-ons | 3550 | 11115 | | 07.125 | acetiletilbarbonols | | |

07.126 | 08 | 78–59–1 | 3,5,5-trimetilcikloheks-2-ēn-1-ons | 3553 | 11918 | 201–126–0 | 07.126 | izoforons; izoacetoferons | | |

07.127 | 08 | 491–09–8 | p-menta-1,4(8)-diēn-3-ons | 3560 | 11189 | 207–729–5 | 07.127 | piperitenons; 4-izopropilidēn-1-metil-1-cikloheksēn-3-ons | | |

07.128 | 08 | 7764–50–3 | dihidrokarvons | 3565 | 11703 | 231–857–0 | 07.128 | cis-dihidrokarvons; cis-mentēn-8(9)-ons(2); 1-metil-4-izopropenilcikloheksān-2-ons | p-ment-8(10)-ēn-2-ons | |

07.129 | 08 | 3720–16–9 | 3-metil-5-propilcikloheks-2-ēn-1-ons | 3577 | | 223–069–0 | 07.129 | 1-metil-5-n-propil-1-cikloheksēn-3-ons | | |

07.130 | 08 | 57378–68–4 | δ-damaskons | 3622 | | 260–709–8 | 07.130 | | 1-(2,6,6-trimetilcikloheks-3-enil)but-2-ēn-1-ons | 5 |

07.131 | 08 | 17283–81–7 | dihidro-β-jonons | 3626 | 11060 | 241–318–1 | 07.131 | 4-(2,6,6-trimetil-2-cikloheksenil)butān-2-ons | 4-(2,6,6-trimetilcikloheks-1-enil)butān-2-ons | |

07.132 | 08 | 31499–72–6 | dihidro-α-jonons | 3628 | 11059 | 250–657–4 | 07.132 | | 4-(2,6,6-trimetilcikloheks-2-enil)butān-2-ons | |

07.133 | 21 | 13171–00–1 | 4-acetil-6- terc-butil-1,1-dimetilindāns | 3653 | | 236–114–4 | 07.133 | celestolīds; 4-acetil-1,1-dimetil-6- terc-butilindāns | acetil-6- terc-butil-2, 3-dihidro-1, 1-dimetilindāns | |

07.134 | 08 | 43052–87–5 | α-damaskons | 3659 | 11053 | | 07.134 | 4-(2,6,6-trimetil-2-cikloheksenil)-2-butēn-4-ons | 1-(2,6,6-trimetilcikloheks-2-enil)but-2-ēn-1-ons | 5 |

07.135 | 25 | 28631–86–9 | 2,4-dihidroksiacetofenons | 3662 | 11884 | | 07.135 | 1-etanons | | |

07.136 | 08 | 34545–88–5 | 4,4a,5,6-tetrahidro-7-metilnaftalīn-2(3H)-ons | 3715 | | 252–079–8 | 07.136 | | | |

07.137 | 05 | 2345–28–0 | pentadekān-2-ons | 3724 | 11808 | 219–064–8 | 07.137 | metiltridecilketons | | |

07.138 | 05 | 63759–55–7 | 2-pentilbut-1-ēn-3-ons | 3725 | | 264–448–0 | 07.138 | 3-metilēn-2-oktanons | 3-metilēnoktān-2-ons | |

07.139 | 05 | 81925–81–7 | 5-metilhept-2-ēn-4-ons | 3761 | | | 07.139 | 2-heptēn-4-ons,5-metil- | | |

07.140 | 08 | 1128–08–1 | 3-metil-2-pentilciklopent-2-ēn-1-ons | 3763 | | 214–434–5 | 07.140 | dihidrojasmons; 2-pentil-3-metil-2-ciklopentēn-1-ons; 3-metil-2-(n-pentanil)- 2-ciklopentēn-1-ons | | |

07.142 | 25 | 498–02–2 | acetovanilons | | 11035 | 207–854–5 | 07.142 | | 4-hidroksi-3-metoksiacetofenons | |

07.143 | 08 | 32388–55–9 | acetilcedrēns | | | 251–020–3 | 07.143 | metilcedrenilketons; 1-(2,3,4,7,8,8a-heksahidro-3,6,8,8-tetrametil-1H-3a,7-metanoazulēn-5-il)etān-1-ons | 5-acetil-2,2,4,8-tetrametiltriciklo[5,3.l(3.7).0(l.7)]undec-4(5)-ēns | |

07.144 | 30 | 1670–46–8 | 2-acetilciklopentān-1-ons | | | 216–797–5 | 07.144 | | | |

07.145 | 05 | 78–94–4 | but-3-ēn-2-ons | | 11043 | 201–160–6 | 07.145 | metilvinilketons | | |

07.146 | 08 | 2244–16–8 | d-karvons | 2249 | 146 | 218–827–2 | 07.146 | | d - p-menta-1,8-diēn-2-ons | 5 |

07.147 | 08 | 6485–40–1 | 1-karvons | 2249 | 146 | 229–352–5 | 07.147 | | 1 - p-menta-1,8-diēn-2-ons | 5 |

07.148 | 08 | 108–94–1 | cikloheksanons | 3909 | 11047 | 203–631–1 | 07.148 | cikloheksilketons; heksanons; ketoheksametilēns | | |

07.149 | 08 | 120–92–3 | ciklopentanons | 3910 | 11050 | 204–435–9 | 07.149 | ketociklopentāns; ketopentametilēns | | |

07.150 | 05 | 693–54–9 | dekān-2-ons | | 11055 | 211–752–6 | 07.150 | | | |

07.151 | 05 | 928–80–3 | dekān-3-ons | | 11056 | 213–183–9 | 07.151 | | | |

07.152 | 10 | 51933–13–2 | 3,3-dietoksibutān-2-ons | | | | 07.152 | | | |

07.153 | 08 | 1803–39–0 | 1,10-dihidronūtkatons | 3776 | | | 07.153 | | 1,2,6-trimetil-9-izopropilēnbiciklo[4.4.0]dekān-4-ons | |

07.154 | 25 | 5650–43–1 | 1-(3,5-dimetoksi-4-hidroksifenil)propān-1-ons | | 11106 | | 07.154 | propiosiringons; 3,5-dimetoksi-4-hidroksipropiofenons | | |

07.155 | 08 | 30434–64–1 | 3,4-dimetilciklopent-2-ēn-1-ons | | | 250–199–5 | 07.155 | | | |

07.156 | 05 | 2550–18–7 | 2,6-dimetilokt-6-ēn-3-ons | | | | 07.156 | | | |

07.157 | 05 | 1604–34–8 | 6,10-dimetilundekān-2-ons | | 11068 | 216–509–8 | 07.157 | | | |

07.158 | 05 | 6175–49–1 | dodekān-2-ols | | 11069 | 228–222–5 | 07.158 | | | |

07.159 | 08 | 4695–62–9 | d-fenhons | 2479 | 551 | 225–160–0 | 07.159 | d-1,3,3-trimetil-2-norbornanons; | 1,3,3-trimetilbiciklo[2.2.1]heptān-2-ons | 5 |

07.160 | 05 | 2922–51–2 | heptadekān-2-ons | | 11089 | | 07.160 | metilpentadecilketons | | |

07.161 | 05 | 1629–60–3 | heks-1-ēn-3-ons | | | 216–625–9 | 07.161 | | | |

07.162 | 05 | 109–49–9 | heks-5-ēn-2-ons | | | 203–675–1 | 07.162 | | | |

07.163 | 05 | 591–78–6 | heksān-2-ons | | 11776 | 209–731–1 | 07.163 | | | |

07.164 | 21 | 2478–38–8 | 4-hidroksi-3, 5-dimetoksiacetofenons | | 11105 | 219–610–5 | 07.164 | acetosiringons | | |

07.165 | 10 | 123–42–2 | 4-hidroksi-4-metilpentān-2-ons | | | 204–626–7 | 07.165 | | | |

07.166 | 10 | 590–90–9 | 4-hidroksibutān-2-ons | | 11103 | 209–693–6 | 07.166 | | | |

07.167 | 10 | 4984–85–4 | 4-hidroksiheksān-3-ons | | 11108 | 225–637–3 | 07.167 | | | |

07.168 | 30 | 490–03–9 | 2-hidroksipiperitons | | | 207–704–9 | 07.168 | | 2-hidroksi-ment-1-ēn-3-ons | |

07.169 | 09 | 116–09–6 | 1-hidroksipropān-2-ons | | 11101 | 204–124–8 | 07.169 | hidroksiacetons; acetilkarbinols | | |

07.170 | 32 | 23267–57–4 | β-jonona epoksids | | 11202 | 245–542–0 | 07.170 | | 4-(1,2-epoksi-2,6,6-trimetilcikloheksil)but-3-ēn-2-ons | |

07.171 | 08 | 18358–53–7 | izopinokamfons | | 11125 | 242–228–5 | 07.171 | | 2,6,6-trimetilbiciklo[3.1.1]cikloheptān-3-ons | |

07.172 | 08 | 500–02–7 | 4-izopropilcikloheks-2-ēn-1-ons | 3939 | 11127 | 207–898–5 | 07.172 | kriptons; 4-izopropilcikloheks-2-enons; DL-kriptons | | |

07.173 | 08 | 13215–88–8 | megastigma-4, 5,8-triēn-3-ons | | | 236–187–2 | 07.173 | | 4-(2-butenilidēn)- 3,5,5-trimetilcikloheks-2-ēn-1-ons | |

07.174 | 08 | 67401–27–8 | megastigma-5, 8-diēn-4-ons | | | 266–685–5 | 07.174 | | 3-(2-butenil)- 2,4,4-trimetilcikloheks-2-ēn-1-ons | |

07.175 | 08 | 89–81–6 | p-ment-1-ēn-3-ons | 2910 | 2052 | 201–942–7 | 07.175 | piperitons; α-piperitons; 1-metil-4-izopropil-1-cikloheksēn-3-ons | | |

07.176 | 08 | 89–80–5 | trans-mentons | 2667 | 2035 | 201–941–1 | 07.176 | | trans- p-mentān-3-ons | 5 |

07.177 | 05 | 33046–81–0 | 7-metil-3-oktenons-2 | 3868 | | 251–361–8 | 07.177 | trans-7-metil-3-oktēn-2-ons | | 5 |

07.178 | 05 | 563–80–4 | 3-metilbutān-2-ons | | 11131 | 209–264–3 | 07.178 | 3-metil-1-butenols-2; metilizopropilketons | | |

07.179 | 08 | 583–60–8 | 2-metilcikloheksanons | 3946 | | 209–513–6 | 07.179 | metiljonons | | |

07.180 | 08 | 591–24–2 | 3-metilcikloheksanons | 3947 | | 209–710–7 | 07.180 | | | |

07.181 | 05 | 928–68–7 | 6-metilheptān-2-ons | | 11146 | 213–179–7 | 07.181 | | | |

07.182 | 05 | 541–85–5 | 5-metilheptān-3-ons | | | 208–793–7 | 07.182 | | | |

07.184 | 10 | 113486–29–6 | 3-metilnona-2, 4-dions | | | | 07.184 | | | |

07.185 | 05 | 565–61–7 | 3-metilpentān-2-ons | | 11157 | 209–282–1 | 07.185 | | | |

07.186 | 10 | 815–57–6 | 3-metilpentān-2,4-dions | | | 212–420–3 | 07.186 | | | |

07.187 | 05 | 32064–72–5 | non-2-ēn-4-ons | | 11162 | 250–909–3 | 07.187 | | | |

07.188 | 05 | 14309–57–0 | non-3-ēn-2-ons | 3955 | 11163 | 238–248–9 | 07.188 | | | |

07.189 | 05 | 4485–09–0 | nonān-4-ons | | 11161 | 224–770–4 | 07.189 | | | |

07.190 | 05 | 65213–86–7 | okta-1,5-diēn-3-ons | | | | 07.190 | | | |

07.191 | 10 | 123–54–6 | pentān-2,4-dions | | 11036 | 204–634–0 | 07.191 | acetilacetons | | |

07.192 | 30 | 93–91–4 | 1-fenilbutān-1,3-dions | | 11181 | 202–286–4 | 07.192 | benzoilacetons | | |

07.193 | 21 | 495–40–9 | 1-fenilbutān-1-ons | | | 207–799–7 | 07.193 | | | |

07.194 | 21 | 2550–26–7 | 4-fenilbutān-2-ons | | 11182 | 219–847–4 | 07.194 | | | |

07.195 | 21 | 103–79–7 | 1-fenilpropān-2-ons | | 11042 | 203–144–4 | 07.195 | benzilmetilketons | | |

07.196 | 08 | 80–57–9 | pin-2-ēn-4-ons | | 11186 | 201–292–4 | 07.196 | verbenons | 4,6,6-trimetilbiciklo[3.1.1]hept-3-ēn-2-ons | |

07.197 | 08 | 31375–17–4 | 6-propionil- p - ment-1-ēns | | | 250–600–3 | 07.197 | | 1-( p - ment-1-ēn-6-il)propān-1-ons | |

07.198 | 05 | 141–10–6 | pseidojonons | | 11191 | 205–457–1 | 07.198 | | 6,10-dimetilundeka-3,5,9-triēn-2-ons | |

07.199 | 05 | 2345–27–9 | tetradekān-2-ons | | 11192 | 219–063–2 | 07.199 | | | |

07.200 | 08 | 79–70–9 | 4-(2,5,6,6-tetrametil-1-cikloheksenil)but-3-ēn-2-ons | | | 201–220–1 | 07.200 | β-irons | | |

07.201 | 05 | 60437–21–0 | tridec-12-ēn-2-ons | | | | 07.201 | | | |

07.202 | 08 | 20013–73–4 | 2,6,6-trimetilcikloheks-2-ēn-1-ons | | | 243–465–7 | 07.202 | | | |

07.203 | 08 | 873–94–9 | 3,3,5-trimetilcikloheksān-1-ons | | | 212–855–9 | 07.203 | | | |

07.204 | 05 | 546–49–6 | 3,3,6-trimetilhepta-1,5-diēn-4-ons | | | 208–903–3 | 07.204 | | | |

07.205 | 05 | 502–69–2 | 6,10,14-trimetilpentadekān-2-ons | | 11205 | 207–950–7 | 07.205 | heksahidrofarnezilacetons | | |

07.206 | 21 | 56681–06–2 | 4-(2,3,6-trimetilfenil)but-3-ēn-2-ons | | | | 07.206 | | | |

07.207 | 08 | 3603–99–4 | ciklotetradekanons | | | 222–758–3 | 07.207 | | | |

07.209 | 08 | 21368–68–3 | kampars | 2230 | 140 | 207–355–2 | 07.209 | | | 5 |

07.210 | 05 | 24415–26–7 | 1-nonēn-3-ons | | | | 07.210 | | | |

.214 | 21 | 941–98–0 | α-metilnaftilketons | | | 213–384–1 | .214 | naftilmetilketons; 1-acetonaftons | | |

07.215 | 08 | 464–49–3 | (1R)- 1,7,7-trimetilbiciklo[2.2.1]heptān-2-ons | 2230 | 140 | 207–335–2 | 07.215 | d-kampars | | 5 |

07.216 | 05 | 689–67–8 | 6,10-dimetil-5,9-undekadiēn-2-ons | | | 211–711–2 | 07.216 | | | |

07.218 | 08 | 1335–46–2 | metiljonons | | | 215–635–0 | 07.218 | | | |

07.219 | 08 | 6261–18–3 | trans- 3-metil-2-(2-pentenil)- 2-ciklopentēn-1-ons | 3196 | 11786 | 228–410–7 | 07.219 | trans-jasmons | | 5 |

07.221 | 08 | 11050–62–7 | 2-metil-3-(2-pentenil)-2-ciklopentēn-1-ons | 3552 | | 234–273–4 | 07.221 | | | |

07.222 | 08 | 14073–97–3 | (2S- trans)- 5-metil-2-(1-metiletil)cikloheksanons | 2667 | 2035 | 237–926–1 | 07.222 | 1-mentons | | 5 |

07.224 | 08 | 23726–91–2 | trans- 1-(2,6,6-trimetil-1-cikloheksēn-1-il)but-2-ēn-1-ons | 3243 | 2340 | 245–842–1 | 07.224 | | | 5 |

07.225 | 08 | 23726–94–5 | cis- 1-(2,6,6-trimetil-2-cikloheksēn-1-il)but-2-ēn-1-ons | 3659 | 11053 | 245–845–8 | 07.225 | cis-α-damaskons | | 5 |

07.226 | 08 | 24720–09–0 | trans- 1-(2,6,6-trimetil-2-cikloheksēn-1-il)but-2-ēn-1-ons | | | 246–430–4 | 07.226 | | | |

07.227 | 05 | 68228–05–7 | 6,10-dimetilundekadiēn-2-ons | | | 269–400–2 | 07.227 | | | |

07.231 | 08 | | α-damascenons | | | | 07.231 | | 1-(2,6,6-trimetilcikloheksa-2, 4-dienil)but-2-ēn-1-ons | |

07.234 | 25 | | 5-paradols | | | | 07.234 | | 1-(4-Hydroxy-3 -methoxyphenyl) nonan-3-one | |

07.236 | 05 | 22610–86–2 | 5-oktēn-2-ons | | 11171 | | 07.236 | | | |

07.238 | 10 | 37160–77–3 | 3-hidroksi-2-oktanons | | | | 07.238 | | | |

08.001 | 01 | 64–18–6 | skudrskābe | 2487 | 1 | 200–579–1 | 08.001 | metānskābe | | 1 |

08.002 | 01 | 64–19–7 | etiķskābe | 2006 | 2 | 200–580–7 | 08.002 | etānskābe; etilskābe; metānkarbonskābe | | 1 |

08.003 | 01 | 79–09–4 | propionskābe | 2924 | 3 | 201–176–3 | 08.003 | metiletiķskābe; etilskudrskābe | | 1 |

08.004 | 09 | 598–82–3 | pienskābe | 2611 | 4 | 209–954–4 | 08.004 | α-hidroksipropanskābe | 2-hidroksipropānskābe | 1 |

08.005 | 01 | 107–92–6 | sviestskābe | 2221 | 5 | 203–532–3 | 08.005 | etiletiķskābe; butānskābe; 1-propānkarbonskābe | | |

08.006 | 02 | 79–31–2 | 2-metilpropionskābe | 2222 | 6 | 201–195–7 | 08.006 | izosviestskābe; izopropilskudrskābe sviestskābe, izo- | | |

08.007 | 01 | 109–52–4 | baldriānskābe | 3101 | 7 | 203–677–2 | 08.007 | pentānskābe; propiletiķskābe; baldriānskābe; 1-butānkarbonskābe | | |

08.008 | 02 | 503–74–2 | 3-metilsviestskābe | 3102 | 8 | 207–975–3 | 08.008 | izopentānskābe; beta-metilsviestskābe; delfīnskābe; aktīvā baldriānskābe; β-metilsviestskābe | | |

08.009 | 01 | 142–62–1 | heksānskābe | 2559 | 9 | 205–550–7 | 08.009 | kapronskābe; heksānskābe 2-butiletiķskābe; pentilskudrskābe | | 1 |

08.010 | 01 | 124–07–2 | oktānskābe | 2799 | 10 | 204–677–5 | 08.010 | kaprilskābe; oktilskābe; 1-heptānkarbonskābe | | 1 |

08.011 | 01 | 334–48–5 | dekānskābe | 2364 | 11 | 206–376–4 | 08.011 | kaprīnskābe; decilskābe; 1-nonānkarbonskābe | | |

08.012 | 01 | 143–07–7 | dodekānskābe | 2614 | 12 | 205–582–1 | 08.012 | laurīnskābe; dodekaskābe; laurostearīnskābe | | 1 |

08.013 | 01 | 112–80–1 | oleīnskābe | 2815 | 13 | 204–007–1 | 08.013 | trans-elaidīnskābe | oktadec-9-ēnskābe | 1 |

08.014 | 01 | 57–10–3 | heskadekānskābe | 2832 | 14 | 200–312–9 | 08.014 | palmitīnskābe; heksadecilskābe; cetilskābe; 1-pentadekānkarbonskābe | | 1 |

08.015 | 01 | 57–11–4 | oktadekānskābe | 3035 | 15 | 200–313–4 | 08.015 | stearīnskābe; oktadecilskābe | | |

08.016 | 01 | 544–63–8 | tetradekānskābe | 2764 | 16 | 208–875–2 | 08.016 | miristīnskābe; krodskābe | | 1 |

08.017 | 30 | 6915–15–7 | 1-ābolskābe | 2655 | 17 | 230–022–8 | 08.017 | 2-hidroksi-1,4-butāndiskābe; hidroksidzintarskābe | 2-hidroksibutān-1,4-diskābe | 1, 5 |

08.018 | 30 | 133–37–9 | vīnskābe | 3044 | 18 | 205–105–7 | 08.018 | racemskābe; 2,3-dihidroksidzintarskābe | 2,3-dihidroksibutāndiskābe | 1 |

08.019 | 09 | 127–17–3 | pirovīnogskābe | 2970 | 19 | 204–824–3 | 08.019 | 2-ketopropionskābe; acetilskudrskābe; α-ketopropionskabe; piroracemskābe | 2-oksopropānskābe | |

08.021 | 23 | 65–85–0 | benzoskābe | 2131 | 21 | 200–618–2 | 08.021 | benzolkarbonskābe; fenilskudrskābe; dracilskābe; karboksibenzols; fenilkarbonskābe | | 1 |

08.022 | 22 | 621–82–9 | kanēļskābe | 2288 | 22 | 210–708–3 | 08.022 | terc-β-fenilakrilskabe; 3-fenil-2-propēnskābe; β-fenilakrilskabe; 3-fenilakrilskābe | 3-fenilprop-2-ēnskābe | 1 |

08.023 | 09 | 123–76–2 | 4-oksobaldriānskābe | 2627 | 23 | 204–649–2 | 08.023 | acetopropionskābe; levulīnskābe 4-oksopentānskābe; 3-acetilpropionskābe | | 1 |

08.024 | 09 | 110–15–6 | dzintarskābe | | 24 | 203–740–4 | 08.024 | butān-1,4-diskābe; 1,2-etāndikarbonskābe | butāndiskābe | 1 |

08.025 | 09 | 110–17–8 | fumārskābe | 2488 | 25 | 203–743–0 | 08.025 | allomaleīnskābe; boletskābe; trans-butēndionskābe; trans- 1,2-etilēndikarbonskābe | but-2-( trans)-ēndiskābe | 1 |

08.026 | 09 | 124–04–9 | adipīnskābe | 2011 | 26 | 204–673–3 | 08.026 | 1,4-butāndikarbonskābe | heksāndiskābe | 1 |

08.028 | 01 | 111–14–8 | heptānskābe | 3348 | 28 | 203–838–7 | 08.028 | n-heptānskābe; enantskābe; n-heptilskābe;; | | 1 |

08.029 | 01 | 112–05–0 | nonānskābe | 2784 | 29 | 203–931–2 | 08.029 | pelargonskābe; oktān-1-karbonskābe; nonilskābe; | | |

08.031 | 02 | 97–61–0 | 2-metilbaldriānskābe | 2754 | 31 | 202–594–9 | 08.031 | 2-metilpentānskābe; metilpropiletiķskābe | | |

08.032 | 22 | 501–52–0 | 3-fenilpropionskābe | 2889 | 32 | 207–924–5 | 08.032 | benziletiķskābe; hidrokanēļskābe; β-fenilpropionskabe; dihidrokanēļskābe | | |

08.033 | 30 | 499–12–7 | prop-1-ēn-1,2,3-trikarbonskābe | 2010 | 33 | 207–877–0 | 08.033 | akonītskābe; ahileīnskābe; ekvizetskābe; citronskābe; 2-karboksiglutakonskābe | | |

08.034 | 07 | 5292–21–7 | cikloheksiletiķskābe | 2347 | 34 | 226–132–0 | 08.034 | cikloheksānetiķskābe | | |

08.035 | 02 | 4536–23–6 | 2-metilheksānskābe | 3191 | 582 | 224–883–9 | 08.035 | 2-metilkapronskābe; 2-butilpropānskābe; heksān-2-karbonskābe | | |

08.036 | 04 | 502–47–6 | citronelskābe | 3142 | 616 | 207–939–7 | 08.036 | rodinolskābe; rodīnskābe | 3,7-dimetilokt-6-ēnskābe | |

08.037 | 30 | 328–50–7 | 2-oksoglutārskābe | 3891 | 653 | 206–330–3 | 08.037 | α-ketoglutarskābe; 2-okso-1,5-pentāndiskābe; 2-ketoglutārskābe | 2-oksopentāndiskābe | |

08.038 | 15 | 103–82–2 | feniletiķskābe | 2878 | 672 | 203–148–6 | 08.038 | α-toluilskabe; benzilkarbonskābe | | |

08.039 | 04 | 112–38–9 | undec-10-ēnskābe | 3247 | 689 | 203–965–8 | 08.039 | undecilēnskābe; 10-hendecēnskābe | | |

08.040 | 23 | 99–96–7 | 4-hidroksibenzoskābe | | 693 | 202–804–9 | 08.040 | p-hidroksibenzoskābe | | |

08.041 | 04 | 60–33–3 | oktadeka-9,12-diēnskābe | 3380 | 694 | 200–470–9 | 08.041 | linolskābe; linolskābe un linolēnskābe | | 1, 5 |

08.042 | 01 | 112–37–8 | undekānskābe | 3245 | 696 | 203–964–2 | 08.042 | n-undekskābe; n-undecilskābe; hendekānskābe | | |

08.043 | 23 | 121–34–6 | vanilīnskābe | | 697 | 204–466–8 | 08.043 | 4-hidroksi-3-metoksibenzoskābe | 4-hidroksi-3-metoksibenzoskābe | |

08.044 | 03 | 21016–46–6 | 2,4-dimetilpent-2-ēnskābe | 3143 | 744 | | 08.044 | | | |

08.045 | 02 | 88–09–5 | 2-etilsviestskābe | 2429 | 2001 | 201–796–4 | 08.045 | α-etilsviestskabe; dietiletiķskābe | | |

08.046 | 02 | 116–53–0 | 2-metilsviestskābe | 2695 | 2002 | 204–145–2 | 08.046 | metiletiletiķskābe; butān-2-karbonskābe | | |

08.047 | 02 | 1188–02–9 | 2-metilheptānskābe | 2706 | 2003 | 214–704–2 | 08.047 | 2-metilenantskābe; metilamiletiķskābe; izokaprilskābe; izooktānskābe | | |

08.048 | 04 | 591–80–0 | pent-4-ēnskābe | 2843 | 2004 | 209–732–7 | 08.048 | aliletiķskābe | | |

08.049 | 15 | 122–59–8 | fenoksietiķskābe | 2872 | 2005 | 204–556–7 | 08.049 | glikolskābes fenilēteris; fenoksietānskābe; o-fenilglikolskābe | | |

08.050 | 04 | 4219–24–3 | heks-3-ēnskābe | 3170 | 2256 | 224–157–1 | 08.050 | | | |

08.051 | 09 | 759–05–7 | 3-metil-2-oksisviestskābe | 3869 | 2262 | 212–065–4 | 08.051 | 2-oksoizobaldriānskābe; dimetilpirovīnogskābe | | |

08.052 | 09 | 816–66–0 | 4-metil-2-oksobaldriānskābe | 3871 | 2263 | 212–435–5 | 08.052 | 2-keto-4-metilpentānskābe; 4-metil-2-oksopentānskābe; α-ketoizokapronskabe; izopropilpirovīnogskābe | | |

08.053 | 09 | 141–82–2 | malonskābe | | 2264 | 205–503–0 | 08.053 | metāndikarbonskābe; propāndiskābe; propān-1,3-diskābe | propāndiskābe | 1 |

08.054 | 03 | 13419–69–7 | heks-2-( trans)-ēnskābe | 3169 | 11777 | 236–528–5 | 08.054 | β-propilakrilsābe; 3-propilakrilskābe | | 5 |

08.055 | 03 | 3142–72–1 | 2-metil-2-pentēnskābe | 3195 | 11680 | 241–026–4 | 08.055 | 3-etil-2-metilakrilskābe; 2-pentēn-2-karbonskābe; 2-propilidēnpropionskābe | | |

08.056 | 02 | 105–43–1 | 3-metilbaldriānskābe | 3437 | 10149 | 203–297–7 | 08.056 | sek - butiletiķskābe; 2-metilbutān-1-karbonskābe; β-metilbaldrianskābe | | |

08.057 | 02 | 646–07–1 | 4-metilbaldriānskābe | 3463 | 10150 | 211–464–0 | 08.057 | izoheksānskābe; izokapronskābe; 4-metilpentānskābe | | |

08.058 | 04 | 37674–63–8 | 2-metilpent-3-ēnskābe | 3464 | 10147 | 253–610–6 | 08.058 | | | |

08.059 | 04 | 1575–74–2 | 2-metilpent-4-ēnskābe | 3511 | 10148 | 216–404–7 | 08.059 | | | |

08.060 | 07 | 98–89–5 | cikloheksānkarbonskābe | 3531 | 11911 | 202–711–3 | 08.060 | | | |

08.061 | 02 | 628–46–6 | 5-metilheksānskābe | 3572 | 10142 | | 08.061 | izopentānskābe; izoenantskābe; izoamiletiķskābe | | |

08.062 | 02 | 45019–28–1 | 4-metilnonānskābe | 3574 | 11925 | 256–180–8 | 08.062 | 4-metilpelargonskābe | | |

08.063 | 02 | 54947–74–9 | 4-metiloktānskābe | 3575 | 11926 | 259–404–2 | 08.063 | | | |

08.064 | 03 | 80–59–1 | 2-metilkrotonskābe | 3599 | 10168 | 201–295–0 | 08.064 | tiglīnskābe; 2-metilkrotonskābe; 2-metil-2-butēnskābe; trans- 2,3-dimetilakrilskābe | metilbut-2-( trans)-ēnskābe | 5 |

08.065 | 04 | 14436–32–9 | dec-9-ēnskābe | 3660 | 10090 | 238–410–9 | 08.065 | | | |

08.066 | 09 | 600–18–0 | 2-oksosviestskābe | 3723 | | 209–986–9 | 08.066 | ketosviestskābe; α-ketosviestskabe | | |

08.067 | 07 | 71298–42–5 | 1,2,5,6-tetrahidrokumīnskābe | 3731 | | | 08.067 | 4-izopropil-3-cikloheksēn-1-karbonskābe; 3-cikloheksēn-1-karbonskābe, 1-(1-metiletil)-, (±)- | 1-(4-izopropilcikloheks-3-enil)karbonskābe | |

08.068 | 04 | 72881–27–7 | dec-(5 un 6)-ēnskābe | 3742 | | | 08.068 | | | |

08.070 | 03 | 541–47–9 | 3-metilkrotonskābe | 3187 | 10138 | 208–782–7 | 08.070 | 3,3-dimetilakrilskābe; 3-metilbut-2-ēnskābe; 4,5-dimetilakrilskābe; senēcijskābe | 3-metilbut-2-( trans)-ēnskābe | |

08.071 | 23 | 100–09–4 | p - anīsskābe | 3945 | 10077 | 202–818–5 | 08.071 | 4-anīsskābe; drakonskābe; p - metoksibenzoskābe | 4-metoksibenzoskābe | |

08.072 | 03 | 3724–65–0 | but-2-ēnskābe ( cis un trans) | 3908 | 10080 | 223–077–4 | 08.072 | krotonskābe ( trans) + izokrotonskābe ( cis) | | 5 |

08.073 | 03 | 3913–85–7 | dec-2-ēnskābe | 3913 | 10087 | 223–475–8 | 08.073 | 2-decēnskābe | | 5 |

08.074 | 04 | 15469–77–9 | dec-3-ēnskābe | | 10088 | 239–489–2 | 08.074 | 3-decēnskābe | | |

08.075 | 04 | 26303–90–2 | dec-4-ēnskābe | 3914 | 10089 | 247–599–7 | 08.075 | 4-decēnskābe | | |

08.076 | 23 | 89–86–1 | 2,4-dihidroksibenzoskābe | 3798 | | 201–946–9 | 08.076 | | | |

08.077 | 09 | 4324–38–3 | 3-etoksipropānskābe | | 10096 | 224–357–9 | 08.077 | | | |

08.078 | 02 | 149–57–5 | 2-etilheksānskābe | | | 205–743–6 | 08.078 | | | |

08.079 | 02 | 16493–80–4 | 4-etiloktānskābe | 3800 | | 240–560–5 | 08.079 | | | |

08.080 | 23 | 149–91–7 | gallusskābe | | 10170 | 205–749–9 | 08.080 | 3,4,5-trihidroksibenzoskābe | 3,4,5-trihidroksibenzoskābe | 1 |

08.081 | 03 | 459–80–3 | gerānijskābe | | 10094 | 207–299–9 | 08.081 | 3,7-dimetil-2-( trans),6-oktadiēnskābe 3,7-dimetilokta-2,6-diēnskābe | 3,7-dimetil-2-( trans), 6-oktadiēnskābe | |

08.082 | 09 | 110–94–1 | glutārskābe | | | 203–817–2 | 08.082 | | pentāndiskābe | 1 |

08.083 | 03 | 18999–28–5 | hept-2-ēnskābe | 3277 | 10102 | 242–738–8 | 08.083 | | | 5 |

08.084 | 04 | 29901–85–7 | hept-3-ēnskābe | | 10103 | 249–943–1 | 08.084 | | | |

08.085 | 03 | 110–44–1 | heksa-2,4-diēnskābe | 3921 | | 203–768–7 | 08.085 | | | 5 |

08.086 | 30 | 1113–60–6 | 3-hidroksi-2-oksopropionskābe | 3843 | | | 08.086 | propānskābe, 3-hidroksi-2-okso-; 3-hidroksi-2-oksopropānskābe | | |

08.087 | 23 | 530–57–4 | 4-hidroksi-3,5-dimetoksibenzoskābe | | 10111 | 208–486–8 | 08.087 | ceriņskābe | | |

08.088 | 22 | 530–59–6 | 4-hidroksi-3,5-dimetoksikanēļskābe | | | 208–487–3 | 08.088 | sinapīnskābe | 3-(4-hidroksi-3,5-dimetoksifenil)prop-2-ēnskābe | |

08.089 | 22 | 1135–24–6 | 4-hidroksi-3-metoksikanēļskābe | | 10113 | 214–490–0 | 08.089 | ferulskābe | 3-(4-hidroksi-3-dimetoksifenil)prop-2-ēnskābe | |

08.090 | 09 | 498–36–2 | 2-hidroksi-4-metilbaldriānskābe | | 10118 | 207–860–8 | 08.090 | | | |

08.091 | 04 | 506–32–1 | ikoza-5,8,11,14-tetraēnskābe | | | 208–033–4 | 08.091 | arahidonskābe | | |

08.092 | 23 | 586–38–9 | 3-metoksibenzoskābe | 3944 | | 209–574–9 | 08.092 | m-anīsskābe; 3-anīsskābe | | |

08.093 | 09 | 39748–49–7 | 3-metil-2-oksobaldriānskābe | 3870 | 10146 | 254–616–1 | 08.093 | metiletilpirovīnogskābe; nātrija 3-metil-2-oksopentanoāts | | |

08.094 | 02 | 24323–24–8 | 4-metildekānskābe | | | | 08.094 | | | |

08.095 | 02 | 5601–60–5 | 8-metildekānskābe | | | | 08.095 | | | |

08.096 | 02 | 3780–58–3 | 3-metilheksānskābe | | | | 08.096 | | | |

08.097 | 02 | 1561–11–1 | 4-metilheksānskābe | | | 216–336–8 | 08.097 | | | |

08.099 | 03 | 10321–71–8 | 4-metilpent-2-ēnskābe | | | 233–706–4 | 08.099 | 4-metilpent-2-ēn-1-skābe | | |

08.100 | 04 | 504–85–8 | 4-metilpent-3-ēnskābe | | | | 08.100 | | | |

08.101 | 03 | 3760–11–0 | non-2-ēnskābe | 3954 | 10153 | 223–171–5 | 08.101 | | | 5 |

08.102 | 04 | 4124–88–3 | non-3-ēnskābe | | 10154 | 223–932–1 | 08.102 | | | |

08.103 | 09 | 123–99–9 | nonāndiskābe | | 10079 | 204–669–1 | 08.103 | azelaīnskābe | | |

08.105 | 04 | 1577–19–1 | okt-3-ēnskābe | | 10157 | 216–418–3 | 08.105 | | | |

08.106 | 04 | 463–40–1 | oktadeka-9,12,15-triēnskābe | 3380 | 695 | 207–334–8 | 08.106 | linolēnskābe | | 5 |

08.107 | 03 | 13991–37–2 | pent-2-ēnskābe | | 10163 | 237–791–9 | 08.107 | | | 5 |

08.108 | 22 | 492–37–5 | 2-fenilpropionskābe | | 10164 | 207–752–0 | 08.108 | hidratropskābe | | |

08.109 | 30 | 156–06–9 | 3-fenilpirovīnogskābe | 3892 | | 205–847–1 | 08.109 | 3-fenil-2-oksopropānskābe | 3-okso-3-fenilpropānskābe | |

08.110 | 30 | 88–99–3 | ftalskābe | | | 201–873–2 | 08.110 | o - dikarboksibenzols; o - benzoldikarbonskābe | 1,2-benzoldikarbonskābe | 1 |

08.111 | 30 | 36413–60–2 | hinskābe | | | 253–023–5 | 08.111 | 1,3,4,5-tetrahidroksicikloheksānkarbonskābe | 1,3,4,5-tetrahidroksicikloheksān-1-karbonskābe | |

08.112 | 23 | 69–72–7 | salicilskābe | | 10165 | 200–712–3 | 08.112 | 2-hidroksibenzoskābe | 2-hidroksi-benzoskābe | |

08.113 | 09 | 150–90–3 | dzintarskābe, dinātrija sāls | 3277 | 24 | 203–740–4 | 08.113 | | | 5 |

08.114 | 03 | 1871–67–6 | 2-oktēnskābe | 3957 | 10156 | 216–001–6 | 08.114 | trans-2-oktēnskābe | okt-2-ēnskābe | 5 |

08.115 | 02 | 3302–03–2 | 4-metilheptānskābe | | | | 08.115 | | | |

08.118 | 09 | 110–16–7 | cis-2-butēnskābe | | | 203–742–5 | 08.118 | maleīnskābe | | |

08.119 | 03 | 1191–04–4 | 2-heksēnskābe | 3169 | 11777 | 214–727–8 | 08.119 | | | 5 |

08.120 | 03 | 13201–46–2 | 2-metil-2-butēnskābe | 3599 | 10168 | 236–167–3 | 08.120 | | | 5 |

08.122 | 04 | 1617–32–9 | trans-3-pentēnskābe | | | 216–573–7 | 08.122 | | | |

08.123 | 03 | 10352–88–2 | trans-2-heptēnskābe | 3920 | | 233–769–8 | 08.123 | | | |

08.124 | 04 | 28163–84–0 | trans-3-heptēnskābe | | | 248–876–5 | 08.124 | | | |

08.125 | 04 | 5163–67–7 | trans-3-oktēnskābe | | | 225–941–6 | 08.125 | | | |

08.126 | 03 | 32466–55–0 | trans-2-tridecēnskābe | | | 251–062–2 | 08.126 | | | |

08.128 | 03 | | 2-metilbut-2-( cis)-ēnskābe | | | | 08.128 | angelikskābe | | |

09.001 | 01 | 141–78–6 | etilacetāts | 2414 | 191 | 205–500–4 | 09.001 | etiķskābes etilesteris | | |

09.002 | 01 | 109–60–4 | propilacetāts | 2925 | 192 | 203–686–1 | 09.002 | propiletanoāts | | |

09.003 | 05 | 108–21–4 | izopropilacetāts | 2926 | 193 | 203–561–1 | 09.003 | etiķskābes izopropilesteris | | |

09.004 | 01 | 123–86–4 | butilacetāts | 2174 | 194 | 204–658–1 | 09.004 | butiletanoāts | | |

09.005 | 02 | 110–19–0 | izobutilacetāts | 2175 | 195 | 203–745–1 | 09.005 | etiķskābes izobutilesteris; 2-metil-1-propilacetāts; izo-butilacetāts | 2-metilpropilacetāts | |

09.006 | 01 | 142–92–7 | heksilacetāts | 2565 | 196 | 205–572–1 | 09.006 | heksiletanoāts; 1-acetoksiheksāns | | |

09.007 | 01 | 112–14–1 | oktilacetāts | 2806 | 197 | 203–939–6 | 09.007 | C-8 acetāts; n-oktilacetāts; 2-etilheksilacetāts; oktiletanoāts | | |

09.008 | 01 | 143–13–5 | nonilacetāts | 2788 | 198 | 205–585–8 | 09.008 | C-9 acetāts; pelargonilacetāts; noniletanoāts | | |

09.009 | 01 | 112–17–4 | decilacetāts | 2367 | 199 | 203–942–2 | 09.009 | C-10 acetāts; deciletanoāts; dekanilacetāts; 1-acetoksidekāns; etiķskābes decilesteris; dekanola acetāts | | |

09.010 | 01 | 112–66–3 | dodecilacetāts | 2616 | 200 | 203–995–1 | 09.010 | laurilacetāts; C-12 acetāts; dodekanilacetāts; lauriletanoāts; dodekaniletanoāts | | |

09.011 | 03 | 105–87–3 | geranilacetāts | 2509 | 201 | 203–341–5 | 09.011 | geraniolacetāts; trans- 3,7-dimetil-2, 6-oktadiēn-1-ilacetāts; 2,6-dimetil-2, 6-oktadiēn-8-ilacetāts | 3,7-dimetilokta-2-( trans), 6-dienilacetāts | |

09.012 | 04 | 150–84–5 | citronelilacetāts | 2311 | 202 | 205–775–0 | 09.012 | 3,7-dimetil-6-oktēn-1-ilacetāts; 3,7-dimetil-6-oktēn-1-iletanoāts | 3,7-dimetilokta-6-enilacetāts | |

09.013 | 06 | 115–95–7 | linalilacetāts | 2636 | 203 | 204–116–4 | 09.013 | bergamols; 3,7-dimetil-1, 6-oktēn-3-ilacetāts; likareolacetāts; linaloola acetāts | 1,5-dimetil-1-vinilheks-4-enilacetāts | |

09.014 | 23 | 140–11–4 | benzilacetāts | 2135 | 204 | 205–399–7 | 09.014 | benziletanoāts | | |

09.015 | 06 | 80–26–2 | α-terpinilacetāts | 3047 | 205 | 201–265–7 | 09.015 | 3-cikloheksēn-1-metanolacetāts, α, α, 4-trimetil- | p-ment-1-ēn-8-ilacetāts | 5 |

09.016 | 08 | 29066–34–0 | mentilacetāts | 2668 | 206 | 240–459–6 | 09.016 | 1- p-ment-3-ilacetāts; mentola acetāts; 1-izopropil-4-metilcikloheks-2-ilacetāts | (1-α, 2-β, 5-α)- 2-izopropil-5-metilcikloheksilacetats | 4 |

09.017 | 08 | 76–49–3 | bornilacetāts | 2159 | 207 | 200–964–4 | 09.017 | borneola acetāts; 2-kamfanilacetāts; borniletanoāts; 1-bornilacetāts; d-bornilacetāts; borniletiķskābes ēteris | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilacetāts | |

09.018 | 22 | 103–54–8 | cinamilacetāts | 2293 | 208 | 203–121–9 | 09.018 | 3-fenil-2-propēn-1-ilacetāts; 3-fenilalilacetāts | 3-fenilprop-2-enilacetāts | |

09.019 | 23 | 104–21–2 | p-anizilacetāts | 2098 | 209 | 203–185–8 | 09.019 | benzolmetanola acetāts, 4-metoksi-; anizilspirta acetāts; benzilspirta acetāts, p-metoksi- | 4-metoksibenzilacetāts | |

09.020 | 18 | 93–28–7 | eigenilacetāts | 2469 | 210 | 202–235–6 | 09.020 | eigenolacetāts; aceteigenols; 2-metoksi-4-fenilacetāts; acetileigenols | 4-alil-2-metoksifenilacetāts | |

09.021 | 01 | 628–63–7 | pentilacetāts | | 211 | 211–047–3 | 09.021 | amilacetāts | | |

09.022 | 01 | 112–06–1 | heptilacetāts | 2547 | 212 | 203–932–8 | 09.022 | C-7 acetāts; heptanilacetāts; heptiletanoāts | | |

09.023 | 01 | 79–20–9 | metilacetāts | 2676 | 213 | 201–185–2 | 09.023 | metiletanoāts | | |

09.024 | 02 | 123–92–2 | izopentilacetāts | 2055 | 214 | 204–662–3 | 09.024 | izoamilacetāts; β-metilbutilacetāts; amilacetāts (parastais); amilizoacetāts; izoamiletanoāts | 3-metilbutilacetāts | |

09.025 | 02 | 10031–87–5 | 2-etilbutilacetāts | 2425 | 215 | 233–095–4 | 09.025 | β-etilbutilacetats | | |

09.026 | 22 | 7493–78–9 | α-pentilcinamilacetāts | 2064 | 216 | 231–339–4 | 09.026 | α-n-amil-β-fenilakrilacetāts; α-pentilcinamilacetāts; floksīnacetāts | 2-pentil-3-fenilprop-2-enilacetāts | |

09.027 | 08 | 622–45–7 | cikloheksilacetāts | 2349 | 217 | 210–736–6 | 09.027 | cikloheksāna acetāts | | |

09.028 | 07 | 21722–83–8 | 2-cikloheksiletilacetāts | 2348 | 218 | 2266952 | 09.028 | cikloheksāna etilacetāts; etilcikloheksilacetāts; heksahidrofeniletilacetāts | | |

09.029 | 06 | 103–07–1 | 1,1-dimetil-3-fenilpropilacetāts | 2735 | 219 | 203–077–0 | 09.029 | dimetilfenetilkarbinilacetāts; 1,1-dimetil-3-fenilpropān-1-ilacetāts; 2-metil-4-fenil-2-butilacetāts | | |

09.030 | 17 | 93–29–8 | 2-metoksi-4-(prop-1-enil)fenilacetāts | 2470 | 220 | 202–236–1 | 09.030 | izoeigenilacetāts; izoeigenola acetāts; 2-metoksi-4-propenilfenilacetāts; acetizoeigenols | | |

09.031 | 15 | 103–45–7 | fenetilacetāts | 2857 | 221 | 203–113–5 | 09.031 | 2-feniletilacetāts; benzilkarbinilacetāts | | |

09.032 | 22 | 122–72–5 | 3-fenilpropilacetāts | 2890 | 222 | 204–569–8 | 09.032 | fenilpropilacetāts; 3-fenil-1-propilacetāts; hidrocinamilacetāts; β-fenilpropilacetats | | |

09.033 | 04 | 141–11–7 | rodinilacetāts | 2981 | 223 | 205–458–7 | 09.033 | α-citronelilacetāts | 3,7-dimetilokt-7-enilacetāts | |

09.034 | 07 | 1323–00–8 | santalilacetāts | 3007 | 224 | 2153496 | 09.034 | α-santalola acetāts; β-santalola acetāts | | 4 |

09.035 | 23 | 881–68–5 | vanililacetāts | 3108 | 225 | 212–920–1 | 09.035 | acetilvanilīns; benzaldehīds, 4-(acetoksi)- 3-metoksi-; 3-metoksi-4-acetoksibenzaldehīds | 4-acetoksi-3-metoksibenzaldehīds | |

09.036 | 25 | 140–39–6 | p-tolilacetāts | 3073 | 226 | 205–413–1 | 09.036 | p-krezilacetāts; 4-metilbenzoskābes metilesteris; acetil- p-krezols; p-toliletanoāts; p-krezilskābes acetāts | 4-metilfenilacetāts | |

09.037 | 01 | 140–88–5 | etilakrilāts | 2418 | 245 | 205–438–8 | 09.037 | etilpropenoāts | etilprop-2-enoāts | |

09.038 | 01 | 623–42–7 | metilbutirāts | 2693 | 263 | 210–792–1 | 09.038 | metilbutanoāts | | |

09.039 | 01 | 105–54–4 | etilbutirāts | 2427 | 264 | 203–306–4 | 09.039 | etil-n-butanoāts; sviestskābes ēteris; etilbutanoāts | | |

09.040 | 01 | 105–66–8 | propilbutirāts | 2934 | 266 | 203–320–0 | 09.040 | propilbutanoāts | | |

09.041 | 05 | 638–11–9 | izopropilbutirāts | 2935 | 267 | 211–320–7 | 09.041 | propilizobutirāts; propilizobutanoāts; izopropilbutanoāts | | |

09.042 | 01 | 109–21–7 | butilbutirāts | 2186 | 268 | 203–656–8 | 09.042 | butilbutanoāts | | |

09.043 | 02 | 539–90–2 | izobutilbutirāts | 2187 | 269 | 208–729–8 | 09.043 | butilizobutirāts; 2-metil-1-propilbutirāts; izobutilbutanoāts | 2-metilpropilbutanoāts | |

09.044 | 01 | 540–18–1 | pentilbutirāts | 2059 | 270 | 208–739–2 | 09.044 | amilbutirāts; amilbutanoāts | | |

09.045 | 01 | 2639–63–6 | heksilbutirāts | 2568 | 271 | 220–136–6 | 09.045 | n-heksil-n-butanoāts; heksilbutanoāts | | |

09.046 | 01 | 110–39–4 | oktilbutirāts | 2807 | 272 | 203–762–4 | 09.046 | oktilbutanoāts | | |

09.047 | 01 | 5454–09–1 | decilbutirāts | 2368 | 273 | 226–700–8 | 09.047 | decilbutanoāts; 1-butiroksidekāns | | |

09.048 | 03 | 106–29–6 | geranilbutirāts | 2512 | 274 | 203–381–3 | 09.048 | trans-3,7-dimetil-2,6-oktadiēn-1-ilbutanoāts | 3,7-dimetilokta-2-( trans),6-dienilbutanoāts | |

09.049 | 04 | 141–16–2 | citronelilbutirāts | 2312 | 275 | 205–463–4 | 09.049 | 3,7-dimetil-6-oktēn-1-ilbutirāts | 3,7-dimetilokt-6-enilbutanoāts | |

09.050 | 06 | 78–36–4 | linalilbutirāts | 2639 | 276 | 201–109–8 | 09.050 | 3,7-dimetil-1,6-oktadiēn-3-ilbutirāts; linalil-n-butirāts | 1,5-dimetil-1-vinilheks-4-enilbutanoāts | |

09.051 | 23 | 103–37–7 | benzilbutirāts | 2140 | 277 | 203–105–1 | 09.051 | benzil-n-butirāts; benzil-n-butanoāts; benzilbutanoāts | | |

09.052 | 06 | 2153–28–8 | terpinilbutirāts | 3049 | 278 | 218–445–6 | 09.052 | p-ment-1-ēn-8-ilbutirāts; p-ment-1-ēn-8-ola butirāts | p-ment-1-ēn-8-ilbutanoāts | |

09.053 | 22 | 103–61–7 | cinamilbutirāts | 2296 | 279 | 203–128–7 | 09.053 | fenilpropenil-n-butirāts; 3-fenil-2-propēn-1-ilbutanoāts; sviestskābes 3-fenil-2-propēn-1-ilesteris | 3-fenilprop-2-enilbutanoāts | |

09.054 | 03 | 2051–78–7 | alilbutirāts | 2021 | 280 | 218–129–8 | 09.054 | alil-n-butirāts; vinilkarbinilbutirāts; 2-propēn-1-ilbutanoāts; alilbutanoāts | | |

09.055 | 02 | 106–27–4 | 3-metilbutilbutirāts | 2060 | 282 | 203–380–8 | 09.055 | izoamilbutirāts; izoamil-n-butirāts | | |

09.057 | 22 | 80866–83–7 | 2-fenilpropilbutirāts | 2891 | 285 | 279–587–2 | 09.057 | sviestskābes, α-fenilpropilesteris; β-metilfenetilbutirats; hidratropilbutirāts | | |

09.058 | 23 | 6963–56–0 | p-anizilbutirāts | 2100 | 286 | 230–163–5 | 09.058 | benzilspirta p-metoksibutirāts; sviestskābes p-metoksibenzilesteris | 4-metoksibenzilbutanoāts | |

09.059 | 01 | 110–38–3 | etildekanoāts | 2432 | 309 | 203–761–9 | 09.059 | etilkaprāts; etildecilāts; etilkaprināts | | |

09.060 | 01 | 123–66–0 | etilheksanoāts | 2439 | 310 | 204–640–3 | 09.060 | etilkaproāts; kapronskābes ēteris, absolūts; etilkapronāts | | |

09.061 | 01 | 626–77–7 | propilheksanoāts | 2949 | 311 | 210–963–0 | 09.061 | propilkapronāts | | |

09.062 | 05 | 2311–46–8 | izopropilheksanoāts | 2950 | 312 | 219–000–9 | 09.062 | izopropilheksanoāts; izopropilheksilāts; izopropilkapronāts; izopropilkaproāts | | |

09.063 | 01 | 626–82–4 | butilheksanoāts | 2201 | 313 | 210–964–6 | 09.063 | butilkaproāts | | |

09.064 | 02 | 105–79–3 | izobutilheksanoāts | 2202 | 314 | 203–332–6 | 09.064 | izobutilkaproāts; izobutilheksanoāts; izobutilkaproāts | 2-metilpropilheksanoāts | |

09.065 | 01 | 540–07–8 | pentilheksanoāts | 2074 | 315 | 208–732–4 | 09.065 | amilheksanoāts; amilkaproāts; pentilkaproāts | | |

09.066 | 01 | 6378–65–0 | heksilheksanoāts | 2572 | 316 | 228–952–4 | 09.066 | heksilkaproāts | | |

09.067 | 03 | 10032–02–7 | geranilheksanoāts | 2515 | 317 | 233–102–0 | 09.067 | geranilkaproāts; trans-3,7-dimetil-2,6-oktadiēn-1-ilheksanoāts | 3,7-dimetilokta-2-( trans), 6-dienil-n-heksanoāts | |

09.068 | 06 | 7779–23–9 | linalilheksanoāts | 2643 | 318 | 231–922–3 | 09.068 | 3,7-dimetil-1,6-oktadiēn-3-ilheksanoāts; linalilkaproāts; linalilheksoāts; linelilheksoāts | 1,5-dimetil-1-vinilheks-4-enilheksanoāts | |

09.069 | 01 | 106–70–7 | metilheksanoāts | 2708 | 319 | 203–425–1 | 09.069 | metilkaproāts | | |

09.070 | 02 | 2198–61–0 | 3-metilbutilheksanoāts | 2075 | 320 | 218–600–8 | 09.070 | izoamilheksanoāts; izoamilkaproāts; izopentil-n-heksanoāts; izopentilheksanoāts; izopentilkaproāts; izopentilheksanoāts | | |

09.071 | 22 | 6281–40–9 | 3-fenilpropilheksanoāts | 2896 | 321 | 228–490–3 | 09.071 | hidrocinamilheksanoāts; hidrocinamilkaproāts; 3-fenilpropilkaproāts | | |

09.072 | 01 | 109–94–4 | etilformiāts | 2434 | 339 | 203–721–0 | 09.072 | etilmetanoāts; skudrskābes ēteris | | |

09.073 | 01 | 110–74–7 | propilformiāts | 2943 | 340 | 203–798–0 | 09.073 | propilmetanoāts | | |

09.074 | 01 | 112–23–2 | heptilformiāts | 2552 | 341 | 203–949–0 | 09.074 | n-heptilmetanoāts; heptilmetanoāts | | |

09.075 | 01 | 112–32–3 | oktilformiāts | 2809 | 342 | 203–959–5 | 09.075 | oktilmetanoāts | | |

09.076 | 03 | 105–86–2 | geranilformiāts | 2514 | 343 | 203–339–4 | 09.076 | trans- 3,7-dimetil-2,6-oktadiēn-1-ilformiāts; trans- 3,7-dimetil-2, 6-oktadiēn-1-ilmetanoāts; geranilmetanoāts | 3,7-dimetilokta-2( trans),6-dienilformiāts | |

09.077 | 23 | 104–57–4 | benzilformiāts | 2145 | 344 | 203–214–4 | 09.077 | skudrskābes benzilesteris; benzilmetanoāts | | |

09.078 | 04 | 105–85–1 | citronelilformiāts | 2314 | 345 | 203–338–9 | 09.078 | 3,7-dimetil-6-oktēn-1-ilformiāts; 3,7-dimetil-6-oktēn-1-ilmetanoāts | 3,7-dimetilokt-6-enilformiāts | |

09.079 | 04 | 141–09–3 | rodinilformiāts | 2984 | 346 | 205–456–6 | 09.079 | α-citronelilformiāts | 3,7-dimetilokt-7-enilformiāts | |

09.080 | 06 | 115–99–1 | linalilformiāts | 2642 | 347 | 204–120–6 | 09.080 | 3,7-dimetil-1, 6-oktadiēn-3-ilformiāts; linaloola formiāts | 1,5-dimetil-1-vinilheks-4-enilformiāts | |

09.081 | 06 | 2153–26–6 | α-terpinilformiats | 3052 | 348 | 218–444–0 | 09.081 | p - ment-1-ēn-8-ilformiāts | | |

09.082 | 08 | 7492–41–3 | bornilformiāts | 2161 | 349 | 231–319–5 | 09.082 | bornilmetanoāts; borneola formiāts; d-bornilformiāts; endo-2-bornanilformiāts; 2-kamfanilformiāts; 1-bornilformiāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilformiāts | |

09.083 | 15 | 104–62–1 | fenetilformiāts | 2864 | 350 | 203–220–7 | 09.083 | 2-feniletilformiāts; 2-feniletilmetanoāts; benzilkarbinilformiāts; benzilkarbinilmetanoāts | | |

09.084 | 22 | 104–64–3 | 3-fenilpropilformiāts | 2895 | 351 | 203–222–8 | 09.084 | fenilpropilformiāts; hidrocinamilformiāts; hidrocinamilmetanoāts; β-fenilpropilformiāts | | |

09.085 | 22 | 104–65–4 | cinamilformiāts | 2299 | 352 | 203–223–3 | 09.085 | 3-fenil-2-propēn-1-ilformiāts; 3-fenilalilformiāts; cinamilmetanoāts | 3-fenilprop-2-enilformiāts | |

09.086 | 06 | 10058–43–2 | 2-metil-1-fenil-2-propilformiāts | 2395 | 353 | | 09.086 | α, α-dimetilfenetilformiats; 2-benzil-2-propilformiāts; benzildimetilkarbinilformiāts; dimetilbenzilkarbinilformiāts | | |

09.087 | 23 | 122–91–8 | p-anizilformiāts | 2101 | 354 | 204–582–9 | 09.087 | anizilspirta formiāts; anizilmetanoāts; p-metoksibenzilmetanoāts; benzolmetanola formiāts, 4-metoksi– | 4-metoksibenzilformiāts | |

09.088 | 18 | 10031–96–6 | 4-eigenilformiāts | 2473 | 355 | 233–099–6 | 09.088 | eigenola formiāts | 4-alil-2-metoksifenilformiāts | |

09.089 | 17 | 7774–96–1 | izoeigenilformiāts | 2474 | 356 | 231–884–8 | 09.089 | 4-metoksi-4-fenilformiāts; 2-metoksi-4-propenilfenilformiāts; | 2-metoksi-4-(prop-1-enil)fenilformiāts | |

09.090 | 22 | 7493–79–0 | α-pentilcinamilformiāts | 2066 | 357 | 231–341–5 | 09.090 | α-n-amilfenilakrilformiāts; α-pentilcinamilformiāts | 2-pentil-3-fenilprop-2-enilformiāts | |

09.091 | 01 | 5454–28–4 | butilheptanoāts | 2199 | 363 | 226–707–6 | 09.091 | butilheptilāts; butilenantoāts | | |

09.092 | 02 | 7779–80–8 | izobutilheptanoāts | 2200 | 364 | 231–940–1 | 09.092 | izobutilheptilāts; butilizoheptanoāts; izobutilheptoāts; 2-metil-1-propilheptanoāts | 2-metilpropilheptanoāts | |

09.093 | 01 | 106–30–9 | etilheptanoāts | 2437 | 365 | 203–382–9 | 09.093 | etilheptilāts; etilheptoāts; etilenantāts; enantskābes esteris | | |

09.094 | 01 | 5132–75–2 | oktilheptanoāts | 2810 | 366 | 225–882–6 | 09.094 | oktilheptilāts; oktilenantāts | | |

09.095 | 01 | 7778–87–2 | propilheptanoāts | 2948 | 367 | 231–917–6 | 09.095 | propilheptilāts; propilheptoāts; propilenantāts | | |

09.096 | 01 | 106–73–0 | metilheptanoāts | 2705 | 368 | 203–428–8 | 09.096 | metilheptoāts; metilenantāts | | |

09.097 | 03 | 142–19–8 | alilheptanoāts | 2031 | 369 | 205–527–1 | 09.097 | alilheptilāts; alilheptoāts; alilenantāts | | |

09.098 | 01 | 7493–82–5 | pentilheptanoāts | 2073 | 370 | 231–342–0 | 09.098 | amilheptanoāts; amilheptilāts; amilheptoāts; amilenantāts | | |

09.099 | 01 | 106–33–2 | etildodekanoāts | 2441 | 375 | 203–386–0 | 09.099 | etillaurāts; etildodecilāts | | |

09.100 | 01 | 106–18–3 | butildodekanoāts | 2206 | 376 | 203–370–3 | 09.100 | butillaurāts; butildodecilāts | | |

09.101 | 01 | 111–82–0 | metildodekanoāts | 2715 | 377 | 203–911–3 | 09.101 | metillaurāts; metildodecilāts | | |

09.102 | 25 | 10024–57–4 | p-tolildodekanoāts | 3076 | 378 | 233–024–7 | 09.102 | p-krezildodekanoāts; p - krezillaurāts; p-metilfenildodekanoāts | 4-metilfenildodekanoāts | |

09.103 | 02 | 6309–51–9 | 3-metilbutildodekanoāts | 2077 | 379 | 228–626–1 | 09.103 | izoamillaurāts; izoamildodekanoāts; izopentillaurāts | | |

09.104 | 01 | 124–06–1 | etiltetradekanoāts | 2445 | 385 | 204–675–4 | 09.104 | etilmiristāts | | |

09.105 | 05 | 110–27–0 | izopropiltetradekanoāts | 3556 | 386 | 203–751–4 | 09.105 | izopropilmiristāts | | |

09.106 | 01 | 124–10–7 | metiltetradekanoāts | 2722 | 387 | 204–680–1 | 09.106 | metilmiristāts | | |

09.107 | 01 | 123–29–5 | etilnonanoāts | 2447 | 388 | 204–615–7 | 09.107 | etilpelargonāts; etilnonilāts | | |

09.108 | 01 | 1731–84–6 | metilnonanoāts | 2724 | 389 | 217–052–7 | 09.108 | metilnonilāts; metilpelargonāts | | |

09.109 | 03 | 7493–72–3 | alilnonanoāts | 2036 | 390 | 231–334–7 | 09.109 | 2-propenilnonanoāts; alilpelargonāts; alilnonilāts; 2-propenilpelargonāts | | |

09.110 | 02 | 7779–70–6 | 3-metilbutilnonanoāts | 2078 | 391 | 231–933–3 | 09.110 | izoamilpelargonāts; izopentilnonanoāts; izoamilnonanoāts; izopentilnonilāts; izoamilnonilāts | | |

09.111 | 01 | 106–32–1 | etiloktanoāts | 2449 | 392 | 203–385–5 | 09.111 | etilkaprilāts; etiloktilāts | | |

09.112 | 01 | 638–25–5 | pentiloktanoāts | 2079 | 393 | 211–328–0 | 09.112 | amiloktanoāts; amilkaprilāts; amiloktilāts; pentiloktilāts | | |

09.113 | 01 | 1117–55–1 | heksiloktanoāts | 2575 | 394 | 214–247–9 | 09.113 | heksilkaprilāts; heksiloktilāts | | |

09.114 | 01 | 2306–88–9 | oktiloktanoāts | 2811 | 395 | 218–980–5 | 09.114 | oktiloktilāts | | |

09.115 | 01 | 7786–48–3 | noniloktanoāts | 2790 | 396 | 232–099–3 | 09.115 | noniloktilāts | | |

09.116 | 06 | 10024–64–3 | linaliloktanoāts | 2644 | 397 | 233–026–8 | 09.116 | 3,7-dimetil-1,6-oktadiēn-3-iloktanoāts; linalilkaprilāts; linaliloktoāts; linaliloktilāts | 1,5-dimetil-1-vinilheks-4-eniloktanoāts | |

09.117 | 01 | 111–11–5 | metiloktanoāts | 2728 | 398 | 203–835–0 | 09.117 | metiloktilāts | | |

09.118 | 01 | 4265–97–8 | heptiloktanoāts | 2553 | 399 | 224–252–8 | 09.118 | heptilkaprilāts | | |

09.119 | 03 | 4230–97–1 | aliloktanoāts | 2037 | 400 | 224–184–9 | 09.119 | alilkaprilāts; 2-propeniloktanoāts; 2-propeniloktilāts; aliloktilāts | | |

09.120 | 02 | 2035–99–6 | 3-metilbutiloktanoāts | 2080 | 401 | 218–004–8 | 09.120 | izoamiloktanoāts; izopentiloktanoāts; pentilizooktanoāts; izoamilkaprilāts; izopentiloktilāts | | |

09.121 | 01 | 105–37–3 | etilpropionāts | 2456 | 402 | 203–291–4 | 09.121 | etilpropanoāts; propionskābes ēteris | | |

09.122 | 01 | 106–36–5 | propilpropionāts | 2958 | 403 | 203–389–7 | 09.122 | propilpropanoāts; n-propilpropionāts | | |

09.123 | 05 | 637–78–5 | izopropilpropionāts | 2959 | 404 | 211–300–8 | 09.123 | propilizopropionāts | | |

09.124 | 01 | 590–01–2 | butilpropionāts | 2211 | 405 | 209–669–5 | 09.124 | butilpropanoāts | | |

09.125 | 02 | 540–42–1 | izobutilpropionāts | 2212 | 406 | 208–746–0 | 09.125 | butilizopropionāts; izobutilpropanoāts | 2-metilpropilpropanoāts | |

09.126 | 01 | 142–60–9 | oktilpropionāts | 2813 | 407 | 205–548–6 | 09.126 | oktilpropanoāts | | |

09.127 | 01 | 5454–19–3 | decilpropionāts | 2369 | 408 | 226–703–4 | 09.127 | decilpropanoāts; 1-propionoksidekāns | | |

09.128 | 03 | 105–90–8 | geranilpropionāts | 2517 | 409 | 203–344–1 | 09.128 | trans-3,7-dimetil-2,6-oktadiēn-1-ilpropanoāts; 2,6-dimetiloktadiēn-6-il-8-propionāts | 3,7-dimetilokta-2-( trans), 6-dienilpropanoāts | |

09.129 | 04 | 141–14–0 | citronelilpropionāts | 2316 | 410 | 205–461–3 | 09.129 | | 3,7-dimetilokt-6-enilpropanoāts | |

09.130 | 06 | 144–39–8 | linalilpropionāts | 2645 | 411 | 205–627–5 | 09.130 | 3,7-dimetil-1,6-oktadiēn-3-ilpropanoāts; 3,7-dimetil-1,6-oktadiēn-3-ilpropionāts | 1,5-dimetil-1-vinilheks-4-enilpropanoāts | |

09.131 | 08 | 2756–56–1 | izobornilpropionāts | 2163 | 412 | 220–410–5 | 09.131 | | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilpropanoāts | |

09.132 | 23 | 122–63–4 | benzilpropionāts | 2150 | 413 | 204–559–3 | 09.132 | benzilpropanoāts; | | |

09.133 | 22 | 103–56–0 | cinamilpropionāts | 2301 | 414 | 203–124–5 | 09.133 | 3-fenil-2-propēn-1-ilpropanoāts; γ-fenilalilpropionats | 3-fenilprop-2-enilpropanoāts | |

09.134 | 01 | 554–12–1 | metilpropionāts | 2742 | 415 | 209–060–4 | 09.134 | metilpropanoāts | | |

09.135 | 01 | 624–54–4 | pentilpropionāts | | 416 | 210–852–7 | 09.135 | pentilpropanoāts; amilpropionāts | | |

09.136 | 02 | 105–68–0 | 3-metilbutilpropionāts | 2082 | 417 | 203–322–1 | 09.136 | izoamilpropionāts; izopentilpropionāts; izopentilpropanoāts; izoamilpropanoāts | | |

09.137 | 15 | 122–70–3 | fenetilpropionāts | 2867 | 418 | 204–567–7 | 09.137 | feniletilpropionāts; 2-feniletilpropanoāts; benzilkarbinilpropionāts | | |

09.138 | 22 | 122–74–7 | 3-fenilpropilpropionāts | 2897 | 419 | 204–571–9 | 09.138 | fenilpropilpropionāts; hidrocinamilpropionāts; β-fenilpropilpropanoats; 3-fenilpropilpropanoāts | | |

09.139 | 01 | 2445–76–3 | heksilpropionāts | 2576 | 420 | 219–495–1 | 09.139 | heksilpropanoāts | | |

09.140 | 08 | 6222–35–1 | cikloheksilpropionāts | 2354 | 421 | 228–303–5 | 09.140 | | | |

09.141 | 04 | 105–89–5 | rodinilpropionāts | 2986 | 422 | 203–343–6 | 09.141 | α-citronelilpropionats | 3,7-dimetilokt-7-enilpropanoāts | |

09.142 | 06 | 80–27–3 | terpinilpropionāts | 3053 | 423 | 201–266–2 | 09.142 | p-mentanilpropionāts (izomēru maisījums pēc FEMA); p-ment-1-en-8-ilpropionāts | p-ment-1-ēn-8-ilpropanoāts | |

09.143 | 08 | 97–45–0 | karvilpropionāts | 2251 | 424 | 202–583–9 | 09.143 | 1-karveola propionāts; p-menta-6,8-diēn-2-ilpropionāts | p-menta-6,8-diēn-2-ilpropanoāts | |

09.144 | 21 | 120–45–6 | 1-fenetilpropionāts | 2689 | 425 | 204–397–3 | 09.144 | α-metilbenzilpropionats; 1-fenil-1-etilpropionāts; metilfenilkarbinilpropionāts | | |

09.145 | 23 | 7549–33–9 | p - anizilpropionāts | 2102 | 426 | 231–433–5 | 09.145 | benzolmetanola propionāts, 4-metoksi- | 4-metoksibenzilpropanoāts | |

09.146 | 03 | 7493–76–7 | alilundec-10-enoāts | 2044 | 441 | 231–337–3 | 09.146 | alilundecilenāts; 2-propenil-10-undecenoāts; alilhendecenoāts; alilundecilenoāts | | |

09.147 | 01 | 539–82–2 | etilvalerāts | 2462 | 465 | 208–726–1 | 09.147 | etilpentanoāts; baldriānskābes etilesteris | | |

09.148 | 01 | 591–68–4 | butilvalerāts | 2217 | 466 | 209–728–5 | 09.148 | baldriānskābes butilesteris; butilpentanoāts | | |

09.149 | 01 | 2173–56–0 | pentilvalerāts | | 467 | 218–528–7 | 09.149 | amilpentanoāts; amilvalerāts | | |

09.150 | 03 | 10402–47–8 | geranilvalerāts | | 468 | 233–869–1 | 09.150 | geranilpentanoāts; 2,6-dimetil-2,6-oktadiēn-8-ilpentanoāts | 3,7-dimetilokta-2-( trans),6-dienilpentanoāts | |

09.151 | 04 | 7540–53–6 | citronelilvalerāts | 2317 | 469 | 231–416–2 | 09.151 | 3,7-dimetil-6-oktēn-1-ilpentanoāts | 3,7-dimetilokt-6-enilpentanoāts | |

09.152 | 23 | 10361–39–4 | benzilvalerāts | | 470 | 233–789–7 | 09.152 | baldriānskābes benzilesteris; benzilpentanoāts; fenilmetilpentanoāts | | |

09.153 | 08 | 7549–41–9 | bornilvalerāts | 2164 | 471 | 231–435–6 | 09.153 | bornilpentanoāts; baldriānskābes bornilesteris; bornil-n-pentanoāts; endo-2-kamfanilvalerāts; endo-2-bornilvalerāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilpentanoāts | |

09.154 | 08 | 89–47–4 | mentilvalerāts | | 472 | 201–910–2 | 09.154 | mentilpentanoāts | p-mentān-3-ilpentanoāts | |

09.156 | 01 | 111–80–8 | metil-2-noninoāts | 2726 | 479 | 203–909–2 | 09.156 | metiloktīna karbonāts | | |

09.157 | 01 | 10031–92–2 | etil-2-noninoāts | 2448 | 480 | 233–098–0 | 09.157 | etiloktīna karbonāts; etiloktīna karboksilāts; etilnon-2-īnoāts; etilheksilpropionāts | | |

09.158 | 01 | 111–12–6 | metil-2-oktinoāts | 2729 | 481 | 203–836–6 | 09.158 | metilheptīna karbonāts; metilokt-2-īnoāts; metilpentilpropionāts | | |

09.159 | 01 | 638–49–3 | pentilformiāts | 2068 | 497 | 211–340–6 | 09.159 | amilformiāts; amilmetanoāts; n-pentilmetanoāts | | |

09.160 | 08 | 4351–54–6 | cikloheksilformiāts | 2353 | 498 | 224–415–3 | 09.160 | | | |

09.161 | 01 | 629–33–4 | heksilformiāts | 2570 | 499 | 211–087–1 | 09.161 | n-heksilformiāts; heksilmetanoāts; skudrskābes heksilesteris | | |

09.162 | 02 | 110–45–2 | 3-metilbutilformiāts | 2069 | 500 | 203–769–2 | 09.162 | izoamilformiāts; izopentilformiāts; amilizoformiāts; pentilizoformiāts; izopentilmetanoāts; amilizometanoāts; izoamilmetanoāts | | |

09.163 | 01 | 592–84–7 | butilformiāts | 2196 | 501 | 209–772–5 | 09.163 | butilmetanoāts | | |

09.164 | 02 | 542–55–2 | izobutilformiāts | 2197 | 502 | 208–818–1 | 09.164 | tetrilformiāts; izobutilformiāts; izobutilmetanoāts; 2-metil-1-propilformiāts | 2-metilpropilformiāts | |

09.165 | 05 | 625–55–8 | izopropilformiāts | 2944 | 503 | 210–901–2 | 09.165 | izopropilformiāts; izopropilmetanoāts; izopropilmetanoāts | | |

09.166 | 01 | 5870–93–9 | heptilbutirāts | 2549 | 504 | 227–526–5 | 09.166 | heptilbutanoāts | | |

09.167 | 03 | 999–40–6 | nerilbutirāts | 2774 | 505 | 213–660–1 | 09.167 | cis-3,7-dimetil-2,6-oktadiēn-1-ilbutanoāts | 3,7-dimetil-2-( cis),6-oktadienilbutanoāts | |

09.168 | 15 | 103–52–6 | fenetilbutirāts | 2861 | 506 | 203–119–8 | 09.168 | β-fenetil-n-butanoāts; 2-feniletilbutanoāts; 2-feniletilbutirāts; benzilkarbinilbutirāts | | |

09.169 | 03 | 105–91–9 | nerilpropionāts | 2777 | 509 | 203–345–7 | 09.169 | cis- 3,7-dimetil-2,6-oktadiēn-1-ilpropionāts | 3,7-dimetil-2-( cis),6-oktadienilpropanoāts | |

09.171 | 08 | 77–54–3 | cedrilacetāts | | 527 | 201–036–1 | 09.171 | | 2,6,6,8-tetrametiltriciklo[5.3.1.0(1.5)]undekān-8-ilacetāts | |

09.172 | 08 | 6243–10–3 | cikloheksilheksanoāts | | 528 | 228–354–3 | 09.172 | | | |

09.174 | 25 | 613–70–7 | 2-metoksifenilacetāts | 3687 | 552 | 210–350–8 | 09.174 | gvajacilacetāts; 1-acetoksi-2-metoksibenzols; acetilgvajakols; o-metoksifenilacetāts | | |

09.175 | 08 | 58479–55–3 | izobornilbutirāts | | 564 | 261–281–5 | 09.175 | | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilbutanoāts | |

09.176 | 08 | 1200–67–5 | izobornilformiāts | 2162 | 565 | 214–853–3 | 09.176 | izobornilmetanoāts; ekso-2-bornilformiāts; ekso-2-kamfanilformiāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilformiāts | |

09.177 | 03 | 7149–29–3 | 2-metilalilbutirāts | 2678 | 572 | 230–474–6 | 09.177 | 2-metil-2-propēn-1-ilbutirāts; 2-metilalilbutanoāts; izopropenilkarbinil-n-butirāts; metilalilbutirāts | 2-metilprop-2-enilbutanoāts | |

09.178 | 21 | 93–92–5 | 1-fenetilacetāts | 2684 | 573 | 202–288–5 | 09.178 | stiralilacetāts; α-feniletilacetāts; metilfenilkarbinilacetāts; sek - feniletilacetāts | 1-feniletilacetāts | |

09.179 | 21 | 7775–38–4 | 1-fenetilformiāts | 2688 | 574 | 231–893–7 | 09.179 | α-metilbenzilformiāts; 1-fenil-1-etilformiāts; α-metilbenzilmetanoāts | | |

09.180 | 01 | 112–39–0 | metilheksadekanoāts | | 581 | 203–966–3 | 09.180 | metilpalmitāts | | |

09.181 | 01 | 13894–63–8 | metilheks-2-enoāts | 2709 | 583 | 237–663–2 | 09.181 | metil-β-propilakrilāts | | |

09.182 | 01 | 624–24–8 | metilvalerāts | 2752 | 588 | 210–838–0 | 09.182 | metilpentanoāts; metilvalerianāts | | |

09.185 | 09 | 592–20–1 | 2-oksopropilacetāts | | 607 | 209–746–3 | 09.185 | acetonilacetāts | | |

09.186 | 10 | 4906–24–5 | sek-butān-3-onilacetāts | 3526 | 608 | | 09.186 | 2-acetoksi-3-butanons; AMC acetāts; acetoīna acetāts; acetilmetilkarbinilacetāts; 2-butanon-3-ilacetāts | 1-metil-2-oksopropilacetāts | |

09.188 | 01 | 5933–87–9 | pentildekanoāts | | 611 | 227–682–4 | 09.188 | amilkaprāts; amilkaprināts | | |

09.189 | 21 | 10031–86–4 | 1-fenilpropilbutirāts | 2424 | 628 | 233–094–9 | 09.189 | α-etilbenzilbutirats; etilfenilkarbinilbutirāts; 1-fenil-1-propilbutirāts; α-fenilpropilbutirāts | | |

09.190 | 01 | 1552–67–6 | etilheks-2-enoāts | 3675 | 631 | 216–296–1 | 09.190 | etil-E-2-heksenoāts | | 5 |

09.191 | 01 | 2396–83–0 | etilheks-3-enoāts | 3342 | | 219–257–7 | 09.191 | | | |

09.192 | 01 | 111–62–6 | etiloleāts | 2450 | 633 | 203–889–5 | 09.192 | etil- cis- 9-oktadecenoāts | etiloktadec-9-enoāts | |

09.193 | 01 | 628–97–7 | etilheksadekanoāts | 2451 | 634 | 211–064–6 | 09.193 | etilpalmitāts; etilcetilāts | | |

09.194 | 01 | 2396–84–1 | etilheksa-2,4-dienoāts | 2459 | 635 | 219–258–2 | 09.194 | etilsorbāts; etil-2,4-heksadienoāts | | |

09.196 | 03 | 10094–40–3 | heks-2-enilacetāts | 2564 | 643 | 233–223–9 | 09.196 | trans- 2-heksenilacetāts; 2-heksēn-1-ilacetāts; 2-hekseniletanoāts | | 5 |

09.197 | 04 | 3681–71–8 | heks-3-( cis)-enilacetāts | 3171 | 644 | 222–960–1 | 09.197 | cis- 3-heksēn-1-ilacetāts; cis- 3-heksenilacetāts; cis- 3-hekseniletanoāts | | |

09.198 | 02 | 2050–09–1 | izopentilvalerāts | | 648 | 218–081–8 | 09.198 | izoamilpentanoāts | 3-metilbutilpentanoāts | |

09.200 | 21 | 10415–88–0 | 1-metil-3-fenilpropilacetāts | 2882 | 671 | 233–890–6 | 09.200 | metilfeniletilkarbinilacetāts; 4-fenil-2-butilacetāts; feniletilmetilkarbinilacetāts | | |

09.201 | 15 | 7460–74–4 | fenetilvalerāts | | 673 | 231–246–9 | 09.201 | fenetilpentanoāts | | |

09.202 | 01 | 141–06–0 | propilvalerāts | | 679 | 205–452–4 | 09.202 | propilpentanoāts; propilvalerāts | | |

09.204 | 01 | 544–35–4 | etiloktadeka-9,12-dienoāts | | 711 | 208–868–4 | 09.204 | etillinoleāts | | |

09.205 | 01 | 1191–41–9 | etiloktadeka-9,12,15-trienoāts | | 712 | 214–734–6 | 09.205 | etillinolenāts | | |

09.208 | 01 | 142–77–8 | butiloleāts | | 741 | 205–559–6 | 09.208 | | butiloktadec-9-enoāts | |

09.209 | 01 | 589–75–3 | butiloktanoāts | | 742 | 209–659–0 | 09.209 | butilkaprilāts | | |

09.210 | 01 | 111–61–5 | etiloktadekanoāts | 3490 | 745 | 203–887–4 | 09.210 | etilstearāts | | |

09.211 | 30 | 60–01–5 | gliceriltributirāts | 2223 | 747 | 200–451–5 | 09.211 | tributirīns; glicerīna tributirāts; butirīns | | 1 |

09.212 | 03 | 2142–94–1 | nerilformiāts | 2776 | 2060 | 218–401–6 | 09.212 | cis- 3,7-dimetil-2,6-oktadiēn-1-ilformiāts cis- 3,7-dimetil-2,6-oktadiēn-1-ilmetanoāts | 3,7-dimetil-2-( cis),6-oktadienilformiāts | |

09.213 | 03 | 141–12–8 | nerilacetāts | 2773 | 2061 | 2054592 | 09.213 | cis- 3,7-dimetil-2,6-oktadiēn-1-ilacetāts; cis-3,7-dimetil-2,6-oktadiēn-1-iletanoāts | 3,7-dimetil-2-( cis),6-oktadienilacetāts | |

09.214 | 04 | 112–19–6 | undec-10-enilacetāts | 3096 | 2062 | 203–944–3 | 09.214 | C 11 acetāts; 10-hendecilacetāts; undecilēnacetāts; undecenilacetāts | | |

09.215 | 08 | 97–42–7 | karvilacetāts | 2250 | 2063 | 202–580–2 | 09.215 | karveilacetāts; p-menta-6,8-diēn-2-ilacetāts | p-menta-6,8-diēn-2-ilacetāts | |

09.216 | 08 | 20777–49–5 | dihidrokarvilacetāts | 2380 | 2064 | 244–029–9 | 09.216 | 6-metil-3-(1-metilvinil)cikloheksilacetāts; dihidrokarveilacetāts; 8- p-mentēn-2-ilacetāts; 6-metil-3-izopropenilcikloheksenilacetāts | p-ment-8-ēn-2-ilacetāts | |

09.218 | 08 | 125–12–2 | izobornilacetāts | 2160 | 2066 | 204–727–6 | 09.218 | izobornilacetāts; ekso-2-kamfanilacetāts; izoborniletanoāts; ekso-2-bornilacetāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-ilacetāts | |

09.219 | 08 | 57576–09–7 | izopulegilacetāts | 2965 | 2067 | 260–820–1 | 09.219 | 5-metil-2-izopropenilcikloheksilacetāts; izopulegolacetāts; 1-metil-4-izopropenilcikloheksān-3-ilacetāts | p-ment-8-ēn-3-ilacetāts | |

09.220 | 23 | 326–61–4 | piperonilacetāts | 2912 | 2068 | 206–312–5 | 09.220 | heliotropilacetāts; 3,4-metilēndioksibenzilacetāts; 1,3-benzodioksol-5-metanola acetāts | 3,4-metilēndioksibenzilacetāts | |

09.224 | 05 | 108–84–9 | 1,3-dimetilbutilacetāts | | 2073 | 203–621–7 | 09.224 | 4-metil-2-pentilacetāts; metilizobutilkarbinilacetāts | | |

09.225 | 09 | 1322–17–4 | 1,3-nonāndiola acetāts | 2783 | 2075 | 215–332–3 | 09.225 | 1,3-nonāndiola acetāts (esteru maisījums); acetoksinonilacetāts (esteru maisījums); jasmonils | nonān-1,3-diilacetāts | 5 |

09.226 | 09 | 7779–54–6 | 3-oksononān-1-ilacetāts | | 2076 | | 09.226 | | | |

09.227 | 06 | 151–05–3 | 1,1-dimetil-2-fenetilacetāts | 2392 | 2077 | 205–781–3 | 09.227 | 2-metil-1-fenil-2-propilacetāts; benzildimetilkarbinilacetāts; dimetilbenzilkarbinilacetāts | | |

09.228 | 25 | 533–18–6 | o-tolilacetāts | 3072 | 2078 | 208–556–8 | 09.228 | acetil- o-krezols; o-krezola acetāts; o-krezilacetāts; | 2-metilfenilacetāts | |

09.230 | 08 | 1551–44–6 | cikloheksilbutirāts | 2351 | 2082 | 216–290–9 | 09.230 | cikloheksilbutanoāts | | |

09.231 | 21 | 3460–44–4 | 1-fenetilbutirāts | 2686 | 2083 | 222–409–5 | 09.231 | α-metilbenzilbutirāts; metilfenilkarbinilbutirāts; stiralilbutirāts; 1-fenil-1-etilbutanoāts | 1-feniletilbutirāts | |

09.232 | 06 | 10094–34–5 | 1,1-dimetil-2-fenetilbutirāts | 2394 | 2084 | 233–221–8 | 09.232 | 2-metil-1-fenil-2-propilbutirāts; benzildimetilkarbinilbutirāts; α, α-dimetilfenetilbutirats | | |

09.233 | 03 | 2408–20–0 | alilpropionāts | 2040 | 2094 | 219–307–8 | 09.233 | 2-propenilpropanoāts; alilpropanoāts | | |

09.234 | 01 | 111–79–5 | metilnon-2-enoāts | 2725 | 2099 | 203–908–7 | 09.234 | metilnonilenāts; metilnonilenoāts | | |

09.235 | 01 | 7492–45–7 | butildec-2-enoāts | 2194 | 2100 | | 09.235 | | | |

09.236 | 01 | 5760–50–9 | metilundec-9-enoāts | 2750 | 2101 | 227–279–3 | 09.236 | metilundecilenāts | | |

09.237 | 01 | 692–86–4 | etilundec-10-enoāts | 2461 | 10634 | 211–734–8 | 09.237 | etilundecilenāts | | |

09.238 | 01 | 109–42–2 | butilundec-10-enoāts | 2216 | 2103 | 203–670–4 | 09.238 | butilundecilenāts | | |

09.239 | 01 | 10522–18–6 | metil-2-undecinoāts | 2751 | 2111 | | 09.239 | metildecīna karbonāts; metilundec-2-īnoāts; metiloktilpropionāts | | |

09.240 | 04 | 33467–73–1 | heks-3-( cis)-enilformiāts | 3353 | 2153 | 251–532–7 | 09.240 | β, γ-heksenilmetanoāts; (Z)- 3-heksenola formiāts; lapu spirta formiāts; 3-heksenilmetanoāts | | 5 |

09.244 | 03 | 123–68–2 | alilheksanoāts | 2032 | 2181 | 204–642–4 | 09.244 | alilkaproāts; 2-propenilheksanoāts | | |

09.246 | 01 | 123–95–5 | butiloktadekanoāts | 2214 | 2189 | 204–666–5 | 09.246 | butilstearāts | | |

09.247 | 03 | 20474–93–5 | alilkrotonāts | | 2222 | 243–845–2 | 09.247 | | alilbut-2-( trans)-enoāts | |

09.248 | 01 | 623–70–1 | etil- trans- 2-butenoāts | 3486 | 2244 | 210–808–7 | 09.248 | etilkrotonāts | | |

09.249 | 21 | 68922–11–2 | 1-metil-2-fenetilbutirāts | 3197 | 2276 | 272–983–6 | 09.249 | 1-fenil-2-propilbutirāts; α-metilfenetilbutirāts | | |

09.250 | 02 | 10588–10–0 | izobutilvalerāts | | 2303 | 234–191–9 | 09.250 | izobutilpentanoāts | 2-metilpropilpentanoāts | |

09.251 | 01 | 110–42–9 | metildekanoāts | | 2304 | 203–766–6 | 09.251 | | | |

09.253 | 25 | 528–79–0 | 2-izopropil-5-metilfenilacetāts | | 2308 | 208–442–8 | 09.253 | timilacetāts; acetiltimols | | |

09.254 | 05 | 4864–61–3 | 3-oktilacetāts | 3583 | 2347 | 225–471–1 | 09.254 | 1-etilheksilacetāts; n-amiletilkarbinilacetāts | 1-etilheksilacetāts | |

09.256 | 01 | 6513–03–7 | propilnonanoāts | | 2351 | 229–403–1 | 09.256 | propilpelargonāts | | |

09.258 | 30 | 3891–59–6 | glikozes pentaacetāts | 2524 | | 223–439–1 | 09.258 | 1,2,3,4,6-pentaacetil-α- D-glikoze; 1,2,3,4,6-pentaacetil-β- D-glikoze; α-pentaacetildekstroglikoze | 1,2,3,4,6-pentaacetil-α- D-glikoze un 1,2,3,4,6-pentaacetil-β- D-glikoze | |

09.260 | 03 | 3025–30–7 | etildeka-2-( cis),4-( trans)-dienoāts | 3148 | 10574 | 221–178–8 | 09.260 | etil-(2E, 4Z)-dekadienoāts | | |

09.261 | 15 | 6290–37–5 | 2-fenetilheksanoāts | 3221 | 10882 | 228–538–3 | 09.261 | 2-feniletilkaproāts; 2-feniletilheksanoāts; benzilkarbinilkaproāts; benzilkarbinilheksanoāts | | |

09.262 | 15 | 5457–70–5 | fenetiloktanoāts | 3222 | 10884 | 226–718–6 | 09.262 | 2-feniletilkaprilāts; benzilkarbiniloktanoāts | | |

09.263 | 30 | 139–45–7 | gliceriltripropionāts | 3286 | 10657 | 205–365–1 | 09.263 | propionskābes triglicerīds; tripropionīns | | 1 |

09.264 | 10 | 84642–61–5 | sek-butān-3-onilbutirāts | 3332 | 10525 | 283–438–7 | 09.264 | acetoilbutirāts; AMC butirāts | 1-metil-2-oksopropilbutanoāts | |

09.265 | 01 | 34495-714 | etilokt-4-enoāts | 3344 | 10619 | 252–065–1 | 09.265 | | | 5 |

09.266 | 01 | 19089–92–0 | heksil-2-butenoāts | 3354 | 10688 | 242–808–8 | 09.266 | | | 5 |

09.267 | 01 | 2396–78–3 | metilheks-3-enoāts | 3364 | 10801 | 219–256–1 | 09.267 | O-heksilheksanolīds | | |

09.268 | 01 | 21063–71–8 | metilokt-4-( cis)-enoāts | 3367 | 10834 | 244–188–4 | 09.268 | | | |

09.269 | 08 | 13851–11–1 | fenhilacetāts | 3390 | 11769 | 237–588–5 | 09.269 | 1,3,3-trimetil-2-norbornanilacetāts | 1,3,3-trimetilbiciklo[2.2.1]heptān-2-ilacetāts | |

09.270 | 04 | 16491–36–4 | heks-3-enilbutirāts | 3402 | 11859 | 240–553–7 | 09.270 | β, γ-heksenil-n-butirats; cis-3-heksenilbutanoāts | | 5 |

09.271 | 04 | 31501–11–8 | heks-3-enilheksenoāts | 3403 | 11779 | 250–661–6 | 09.271 | 3-heksenilkaproāts; cis- 3-heksenilkaproāts | | 5 |

09.272 | 07 | 72928–52–0 | mirtenilformiāts | 3405 | 10858 | 277–082–1 | 09.272 | 2-pinēn-10-ola formiāts | (6,6-dimetilbiciklo[3.3.1]hept-5-en-2-il)metilformiāts | |

09.273 | 02 | 589–66–2 | izobutilkrotonāts | 3432 | 10706 | 209–658–5 | 09.273 | | 2-metilpropilbut-2-( trans)-enoāts | |

09.274 | 01 | 627–90–7 | etilundekanoāts | 3492 | 10633 | 211–018–5 | 09.274 | etilundecilāts; etilhendekanoāts | | |

09.275 | 04 | 1576–77–8 | hept-3-( trans)-enilacetāts | 3493 | 10662 | 216–411–5 | 09.275 | | | |

09.276 | 03 | 3913–80–2 | okt-2-enilacetāts | 3516 | 11906 | 223–473–7 | 09.276 | 2-oktēn-1-ola acetāts, (E)- | | 5 |

09.277 | 03 | 84642–60–4 | okt-2-( trans)-enilbutirāts | 3517 | 11907 | 283–437–1 | 09.277 | trans-2-oktenilbutirāts | | |

09.278 | 07 | 15111–96–3 | p - menta-1,8-diēn-7-ilacetāts | 3561 | 10742 | 239–162–4 | 09.278 | perilacetāts; perililacetāts; perillilacetāts; etiķskābes perillilesteris; mentadiēn-7-karbinilacetāts | | |

09.280 | 09 | 67715–81–5 | nonān-1,4-diildiacetāts | 3579 | 11927 | | 09.280 | nonāndiola-1,4 acetāts | | |

09.281 | 05 | 2442–10–6 | okt-1-ēn-3-ilacetāts | 3582 | 11716 | 219–474–7 | 09.281 | oktenilacetāts; amilvinilkarbinilacetāts; 3-acetoksioktēns; amilkrotonilacetāts; pentilkrotonilacetāts | 1-vinilheksilacetāts | |

09.282 | 05 | 16491–54–6 | okt-1-ēn-3-ilbutirāts | 3612 | | 240–555–8 | 09.282 | | 1-vinilheksilbutirāts | |

09.283 | 01 | 7367–88–6 | etildec-2-enoāts | 3641 | 10577 | 230–918–9 | 09.283 | | | 5 |

09.284 | 01 | 76649–16–6 | etildec-4-enoāts | 3642 | 10578 | 278–509–4 | 09.284 | | | 5 |

09.285 | 01 | 7367–82–0 | etilokt-2-( trans)-enoāts | 3643 | 10617 | 230–913–1 | 09.285 | | | 5 |

09.286 | 02 | 624–41–9 | 2-metilbutilacetāts | 3644 | 10762 | 210–843–8 | 09.286 | | | |

09.287 | 01 | 28316–62–3 | propildeka-2,4-dienoāts | 3648 | 10889 | 248–960–1 | 09.287 | | | 5 |

09.288 | 21 | 3572–06–3 | 4-(4-acetoksifenil)butān-2-ons | 3652 | | 222–682–0 | 09.288 | | | |

09.289 | 07 | 36789–59–0 | α-kamfolena acetāts | 3657 | | 253–212–2 | 09.289 | 1-acetoksi-2-(2,2,3)-trimetil-3-ciklopenteniletāns | 2-(2,2,3-trimetilciklopent-3-enil)etilacetāts | 5 |

09.290 | 01 | 69925–33–3 | etilokta-4,7-dienoāts | 3682 | | | 09.290 | etil-4,7-oktadienoāts | | |

09.291 | 04 | 61444–38–0 | heks-3-enilheks-3-enoāts | 3689 | | 262–797–3 | 09.291 | Z-3-heksenilheksenoāts | | 5 |

09.292 | 01 | 33855–57–1 | heksil-2-heksenoāts | 3692 | | | 09.292 | heksil-E-2-heksenoāts | | |

09.293 | 09 | 52789–73–8 | 1-acetoksi-1-acetilcikloheksāns | 3701 | | 258–186–6 | 09.293 | metil-1-acetoksicikloheksils; 1-acetilcikloheksilacetāts | | |

09.294 | 23 | 17373–93–2 | 2-metilbenzilacetāts | 3702 | | 241–412–2 | 09.294 | | | 5 |

09.298 | 01 | 13481–87–3 | metilnon-3-enoāts | 3710 | | 236–786–9 | 09.298 | | | |

09.299 | 01 | 7367–81–9 | metilokt-2-( trans)-enoāts | 3712 | 11800 | 230–912–6 | 09.299 | metil-E-2-oktenoāts | | 5 |

09.300 | 01 | 689–89–4 | metilheksa-2,4-dienoāts | 3714 | | 211–712–8 | 09.300 | metilsorbāts; metil-2,4-heksadienoāts; metil-E, E-2,4-heksadienoāts | | 5 |

09.301 | 25 | 59558–23–5 | p-toliloktanoāts | 3733 | | 261–803–1 | 09.301 | o-kreziloktanoāts; p-metilfeniloktanoāts; p-krezilkaprilāts | 4-metilfeniloktanoāts | |

09.302 | 07 | 1079–01–2 | mirtenilacetāts | 3765 | 10887 | 214–088–5 | 09.302 | 2-pinēn-10-ola acetāts | (6,6-dimetilbiciklo[3.3.1]hept-2-en-2-il)metilacetāts | |

09.303 | 03 | | hept-2-enilizovalerāts | | 10664 | | 09.303 | | hept-2-enil-3-metilbutanoāts | |

09.304 | 05 | | sek-heptilizovalerāts | | 10806 | | 09.304 | | 1-metilheksil-3-metilbutanoāts | |

09.305 | 08 | 22030–19–9 | β-jonilacetats | 3844 | 10702 | | 09.305 | β-jonola acetats; 3-butēn-2-ola acetāts, 4-(2,6,6-trimetil-1-cikloheksēn-1-il)– | 4-(2,2,6-trimetilcikloheks-1-enil)but-3-ēn-2-ilacetāts | |

09.306 | 22 | | 2-metoksicinamilacetāts | | 10752 | | 09.306 | | 3-(2-metoksifenil)prop-2-enil)acetāts | |

09.307 | 02 | | 2-metilbutildodekanoāts | | 10766 | | 09.307 | | | |

09.311 | 03 | 591–87–7 | alilacetāts | | 11730 | 209–734–8 | 09.311 | | | |

09.312 | 03 | 7493–75–6 | alilheksa-2,4-dienoāts | 2041 | 2182 | 231–336–8 | 09.312 | alilsorbāts | | |

09.313 | 23 | 56423–40–6 | benzil-2-metilbutirāts | | 10523 | 260–169–3 | 09.313 | | | |

09.314 | 23 | 65416–24–2 | benzilkrotonāts | | | 265–764–1 | 09.314 | | benzilbut-2-( trans)-enoāts | |

09.315 | 23 | 140–25–0 | benzildodekanoāts | | | 205–405–8 | 09.315 | benzillaurāts | | |

09.316 | 23 | 6938–45–0 | benzilheksanoāts | | 10521 | 230–068–9 | 09.316 | | | |

09.317 | 23 | 2051–96–9 | benzillaktāts | | | 218–136–6 | 09.317 | | benzil-2-hidroksipropanoāts | |

09.318 | 23 | 10276–85–4 | benziloktanoāts | | | 233–620–7 | 09.318 | | | |

09.319 | 08 | 13109–70–1 | bornilbutirāts | 3907 | | 236–036–0 | 09.319 | bornilbutanoāts; sviestskābes 2-bornilesteris | 1,7,7-trimetilbiciklo[2.2.1]heptān-2-ilbutanoāts | |

09.320 | 09 | 112–07–2 | 2-butoksietilacetāts | | | 203–933–3 | 09.320 | | | |

09.321 | 01 | 7785–64–0 | butil-2-metilbut-2-( cis)-enoāts | | | 232–084–1 | 09.321 | butilangelāts | | |

09.322 | 01 | 6297–41–2 | butil-2-metilvalerāts | | | 228–569–2 | 09.322 | butil-2-metilpentanoāts | | |

09.323 | 05 | 105–46–4 | sek-butilacetāts | | 10527 | 203–300–1 | 09.323 | but-2-ilacetāts | 1-metilpropilacetāts | |

09.324 | 01 | 591–63–9 | butilbut-2-enoāts | | | | 09.324 | | | |

09.325 | 05 | 819–97–6 | sek-butilbutirāts | | 10528 | 212–465–9 | 09.325 | but-2-ilbutirāts | 1-metilpropilbutanoāts | |

09.326 | 01 | 28369–24–6 | butildeka-2,4-dienoāts | | 10529 | 248–994–7 | 09.326 | | | 5 |

09.327 | 01 | 30673–36–0 | butildekanoāts | | 10530 | 250–280–5 | 09.327 | butilkaprāts | | |

09.328 | 05 | 589–40–2 | sek-butilformiāts | | 10532 | | 09.328 | but-2-ilformiāts | 1-metilpropilformiāts | |

09.329 | 01 | 13416–74–5 | butilheks-2-enoāts | | | | 09.329 | | | |

09.330 | 01 | 118869–62–8 | butilheks-3-enoāts | | | | 09.330 | | | |

09.331 | 01 | 111–06–8 | butilheksadekanoāts | | | 203–829–8 | 09.331 | butilpalmitāts | | |

09.332 | 05 | 820–00–8 | sek-butilheksanoāts | | 10533 | | 09.332 | but-2-ilkaproāts; 2-butilheksanoāts | 1-metilpropilheksanoāts | |

09.333 | 09 | 18449–60–0 | sek-butillaktāts | | | 242–334–1 | 09.333 | | 1-metilpropil-2-hidroksipropanoāts | |

09.334 | 01 | 50623–57–9 | butilnonanoāts | | | 256–661–2 | 09.334 | | | |

09.335 | 01 | 57403–32–4 | butilokt-2-enoāts | | 10536 | 260–720–8 | 09.335 | | | |

09.336 | 01 | 110–36–1 | butiltetradekanoāts | | | 203–759–8 | 09.336 | butilmiristāts | | |

09.337 | 25 | 6380–28–5 | karvakrilacetāts | | | 228–963–4 | 09.337 | | 5-izopropil-2-metilfenilacetāts | |

09.338 | 08 | 32214–91–8 | kariofilēnspirta acetāts | | | 250–960–1 | 09.338 | kariofilēna acetāts | 4,11,11-trimetil-8-metilēnbiciklo[7.2.0]undec-3-ēn-5-ilacetāts | |

09.339 | 22 | 61792–12–9 | cinamil-2-metilkrotonāts | | | 263–215–0 | 09.339 | cinamiltiglāts | 3-fenilprop-2-enil-2-metilbut-2-( trans)-enoāts | |

09.340 | 03 | 24717–85–9 | citronelil-2-metilbut-2-enoāts | | | 246–426–2 | 09.340 | | 3,7-dimetilokt-6-enil-2-metilbutanoāts | |

09.341 | 04 | 10580–25–3 | citronelilheksanoāts | | | 234–175–1 | 09.341 | | 3,7-dimetilokt-6-enilheksanoāts | |

09.342 | 07 | 54993–30–5 | ciklogeranilacetāts | | | | 09.342 | | (2,6,6-trimetil-1-cikloheksenil)metilacetāts | |

09.343 | 08 | 1129–47–1 | cikloheksilizobutirāts | | 10548 | 214–448–1 | 09.343 | | cikloheksil-2-metilpropanoāts | |

09.344 | 04 | 50816–18–7 | dec-9-enilacetāts | | | 256–784–1 | 09.344 | rozalvacetāts | | |

09.345 | 09 | 818–04–2 | diizopentilsukcināts | | 10555 | 212–448–6 | 09.345 | diizoamilsukcināts; di-(3-metilbutil)sukcināts | di-(3-metilbutil)butāndionāts | |

09.346 | 30 | 1587–18–4 | dibutilmalāts | | | | 09.346 | | dibutil-2-hidroksibutāndioāts | |

09.347 | 09 | 141–03–7 | dibutilsukcināts | | | 205–449–8 | 09.347 | | dibutilbutāndioāts | |

09.348 | 09 | 141–28–6 | dietiladipāts | | | 205–477–0 | 09.348 | | dietilheksāndioāts | |

09.349 | 30 | 32074–56–9 | dietilcitrāts | | | 250–914–0 | 09.349 | | | |

09.350 | 09 | 623–91–6 | dietilfumarāts | | | 210–819–7 | 09.350 | | dietilbut-2-( trans)-ēndioāts | |

09.351 | 09 | 141–05–9 | dietilmaleāts | | 10551 | 205–451–9 | 09.351 | 2-butēndiskābes dietilesteris; etilmaleāts | dietilbut-2-( cis)-ēndioāts | |

09.352 | 09 | 624–17–9 | dietilnonāndioāts | | 10549 | 210–833–3 | 09.352 | dietilazelāts | | |

09.353 | 09 | 95–92–1 | dietiloksalāts | | | 202–464–1 | 09.353 | | dietiletāndioāts | |

09.354 | 09 | 818–38–2 | dietilpentāndioāts | | | 212–451–2 | 09.354 | | | |

09.355 | 08 | 20777–49–5 | neo-dihidrokarvilacetāts | | 10859 | 244–029–9 | 09.355 | | p-ment-8(9)-ēn-2-ilacetāts | |

09.356 | 06 | 20487–40–5 | 1,1-dimetiletilpropionāts | | | | 09.356 | terc-butilpropionāts | | |

09.358 | 02 | 20780–49–8 | 3,7-dimetiloktilacetāts | | 10899 | 244–034–6 | 09.358 | tetrahidrogeranilacetāts | | |

09.359 | 09 | 111–15–9 | 2-etoksietilacetāts | | 10565 | 203–839–2 | 09.359 | etilēnglikola monoetilētera acetāts | | |

09.360 | 09 | 2985–28–6 | etil-2-acetoksipropionāts | | | | 09.360 | etilacetillaktāts | | |

09.361 | 09 | 27372–03–8 | etil-2-hidroksi-3-metilbutirāts | | 10600 | | 09.361 | | | |

09.362 | 23 | 60770–00–5 | etil-2-hidroksi-4-metilbenzoāts | | | | 09.362 | | | |

09.363 | 23 | 7335–26–4 | etil-2-metoksibenzoāts | | | 230–843–1 | 09.363 | | | |

09.364 | 15 | 2510–99–8 | etil-2-fenilpropionāts | | | 219–727–1 | 09.364 | | | |

09.365 | 01 | 638–10–8 | etil-3-metilkrotonāts | | 10610 | 211–319–1 | 09.365 | etilseneciāts | etil-3-metilbut-2-( trans)-enoāts | |

09.366 | 09 | 121312–01–4 | etil-4-acetoksioktanoāts | | | | 09.366 | | | |

09.367 | 23 | 120–47–8 | etil-4-hidroksibenzoāts | | | 204–399–4 | 09.367 | | | 4 |

09.368 | 01 | 6849–18–9 | etil-4-metilpent-3-enoāts | | 10615 | | 09.368 | | | |

09.370 | 01 | 67233–91–4 | etildec-9-enoāts | | 10579 | | 09.370 | | | |

09.371 | 01 | 78417–28–4 | etildeka-2,4,7-trienoāts | 3832 | 10576 | | 09.371 | etildeka-2,4,7-trienoāts; 2,4,7-dekatriēnskābes etilesteris | | |

09.372 | 01 | 28290–90–6 | etildodec-2-enoāts | | 10584 | | 09.372 | | | |

09.373 | 01 | 32659–21–5 | etilgeranāts | | | 251–144–8 | 09.373 | | etil-3,7-dimetilokta-2-( trans),6-dienoāts | |

09.374 | 01 | 54340–72–6 | etilhept-2-enoāts | | | | 09.374 | | | |

09.375 | 01 | 97–63–2 | etilmetakrilāts | | | 202–597–5 | 09.375 | | etil-2-metilprop-2-enoāts | |

09.376 | 01 | 26553–47–9 | etilokt-3-( trans)-enoāts | | | 247–799–4 | 09.376 | | | |

09.377 | 01 | 1117–65–3 | etilokt-3-enoāts | | 10618 | | 09.377 | | | |

09.378 | 01 | 78989–37–4 | etilokt-4-( trans)-enoāts | | | 279–035–0 | 09.378 | | | |

09.379 | 01 | 2445–93–4 | etilpent-2-enoāts | | 10623 | 219–500–7 | 09.379 | | | |

09.380 | 01 | 41114–00–5 | etilpentadekanoāts | | 10622 | 255–223–8 | 09.380 | | | |

09.381 | 02 | 103–09–3 | 2-etilheksilacetāts | | | 203–079–1 | 09.381 | β-etilheksilacetāts; 2-etilheksanilacetāts | | |

09.382 | 03 | 68705–63–5 | geranil-2-metilbutirāts | | | 272–100–4 | 09.382 | | 3,7-dimetil-2-( trans),6-oktadienil-2-metilbutanoāts | |

09.383 | 03 | 7785–33–3 | geranil-2-metilkrotonāts | | 11829 | 232–078–9 | 09.383 | geraniltiglāts | 3,7-dimetil-2-( trans),6-oktadienil-2-metilbut-2-( trans)-enoāts | |

09.384 | 03 | 51532–26–4 | geraniloktanoāts | | | 257–256–3 | 09.384 | geranilkaprilāts | 3,7-dimetilokta-2-( trans),6-dieniloktanoāts | |

09.385 | 03 | 16939–73–4 | hept-2-enilacetāts | | 10661 | 241–002–3 | 09.385 | | | 5 |

09.386 | 05 | 94088–33–2 | sek-hept-4-( cis)-enilacetāts | | | 302–032–3 | 09.386 | | 1-metilheks-3-( cis)-enilacetāts | |

09.387 | 01 | 50862–12–9 | heptil-2-metilbutirāts | | 10668 | 256–811–7 | 09.387 | | | |

09.388 | 05 | 5921–82–4 | sek-heptilacetāts | | 10802 | 227–647–3 | 09.388 | | 1-metilheksilacetāts | |

09.390 | 01 | 6976–72–3 | heptilheksanoāts | | 10666 | 230–239–8 | 09.390 | | | |

09.391 | 05 | 6624–58–4 | sek-heptilheksanoāts | | 10805 | 229–582–6 | 09.391 | | 1-metilheksilheksanoāts | |

09.392 | 01 | 56423–43–9 | heptilizovalerāts | | 10667 | 260–170–9 | 09.392 | | heptil-3-metilbutanoāts | |

09.393 | 01 | 5451–80–9 | heptilvalerāts | | 10672 | 226–686–3 | 09.393 | heptilpentanoāts | | |

09.394 | 03 | 2497–18–9 | heks-2-( trans)-enilacetāts | 2564 | 643 | 219–680–7 | 09.394 | trans-2-heksenilacetāts; 2-heksēn-1-ilacetāts | | 5 |

09.395 | 03 | 53398–80–4 | heks-2-( trans)-enilpropionāts | 3932 | 11830 | 258–513–2 | 09.395 | 2-heksenilpropanoāts; (E)-heks-2-enilpropionāts; trans- 2-heksenilpropionāts | | |

09.396 | 03 | 53398–83–7 | heks-2-enilbutirāts | 3926 | | 258–515–3 | 09.396 | | | 5 |

09.397 | 03 | 53398–78–0 | heks-2-enilformiāts | 3927 | 11858 | 258–512–7 | 09.397 | (E)-heks-2-enilformiāts; trans-2-heksenilformiāts | | 5 |

09.398 | 03 | 53398–86–0 | heks-2-enilheksanoāts | | | 258–519–5 | 09.398 | | | 5 |

09.399 | 03 | 35154–45–1 | heks-2-enilizovalerāts | 3930 | | 252–404–3 | 09.399 | | heks-2-enil-3-metilbutanoāts | 5 |

09.400 | 15 | 68133–78–8 | heks-2-enilfenilacetāts | | | 268–705–8 | 09.400 | | | 5 |

09.401 | 09 | 2308–18–1 | izopentilacetoacetāts | 3551 | 227 | 218–991–5 | 09.401 | 3-metilbutilacetoacetāts; pentil-3-oksobutanoāts; izoamil-β-ketobutirats | 3-metilbutil-3-oksobutanoāts | |

09.402 | 09 | 141–97–9 | etilacetoacetāts | 2415 | 240 | 205–516–1 | 09.402 | etilacetilacetāts; etil-β-ketobutirats; acetetiķskābes esteris | etil-3-oksobutanoāts | |

09.403 | 09 | 591–60–6 | butilacetoacetāts | 2176 | 241 | 209–722–2 | 09.403 | butil-3-ketobutanoāts; butil-3-ketobutirāts | butil-3-oksobutanoāts | |

09.404 | 09 | 7779–75–1 | izobutilacetoacetāts | 2177 | 242 | 231–937–5 | 09.404 | izobutil-β-ketobutirats; izobutil-3-oksobutanoāts; 2-metil-1-propilacetoacetāts; izobutil-3-ketobutanoāts | 2-metilpropil-3-oksobutanoāts | |

09.405 | 09 | 10032–00–5 | geranilacetoacetāts | 2510 | 243 | 233–101–5 | 09.405 | geranil-3-oksobutanoāts; geranil-β-ketobutirats; trans- 3,7-dimetil-2,6-oktadiēn-1-ilacetoacetāts | 3,7-dimetilokta-2-( trans),6-dienil-3-oksobutanoāts | |

09.406 | 23 | 5396–89–4 | benzil-3-oksobutirāts | 2136 | 244 | 226–416–4 | 09.406 | benzilacetilacetāts; benzil-3-oksobutanoāts; benzil-β-ketobutirāts | | |

09.407 | 15 | 42078–65–9 | 2-fenetil-3-metilkrotonāts | 2869 | 246 | 255–649–4 | 09.407 | 2-feniletil-3-metil-2-butenoāts; 2-fenetilseneciāts; fenetil-3, 4-dimetilakrilāts | 2-feniletil-3-metilbut-2-( trans)-enoāts | |

09.408 | 02 | 7779–81–9 | izobutil-2-metilbut-2-( cis)-enoāts | 2180 | 247 | 231–941–7 | 09.408 | izobutilangelāts; izobutil- cis-2-metil-2-butenoāts | 2-metilpropil-2-metilbut-2-( cis)-enoāts | 5 |

09.409 | 01 | 7452–79–1 | etil-2-metilbutirāts | 2443 | 265 | 231–225–4 | 09.409 | etil-2-metilbutanoāts | | |

09.410 | 03 | 7493–69–8 | alil-2-etilbutirāts | 2029 | 281 | 231–332–6 | 09.410 | 2-propenil-2-etilbutanoāts; 2-propenil-2-etilbutirāts | | |

09.411 | 03 | 7493–65–4 | alilcikloheksānbutirāts | 2024 | 283 | | 09.411 | alil-4-cikloheksilbutirāts; 2-propēn-1-ilcikloheksānbutirāts; alilheksahidrofenilbutirāts; alilcikloheksilbutirāts | | |

09.412 | 01 | 547–63–7 | metilizobutirāts | 2694 | 287 | 208–929–5 | 09.412 | metildimetilacetāts; metil-2-metilpropionāts | metil-2-metilpropanoāts | |

09.413 | 01 | 97–62–1 | etilizobutirāts | 2428 | 288 | 202–595–4 | 09.413 | etilizobutanoāts; etil-2-metilpropanoāts; propānskābes etilesteris, 2-metil- | etil-2-metilpropanoāts | |

09.414 | 01 | 644–49–5 | propilizobutirāts | 2936 | 289 | 211–417–4 | 09.414 | | propil-2-metilpropanoāts | |

09.415 | 05 | 617–50–5 | izopropilizobutirāts | 2937 | 290 | 210–517–5 | 09.415 | izopropilizobutirāts; izopropil-2-metilpropanoāts; izoropil-2-metilpropanoāts | izopropil-2-metilpropanoāts | |

09.416 | 01 | 97–87–0 | butilizobutirāts | 2188 | 291 | 202–614–6 | 09.416 | butil-2-metilpropionāts; n-butil-2-metilpropanoāts | izobutil-2-metilpropanoāts | |

09.417 | 02 | 97–85–8 | izobutilizobutirāts | 2189 | 292 | 202–612–5 | 09.417 | izobutil-2-metilpropionāts; 2-metil-1-propil-2-metilpropanoāts; izobutil-2-metilpropanoāts | 2-metilpropil-2-metilpropanoāts | |

09.418 | 01 | 2445–72–9 | pentilizobutirāts | | 293 | 219–494–6 | 09.418 | amilizobutirāts | pentil-2-metilpropanoāts | |

09.419 | 02 | 2050–01–3 | izopentilizobutirāts | 3507 | 294 | 218–078–1 | 09.419 | izopentil-2-metilpropanoāts | 3-metilbutil-2-metilpropanoāts | |

09.420 | 01 | 2349–13–5 | heptilizobutirāts | 2550 | 295 | 219–076–3 | 09.420 | heptil-2-metilpropanoāts | heptil-2-metilpropanoāts | |

09.421 | 04 | 97–89–2 | citronelilizobutirāts | 2313 | 296 | 202–616–7 | 09.421 | citronelil-2-metilpropionāts; 3,7-dimetil-6-oktēn-1-ilizobutirāts; 3,7-dimetil-6-oktēn-1-ilmetilpropanoāts | 3,7-dimetilokt-6-enil-2-metilpropanoāts | |

09.423 | 06 | 78–35–3 | linalilizobutirāts | 2640 | 298 | 201–108–2 | 09.423 | linalil-2-metilpropionāts; 3,7-dimetil-1,6-oktadiēn-3-ilizobutirāts; linaloola izobutirāts | 1,5-dimetil-1-vinilheks-4-enil-2-metilpropanoāts | |

09.424 | 03 | 2345–24–6 | nerilizobutirāts | 2775 | 299 | 219–061–1 | 09.424 | cis- 3,7-dimetil-2, 6-oktadiēn-1-ilizobutirāts | 3,7-dimetil-2-( cis), 6-oktadienil-2-metilpropanoāts | |

09.425 | 06 | 7774–65–4 | terpinil-2-metilpropionāts | 3050 | 300 | 231–878–5 | 09.425 | terpinilizobutirāts; 1-metil-1-(4-metilcikloheks-3-enil)etil-2-metilpropionāts | p-ment-1-ēn-8-ilizobutirāts | |

09.426 | 23 | 103–28–6 | benzilizobutirāts | 2141 | 301 | 203–095–9 | 09.426 | benzil-2-metilpropanoāts | benzil-2-metilpropanoāts | |

09.427 | 15 | 103–48–0 | fenetilizobutirāts | 2862 | 302 | 203–116–1 | 09.427 | 2-fenetilizobutirāts; 2-feniletilizobutirāts; benzilkarbinil-2-metilpropanoāts; fenetil-2-metilpropanoāts | 2-feniletil-2-metilpropanoāts | |

09.428 | 22 | 103–58–2 | 3-fenilpropilizobutirāts | 2893 | 303 | 203–125–0 | 09.428 | hidrocinamilizobutirāts; hidrocinamil-2-metilpropanoāts | 3-fenilpropil-2-metilpropanoāts | |

09.429 | 25 | 103–93–5 | p-tolilizobutirāts | 3075 | 304 | 203–159–6 | 09.429 | p-krezilizobutirāts; p-metilfenil-2-metilpropanoāts; p-metilfenilizobutirāts; p-tolil-2-metilpropanoāts | 4-metilfenil-2-metilpropanoāts | |

09.430 | 23 | 5461–08–5 | piperonilizobutirāts | 2913 | 305 | 226–745–3 | 09.430 | piperonil-2-metilpropionāts; 3,4-metilēndioksibenzil-2-metilpropanoāts; heliotropil-2-metilpropanoāts | 3,4-metilēndioksibenzil-2-metilpropanoāts | |

09.431 | 03 | 2345–26–8 | geranilizobutirāts | 2513 | 306 | 219–062–7 | 09.431 | geranil-2-metilpropionāts; trans- 3,7-dimetil-2,6-oktadiēn-1-ilizobutirāts | 3,7-dimetilokta-2-( trans), 6-dienil-2-metilpropanoāts | |

09.432 | 01 | 2412–80–8 | metil-4-metilvalerāts | 2721 | 322 | 219–320–9 | 09.432 | metil-4-metilpentanoāts; metilizokaproāts; metilizobutilacetāts | | |

09.433 | 09 | 97–64–3 | etillaktāts | 2440 | 371 | 202–598–0 | 09.433 | etil-α-hidroksipropionāts | etil-2-hidroksipropanoāts | |

09.434 | 09 | 138–22–7 | butillaktāts | 2205 | 372 | 205–316–4 | 09.434 | butil-α-hidroksipropionāts; butilhidroksipropanoāts | butil-2-hidroksipropanoāts | |

09.435 | 09 | 539–88–8 | etil-4-oksovalerāts | 2442 | 373 | 208–728–2 | 09.435 | etillevulināts; etil-4-ketovalerāts; etilacetilpropanoāts; etillevulāts | | |

09.436 | 09 | 2052–15–5 | butil-4-oksovalerāts | 2207 | 374 | 218–143–4 | 09.436 | butillevulināts; butil-4-ketovalerāts; butil-4-oksopentanoāts; butilacetilpropionāts | | |

09.439 | 30 | 7554–12–3 | dietilmalāts | 2374 | 382 | 231–444–5 | 09.439 | dietilhidroksisukcināts; etilmalāts | dietil-2-hidroksibutāndioāts | |

09.441 | 09 | 17373–84–1 | butiletilmalonāts | 2195 | 384 | | 09.441 | etilbutilmalonāts | butiletilpropāndioāts | |

09.442 | 09 | 617–35–6 | etilpiruvāts | 2457 | 430 | 210–511–2 | 09.442 | etilacetilformiāts; etil-α-ketopropionats; etilpiroracemāts | etil-2-oksopropanoāts | |

09.443 | 09 | 7779–72–8 | izopentilpiruvāts | 2083 | 431 | 231–934–9 | 09.443 | izoamil-2-oksopropanoāts | 3-metilbutil-2-oksopropanoāts | |

09.444 | 09 | 123–25–1 | dietilsukcināts | 2377 | 438 | 204–612–0 | 09.444 | dietilbutāndioāts; dietiletāndikarboksilāts; etilsukcināts | dietilbutāndioāts | |

09.445 | 09 | 106–65–0 | dimetilsukcināts | 2396 | 439 | 203–419–9 | 09.445 | dimetilbutāndioāts; metilsukcināts | dimetilbutāndioāts | |

09.446 | 30 | 87–91–2 | dietiltartrāts | 2378 | 440 | 201–783–3 | 09.446 | dietil-2,3-dihidroksibutāndioāts; etiltartrāts; dietil-2,3-dihidroksisukcināts | dietil-2,3-dihidroksibutāndioāts | |

09.447 | 01 | 108–64–5 | etilizovalerāts | 2463 | 442 | 203–602–3 | 09.447 | etil-β-metilbutirats; etilizopentanoāts | etil-3-metilbutanoāts | |

09.448 | 01 | 557–00–6 | propilizovalerāts | 2960 | 443 | 209–148–2 | 09.448 | propilizovalerāts; propil-3-metilbutanoāts; propilizopentanoāts; propil-3-metilbutirāts | | |

09.449 | 01 | 109–19–3 | butilizovalerāts | 2218 | 444 | 203–654–7 | 09.449 | butilizovalerāts; butilizopentanoāts | butil-3-metilbutanoāts | |

09.450 | 05 | 32665–23–9 | izopropilizovalerāts | 2961 | 445 | 251–145–3 | 09.450 | izopropilizovalerāts; izopropilizopentanoāts | izopropil-3-metilbutanoāts | |

09.451 | 01 | 7786–58–5 | oktilizovalerāts | 2814 | 446 | 232–100–7 | 09.451 | oktilizovalerāts; oktilpentanoāts; oktil-3-metilbutirāts | oktil-3-metilbutanoāts | |

9.452 | 01 | 7786–47–2 | nonilizovalerāts | 2791 | 447 | 232–098–8 | 9.452 | nonilizovalerāts; nonilizopentanoāts | nonil-3-metilbutanoāts | |

09.453 | 03 | 109–20–6 | geranilizovalerāts | 2518 | 448 | 203–655–2 | 09.453 | geranil-3-metilbutirāts; trans- 3,7-dimetil-2,6-oktadiēn-1-ilizopentanoāts | 3,7-dimetilokta-2-( trans), 6-dienil-3-metilbutanoāts | |

09.454 | 06 | 1118–27–0 | linalilizovalerāts | 2646 | 449 | 214–259–4 | 09.454 | linalil-3-metilbutirāts; 3,7-dimetil-1,6-oktadiēn-3-ilizovalerāts; linalilizopentanoāts; linalilizovalerāts | 1,5-dimetil-1-vinilheks-4-enil-3-metilbutanoāts | |

09.455 | 08 | 16409–46–4 | mentilizovalerāts | 2669 | 450 | 240–460–1 | 09.455 | p-ment-3-ilizovalerāts; mentilizovalerāts; 1-izopropil-4-metilcikloheks-2-il-3-metilbutanoāts | 2-izopropil-5-metilcikloheksanil-3-metilbutanoāts | |

09.456 | 08 | 76–50–6 | bornilizovalerāts | 2165 | 451 | 200–966–5 | 09.456 | bornil-3-metilbutirāts; bornilizovalerāts; bornilizopentanoāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-3-metilbutanoāts | |

09.457 | 08 | 7779–73–9 | izobornilizovalerāts | 2166 | 452 | 231–935–4 | 09.457 | izobornil-3-metilbutirāts; izobornilizovalerāts; izobornilizopentanoāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-3-metilbutanoāts | |

09.458 | 23 | 103–38–8 | benzilizovalerāts | 2152 | 453 | 203–106–7 | 09.458 | benzilizovalerāts; benzilizopentanoāts | benzil-3-metilbutanoāts | |

09.459 | 22 | 140–27–2 | cinamilizovalerāts | 2302 | 454 | 205–407–9 | 09.459 | cinamil-3-metilbutirāts; cinamilizovalerāts; 3-fenilalilizovalerāts; 3-fenil-2-propēn-1-il-3-metilbutanoāts | 3-fenilprop-2-enil-3-metilbutanoāts | |

09.460 | 04 | 68922–10–1 | citronelilizovalerāts | | 455 | 272–982–0 | 09.460 | citronelilizopentanoāts | 3,7-dimetilokt-6-enil-3-metilbutanoāts | |

09.461 | 06 | 1142–85–4 | terpinilizovalerāts | 3054 | 456 | | 09.461 | p-ment-1-ēn-8-ilizovalerāts; terpinilizopentanoāts; p-ment-1-ēn-8-il-3-metilbutirāts | p-ment-1-ēn-8-il-3-metilbutanoāts | |

09.462 | 01 | 556–24–1 | metilizovalerāts | 2753 | 457 | 209–117–3 | 09.462 | metilizovalerāts; metil-β-metilbutirats | metil-3-metilbutanoāts | |

09.463 | 02 | 659–70–1 | 3-metilbutil-3-metilbutirāts | 2085 | 458 | 211–536–1 | 09.463 | izoamilizopentanoāts; izopentilizopentanoāts; izoamil-β-metilbutirats | | |

09.464 | 08 | 7774–44–9 | cikloheksilizovalerāts | 2355 | 459 | 231–874–3 | 09.464 | cikloheksilizovalerāts; cikloheksilizopentanoāts | cikloheksil-3-metilbutanoāts | |

09.465 | 04 | 7778–96–3 | rodinilizovalerāts | 2987 | 460 | 231–919–7 | 09.465 | α-citronelilizopentanoats | 3,7-dimetilokt-7-enil-3-metilbutanoāts | 5 |

09.466 | 15 | 140–26–1 | fenetilizovalerāts | 2871 | 461 | 205–406–3 | 09.466 | feniletilizopentanoāts; 2-feniletilizovalerāts; benzilkarbinil-3-metilbutanoāts | 2-feniletil-3-metilbutanoāts | |

09.467 | 22 | 5452–07–3 | 3-fenilpropilizovalerāts | 2899 | 462 | 226–692–6 | 09.467 | hidrocinamilizovalerāts; 3-fenilpropilizovalerāts; hidrocinamil-3-metilbutanoāts; 3-fenilpropilizopentanoāts | 3-fenilpropil-3-metilbutanoāts | |

09.468 | 22 | 7493–80–3 | α-pentilcinamilizovalerats | 2067 | 463 | | 09.468 | α-amilcinamil-3-metilbutirats; α-n-amil-β-fenilakrilizovalerāts; floksīna izovalerāts | 2-pentil-3-fenilprop-2-enil-3-metilbutanoāts | |

09.469 | 03 | 7493–68–7 | alilcikloheksānvalerāts | 2027 | 474 | | 09.469 | alil-5-cikloheksilpentanoāts; alilcikloheksānpentanoāts; 2-propēn-1-ilcikloheksānvalerāts | | |

09.470 | 22 | 103–59–3 | cinamilizobutirāts | 2297 | 496 | 203–126–6 | 09.470 | cinamil-2-metilpropionāts; cinamil-2-metilpropanoāts; 3-fenil-2-propēn-1-ilizobutirāts | 3-fenilprop-2-enil-2-metilpropanoāts | |

09.471 | 03 | 3915–83–1 | nerilizovalerāts | 2778 | 508 | 223–478–4 | 09.471 | neril-β-metilbutirats; neril-3-metilbutirāts; nerilizovalerāts; cis- 3,7-dimetil-2,6-oktadiēn-1-ilpentanoāts | 3,7-dimetil-2-( cis), 6-oktadienil-3-metilbutanoāts | |

09.472 | 02 | 589–59–3 | izobutilizovalerāts | 3369 | 568 | 209–653–8 | 09.472 | | 2-metilpropil-3-metilbutanoāts | |

09.473 | 01 | 109–15–9 | oktilizobutirāts | 2808 | 593 | 203–651–0 | 09.473 | | oktil-2-metilpropanoāts | |

09.474 | 09 | 109–43–3 | dibutilsebacāts | 2373 | 622 | 203–672–5 | 09.474 | butilsebacāts; dibutildekāndioāts; dibutil-1,8-oktāndikarboksilāts | dibutildekān-1,10-dioāts | |

09.475 | 09 | 110–40–7 | dietilsebacāts | 2376 | 623 | 203–764–5 | 09.475 | dietil-1,8-oktāndikarboksilāts; etilsebacāts | dietildekāndioāts | |

09.476 | 30 | 94–02–0 | etil-3-fenil-3-oksopropionāts | 2423 | 627 | 202–295–3 | 09.476 | etilbenzoilacetāts; etil-3-fenil-3-oksopropanoāts; etil-β-keto-β-fenilpropionats | | |

09.478 | 01 | 2349–07–7 | heksilizobutirāts | 3172 | 646 | 219–075–8 | 09.478 | | heksil-2-metilpropanoāts | |

09.480 | 25 | 36438–54–7 | o-tolilizobutirāts | 3753 | 681 | | 09.480 | | 2-metilfenil-2-metilpropanoāts | |

09.481 | 01 | 105–58–8 | dietilkarbonāts | | 710 | 203–311–1 | 09.481 | | | |

09.482 | 03 | 4728–82–9 | alilcikloheksānacetāts | 2023 | 2070 | 225–230–0 | 09.482 | alilcikloheksilacetāts; 2-propēn-1-ilcikloheksānacetāts | | |

09.483 | 01 | 868–57–5 | metil-2-metilbutirāts | 2719 | 2085 | 212–778–0 | 09.483 | metilmetiletilacetāts; metil-2-metilbutanoāts | | |

09.484 | 06 | 10031–71–7 | 1,1-dimetil-3-fenilpropilizobutirāts | 2736 | 2086 | 233–092–8 | 09.484 | dimetilfenetilkarbinilizobutirāts; 2-metil-4-fenil-2-butilizobutirāts; 2-metil-4-fenil-2-butil-2-metilpropanoāts | 1,1-dimetil-3-fenilpropil-2-metilpropanoāts | |

09.485 | 22 | 65813–53–8 | 2-fenilpropilizobutirāts | 2892 | 2087 | 265–931–9 | 09.485 | 2-metil-2-feniletil-2-metilpropanoāts; 2-α-fenilpropilspirta izosviestskābes esteris; hidratropilizobutirāts | 2-fenilpropil-2-metilpropanoāts | |

09.486 | 21 | 7775–39–5 | 1-fenetilizobutirāts | 2687 | 2088 | 231–894–2 | 09.486 | α-metilbenzilizobutirats; stiralilizobutirāts; metilfenilkarbinilbutirāts; 1-fenil-1-etil-2-metilpropanoāts; metilfenilkarbinilizobutirāts | 1-(2-feniletil)- 2-metilpropanoāts | |

09.487 | 15 | 103–60–6 | 2-fenoksietilizobutirāts | 2873 | 2089 | 203–127–1 | 09.487 | 2-fenoksietil-2-metilpropanoāts; etilēnglikola monofenilētera izobutirāts; fenilcelosolva izobutirāts | 2-fenoksietil-2-metilpropanoāts | |

09.488 | 01 | 10094–36–7 | etilcikloheksānpropionāts | 2431 | 2095 | 233–222–3 | 09.488 | etil-3-cikloheksilpropionāts; etilheksahidrofenilpropionāts | | |

09.489 | 03 | 2835–39–4 | alilizovalerāts | 2045 | 2098 | 220–609–7 | 09.489 | 2-propenilizopentanoāts; alilizopentanoāts; alilizovalerāts; 2-propenil-3-metilbutanoāts | alil-3-metilbutanoāts | |

09.490 | 09 | 105–53–3 | dietilmalonāts | 2375 | 2106 | 203–305–9 | 09.490 | etilmalonāts; malonskābes esteris; etilpropāndioāts; etilmetāndikarboksilāts | dietilpropāndioāts | |

09.491 | 09 | 7492–70–8 | butil- o - butirillaktāts | 2190 | 2107 | 231–326–3 | 09.491 | butilbutirolaktāts; butil-α-butiroksipropionāts; butil-2-(propilkarboksi)propionāts | butil-2-butanoiloksipropanoāts | |

09.492 | 03 | 7493–66–5 | alilcikloheksānheksanoāts | 2025 | 2180 | | 09.492 | alil-3-cikloheksilheksanoāts; alilheksahidrofenilheksanoāts; alilcikloheksānkaproāts | | |

09.493 | 03 | 7493–71–2 | alil-2-metilkrotonāts | 2043 | 2183 | 231–333–1 | 09.493 | aliltiglāts; alil- trans- 2,3-dimetilakrilāts; alil- trans- 2-metil-2-butenoāts; alil-2-metilkrotonāts | alil-2-metilbut-2-( trans)-enoāts | |

09.494 | 23 | 37526–88–8 | benzil-2-metilkrotonāts | 3330 | 2184 | 253–544–8 | 09.494 | benziltiglāts; benzil- trans-2,3-dimetilakrilāts; benzil- trans- 2-metilkrotonāts | benzil-2-metilbut-2-( trans)-enoāts | |

09.495 | 01 | 5837–78–5 | etil-2-metilkrotonāts | 2460 | 2185 | 227–425–6 | 09.495 | etiltiglāts; etil- trans-2,3-dimetilakrilāts; etil-( trans)-2-metilkrotonāts; tiglīnskābes etilesteris | etil-2-metilbut-2-( trans)-enoāts | |

09.496 | 15 | 55719–85–2 | fenetil-2-metilkrotonāts | 2870 | 2186 | 259–774–5 | 09.496 | fenetiltiglāts; 2-feniletiltiglāts; 2-feniletil- trans-2,3-dimetilakrilāts; 2-feniletil- trans-2-metilbutenoāts | 2-feniletil-2-metilbut-2-( trans)-enoāts | |

09.497 | 09 | 94022–04–5 | butil- o - butirilglikolāts | | 2188 | 301–496–4 | 09.497 | | | |

09.498 | 03 | 2705–87–5 | alilcikloheksānpropionāts | 2026 | 2223 | 220–292–5 | 09.498 | alil-3-cikloheksilpropionāts; 2-propēn-1-ilcikloheksānpropionāts; alilheksahidrofenilpropionāts | | |

09.499 | 01 | 25415–62–7 | pentilizovalerāts | | 2224 | 246–954–3 | 09.499 | amilizopentanoāts; pentil-3-metilbutirāts; pentil-3-metilbutanoāts; n-amilizovalerāts | pentil-3-metilbutanoāts | |

09.501 | 21 | 620–79–1 | etil-2-acetil-3-fenilpropionāts | 2416 | 2241 | 210–651–4 | 09.501 | etil-2-benzilacetoacetāts; etil-2-acetildihidrocinamāts; etil-α-acetilhidrocinamāts | | |

09.502 | 09 | 71662–27–6 | etilbutirillaktāts | | 2242 | 275–793–1 | 09.502 | etil- o — butirillaktāts | etil-2-(butoksikarbonil)propanoāts | |

09.505 | 04 | 10032–11–8 | heks-3-enilizovalerāts | 3498 | 2344 | 233–104–1 | 09.505 | 3-heksenilizopentanoāts;3-heksenilizovalerāts | heks-3-enil-3-metilbutanoāts | |

09.506 | 04 | 10094–41–4 | heks-3-enil-2-metilbutirāts | 3497 | 2345 | 233–224–4 | 09.506 | 3-heksenil-2-metilbutirāts; cis- 3-heksenil-α-metilbutirāts; heks-3-enil-2-metilbutanoāts | | |

09.507 | 01 | 10032–15–2 | heksil-2-metilbutirāts | 3499 | 4132 | 233–106–2 | 09.507 | | | |

09.508 | 23 | 7492–69–5 | benzil-2,3-dimetilkrotonāts | 2143 | 11868 | | 09.508 | benzilmetiltiglāts; benzil-2,3-dimetil-2-butenoāts | benzil-2,3-dimetilbut-2-( trans)-enoāts | |

09.509 | 06 | 7774–60–9 | 1-metil-1-fenetilizobutirāts | 2388 | 11828 | 231–876–4 | 09.509 | dimetilfenilkarbinilizobutirāts; fenilpropān-2-il-2-metilpropionāts; α, α-dimetilbenzilizobutirāts; 2-fenilpropān-2-il-2-metilpropanoāts | 1-metil-1-(2-feniletil)- 2-metilpropanoāts | |

09.510 | 30 | 1321–30–8 | etilakonitāts | 2417 | 11845 | | 09.510 | trietilakonitāts; etil-1-propēn-1,2,3-trikarboksilāts; etil-2-karboksiglutakonāts | trietilpropēn-1,2,3-trikarboksilāts | |

09.511 | 30 | 77–90–7 | tributilacetilcitrāts | 3080 | | 201–067–0 | 09.511 | acetiltributilcitrāts | tributil-2-acetoksi-1,2,3-propāntrikarboksilāts | |

09.512 | 30 | 77–93–0 | trietilcitrāts | 3083 | 11762 | 201–070–7 | 09.512 | etilcitrāts | trietil-2-hidroksi-1,2,3-propāntrikarboksilāts | 1 |

09.513 | 05 | 1733–25–1 | izopropil-2-metilkrotonāts | 3229 | 10733 | 217–067–9 | 09.513 | propilizotiglāts; izopropiltiglāts; propilizo-α-metilkrotonāts; izopropil-α-metilkrotonāts | izopropil-2-metilbut-2-( trans)-enoāts | |

09.514 | 30 | 13246–52–1 | etil-2,4-dioksoheksanoāts | 3278 | 11903 | 236–228–4 | 09.514 | etilpropionilpiruvāts; etil-2,4-diketokaproāts; etilpropionilpiruvāts | | |

09.515 | 03 | 73019–14–4 | geranil-2-etilbutirāts | 3339 | 11667 | 277–234–7 | 09.515 | | 3,7-dimetil-2-( trans), 6-oktadienil-2-etilbutanoāts | |

09.516 | 02 | 2445–78–5 | 2-metilbutil-2-metilbutirāts | 3359 | 10773 | 219–497–2 | 09.516 | 2-metilbutil-2-metilbutanoāts | | |

09.517 | 01 | 2270–60–2 | metilcitronelāts | 3361 | 10781 | 218–874–9 | 09.517 | metil-3,7-dimetilokt-6-enoāts | metil-3,7-dimetilokt-6-enoāts | |

09.518 | 25 | 55066–56–3 | 4-metilfenilizovalerāts | 3387 | 10545 | 259–465–5 | 09.518 | p - krezilizopentanoāts; 4-metilfenil-3-metilbutirāts; p-tolilizovalerāts; p-tolil-3-metilbutirāts | 4-metilfenil-3-metilbutanoāts | |

09.519 | 01 | 15706–73–7 | butil-2-metilbutirāts | 3393 | 10534 | 239–798–2 | 09.519 | | | |

09.520 | 30 | 24851–98–7 | metil-3-okso-2-pentil-1-ciklopentilacetāts | 3408 | 10785 | 246–495–9 | 09.520 | hedions; etildihidrojasmonāts; metil-2-pentil-3-okso-1-ciklopentilacetāts; dihidrojasmīnskābes (E) metilesteris | | |

09.521 | 30 | 39924–52–2 | metil-3-okso-2-pent-2-enil-1-ciklopentilacetāts | 3410 | 10821 | 214–918–6 | 09.521 | metiljasmonāts; 2-pentenilciklopentanon-3-etiķskābes metilesteris; metil-(2-pent-2-enil-3-okso-1-ciklopentil)acetāts | | |

09.522 | 09 | 5405–41–4 | Etil-3-hidroksibutirāts | 3428 | 10596 | 226–456–2 | 09.522 | Etil-3-hidroksibutanoāts; etil-β-hidroksibutirāts | | |

09.523 | 01 | 6624–71–1 | dodecilizobutirāts | 3452 | 10563 | 229–583–1 | 09.523 | dodecil-2-metilpropanoāts; laurilizobutirāts; lauril-2-metilpropionāts | dodecil-2-metilpropanoāts | |

09.524 | 01 | 1617–23–8 | etil-2-metilpent-3-enoāts | 3456 | 10612 | 216–572–1 | 09.524 | | | |

09.525 | 12 | 65416–14–0 | maltilizobutirāts | 3462 | 10739 | 265–755–2 | 09.525 | 2-metil-4-piron-3-il-2-metilpropanoāts; maltil-2-metilpropanoāts | 2-metil-4H-pirān-4-on-3-il-2-metilpropanoāts | |

09.526 | 01 | 39255–32–8 | etil-2-metilvalerāts | 3488 | 10616 | 254–384–1 | 09.526 | etil-2-metilpentanoāts | | |

09.527 | 01 | 53399–81–8 | etil-2-metilpent-4-enoāts | 3489 | 10613 | 258–520–0 | 09.527 | | | |

09.528 | 04 | | trans- 3-heptenilizobutirāts | 3494 | 10663 | | 09.528 | hept-3-( trans)-enilizobutirāts | hept-3-( trans)-enil-2-metilpropanoāts | |

09.529 | 01 | 10032–13–0 | heksilizovalerāts | 3500 | 10692 | 233–105–7 | 09.529 | heksilizopentanoāts; heksilizovalerāts | heksil-3-metilbutanoāts | |

09.530 | 02 | 27625–35–0 | izopentil-2-metilbutirāts | 3505 | 10721 | 248–581–1 | 09.530 | izoamil-2-metilbutanoāts; izopentil-2-metilbutanoāts; izoamil-2-metilbutanoāts | 3-metilbutil-2-metilbutanoāts | |

09.531 | 02 | 2445–77–4 | 2-metilbutilizovalerāts | 3506 | 10772 | 219–496–7 | 09.531 | 2-metilbutilizopentanoāts | 2-metilbutil-3-metilbutanoāts | |

09.532 | 09 | 21188–58–9 | metil-3-hidroksiheksanoāts | 3508 | 10812 | 244–261–0 | 09.532 | metil-3-hidroksikaproāts; metil-β-hidroksikaproats; metil-β-hidroksiheksanoāts | | |

09.533 | 09 | 105–95–3 | etilbrasilāts | 3543 | 10571 | 203–347–8 | 09.533 | etilēnglikola brasilāts, cikliskais diesteris; etilēnbrasilāts; etilēnundekāndikarboksilāts | 1,4-dioksacikloheptadekān-5,17-dions | |

09.534 | 01 | 3289–28–9 | etilcikloheksānkarboksilāts | 3544 | 11916 | 221–945–7 | 09.534 | | | |

09.535 | 09 | 2305–25–1 | etil-3-hidroksiheksanoāts | 3545 | 11764 | 218–973–7 | 09.535 | | | |

09.536 | 01 | 4630–82–4 | metilcikloheksānkarboksilāts | 3568 | 11920 | 225–050–2 | 09.536 | | | |

09.537 | 01 | 29811–50–5 | oktil-2-metilbutirāts | 3604 | 10866 | 249–872–6 | 09.537 | | | |

09.538 | 15 | 24817–51–4 | fenetil-2-metilbutirāts | 3632 | 10883 | 246–476–5 | 09.538 | 2-feniletil-2-metilbutanoāts; benzilkarbinil-2-metilbutirāts; β-fenetil-α-metilbutanoāts | | |

09.539 | 05 | 94133–92–3 | okt-3-il-2-metilkrotonāts | 3676 | | 302–757–5 | 09.539 | okt-3-iltiglāts; 1-etilheksil-2-metil-2-butenoāts; 1-etilheksil-2-metilkrotonāts; 3-oktiltiglāts | 1-etilheksil-2-metilbut-2-( trans)-enoāts | |

09.540 | 01 | 60523–21–9 | etil-2-metilpent-3, 4-dienoāts | 3678 | | 262–278–1 | 09.540 | | | |

09.541 | 01 | 5870–68–8 | etil-3-metilvalerāts | 3679 | | 227–524–4 | 09.541 | | | |

09.542 | 09 | 3249–68–1 | etil-3-oksoheksanoāts | 3683 | | 221–835–9 | 09.542 | etil-β-ketoheksanoāts | | |

09.543 | 30 | 26446–31–1 | gliceril-5-hidroksidekanoāts | 3685 | 10648 | 247–699–0 | 09.543 | | | |

09.544 | 30 | 26446–32–2 | gliceril-5-hidroksidodekanoāts | 3686 | 10649 | 247–700–4 | 09.544 | | | |

09.545 | 09 | 61931–81–5 | heks-3-enillaktāts | 3690 | 10681 | 263–337–4 | 09.545 | | heks-3-enil-2-hidroksipropanoāts | |

09.546 | 01 | 58625–95–9 | heksil-2-metilpent-(3 un 4)-enoāts | 3693 | | | 09.546 | | | |

09.547 | 05 | 66576–71–4 | izopropil-2-metilbutirāts | 3699 | | 266–411–4 | 09.547 | | | |

09.548 | 09 | 40348–72–9 | metil-2-hidroksi-4-metilvalerāts | 3706 | | 254–883–4 | 09.548 | metil-2-hidroksiizokaproāts | | |

09.549 | 01 | 2177–77–7 | metil-2-metilvalerāts | 3707 | | 218–543–9 | 09.549 | metil-2-metilvalerāts | | |

09.550 | 09 | 3682–42–6 | metil-2-okso-3-metilvalerāts | 3713 | | | 09.550 | metil-2-keto-3-metilpentanoāts; metil-2-keto-3-metilvalerāts; metil-3-metil-2-oksovalerāts | | |

09.551 | 08 | 59259–38–0 | L-mentillaktāts | 3748 | | 261–678–3 | 09.551 | 5-metil-2-(1-metiletil)cikloheksil-α-hidroksipropanoats; L- p-mentān-3-illaktāts | | |

09.552 | 30 | 91052–69–6 | 3-oksodekānskābes glicerīds | 3767 | 10650 | 293–231–3 | 09.552 | gliceril-β-ketodekanoats; 3-oksodekānskābes glicerilmonoesteris | | |

09.553 | 30 | 91052–70–9 | 3-oksododekānskābes glicerīds | 3768 | 10651 | 293–232–9 | 09.553 | gliceril-β-ketododekanoats; 3-oksododekānskābes glicerilmonoesteris | | |

09.554 | 30 | 91052–71–0 | 3-oksoheksadekānskābes glicerīds | 3769 | 10652 | 293–233–4 | 09.554 | gliceril-β-ketoheksadekanoats; 3-oksoheksadekānskābes glicerilmonoesteris | | |

09.555 | 30 | 91052–72–1 | 3-oksoheksānskābes glicerīds | 3770 | 10653 | 293–235–5 | 09.555 | gliceril-β-ketoheksanoāts; 3-oksoheksānskābes glicerildiesteris | | |

09.556 | 30 | 91052–68–5 | 3-oksooktānskābes glicerīds | 3771 | 10654 | 293–230–8 | 09.556 | gliceril-β-ketooktanoāts; 3-oksooktānskābes glicerilmonoesteris | | |

09.557 | 30 | 91052–73–2 | 3-oksotetradekānskābes glicerīds | 3772 | 10655 | 293–236–0 | 09.557 | gliceril-β-ketotetradekanoāts; 3-oksotetradekānskābes glicerilmonoesteris | | |

09.558 | 09 | 108–59–8 | dimetilmalonāts | | 11754 | 203–597–8 | 09.558 | dimetilazelāts | dimetilpropāndioāts | |

09.559 | 04 | 67883–79–8 | heks-3-( cis)-enil-2-metilkrotonāts | 3931 | | 267–554–5 | 09.559 | cis-3-hekseniltiglāts; cis-3-heksenil-2-metil- trans- 2-butenoāts; (Z)-3-heksenil-2-metilkrotonāts | heks-3-( cis)-enil-2-metilbut-2-( trans)-enoāts | |

09.560 | 23 | 121432–33–5 | heks-3-( cis)-enilanizāts | | | | 09.560 | | heks-3-( cis)-enil-(4-metoksi)benzoāts | |

09.561 | 27 | 65405–76–7 | heks-3-( cis)-enilantranilāts | 3925 | 10676 | 265–744–2 | 09.561 | (Z)-heksenil-2-aminobenzoāts; (Z)-heks-3-enilantranilāts; cis-3-heksenilantranilāts | heks-3-( cis)-enil-2-aminobenzoāts | |

09.562 | 04 | 56922–80–6 | trans- 3-heksenilformiāts | 3353 | | 260–442–7 | 09.562 | | | 5 |

09.563 | 04 | 41519–23–7 | heks-3-( cis)-enilizobutirāts | 3929 | 11783 | 255–424–0 | 09.563 | β, γ-heksenilizobutanoāts; (Z)-heks-3-enilizobutirāts; cis- 3-heksenilizobutirāts | heks-3-( cis)-enil-2-metilpropanoāts | |

09.564 | 04 | 33467–74–2 | heks-3-( cis)-enilpropionāts | 3933 | 10683 | 251–533–2 | 09.564 | β, γ-heksenilpropanoāts; (E)-heks-2-enilpropionāts; trans- 2-heksenilpropionāts | | |

09.565 | 09 | 68133–76–6 | heks-3-enil-2-oksopropionāts | 3934 | 10684 | 268–703–7 | 09.565 | heks-3-enilpiruvāts | | 5 |

09.566 | 04 | 65405–80–3 | heks-3-enilbut-2-enoāts | | | 265–746–3 | 09.566 | | | 5 |

09.567 | 04 | 85554–69–4 | heks-3-enildekanoāts | | | 287–601–3 | 09.567 | | | 5 |

09.568 | 04 | 53398–87–1 | heks-3-enilheks-2-enoāts | 3928 | | | 09.568 | | | 5 |

09.569 | 04 | 61444–41–5 | heks-3-eniloktanoāts | | | 262–799–4 | 09.569 | | | 5 |

09.570 | 23 | 65405–77–8 | heks-3-enilsalicilāts | | 10685 | 265–745–8 | 09.570 | | heks-3-enil-2-hidroksibenzoāts | |

09.571 | 04 | 35852–46–1 | heks-3-enilvalerāts | 3936 | 10686 | 252–761–5 | 09.571 | heks-3-enilpentanoāts; cis- 3-heksenilpentanoāts; cis- 3-heksenilvalerāts; (Z)-heks-3-enilvalerāts | | 5 |

09.572 | 04 | 42125–17–7 | heks-4-enilacetāts | | | | 09.572 | | | |

09.573 | 03 | 1516–17–2 | heksa-2, 4-dienilacetāts | | 10675 | 216–163–8 | 09.573 | | | |

09.574 | 01 | 629–70–9 | heksadec-1-ilacetāts | | | 211–103–7 | 09.574 | cetilacetāts | | |

09.575 | 04 | 61444–39–1 | 3-heksenilheptanoāts | | | 262–798–9 | 09.575 | | | 5 |

09.576 | 05 | 5953–49–1 | sek-heksilacetāts | | 10840 | 227–716–8 | 09.576 | | 1-metilpentilacetāts | |

09.577 | 05 | 6963–52–6 | sek-heksilbutirāts | | | | 09.577 | | 1-metilpentilbutanoāts | |

09.578 | 01 | 19089–92–0 | heksilkrotonāts | 3354 | 10688 | 240–997–1 | 09.578 | | heksilbut-2-( trans)-enoāts | |

09.579 | 01 | 34316–64–8 | heksildodekanoāts | | | 251–932–1 | 09.579 | | | |

09.580 | 09 | 20279–51–0 | heksillaktāts | | | 243–676–4 | 09.580 | | heksil-2-hidroksipropanoāts | |

09.581 | 23 | 6259–76–3 | heksilsalicilāts | | 10695 | 228–408–6 | 09.581 | n-heksil- o - hidroksibenzoāts | heksil-2-hidroksibenzoāts | |

09.582 | 01 | 42231–99–2 | heksiltetradekanoāts | | | 255–722–0 | 09.582 | | | |

09.583 | 01 | 1117–59–5 | heksilvalerāts | | 10696 | 214–248–4 | 09.583 | heksilpentanoāts | | |

09.584 | 08 | 85586–67–0 | izobornilizobutirāts | | | 287–872–8 | 09.584 | izobornil-2-metilpropionāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-2-metilpropanoāts | |

09.585 | 02 | 2445–67–2 | izobutil-2-metilbutirāts | | 10710 | 219–492–5 | 09.585 | | 2-metilpropil-2-metilbutanoāts | |

09.586 | 02 | 97–86–9 | izobutil-2-metilprop-2-enoāts | | | 202–613–0 | 09.586 | | 2-metilpropil-2-metilprop-2-enoāts | |

09.587 | 02 | 30673–38–2 | izobutildekanoāts | | 10707 | 250–281–0 | 09.587 | | 2-metilpropildekanoāts | |

09.588 | 02 | 37811–72–6 | izobutildodekanoāts | | 10708 | 253–675–0 | 09.588 | | 2-metilpropildodekanoāts | |

09.589 | 02 | 110–34–9 | izobutilheksadekanoāts | | 10715 | 203–758–2 | 09.589 | izobutilpalmitāts | 2-metilpropilheksadekanoāts | |

09.590 | 09 | 585–24–0 | izobutillaktāts | | 10709 | 209–551–3 | 09.590 | | 2-metilpropil-2-hidroksipropanoāts | |

09.591 | 02 | 30982–03–7 | izobutilnonanoāts | | 10713 | 250–411–6 | 09.591 | | 2-metilpropilnonanoāts | |

09.592 | 02 | 646–13–9 | izobutiloktadekanoāts | | | 211–466–1 | 09.592 | izobutilstearāts | 2-metilpropiloktadekanoāts | |

09.593 | 02 | 5461–06–3 | izobutiloktanoāts | | 10714 | 226–744–8 | 09.593 | | 2-metilpropiloktanoāts | |

09.594 | 02 | 25263–97–2 | izobutiltetradekanoāts | | 10712 | 246–765–6 | 09.594 | izobutilmiristāts | 2-metilpropiltetradekanoāts | |

09.596 | 02 | 10482–55–0 | izopentil-2-metilkrotonāts | | | 233–985–2 | 09.596 | izoamilangelāts | 3-metilbutil-2-metilbut-2-( trans)-enoāts | |

09.597 | 02 | 25415–77–4 | izopentilbut-2-enoāts | | | 246–958–5 | 09.597 | izoamil-2-butenoāts | 3-metilbutilbut-2-enoāts | |

09.598 | 02 | 2306–91–4 | izopentildekanoāts | | | 218–982–6 | 09.598 | | 3-metilbutildekanoāts | |

09.599 | 02 | 109–25–1 | izopentilheptanoāts | | 10719 | 203–658–9 | 09.599 | | 3-metilbutilheptanoāts | |

09.600 | 02 | 81974–61–0 | izopentilheksadekanoāts | | 10723 | 279–864–8 | 09.600 | izoamilpalmitāts | 3-metilbutilheksadekanoāts | |

09.601 | 09 | 19329–89–6 | izopentillaktāts | | 10720 | 242–966–8 | 09.601 | | 3-metilbutil-2-hidroksipropanoāts | |

09.602 | 02 | 62488–24–8 | izopentiltetradekanoāts | | 10722 | 263–570–1 | 09.602 | izoamilmiristāts | 3-metilbutiltetradekanoāts | |

09.603 | 05 | 6284–46–4 | izopropilkrotonāts | | 10729 | | 09.603 | | izopropilbut-2-( trans)-enoāts | |

09.604 | 05 | 2311–59–3 | izopropildekanoāts | | 10730 | 219–001–4 | 09.604 | izopropilkaprāts | | |

09.605 | 05 | 10233–13–3 | izopropildodekanoāts | | | 233–560–1 | 09.605 | izopropillaurāts | | |

09.606 | 05 | 142–91–6 | izopropilheksadekanoāts | | 10732 | 205–571–1 | 09.606 | izopropilpalmitāts | | |

09.608 | 05 | 5458–59–3 | izopropiloktanoāts | | 10731 | 226–721–2 | 09.608 | izopropilkaprilāts | | |

09.609 | 05 | 18362–97–5 | izopropilvalerāts | | | 242–235–3 | 09.609 | izopropilpentanoāts | | |

09.610 | 08 | 579–94–2 | 2-izopropil-2-metilcikloheksiletoksiacetāts | | | 209–448–3 | 09.610 | korifīns B | | |

09.611 | 23 | 59230–57–8 | 4-izopropilbenzilacetāts | | | 261–671–5 | 09.611 | kuminilacetāts | | |

09.612 | 04 | 25905–14–0 | lavandulilacetāts | | | 247–327–7 | 09.612 | | 5-metil-2-(1-metilēnetil)heks-4-enilacetāts | |

09.614 | 06 | 10471–96–2 | linalilvalerāts | | 10738 | 233–961–1 | 09.614 | linalilpentanoāts | 1,5-dimetil-1-vinilheks-4-enilpentanoāts | |

09.615 | 07 | 28839–13–6 | p-ment-1-ēn-9-ilacetāts | 3566 | 10748 | 249–266–1 | 09.615 | | | |

09.616 | 08 | 77341–67–4 | monoment-3-ilsukcināts | 3810 | | | 09.616 | butāndiskābes mono[5-metil-2-(1-metiletil)cikloheksil]esteris, [1R-(1-α,2-β,5-α)]- | 3-(5-metil-2-izopropilcikloheksoksikarbonil)propānskābe | |

09.617 | 06 | 58985–18–5 | p-mentān-8-ilacetāts | | | 261–543–9 | 09.617 | dihidro-α-terpinilacetāts | | |

09.618 | 08 | 2230–90–2 | mentilformiāts | | 10751 | 218–768–2 | 09.618 | | p-mentān-3-ilformiāts | |

09.619 | 08 | 6070–16–2 | mentilheksanoāts | | | 228–007–6 | 09.619 | | p-mentān-3-ilheksanoāts | 5 |

09.620 | 15 | 26171–78–8 | mentilfenilacetāts | | | 247–498–8 | 09.620 | (-)-mentilfenilacetāts | | |

09.621 | 25 | 89–46–3 | mentilsalicilāts | | | 201–909–7 | 09.621 | mentil-2-hidroksibenzoāts | p-mentān-3-il-2-hidroksibenzoāts | |

09.622 | 01 | 598–98–1 | metil-2,2-dimetilpropionāts | | 10790 | 209–959–1 | 09.622 | metilpivalāts | | |

09.623 | 23 | 4707–47–5 | metil-2,4-dihidroksi-3,6-dimetilbenzoāts | | | 225–193–0 | 09.623 | | | |

09.624 | 01 | 6622–76–0 | metil-2-metilkrotonāts | | | 229–575–8 | 09.624 | metiltiglāts | metil-2-metilbut-2-( trans)-enoāts | |

09.625 | 01 | 33603–30–4 | metil-2-metilpent-3-enoāts | | | | 09.625 | | | |

09.626 | 09 | 600–22–6 | metil-2-oksopropionāts | | 10848 | 209–987–4 | 09.626 | metilpiruvāts | | |

09.627 | 09 | 139564–42–4 | metil-3-acetoksi-2-metilbutirāts | | | | 09.627 | | | |

09.628 | 09 | 89422–42–4 | metil-3-acetoksibutirāts | | | | 09.628 | | | |

09.629 | 09 | 21188–60–3 | metil-3-acetoksiheksanoāts | | 10755 | 244–262–6 | 09.629 | | | |

09.630 | 01 | 924–50–5 | metil-3-metilbut-2-enoāts | | | 213–107–4 | 09.630 | metilsenecioāts | | |

09.631 | 23 | 99–75–2 | metil-4-metilbenzoāts | | | 202–784–1 | 09.631 | metil- p-toluāts | | |

09.632 | 09 | 35234–22–1 | metil-5-acetoksiheksanoāts | | 10756 | | 09.632 | | | |

09.633 | 09 | 101853–47–8 | metil-3-hidroksidekanoāts | | | | 09.633 | | | |

09.634 | 09 | 105–45–3 | metilacetoacetāts | | | 203–299–8 | 09.634 | metilacetilacetāts | metil-3-oksobutanoāts | |

09.635 | 01 | 96–33–3 | metilakrilāts | | 10759 | 202–500–6 | 09.635 | | metilprop-2-enoāts | |

09.636 | 01 | 623–43–8 | metilkrotonāts | | | 210–793–7 | 09.636 | 2-butēnskābes metilesteris | metilbut-2-( trans)-enoāts | |

09.637 | 01 | 2482–39–5 | metildec-2-enoāts | | 11799 | 219–618–9 | 09.637 | | | |

09.638 | 01 | 7367–83–1 | metildec-4-enoāts | | 10784 | 230–914–7 | 09.638 | | | 5 |

09.639 | 01 | 4493–42–9 | metildeka-2,4-dienoāts | 3859 | | 224–787–7 | 09.639 | | | |

09.640 | 01 | 1191–03–3 | metildeka-4,8-dienoāts | | 10782 | | 09.640 | | | |

09.641 | 01 | 6208–91–9 | metildodec-2-enoāts | | 10792 | | 09.641 | | | |

09.642 | 01 | 107–31–3 | metilformiāts | | 10795 | 203–481–7 | 09.642 | | | |

09.643 | 01 | 1189–09–9 | metilgeranāts | | 10797 | 214–712–6 | 09.643 | | metil-3, 7-dimetil-2-( trans),6-oktadienoāts | |

09.644 | 09 | 27871–49–4 | metillaktāts | | | 248–704–9 | 09.644 | | metil-2-hidroksipropanoāts | 5 |

09.645 | 01 | 112–63–0 | metillinoleāts | 3411 | 713 | 203–993–0 | 09.645 | metiloktadeka-9-( cis),12-( cis)-dienoāts | | 5 |

09.646 | 01 | 301–00–8 | metillinolenāts | 3411 | 714 | 206–102–3 | 09.646 | metiloktadeka-9-( cis),12-( cis),15-( cis)-trienoāts | | 5 |

09.647 | 01 | 80–62–6 | metilmetakrilāts | | | 201–297–1 | 09.647 | | metil-2-metilprop-2-enoāts | |

09.648 | 27 | 10072–05–6 | metil-N, N-dimetilantranilāts | | | 233–202–4 | 09.648 | | metil-N, N-dimetil-2-aminobenzoāts | |

09.649 | 27 | 2719–08–6 | metil-N-acetilantranilāts | | | 220–318–5 | 09.649 | | metil-N-acetil-2-aminobenzoāts | |

09.650 | 27 | 41270–80–8 | metil-N-formilantranilāts | | | 255–287–7 | 09.650 | | metil-N-formil-2-aminobenzoāts | |

09.651 | 01 | 112–61–8 | metiloktadekanoāts | | 10849 | 203–990–4 | 09.651 | metilstearāts | | |

09.652 | 01 | 112–62–9 | metiloleāts | | 10836 | 203–992–5 | 09.652 | metil-9-oktadecenoāts | metiloktadec-9-enoāts | |

09.653 | 01 | 1731–86–8 | metilundekanoāts | | 10854 | 217–053–2 | 09.653 | | | |

09.654 | 30 | 68227–51–0 | 2-metil-5-oksociklopent-1-enilbutirāts | | 11787 | 269–363–2 | 09.654 | metilciklopentenolona butirāts; kļavu laktona butirāts | | |

09.655 | 04 | 5205–07–2 | 3-metilbut-3-enilacetāts | | | 225–996–6 | 09.655 | | | |

09.656 | 23 | 5205–12–9 | 3-metilbut-3-enilbenzoāts | | | | 09.656 | | | |

09.657 | 05 | 626–38–0 | 1-metilbutilacetāts | | 10761 | 210–946–8 | 09.657 | pent-2-ilacetāts | | |

09.658 | 05 | 60415–61–4 | 1-metilbutilbutirāts | 3893 | 10763 | 262–226–8 | 09.658 | pent-2-ilbutirāts | | |

09.659 | 02 | 51115–64–1 | 2-metilbutilbutirāts | | | 256–973–9 | 09.659 | | | |

09.660 | 02 | 55195–23–8 | 2-metilbutildekanoāts | | 10765 | | 09.660 | | | |

09.661 | 02 | 35073–27–9 | 2-metilbutilformiāts | | | 252–343–2 | 09.661 | | | |

09.662 | 02 | 2601–13–0 | 2-metilbutilheksanoāts | | 10768 | 220–005–3 | 09.662 | | | |

09.663 | 02 | 2445–69–4 | 2-metilbutilizobutirāts | | 10770 | 219–493–0 | 09.663 | 2-metilpropionskābes 2-metilbutilesteris | 2-metilbutil-2-metilpropanoāts | |

09.664 | 02 | 67121–39–5 | 2-metilbutiloktanoāts | | 10776 | | 09.664 | | | |

09.665 | 02 | 2438–20–2 | 2-metilbutilpropionāts | | 10778 | 219–449–0 | 09.665 | | | |

09.666 | 02 | 93805–23–3 | 2-metilbutiltetradekanoāts | | 10774 | 298–506–1 | 09.666 | metilbutilmiristāts | | |

09.669 | 06 | 1118–39–4 | mircenilacetāts | | 10857 | 214–262–0 | 09.669 | | 7-metil-3-metilēnokt-1-ēn-7-ilacetāts | |

09.670 | 07 | 29021–36–1 | mirtanilacetāts | | | 249–371–2 | 09.670 | | (6,6-dimetilbiciklo[3.1.1]heptān-2-il)metilacetāts | |

09.671 | 06 | 56001–43–5 | nerolidilacetāts | | 10862 | 259–941–2 | 09.671 | | 1,5,9-trimetil-1-vinil-4-( cis), 8-dekadienilacetāts | |

09.672 | 04 | 13049–88–2 | non-3-enilacetāts | | | | 09.672 | | | |

09.673 | 04 | 76238–22–7 | non-6-enilacetāts | | | 278–397–7 | 09.673 | | | 5 |

09.674 | 04 | 76649–26–8 | nona-3,6-dienilacetāts | | | 278–519–9 | 09.674 | | | |

09.676 | 05 | 2051–50–5 | sek - oktilacetāts | | 10799 | 218–123–5 | 09.676 | | 1-metilheptilacetāts | |

09.677 | 01 | 4887–30–3 | oktilheksanoāts | | 10865 | 225–499–4 | 09.677 | | | |

09.678 | 03 | 74298–89–8 | pent-2-enilheksanoāts | | | 277–808–7 | 09.678 | | | 5 |

09.679 | 01 | 68039–26–9 | pentil-2-metilbutirāts | | 10875 | 268–244–2 | 09.679 | amil-2-metilbutirāts | | |

09.680 | 01 | 7785–63–9 | pentil-2-metilizokrotonāts | | | 232–083–6 | 09.680 | amilangelāts | pentil-2-metilbut-2-( cis)-enoāts | |

09.681 | 01 | 5350–03–8 | pentildodekanoāts | | | 226–319–7 | 09.681 | amildodekanoāts | | |

09.682 | 01 | 31148–31–9 | pentilheksadekanoāts | | | 250–487–0 | 09.682 | amilpalmitāts | | |

09.683 | 09 | 6382–06–5 | pentillaktāts | | | 228–974–4 | 09.683 | | pentil-2-hidroksipropanoāts | |

09.684 | 15 | 64181–20–0 | fenetilkrotonāts | | 10880 | | 09.684 | | feniletilbut-2-( trans)-enoāts | |

09.685 | 15 | 61810–55–7 | 2-fenetildekanoāts | | 10881 | 263–237–0 | 09.685 | fenetilkaprāts | | |

09.686 | 15 | 10138–63–3 | fenetillaktāts | | | | 09.686 | | 2-feniletil-2-hidroksipropanoāts | |

09.687 | 15 | 23511–70–8 | 2-fenoksietilbutirāts | | | 245–705–6 | 09.687 | | | |

09.688 | 25 | 122–79–2 | fenilacetāts | 3958 | 10878 | 204–575–0 | 09.688 | (acetiloksi)benzols; fenola acetāts; acetoksibenzols | | |

09.689 | 25 | 118–55–8 | fenilsalicilāts | 3960 | 11814 | 204–259–2 | 09.689 | salols; fenil-2-hidroksibenzoāts | fenil- o — hidroksibenzoāts | |

09.690 | 22 | 7402–29–1 | 3-fenilpropilbutirāts | | | 231–005–8 | 09.690 | | | |

09.691 | 03 | 10236–16–5 | fitilacetāts | | | 233–565–9 | 09.691 | | 3,7,11,15-tetrametilheksadec-2-enilacetāts | 5 |

09.692 | 03 | 1191–16–8 | prenilacetāts | | 11796 | 214–730–4 | 09.692 | | 3-metilbut-2-enilacetāts | |

09.693 | 23 | 5205–11–8 | prenilbenzoāts | | | 225–998–7 | 09.693 | | 3-metilbut-2-enilbenzoāts | |

09.694 | 03 | 68480–28–4 | prenilformiāts | | | 270–906–0 | 09.694 | | 3-metilbut-2-enilformiāts | |

09.695 | 03 | 76649–23–5 | prenilizobutirāts | | | 278–516–2 | 09.695 | | 3-metilbut-2-enil-2-metilpropanoāts | |

09.696 | 23 | 68555–58–8 | prenilsalicilāts | | | 271–434–8 | 09.696 | | 3-metilbut-2-enil-2-hidroksibenzoāts | |

09.698 | 01 | 37064–20–3 | propil-2-metilbutirāts | | 10891 | 253–329–9 | 09.698 | | | |

09.699 | 01 | 10352–87–1 | propilkrotonāts | | | 233–768–2 | 09.699 | | propilbut-2-( trans)-enoāts | |

09.700 | 01 | 30673–60–0 | propildekanoāts | | | 250–283–1 | 09.700 | propilkaprāts | | |

09.701 | 15 | 7493–74–5 | alilfenoksiacetāts | 2038 | 228 | 231–335–2 | 09.701 | acetāts P. A.; 2-propenilfenoksiacetāts | | |

09.702 | 15 | 4606–15–9 | propilfenilacetāts | 2955 | 229 | 225–012–5 | 09.702 | propil-α-toluāts; propil- α-Toluāts | | |

09.703 | 15 | 122–45–2 | oktilfenilacetāts | 2812 | 230 | 204–545–7 | 09.703 | oktil-α-toluāts | | |

09.704 | 15 | 102–22–7 | geranilfenilacetāts | 2516 | 231 | 203–014–7 | 09.704 | geranil-α-toluāts; trans- 3,7-dimetil-2,6-oktadiēn-1-ilfenilacetāts | 3,7-dimetilokta-2-( trans),6-dienilfenilacetāts | |

09.705 | 23 | 102–16–9 | benzilfenilacetāts | 2149 | 232 | 203–008–4 | 09.705 | benzil-α-toluāts; feniletiķskābes benzilesteris; benzil-2-feniletanoāts | | |

09.706 | 23 | 102–17–0 | anizilfenilacetāts | 3740 | 233 | 203–010–5 | 09.706 | 4-metoksibenzilfenilacetāts; anizil-α-toluāts; p-metoksibenzilfenilacetāts; feniletiķskābes p-metoksibenzilesteris | | |

09.707 | 15 | 102–20–5 | fenetilfenilacetāts | 2866 | 234 | 203–013–1 | 09.707 | feniletilfenilacetāts; fenetil-α-toluāts; 2-feniletil-α-toluats; 2-feniletilfenilacetāts | | |

09.708 | 22 | 7492–65–1 | cinamilfenilacetāts | 2300 | 235 | 231–322–1 | 09.708 | 3-fenil-2-propēn-1-ilfenilacetāts; cinamil-α-toluāts; 3-fenilalilfenilacetāts | 3-fenilprop-2-enilfenilacetāts | |

09.709 | 15 | 101–94–0 | p-tolilfenilacetāts | 3077 | 236 | 202–990–1 | 09.709 | p-krezil-α-toluāts; p-krezilfenilacetāts; p-tolil-α-toluāts | 4-metilfenilfenilacetāts | |

09.710 | 17 | 120–24–1 | izoeigenilfenilacetāts | 2477 | 237 | 204–381–6 | 09.710 | 2-metoksi-4-fenilfenilacetāts; 4-propenilgvajacilfenilacetāts; izoeigenil-α-toluāts | 2-metoksi-4-(prop-1-enil)fenilfenilacetāts | |

09.711 | 25 | 4112–89–4 | gvajacilfenilacetāts | 2535 | 238 | 223–898–8 | 09.711 | o-metilkatehola acetāts; gvajakola fenilacetāts; o-metoksifenilfenilacetāts | 2-metoksifenilfenilacetāts | |

09.712 | 15 | 1323–75–7 | santalilfenilacetāts | 3008 | 239 | 215–358–5 | 09.712 | α-santalilfenilacetāts; β-santalilfenilacetāts; santalil-α-toluāts | | 4 |

09.713 | 23 | 121–98–2 | metil-4-metoksibenzoāts | 2679 | 248 | 204–513–2 | 09.713 | metil- p-metoksibenzoāts; metil- p-anizāts; metilanizāts | | |

09.714 | 23 | 94–30–4 | etil-4-metoksibenzoāts | 2420 | 249 | 202–320–8 | 09.714 | metil- p-metoksibenzoāts; etil- p-anizāts; etilanizāts | | |

09.715 | 27 | 134–20–3 | metilantranilāts | 2682 | 250 | 205–132–4 | 09.715 | metil- o-aminobenzoāts; o-aminometilbenzoāts | metil-2-aminobenzoāts | |

09.716 | 27 | 87–25–2 | etilantranilāts | 2421 | 251 | 201–735–1 | 09.716 | etil- o-aminobenzoāts | etil-2-aminobenzoāts | |

09.717 | 27 | 7756–96–9 | butilantranilāts | 2181 | 252 | 231–816–7 | 09.717 | butil-2-aminobenzoāts; butil- o-aminobenzoāts | butil-2-aminobenzoāts | |

09.718 | 27 | 7779–77–3 | izobutilantranilāts | 2182 | 253 | 231–938–0 | 09.718 | izobutil-2-aminobenzoāts; izobutil- o-aminobenzoāts | 2-metilpropil-2-aminobenzoāts | |

09.719 | 27 | 7493–63–2 | alilantranilāts | 2020 | 254 | 231–331–0 | 09.719 | alil- o-aminobenzoāts; 2-propenil-2-aminobenzoāts; 2-propenilantranilāts | alil-2-aminobenzoāts | |

09.721 | 06 | 7149–26–0 | linalilantranilāts | 2637 | 256 | 230–472–5 | 09.721 | linalil- o-aminobenzoāts; 3,7-dimetil-1, 6-oktadiēn-3-il-2-aminobenzoāts; linalil-2-aminobenzoāts | 1,5-dimetil-1-vinilheks-4-enil-2-aminobenzoāts | |

09.722 | 27 | 7779–16–0 | cikloheksilantranilāts | 2350 | 257 | 231–920–2 | 09.722 | | cikloheksil-2-aminobenzoāts | |

09.723 | 15 | 133–18–6 | fenetilantranilāts | 2859 | 258 | 205–098–0 | 09.723 | 2-feniletilantranilāts; β-feniletil- o-aminobenzoāts | 2-feniletil-2-aminobenzoāts | |

09.724 | 06 | 14481–52–8 | α-terpinilantranilāts | 3048 | 259 | | 09.724 | p-ment-1-ēn-8-ilantranilāts; p-ment-1-ēn-8-il-2-aminobenzoāts; terpinil- o-aminobenzoāts | p-ment-1-ēn-8-il-2-aminobenzoāts; | |

09.725 | 23 | 93–58–3 | metilbenzoāts | 2683 | 260 | 202–259–7 | 09.725 | metilbenzolkarboksilāts | | |

09.726 | 23 | 93–89–0 | etilbenzoāts | 2422 | 261 | 202–284–3 | 09.726 | etilbenzolkarboksilāts; etilbenzola karboksilāts | | |

09.727 | 23 | 120–51–4 | benzilbenzoāts | 2138 | 262 | 204–402–9 | 09.727 | benzoskābes benzilesteris; benzilbenzolkarboksilāts; benzilfenilformiāts | | |

09.728 | 22 | 10031–93–3 | etil-4-fenilbutirāts | 2453 | 307 | | 09.728 | butānskābes etilesteris, 4-metil-; etil-4-fenilbutanoāts | | |

09.729 | 22 | 2046–17–5 | metil-4-fenilbutirāts | 2739 | 308 | 218–067–1 | 09.729 | metil-γ-fenilbutirāts | | |

09.730 | 22 | 103–36–6 | etilcinamāts | 2430 | 323 | 203–104–6 | 09.730 | etil-β-fenilakrilāts; etil- trans - cinamāts; etil-3-fenilpropenoāts; etilfenilakrilāts | etil-3-fenilprop-2-enoāts | |

09.731 | 22 | 7778–83–8 | propilcinamāts | 2938 | 324 | 231–916–0 | 09.731 | n-propil-3-fenilpropenoāts; n-propil-β-fenilakrilāts | propil-3-fenilprop-2-enoāts | |

09.732 | 22 | 7780–06–5 | izopropilcinamāts | 2939 | 325 | 231–949–0 | 09.732 | izopropilcinamāts; izopropil-3-fenilpropenoāts; 1-metiletil-3-fenilpropenoāts | izopropil-3-fenilprop-2-enoāts | |

09.733 | 22 | 538–65–8 | butilcinamāts | 2192 | 326 | 208–699–6 | 09.733 | butil-3-fenilpropenoāts; butil-β-fenilakrilats; n-butilfenilakrilāts; kanēļskābes butilesteris | butil-3-fenilprop-2-enoāts | |

09.734 | 22 | 122–67–8 | izobutilcinamāts | 2193 | 327 | 204–564–0 | 09.734 | 2-metilpropil-β-fenilakrilāts; 2-metilpropil-3-fenilpropenoāts; izobutil-β-fenilakrilāts | 2-metilpropil-3-fenilprop-2-enoāts | |

09.735 | 22 | 3487–99–8 | pentilcinamāts | | 328 | 222–478–1 | 09.735 | amilcinamāts; kanēļskābes amilesteris; pentil-3-fenilprop-2-enoāts | pentil-3-fenilprop-2-enoāts | |

09.736 | 06 | 78–37–5 | linalilcinamāts | 2641 | 329 | 201–110–3 | 09.736 | 3,7-dimetil-1,6-oktadiēn-3-ilcinamāts; linalil-3-fenilpropenoāts; 3,7-dimetil-1,6-oktadiēn-3-il- β-fenilakrilāts | 1,5-dimetil-1-vinilheks-4-enil-3-fenilprop-2-enoāts | |

09.737 | 06 | 10024–56–3 | terpinilcinamāts | 3051 | 330 | 233–023–1 | 09.737 | terpinil-3-fenilpropenoāts; terpinil-β-fenilakrilāts | p - ment-1-ēn-8-ilcinamāts | 5 |

09.738 | 23 | 103–41–3 | benzilcinamāts | 2142 | 331 | 203–109–3 | 09.738 | cinameīns; benzil-β-fenilakrilāts; 2-propēnskābes fenilmetilesteris, 3-fenil- | benzil-3-fenilprop-2-enoāts | |

09.739 | 22 | 122–69–0 | cinamilcinamāts | 2298 | 332 | 204–566–1 | 09.739 | stiracīns; fenilalilcinamāts; 3-fenil-2-propēn-1-il-3-fenilpropenoāts | 3-fenilprop-2-enil-3-fenilprop-2-enoāts | |

09.740 | 22 | 103–26–4 | metilcinamāts | 2698 | 333 | 203–093–8 | 09.740 | metil-3-fenilpropenoāts; metil-3-fenilprop-2-enoāts | metil-3-fenilprop-2-enoāts | |

09.741 | 22 | 1866–31–5 | alilcinamāts | 2022 | 334 | 217–477–8 | 09.741 | alil-β-fenilakrilats; propenilcinamāts; alil-3-fenilpropenoāts; alil-β-fenilakrilāts | alil-3-fenilprop-2-enoāts | |

09.742 | 22 | 7779–65–9 | izopentilcinamāts | 2063 | 335 | 231–931–2 | 09.742 | izopentilcinamāts; izoamilcinamāts; izopentil-3-fenilpropenoāts; izopentil-β-fenilakrilāts | 3-metilbutil-3-fenilprop-2-enoāts | |

09.743 | 15 | 103–53–7 | fenetilcinamāts | 2863 | 336 | 203–120–3 | 09.743 | benzilkarbinilcinamāts; 2-feniletil-3-fenilpropenoāts; β-fenetil-β-fenilakrilāts | fenetil-3-fenilprop-2-enoāts | |

09.744 | 22 | 7779–17–1 | cikloheksilcinamāts | 2352 | 337 | 231–921–8 | 09.744 | cikloheksil-3-fenilpropenoāts; cikloheksil-β-fenilakrilāts; cikloheksil-3-fenilprop-2-enoāts | cikloheksil-3-fenilprop-2-enoāts | |

09.745 | 22 | 122–68–9 | 3-fenilpropilcinamāts | 2894 | 338 | 204–565–6 | 09.745 | hidrocinamilcinamāts; fenilpropilcinamāts; hidrocinamil-3-fenilpropenoāts; 3-fenilpropil-β-fenilakrilāts | 3-fenilpropil-3-fenilprop-2-enoāts | |

09.746 | 22 | 103–25–3 | metil-3-fenilpropionāts | 2741 | 427 | 203–092–2 | 09.746 | metilhidrocinamāts; metildihidrocinamāts | | |

09.747 | 22 | 2021–28–5 | metil-3-fenilpropionāts | 2455 | 429 | 217–966–6 | 09.747 | etilhidrocinamāts; etildihidrocinamāts | | |

09.748 | 23 | 118–61–6 | etilsalicilāts | 2458 | 432 | 204–265–5 | 09.748 | salicilēteris; salicilskābes etilesteris | etil-2-hidroksibenzoāts | |

09.749 | 23 | 119–36–8 | metilsalicilāts | 2745 | 433 | 204–317–7 | 09.749 | | metil-2-hidroksibenzoāts | |

09.750 | 23 | 87–19–4 | izobutilsalicilāts | 2213 | 434 | 201–729–9 | 09.750 | 2-metil-1-propilsalicilāts; 2-metilpropil- o-hidroksibenzoāts; butilsalicilāts; izobutil- o-hidroksibenzoāts | 2-metilpropil-2-hidroksibenzoāts | |

09.751 | 23 | 87–20–7 | izopentilsalicilāts | 2084 | 435 | 201–730–4 | 09.751 | izopentil- o-hidroksibenzoāts; salicilskābes izopentilesteris; izoamil- o-hidroksibenzoāts; 3-metilbutilsalicilāts | 3-metilbutil-2-hidroksibenzoāts | |

09.752 | 23 | 118–58–1 | benzilsalicilāts | 2151 | 436 | 204–262–9 | 09.752 | benzoskābes fenilmetilesteris, 2-hidroksi-; benzil- o-hidroksibenzoāts; salicilskābes benzilesteris | benzil-2-hidroksibenzoāts | |

09.753 | 15 | 87–22–9 | fenetilsalicilāts | 2868 | 437 | 201–732–5 | 09.753 | 2-feniletilsalicilāts; benzilkarbinil-2-hidroksibenzoāts; benzilkarbinilsalicilāts | 2-feniletil-2-hidroksibenzoāts | |

09.754 | 23 | 94–26–8 | butil-4-hidroksibenzoāts | 2203 | 525 | 202–318–7 | 09.754 | butil- p-hidroksibenzoāts; butilparasepts; p-hidroksibenzoskābes butilesteris | | 4 |

09.755 | 23 | 94–46–2 | izopentilbenzoāts | 2058 | 562 | 202–334–4 | 09.755 | izoamilbenzoāts; izopentilbenzoāts; benzoskābes izoamilesteris; izopentilfenilmetanoāts | 3-metilbutilbenzoāts | |

09.756 | 15 | 94022–06–7 | izobornilfenilacetāts | | 566 | 301–499–0 | 09.756 | ekso-2-bornilfenilacetāts | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-2-fenilacetāts | |

09.757 | 23 | 120–50–3 | izobutilbenzoāts | 2185 | 567 | 204–401–3 | 09.757 | izobutilfenilmetanoāts | 2-metilpropilbenzoāts | |

09.758 | 15 | 3549–23–3 | metil- p- terc - butilfenilacetāts | 2690 | 577 | 222–602–4 | 09.758 | | metil-4-(1,1-dimetiletil)fenilacetāts | |

09.761 | 15 | 5137–52–0 | pentilfenilacetāts | | 612 | 225–895–7 | 09.761 | amilfenilacetāts | | |

09.762 | 23 | 2050–08–0 | pentilsalicilāts | | 613 | 218–080–2 | 09.762 | izoamil- o-hidroksibenzoāts; izoamilsalicilāts | pentil-2-hidroksibenzoāts | |

09.763 | 23 | 2052–14–4 | butilsalicilāts | 3650 | 614 | 218–142–9 | 09.763 | butil-(2-hidroksifenil)metanoāts | butil-2-hidroksibenzoāts | |

09.764 | 27 | 38446–21–8 | etil-N-etilantranilāts | | 629 | 253–935–3 | 09.764 | | etil-N-etil-2-aminobenzoāts | |

09.765 | 27 | 35472–56–1 | etil-N-metilantranilāts | | 632 | | 09.765 | | etil-N-metil-2-aminobenzoāts | |

09.766 | 18 | 531–26–0 | eigenilbenzoāts | 2471 | 636 | 208–504–4 | 09.766 | benzoileigenols; eigenola benzoāts | 4-alil-2-metoksifenilbenzoāts | |

09.767 | 23 | 94–48–4 | geranilbenzoāts | 2511 | 639 | 202–337–0 | 09.767 | geraniola benzoāts; trans-3,7-dimetil-2,6-oktadiēn-1-ilbenzoāts | 3,7-dimetilokta-2-( trans),6-dienilbenzoāts | |

09.768 | 23 | 6789–88–4 | heksilbenzoāts | 3691 | 645 | 229–856–5 | 09.768 | n-heksilbenzoāts; heksilfenilmetanoāts | | |

09.769 | 27 | 65505–24–0 | izobutil-N-metilantranilāts | | 649 | 265–798–7 | 09.769 | | 2-metilpropil-N-metil-2-aminobenzoāts | |

09.770 | 23 | 939–48–0 | izopropilbenzoāts | 2932 | 652 | 213–361–6 | 09.770 | izopropilbenzoāts; 1-metiletilbenzoāts | | |

09.771 | 06 | 126–64–7 | linalilbenzoāts | 2638 | 654 | 204–796–2 | 09.771 | linaloola benzoāts; 3,7-dimetil-1,6-oktadiēn-3-ilbenzoāts | 1,5-dimetil-1-vinilheks-4-enilbenzoāts | |

09.772 | 06 | 7143–69–3 | linalilfenilacetāts | 3501 | 655 | 230–444–2 | 09.772 | linalil-α-toluāts; 3,7-dimetil-1,6-oktadiēn-3-ilfenilacetāts | 1,5-dimetil-1-vinilheks-4-enilfenilacetāts | |

09.774 | 15 | 94–47–3 | fenetilbenzoāts | 2860 | 667 | 202–336–5 | 09.774 | 2-feniletilbenzoāts; benzilkarbinilbenzoāts | | |

09.776 | 23 | 2315–68–6 | propilbenzoāts | 2931 | 677 | 219–020–8 | 09.776 | propilfenilmetanoāts | | |

09.779 | 23 | 136–60–7 | butilbenzoāts | | 740 | 205–252–7 | 09.779 | n-butilbenzoāts | | |

09.780 | 22 | 5320–75–2 | cinamilbenzoāts | | 743 | 226–180–2 | 09.780 | 3-fenilalilbenzoāts | 3-fenilprop-2-enilbenzoāts | |

09.781 | 27 | 85–91–6 | metil-N-metilantranilāts | 2718 | 756 | 201–642–6 | 09.781 | dimetilantranilāts; 2-metilaminometilbenzoāts; metil-2-metilaminobenzoāts; metil- o-metilaminobenzoāts | metil-N-metil-2-aminobenzoāts | |

09.782 | 22 | 10032–08–3 | heptilcinamāts | 2551 | 2104 | | 09.782 | heptil-β-fenilakrilats; heptil-3-fenilpropenoāts | heptil-3-fenilprop-2-enoāts | |

09.783 | 15 | 101–41–7 | metilfenilacetāts | 2733 | 2155 | 202–940–9 | 09.783 | metil-α-toluāts; | | |

09.784 | 15 | 101–97–3 | etilfenilacetāts | 2452 | 2156 | 202–993–8 | 09.784 | etil-α-toluāts; α-toluilskabes etilesteris | | |

09.785 | 15 | 139–70–8 | citronelilfenilacetāts | 2315 | 2157 | 205–373–5 | 09.785 | 3,7-dimetil-6-oktēn-1-ilfenilacetāts; citronelil-α-toluats | 3,7-dimetilokt-6-enilfenilacetāts | |

09.786 | 15 | 4861–85–2 | izopropilfenilacetāts | 2956 | 2158 | 225–468–5 | 09.786 | izopropil-α-toluāts | | |

09.787 | 15 | 122–43–0 | butilfenilacetāts | 2209 | 2159 | 204–543–6 | 09.787 | butil-α-toluāts | | |

09.788 | 15 | 102–13–6 | izobutilfenilacetāts | 2210 | 2160 | 203–007–9 | 09.788 | izobutil-α-toluāts | 2-metilpropilfenilacetāts | |

09.789 | 15 | 102–19–2 | 3-metilbutilfenilacetāts | 2081 | 2161 | 203–012–6 | 09.789 | izoamilfenilacetāts; izopentilfenilacetāts; izoamil-α-toluāts | | |

09.790 | 03 | 1797–74–6 | alilfenilacetāts | 2039 | 2162 | 217–281–2 | 09.790 | alil-α-toluāts; 2-propenilfenilacetāts | | |

09.791 | 15 | 10486–14–3 | rodinilfenilacetāts | 2985 | 2163 | 234–003–5 | 09.791 | α-citronelilfenilacetāts; 3,7-dimetil-7-oktēn-1-ilfenilacetāts; rodinil-α-toluāts | 3,7-dimetilokt-7-enil-2-fenilacetāts | 5 |

09.796 | 23 | 606–45–1 | metil-2-metoksibenzoāts | 2717 | 2192 | 210–118–6 | 09.796 | o-metoksibenzoskābes metilesteris; dimetilsalicilāts; metil- o-anizāts; metilsalicilāta o-metilēteris | | |

09.797 | 15 | 67028–40–4 | etil-( p-toliloksi)acetāts | 3157 | 2243 | 266–554–2 | 09.797 | etilkrezoksiacetāts; etiķa šķīdinātājs | etil-(4-metilfenoksi)acetāts | |

09.798 | 23 | 617–05–0 | etilvanilāts | | 2302 | 210–503–9 | 09.798 | | etil-4-hidroksi-3-metoksibenzoāts | |

09.799 | 23 | 3943–74–6 | metilvanilāts | | 2305 | 223–525–9 | 09.799 | | metil-4-hidroksi-3-metoksibenzoāts | |

09.801 | 27 | 63449–68–3 | 2-naftilantranilāts | 2767 | 11862 | 264–155–8 | 09.801 | 2-naftil- o - aminobenzoāts | naft-2-il-2-aminobenzoāts | |

09.802 | 22 | 2983–36–0 | etil-2-etil-3-fenilpropionāts | 3341 | 10587 | 221–042–8 | 09.802 | etil-α-etildihidrocinamats; etilbenzilbutirāts; etil-2-etildihidrocinamāts | | |

09.803 | 23 | 19224–26–1 | propilēnglikola dibenzoāts | 3419 | 10890 | 242–894–7 | 09.803 | 1,2-propāndiola dibenzoāts | propān-1, 2-diildibenzoāts | |

09.804 | 15 | 5421–17–0 | heksilfenilacetāts | 3457 | 10694 | 226–537–2 | 09.804 | heksil-α-toluats; feniletiķskābes heksilesteris | | |

09.805 | 15 | 42436–07–7 | heks-3-( cis)-enilfenilacetāts | 3633 | 10682 | 255–826–6 | 09.805 | β,γ-heksenil-α-toluats; 3-heksenil-α-toluats; cis-heksenilfenilacetāts | | |

09.806 | 23 | 25152–85–6 | heks-3-enilbenzoāts | 3688 | 11778 | 246–669–4 | 09.806 | 3-heksēn-1-ola benzoāts | | 5 |

09.807 | 25 | 617–01–6 | o-tolilsalicilāts | 3734 | | 210–500–2 | 09.807 | 2-metilfenil-2-hidroksibenzoāts; o-krezilsalicilāts | 2-hidroksi-2-metilfenilbenzoāts | |

09.808 | 06 | 134–28–1 | gvajilacetāts | | 10659 | 205–135–0 | 09.808 | gvajokola acetāts; gvajakkoka acetāts; gvajakacetāts | 3,10-dimetil-3-(1-metilacetāt)-biciklo[5.3.0]dec-1(7)-ēns | 5 |

09.809 | 07 | 15111–97–4 | p-menta-1,8(10)-diēn-9-ilacetāts | | 10743 | 239–164–5 | 09.809 | limonēn-9-ilacetāts | | |

09.811 | 23 | 20665–85–4 | vanilīna izobutirāts | 3754 | | 243–956–6 | 09.811 | 4-izobutiril- m-anīsaldehīds; 3-metoksi-4-izobutirilbenzaldehīds; 4-formil-2-metoksifenil-2-metilpropionāts | 4-formil-2-metoksifenil-2-metilpropanoāts | |

09.812 | 23 | 614–33–5 | gliceriltribenzoāts | 3398 | 10656 | 210–379–6 | 09.812 | | propāntri-1,2,3-iltribenzoāts | 4 |

09.813 | 01 | 3681–78–5 | propildodekanoāts | | | 222–961–7 | 09.813 | propillaurāts | | |

09.814 | 01 | 2239–78–3 | propilheksadekanoāts | | 10893 | 218–803–1 | 09.814 | propilpalmitāts | | |

09.815 | 09 | 616–09–1 | propillaktāts | | | 210–464–8 | 09.815 | | propil-2-hidroksipropanoāts | |

09.816 | 01 | 624–13–5 | propiloktanoāts | | 10892 | 210–830–7 | 09.816 | propilkaprilāts | | |

09.817 | 15 | 10521–96–7 | stirilacetāts | | | 234–065–3 | 09.817 | | 2-feniletenilacetāts | |

09.818 | 03 | 29548–30–9 | 3,7,11-trimetildodeka-2,6,10-trienilacetāts | | | 249–689–1 | 09.818 | farnezilacetāts | | |

09.819 | 02 | 58430–94–7 | 3,5,5-trimetilheksilacetāts | | | 261–245–9 | 09.819 | | | |

09.820 | 01 | 1731–81–3 | undecilacetāts | | 10906 | 217–051–1 | 09.820 | | | |

09.821 | 08 | 117–98–6 | vetiverilacetāts | | 11887 | 204–225–7 | 09.821 | vetiveracetāts vetivertacetāts | 2,6-dimetil-9-(1-metiletilidēn)biciklo[5.3.0]dec-2-ēn-4-ilacetāts | |

09.822 | 03 | 108–22–5 | izopropenilacetāts | | | 203–562–7 | 09.822 | | | |

09.824 | 09 | 607–97–6 | etil-2-acetilbutirāts | | | 210–151–6 | 09.824 | | | |

09.825 | 23 | 2049–96–9 | pentilbenzoāts | | 2307 | 218–077–6 | 09.825 | amilbenzoāts; izoamilbenzoāts; 3-metil-1-butilbenzoāts | | |

09.828 | 01 | 2396–85–2 | metil-2-oktenoāts | 3712 | 11800 | 219–259–8 | 09.828 | | | 5 |

09.829 | 01 | 5452–75–5 | etilcikloheksilacetāts | 2348 | 218 | 226–695–2 | 09.829 | | | 5 |

09.830 | 06 | 8007–35–0 | terpineola acetāts | 3047 | 205 | 201–265–7 | 09.830 | | | 5 |

09.831 | 01 | 13058–12–3 | etil-3, 7-dimetil-2, 6-oktadienoāts | | | 235–948–6 | 09.831 | etilgeranāts | | |

09.832 | 09 | 21188–61–4 | etil-3-acetoheksanoāts | | 10566 | 244–263–1 | 09.832 | | | 5 |

09.833 | 09 | 21884–26–4 | izopropil-4-oksopentanoāts | | | 244–630–6 | 09.833 | izopropillevulināts | | |

09.835 | 23 | 42175–41–7 | benzildekanoāts | | | 255–696–0 | 09.835 | | | |

09.836 | 22 | 60045–26–3 | 3-fenilpropilbenzoāts | | | | 09.836 | | | |

09.837 | 22 | 60045–27–4 | 3-fenilpropil-3-fenilpropionāts | | | 262–036–5 | 09.837 | | | |

09.838 | 04 | 67633–96–9 | 3-heksenilmetilkarbonāts | | | 266–797–4 | 09.838 | | | 5 |

09.839 | 01 | 72928–48–4 | decil-3-metilbutirāts | | | 277–077–4 | 09.839 | | | |

09.840 | 01 | 84788–08–9 | propil-2,4-dekadienoāts | 3648 | 10889 | 284–147–8 | 09.840 | | | |

09.841 | 03 | 85554–72–9 | 2-hekseniloktanoāts | | | 287–605–5 | 09.841 | | | 5 |

09.842 | 08 | 156679–39–9 | mentoletilēnglikola karbonāts | 3805 | | | 09.842 | | | |

09.843 | 08 | 30304–82–6 | mentol-1- un 2-propilēnglikola karbonāts | 3806 | | | 09.843 | | | |

09.845 | 08 | 1205–42–1 | cis- 2-metil-5-(1-metiletenil)- 2-cikloheksēn-1-ilacetāts | | | 214–883–7 | 09.845 | | | |

09.846 | 04 | 2315–09–5 | 3-heksenilformiāts | 3353 | 2153 | 219–017–1 | 09.846 | | | 5 |

09.848 | 08 | 5655–61–8 | (1S-endo)- 1,7,7-trimetilbiciklo[2.2.1]heptān-2-ola acetāts | | | 227–101–4 | 09.848 | | | |

09.849 | 05 | 10250–45–0 | 2,6-dimetil-4-heptilacetāts | | | 233–588–4 | 09.849 | | 1-izobutil-3-metilbutilacetāts | |

09.850 | 01 | 27829–72–7 | etil- trans- 2-heksenoāts | 3675 | 631 | 248–681–5 | 09.850 | | | 5 |

09.852 | 23 | 51115–63–0 | 2-metilbutil-2-hidroksibenzoāts | | | 256–972–3 | 09.852 | | | 5 |

09.853 | 23 | 52513–03–8 | 2-metilbutilbenzoāts | | | 257–982–0 | 09.853 | | | |

09.854 | 04 | 53398–85–9 | cis- 3-heksenil-2-metilbutanoāts | 3497 | 2345 | 258–517–4 | 09.854 | | | 5 |

09.855 | 04 | 56922–82–8 | trans- 3-heksenilheksanoāts | | | 260–444–8 | 09.855 | | | |

09.856 | 04 | 65405–80–3 | cis- 3-heksenilkrotonāts | | | 265–746–3 | 09.856 | | cis- 3-heksenil- trans- 2-butenoāts | 5 |

09.857 | 09 | 63270–14–4 | nonāndiola diacetāts | 2783 | | 264–060–1 | 09.857 | | nonān-1,3-diildiacetāts | |

09.858 | 23 | 67674–41–3 | fenilmetil-2-metil-2-butenoāts | 3330 | 2184 | 266–880–5 | 09.858 | | | |

09.862 | 09 | 85554–66–1 | etil-3-acetoksioktanoāts | | | 287–598–9 | 09.862 | | | |

09.863 | 09 | 638–33–5 | 2-metilbutillaktāts | | 10769 | | 09.863 | | 2-metilbutil-2-hidroksipropanoāts | |

09.865 | 01 | 20290–84–0 | heksil-9-oktadecenoāts | | | 243–692–1 | 09.865 | heksiloleāts | | |

09.866 | 03 | | alilvalerāts | | | | 09.866 | alilpentanoāts | | |

09.868 | 05 | | sek-butil-2-metilkrotonāts | | | | 09.868 | 2-butiltiglāts | 1-metilpropil-2-metilbut-2-( trans)-enoāts | |

09.870 | 08 | | karvil-3-metilbutirāts | | | | 09.870 | karvilizopentanoāts | p-menta-6,8-dienil-2-metilbutanoāts | |

09.871 | 04 | | citronelildekanoāts | | | | 09.871 | citronelilkaprāts | 3,7-dimetilokt-6-enildekanoāts | |

09.872 | 04 | | citronelildodekanoāts | | | | 09.872 | citronelillaurāts | 3,7-dimetilokt-6-enildodekanoāts | |

09.874 | 30 | | di-(2-metilbutil)malāts | | | | 09.874 | | di-(2-metilbutil)- 2-hidroksibutāndioāts | |

09.878 | 18 | 61114–24–7 | eigenilizovalerāts | | | | 09.878 | | 4-alil-2-metoksifenil-3-metilbutanoāts | |

09.880 | 05 | | hept-4-enil-2-butirāts | | | | 09.880 | | 1-metilheks-3-enilbutirāts | |

09.881 | 03 | | heks-2-( trans)-enilizobutirāts | | | | 09.881 | | heks-2-( trans)-enil-2-metilpropanoāts | |

09.883 | 04 | | heks-3-( cis)-enilmetilkarbonāts | | | | 09.883 | | | |

09.884 | 04 | | heks-3-enil-2-etilbutirāts | | | | 09.884 | | | |

09.885 | 04 | | heks-3-enilheksadekanoāts | | | | 09.885 | 3-heksenilpalmitāts | | |

09.887 | 01 | 16930–96–4 | heksiltiglāts | | | | 09.887 | | heksil-2-metilbut-2-( trans)-enoāts | |

09.888 | 08 | | izobornil-2-metilbutirāts | | | | 09.888 | | 1,7,7-trimetilbiciklo[2.2.1]hept-2-il-2-metilbutanoāts | |

09.889 | 02 | | izobutil-2-metilkrotonāts | | | | 09.889 | izobutiltiglāts | 2-metilpropil-2-metilbut-2-( trans)-enoāts | |

09.890 | 04 | | izoprenil-2-metilbutirāts | | | | 09.890 | | 2-metil-1,3-butadienil-2-metilbutanoāts | |

09.893 | 25 | | 2-izopropil-5-metilfenilformiāts | | | | 09.893 | timilformiāts | | |

09.894 | 17 | | 2-metoksi-4-(prop-1-enil)fenil-3-metilbutirāts | | | | 09.894 | izoeigenilizopentanoāts | | |

09.895 | 23 | | 4-metoksibenzil-2-metilpropionāts | | | | 09.895 | | | |

09.896 | 03 | | 2-metilbut-2-enilformiāts | | | | 09.896 | | | |

09.897 | 04 | | 3-metilbut-3-ēn-1-ilbutirāts | | | | 09.897 | | | |

09.898 | 04 | | 3-metilbut-3-ēn-1-ilheksanoāts | | | | 09.898 | | | |

09.899 | 07 | | mirtenil-2-metilbutirāts | | | | 09.899 | | (6,6-dimetilbiciklo[3.3.1]hept-2-ēn-2-il)metil-2-metilbutanoāts | |

09.900 | 07 | | mirtenil-3-metilbutirāts | | | | 09.900 | mirtenilizovalerāts | (6,6-dimetilbiciklo[3.3.1]hept-2-enil)metilizopentanoāts | |

09.903 | 03 | | prenil-3-metilbut-2-enoāts | | | | 09.903 | | 3-metilbut-2-enil-3-metilbut-2-enoāts | |

09.914 | 30 | | dietilcitrāts | | | | 09.914 | | | |

09.915 | 23 | 94–13–3 | propil-4-hidroksibenzoāts | 2951 | 678 | 202–307–7 | 09.915 | | | |

09.916 | 09 | 7367–90–0 | etil-3-hidroksioktanoāts | | 10603 | 230–919–4 | 09.916 | | | |

10.001 | 09 | 104–61–0 | nonano-1,4-laktons | 2781 | 178 | 203–219–1 | 10.001 | γ-nonalaktons; 4-hidroksinonānskābes?-laktons; C 18 aldehīds (tā sauktais); prunolīds; γ-amilbutirolaktons; nonanolīds-1,4 | | |

10.002 | 09 | 104–67–6 | undekano-1,4-laktons | 3091 | 179 | 203–225–4 | 10.002 | γ-undekalaktons; C 18 aldehīds (tā sauktais); γ-undecillaktons; γ-heptilbutirolaktons; 1,4-hendekanolīds | | |

10.003 | 09 | 7779–50–2 | heksadec-6-ēno-1,16-laktons | 2555 | 180 | 231–929–1 | 10.003 | ambretolīds; ω-6-heksadecenlaktons; 16-hidroksi-7-heksadecēnskābes laktons; cikloheksadec-7-olīds; 6-heksadecenolīds | | 5 |

10.004 | 09 | 106–02–5 | pentadekano-1,15-laktons | 2840 | 181 | 203–354–6 | 10.004 | eksaltolīds; ω-pentadekalaktons; angelikas laktons; muskolaktons; 15-hidroksitetradekānskābes laktons; 1,15-epoksipentadekān-1-ons; ciklopentadekanolīds; 15-pentadekanolīds | | |

10.005 | 11 | 17369–59–4 | 3-propilidēnftalīds | 2952 | 494 | 241–402–8 | 10.005 | | | |

10.006 | 09 | 96–48–0 | butiro-1,4-laktons | 3291 | 615 | 202–509–5 | 10.006 | 4-hidroksibutānskābes laktons; γ-butirolaktons; 1,4-epoksibutān-1-ons; 2-oksooksolēns; dihidro-2-(3H)-furanons; 3-(vai 4-)-hidroksisviestskābes laktons; 1,2-butanolīds | | |

10.007 | 09 | 705–86–2 | dekano-1,5-laktons | 2361 | 621 | 211–889–1 | 10.007 | δ-dekalaktons; dekanolīds-1,5; amil-δ-valerolaktons; δ-n-amil-δ-valerolaktons | | |

10.008 | 09 | 713–95–1 | dodekano-1,5-laktons | 2401 | 624 | 211–932–4 | 10.008 | δ-dodekalaktons; n-heptil-δ-valerolaktons; 5-hidroksidodekānskābes δ-laktons; δ-n-heptil-δ-valerolaktons; dodekanolīds-1,5 | | |

10.009 | 09 | 18679–18–0 | dodec-6-ēno-1,4-laktons | 3780 | 625 | 242–497–9 | 10.009 | γ-dodecen-6-laktons; 4-hidroksi-6-dodecēnskābes laktons; dihidr-5-(2-oktenil)- 2(3H)-furanons; cis-6-dodecēn-4-olīds | | 5 |

10.010 | 09 | 823–22–3 | heksano-1, 5-laktons | 3167 | 641 | 212–511–8 | 10.010 | δ-heksalaktons; 5-hidroksiheksānskābes laktons; δ-kaprolaktons; 5-metil-d-valerolaktons; 5-metil-5-hidroksipentānskābes laktons | | |

10.011 | 09 | 710–04–3 | undekano-1,5-laktons | 3294 | 688 | 211–915–1 | 10.011 | 5-hidroksiundekānskābes laktons; undekanolīds-1,5; α-n-heksil-δ-valerolaktons; 5-n-heksil-5-hidroksipentānskābes laktons | | |

10.012 | 13 | 591–12–8 | 5-metilfurān-2(3H)-ons | 3293 | 731 | 209–701–8 | 10.012 | 4-hidroksi-3-pentēnskābes laktons; pent-3-ēn-1,4-laktons; β, γ-angelikas laktons; 5-metil-2-(3H)-furanons; γ-metil-β-butenolids | | |

10.013 | 09 | 108–29–2 | pentano-1,4-laktons | 3103 | 757 | 203–569–5 | 10.013 | γ-valerolaktons; 4-hidroksipentānskābes laktons; γ-metil-γ-butirolaktons; γ-pentalaktons; 4-valerolaktons; 4-pentanolīds | | |

10.014 | 09 | 3301–94–8 | nonano-1,5-laktons | 3356 | 2194 | 221–974–5 | 10.014 | δ-nonalaktons; 5-hidroksinonānskābes laktons; nonanolīds-1,5; n-butil-δ-valerolaktons | | |

10.015 | 09 | 698–76–0 | oktano-1,5-laktons | 3214 | 2195 | 211–820–5 | 10.015 | 5-hidroksioktānskābes laktons; δ-oktalaktons; tetrahidro-6-propil-5-hidroksi-2H-pirān-2-ons | | |

10.016 | 09 | 2721–22–4 | tetradekano-1,5-laktons | 3590 | 2196 | 220–334–2 | 10.016 | δ-tetradekalaktons; 5-hidroksitetradekānskābes laktons; 2H-pirān-2-ons, tetrahidro-6-nonil– | | |

10.017 | 09 | 706–14–9 | dekano-1,4-laktons | 2360 | 2230 | 211–892–8 | 10.017 | γ-dekalaktons; γ-n-dekalaktons; dekanolīds-1,4; γ-n-heksil-γ-butirolaktons | | |

10.018 | 09 | 7774–47–2 | 4-butiloktano-1,4-laktons | 2372 | 2231 | 231–875–9 | 10.018 | 4,4-dibutil-4-hidroksisviestskābes γ-laktons; 4-butil-4-hidroksioktānskābes laktons | | |

10.019 | 09 | 2305–05–7 | dodekano-1,4-laktons | 2400 | 2240 | 218–971–6 | 10.019 | γ-dodekalaktons; dodekanolīds-1,4; γ-n-oktil-γ-n-butirolaktons; dodekanolīds-1 | | |

10.020 | 09 | 105–21–5 | heptano-1,4-laktons | 2539 | 2253 | 203–279–9 | 10.020 | heptanolīds-1,4; γ-heptalaktons; heptanolīds-4,1; 4-hidroksiheptānskābes γ-laktons | | |

10.021 | 09 | 695–06–7 | heksano-1,4-laktons | 2556 | 2254 | 211–778–8 | 10.021 | γ-heksalaktons; heksanolīds-1,4; γ-etil-n-butirolaktons; tonkalīds; γ-kaprolaktons; etilbutirolaktons | | |

10.022 | 09 | 104–50–7 | oktano-1,4-laktons | 2796 | 2274 | 203–208–1 | 10.022 | γ-oktalaktons; oktanolīds-1,4; γ-n-butil-γ-butirolaktons | | |

10.023 | 13 | 698–10–2 | 5-etil-3-hidroksi-4-metilfurān-2(5H)-ons | 3153 | 2300 | 211–811–6 | 10.023 | emoksifurons; 2,4-dihidroksi-3-metil-2-heksēnskābes γ-laktons; 2-etil-3-metil-4-hidroksidihidro-2,5-furān-5-ons | | |

10.024 | 11 | 551–08–6 | 3-butilidēnftalīds | 3333 | 10083 | 208–991–3 | 10.024 | | | |

10.025 | 11 | 6066–49–5 | 3-butilftalīds | 3334 | 10084 | 228–000–8 | 10.025 | | | |

10.026 | 09 | 40923–64–6 | 3-heptildihidro-5-metil-2(3H)-furanons | 3350 | 10953 | 255–141–2 | 10.026 | α-heptil-γ-valerolaktons; α-n-heptil-8-valerolaktons | | |

10.027 | 09 | 499–54–7 | 3,7-dimetiloktano-1,6-laktons | 3355 | 11833 | 207–882–8 | 10.027 | mentāna laktons; 6-hidroksi-3, 7-dimetilkaprilskābes laktons; 4-metil-7-izopropil-2-oksepanons; mentona laktons | | |

10.028 | 09 | 16429–21–3 | dodekano-1,6-laktons | 3610 | | 240–483–7 | 10.028 | ε-dodekalaktons; 7-heksil-2-oksepanons | | |

10.029 | 09 | 5579–78–2 | dekano-1,6-laktons | 3613 | | 226–963–9 | 10.029 | ε-dekalaktons; 7-butil-2-oksepanons; 6-butilheksanolīds | | |

10.030 | 13 | 28664–35–9 | 3-hidroksi-4,5-dimetilfurān-2(5H)-ons | 3634 | 11834 | 249–136–4 | 10.030 | 2-hidroksi-3-metilpent-2-ēn-1,4-laktons; 2,3-dimetil-4-hidroksi-2,5-dihidrofurān-5-ons | | |

10.031 | 09 | 27593–23–3 | 6-pentil-2H-pirān-2-ons | 3696 | 10967 | 248–552–3 | 10.031 | 6-pentil-α-pirons; 2H-pirān-2-ons, 6-pentil– | | |

10.033 | 09 | 34686–71–0 | dec-7-ēno-1,5-laktons | 3745 | | 247–074–2 | 10.033 | 2H-pirān-2-ons, tetrahidro-6-(2-pentenil)-, (Z)-; 7-decēn-5-olīds | | |

10.034 | 13 | 80417–97–6 | 5,6-dihidro-3,6-dimetilbenzofurān-2(4H)-ons | 3755 | | 279–462–2 | 10.034 | dehidromentofurolaktons; 2(4H)-benzofuranons, 5,6dihidro-3,6-dimetil-, (R)– | | |

10.035 | 09 | 68959–28–4 | undec-8-ēno-1, 5-laktons | 3758 | | 273–411–8 | 10.035 | 5-hidroksiundec-8-ēnskābes laktons; 6-(3-heksenil)tetrahidro(2H)pirān-2-ons; 2H-pirān-2-ons, 6-(3-heksenil)tetrahidro-, (Z)- | | |

10.036 | 11 | 13341–72–5 | 5,6,7,7a-tetrahidro-3,6-dimetilbenzofurān-2(4H)-ons | 3764 | | 236–390–6 | 10.036 | 2(4H)-benzofuranons, 5,6,7,7a-tetrahidro-3,6-dimetil-; dehidroksimentofurolaktons | mintlaktons | |

10.037 | 09 | 54814–64–1 | dec-2-ēno-1,5-laktons | 3744 | | 259–359–9 | 10.037 | masojalaktons | | |

10.038 | 09 | 67114–38–9 | dec-7-ēno-1,4-laktons | | | | 10.038 | | | |

10.039 | 09 | 63095–33–0 | cis-dec-7-ēno-1,4-laktons | | | 263–852–4 | 10.039 | (Z)- 5-(3-heksenil)dihidrofurān-2(3H)-ons | | |

10.040 | 09 | 32764–98–0 | dec-8-ēno-1,5-laktons | | | 251–201–7 | 10.040 | tetrahidro-6-(3-pentenil)- 2H-pirān-2-ons | | |

10.041 | 13 | 10547–84–9 | 3,4-dimetil-5-pentilfurān-2(5H)-ons | | | | 10.041 | | | |

10.042 | 13 | 774–64–1 | 3,4-dimetil-5-pentilidēnfurān-2(5H)-ons | | 11873 | | 10.042 | bovolīds; 4-hidroksi-2,3-dimetilnona-2,4-diēnskābes laktons | | |

10.043 | 09 | 74183–60–1 | 2,7-dimetilokta-5-( trans), 7-dieno-1,4-laktons | | | | 10.043 | marmarolaktons | | |

10.044 | 09 | 16400–72–9 | dodec-2-ēno-1,5-laktons | 3802 | | 240–453–3 | 10.044 | 5-hidroksi-2-dodecēnskābes laktons; δ-2-dodecenolaktons; 6-heptil-5, 6-dihidro-2-pirons; 5-heptil-2-pentēn-5-olīds | | |

10.045 | 09 | 3301–90–4 | heptano-1,5-laktons | | 10660 | 221–972–4 | 10.045 | 6-etiltetrahidro-2H-pirān-2-ons | | |

10.046 | 13 | 2407–43–4 | heks-2-ēno-1,4-laktons | | | 219–304–1 | 10.046 | 5-etil-2(5H)-furanons; 5-etilfurān-2(5H)-ons | | |

10.047 | 09 | 109–29–5 | heksadekano-1, 16-laktons | | | 203–662–0 | 10.047 | dihidroambretolīds; heksadekān-16-olīds; oksacikloheptadekān-2-ons | | |

10.048 | 09 | 730–46–1 | heksadekano-1,4-laktons | | 10673 | | 10.048 | | | |

10.049 | 09 | 7370–44–7 | heksadekano-1,5-laktons | | 10674 | 230–924–1 | 10.049 | tetrahidro-6-undecil-2H-pirān-2-ons | | |

10.050 | 13 | 92015–65–1 | heksahidro-3, 6-dimetil-2(3H)-benzofuranons | | | | 10.050 | | | |

10.051 | 09 | 7011–83–8 | 5-heksil-5-metildihidrofurān-2(3H)-ons | 3786 | | 230–291–1 | 10.051 | metil-γ-dekalaktons; dihidrojasmona laktons; 5-heksildihidro-5-metilfurān-2(3H)-ons | | |

10.052 | 09 | 33673–62–0 | 3-metilnonano-1,4-laktons | | | 251–629–4 | 10.052 | dihidro-4-metil-5-pentilfurān-2(3H)-ons | | |

10.053 | 09 | 39212–23–2 | 3-metiloktano-1,4-laktons | 3803 | 10535 | 254–357–4 | 10.053 | β-metil-γ-oktalaktons; 4-butil-3-metil-1, 4-butirolaktons; 5-butildihidro-4-metilfurān-2(3H)-ons | | |

10.054 | 13 | 21963–26–8 | non-2-ēno-1,4-laktons | | | 244–685–6 | 10.054 | 5-pentilfurān-2(5H)-ons | | |

10.055 | 09 | 542–28–9 | pentano-1,5-laktons | | 10907 | 208–807–1 | 10.055 | 1,5-valerolaktons; δ-valerolaktons | | |

10.056 | 11 | 87–41–2 | ftalīds | | | 201–744–0 | 10.056 | 1(3H)-izobenzofuranons | benzofurān-2(5H)-ons | |

10.057 | 11 | 57743–63–2 | 3a,4,5,7a-tetrahidro-3,6-dimetilbenzofurān-2(3H)-ons | | | | 10.057 | | | |

10.058 | 09 | 7370–92–5 | tridekano-1, 5-laktons | | 10902 | 230–927–8 | 10.058 | tetrahidro-6-oktil-2H-pirān-2-ons | | |

10.059 | 09 | 123–69–3 | heksadec-7-ēn-1,16-laktons | | | 203–644–5 | 10.059 | heksadec-7-ēn-16-olīds; oksacikloheptadec-8-ēn-2-ons, (Z)- | | |

10.060 | 13 | 2518–53–8 | 2-decēn-1,4-laktons | | | 219–742–3 | 10.060 | 5-heksilfurān-2(5)-ons | | |

10.061 | 13 | 70851–61–5 | cis-5-heksenildihidro-5-metilfurān-2(3H)-ons | 3937 | | 274–942–8 | 10.061 | 4-hidroksi-4-metildec-9-ēnskābes laktons; (Z)- 2-heks-3-enildihidro-5-metilfurān-2(3H)-ons | | |

10.063 | 09 | 28645–51–4 | heksadec-9-ēn-1,16-laktons | | | 249–120–7 | 10.063 | | oksacikloheptadec-10-ēn-2-ons | |

10.065 | 13 | | 2,3-dimetilnon-2-ēno-1,4-laktons | | | | 10.065 | | | |

10.066 | 13 | | furān-2(5H)-ons | | | | 10.066 | but-2-ēn-1,4-laktons | | |

10.068 | 09 | | pentadekano-1,14-laktons | | | | 10.068 | | | |

11.001 | 33 | 107–85–7 | 3-metilbutilamīns | 3219 | 512 | 203–526–0 | 11.001 | izoamilamīns; izopentilamīns; 1-butānamīns, 3-metil– | | |

11.002 | 33 | 78–81–9 | izobutilamīns | | 513 | 201–145–4 | 11.002 | | 2-metilpropilamīns | |

11.003 | 33 | 109–73–9 | butilamīns | 3130 | 524 | 203–699–2 | 11.003 | 1-aminobutāns | | |

11.004 | 33 | 107–10–8 | propilamīns | | 601 | 203–462–3 | 11.004 | | | |

11.005 | 33 | 13952–84–6 | sek-butilamīns | | 707 | 237–732–7 | 11.005 | but-2-ilamīns | 1-metilpropilamīns | |

11.006 | 33 | 64–04–0 | fenetilamīns | 3220 | 708 | 200–574–4 | 11.006 | 1-amino-2-feniletāns; 2-aminoetilbenzols; 2-feniletilamīns | | |

11.007 | 33 | 51–67–2 | 2-(4-hidroksifenil)etilamīns | | 709 | 200–115–8 | 11.007 | tiramīns; 4-(2-aminoetil)fenols; 4-hidroksifeniletilamīns; tirozamīns | | |

11.008 | 33 | 551–93–9 | 2-aminoacetofenons | 3906 | 2041 | 209–002–8 | 11.008 | 1-acetil-2-aminobenzols; o-acetilanilīns; 2-acetilfenilamīns; o-aminoacetofenons; 2-aminofenilmetilketons | | |

11.009 | 33 | 75–50–3 | trimetilamīns | 3241 | 10497 | 200–875–0 | 11.009 | N, N-dimetilmetilamīns | | |

11.011 | 33 | 5331–48–6 | N-acetilpropilamīns | | | 226–231–9 | 11.011 | N-propilacetamīds | | |

11.012 | 33 | 109–89–7 | dietilamīns | | 10470 | 203–716–3 | 11.012 | N-etiletilamīns | | |

11.013 | 33 | 124–40–3 | dimetilamīns | | 10473 | 204–697–4 | 11.013 | | | |

11.014 | 33 | 19342–01–9 | N, N-dimetilfenetilamīns | | | 242–976–2 | 11.014 | | | |

11.015 | 33 | 75–04–7 | etilamīns | | 10477 | 200–834–7 | 11.015 | | | |

11.016 | 33 | 111–26–2 | heksilamīns | | 10478 | 203–851–8 | 11.016 | | | |

11.017 | 33 | 35448–31–8 | N-izopentilidēnizopentilamīns | | | | 11.017 | | N-(3-metilbutilidēn)- 3-metil-1-butilamīns | |

11.018 | 33 | 75–31–0 | izopropilamīns | | 10480 | 200–860–9 | 11.018 | | 2-aminopropāns | |

11.019 | 33 | 74–89–5 | metilamīns | | 10483 | 200–820–0 | 11.019 | | | |

11.020 | 33 | 96–15–1 | 2-metilbutilamīns | | 10484 | 202–483–5 | 11.020 | | | |

11.021 | 33 | 110–58–7 | pentilamīns | | 11734 | 203–780–2 | 11.021 | amilamīns | | |

11.022 | 33 | 102–82–9 | tributilamīns | | | 203–058–7 | 11.022 | | | |

11.023 | 33 | 121–44–8 | trietilamīns | | 10496 | 204–469–4 | 11.023 | N, N-dietiletilamīns | | |

11.024 | 33 | 593–81–7 | trimetilamīna hidrohlorīds | | | 209–810–0 | 11.024 | | | |

11.025 | 33 | 1184–78–7 | trimetilamīna oksīds | | 10494 | 214–675–6 | 11.025 | trimetilamīna N-oksīda dihidrāts | | |

11.026 | 33 | 102–69–2 | tripropilamīns | | 10495 | 203–047–7 | 11.026 | | | |

12.001 | 20 | 3268–49–3 | 3-(metiltio)propionaldehīds | 2747 | 125 | 221–882–5 | 12.001 | metionāls; 3-(metiltio)propanāls; metilmerkaptopropionaldehīds; β-metiltiopropionaldehids | | |

12.002 | 20 | 13532–18–8 | metil-3-(metiltio)propionāts | 2720 | 428 | 236–883–6 | 12.002 | metil-β-metilmerkaptopropionats; metil-β-metiopropionats | | |

12.003 | 20 | 74–93–1 | metāntiols | 2716 | 475 | 200–822–1 | 12.003 | metilmerkaptāns; tiometilspirts; metilsulfhidrāts; merkaptometāns | | |

12.004 | 20 | 870–23–5 | aliltiols | 2035 | 476 | 212–792–7 | 12.004 | 2-propēn-1-tiols; alilsulfhidrāts | | |

12.005 | 20 | 100–53–8 | fenilmetāntiols | 2147 | 477 | 202–862–5 | 12.005 | benzilmerkaptāns; α-merkaptotoluols; α-toluoltiols; benzilhidrosulfīds; benziltiols; tiobenzilspirts | | |

12.006 | 20 | 75–18–3 | dimetilsulfīds | 2746 | 483 | 200–846–2 | 12.006 | metilsulfīds; 2-tiapropāns | | |

12.007 | 20 | 544–40–1 | dibutilsulfīds | 2215 | 484 | 208–870–5 | 12.007 | butilsulfīds; di-n-butilsulfīds; butiltiobutāns | | |

12.008 | 20 | 2179–57–9 | dialildisulfīds | 2028 | 485 | 218–548–6 | 12.008 | alildisulfīds; 2-propenildisulfīds | | |

12.009 | 20 | 2050–87–5 | dialiltrisulfīds | 3265 | 486 | 218–107–8 | 12.009 | aliltrisulfīds; prop-2-eniltritioprop-2-ēns | | |

12.010 | 20 | 109–79–5 | butān-1-tiols | 3478 | 526 | 203–705–3 | 12.010 | n-butilmerkaptāns | | |

12.011 | 20 | 1569–69–3 | cikloheksāntiols | | 529 | 216–378–7 | 12.011 | cikloheksilmerkaptāns | | |

12.012 | 20 | 110–81–6 | dietildisulfīds | | 533 | 203–805–7 | 12.012 | | | |

12.013 | 20 | 3658–80–8 | dimetiltrisulfīds | 3275 | 539 | 222–910–9 | 12.013 | metiltrisulfīds; metiltritiometāns; | | |

12.014 | 20 | 629–19–6 | dipropildisulfīds | 3228 | 540 | 211–079–8 | 12.014 | propildisulfīds; propilditiopropāns | | |

12.015 | 20 | 111–47–7 | dipropilsulfīds | | 541 | 203–873–8 | 12.015 | | | |

12.016 | 20 | 625–80–9 | diizopropilsulfīds | | 542 | 210–911–7 | 12.016 | | | |

12.017 | 20 | 75–08–1 | etāntiols | | 546 | 200–837–3 | 12.017 | etilmerkaptāns | | |

12.018 | 20 | 625–60–5 | S-etilacetotioāts | 3282 | 11665 | 210–904–9 | 12.018 | etiltioacetāts; etiķskābes tioetils; etāntioskābes S-etilesteris; etiķskābes tioetilesteris | | |

12.019 | 20 | 2179–60–4 | metilpropildisulfīds | 3201 | 585 | 218–551–2 | 12.019 | propilmetildisulfīds; metilditiopropāns | | |

12.020 | 20 | 17619–36–2 | metilpropiltrisulfīds | 3308 | 586 | 241–594–3 | 12.020 | propilmetiltrisulfīds; metiltritiopropāns; propilmetiltrisulfīds | | |

12.021 | 20 | 2179–59–1 | alilpropildisulfīds | | 600 | 218–550–7 | 12.021 | | | |

12.022 | 20 | 4532–64–3 | butān-2,3-ditiols | 3477 | 725 | 224–870–8 | 12.022 | 2,3-dimerkaptobutāns | | |

12.023 | 20 | 6028–61–1 | dipropiltrisulfīds | 3276 | 726 | 227–903–4 | 12.023 | propiltrisulfīds; propiltritiopropāns | | |

12.024 | 20 | 37887–04–0 | 3-merkaptobutān-2-ols | 3502 | 760 | 253–701–0 | 12.024 | 2-hidroksi-3-butāntiols; 3-hidroksi-2-butāntiols; 3-merkapto-2-butanols | | |

12.025 | 30 | 57–06–7 | alilizotiocianāts | 2034 | 2110 | 200–309–2 | 12.025 | 3-izotiocianātpropēns; 2-propenilizotiocianāts; AITC; izotiociānskābes alilesteris; 2-propenilizotiocianāts; alilizosulfocianāts; aliltiokarbonimīds | | |

12.026 | 20 | 624–92–0 | dimetildisulfīds | 3536 | 2175 | 210–871–0 | 12.026 | metildisulfīds; | | |

12.027 | 20 | 137–06–4 | 2-metilbenzol-1-tiols | 3240 | 2272 | 205–276–8 | 12.027 | o-toluoltiols; 2-metiltiofenols; o-tolilmerkaptāns | | |

12.028 | 20 | 2550–40–5 | dicikloheksildisulfīds | 3448 | 2320 | 219–851–6 | 12.028 | cikloheksildisulfīds | | |

12.029 | 20 | 1679–07–8 | ciklopentāntiols | 3262 | 2321 | 216–841–3 | 12.029 | ciklopentilmerkaptāns | | |

12.030 | 30 | 505–79–3 | 3-(metiltio)propilizotiocianāts | 3312 | 2326 | 208–020–3 | 12.030 | 3-metilmerkaptopropilizotiocianāts; izotiociānskābes 3-(metiltio)propilesteris | | |

12.031 | 20 | 67633–97–0 | 3-merkaptopentān-2-ons | 3300 | 2327 | 266–799–5 | 12.031 | | | |

12.032 | 20 | 2432–51–1 | S-metilbutāntioāts | 3310 | 2328 | 219–407–1 | 12.032 | metiltiobutirāts; metāntiola n-butirāts; tiosviestskābes metilesteris | | |

12.033 | 20 | 91–60–1 | naftalīn-2-tiols | 3314 | 2330 | 202–082–5 | 12.033 | β-tionaftols; 2-merkaptonaftalīns; 2-naftilmerkaptāns; 2-tionaftols | | |

12.034 | 20 | 1191–62–4 | oktān-1,8-ditiols | 3514 | 2331 | 214–738–8 | 12.034 | 1,8-dimerkaptooktāns; oktaetilēndimerkaptāns | | |

12.035 | 20 | | 2-, 3- un 10-merkaptopināns | 3503 | 2332 | 2459006 | 12.035 | pināntiols; pinanilmerkaptāns | 2,6,6-trimetilbiciklo[3.1.1]heptān-(2,3 un 10)-tiols | |

12.036 | 20 | 54957–02–7 | 3-[(2-merkapto-1-metilpropil)tio]butān-2-ols | 3509 | 2353 | | 12.036 | α-metil-β-hidroksipropil-α-metil-β-merkaptopropilsulfīds; 2-butanols, 3-[(2-merkapto-1-metilpropil)tiol- | | |

12.037 | 20 | 2179–58–0 | alilmetildisulfīds | 3127 | 11866 | 218–549–1 | 12.037 | metilalildisulfīds | | |

12.038 | 20 | 38462–22–5 | 8-merkapto- p-mentān-3-ons | 3177 | 11789 | 253–953–1 | 12.038 | 8-merkaptomentons; tiomentons | | |

12.039 | 20 | 79–42–5 | 2-merkaptopropionskābe | 3180 | 11790 | 201–206–5 | 12.039 | tiopienskābe; α-merkaptopropionskabe; 2-tiolpropionskābe | | |

12.040 | 20 | 23328–62–3 | 2-metiltioacetaldehīds | 3206 | 11686 | 245–587–6 | 12.040 | metilmerkaptoaldehīds; metilmerkaptoacetaldehīds | | |

12.041 | 20 | 13678–58–5 | 1-(metiltio)butān-2-ons | 3207 | 11543 | 237–169–7 | 12.041 | | | |

12.042 | 20 | 1073–29–6 | 2-(metiltio)fenols | 3210 | 11553 | 214–027–2 | 12.042 | 1-hidroksi-2-metilmerkaptobenzols; 2-metilmerkaptofenols | | |

12.043 | 20 | 882–33–7 | difenildisulfīds | 3225 | 11757 | 212–926–4 | 12.043 | fenildisulfīds; bifenildisulfīds; fenilditiobenzols | | |

12.044 | 20 | 5905–46–4 | prop-1-enilpropildisulfīds | 3227 | 11699 | 227–604–9 | 12.044 | propilpropenildisulfīds | | |

12.045 | 20 | 34135–85–8 | metilaliltrisulfīds | 3253 | 11867 | 251–843–8 | 12.045 | metilaliltrisulfīds | | |

12.046 | 20 | 19788–49–9 | etil-2-merkaptopropionāts | 3279 | 11469 | 243–314–5 | 12.046 | etiltiolaktāts; 2-merkaptopropionskābes etilesteris | | |

12.047 | 20 | 40789–98–8 | 3-merkaptobutān-2-ons | 3298 | 11497 | 255–082–2 | 12.047 | | | |

12.048 | 20 | 1878–18–8 | 2-metilbutān-1-tiols | 3303 | 11509 | 217–515–3 | 12.048 | amilmerkaptāns; 2-metilbutilmerkaptāns; tioamilspirts | | |

12.049 | 20 | 2084–18–6 | 3-metilbutān-2-tiols | 3304 | 11510 | 218–223–9 | 12.049 | sek-izoamilmerkaptāns | | |

12.052 | 20 | 40790–04–3 | di-(3-oksobutil)sulfīds | 3335 | 11441 | | 12.052 | bis-(butān-3-on-1-il)sulfīds | | |

12.053 | 20 | 13327–56–5 | etil-3-(metiltio)propionāts | 3343 | 11476 | 236–370–7 | 12.053 | etil-β-metiltiopropionats | | |

12.054 | 20 | 4500–58–7 | 2-(etiltio)fenols | 3345 | 11666 | 224–811–6 | 12.054 | 2-etilfenilmerkaptāns; 2-etilbenzoltiols | | |

12.055 | 20 | 34619–12–0 | 4-merkaptobutān-2-ons | 3357 | 11498 | | 12.055 | 2-keto-4-butāntiols | | |

12.056 | 20 | 16630–52–7 | 3-(metiltio)butanāls | 3374 | 11687 | 240–678–7 | 12.056 | 3-metiltiobutiraldehīds; 3-metilpropāntiols; tioizoamilaldehīds; tioizovaleraldehīds | | |

12.057 | 20 | 34047–39–7 | 4-(metiltio)butān-2-ons | 3375 | 11688 | 251–810–8 | 12.057 | (4-metil)tio-2-butanons; metilpropiltioketons; 4-metil-2-butāntions; 2-pentāntions | | |

12.058 | 20 | 23550–40–5 | 4-(metiltio)-4-metilpentān-2-ons | 3376 | 11551 | 245–727–6 | 12.058 | | | |

12.059 | 20 | 2307–10–0 | propiltioacetāts | 3385 | 11576 | 218–984–7 | 12.059 | etāntioskābes S-propilesteris; etiķskābes tiopropilesteris | | |

12.060 | 20 | 53053–51–3 | metil-4-(metiltio)butirāts | 3412 | 11526 | 258–328–7 | 12.060 | metil-γ-metilmerkaptobutirats; | | |

12.061 | 20 | 42919–64–2 | 4-(metiltio)butanāls | 3414 | 11542 | 256–001–3 | 12.061 | 4-(metilmerkapto)butanāls | | |

12.062 | 20 | 505–10–2 | 3-(metiltio)propān-1-ols | 3415 | 11554 | 208–004–6 | 12.062 | metionols; γ-hidroksipropilmetilsulfids; 3-metiltiopropilspirts; metil-3-hidroksipropilsulfīds | | |

12.063 | 20 | 51755–66–9 | 3-(metiltio)heksān-1-ols | 3438 | 11548 | 257–380–8 | 12.063 | 3-metilmerkapto-1-heksanols | | |

12.064 | 20 | 39067–80–6 | tiogeraniols | 3472 | 11583 | 254–269–6 | 12.064 | 3,7-dimetil-2,6-oktadiēn-1-tiols | 3,7-dimetil-2-( trans),6-oktadiēn-1-tiols | |

12.065 | 20 | 59902–01–1 | 2,8-ditianon-4-ēn-4-karboksaldehīds | 3483 | 11904 | 261–978–4 | 12.065 | 5-(metiltio)-2-(metiltio)metilpent-2-ēn-1-āls | 5-metiltio-2-[(metiltio)metil]pent-2-enāls | |

12.066 | 20 | 540–63–6 | etān-1,2-ditiols | 3484 | 11467 | 208–752–3 | 12.066 | ditioglikols; 1,2-dimerkaptoetāns; etilēnditioglikols; etilēnmerkaptāns | | |

12.067 | 20 | 1191–43–1 | heksān-1,6-ditiols | 3495 | 11486 | 214–735–1 | 12.067 | 1,6-dimerkaptoheksāns; heksametilēndimerkaptāns | | |

12.068 | 20 | 699–10–5 | benzilmetildisulfīds | 3504 | 11508 | 211–826–8 | 12.068 | benzilditiometāns; metilfenilmetildisulfīds | | |

12.069 | 20 | 3489–28–9 | nonān-1,9-ditiols | 3513 | 11558 | 222–482–3 | 12.069 | 1,9-dimerkaptononāns; nonametilēndimerkaptāns | | |

12.070 | 20 | 814–67–5 | propān-1,2-ditiols | 3520 | 11564 | 212–398–5 | 12.070 | 1,2-dimerkaptopropāns | | |

12.071 | 20 | 107–03–9 | 1-propān-1-tiols | 3521 | 11816 | 203–455–5 | 12.071 | propilmerkaptāns; n-tiopropilspirts; propiltiols | | |

12.072 | 20 | 16128–68–0 | butān-1,2-ditiols | 3528 | 11909 | 240–290–8 | 12.072 | 1,2-dimerkaptobutāns | | |

12.073 | 20 | 24330–52–7 | butān-1,3-ditiols | 3529 | 11910 | 246–172–2 | 12.073 | 1,3-dimerkaptobutāns | | |

12.074 | 20 | 72869–75–1 | dialilpolisulfīdi | 3533 | 11912 | | 12.074 | 2-propenilpolisulfīdi; dialildi-, tri-, tetra- un pentasulfīdi | | |

12.075 | 20 | 5905–47–5 | metilprop-1-enildisulfīds | 3576 | 11712 | 227–605–4 | 12.075 | 1-propenilmetildisulfīds; metilditio-1-propēns | | |

12.076 | 20 | 109–80–8 | propān-1,3-ditiols | 3588 | 11929 | 203–706–9 | 12.076 | 1,3-dimerkaptopropāns; trimetilēndimerkaptāns | | |

12.077 | 20 | 766–92–7 | benzilmetilsulfīds | 3597 | | 212–174–7 | 12.077 | benzilmetilsulfīds; metiltiometilbenzols | | |

12.078 | 20 | 20582–85–8 | 4-(metiltio)butān-1-ols | 3600 | | | 12.078 | | | |

12.079 | 20 | 40878–72–6 | 2-(metiltiometil)but-2-enāls | 3601 | 11549 | 255–126–0 | 12.079 | 2-etilidēnmetionāls | | |

12.080 | 20 | 108–98–5 | tiofenols | 3616 | 11585 | 203–635–3 | 12.080 | benzoltiols; fenilmerkaptāns | | |

12.081 | 20 | 150–60–7 | dibenzildisulfīds | 3617 | | 205–764–0 | 12.081 | 1,4-difenil-2,3-ditiobutāns; α-benzilditiotoluols | | |

12.082 | 20 | 118–72–9 | 2,6-(dimetil)tiofenols | 3666 | | 204–272–3 | 12.082 | 2,6-dimetilbenzoltiols; 2,6-ksiloltiols | | |

12.083 | 20 | 5466–06–8 | etil-3-merkaptopropionāts | 3677 | | 226–771–5 | 12.083 | etil-3-tiopropionāts | | |

12.084 | 20 | 22014–48–8 | etil-4-(metiltio)butirāts | 3681 | | 244–720–5 | 12.084 | | | |

12.085 | 20 | 71159–90–5 | p-ment-1-ēn-8-tiols | 3700 | | 275–223–1 | 12.085 | α,α,4-trimetil-3-cikloheksen-1-metāntiols | | |

12.086 | 20 | 51534–66–8 | metil-2-(metiltio)butirāts | 3708 | | 255–648–9 | 12.086 | metiltio-2-metilbutirāts | 2-metilbutāntioskābes S-metilesteris | |

12.087 | 20 | 65887–08–3 | 2-(metiltiometil)- 3-fenilpropenāls | 3717 | | | 12.087 | α-benzilidenmetionals; 2-propenāls, 2-(metiltiometil)- 3-fenil- | | |

12.088 | 20 | 592–88–1 | dialilsulfīds | 2042 | 11846 | 209–775–1 | 12.088 | alilsulfīds; 2-propenilsulfīds; tioalilēteris | | |

12.089 | 20 | | etil-3-(metiltio)butirāts | 3836 | 11475 | | 12.089 | | | |

12.090 | 20 | | propilmetāntiosulfonāts | | 11571 | | 12.090 | | | |

12.091 | 20 | 6588–78–9 | 10-merkaptopināns | 3503 | 2332 | 229–520–8 | 12.091 | | 2,6,6-trimetilbiciklo[3.1.1]heptān-10-tiols | 5 |

12.092 | 20 | | dialilpentasulfīds | 3533 | 11912 | | 12.092 | | | |

12.093 | 20 | | dialilheksasulfīds | 3533 | 11912 | | 12.093 | | | |

12.094 | 20 | | dialilheptasulfīds | 3533 | 11912 | | 12.094 | | | |

12.096 | 20 | 10152–76–8 | alilmetilsulfīds | | 11429 | 233–422–0 | 12.096 | | | |

12.097 | 20 | 90195–83–8 | alilmetiltetrasulfīds | | | | 12.097 | | | |

12.098 | 20 | 33368–82–0 | alilprop-1-enildisulfīds | | 11433 | | 12.098 | | | |

12.099 | 20 | 33922–70–2 | alilpropilsulfīds | | 11434 | | 12.099 | (2-propenil)tiopropāns | | |

12.100 | 20 | 33922–73–5 | alilpropiltrisulfīds | | 11435 | | 12.100 | | | |

12.101 | 20 | 41820–22–8 | aliltiopropionāts | 3329 | 11436 | | 12.101 | | | |

12.102 | 30 | 622–78–6 | benzilizotiocianāts | | 11863 | 210–753–9 | 12.102 | 2-izocianāttoluols | | |

12.103 | 20 | 1191–08–8 | butān-1,4-ditiols | | | 214–728–3 | 12.103 | 1,4-butānditiols | | |

12.104 | 20 | 513–53–1 | butān-2-tiols | | | 208–165–2 | 12.104 | 2-butāntiols | | |

12.105 | 20 | 34322–09–3 | S-2-butil-3-metilbut-2-ēntioāts | | | 251–938–4 | 12.105 | sek-butil-3-metil-2-butēntioāts | | |

12.106 | 20 | 2432–91–9 | S-2-butil-3-metilbutāntioāts | | | 219–416–0 | 12.106 | | | |

12.107 | 30 | 592–82–5 | butilizotiocianāts | | 11488 | 209–770–4 | 12.107 | 4-izotiocianātbut-1-ēns | | |

12.108 | 20 | 68084–03–7 | diizopentiltiomalāts | | 11454 | 268–416–7 | 12.108 | bis-(3-metilbutil)merkaptosukcināts | di-(3-metilbutil)but-2-( cis)-ēn- bis-(tioāts) | |

12.109 | 20 | 4253–89–8 | diizopropildisulfīds | 3827 | 11455 | 224–225–0 | 12.109 | disulfīds, bis-(1-metiletil)-; izopropildisulfīds; 2,5-dimetil-3, 4-ditioheksāns; bis-(1-metiletil)disulfīds | | |

12.110 | 20 | 2444–49–7 | dialiltetrasulfīds | | 11449 | 219–485–7 | 12.110 | | | |

12.111 | 20 | 629–45–8 | dibutildisulfīds | | | 211–091–3 | 12.111 | | | |

12.112 | 20 | 5943–31–7 | dibutiltrisulfīds | | | | 12.112 | | | |

12.113 | 20 | 352–93–2 | dietilsulfīds | 3825 | 11450 | 206–526–9 | 12.113 | etiltioetāns; etāns, 1,1-tio- bis-; etilsulfīds; 1,1-tio- bis-etāns; 3-tiopentāns; dietiltioēteris | | |

12.114 | 20 | 3600–24–6 | dietiltrisulfīds | | 11451 | 222–754–1 | 12.114 | | | |

12.115 | 20 | 420–12–2 | dietilēnsulfīds | | | 206–993–9 | 12.115 | | | |

12.116 | 20 | 5756–24–1 | dimetiltetrasulfīds | | 11459 | 227–278–8 | 12.116 | | | |

12.117 | 20 | 872–10–6 | dipentilsulfīds | | | 212–820–8 | 12.117 | | | |

12.118 | 20 | 1618–26–4 | 2,4-ditiapentāns | 3878 | | 216–577–9 | 12.118 | formaldehīda dimetilmerkaptāls; bis-[metilmerkapto]metāns; formaldehīda dimetilditioacetāls | | |

12.119 | 20 | 112–55–0 | dodecilmerkaptāns | | | 203–984–1 | 12.119 | dodekān-1-tiols | dodekān-1-tiols | |

12.120 | 20 | 68398–18–5 | 2,8-epitio- p-mentāns | | | 269–970–2 | 12.120 | | | |

12.121 | 20 | 23747–43–5 | etil-2-(metiltio)propionāts | 3834 | 11471 | 245–862–0 | 12.121 | etil-α-(metiltio)propionats | | |

12.122 | 20 | 4455–13–4 | etil-2-(metiltio)acetāts | 3835 | | 224–700–2 | 12.122 | etil(metiltio)acetāts; etil-2-metiltioacetāts | | |

12.124 | 20 | 638–46–0 | etilbutilsulfīds | | | | 12.124 | | | |

12.125 | 20 | 2432–42–0 | etilpropāntioāts | | | 219–405–0 | 12.125 | S-etilpropāntioāts | | |

12.126 | 20 | 30453–31–7 | etilpropildisulfīds | | 11478 | | 12.126 | etilditiopropāns | | |

12.127 | 20 | 4110–50–3 | etilpropilsulfīds | | 11479 | 223–890–4 | 12.127 | | | |

12.128 | 20 | 7341–17–5 | 2-etilheksān-1-tiols | 3833 | | 230–854–1 | 12.128 | | | |

12.129 | 20 | 18721–61–4 | 3-(etiltio)propān-1-ols | | | 242–534–9 | 12.129 | 3-(etiltio)propanols | | |

12.130 | 20 | 1639–09–4 | heptān-1-tiols | | 11485 | 216–678–8 | 12.130 | heptilmerkaptāns | | |

12.131 | 20 | 2917–26–2 | heksadekān-1-tiols | | | 220–846–6 | 12.131 | | | |

12.132 | 20 | 111–31–9 | heksān-1-tiols | 3842 | 11487 | 203–857–0 | 12.132 | heksilmerkaptāns | | |

12.133 | 20 | 93762–35–7 | izopentil-3-(metiltio)propionāts | | | 297–748–5 | 12.133 | | 3-metilbutil-3-(metiltio)propanoāts | 5 |

12.134 | 20 | 34365–79–2 | S-izopropil-3-metilbut-2-ēntioāts | | | 251–966–7 | 12.134 | S-izopropiltioseneciāts; S-izopropil-3-metiltiokrotonāts | | |

12.135 | 20 | 26473–47–2 | 3-merkapto-2-metilpropionskābe | | | 247–726–6 | 12.135 | 3-merkaptoizosviestskābe | | |

12.136 | 20 | 2464–23–5 | 3-merkapto-2-oksopropionskābe | | | | 12.136 | | | |

12.137 | 20 | 34300–94–2 | 3-merkapto-3-metilbutān-1-ols | 3854 | | | 12.137 | 1-butanols, 3-merkapto-3-metil-; 3-metil-3-merkaptobutilspirts; 3-merkapto-3-metilbutilspirts | | |

12.138 | 20 | 50746–10–6 | 3-merkapto-3-metilbutilformiāts | 3855 | | | 12.138 | 3-metil-3-tiobutilformiāts; 3-merkapto-3-metil-1-butanola skudrskābes esteris; 3-metil-3-merkaptobutilformiāts | | |

12.139 | 20 | 7217–59–6 | 2-merkaptoanizols | | 11880 | 230–605–7 | 12.139 | tiogvajakols; 2-metoksitiofenols; 2-metoksibenzoltiols | 2-metoksibenzol-1-tiols | |

12.140 | 20 | 17042–24–9 | 2-merkaptopentān-3-ons | | | | 12.140 | | | |

12.141 | 20 | 23832–18–0 | 2-merkaptopināns | 3503 | 2332 | 245–900–6 | 12.141 | pinān-2-tiols | 2,6,6-trimetilbiciklo[3.1.1]heptān-2-tiols | 5 |

12.142 | 20 | 72361–41–2 | 3-merkaptopināns | 3503 | 2332 | 276–598–4 | 12.142 | | 2,6,6-trimetilbiciklo[3.1.1]heptān-3-tiols | 5 |

12.143 | 20 | 24653–75–6 | 1-merkaptopropān-2-ons | 3856 | | | 12.143 | merkaptoacetons | | |

12.144 | 20 | 107–96–0 | 3-merkaptopropionskābe | | 11709 | 203–537–0 | 12.144 | | | |

12.145 | 20 | 94087–83–9 | 4-metoksi-2-metilbutān-2-tiols | 3785 | | 301–977–9 | 12.145 | | | |

12.146 | 20 | 16630–66–3 | metil(metiltio)acetāts | | 11525 | 240–683–4 | 12.146 | | | |

12.148 | 20 | 61122–71–2 | S-metil-4-metilpentāntioāts | 3867 | | | 12.148 | | | |

12.149 | 20 | 1534–08–3 | S-metilacetotioāts | 3876 | | 216–252–1 | 12.149 | | | |

12.150 | 20 | 5925–68–8 | S-metilbenzotioāts | 3857 | 11505 | 227–656–2 | 12.150 | metāntiobenzoāts; S-metiltiobenzoāts; netāntiola benzoāts | | |

12.151 | 20 | 60779–24–0 | metilbutildisulfīds | | | | 12.151 | | | |

12.152 | 20 | 628–29–5 | metilbutilsulfīds | | | 211–034–2 | 12.152 | | | |

12.153 | 20 | 20333–39–5 | metiletildisulfīds | | 11470 | | 12.153 | | | |

12.154 | 20 | 624–89–5 | metiletilsulfīds | 3860 | 11474 | 210–868–4 | 12.154 | (metiltio)etāns; sulfīds, etilmetil-; 1-(metiltio)etāns; 2-tiobutāns; etilmetiltioēteris | | |

12.155 | 20 | 31499–71–5 | metiletiltrisulfīds | 3861 | | | 12.155 | 2,3,4-tritioheksāns; etilmetiltrisulfīds | | |

12.156 | 20 | 20756–86–9 | S-metilheksāntioāts | 3862 | 11515 | | 12.156 | | | |

12.157 | 20 | 23747–45–7 | S-metilizopentāntioāts | 3864 | 11506 | 245–863–6 | 12.157 | metāntioizopentanoāts | S-metil-3-metilbutāntioāts | |

12.158 | 20 | 5897–45–0 | metilizoprenilsulfīds | | | | 12.158 | | 2-metil-1-metiltio-1,3-butadiēns | |

12.159 | 20 | 2949–92–0 | metilmetāntiosulfonāts | | 11520 | 220–970–0 | 12.159 | | | |

12.160 | 20 | 42075–43–4 | S-metilpentāntioāts | | | | 12.160 | | | |

12.161 | 20 | 14173–25–2 | metilfenildisulfīds | 3872 | 11532 | 238–020–9 | 12.161 | fenilmetildisulfīds | | |

12.162 | 20 | 100–68–5 | metilfenilsulfīds | 3873 | 11533 | 202–878–2 | 12.162 | tioanizols; benzols, (metiltio)-; sulfīds, metilfenil-; 1-fenil-1-tioetāns; metilfeniltioēteris | | |

12.163 | 20 | 10152–77–9 | metilprop-1-enilsulfīds | | 11538 | | 12.163 | | | |

12.164 | 20 | 33368–80–8 | metilprop-1-eniltrisulfīds | | 11539 | | 12.164 | | | |

12.165 | 20 | 5925–75–7 | S-metilpropāntioāts | | | | 12.165 | | | |

12.166 | 20 | 3877–15–4 | metilpropilsulfīds | | 11541 | 223–403–5 | 12.166 | | | |

12.167 | 20 | 87148–08–1 | metilpropiltetrasulfīds | | | 289–302–3 | 12.167 | | | |

12.168 | 20 | 67952–60–7 | 2-metil-2-(metilditio)propanāls | 3866 | | 267–914–1 | 12.168 | 2-metil-2-(metilditio)propionaldehīds; 2-(metilditio)izobutiraldehīds | | |

12.169 | 20 | 19872–52–7 | 2-metil-4-oksopentān-2-tiols | | 11500 | 243–386–8 | 12.169 | 4-merkapto-4-metilpentān-2-ons | | |

12.170 | 20 | 5287–45–6 | 3-metilbut-2-ēn-1-tiols | 3896 | 11511 | | 12.170 | | | |

12.171 | 20 | 541–31–1 | 3-metilbutān-1-tiols | 3858 | | 208–774–3 | 12.171 | izoamilmerkaptāns | | |

12.172 | 20 | 1679–09–0 | 2-metilbutān-2-tiols | | | 216–843–4 | 12.172 | | | |

12.173 | 20 | 513–44–0 | 2-metilpropān-1-tiols | | 11536 | 208–162–6 | 12.173 | izobutilmerkaptāns | | |

12.174 | 20 | 75–66–1 | 2-metilpropān-2-tiols | | 11537 | 200–890–2 | 12.174 | terc-butilmerkaptāns | | |

12.175 | 20 | 67–68–5 | metilsulfinilmetāns | 3875 | | 200–664–3 | 12.175 | dimetilsulfoksīds (SNN); metilsulfoksīds; DMSO | | |

12.176 | 20 | 583–92–6 | 4-(metiltio)-2-oksosviestskābe | 3881 | | | 12.176 | | | |

12.177 | 20 | 32637–94–8 | 8-(metiltio)- p-mentān-3-ons | | | | 12.177 | | | |

12.178 | 20 | 16630–65–2 | 3-(metiltio)sviestskābe | | | 240–682–9 | 12.178 | | | |

12.179 | 20 | 5271–38–5 | 2-(metiltio)etān-1-ols | | 11545 | 226–090–3 | 12.179 | 2-(metiltio)etanols; 2-hidroksietilmetilsulfīds | | |

12.180 | 20 | 31331–53–0 | 1-(metiltio)etān-1-tiols | | | | 12.180 | | | |

12.181 | 20 | 66735–69–1 | 1-(metiltio)pentān-3-ons | | | | 12.181 | | | |

12.182 | 20 | 58809–73–7 | 2-(metiltio)propionskābe | | | 261–450–3 | 12.182 | | | |

12.183 | 20 | 646–01–5 | 3-(metiltio)propionskābe | | | 211–460–9 | 12.183 | | | |

12.184 | 20 | 84559–98–8 | 3-(metiltio)propil-3-metilbutirāts | | | 283–185–2 | 12.184 | 3-(metiltio)propilizovalerāts | | |

12.185 | 20 | 16630–60–7 | 3-(metiltio)propilbutirāts | | | 240–680–8 | 12.185 | | | |

12.186 | 30 | 4104–45–4 | 3-(metiltio)propilamīns | | | 223–875–2 | 12.186 | | | |

12.187 | 20 | 74758–93–3 | metiltiometilbutirāts | 3879 | | 277–989–2 | 12.187 | | | |

12.188 | 20 | 74758–91–1 | metiltiometilheksanoāts | 3880 | | 277–988–7 | 12.188 | | | |

12.189 | 20 | 77974–85–7 | S-(metiltiometil)- 2-metilpropāntioāts | | | | 12.189 | | | |

12.190 | 20 | 25103–58–6 | 2,4,4,6,6-pentametilheptān-2-tiols | | | 246–619–1 | 12.190 | terc-dodecilmerkaptāns; terc-dodeciltiols | | 5 |

12.191 | 20 | 110–66–7 | pentān-1-tiols | | | 203–789–1 | 12.191 | 1-pentāntiols | | |

12.192 | 20 | 2084–19–7 | pentān-2-tiols | 3792 | | 218–224–4 | 12.192 | sek-amilmerkaptāns; 1-metilbutāntiols; 2-merkaptopentāns | | |

12.193 | 30 | 2257–09–2 | fenetilizotiocianāts | | 11495 | 218–855–5 | 12.193 | | | |

12.194 | 20 | 4410–99–5 | 2-feniletān-1-tiols | 3894 | 11561 | 224–563–9 | 12.194 | | | |

12.195 | 20 | 33049–93–3 | S-preniltioacetāts | 3895 | | | 12.195 | etāntioskābes S-(3-metil-2-butēn-1-il)esteris; tioetiķskābes S-(3-metilbut-2-ēn-1-il)esteris | 3-metilbut-2-enilacetotioāts | |

12.196 | 20 | 53626–94–1 | S-preniltioizobutirāts | | | | 12.196 | | S-(3-metilbut-2-enil)- 2-metilpropāntioāts | |

12.197 | 20 | 75–33–2 | propān-2-tiols | 3897 | 11565 | 200–861–4 | 12.197 | izopropilmerkaptāns | | |

12.198 | 20 | | 2,3,5-tritiaheksāns | | | | 12.198 | | | |

12.199 | 20 | 507–09–5 | etāntioskābe | | | 208–063–8 | 12.199 | tioetiķskābe | | |

12.200 | 20 | 14252–42–7 | 1,1- bis-(etiltio)etāns | | | | 12.200 | acetaldehīda dietilmerkaptāls | | |

12.201 | 20 | 57074–34–7 | 8-acetiltio- p-mentanons-3 | 3809 | | 304–949–4 | 12.201 | | | |

12.203 | 20 | 74586–09–7 | metiltio-2-(acetiloksi)propionāts | 3788 | | 277–931–6 | 12.203 | | | |

12.204 | 20 | 623–51–8 | etil-2-merkaptoacetāts | | | 210–800–3 | 12.204 | | | |

12.205 | 20 | 4124–63–4 | merkaptoacetaldehīds | | | 223–929–5 | 12.205 | 2-merkaptoetanāls | | |

12.211 | 20 | | but-1-enilmetilsulfīds | 3820 | | | 12.211 | | | |

12.212 | 20 | | etil-5-(metiltio)valerāts | | | | 12.212 | | | |

12.213 | 20 | | S-etilbenzotioāts | | | | 12.213 | | | |

12.214 | 20 | 127931–21–9 | izobutil-3-(metiltio)butirāts | | | | 12.214 | | 2-metilpropil-3-(metiltio)butanoāts | |

12.215 | 20 | | S-izopropil-3-metilbutāntioāts | | | | 12.215 | S-izopropiltioizopentanoāts | | |

12.217 | 20 | | 3-merkaptoheksān-1-ols | 3850 | | | 12.217 | 3-tioheksanols; 3-tioheksān-1-ols | | |

12.218 | 20 | | metil-3-metil-1-butenildisulfīds | 3865 | | | 12.218 | | | |

12.219 | 20 | | 5-metiltio-2-(metiltio)metilpent-2-enāls | | | | 12.219 | | | |

12.220 | 20 | | 2,2,4,6,6-pentametilheptān-4-tiols | | | | 12.220 | | | |

12.221 | 20 | | S-preniltioizopentanoāts | | | | 12.221 | | 3-metilbut-2-enil-3-metilbutāntioāts | |

12.225 | 20 | | etil-3-metiltio-2-metilpropanoāts | | | | 12.225 | | | |

12.227 | 20 | | metiltio-2-(propioniloksi)propionāts | 3790 | | | 12.227 | | | |

12.229 | 20 | | 3-merkapto-2-metilbutilformiāts | | | | 12.229 | | | |

12.234 | 20 | 136954–20–6 | 3-merkaptoheksilacetāts | 3851 | | | 12.234 | | | |

12.235 | 20 | 136954–21–7 | 3-merkaptoheksilbutirāts | 3852 | | | 12.235 | | | |

12.236 | 20 | 51755–85–2 | 3-(metiltio)heksilacetāts | 3789 | | | 12.236 | | | |

12.237 | 20 | 16630–55–0 | 3-(metiltio)propilacetāts | 3883 | | 240–679–2 | 12.237 | 3-acetoksipropilmetilsulfīds; 3-(metiltio)- 1-propanola acetāts; metionilacetāts | | |

13.001 | 14 | 620–02–0 | 5-metilfurfurols | 2702 | 119 | 210–622–6 | 13.001 | 5-metil-2-furaldehīds | 5-metil-2-furaldehīds | |

13.002 | 14 | 611–13–2 | metil-2-furoāts | 2703 | 358 | 210–254–6 | 13.002 | metilfuroāts; metilpiromukāts; furān-?-karbonskābes metilesteris; | | |

13.003 | 14 | 615–10–1 | propil-2-furoāts | 2946 | 359 | 210–407–7 | 13.003 | propilfurān-2-karboksilāts; n-propilpiromukāts | | |

13.004 | 03 | 4208–49–5 | alil-2-furoāts | 2030 | 360 | 224–128–3 | 13.004 | alilfurān-2-karboksilāts; alilpiromukāts; 2-propenilfurān-2-karboksilāts; 2-propenil-2-furoāts | | |

13.005 | 14 | 39251–86–0 | heksil-2-furoāts | 2571 | 361 | 254–377–3 | 13.005 | | | |

13.006 | 14 | 7149–32–8 | fenetil-2-furoāts | 2865 | 362 | | 13.006 | 2-feniletil-2-furoāts | | |

13.007 | 13 | 3208–40–0 | 2-(3-fenilpropil)tetrahidrofurāns | 2898 | 489 | 221–715–6 | 13.007 | 2-hidrocinamiltetrahidrofurāns; α-(3-fenilpropil)tetrahidrofurans | | |

13.009 | 11 | 119–84–6 | 3,4-dihidrokumarīns | 2381 | 535 | 204–354–9 | 13.009 | dihidrokumarīns; 1,2-benzodihidropirons; hidrokumarīns; 2-hromanons; 2-oksohromāns; o-hidroksidihidrokanēļskābes laktons | | |

13.010 | 13 | 3658–77–3 | 4-hidroksi-2,5-dimetilfurān-3(2H)-ons | 3174 | 536 | 222–908–8 | 13.010 | furaneols; 2,5-dimetil-4-hidroksi-2,3-dihidrofurān-3-ons | | |

13.011 | 14 | 623–20–1 | etilfurfurakrilāts | | 545 | 210–778–5 | 13.011 | | etil-3-(2-furil)prop-2-enoāts | |

13.012 | 11 | 92–48–8 | 6-metilkumarīns | 2699 | 579 | 202–158–8 | 13.012 | 5-metil-2-hidroksifenilpropēnskābes laktons; 6-metil-2H-1-benzopirān-2-ons; 6-metilbenzopirons | 6-metil-1,2-benzopirons | |

13.015 | 14 | 28588–73–0 | bis-(2,5-dimetil-3-furil)disulfīds | 3476 | 722 | 249–093–1 | 13.015 | 3,3(1)-ditio- bis-(2,5-dimetilfurāns) | | |

13.016 | 14 | 28588–75–2 | bis-(2-metil-3-furil)disulfīds | 3259 | 723 | 249–095–2 | 13.016 | 2-metil-3-furildisulfīds; 3,3′-ditio-2, 2′-dimetildifurāns | | |

13.017 | 14 | 28588–76–3 | bis-(2-metil-3-furil)tetrasulfīds | 3260 | 724 | | 13.017 | 2-metil-3-furiltetrasulfīds; 3,3′-tetratio- bis-(2-metilfurāns) | | |

13.018 | 14 | 98–01–1 | furfurols | 2489 | 2014 | 202–627–7 | 13.018 | furfuraldehīds; 2-furānkarboksaldehīds; furāls; 2-formilfurāns; 2-furaldehīds; pirogļotskābes aldehīds; 2-furilkarboksaldehīds | | 2, 3 |

13.019 | 14 | 98–00–0 | furfurilspirts | 2491 | 2023 | 202–626–1 | 13.019 | 2-furānkarbinols; furfuralkohols; α-furilkarbinols; 2-furilkarbinols; 2-hidroksimetilfurāns | | |

13.020 | 13 | 97–99–4 | tetrahidrofurfurilspirts | 3056 | 2029 | 202–625–6 | 13.020 | tetrahidro-2-furānkarbinols; tetrahidro-2-furānmetanols; tetrahidro-2-furilmetanols | | |

13.021 | 14 | 7779–66–0 | izopentil-4-(2-furān)butirāts | 2070 | 2080 | | 13.021 | izopentilfuril-2-butirāts; izoamilfurfurilpropionāts; 3-metilbutil-2-furānbutirāts; α-izoamilfurfurilpropionats | 3-metilbutil-4-(2-furān)butanoāts | |

13.022 | 14 | 10031–90–0 | etil-3-(2-furil)propionāts | 2435 | 2091 | 233–097–5 | 13.022 | etil-2-furānpropionāts; etilfurfurilacetāts; etilfurilpropionāts | | |

13.023 | 14 | 7779–67–1 | izopentil-3-(2-furān)propionāts | 2071 | 2092 | 231–932–8 | 13.023 | izoamilfurilpropionāts; izoamilfurfurilacetāts; izoamilfurfurhidrakrilāts; α-izoamilfurfurilacetats | 3-metilbutil-3-(2-furān)propanoāts | |

13.024 | 14 | 105–01–1 | izobutil-3-(2-furil)propionāts | 2198 | 2093 | 203–261–0 | 13.024 | izobutil-2-furānpropionāts; izobutilfurfurilacetāts; izobutil-2-furānpropionāts | 2-metilpropil-3-(2-furil)propanoāts | |

13.025 | 14 | 1334–82–3 | pentil-2-furoāts | 2072 | 2109 | 215–616–7 | 13.025 | amil-2-furoāts; amilfurān-2-karboksilāts; pentilfurān-2-karboksilāts | | |

13.026 | 14 | 98–02–2 | 2-furānmetāntiols | 2493 | 2202 | 202–628–2 | 13.026 | furfurilmerkaptāns; 2-furilmetāntiols; α-furfurilmerkaptans | | |

13.027 | 12 | 65504–96–3 | 2-pentil-5 vai 6-keto-1,4-dioksāns | 2076 | 2205 | | 13.027 | 5-pentil-1,4-dioksān-2-ons | | |

13.028 | 12 | 65504–45–2 | 2-butil-5 vai 6-keto-1,4-dioksāns | 2204 | 2206 | | 13.028 | 5-butil-1,4-dioksān-2-ons | | |

13.029 | 14 | 625–86–5 | 2,5-dimetilfurāns | | 2208 | 210–914–3 | 13.029 | | | |

1 3.030 | 14 | 534–22–5 | 2-metilfurāns | | 2209 | 208–594–5 | 1 3.030 | | | |

13.031 | 14 | 4265–16–1 | 2-benzfurānkarboksaldehīds | 3128 | 2247 | 224–248–6 | 13.031 | 2-formilbenzfurāns | | |

13.032 | 14 | 1883–78–9 | furfurilizopropilsulfīds | 3161 | 2248 | | 13.032 | izopropilfurfurilsulfīds | | |

13.033 | 14 | 13678–68–7 | S-furfurilacetotioāts | 3162 | 2250 | 237–173–9 | 13.033 | furfuriltioacetāts | | |

13.034 | 14 | 623–30–3 | 3-(2-furil)akrilaldehīds | 2494 | 2252 | 210–785–3 | 13.034 | furilakroleīns; 2-furānakroleīns | 3-(2-furil)prop-2-enāls | |

13.035 | 14 | 494–90–6 | mentofurāns | 3235 | 2265 | 207–795–5 | 13.035 | 3,9-epoksi- p-menta-3,8-diēns | 5,4,6,7-tetrahidro-3,6-dimetilbenzfurāns | 2, 3 |

13.036 | 14 | 623–18–7 | metilfurfurakrilāts | | 2267 | | 13.036 | | metil-3-(2-furil)prop-2-enoāts | |

13.037 | 16 | 16409–43–1 | 2-(2-metilprop-1-enil)-4-metiltetrahidropirāns | 3236 | 2269 | 240–457–5 | 13.037 | rozoksīds; tetrahidro-4-metil-2-(2-metilpropēn-1-il)pirāns; L-rozoksīds | | |

13.038 | 14 | 50626–02–3 | 2-fenil-3-karbetoksifurāns | 3468 | 2309 | 256–663–3 | 13.038 | feniloksaromāts; etil-2-fenil-3-furoāts | etil-2-fenil-3-furoāts | |

13.039 | 30 | 22694–96–8 | 2,4,5-trimetil-δ-3-oksazolins | 3525 | 2319 | | 13.039 | 2,4,5-trimetil-2,5-dihidrooksazols; 3-oksazolīns, 2,4,5-trimetil- | | |

1 3.040 | 14 | 65505–16–0 | 2,5-dimetil-3-tiofuroilfurāns | 3481 | 2323 | 265–796–6 | 1 3.040 | S-(2,5-dimetil-3-furil)tio-2-furoāts | | |

1 3.041 | 14 | 55764–28–8 | 2,5-dimetil-3-(izopentiltio)furāns | 3482 | 2324 | 259–802–6 | 1 3.041 | S-(2,5-dimetil-3-furil)tioizovalerāts | 2,5-dimetil-3-(3-metilbutiltio)furāns | 5 |

13.042 | 13 | 3188–00–9 | 4,5-dihidro-2-metilfurān-3(2H)-ons | 3373 | 2338 | 221–685–4 | 13.042 | tetrahidro-2-metil-3-oksofurāns; 2-metiltetrahidrofurān-3-ons; dihidro-2-metil-3-furanons; dihidrofuranons-3(2H)-, 2-metil- | | |

13.043 | 14 | 770–27–4 | furfurilidēn-2-butanāls | 2492 | 11885 | 212–221–1 | 13.043 | furfurilidēn-2-butiraldehīds; 3-etil-3-(2-furil)- 2-propenāls; 2-etil-3-(2-furil)akroleīns; 3-(2-furil)- 2-etilakroleīns | | |

13.044 | 14 | 623–15–4 | 4-(2-furil)but-3-ēn-2-ons | 2495 | 11838 | 210–774–3 | 13.044 | furfurilidīnacetons; furfurolacetons | | |

13.045 | 14 | 6975–60–6 | 1-(2-furil)propān-2-ons | 2496 | 11837 | 230–234–0 | 13.045 | furfurilmetilketons; 2-acetonilfurāns; furilacetons; metilfurfurilketons | | |

13.046 | 14 | 874–66–8 | 3-(2-furil)- 2-metilprop-2-enāls | 2704 | 11878 | 212–866–9 | 13.046 | 2-furfurilidēnpropionaldehīds; 2-metil-3-furilakroleīns; α-metil-β-furilakroleins; furfurilidēn-2-propanāls | | |

13.047 | 14 | 623–22–3 | propil-3-(2-furil)akrilāts | 2945 | 11842 | 210–780–6 | 13.047 | propilfurānakrilāts; propilfurilakrilāts | propil-3-(2-furil)prop-2-enoāts | |

13.048 | 13 | 2217–33–6 | tetrahidrofurfurilbutirāts | 3057 | 11841 | 211–297–3 | 13.048 | tetrahidro-2-furilmetil-n-butanoāts; tetrahidrofurfuril-n-butirāts | | |

13.049 | 13 | 637–65–0 | tetrahidrofurfurilpropionāts | 3058 | 11843 | 218–710–6 | 13.049 | 2-tetrahidrofurilmetilpropionāts | | |

13.050 | 14 | 4437–20–1 | difurfurildisulfīds | 3146 | 11480 | 224–649–6 | 13.050 | bis-(2-furfuril)disulfīds; 2-furfurildisulfīds | | |

13.051 | 14 | 59020–90–5 | 2-furfuriltioformiāts | 3158 | 11770 | 261–563–8 | 13.051 | 2-furilmetāntiola formiāts; furfuriltioformiāts | | |

13.052 | 14 | 13679–46–4 | furfurilmetilēteris | 3159 | 10944 | 237–176–5 | 13.052 | metilfurfurilēteris | | |

13.053 | 14 | 1438–91–1 | metilfurfurilsulfīds | 3160 | 11482 | 215–874–0 | 13.053 | | | |

13.054 | 14 | 1192–62–7 | 2-acetilfurāns | 3163 | 11653 | 214–757–1 | 13.054 | 2-furilmetilketons; metil-2-furilketons | | |

13.055 | 14 | 28588–74–1 | 2-metilfurān-3-tiols | 3188 | 11678 | 249–094–7 | 13.055 | 2-metil-3-furilmerkaptāns | | |

13.056 | 14 | 13678–67–6 | difurfurilsulfīds | 3238 | 11438 | 237–172–3 | 13.056 | 2,2′-(tiodimetilēn)difurāns; 2-furfurilmonosulfīds; difurfurilmonosulfīds | | |

13.057 | 14 | 13678–60–9 | furfurilizovalerāts | 3283 | 10642 | 237–171–8 | 13.057 | | furfuril-3-metilbutanoāts | |

13.058 | 14 | 31704–80–0 | 3-(5-metil-2-furil)butanāls | 3307 | 10355 | 250–771–4 | 13.058 | 2-furānpropanāls, β,5-dimetil-; 3-(5-metil-2-furil)butiraldehīds | | |

13.059 | 14 | 3777–69–3 | 2-pentilfurāns | 3317 | 10966 | 223–234–7 | 13.059 | 2-amilfurāns | | |

13.060 | 13 | 65505–25–1 | tetrahidrofurfurilcinamāts | 3320 | 11821 | 265–799–2 | 13.060 | kanēļskābes tetrahidrofurfurilesteris; tetrahidro-2-furilmetil-3-fenilpropenoāts; tetrahidro-2-furilmetilcinamāts | tetrahidrofurfuril-3-fenilprop-2-enoāts | |

13.061 | 14 | 4437–22–3 | difurfurilēteris | 3337 | 10930 | | 13.061 | furfurilēteris | | |

13.062 | 14 | 623–19–8 | furfurilpropionāts | 3346 | 10646 | 210–776–4 | 13.062 | furfurilpropanoāts | | |

13.063 | 14 | 59020–85–8 | S-furfurilpropāntioāts | 3347 | 11484 | 261–562–2 | 13.063 | furfuriltiopropionāts | | |

13.064 | 14 | 57500–00–2 | metilfurfurildisulfīds | 3362 | 11513 | 260–773–7 | 13.064 | furfurilmetildisulfīds; metil-2-furilmetildisulfīds | | |

13.065 | 14 | 13678–59–6 | 2-metil-5-(metiltio)furāns | 3366 | 11550 | 237–170–2 | 13.065 | metil-5-metil-2-furilsulfīds; (5-metilfuril-2)-tiometāns | | |

13.066 | 14 | 10599–70–9 | 3-acetil-2,5-dimetilfurāns | 3391 | 10921 | 234–216–3 | 13.066 | 2,5-dimetil-3-acetilfurāns | | |

13.067 | 14 | 39252–03–4 | furfuriloktanoāts | 3396 | 10645 | 254–381–5 | 13.067 | α-furfurilkaprilats | | |

13.068 | 14 | 36701–01–6 | furfurilvalerāts | 3397 | 10647 | 253–160–0 | 13.068 | furfurilpentanoāts; α-furfurilpentanoats; α-furfurilvalerats | | |

13.069 | 14 | 3777–71–7 | 2-heptilfurāns | 3401 | 10952 | 223–236–8 | 13.069 | | | |

13.070 | 14 | 14360–50–0 | 2-heksanoilfurāns | 3418 | 11180 | 238–333–0 | 13.070 | 2-furilpentilketons | | |

13.071 | 14 | 55764–23–3 | 2,5-dimetilfurān-3-tiols | 3451 | 11457 | 259–800–5 | 13.071 | 2,5-dimetil-3-merkaptofurāns; 2,5-dimetil-3-furilmerkaptāns | | |

13.072 | 16 | 3738–00–9 | 1,5,5,9-tetrametil-13-oksatriciklo[8.3.0.0.(4.9)]tridekāns | 3471 | 10514 | 223–118–6 | 13.072 | tetrametilperhidronaftofurāns | | |

13.073 | 14 | 39251–88–2 | oktil-2-furoāts | 3518 | 10864 | 254–378–9 | 13.073 | oktil-2-furānkarboksilāts | | |

13.074 | 14 | 3782–00–1 | 2,3-dimetilbenzofurāns | 3535 | 11913 | 223–245–7 | 13.074 | | | |

13.075 | 14 | 61295–51–0 | 2,6-dimetil-3-[(2-metil-3-furil)tio]heptān-4-ons | 3538 | 11915 | 262–692–2 | 13.075 | 1,3-diizopropilacetonil-2-metil-3-furilsulfīds; 3-[(2-metil-3-furil)tio]- 2,6-dimetil-4-heptanons | | |

13.076 | 06 | 65620–50–0 | 6-hidroksidihidroteaspirāns | 3549 | 11917 | | 13.076 | 6-hidroksi-2,6,10,10-tetrametil-1-oksaspiro[4.5]dekāns | 2,6,10,10-tetrametil-1-oksaspiro[4.5]dekān-6-ols | |

13.077 | 14 | 61295–41–8 | 3-[(2-metil-3-furil)tio]heptān-4-ons | 3570 | 11922 | 262–690–1 | 13.077 | 1,3-dietilacetonil-2-metil-3-furilsulfīds | | |

13.078 | 14 | 61295–50–9 | 4-[(2-metil-3-furil)tio]nonān-5-ons | 3571 | 11923 | 262–691–7 | 13.078 | 1,3-dipropilacetonil-2-metil-3-furilsulfīds | | |

13.079 | 14 | 65505–17–1 | metil-2-metil-3-furildisulfīds | 3573 | 11924 | 265–797–1 | 13.079 | | | |

13.082 | 14 | 61197–09–9 | propil-2-metil-3-furildisulfīds | 3607 | | 262–650–3 | 13.082 | 2-metil-3-furilpropildisulfīds | | |

13.083 | 14 | 1193–79–9 | 2-acetil-5-metilfurāns | 3609 | 11038 | 214–779–1 | 13.083 | metil-5-metil-2-furilketons; etanons, 1- (5-metil-2-furanil)-; 1-(5-metil-2-furil)etanons | | |

13.084 | 13 | 27538–09–6 | 2-etil-4-hidroksi-5-metil-3(2H)-furanons | 3623 | | 248–513–0 | 13.084 | 5-etil-4-hidroksi-2-metil-3(2H)-furanons | | 5 |

13.085 | 13 | 19322–27–1 | 4-hidroksi-5-metilfurān-3(2H)-ons | 3635 | 11785 | 242–961–0 | 13.085 | 2,3-dihidro-4-hidroksi-5-metilfurān-3-ons; 5-metil-4-hidroksi-3(2H)-furanons | | |

13.086 | 14 | 26486–14–6 | 4,5-dihidro-2-metil-3-tioacetoksifurāns | 3636 | | 247–731–3 | 13.086 | 2-metil-4, 5-dihidro-3-furāntiola acetāts; 4,5-dihidro-2-metil-3-furāntiola acetāts | | |

13.087 | 30 | 57893–27–3 | 6-acetoksidihidroteaspirāns | 3651 | | 261–005–3 | 13.087 | 2,6,10,10-tetrametil-1-oksaspiro[4.5]dec-6-ilacetāts | 2,6,10,10-tetrametil-1-oksaspiro[4,5]dec-6-ilacetāts | |

13.088 | 16 | 1786–08–9 | 3,6-dihidro-4-metil-2-(2-metilprop-1-ēn-1-il)- 2H-pirāns | 3661 | | 217–241–4 | 13.088 | 3,6-dihidro-4-metil-2-(2-metil-1-propenil)- 2H-pirāns | | |

13.089 | 13 | 4077–47–8 | 2,5-dimetil-4-metoksifurān-3(2H)-ons | 3664 | | 223–797–9 | 13.089 | mezifurāns; 4-metoksi-2,5-dimetil-3-furanons | | |

13.090 | 13 | 7416–35–5 | 2,2-dimetil-5-(1-metilprop-1-enil)tetrahidrofurāns | 3665 | 10937 | 231–028–3 | 13.090 | tetrahidrofurāns, 2,2-dimetil-5-(1-metil-1-propenil)- | | |

13.091 | 30 | 53833–30–0 | 4,5-dimetil-2-etiloksazols | 3672 | | 258–815–4 | 13.091 | | | |

13.092 | 14 | 3208–16–0 | 2-etilfurāns | 3673 | 11706 | 221–714–0 | 13.092 | 2-etiloksols | | |

13.093 | 14 | 94278–27–0 | etil-3-(2-furfuriltio)propionāts | 3674 | | 304–716–7 | 13.093 | etil-β-furfuril-α-tiopropionats | | |

13.094 | 16 | 7392–19–0 | 2,6,6-trimetil-2-viniltetrahidropirāns | 3735 | 10976 | 230–983–3 | 13.094 | rožkoka oksīds | | |

13.095 | 13 | 41239–48–9 | 2,5-dietiltetrahidrofurāns | 3743 | 11882 | 255–274–6 | 13.095 | tetrahidrofurāns, 2,5-dietil-; furāns, 2,5-dietiltetrahidro- | | |

13.096 | 13 | 5989–33–3 | 5-(2-hidroksiizopropil)-2-metil-2-viniltetrahidrofurāns | 3746 | 2214 | 227–814–0 | 13.096 | linaloola oksīds B ( cis, 5-locekļu cikla) | | 5 |

13.097 | 13 | 13679–86–2 | anhidrolinaloola oksīds (5) | 3759 | 11944 | 237–184–9 | 13.097 | anhidrolinaloola oksīds; dehidroksilinaloola oksīds | 2-(1-metilēnetil)- 5-metil-5-viniltetrahidrofurāns | |

13.098 | 16 | 36431–72–8 | teaspirāns | 3774 | 10515 | 253–031–9 | 13.098 | 1-oksaspiro-2,6,10,10-tetrametil[4.5]dec-6-ēns | 2,6,10,10-tetrametil-1-oksaspiro[4.5]dec-6-ēns | |

13.099 | 13 | 4166–20–5 | 4-acetoksi-2,5-dimetilfurān-3(2H)-ons | 3797 | | | 13.099 | | | |

13.100 | 30 | 13678–73–4 | 2-acetil-1-furfurilpirols | | 11941 | | 13.100 | | | |

13.101 | 14 | 22940–86–9 | 2-acetil-3,5-dimetilfurāns | | | | 13.101 | | | |

13.102 | 14 | 583–33–5 | butil-2-furoāts | | | | 13.102 | | | |

13.103 | 14 | 4466–24–4 | 2-butilfurāns | | 10927 | 224–732–7 | 13.103 | | | |

13.104 | 13 | 1004–29–1 | 2-butiltetrahidrofurāns | | | 213–718–6 | 13.104 | | | |

13.105 | 14 | 100113–53–9 | 2-butirilfurāns | | 11045 | | 13.105 | 2-furilpropilketons | | |

13.106 | 14 | 83469–85–6 | 2-decilfurāns | | | | 13.106 | | | |

13.107 | 14 | 64280–32–6 | 2,4-difurfurilfurāns | | | | 13.107 | | | |

13.108 | 14 | 26486–13–5 | 4,5-dihidro-3-merkapto-2-metilfurāns | | | | 13.108 | 2-metil-4,5-dihidrofurān-3-tiols | | |

13.109 | 11 | 17092–92–1 | dihidroaktinidiolīds | | 10931 | | 13.109 | | 2,2,6-trimetil-7-oksabiciklo[4.3.0]non-9-ēns | |

13.110 | 30 | 62147–49–3 | 2,5-dihidroksi-2,5-di(hidroksimetil)- 1,4-dioksāns | | | | 13.110 | | | |

13.112 | 30 | 53833–32–2 | 4,5-dimetil-2-propiloksazols | | 11379 | 258–817–5 | 13.112 | | | |

13.113 | 14 | 61197–06–6 | 2,5-dimetil-3-(metilditio)furāns | | | | 13.113 | | | |

13.114 | 14 | 63359–63–7 | 2,5-dimetil-3-(metiltio)furāns | | | | 13.114 | | | |

13.115 | 30 | 77311–02–5 | 2,4-dimetil-3-oksazolīns | | | | 13.115 | | | |

13.116 | 14 | 55764–22–2 | 2,5-dimetil-3-tioacetoksifurāns | | | 259–799–1 | 13.116 | S-(2,5-dimetil-3-furil)etāntioāts | | |

13.117 | 13 | 65330–49–6 | 2,5-dimetil-4-etoksifurān-3(2H)-ons | | | 265–701–8 | 13.117 | 4-etoksi-2,5-dimetilfurān-3(2H)-ons | | |

13.118 | 30 | 30408–61–8 | 2,5-dimetil-4-etiloksazols | | | 250–181–7 | 13.118 | 4-etil-2,5-dimetiloksazols | | |

13.119 | 13 | 14400–67–0 | 2,5-dimetilfurān-3(2H)-ons | | 11066 | 238–365–5 | 13.119 | | | |

13.120 | 16 | 1003–38–9 | 2,5-dimetiltetrahidrofurāns | | | 213–707–6 | 13.120 | tetrahidro-2,5-dimetilfurāns | | |

13.121 | 11 | 87–05–8 | 7-etoksi-4-metilkumarīns | | 11870 | 201–721–5 | 13.121 | | | |

13.122 | 14 | 614–99–3 | etil-2-furoāts | | 10588 | 210–404–0 | 13.122 | | | |

13.123 | 14 | 6270–56–0 | etilfurfurilēteris | | 10940 | 228–454–7 | 13.123 | 2-(etoksimetil)furans | | |

13.124 | 14 | 2024–70–6 | etilfurfurilsulfīds | | | | 13.124 | | | |

13.125 | 14 | 1703–52–2 | 2-etil-5-metilfurāns | | 10942 | 216–937–5 | 13.125 | | | |

13.126 | 14 | 13529–27–6 | furfurola dietilacetāls | | | 236–872–6 | 13.126 | 2-furaldehīda dietilacetāls | | 2, 3 |

13.127 | 14 | 13678–61–0 | furfuril-2-metilbutirāts | | 10643 | | 13.127 | | | |

13.128 | 14 | 623–17–6 | furfurilacetāts | 2490 | 2065 | 210–775–9 | 13.128 | | | |

13.129 | 14 | 59020–84–7 | furfurilbut-2-enoāts | | | | 13.129 | | | |

13.130 | 14 | 623–21–2 | furfurilbutirāts | | 638 | 210–779–0 | 13.130 | | | |

13.131 | 14 | 39481–28–2 | furfurilheptanoāts | | | | 13.131 | | | |

13.132 | 14 | 39252–02–3 | furfurilheksanoāts | | | | 13.132 | | | |

13.133 | 14 | 6270–55–9 | furfurilizobutirāts | | 10641 | 228–453–1 | 13.133 | | furfuril-2-metilpropanoāts | |

13.134 | 30 | 1438–94–4 | 1-furfurilpirols | 3284 | 2317 | 215–876–1 | 13.134 | 1-furfuril-1H-pirols | | |

13.135 | 14 | 58066–86–7 | 1-(2-furfuriltio)propanons | | | | 13.135 | | | |

13.136 | 14 | 88–14–2 | 2-furānskābe | | 10098 | 201–803–0 | 13.136 | | 2-furānkarbonskābe | |

13.137 | 14 | 65545–81–5 | 3-(2-furil)- 2-fenilprop-2-enāls | 3586 | 11928 | | 13.137 | | | |

13.138 | 14 | 699–17–2 | 1-(2-furil)butān-3-ons | | 11084 | 211–831–5 | 13.138 | 4-(2-furil)butān-2-ons | | |

13.139 | 14 | 67–47–0 | 5-hidroksimetilfurfuraldehīds | | 11112 | 200–654–9 | 13.139 | 5-(hidroksimetil)- 2-furaldehīds | | |

13.140 | 30 | 1365–19–1 | linaloola oksīds (5-locekļu cikla) | 3746 | 11876 | 215–723–9 | 13.140 | | 5-(1-hidroksi-1-izopropil)- 2-metil-2-viniltetrahidrofurāns | 5 |

13.141 | 14 | 108499–33–8 | metil-(2-furfuriltio)acetāts | | | | 13.141 | | | |

13.142 | 14 | 13679–61–3 | S-metil-2-furāntiokarboksilāts | 3311 | 11547 | 237–177–0 | 13.142 | furoiltiometāns; metiltio-2-furoāts | | |

13.143 | 14 | 94278–26–9 | metil-3-(furfuriltio)propionāts | | | 304–715–1 | 13.143 | | | |

13.144 | 14 | 78818–78–7 | metil-5-metilfurfurildisulfīds | | | | 13.144 | | | |

13.145 | 14 | 13679–60–2 | metil-5-metilfurfurilsulfīds | | 11522 | | 13.145 | | | |

13.146 | 14 | 66169–00–4 | metilfurfuriltrisulfīds | | | | 13.146 | | | |

13.147 | 13 | 92343–93–6 | 2-(3-metil-1,3-butadienil)-4-metiltetrahidrofurāns | | | | 13.147 | | | |

13.148 | 14 | 15186–51–3 | 3-metil-2-(3-metilbut-2-enil)furāns | | | | 13.148 | | | |

13.149 | 14 | 59303–05–8 | 5-metil-2-furānmetāntiols | | | | 13.149 | | | |

13.150 | 14 | 5555–90–8 | 3-(5-metil-2-furil)prop-2-enāls | | | | 13.150 | | | |

13.151 | 14 | 65530–53–2 | 2-metil-3,5 un 6-(furfuriltio)pirazīns | 3189 | 2287 | | 13.151 | metil(furfuriltio)pirazīns (izomēru maisījums) | | |

13.152 | 14 | 63012–97–5 | 2-metil-3-(metiltio)furāns | 3949 | | | 13.152 | dimetiltiofurāns | | |

13.153 | 14 | 55764–25–5 | 2-metil-3-furiltioacetāts | | | 259–801–0 | 13.153 | S-(2-metil-3-furil)etāntioāts | | |

13.154 | 30 | 95–21–6 | 2-metil-4,5-benzoksazols | | | 202–399–9 | 13.154 | 2-metilbenzoksazols | | |

13.155 | 14 | 10599–69–6 | 2-metil-5-propionilfurāns | | 11158 | 234–215–8 | 13.155 | 1-(5-metil-2-furil)propān-1-ons | | |

13.156 | 13 | 41763–99–9 | 2-metilfurān-3(2H)-ons | | | | 13.156 | | | |

13.157 | 13 | 3511–32–8 | 5-metilfurān-3(2H)-ons | | | | 13.157 | | | |

13.158 | 13 | 96–47–9 | 2-metiltetrahidrofurāns | | 10964 | 202–507–4 | 13.158 | tetrahidro-2-metilfurāns | | |

13.159 | 13 | 34003–72–0 | 5-metiltetrahidrofurān-3-ons | | | | 13.159 | | | |

13.160 | 13 | 57124–87–5 | 2-metiltetrahidrofurān-3-tiols | 3787 | | 260–572–4 | 13.160 | | | |

13.161 | 11 | 4430–31–3 | oktahidrokumarīns | 3791 | | 224–623–4 | 13.161 | biciklononalaktons; cikloheksillaktons; oktahidro-2H-1-benzpirān-2-ons | oktahidro-1(2H)-benzpirān-2-ons | |

13.162 | 14 | 4179–38–8 | 2-oktilfurāns | | 10965 | 224–049–4 | 13.162 | | | |

13.163 | 14 | 3194–17–0 | 2-pentanoilfurāns | | | | 13.163 | | | |

13.164 | 14 | 4229–91–8 | 2-propilfurāns | | 10971 | 224–182–8 | 13.164 | | | |

13.165 | 16 | 5552–30–7 | 6,7,8,8a-tetrahidro-2,5,5,8a-tetrametil-5H-1-benzpirāns | 3822 | | 226–916–2 | 13.165 | | | |

13.166 | 13 | 637–64–9 | tetrahidrofurfurilacetāts | 3055 | 2069 | 211–296–8 | 13.166 | | | |

13.167 | 13 | 5421–00–1 | tetrahidrofurilfenilacetāts | | | 226–534–6 | 13.167 | | | 5 |

13.169 | 30 | 20662–84–4 | trimetiloksazols | | 11424 | 243–952–4 | 13.169 | 2,4,5-trimetiloksazols | | |

13.170 | 16 | 3033–23–6 | 2S- cis-tetrahidro-4-metil-2-(2-metil-1-propenil)- 2H-pirāns | | | 221–217–9 | 13.170 | | | |

13.175 | 13 | | 4-acetil-2,5-dimetilfurān-3(2H)-ons | | | | 13.175 | | | |

13.176 | 14 | | furanilbutirāts | | | | 13.176 | | 2,5-dimetilfurān-3(2H)-on-4-ilbutanoāts | |

13.178 | 14 | | 3-(furfuriltio)- 2-metilfurāns | | | | 13.178 | | | |

13.181 | 14 | | 2-metil-3-furilbutān-3-on-1-ildisulfīds | | | | 13.181 | 2-metil-3-furil-3-oksobutildisulfīds | | |

13.182 | 14 | | 2-metil-3-tioacetoksitetrahidrofurāns | | | | 13.182 | | | |

13.185 | 14 | | 2-furfuril-3-okso-2-butildisulfīds | | | | 13.185 | | | |

13.187 | 14 | 23747–34–4 | 2-propionil-3-metilfurāns | | 10970 | | 13.187 | | | |

13.188 | 14 | 59303–07–0 | 2-metil-3-furfuriltiopirazīns | 3189 | | | 13.188 | | | |

13.189 | 16 | 56469–39–7 | linaloola oksīda (5) acetāts | | | | 13.189 | | 2-(5-metil-5-viniltetrahidro-2-furil)propān-2-ilacetāts | |

13.190 | 14 | 61296–44–1 | 3-[(2-metil-3-furil)tio]- 2-butanons | | | | 13.190 | | | |

14.001 | 28 | 119–65–3 | izohinolīns | 2978 | 487 | 204–341–8 | 14.001 | 2-azanaftalīns; 2-benzazīns; 3,4-benzpirīns; benzpirīns | | |

14.002 | 30 | 491–35–0 | 4-metilhinolīns | | 488 | 207–734–2 | 14.002 | lepidīns | | |

14.003 | 30 | 94–62–2 | piperīns | 2909 | 492 | 202–348–0 | 14.003 | 1-piperoilpiperidīns; piperoilpiperidīns | 1-[5-(3,4-metilēndioksifenil)- 1-okso-2, 4-pentadienil]piperidīns | |

14.004 | 28 | 83–34–1 | 3-metilindols | 3019 | 493 | 201–471–7 | 14.004 | skatols; 3-metil-4,5-benzpirols; β-metilindols | | |

14.005 | 24 | 15707–24–1 | 2,3-dietilpirazīns | 3136 | 534 | 239–800–1 | 14.005 | | | |

14.006 | 24 | 15707–23–0 | 2-etil-3-metilpirazīns | 3155 | 548 | 239–799–8 | 14.006 | | | |

14.007 | 28 | 120–72–9 | indols | 2593 | 560 | 204–420–7 | 14.007 | benzpirols; 1-benzazols; 1-benzpirols; 2,3-benzpirols | | |

14.008 | 28 | 110–86–1 | piridīns | 2966 | 604 | 203–809–9 | 14.008 | azīns; azabenzols | | |

14.010 | 30 | 110–89–4 | piperidīns | 2908 | 675 | 203–813–0 | 14.010 | heksahidropiridīns; heksazāns pentametilēnimīns | | |

14.011 | 30 | 130–89–2 | hinīna hidrohlorīds | 2976 | 715 | 205–001–1 | 14.011 | hinīna hlorīds; hinīna monohidrohlorīds | | 2, 3 |

14.014 | 30 | 36267–71–7 | 5,7-dihidro-2-metiltieno[3,4-d]pirimidīns | 3338 | 720 | 252–940–8 | 14.014 | | | |

14.015 | 24 | 34413–35–9 | 5,6,7,8-tetrahidrohinoksalīns | 3321 | 721 | 252–002–8 | 14.015 | cikloheksapirazīns; tetrahidrohinoksalīns | | |

14.016 | 24 | 27043–05–6 | 2,5-dimetil-3-etilpirazīns | 3149 | 727 | 248–182–2 | 14.016 | | | 5 |

14.017 | 24 | 13360–64–0 | 2-etil-5-metilpirazīns | 3154 | 728 | 236–416–6 | 14.017 | 2-metil-5-etilpirazīns | | |

14.018 | 24 | 1124–11–4 | 2,3,5,6-tetrametilpirazīns | 3237 | 734 | 214–391–2 | 14.018 | | | |

14.019 | 24 | 14667–55–1 | 2,3,5-trimetilpirazīns | 3244 | 735 | 2387120 | 14.019 | | | |

14.020 | 24 | 123–32–0 | 2,5-dimetilpirazīns | 3272 | 2210 | 204–618–3 | 14.020 | 2,5-dimetil-1,4-diazīns; glikolīns; ketīns; 2,5-dimetilparadiazīns; 2,5-dimetilpiazīns | | |

14.021 | 24 | 108–50–9 | 2,6-dimetilpirazīns | 3273 | 2211 | 203–589–4 | 14.021 | 2,6-dimetil-1,4-diazīns; 2,6-dimetilparadiazīns; 2,6-dimetilpiazīns | | |

14.022 | 24 | 13925–00–3 | etilpirazīns | 3281 | 2213 | 237–691–5 | 14.022 | 2-etilpirazīns; 2-etil-1,4-diazīns | | |

14.023 | 28 | 96–54–8 | 1-metilpirols | | 2217 | 202–513–7 | 14.023 | N-metilpirols | | |

14.024 | 24 | 13925–07–0 | 2-etil-3,5-dimetilpirazīns | 3150 | 2245 | 237–694–1 | 14.024 | 2,6-dimetil-3-etilpirazīns | | |

14.025 | 24 | 63450–30–6 | 2, 5 vai 6-metoksi-3-metilpirazīns | 3183 | 2266 | 264–168–9 | 14.025 | metilmetoksipirazīns | | |

14.026 | 24 | 13925–05–8 | 2-izopropil-5-metilpirazīns | 3554 | 2268 | | 14.026 | 5-izopropil-2-metilpirazīns; 2-metil-5-izopropilpirazīns | | |

14.027 | 24 | 109–08–0 | 2-metilpirazīns | 3309 | 2270 | 203–645–8 | 14.027 | 2-metil-1,4-diazīns | | |

14.028 | 24 | 13708–12–8 | 5-metilhinoksalīns | 3203 | 2271 | 237–246–5 | 14.028 | | | |

14.029 | 30 | 65504–93–0 | 1-fenil-(3 vai 5)-propilpirazols | 3727 | 2277 | | 14.029 | 1-fenil-3 vai 5-propil-1,2-diazols | | |

14.030 | 28 | 2044–73–7 | 2-piridīnmetāntiols | 3232 | 2279 | 218–061–9 | 14.030 | 2-metkaptometilpiridīns; 2-piridilmetāntiols; 2-piridilmetilmerkaptāns | | |

14.031 | 24 | 35250–53–4 | pirazīnetāntiols | 3230 | 2285 | | 14.031 | 2-piraziniletāntiols; piraziniletāntiols | | |

14.032 | 24 | 22047–25–2 | acetilpirazīns | 3126 | 2286 | 244–753–5 | 14.032 | 2-acetilpirazīns; metilpirazinilketons | | |

14.034 | 24 | 21948–70–9 | pirazinilmetilsulfīds | 3231 | 2288 | 244–675–1 | 14.034 | 2-metiltiopirazīns; pirazinilmetilmetilsulfīds | (metiltio)pirazīns | |

14.035 | 24 | 67952–65–2 | 2-metil-3,5 vai 6-metiltiopirazīns | 3208 | 2290 | 267–918–3 | 14.035 | metil(metiltio)pirazīns (izomēru maisījums) | | |

14.037 | 24 | 23747–48–0 | 6,7-dihidro-5-metil-5H-ciklopentapirazīns | 3306 | 2314 | 245–864–1 | 14.037 | | | |

14.038 | 28 | 1122–62–9 | 2-acetilpiridīns | 3251 | 2315 | 214–355–6 | 14.038 | metil-2-piridilketons; 2-acetopiridīns | | |

14.039 | 28 | 350–03–8 | 3-acetilpiridīns | 3424 | 2316 | 206–496–7 | 14.039 | β-acetilpiridins; metil-3-piridilketons; metil-β-piridilketons; metilpiridilketons | | |

14.041 | 28 | 109–97–7 | pirols | 3386 | 2318 | 203–724–7 | 14.041 | azols; divinilēnimīns; imidols | | |

14.042 | 28 | 91–62–3 | 6-metilhinolīns | 2744 | 2339 | 202–084–6 | 14.042 | p-metilhinolīns; p-toluhinolīns | | |

14.043 | 24 | 24683–00–9 | 2-izobutil-3-metoksipirazīns | 3132 | 11338 | 246–402–1 | 14.043 | 2-butil-3-metoksipirazīns; 2-metoksi-3-izobutilpirazīns | | |

14.044 | 24 | 13925–06–9 | 2-izobutil-3-metilpirazīns | 3133 | | 237–693–6 | 14.044 | 2-butil-3-metilpirazīns; 2-metil-3-izobutilpirazīns | 2-(2-metilpropil)-3-metilpirazīns | |

14.045 | 28 | 39741–41–8 | 2-acetil-1-etilpirols | 3147 | 11371 | | 14.045 | 1-etil-2-acetilazols | | |

14.046 | 28 | 932–16–1 | 2-acetil-1-metilpirols | 3184 | 11373 | 213–247–6 | 14.046 | 1-metilpirol-2-ilmetilketons; 2-acetil-n-metilpirols; metil-1-metilpirol-2-ilketons | | |

14.047 | 28 | 1072–83–9 | 2-acetilpirols | 3202 | 11721 | 214–016–2 | 14.047 | metil-2-pirolilketons; 2-acetopirols; 2-pirolilmetilketons | | |

14.049 | 24 | 32974–92–8 | 2-acetil-3-etilpirazīns | 3250 | 11293 | 251–316–2 | 14.049 | 2-etil-3-pirazinilmetilketons; 2-acetil-3-etil-1,4-diazīns | | |

14.050 | 24 | 5910–89–4 | 2,3-dimetilpirazīns | 3271 | 11323 | 227–630–0 | 14.050 | 2,3-dimetil-1,4-diazīns | | |

14.051 | 24 | 68739–00–4 | 2,5 vai 6-metoksi-3-etilpirazīns | 3280 | 11329 | 272–125–0 | 14.051 | 3-etil-(5 vai 6)-metoksipirazīns; 5 vai 6-metoksi-3-etilpirazīns; 2,5 vai 6-metoksi-3-etilpirazīns | | 5 |

14.052 | 24 | 38713–41–6 | izopropenilpirazīns | 3296 | 11341 | | 14.052 | 2-izopropenil-1,4-diazīns | (1-metilēnetil)pirazīns | |

14.053 | 24 | 59021–02–2 | merkaptometilpirazīns | 3299 | 11502 | | 14.053 | pirazīnmetāntiols | | |

14.054 | 24 | 3149–28–8 | metoksipirazīns | 3302 | 11347 | 221–579–8 | 14.054 | 2-metoksi-1,4-diazīns | | |

14.055 | 24 | 54300–08–2 | 2-acetil-3,5-dimetilpirazīns | 3327 | 11294 | 259–076–0 | 14.055 | | | |

14.056 | 24 | 18138–04–0 | 2,3-dietil-5-metilpirazīns | 3336 | 11303 | 242–024–6 | 14.056 | | | |

14.057 | 24 | 25773–40–4 | 2-izopropil-3-metoksipirazīns | 3358 | 11344 | 247–256–1 | 14.057 | | | 5 |

14.058 | 28 | 6304–24–1 | 2-izobutilpiridīns | 3370 | 11395 | 228–606–2 | 14.058 | 2-butilpiridīns | 2-(2-metilpropil)piridīns | |

14.059 | 28 | 14159–61–6 | 3-izobutilpiridīns | 3371 | 11396 | 2380036 | 14.059 | 3-butilpiridīns | 3-(2-metilpropil)piridīns | |

14.060 | 28 | 2294–76–0 | 2-pentilpiridīns | 3383 | 11412 | 218–937–0 | 14.060 | 2-amilpiridīns | | |

14.061 | 28 | 536–78–7 | 3-etilpiridīns | 3394 | 11386 | 208–647–2 | 14.061 | β-etilpiridins; β-lutidins | | |

14.062 | 24 | 24168–70–5 | 2-( sek-butil)-3-metoksipirazīns | 3433 | 11300 | 246–050–9 | 14.062 | 2-but-2-il-3-metoksipirazīns; 2-metoksi-3-(1-metilpropil)cikloheksanons; 2-metoksi-3- sek-butilpirazīns | 2-(1-metilpropil)-3-metoksipirazīns | |

14.063 | 28 | 91–22–5 | hinolīns | 3470 | 11364 | 202–051–6 | 14.063 | 1-benzazīns; 2,3-benzpirīns; benzpirīns; hinoleīns; leikolīns; 1-azanaftalīns; leikols | 2,3-benzpiridīns | |

14.064 | 28 | 123–75–1 | pirolidīns | 3523 | 10491 | 204–648–7 | 14.064 | tetrametilēnimīns | tetrahidropirols | |

14.065 | 28 | 108–48–5 | 2,6-dimetilpiridīns | 3540 | 11381 | 203–587–3 | 14.065 | 2,6-lutidīns | | |

14.066 | 28 | 104–90–5 | 5-etil-2-metilpiridīns | 3546 | 11385 | 203–250–0 | 14.066 | 5-etil-2-pikolīns; 2-metil-5-etilpiridīns | | |

14.067 | 24 | 32737–14–7 | 2-metil-3,5 vai 6-etoksipirazīns | 3569 | 11921 | 2511846 | 14.067 | | | 5 |

14.068 | 28 | 1073–26–3 | 2-propionilpirols | 3614 | 11942 | 214–026–7 | 14.068 | etil-2-pirolilketons | | |

14.069 | 24 | 28217–92–7 | cikloheksilmetilpirazīns | 3631 | | 248–905–1 | 14.069 | 2-pirazīncikloheksilmetils; 2-pirazinilncikloheksilmetils | | |

14.070 | 30 | 67860–38–2 | 4-acetil-2-metilpirimidīns | 3654 | | | 14.070 | etanons, 1-(2-metil-4-pirimidinil)- | | |

14.071 | 28 | 93–60–7 | metilnikotināts | 3709 | | 202–261–8 | 14.071 | 3-karbometoksipiridīns | metil-3-piridīnkarboksilāts | |

14.072 | 28 | 2110–18–1 | 2-(3-fenilpropil)piridīns | 3751 | | 218–300–7 | 14.072 | | | |

14.076 | 24 | | 2-metoksi-(3, 5 vai 6)-metilpirazīns | 3183 | 2266 | | 14.076 | | | |

14.077 | 24 | | 2-etil-(3,5 vai 6)-metoksipirazīns (85 %) un 2-metil-(3,5 vai 6)-metoksipirazīns (13 %) | 3280 | 11329 | | 14.077 | | | |

14.078 | 24 | | 2-izopropil-(5 vai 6)-metoksipirazīns | 3358 | 11344 | | 14.078 | | | 5 |

14.079 | 28 | 27300–27–2 | 2-acetil-1,4,5,6-tetrahidropiridīns | | | | 14.079 | | | |

14.080 | 33 | 99583–29–6 | 2-acetil-1-pirolīns | | | | 14.080 | | | |

14.081 | 24 | 54300–10–6 | 5-acetil-2,3-dimetilpirazīns | | | | 14.081 | | | |

14.082 | 24 | 23787–80–6 | 2-acetil-3-metilpirazīns | | 11296 | 245–889–8 | 14.082 | | | |

14.083 | 24 | 43108–58–3 | 2-acetil-5-etilpirazīns | | | | 14.083 | | | |

14.084 | 24 | 22047–27–4 | 2-acetil-5-metilpirazīns | | 11297 | | 14.084 | | | |

14.085 | 28 | 6982–72–5 | 2-acetil-5-metilpirols | | | | 14.085 | | | |

14.086 | 24 | 34413–34–8 | 2-acetil-6-etilpirazīns | | 11295 | | 14.086 | | | |

14.087 | 24 | 22047–26–3 | 2-acetil-6-metilpirazīns | | 11298 | | 14.087 | | | |

14.088 | 28 | 576–15–8 | 1-acetilindols | | | 209–396–1 | 14.088 | N-acetilindols; 1-acetil-1H-indols | | |

14.089 | 28 | 1122–54–9 | 4-acetilpiridīns | | | 214–350–9 | 14.089 | metil-4-piridilketons | | |

14.090 | 28 | 25224–14–0 | 3-( sek-butil)piridīns | | | | 14.090 | 3-but-2-ilpiridīns | 3-(1-metilpropil)piridīns | |

14.091 | 24 | 15987–00–5 | 2-butil-3-metilpirazīns | | | 240–126–5 | 14.091 | | | |

14.092 | 28 | 5058–19–5 | 2-butilpiridīns | | | 225–758–1 | 14.092 | | | |

14.093 | 28 | 539–32–2 | 3-butilpiridīns | | | 208–715–1 | 14.093 | | | |

14.094 | 28 | 74808–78–9 | 4-butilhinolīns | | | | 14.094 | | | |

14.095 | 24 | 18138–05–1 | 3,5-dietil-2-metilpirazīns | 3916 | 11305 | | 14.095 | 2,6-dietil-3-metilpirazīns | | |

14.096 | 24 | 32736–91–7 | 2,5-dietil-3-metilpirazīns | 3915 | 11304 | | 14.096 | | | |

14.097 | 24 | 13238–84–1 | 2,5-dietilpirazīns | | 11306 | | 14.097 | | | |

14.098 | 24 | 38917–62–3 | 6,7-dihidro-2,3-dimetil-5H-ciklopentapirazīns | 3917 | 11309 | | 14.098 | | | |

14.099 | 24 | 41330–21–6 | 6,7-dihidro-5,7-dimetil-5H-ciklopentapirazīns | | | | 14.099 | | | |

14.100 | 24 | 55031–15–7 | 3,(5 vai 6)-dimetil-2-etilpirazīns | 3149 | 727 | | 14.100 | 2,(5 vai 6)-dimetil-3-etilpirazīns; 2-etil-3,5(6)-dimetilpirazīns; 3-etil-2,5(6)-dimetilpirazīns | | |

14.101 | 24 | 40790–20–3 | 2,5-dimetil-3-izopropilpirazīns | | 11318 | | 14.101 | | | |

14.102 | 24 | 38917–61–2 | 5,6-dimetildihidrociklopentapirazīns | | | | 14.102 | | | |

14.103 | 28 | 583–61–9 | 2,3-dimetilpiridīns | | | 209–514–1 | 14.103 | | | |

14.104 | 28 | 108–47–4 | 2,4-dimetilpiridīns | | | 203–586–8 | 14.104 | | | |

14.105 | 28 | 583–58–4 | 3,4-dimetilpiridīns | | | 209–511–5 | 14.105 | | | |

14.106 | 28 | 591–22–0 | 3,5-dimetilpiridīns | | 11382 | 209–708–6 | 14.106 | | | |

14.107 | 28 | 625–84–3 | 2,5-dimetilpirols | | 11383 | 210–913–8 | 14.107 | 2,5-dimetil-1H-pirols | | |

14.108 | 24 | 2379–55–7 | 2,3-dimetilhinoksalīns | | | 219–162–0 | 14.108 | | | |

14.109 | 24 | 32737–14–7 | 2-etoksi-3-metilpirazīns | 3569 | 11325 | 251–184–6 | 14.109 | | | 5 |

14.110 | 28 | 614–18–6 | etilnikotināts | | | 210–370–7 | 14.110 | 3-piridīnkarbonskābes etilesteris | etil-3-piridīna karboksilāts | |

14.111 | 24 | 13360–65–1 | 3-etil-2,5-dimetilpirazīns | 3149 | 2246 | 236–417–1 | 14.111 | | | 5 |

14.112 | 24 | 25680–58–4 | 2-etil-3-metoksipirazīns | 3280 | 11329 | 247–184–0 | 14.112 | | | 5 |

14.113 | 24 | 52517–53–0 | 5-etil-6,7-dihidro-5H-ciklopentapirazīns | | | | 14.113 | | | |

14.114 | 24 | 13925–03–6 | 2-etil-6-metilpirazīns | 3919 | 11331 | 237–692–0 | 14.114 | 2-metil-6-etilpirazīns; 6-metil-2-etilpirazīns | | |

14.115 | 28 | 100–71–0 | 2-etilpiridīns | | 11767 | 202–881–9 | 14.115 | | | |

14.116 | 28 | 536–75–4 | 4-etilpiridīns | | 11387 | 208–646–7 | 14.116 | | | |

14.117 | 28 | 1129–69–7 | 2-heksilpiridīns | | | 214–454–4 | 14.117 | | | |

14.118 | 28 | 142–08–5 | 2-hidroksipiridīns | | | 205–520–3 | 14.118 | 2-piridons | | |

14.120 | 28 | 553–60–6 | izopropilnikotināts | | | 209–043–1 | 14.120 | | izopropil-3-piridīnkarboksilāts | |

14.121 | 24 | 93905–03–4 | 2-izopropil-(3,5 vai 6)-metoksipirazīns | 3358 | 11344 | 299–837–4 | 14.121 | | | |

14.122 | 24 | 67952–59–4 | 2-izopropil-3-metiltiopirazīns | | 11342 | 267–913–6 | 14.122 | | 2-(1-metiletil)- 3-(metiltio)pirazīns | |

14.123 | 24 | 29460–90–0 | izopropilpirazīns | 3940 | 11343 | 249–646–7 | 14.123 | | (2-metilpropil)pirazīns | |

14.124 | 28 | 644–98–4 | 2-izopropilpiridīns | | 11400 | 211–426–3 | 14.124 | | | |

14.125 | 28 | 696–30–0 | 4-izopropilpiridīns | | | 211–794–5 | 14.125 | | | |

14.126 | 24 | 2847–30–5 | 2-metoksi-3-metilpirazīns | 3183 | 2266 | 220–651–6 | 14.126 | 2-metil-3-metoksipirazīns | | 5 |

14.127 | 24 | 25680–57–3 | 2-metoksi-3-propilpirazīns | | | | 14.127 | | | |

14.128 | 24 | 2882–20–4 | 2-metil-3-metiltiopirazīns | | | 220–736–8 | 14.128 | 2-metil-3-(metiltio)pirazīns | | |

14.129 | 24 | 15986–80–8 | 2-metil-3-propilpirazīns | | | 240–121–8 | 14.129 | | | |

14.131 | 28 | 95–20–5 | 2-metilindols | | | 202–398–3 | 14.131 | | | |

14.133 | 33 | 109–05–7 | 2-metilpiperidīns | | | 203–642–1 | 14.133 | α-pipekolins | | |

14.134 | 28 | 109–06–8 | 2-metilpiridīns | | 11415 | 203–643–7 | 14.134 | α-pikolins; 2-pikolīns | | |

14.135 | 28 | 108–99–6 | 3-metilpiridīns | | 11801 | 203–636–9 | 14.135 | β-pikolins; 3-pikolīns | | |

14.136 | 28 | 108–89–4 | 4-metilpiridīns | | 11416 | 203–626–4 | 14.136 | γ-pikolins; 4-pikolīns | | |

14.137 | 28 | 120–94–5 | 1-metilpirolidīns | | | 204–438–5 | 14.137 | | | |

14.138 | 30 | 91–63–4 | 2-metilhinolīns | | 11358 | 202–085–1 | 14.138 | hinaldīns | | |

14.139 | 24 | 7251–61–8 | 2-metilhinoksalīns | | | 230–664–9 | 14.139 | | | |

14.140 | 28 | 1802–20–6 | 3-pentilpiridīns | | | | 14.140 | | | |

14.141 | 33 | 110–85–0 | piperazīns | | | 203–808–3 | 14.141 | | | |

14.142 | 24 | 18138–03–9 | propilpirazīns | 3961 | 11362 | 242–023–0 | 14.142 | | | |

14.143 | 28 | 4673–31–8 | 3-propilpiridīns | | 11419 | 225–122–3 | 14.143 | | | |

14.144 | 24 | 290–37–9 | pirazīns | | 11363 | 206–027–6 | 14.144 | | | |

14.145 | 28 | 1003–29–8 | pirol-2-karbaldehīds | | 11393 | 213–705–5 | 14.145 | 2-formilpirols | | |

14.146 | 30 | 130–95–0 | hinīns | | | 205–003–2 | 14.146 | | | 2, 3 |

14.147 | 24 | 91–19–0 | hinoksalīns | | 11365 | 202–047–4 | 14.147 | 1,4-benzodiazīns | | |

14.148 | 24 | 52517–54–1 | 5,6,7,8-tetrahidro-5-metilhinoksalīns | | | | 14.148 | | | |

14.149 | 28 | 91–61–2 | 1,2,3,4-tetrahidro-6-metilhinolīns | | | 202–083–0 | 14.149 | | | |

14.150 | 28 | 108–75–8 | 2,4,6-trimetilpiridīns | | | 203–613–3 | 14.150 | 2,4,6-kolidīns | | |

14.151 | 24 | 4177–16–6 | vinilpirazīns | | 11370 | 224–045–2 | 14.151 | | | |

14.152 | 30 | 6119–70–6 | hinīna sulfāts | 2977 | | | 14.152 | | | 2, 3, 5 |

14.153 | 28 | 1333–53–5 | (1-metiletil)hinolīns | | | 215–595–4 | 14.153 | | | |

14.154 | 30 | 7549–43–1 | hinīna hlorhidrāts | | | 231–437–7 | 14.154 | hinīna hidrohlorīds | | 2, 3 |

14.155 | 30 | 6119–47–7 | hinīna monohidrohlorīda dihidrāts | | | | 14.155 | | | 2, 3 |

14.156 | 33 | 147030–02–2 | (E)-1-(1-okso-2-decenil)piperidīns | | | | 14.156 | | | |

14.157 | 33 | 78910–33–5 | (E,E)-1-(okso-2,4-dekadienil)pirolidīns | | | | 14.157 | | | |

14.158 | 24 | 94089–22–2 | 2-izopropoksi-3-metilpirazīns | | | 302–122–2 | 14.158 | 2-metil-3-(1-metiletoksi)pirazīns | | |

14.161 | 24 | | 6,7-dihidro-2, 5-dimetil-5H-ciklopentapirazīns | | 11310 | | 14.161 | | | |

15.001 | 29 | 7774–74–5 | 2-merkaptotiofēns | 3062 | 478 | 231–881–1 | 15.001 | 2-tionilmerkaptāns; 2-tiofēntiols | | |

15.002 | 29 | 38205–64–0 | 2-metil-5-metoksitiazols | 3192 | 736 | | 15.002 | 5-metoksi-2-metiltiazols | | |

15.004 | 29 | 13679–70–4 | 5-metil-2-tiofēnkarbaldehīds | 3209 | 2203 | 237–178–6 | 15.004 | 2-formil-5-metiltiofēns; 2-tiofēnkarboksaldehīds, 5-metil-; 2-tiofēnkarbaldehīds, 5-metil- | | |

15.005 | 29 | 65505–18–2 | 2,4-dimetil-5-viniltiazols | 3145 | 2237 | | 15.005 | | | |

15.006 | 20 | 55704–78–4 | 2,5-dihidroksi-2,5-dimetil-1,4-ditiāns | 3450 | 2322 | 259–770–3 | 15.006 | 2,5-dimetil-2, 5-dihidroksi- p-ditiāns | | |

15.007 | 20 | 38325–25–6 | spiro[2,4-ditia-1-metil-8-oksabiciklo[3.3.0]oktān-3, 3′-(1′-oksa-2′-metil)ciklopentāns] un spiro[ditia-6-metil-7-oksabiciklo[3.3.0]oktān-3, 3′-(1′-oksa-2-metil)ciklopentāns] | 3270 | 2325 | 253–884–7 | 15.007 | spiro[ditia-6-metil-7-oksabiciklo[3.3.0]oktān-3,3?-(1α-oksa-2-metil)ciklopentans] (izomera komponente) | | |

15.008 | 29 | 6911–51–9 | 2-tienildisulfīds | 3323 | 2333 | | 15.008 | 2,2-ditioditiofēns; 2,2α-ditioditiofens | | |

15.009 | 20 | 828–26–2 | tritioacetons | 3475 | 2334 | 212–582–5 | 15.009 | 2,2,4,4,6,6-heksametil-s-tritiāns | 2,2,4,4,6,6-heksametil-1,3,5-tritiāns | |

15.010 | 29 | 29926–41–8 | 2-acetil-2-tiazolīns | 3817 | 2335 | | 15.010 | acetiltiazolīns-2; 2-acetil-4,5-dihidrotiazols | | |

15.011 | 29 | 38205–60–6 | 5-acetil-2,4-dimetiltiazols | 3267 | 2336 | 253–826–0 | 15.011 | 2,4-dimetil-5-acetiltiazols; 2,4-dimetil-5-tiazoilmetilketons | | |

15.012 | 29 | 1003–04–9 | 4,5-dihidrotiofēn-3(2H)-ons | 3266 | 2337 | 213–698–9 | 15.012 | 3-tetrahidrotiofenons; 3-tiofenons; tetrahidrotiofēn-3-ons; dihidrotiofenons | | |

15.013 | 29 | 18640–74–9 | 2-izobutiltiazols | 3134 | 11618 | 242–470–1 | 15.013 | tiazols, 2-izobutil-; 2-butiltiazols | 2-(2-metilpropil)tiazols | |

15.014 | 29 | 137–00–8 | 5-(2-hidroksietil)-4-metiltiazols | 3204 | 11621 | 205–272–6 | 15.014 | 4-metil-5-tiazoletanols; sulfurols; 5-tiazoletanols, 4-metil- | | |

15.015 | 29 | 656–53–1 | 4-metil-5-(2-acetoksietil)tiazols | 3205 | 11620 | 211–515–7 | 15.015 | 4-metil-5-tiazoletanola acetāts; 5-tiazoletanola, 4-metil-, acetāts | | |

15.016 | 29 | 95–16–9 | benztiazols | 3256 | 11594 | 202–396–2 | 15.016 | | | |

15.017 | 29 | 3581–91–7 | 4,5-dimetiltiazols | 3274 | 11606 | 222–703–3 | 15.017 | | | |

15.018 | 29 | 1759–28–0 | 4-metil-5-viniltiazols | 3313 | 11633 | 217–160–4 | 15.018 | tiazols, 4-metil-5-vinil- | | |

15.019 | 29 | 13623–11–5 | 2,4,5-trimetiltiazols | 3325 | 11650 | 237–107–9 | 15.019 | | | |

15.020 | 29 | 24295–03–2 | 2-acetiltiazols | 3328 | 11726 | 246–134–5 | 15.020 | metil-2-tiazoilketons; etanons, 1-(2-tiazolil)-; 2-tiazolilmetilketons | | |

15.021 | 29 | 15679–19–3 | 2-etoksitiazols | 3340 | 11611 | 239–760–5 | 15.021 | 2-tiazoliletilēteris; etil-2-tiazolilēteris | | |

15.022 | 29 | 18277–27–5 | 2-( sek-butil)tiazols | 3372 | 11598 | 242–154–3 | 15.022 | 2-but-2-iltiazols tiazols, 2- sek-butil– | 2-(1-metilpropil)tiazols | |

15.023 | 29 | 13679–85–1 | 4,5-dihidro-2-metiltiofēn-3(2H)-ons | 3512 | 11601 | 237–183–3 | 15.023 | 2-metiltetratiofēn-3-ons; 2-metil-4,5-dihidro-3-tiofenons; 2-metiltiolān-3-ons; dihidrotiofenons-3(2H), 2-metil- | | |

15.024 | 29 | 2530–10–1 | 3-acetil-2,5-dimetiltiofēns | 3527 | 11603 | 219–779–5 | 15.024 | 2,5-dimetil-3-tienilmetilketons; etanons, 1-(2,5-dimetil-3-tienil)- | | |

15.025 | 20 | 23654–92–4 | 3,5-dimetil-1,2,4-tritiolāns | 3541 | 11883 | 245–808–6 | 15.025 | | | |

15.026 | 29 | 15679–13–7 | 2-izopropil-4-metiltiazols | 3555 | | 239–758–4 | 15.026 | tiazols, 2-izopropil-4-metil- | | |

15.027 | 29 | 43039–98–1 | 2-propioniltiazols | 3611 | | | 15.027 | tiazols, 2-propionil– | | |

15.028 | 29 | 288–47–1 | tiazols | 3615 | 11642 | 206–021–3 | 15.028 | | | |

15.029 | 29 | 65894–82–8 | 2-( sek-butil)- 4,5-dimetil-3-tiazolīns | 3619 | | 265–968–0 | 15.029 | 2,5-dihidro-4,5-dimetil-2-but-2-iltiazols | 2-(1-metilpropil)- 4,5-dimetil-3-tiazolīns | |

15.030 | 29 | 76788–46–0 | 4,5-dimetil-2-etil-3-tiazolīns | 3620 | | 278–551–3 | 15.030 | 2-dimetil-4,5-etil-3-tiazolīns | | |

15.032 | 29 | 65894–83–9 | 4,5-dimetil-2-izobutil-3-tiazolīns | 3621 | | 265–969–6 | 15.032 | 4,5-dimetil-2-(2-metilpropil)- 3-tiazolīns; 3-tiazolīns, 4,5-dimetil-2-(2-metilpropil)- | | |

15.033 | 29 | 15679–12–6 | 2-etil-4-metiltiazols | 3680 | 11612 | 239–757–9 | 15.033 | | | |

15.034 | 20 | 5616–51–3 | 2-metil-1,3-ditiolāns | 3705 | | 227–038–2 | 15.034 | | | |

15.035 | 29 | 693–95–8 | 4-metiltiazols | 3716 | 11627 | 211–764–1 | 15.035 | | | |

15.036 | 20 | 43040–01–3 | 3-metil-1,2,4-tritiāns | 3718 | | 256–056–3 | 15.036 | | | |

15.037 | 29 | 13679–72–6 | 2-acetil-3-metiltiofēns | | 11590 | 237–179–1 | 15.037 | 1-(3-metil-2-tienil)etān-1-ons | | |

15.038 | 29 | 7533–07–5 | 2-acetil-4-metiltiazols | | 11589 | | 15.038 | | | |

15.039 | 29 | 59303–17–2 | 2-acetil-5-metiltiazols | | | | 15.039 | | | |

15.040 | 29 | 88–15–3 | 2-acetiltiofēns | | 11728 | 201–804–6 | 15.040 | metil-2-tieniilketons | | |

15.041 | 29 | 76572–48–0 | 2-butil-4,5-dimetiltiazols | | | | 15.041 | | | |

15.042 | 30 | 132344–97–9 | 2-butil-4-metil(4H)pirolidīn[1,2-d]- 1,3,5-ditiazīns | | | | 15.042 | | 4-butil-2-metil-1-aza-3,5-ditiabiciklo[4.3.0]nonāns | |

15.043 | 29 | 54411–06–2 | 2-butil-5-etiltiofēns | | 11596 | | 15.043 | | | |

15.044 | 29 | 37645–61–7 | 2-butiltiazols | | 11597 | 253–577–8 | 15.044 | | | |

15.045 | 29 | 1455–20–5 | 2-butiltiofēns | | | 215–935–1 | 15.045 | | | |

15.046 | 29 | 34722–01–5 | 3-butiltiofēns | | | | 15.046 | | | |

15.047 | 20 | 92900–67–9 | 3,5-diizobutil-1,2,4-tritiolāns | | | | 15.047 | | 3,5-di-(2-metilpropil)- 1,2,4-tritiolāns | |

15.048 | 20 | 54934–99–5 | 3,5-diizopropil-1,2,4-tritiolāns | | | | 15.048 | | | |

15.049 | 20 | 54644–28–9 | 3,5-dietil-1, 2,4-tritiolāns | | | | 15.049 | | | |

15.050 | 29 | 41981–71–9 | 2,5-dietil-4-metiltiazols | | | | 15.050 | | | |

15.051 | 29 | 4276–68–0 | 2,5-dietil-4-propiltiazols | | | | 15.051 | | | |

15.052 | 29 | 15729–76–7 | 2,5-dietiltiazols | | | 239–823–7 | 15.052 | tiazols, 2,5-dietil– | | |

15.053 | 29 | 35686–14–7 | 3,4-dietiltiofēns | | | | 15.053 | | | |

15.054 | 30 | 54717–17–8 | dihidro-2, 4,6-trietil-1,3,5-(4H)-ditiazīns | | | | 15.054 | | | |

15.055 | 30 | 116505–60–3 | 2,4-dimetl(4H)pirolidīn[1,2-e]- 1,3,5-ditiazīns | | | | 15.055 | | 2,4-dimetil-1-aza-3,5-ditiabiciklo[4.3.0]nonāns | |

15.056 | 20 | 67411–27–2 | 3,6-dimetil-1,2,4,5-tetratiāns | | | | 15.056 | | | |

15.057 | 30 | 104691–40–9 | 4,6-dimetil-2-(1-metiletil)dihidro-1,3,5-ditiazīns | 3782 | | | 15.057 | 2(4)-izopropil-4(2), 6-dimetildihidro-4H-1, 3,5-ditiazīns | | |

15.058 | 29 | 873–64–3 | 4,5-dimetil-2-etiltiazols | | | | 15.058 | | | |

15.059 | 29 | 41981–72–0 | 4,5-dimetil-2-propiltiazols | | | 255–604–9 | 15.059 | | | |

15.060 | 29 | 60755–05–7 | 2,4-dimetil-3-tiazolīns | | | 262–405–0 | 15.060 | 2,5-dihidro-2,4-dimetiltiazols | | |

15.061 | 29 | 32272–57–4 | 2,5-dimetil-4-etiltiazols | | | | 15.061 | | | |

15.062 | 29 | 541–58–2 | 2,4-dimetiltiazols | | 11605 | 208–786–9 | 15.062 | | | |

15.063 | 29 | 4175–66–0 | 2,5-dimetiltiazols | | | | 15.063 | | | |

15.064 | 29 | 638–02–8 | 2,5-dimetiltiofēns | | 11609 | 211–313–9 | 15.064 | | | |

15.065 | 29 | 632–15–5 | 3,4-dimetiltiofēns | | 11610 | | 15.065 | | | |

15.066 | 20 | 505–29–3 | 1,4-ditiāns | 3831 | | 208–007–2 | 15.066 | p - ditiāns; 1,4-ditiocikloheksāns; 1,4-ditiīns, tetrahidro-; dietilēndisulfīds | | |

15.067 | 29 | 32272–48–3 | 4-etil-2-metiltiazols | | | | 15.067 | | | |

15.068 | 29 | 19961–52–5 | 5-etil-2-metiltiazols | | | | 15.068 | | | |

15.069 | 29 | 52414–91–2 | 4-etil-5-metiltiazols | | | 257–904–5 | 15.069 | | | |

15.070 | 29 | 40323–88–4 | 2-etil-5-metiltiofēns | | | | 15.070 | | | |

15.071 | 29 | 15679–09–1 | 2-etiltiazols | | | 239–755–8 | 15.071 | | | |

15.072 | 29 | 872–55–9 | 2-etiltiofēns | | 11614 | 212–830–2 | 15.072 | | | |

15.073 | 29 | 1795–01–3 | 3-etiltiofēns | | | 217–267–6 | 15.073 | | | |

15.074 | 29 | 36880–33–8 | 5-etiltiofēn-2-karbaldehīds | | | 253–252–0 | 15.074 | | | |

15.075 | 29 | 65016–61–7 | 3-heptiltiofēns | | | | 15.075 | | | |

15.076 | 29 | 18794–77–9 | 2-heksiltiofēns | | 11616 | 242–579–4 | 15.076 | | | |

15.077 | 29 | 26494–10–0 | 4-hidroksi-2,5-dimetiltiofēn-3(2H)-ons | | | 247–742–3 | 15.077 | | | |

15.078 | 29 | 53498–32–1 | 2-izobutil-4,5-dimetiltiazols | | 11617 | 258–586–0 | 15.078 | | 4,5-dimetil-2-(2-metilpropil)tiazols | |

15.079 | 30 | 101517–87–7 | 2-izobutildihidro-4,6-dimetil-1,3,5-ditiazīns | 3781 | | | 15.079 | 2(4)-izobutil-4(2),6-dimetildihidro-4H-1,3,5-ditiazīns | 2-(2-metilpropil)dihidro-4,6-dimetil-1,3,5-ditiazīns | |

15.080 | 29 | 53498–30–9 | 2-izopropil-4,5-dimetiltiazols | | | | 15.080 | | | |

15.081 | 20 | 292–46–6 | lentionīns | | 11619 | | 15.081 | | 1,2,3,5,6-pentatiacikloheptāns | |

15.082 | 29 | 7774–73–4 | 3-merkaptotiofēns | | | 231–880–6 | 15.082 | tiofēn-3-tiols | | |

15.083 | 20 | 51647–38–2 | 3-metil-1,2,4-tritiolāns | | | | 15.083 | | | |

15.084 | 29 | 86290–21–3 | 5-metil-2-pentiltiazols | | | | 15.084 | | | |

15.085 | 29 | 13679–83–9 | 4-metil-2-propioniltiazols | | 11622 | | 15.085 | | | |

15.086 | 29 | 2346–00–1 | 2-metil-2-tiazolīns | | | 219–071–6 | 15.086 | | | |

15.087 | 29 | 2527–76–6 | 2-metil-3-merkaptotiofēns | | | 219–770–6 | 15.087 | 2-metiltiofēn-3-tiols | | |

15.088 | 29 | 120–75–2 | 2-metil-4,5-benztiazols | | | 204–423–3 | 15.088 | 2-metilbenztiazols | | |

15.089 | 29 | 3581–87–1 | 2-metiltiazols | | 11626 | 222–702–8 | 15.089 | | | |

15.090 | 29 | 24050–16–6 | 2-metiltiazolidīns | | | | 15.090 | | | |

15.091 | 29 | 554–14–3 | 2-metiltiofēns | | 11631 | 209–063–0 | 15.091 | | | |

15.092 | 29 | 616–44–4 | 3-metiltiofēns | | 11632 | 210–482–6 | 15.092 | | | |

15.093 | 29 | 880–36–4 | 2-oktiltiofēns | | | 212–913–3 | 15.093 | | | |

15.094 | 29 | 53119–25–8 | 2-pentanoiltiofēns | | | | 15.094 | | | |

15.095 | 29 | 102871–31–8 | 3-pentiltiofēns | | | | 15.095 | | | |

15.096 | 29 | 4861–58–9 | sek-pentiltiofēns | | 11634 | 225–465–9 | 15.096 | | 1-metilbutiltiofēns | |

15.097 | 29 | 13679–75–9 | 2-propioniltiofēns | | 11635 | 237–182–8 | 15.097 | 2-propanoiltiofēns | | |

15.098 | 29 | 17626–75–4 | 2-propiltiazols | | | 241–606–7 | 15.098 | | | |

15.099 | 29 | 24050–10–0 | 2-propiltiazolidīns | | | | 15.099 | | | |

15.100 | 29 | 1551–27–5 | 2-propiltiofēns | | | 216–288–8 | 15.100 | | | |

15.101 | 29 | 1518–75–8 | 3-propiltiofēns | | | | 15.101 | | | |

15.102 | 20 | 110–01–0 | tetrahidrotiofēns | | | 203–728–9 | 15.102 | tiaciklopentāns; tiofāns; tetrametilēnsulfīds | | |

15.103 | 20 | 291–22–5 | 1,2,4,5-tetratiāns | | | | 15.103 | | | |

15.104 | 29 | 5333–83–5 | 1-(2-tienil)butān-1-ons | | | 226–246–0 | 15.104 | 2-butiriltiofēns | | |

15.105 | 29 | 94089–02–8 | 1-(2-tienil)etān-1-tiols | | 11580 | 302–104–4 | 15.105 | 1-(2-tienil)etilmerkaptāns | | |

15.106 | 29 | 110–02–1 | tiofēns | | 11647 | 203–729–4 | 15.106 | | | |

15.107 | 29 | 98–03–3 | tiofēn-2-karbaldehīds | | 11874 | 202–629–8 | 15.107 | 2-formiltiofēns | | |

15.108 | 29 | 6258–63–5 | 2-tiofēnmetāntiols | | | 228–394–1 | 15.108 | tienilmerkaptāns | | |

15.109 | 30 | 638–17–5 | 2,4,6-trimetildihidro-1,3,5-(4H)-ditiazīns | | 11649 | | 15.109 | tialdīns | | |

15.110 | 20 | 2765–04–0 | 2,4,6-trimetil-1,3,5-tritiāns | | | | 15.110 | | | |

15.111 | 20 | 289–16–7 | 1,2,4-tritiolāns | | | | 15.111 | | | |

15.113 | 30 | 74595–94–1 | 5,6-dihidro-2,4,6- tris-(2-metilpropil)- 4H-1,3,5-ditiazīns | | | | 15.113 | | | |

15.114 | 30 | 101417–25–8 | 5-acetil-2,3-dihidro-1,4-tiazīns | | | | 15.114 | | | |

15.115 | 29 | 61323–24–8 | 2-izobutil-4-metiltiazols | | | 262–709–3 | 15.115 | | 2-(2-metilpropil)- 4-metiltiazols | |

15.116 | 29 | | 2-acetil-4-etiltiazols | | | | 15.116 | | | |

15.117 | 29 | | 2-izobutil-4,5-dimetiltiazols | | | | 15.117 | | 2-(2-metilpropil)- 4,5-dimetiltiazols | |

15.118 | 29 | | 4-butiltiazols | | | | 15.118 | | | |

15.119 | 29 | | 2-izobutil-3-tiazolīns | | | | 15.119 | | 2-(2-metilpropil)- 2,5-dihidrotiazols | |

15.121 | 29 | | 4-merkapto-2-metil-4,5-dihidrotiofēns | | | | 15.121 | | | |

15.122 | 30 | | 2,4,6-trietil-1,3,5-tritiazīns | | | | 15.122 | | | |

16.001 | 02 | 7563–33–9 | amonija izovalerāts | 2054 | 464 | 231–458–1 | 16.001 | izobaldriānskābes amonija sāls; amonija 3-metilbutanoāts; 3-metilbutānskābes amonija sāls | amonija 3-metilbutanoāts | |

16.002 | 30 | 12135–76–1 | diamonija sulfīds | 2053 | 482 | 2351843 | 16.002 | amonija monosulfīds | | 1, 5 |

16.006 | 19 | 2444–46–4 | N-nonanoil-4-hidroksi-3-metoksibenzilamīds | 2787 | 590 | 219–484–1 | 16.006 | pelargonilvanililamīds; N-(4-hidroksi-3-metoksibenzil)nonānamīds; n-nonanoilvanililamīds | | |

16.007 | 30 | 7783–06–4 | sērūdeņradis | 3779 | 647 | 231–977–3 | 16.007 | | | |

16.009 | 30 | 7664–41–7 | amonjaks | | 739 | 231–635–3 | 16.009 | | | 4 |

16.012 | 30 | | glicirizīnskābe | 2528 | 2221 | 215–785–7 | 16.012 | glicirizīns | | 3, 5 |

16.013 | 19 | 39711–79–0 | N-etil-2-izopropil-5-metilcikloheksānkarboksamīds | 3455 | 2298 | 254–599–0 | 16.013 | N-etil- p - mentān-3-karboksamīds | | |

16.014 | 19 | 404–86–4 | N-(4-hidroksi-3-metoksibenzil)- 8-metilnon-6-ēnamīds | 3404 | 2299 | 206–969–8 | 16.014 | kapsaicīns;8-metilnon-3-enoil-4-hidroksi-3-metoksibenzilamīds; trans-8-metil-N-vanilil-6-nonēnamīds; izodecēnskābes vanililamīds | | |

16.015 | 32 | 77–83–8 | etilmetilfenilglicidāts | 2444 | 6002 | 201–061–8 | 16.015 | etil-α,β-epoksi-β-metilfenilpropionats; zemeņu aldehīds; C 16 aldehīds | etil-2,3-epoksi-3-metil-3-fenilbutanoāts | |

16.016 | 30 | 58–08–2 | kofeīns | 2224 | 11741 | 200–362–1 | 16.016 | | 1,3,7-trimetil-2,6-dioksopurīns | 2, 3 |

16.017 | 30 | 109–95–5 | etilnitrīts | 2446 | 11869 | 203–722–6 | 16.017 | slāpekļa(I) ēteris | | 4 |

16.018 | 32 | 121–39–1 | etil-3-fenil-2,3-epoksipropionāts | 2454 | 11844 | 204–467–3 | 16.018 | etil-α,β-epoksi-α-fenilpropionats; etil-3-fenilglicidāts | | |

16.027 | 29 | 67–03–8 | tiamīna hidrohlorīds | 3322 | 10493 | 200–641–8 | 16.027 | B 1 vitamīns | 3-[(4-amino-2-metil-5-pirimidinil)metil]-5-(2-hidroksietil)- 4-metiltiazolija hlorīds | 1, 3 |

16.030 | 20 | 67715–80–4 | 2-metil-4-propil-1,3-oksatiāns | 3578 | 11540 | | 16.030 | 1,3-oksatiāns, 2-metil-4-propil- | | |

16.032 | 30 | 83–67–0 | teobromīns | 3591 | | 201–494–2 | 16.032 | 3,7-dihidro-3,7-dimetil-1H-purīn-2,6-dions;3,7-dimetilksantīns; 1H-purīn-2,6-dions,3,7-dihidro-3,7-dimetil- | 3,7-dihidro-3,7-dimetil-1H-purīn-2,6-dions | 2, 3 |

16.039 | 30 | | kālija 2-(1′-etoksi)etoksipropanoāts | 3752 | | | 16.039 | | | |

16.040 | 32 | 74367–97–8 | etil-2,3-epoksi-3-metil-3- p - tolilpropionāts | 3757 | 11707 | 277–844–3 | 16.040 | etilmetil- p-tolilglicidāts; etilmetil- p-metilfenilglicidāts | etil-2,3-epoksi-3-(4-metilfenil)butanoāts | |

16.041 | 22 | 13794–15–5 | nātrija 2-(4-metoksifenoksi)propionāts | 3773 | | | 16.041 | | | |

16.042 | 32 | 18383–49–8 | karvona 5,6-oksīds | | 10501 | | 16.042 | | 5,6-epoksi- p-ment-8-ēn-2-ons | |

16.043 | 32 | 1139–30–6 | β-kariofilena epoksīds | | 10500 | 214–519–7 | 16.043 | β-kariofilena oksīds | 4,5-epoksi-4,12,12-trimetil-8-metilēnbiciklo[8.2.0]dodekāns | |

16.044 | 32 | 35178–55–3 | piperitenona oksīds | | 10508 | | 16.044 | | 1,2-epoksi- p - ment-4(8)-ēn-3-ons | |

16.047 | 19 | 60–35–5 | acetamīds | | | 200–473–5 | 16.047 | | | |

16.048 | 30 | 12125–02–9 | amonija hlorīds | | | 235–186–4 | 16.048 | | | |

16.049 | 19 | 541–35–5 | butiramīds | | | 208–776–4 | 16.049 | butānamīds | | |

16.050 | 30 | 5146–66–7 | 3,7-dimetilokta-2,6-diēnnitrils | | | 225–918–0 | 16.050 | | | |

16.051 | 32 | 38284–11–6 | epoksioksoforons | | | | 16.051 | 1,3,3-trimetil-7-oksabiciklo[4.1.0]heptān-2,5-dions | 2,3-epoksi-2,6,6-trimetil-1,4-cikloheksāndions | |

16.052 | 19 | 105–60–2 | 1,6-heksalaktāms | | | 203–313–2 | 16.052 | | | |

16.053 | 30 | 51115–67–4 | 2-izopropil-N,2,3-trimetilbutānamīds | 3804 | 10459 | 256–974–4 | 16.053 | 2-izopropil-N,2,3-trimetilbutiramīds; N,2,3-trimetil-2-izopropilbutānamīds | | |

16.054 | 16 | 65416–59–3 | 6-metilēn-2,10,10-trimetil-1-oksaspiro[4.5]dec-7-ēns | | | | 16.054 | vitispirāns | | |

16.055 | 11 | 564–20–5 | sklareolīds | 3794 | | 209–269–0 | 16.055 | norambriēnolīds; dekahidrotetrametilnaftofuranons | 3a,6,6,9a-tetrametildekahidronafto(2,1b)furān-1-ons | |

16.056 | 34 | 107–35–7 | taurīns | 3813 | | 203–483–8 | 16.056 | | 2-aminoetānsulfoskābe | 1, 3 |

16.057 | 20 | 72472–02–7 | 2,4,4-trimetil-1,3-oksatiāns | | | | 16.057 | | | |

16.058 | 25 | 10236–47–2 | naringīns | 2769 | 10286 | 233–566–4 | 16.058 | | | |

16.059 | 30 | 12124–99–1 | amonija hidrogēnsulfīds | 2053 | 482 | 235–184–3 | 16.059 | | | 1, 5 |

16.060 | 30 | 53956–04–0 | amonija glicirizināts | 2528 | 2221 | 258–887–7 | 16.060 | | | 1, 3, 5 |

16.061 | 30 | 20702–77–6 | neohesperidīna dihidrohalkons | 3811 | | 243–978–6 | 16.061 | | | 4 |

16.062 | 20 | 59324–17–3 | tran- 2-metil-4-propil-1,3-oksatiāns | | | 261–700–1 | 16.062 | | | |

16.064 | 07 | 52104–11–7 | kariolanols-1 | | | | 16.064 | | | |

16.065 | 23 | | 4-(β- D-glikopiranoziloksi)- 3-metoksibenzaldehīds | | | | 16.065 | | | |

16.066 | 30 | 34625–23–5 | etil- D-glikopiranozīds | | | 252–122–0 | 16.066 | | | |

16.067 | 30 | 18604–50–7 | 2-metoksi-4-(2-propenil)fenil-β- D-glikopiranozīds | | | | 16.067 | | | |

16.068 | 30 | 100–47–0 | benzonitrils | | | 202–855–7 | 16.068 | | | 4 |

16.069 | 30 | 85–32–5 | guanilskābe | | | | 16.069 | | | |

16.070 | 32 | | 7,15-epoksi-3-kariofilēns | | | | 16.070 | | | |

16.071 | 32 | | 4,5-epoksidec-2-( trans)-enāls | | | | 16.071 | | | |

16.073 | 01 | | nātrija diacetāts | 3900 | | | 16.073 | nātrija etanoāts | | |

16.075 | 23 | | etilvanilīn-?- D - glikopiranozīds | 3801 | | | 16.075 | | | |

16.077 | 20 | | 2-(2-metil-1-propenil)- 4,4-dimetil-1, 3-oksatiāns | | | | 16.077 | | | |

16.078 | 34 | | lizīna hidrohlorīds | | | | 16.078 | | | |

16.079 | 25 | | 4-( p-hidroksifenil)- 2-butanon-β- D-glikopiranozīds | | | | 16.079 | | | |

16.080 | 30 | 72401–53–7 | miecskābe | 3042 | | 276–638–0 | 16.080 | | D-glikozes pentakis-{3,4-dihidroksi-5-[(trihidroksi-3,4,5-benzoil)oksi}benzoāts | |

16.081 | 30 | 126–14–7 | saharozes oktaacetāts | 3038 | 11819 | 204–772–1 | 16.081 | oktaacetilsaharoze | | |

17.001 | 34 | 107–95–9 | β-alanins | 3252 | | 203–536–5 | 17.001 | | 3-aminopropānskābe | 1, 3 |

17.002 | 34 | 56–41–7 | L-alanīns | 3818 | 11729 | 200–273–8 | 17.002 | | 2-aminopropānskābe | 1, 3 |

17.003 | 34 | 74–79–3 | L-arginīns | 3819 | 11890 | 200–811–1 | 17.003 | (S)-2-amino-5-guanidinobaldriānskābe; arginīns; 2-amino-5-guanidinobaldriānskābe | | 1, 3 |

17.004 | 34 | 3130–87–8 | asparagīns | | 516 | 221–521–1 | 17.004 | | | 1, 3 |

17.005 | 34 | 56–84–8 | asparagīnskābe | 3656 | 10078 | 200–291–6 | 17.005 | | 2-aminobutāndiskābe | 1, 3 |

17.006 | 34 | 56–89–3 | cistīns | | 11747 | 200–296–3 | 17.006 | | | 1, 3, 5 |

17.007 | 34 | 56–85–9 | glutamīns | 3684 | | 200–292–1 | 17.007 | | | 1, 3 |

17.008 | 34 | 71–00–1 | L - histidīns | 3694 | | 200–745–3 | 17.008 | | | 1, 3 |

17.009 | 34 | 36901–87–8 | 4-hidroksiprolīns | | | | 17.009 | | 4-hidroksipirolidīn-2-karbonskābe | |

17.010 | 34 | 443–79–8 | D, L - izoleicīns | 3295 | 10127 | 207–139–8 | 17.010 | | 2-amino-3-metilpentānskābe | 1, 3 |

17.011 | 34 | 595–39–1 | izovalīns | | | | 17.011 | 2-amino-2-metilsviestskābe | 2-amino-2-metilbutānskābe | 1, 3 |

17.012 | 34 | 61–90–5 | L - leicīns | 3297 | 10482 | 200–522–0 | 17.012 | | | 1, 3 |

17.013 | 34 | 70–54–2 | DL - lizīns | 3847 | 11947 | 200–740–6 | 17.013 | | | 1, 3, 5 |

17.014 | 34 | 59–51–8 | L - metionīns | 3301 | 569 | 200–432–1 | 17.014 | D, L-metionīns; α-amino-γ-metiltio-n-sviestskabe; 2-amino-4-(metiltio)butānskābe | 2-amino-4-(metiltio)butānskābe | 1, 3 |

17.015 | 34 | 1115–84–0 | S-metilmetionīnsulfonija hlorīds | 3445 | 761 | 214–231–1 | 17.015 | U vitamīns; DL-(3-amino-3-karboksipropil)dimetilsulfonija hlorīds | | |

17.016 | 34 | 3184–13–2 | L-ornitīna monohlorhidrāts | | | 221–678–6 | 17.016 | | | 1, 3 |

17.017 | 34 | 150–30–1 | DL-fenilalanīns | 3726 | 10488 | 205–756–7 | 17.017 | | | 1, 3 |

17.018 | 34 | 63–91–2 | L-fenilalanīns | 3585 | 10488 | 200–568–1 | 17.018 | | | 1, 3 |

17.019 | 34 | 147–85–3 | L-prolīns | 3319 | 10490 | 205–702–2 | 17.019 | | pirolidīn-2-karbonskābe | 1, 3 |

17.020 | 34 | 302–84–1 | serīns | | | 206–130–6 | 17.020 | | 2-amino-3-hidroksipropānskābe | 1, 3 |

17.021 | 34 | 80–68–2 | treonīns | | | 201–300–6 | 17.021 | | 2-amino-3-hidroksibutānskābe | 1, 3 |

17.022 | 34 | 60–18–4 | L-tirozīns | 3736 | | 200–460–4 | 17.022 | | | 1, 3 |

17.023 | 34 | 516–06–3 | DL-valīns | 3444 | | 208–220–0 | 17.023 | | 2-amino-3-metilbutānskābe | 1, 3 |

17.024 | 34 | 302–72–7 | DL-alanīns | 3818 | 11729 | 206–126–4 | 17.024 | L-α-alanins; (S)-2-aminopropānskābe; L-α-aminopropionskabe; DL-alanīns; DL-2-aminopropānskābe | | 1, 3, 5 |

17.026 | 34 | 56–87–1 | L-lizīns | 3847 | 11947 | 200–294–2 | 17.026 | lizīns; (S)- 2,6-diaminoheksānskābe; α, ε-diaminokapronskabe | | 1, 3 |

17.027 | 34 | 63–68–3 | L-metionīns | 3301 | | 200–562–9 | 17.027 | | | 1, 3, 5 |

17.028 | 34 | 72–18–4 | L-valīns | 3444 | | 200–773–6 | 17.028 | | | 1, 3, 5 |

17.030 | 34 | 73–32–5 | L-izoleicīns | | | 200–798–2 | 17.030 | | | 1, 3 |

17.031 | 34 | 657–27–2 | L-lizīna monohlorhidrāts | | | | 17.031 | | | 1, 3, 5 |

17.032 | 34 | 52–89–1 | L-cisteīna hidrohlorīds | | 11746 | 200–157–7 | 17.032 | | | 1 |

17.033 | 34 | 52–90–4 | L-cisteīns | 3263 | 10464 | 200–158–2 | 17.033 | | | 1 |

17.034 | 34 | 56–40–6 | glicīns | 3287 | 11771 | 200–272–2 | 17.034 | | | 1 |

B DAĻA

AROMATIZĒJOŠAS VIELAS, KAS IZZIŅOTAS, PIEMĒROJOT REGULAS (EK) Nr. 2232/96 3. PANTA 2. PUNKTU, UN KURĀM IR PIEPRASĪTA RAŽOTĀJA INTELEKTUĀLĀ ĪPAŠUMA TIESĪBU AIZSARDZĪBA

Kods | Datums, kad Komisija saņēmusi paziņojumu |

CN003 | 17.10.1998. |

CN004 | 17.10.1998. |

CN009 | 17.10.1998. |

CN010 | 17.10.1998. |

CN012 | 17.10.1998. |

CN013 | 17.10.1998. |

CN014 | 17.10.1998. |

CN016 | 17.10.1998. |

CN019 | 17.10.1998. |

CN022 | 17.10.1998. |

CN023 | 17.10.1998. |

CN030 | 17.10.1998. |

CN031 | 17.10.1998. |

CN033 | 17.10.1998. |

CN035 | 17.10.1998. |

CN036 | 17.10.1998. |

CN037 | 17.10.1998. |

CN042 | 17.10.1998. |

CN045 | 17.10.1998. |

CN048 | 17.10.1998. |

CN049 | 17.10.1998. |

CN050 | 17.10.1998. |

CN052 | 17.10.1998. |

CN053 | 17.10.1998. |

CN054 | 17.10.1998. |

CN057 | 17.10.1998. |

CN058 | 30.10.1998. |

CN059 | 18.9.1998. |

CN060 | 26.10.1998. |

CN061 | 26.10.1998. |

CN064 | 3.2.1999. |

CN065 | 26.1.2001. |

"

[1] Chemical Abstracts Service.

[2] EuropeanInventory of Existing Chemical Substances.

[3] Council of Europe (Eiropas Padome).

[4] Flavour and Extract Manufacturers "Association of the US" (ASV aromatizētāju un ekstraktu ražotāju apvienība).

--------------------------------------------------

Top