EUR-Lex Access to European Union law

Back to EUR-Lex homepage

This document is an excerpt from the EUR-Lex website

Document 22011A0514(01)

Freihandelsabkommen zwischen der Europäischen Union und ihren Mitgliedstaaten einerseits und der Republik Korea andererseits

OJ L 127, 14.5.2011, p. 6–1343 (BG, ES, CS, DA, DE, ET, EL, EN, FR, IT, LV, LT, HU, MT, NL, PL, PT, RO, SK, SL, FI, SV)
Special edition in Croatian: Chapter 11 Volume 014 P. 6 - 1343

In force: This act has been changed. Current consolidated version: 01/08/2018

22011A0514(01)

Freihandelsabkommen zwischen der Europäischen Union und ihren Mitgliedstaaten einerseits und der Republik Korea andererseits

Amtsblatt Nr. L 127 vom 14/05/2011 S. 006 - 1343


Freihandelsabkommen

zwischen der Europäischen Union und ihren Mitgliedstaaten einerseits und der Republik Korea andererseits

DAS KÖNIGREICH BELGIEN,

DIE REPUBLIK BULGARIEN,

DIE TSCHECHISCHE REPUBLIK,

DAS KÖNIGREICH DÄNEMARK,

DIE BUNDESREPUBLIK DEUTSCHLAND,

DIE REPUBLIK ESTLAND,

IRLAND,

DIE HELLENISCHE REPUBLIK,

DAS KÖNIGREICH SPANIEN,

DIE FRANZÖSISCHE REPUBLIK,

DIE ITALIENISCHE REPUBLIK,

DIE REPUBLIK ZYPERN,

DIE REPUBLIK LETTLAND,

DIE REPUBLIK LITAUEN,

DAS GROSSHERZOGTUM LUXEMBURG,

DIE REPUBLIK UNGARN,

MALTA,

DAS KÖNIGREICH DER NIEDERLANDE,

DIE REPUBLIK ÖSTERREICH,

DIE REPUBLIK POLEN,

DIE PORTUGIESISCHE REPUBLIK,

RUMÄNIEN,

DIE REPUBLIK SLOWENIEN,

DIE SLOWAKISCHE REPUBLIK,

DIE REPUBLIK FINNLAND,

DAS KÖNIGREICH SCHWEDEN,

DAS VEREINIGTE KÖNIGREICH GROSSBRITANNIEN UND NORDIRLAND,

Vertragsparteien des Vertrags über die Europäische Union und des Vertrags über die Arbeitsweise der Europäischen Union, im Folgenden "Mitgliedstaaten der Europäischen Union" genannt,

und

DIE EUROPÄISCHE UNION

einerseits und

DIE REPUBLIK KOREA, im Folgenden "Korea" genannt,

andererseits —

IN ANERKENNUNG ihrer langjährigen, starken Partnerschaft auf der Grundlage der gemeinsamen Grundsätze und Wertvorstellungen, die sich in dem Rahmenabkommen widerspiegeln,

IN DEM WUNSCH, ihre engen Wirtschaftsbeziehungen im Einklang mit ihren allgemeinen Beziehungen weiter zu vertiefen, und in der Überzeugung, dass dieses Abkommen ein neues Klima schaffen wird, das der Entwicklung des Handels und der Investitionstätigkeit zwischen den Vertragsparteien förderlich ist,

IN DER ÜBERZEUGUNG, dass dieses Abkommen einen erweiterten und sicheren Markt für Waren und Dienstleistungen sowie ein stabiles und berechenbares Umfeld für Investitionen schaffen und damit die Wettbewerbsfähigkeit ihrer Unternehmen auf dem Weltmarkt verbessern wird,

IN BEKRÄFTIGUNG ihrer Bindung an die am 26. Juni 1945 in San Francisco unterzeichnete Charta der Vereinten Nationen und an die am 10. Dezember 1948 von der Generalversammlung der Vereinten Nationen angenommene Allgemeine Erklärung der Menschenrechte,

IN BEKRÄFTIGUNG ihres Eintretens für nachhaltige Entwicklung und überzeugt vom Beitrag des internationalen Handels zu nachhaltiger Entwicklung in ihrer wirtschaftlichen, sozialen und ökologischen Dimension unter Einbeziehung der wirtschaftlichen Entwicklung, der Eindämmung der Armut, der Gewährleistung produktiver Vollbeschäftigung und menschenwürdiger Arbeit für alle sowie des Schutzes und der Erhaltung der Umwelt und der natürlichen Ressourcen,

IN ANERKENNUNG des Rechts der Vertragsparteien, Maßnahmen zur Erreichung legitimer öffentlicher Ziele auf dem ihnen notwendig erscheinenden Schutzniveau zu ergreifen, wobei derartige Maßnahmen im Sinne dieses Abkommens nicht zu ungerechtfertigter Diskriminierung oder verdeckter Beschränkung des internationalen Handels dienen dürfen,

ENTSCHLOSSEN, die Transparenz für alle relevanten interessierten Parteien, einschließlich der Privatwirtschaft und der organisierten Zivilgesellschaft, zu fördern,

IN DEM WUNSCH, durch die Liberalisierung und Ausweitung des gegenseitigen Handels und der gegenseitigen Investitionen den Lebensstandard anzuheben, das Wirtschaftswachstum und die Stabilität zu fördern, neue Beschäftigungsmöglichkeiten zu schaffen und das Gemeinwohl zu fördern,

IN DEM BESTREBEN, klare und beiderseits vorteilhafte Regeln für Handel und Investitionen aufzustellen sowie die Beschränkungen der gegenseitigen Handels- und Investitionstätigkeit zu reduzieren oder aufzuheben,

ENTSCHLOSSEN, zur harmonischen Entwicklung und Ausweitung des Welthandels durch Beseitigung von Handelsschranken mittels dieses Abkommens beizutragen und den Aufbau neuer Handels- oder Investitionsschranken, die den Nutzen dieses Abkommens verringern könnten, zwischen ihren Gebieten zu vermeiden,

IN DEM WUNSCH, die Entwicklung und Durchsetzung des Arbeits- und Umweltrechts und entsprechender Politikvorhaben zu untermauern, grundlegende Arbeitnehmerrechte und nachhaltige Entwicklung zu fördern und dieses Abkommen in einer Weise umzusetzen, die mit diesen Zielen im Einklang ist und

GESTÜTZT auf ihre jeweiligen Rechte und Pflichten aus dem Übereinkommen von Marrakesch zur Errichtung der Welthandelsorganisation vom 15. April 1994 (im Folgenden "WTO-Übereinkommen" genannt) und aus anderen multilateralen, regionalen und bilateralen Übereinkünften und Vereinbarungen, bei denen sie Vertragspartei sind —

SIND WIE FOLGT ÜBEREINGEKOMMEN:

KAPITEL EINS

ZIELE UND ALLGEMEINE BEGRIFFSBESTIMMUNGEN

Artikel 1.1

Ziele

(1) Die Vertragsparteien errichten eine Freihandelszone für Waren, Dienstleistungen und Niederlassung und legen entsprechende Regeln nach Maßgabe dieses Abkommens fest.

(2) Die Ziele dieses Abkommens sind:

a) beiderseitige Liberalisierung und Erleichterung des Warenverkehrs im Einklang mit Artikel XXIV des Allgemeinen Zoll- und Handelsabkommens 1994 (im Folgenden "GATT 1994" genannt),

b) beiderseitige Liberalisierung und Erleichterung des Handels mit Dienstleistungen und Investitionen im Einklang mit Artikel V des Allgemeinen Übereinkommens über den Handel mit Dienstleistungen (im Folgenden "GATS" genannt),

c) Förderung des Wettbewerbs in den Volkswirtschaften der Vertragsparteien, insbesondere in Bezug auf die gegenseitigen Wirtschaftsbeziehungen,

d) weitere Liberalisierung der Märkte für das öffentliche Beschaffungswesen nach dem Grundsatz der Gegenseitigkeit,

e) angemessener und wirksamer Schutz der Rechte des geistigen Eigentums,

f) Förderung der harmonischen Entwicklung und Ausweitung des Welthandels durch Beseitigung von Handelsschranken und Schaffung von Rahmenbedingungen, die der Verstärkung der Investitionsströme dienlich sind,

g) Festlegung auf die Weiterentwicklung des internationalen Handels in dem Bestreben, dem Ziel einer nachhaltigen Entwicklung näher zu kommen und zu gewährleisten, dass die Vertragsparteien dieses Ziel auf allen Ebenen ihrer Handelsbeziehungen zur Geltung bringen, in dem Bewusstsein, dass nachhaltige Entwicklung ein übergeordnetes Ziel darstellt, und

h) Förderung ausländischer Direktinvestitionen ohne Abschwächung oder Reduzierung der Normen in den Bereichen Umweltschutz, Arbeitsrecht oder Gesundheitsschutz und Sicherheit am Arbeitsplatz bei der Anwendung und Durchsetzung des Arbeits- und Umweltrechts durch die Vertragsparteien.

Artikel 1.2

Allgemeine Begriffsbestimmungen

In diesem Abkommen gelten folgende Begriffsbestimmungen:

"Vertragsparteien" sind die Europäische Union oder ihre Mitgliedstaaten oder die Europäische Union und ihre Mitgliedstaaten im Rahmen ihrer sich aus dem Vertrag über die Europäische Union und dem Vertrag über die Arbeitsweise der Europäischen Union ergebenden Zuständigkeiten (im Folgenden "EU-Vertragspartei" genannt) einerseits und Korea andererseits,

"Rahmenabkommen" ist das Rahmenabkommen über den Handel und die Zusammenarbeit zwischen der Europäischen Gemeinschaft und ihren Mitgliedstaaten einerseits und der Republik Korea andererseits, das am 28. Oktober 1996 in Luxemburg unterzeichnet wurde, oder jedes Abkommen, das dieses Rahmenabkommen ändert oder ersetzt, und

"Zollabkommen" ist das Abkommen zwischen der Europäischen Gemeinschaft und der Republik Korea über Zusammenarbeit und gegenseitige Amtshilfe im Zollbereich, das am 10. April 1997 in Brüssel unterzeichnet wurde.

KAPITEL ZWEI

INLÄNDERBEHANDLUNG UND MARKTZUGANG FÜR WAREN

ABSCHNITT A

Gemeinsame Bestimmungen

Artikel 2.1

Objective

Während einer Übergangszeit, die mit dem Inkrafttreten dieses Abkommens beginnt, liberalisieren die Vertragsparteien nach Maßgabe dieses Abkommens und im Einklang mit Artikel XXIV des GATT 1994 beiderseitig schrittweise den Warenhandel.

Artikel 2.2

Geltungsbereich

Dieses Kapitel gilt für den Warenhandel [1] zwischen den Vertragsparteien.

Artikel 2.3

Zölle

Für die Zwecke dieses Kapitels sind Zölle Abgaben und Belastungen jeder Art, die bei oder im Zusammenhang mit der Einfuhr von Waren erhoben werden, einschließlich Ergänzungsabgaben und Zuschlägen in jeder Form, die bei oder im Zusammenhang mit einer solchen Einfuhr [2] erhoben werden. Zölle sind jedoch nicht:

a) einer inländischen Abgabe gleichwertige Belastungen, soweit sie mit Artikel 2.8 vereinbar sind und gleichartigen inländischen Waren oder solchen Waren auferlegt werden, aus denen die eingeführte Ware ganz oder teilweise hergestellt ist,

b) Zölle, die nach den Rechtsvorschriften einer Vertragspartei erhoben werden, soweit sie mit Kapitel Drei (Handelspolitische Schutzmaßnahmen) vereinbar sind,

c) Gebühren oder andere Belastungen, die nach den Rechtsvorschriften einer Vertragspartei erhoben werden, soweit sie mit Artikel 2.10 vereinbar sind, oder

d) Zölle, die nach den Rechtsvorschriften einer Vertragspartei erhoben werden, soweit sie mit Artikel 5 des Übereinkommens über die Landwirtschaft in Anhang 1A des WTO-Übereinkommens (im Folgenden "Übereinkommen über die Landwirtschaft" genannt) vereinbar sind.

Artikel 2.4

Einreihung der Waren

Für die Einreihung der Waren im Handel zwischen den Vertragsparteien gilt die Zolltarifnomenklatur der jeweiligen Vertragspartei, ausgelegt im Einklang mit dem Harmonisierten System des am 14. Juni 1983 in Brüssel geschlossenen Internationalen Übereinkommens über das harmonisierte System zur Bezeichnung und Codierung der Waren (im Folgenden "HS" genannt).

ABSCHNITT B

Abschaffung der Zölle

Artikel 2.5

Abschaffung der Zölle

(1) Sofern dieses Abkommen nichts anderes bestimmt, schafft jede Vertragspartei ihre Zölle auf Ursprungswaren der anderen Vertragspartei nach dem Stufenplan in Anhang 2-A ab.

(2) Für jede Ware gilt als Basiszollsatz, von dem aus die schrittweisen Zollsenkungen nach Absatz 1 vorgenommen werden, der jeweils im Stufenplan in Anhang 2-A genannte Satz.

(3) Senkt eine Vertragspartei nach Inkrafttreten dieses Abkommens ihren geltenden Meistbegünstigungszollsatz, so gilt dieser Zollsatz für den unter dieses Abkommen fallenden Handel, solange er niedriger ist als der nach dem entsprechenden Stufenplan in Anhang 2-A errechnete Zollsatz.

(4) Drei Jahre nach Inkrafttreten dieses Abkommens konsultieren die Vertragsparteien einander auf Ersuchen einer Vertragspartei, um zu erwägen, die Abschaffung von Zöllen auf gegenseitige Einfuhren zu beschleunigen und den Umfang der Abschaffung auszuweiten. Beschließen die Vertragsparteien im Handelsausschuss nach derartigen Konsultationen, die Abschaffung von Zöllen auf eine Ware zu beschleunigen oder den Umfang der Abschaffung auszuweiten, dann ersetzt dieser Beschluss den Zollsatz oder die Abbaustufe, der bzw. die nach dem entsprechenden Stufenplan in Anhang 2-A für diese Ware festgelegt wurde.

Artikel 2.6

Stillhalteregelung

Sofern dieses Abkommen nichts anderes bestimmt, wobei dies die ausdrücklichen Festlegungen im Stufenplan der jeweiligen Vertragspartei in Anhang 2-A einschließt, kann keine Vertragspartei bei einer Ursprungsware der anderen Vertragspartei einen geltenden Zoll erhöhen oder einen neuen Zoll einführen. Dies schließt nicht aus, dass eine Vertragspartei einen Zoll nach einer einseitigen Absenkung auf die in ihrem Stufenplan in Anhang 2-A vorgesehene Höhe anhebt.

Artikel 2.7

Anwendung und Umsetzung von Zollkontingenten

(1) Jede Vertragspartei sorgt für die Anwendung und Umsetzung der Zollkontingente in Anlage 2-A-1 ihres in Anhang 2-A enthaltenen Stufenplans im Einklang mit Artikel XIII des GATT 1994 und dessen Anmerkungen zur Auslegung sowie dem Übereinkommen über Einfuhrlizenzverfahren in Anhang 1A des WTO-Übereinkommens.

(2) Jede Vertragspartei stellt sicher, dass:

a) ihre Verfahren zur Anwendung ihrer Zollkontingente transparent, der Öffentlichkeit zugänglich, aktuell und diskriminierungsfrei sind, den Marktsignalen folgen, den Handel minimal beeinträchtigen und den Präferenzen der Endverwender gerecht werden;

b) jede Person einer Vertragspartei, die die Rechts- und Verwaltungsvorschriften der einführenden Vertragspartei erfüllt, das Recht hat, die Gewährung eines Zollkontingents durch die Vertragspartei zu beantragen und dafür in Betracht gezogen zu werden. Sofern die Vertragsparteien nicht durch Beschluss des Ausschusses "Warenhandel" etwas anderes vereinbaren, haben Verarbeiter, Einzelhändler, Restaurants, Hotels, Lebensmittelversorger oder jede andere Person das Recht, die Gewährung eines Zollkontingents durch die Vertragspartei zu beantragen und dafür in Betracht gezogen zu werden. Etwaige Gebühren für Dienstleistungen im Zusammenhang mit der Beantragung eines Zollkontingents müssen sich auf die tatsächlichen Kosten der Dienstleistung beschränken;

c) sie, außer in den in Anlage 2-A-1 ihres Stufenplans in Anhang 2-A genannten Fällen, davon absieht, einer Herstellergruppe Teile von Zollkontingenten zu gewähren, die Gewährung eines Zollkontingents an den Erwerb inländischer Waren zu knüpfen oder die Gewährung eines Zollkontingents auf Verarbeiter zu beschränken, und

d) sie Zollkontingente in wirtschaftlich rentablen Transportmengen und weitestmöglich in den von den Einführern verlangten Mengen gewährt. Vorbehaltlich anderer Bestimmungen für das einzelne Zollkontingent und der anwendbaren Tariflinie in Anlage 2-A-1 des Stufenplans einer Vertragspartei in Anhang 2-A gilt die Gewährung des Zollkontingents für jedes Erzeugnis oder jede Mischung von Erzeugnissen innerhalb eines bestimmten Zollkontingents unabhängig von der Spezifikation oder der Güte des Erzeugnisses oder der Erzeugnisse, sie darf ferner nicht vom Endverwendungszweck oder der Verpackungsgröße eines Erzeugnisses oder einer Mischung von Erzeugnissen abhängig gemacht werden.

(3) Jede Vertragspartei benennt die Stellen, die für die Anwendung ihrer Zollkontingente zuständig sind.

(4) Jede Vertragspartei bemüht sich nach besten Kräften, ihre Zollkontingente so anzuwenden, dass Einführer die Zollkontingentsmengen voll ausschöpfen können.

(5) Die Vertragsparteien sehen davon ab, die Beantragung oder Inanspruchnahme gewährter Zollkontingente von der Wiederausfuhr einer Ware abhängig zu machen.

(6) Auf schriftliches Ersuchen einer Vertragspartei konsultieren die Vertragsparteien einander über die Anwendung der Zollkontingente seitens einer Vertragspartei.

(7) Sofern Anlage 2-A-1 ihres Stufenplans in Anhang 2-A nichts anderes bestimmt, stellt jede Vertragspartei den Antragstellern die gesamte in dieser Anlage festgelegte Zollkontingentsmenge wie folgt bereit: im ersten Jahr am Tag des Inkrafttretens dieses Abkommens, danach jeweils am Jahrestag seines Inkrafttretens. Im laufenden Jahr veröffentlicht die für die Anwendung zuständige Behörde der einführenden Vertragspartei auf ihrer diesbezüglichen öffentlich zugänglichen Internetseite unverzüglich den Grad der Inanspruchnahme der jeweiligen Zollkontingente und die noch verbleibenden Mengen.

ABSCHNITT C

Nichttarifäre Maßnahmen

Artikel 2.8

Inländerbehandlung

Jede Vertragspartei gewährt den Waren der anderen Vertragspartei Inländerbehandlung nach Artikel III des GATT 1994, einschließlich seiner Anmerkungen zur Auslegung. Zu diesem Zweck sind Artikel III des GATT 1994 und seine Anmerkungen zur Auslegung mutatis mutandis Bestandteil dieses Abkommens.

Artikel 2.9

Einfuhr- und Ausfuhrbeschränkungen

Die Vertragsparteien dürfen nach Artikel XI des GATT 1994 und seinen Anmerkungen zur Auslegung bei der Einfuhr einer Ware aus dem Gebiet der anderen Vertragspartei oder bei der Ausfuhr einer Ware oder ihrem Verkauf zwecks Ausfuhr in das Gebiet der anderen Vertragspartei außer Zöllen, Abgaben und sonstigen Belastungen keine Verbote oder Beschränkungen erlassen oder beibehalten. Zu diesem Zweck sind Artikel XI des GATT 1994 und seine Anmerkungen zur Auslegung mutatis mutandis Bestandteil dieses Abkommens.

Artikel 2.10

Gebühren und sonstige Belastungen auf Einfuhren

Jede Vertragspartei stellt sicher, dass alle bei oder im Zusammenhang mit der Einfuhr erhobenen Gebühren und Belastungen jeglicher Art (soweit es sich nicht um Zölle oder nach Artikel 2.3 Buchstaben a, b und d von der Begriffsbestimmung für Zölle ausgenommene Aufschläge handelt) sich dem Betrag nach ungefähr auf die Kosten der erbrachten Dienstleistungen beschränken, nicht auf Wertbasis berechnet werden und weder einen mittelbaren Schutz für inländische Waren noch eine Besteuerung der Einfuhr zur Erzielung von Einnahmen darstellen.

Artikel 2.11

Zölle, Abgaben, Gebühren und sonstige Belastungen auf Ausfuhren

Die Vertragsparteien dürfen keine Zölle, Abgaben, Gebühren oder sonstigen Belastungen auf oder im Zusammenhang mit der Ausfuhr von Waren in die andere Vertragspartei und keine inländischen Abgaben, Gebühren oder Belastungen auf in die andere Vertragspartei ausgeführte Waren beibehalten oder einführen, die über das hinausgehen, was für gleichartige, zum inländischen Verkauf bestimmte Waren erhoben wird.

Artikel 2.12

Zollwertermittlung

Das Übereinkommen zur Durchführung des Artikels VII des Allgemeinen Zoll- und Handelsabkommens 1994 in Anhang 1A des WTO-Übereinkommens (im Folgenden "Zollwertübereinkommen" genannt), ist mutatis mutandis Bestandteil dieses Abkommens. Die Vorbehalte und Möglichkeiten nach Artikel 20 des Zollwertübereinkommens und seines Anhangs III Absätze 2 bis 4 finden keine Anwendung.

Artikel 2.13

Staatliche Handelsunternehmen

(1) Die Vertragsparteien bekräftigen ihre Rechte und Pflichten aus Artikel XVII des GATT 1994, aus dessen Anmerkungen zur Auslegung sowie aus der Vereinbarung zur Auslegung des Artikels XVII des Allgemeinen Zoll- und Handelsabkommens 1994 in Anhang 1A des WTO-Übereinkommens, die mutatis mutandis Bestandteil dieses Abkommens sind.

(2) Ersuchen die Vertragsparteien einander um Einzelfallauskünfte über staatliche Handelsunternehmen, über deren Betriebsweise und über die Auswirkungen ihrer Tätigkeit auf den bilateralen Handel, beachtet die ersuchte Vertragspartei das Gebot größtmöglicher Transparenz unbeschadet des Artikels XVII Absatz 4 Buchstabe d des GATT 1994 über vertrauliche Informationen.

Artikel 2.14

Abschaffung sektoraler nichttarifärer Maßnahmen

(1) Die Vertragsparteien erfüllen ihre Verpflichtungen bezüglich sektorspezifischer nichttarifärer warenbezogener Maßnahmen im Einklang mit den in den Anhängen 2-B bis 2-E festgelegten Verpflichtungen.

(2) Drei Jahre nach Inkrafttreten dieses Abkommens konsultieren die Vertragsparteien einander auf Ersuchen einer Vertragspartei, um die Ausweitung des Umfangs ihrer Verpflichtungen bezüglich sektorspezifischer nichttarifärer warenbezogener Maßnahmen zu erwägen.

ABSCHNITT D

Besondere Ausnahmen in Bezug auf Waren

Artikel 2.15

Allgemeine Ausnahmen

(1) Die Vertragsparteien bekräftigen, dass ihre Rechte und Pflichten aus Artikel XX des GATT 1994 und dessen Anmerkungen zur Auslegung, die mutatis mutandis Bestandteil dieses Abkommens sind, sich auf den von diesem Abkommen betroffenen Warenhandel erstrecken.

(2) Die Vertragsparteien vereinbaren, dass die Vertragspartei, die eine in Artikel XX Buchstaben i und j des GATT 1994 vorgesehene Maßnahme zu treffen beabsichtigt, der anderen Vertragspartei vor Einführung dieser Maßnahme alle zweckdienlichen Angaben zur Verfügung stellt, um eine für die Vertragsparteien annehmbare Lösung zu ermöglichen. Die Vertragsparteien können sich auf die für die Behebung der Schwierigkeiten erforderlichen Maßnahmen verständigen. Wird binnen 30 Tagen nach Bereitstellung derartiger Angaben kein Einvernehmen erzielt, so kann die Vertragspartei die nach diesem Artikel vorgesehenen Maßnahmen bei der betreffenden Ware anwenden. Schließen besondere und kritische Umstände, die ein sofortiges Eingreifen erfordern, eine vorherige Unterrichtung oder Prüfung aus, so kann die Vertragspartei, die die Maßnahmen zu treffen beabsichtigt, unverzüglich die zur Abhilfe notwendigen Sicherungsmaßnahmen treffen; darüber hat sie die andere Vertragspartei umgehend zu unterrichten.

ABSCHNITT E

Institutionelle Bestimmungen

Artikel 2.16

Ausschuss "Warenhandel"

(1) Der nach Artikel 15.2 Absatz 1 (Sonderausschüsse) eingesetzte Ausschuss "Warenhandel", in dem beide Vertragsparteien vertreten sind, tritt auf Ersuchen einer Vertragspartei oder des Handelsausschusses zusammen, um sich mit allen Fragen zu befassen, die sich aus diesem Kapitel ergeben.

(2) Der Ausschuss hat unter anderem die Aufgabe,

a) den Warenhandel zwischen den Vertragsparteien zu fördern; dies umfasst auch Konsultationen über die Beschleunigung und umfangmäßige Ausdehnung des Zollabbaus, über die Erweiterung des Umfangs der Verpflichtungen bezüglich nichttarifärer Maßnahmen im Rahmen dieses Abkommens sowie gegebenenfalls über andere Fragen, und

b) sich mit tarifären und nichttarifären Maßnahmen beim Warenhandel zwischen den Vertragsparteien zu befassen und diesbezügliche Fragen gegebenenfalls dem Handelsausschuss zu unterbreiten,

sofern diese Aufgaben nicht den einschlägigen Arbeitsgruppen übertragen wurden, die nach Artikel 15.3 Absatz 1 (Arbeitsgruppen) eingerichtet wurden.

Artikel 2.17

Besondere Bestimmungen über die Verwaltungszusammenarbeit

(1) Die Vertragsparteien sind sich darin einig, dass die Zusammenarbeit der Verwaltungen für die Durchführung und Überwachung der nach diesem Kapitel eingeräumten Zollpräferenzbehandlung von entscheidender Bedeutung ist, und bekräftigen ihre Zusage, Unregelmäßigkeiten und Betrug im Zusammenhang mit Zöllen und diesbezüglichen Fragen zu bekämpfen.

(2) Stellt eine Vertragspartei anhand objektiver Informationen eine Verweigerung der Verwaltungszusammenarbeit und/oder Unregelmäßigkeiten oder Betrug fest, so tritt auf ihr Ersuchen binnen 20 Tagen der Zollausschuss zusammen, um umgehend nach einer Lösung zu suchen. Die Konsultationen im Zollausschuss erfüllen dieselbe Funktion wie Konsultationen nach Artikel 14.3 (Konsultationen).

KAPITEL DREI

HANDELSPOLITISCHE SCHUTZMASSNAHMEN

ABSCHNITT A

Bilaterale Schutzmaßnahmen

Artikel 3.1

Anwendung einer bilateralen Schutzmaßnahme

(1) Werden Ursprungswaren einer Vertragspartei infolge der Senkung oder Abschaffung eines Zolls im Rahmen dieses Abkommens in absoluten Zahlen oder im Verhältnis zur inländischen Produktion in derart erhöhten Mengen und unter solchen Bedingungen in das Gebiet der anderen Vertragspartei eingeführt, dass einem inländischen Wirtschaftszweig, der gleichartige oder unmittelbar konkurrierende Waren herstellt, eine bedeutende Schädigung entsteht oder zu entstehen droht, dann kann die einführende Vertragspartei unter den Bedingungen und nach den Verfahren dieses Abschnitts die in Absatz 2 aufgeführten Maßnahmen ergreifen.

(2) Die einführende Vertragspartei kann eine bilaterale Schutzmaßnahme mit folgender Wirkung ergreifen:

a) Aussetzung der nach diesem Abkommen vorgesehenen weiteren Senkung des Zollsatzes für die betreffende Ware oder

b) Anhebung des betreffenden Warenzolls bis zur Höhe des niedrigeren der beiden folgenden Sätze:

i) zum Zeitpunkt der Ergreifung der Maßnahme geltender Meistbegünstigungszollsatz für die betreffende Ware oder

ii) im Stufenplan in Anhang 2-A (Abschaffung der Zölle) genannter Basiszollsatz nach Artikel 2.5 Absatz 2 (Abschaffung der Zölle).

Artikel 3.2

Bedingungen und Beschränkungen

(1) Die Vertragsparteien notifizieren einander schriftlich die Einleitung einer Untersuchung nach Absatz 2 und konsultieren einander so früh wie möglich vor Anwendung einer bilateralen Schutzmaßnahme, damit die Untersuchungsergebnisse geprüft werden können und ein Meinungsaustausch über die Maßnahme möglich ist.

(2) Eine Vertragspartei führt eine bilaterale Schutzmaßnahme erst ein, wenn ihre zuständigen Behörden eine Untersuchung nach Artikel 3 und Artikel 4 Absatz 2 Buchstabe c des Übereinkommens über Schutzmaßnahmen in Anhang 1A des WTO-Übereinkommens (im Folgenden "Übereinkommen über Schutzmaßnahmen" genannt) durchgeführt haben; zu diesem Zweck sind Artikel 3 und Artikel 4 Absatz 2 Buchstabe c des Übereinkommens über Schutzmaßnahmen mutatis mutandis Bestandteil dieses Abkommens.

(3) Bei der Untersuchung nach Absatz 2 erfüllt die Vertragspartei die Auflagen von Artikel 4 Absatz 2 Buchstabe a des Übereinkommens über Schutzmaßnahmen; zu diesem Zweck ist Artikel 4 Absatz 2 Buchstabe a des Übereinkommens über Schutzmaßnahmen mutatis mutandis Bestandteil dieses Abkommens.

(4) Jede Vertragspartei stellt sicher, dass ihre zuständigen Behörden die Untersuchung binnen eines Jahres nach dem Tag ihrer Einleitung abschließen.

(5) Die Vertragsparteien dürfen eine bilaterale Schutzmaßnahme nur mit folgenden Einschränkungen ergreifen:

a) Die Maßnahme darf nur in dem Maße und nur so lange angewendet werden, wie dies zur Vermeidung oder Beseitigung einer bedeutenden Schädigung oder zur Erleichterung der Anpassung erforderlich ist,

b) die Maßnahme darf nicht länger als zwei Jahre angewendet werden, es sei denn, die Frist wird um bis zu zwei weitere Jahre verlängert, nachdem die zuständigen Behörden der einführenden Vertragspartei nach den Verfahren dieses Artikels festgestellt haben, dass die Maßnahme zur Vermeidung oder Beseitigung einer bedeutenden Schädigung oder zur Erleichterung der Anpassung weiterhin erforderlich ist und der Wirtschaftszweig sich nachweislich anpasst, wobei die Gesamtgeltungsdauer der Schutzmaßnahme, die die ursprüngliche Geltungsdauer und eine etwaige Verlängerung einschließt, vier Jahre nicht überschreiten darf, und

c) die Maßnahme darf nur mit Zustimmung der anderen Vertragspartei über das Ende der Übergangsfrist hinaus gelten.

(6) Wenn eine Vertragspartei eine bilaterale Schutzmaßnahme beendet, gilt der Zollsatz, der nach ihrem Stufenplan in Anhang 2-A (Abschaffung der Zölle) gegolten hätte, wäre die Maßnahme nicht ergriffen worden.

Artikel 3.3

Vorläufige Maßnahmen

In einer kritischen Lage, in der eine Verzögerung einen schwer wiedergutzumachenden Schaden verursachen würde, kann eine Vertragspartei eine vorläufige bilaterale Schutzmaßnahme ergreifen, wenn aufgrund einer vorläufigen Feststellung schlüssige Beweise dafür vorliegen, dass die Einfuhren einer Ware mit Ursprung in der anderen Vertragspartei infolge der Senkung oder Abschaffung eines Zolls im Rahmen dieses Abkommens gestiegen sind und dass dem inländischen Wirtschaftszweig durch diese Einfuhren eine bedeutende Schädigung entsteht oder zu entstehen droht. Die Geltungsdauer einer vorläufigen Maßnahme ist auf höchstens 200 Tage beschränkt; während dieses Zeitraums erfüllt die Vertragspartei die Auflagen des Artikels 3.2 Absätze 2 und 3. Die Vertragspartei erstattet unverzüglich etwaige Zollerhöhungen, wenn die Untersuchung nach Artikel 3.2 Absatz 2 ergibt, dass die Voraussetzungen des Artikels 3.1 nicht erfüllt sind. Die Dauer einer vorläufigen Maßnahme wird auf die Gesamtgeltungsdauer nach Artikel 3.2 Absatz 5 Buchstabe b angerechnet.

Artikel 3.4

Ausgleich

(1) Eine Vertragspartei, die eine bilaterale Schutzmaßnahme ergreift, konsultiert die andere Vertragspartei, um ein Einvernehmen zu erzielen über einen angemessenen handelsliberalisierenden Ausgleich mittels Zugeständnissen, die ihrem Wesen nach eine gleichwertige Wirkung auf den Handel haben oder dem Wert der zusätzlichen Zölle entsprechen, die sich aus der Schutzmaßnahme voraussichtlich ergeben. Die Vertragspartei sorgt dafür, dass die entsprechenden Konsultationen binnen 30 Tagen nach Inkraftsetzung der bilateralen Schutzmaßnahme stattfinden können.

(2) Wenn die Konsultationen nach Absatz 1 nicht binnen 30 Tagen nach ihrem Beginn zu einem Einvernehmen über einen handelsliberalisierenden Ausgleich führen, kann die Vertragspartei, deren Waren Gegenstand der Schutzmaßnahme sind, ihrem Wesen nach gleichwertige Zugeständnisse aussetzen, die sie der Vertragspartei eingeräumt hat, welche die Schutzmaßnahme ergriffen hat.

(3) Sofern die Schutzmaßnahme den Bestimmungen dieses Abkommens entspricht, wird in den ersten 24 Monaten nach Inkraftsetzung einer bilateralen Schutzmaßnahme auf die Ausübung des Aussetzungsrechts nach Absatz 2 verzichtet.

Artikel 3.5

Begriffsbestimmungen

Für die Zwecke dieses Abschnitts gelten folgende Begriffsbestimmungen:

Bedeutende Schädigung und drohende bedeutende Schädigung sind im Sinne von "ernsthafter Schaden" und "drohender ernsthafter Schaden" in Artikel 4 Absatz 1 Buchstaben a und b des Übereinkommens über Schutzmaßnahmen zu verstehen. Zu diesem Zweck sind Artikel 4 Absatz 1 Buchstaben a und b mutatis mutandis Bestandteil dieses Abkommens, und

Übergangszeit ist je nach Ware der Zeitraum vom Tag des Inkrafttretens dieses Abkommens bis 10 Jahre nach Abschluss der Senkung oder Abschaffung des Zolls für die betreffende Ware.

ABSCHNITT B

Landwirtschaftsbezogene Schutzmaßnahmen

Artikel 3.6

Landwirtschaftsbezogene Schutzmaßnahmen

(1) Eine Vertragspartei kann im Einklang mit den Absätzen 2 bis 8 einen höheren Einfuhrzoll auf ein in ihrem Stufenplan in Anhang 3 aufgeführtes landwirtschaftliches Ursprungserzeugnis erheben, wenn der Gesamtumfang der Einfuhren dieses Erzeugnisses in einem beliebigen Jahr die in ihrem Stufenplan in Anhang 3 festgelegte Auslösungsschwelle überschreitet.

(2) Der in Absatz 1 genannte Zoll darf den niedrigsten der folgenden Sätze nicht übersteigen: den geltenden Meistbegünstigungszollsatz oder den am Tag vor dem Inkrafttreten dieses Abkommens geltenden Meistbegünstigungszollsatz oder den im Stufenplan der Vertragspartei in Anhang 3 aufgeführten Zollsatz.

(3) Die Zölle, die jede Vertragspartei nach Absatz 1 erhebt, werden nach Maßgabe ihres jeweiligen Stufenplans in Anhang 3 festgesetzt.

(4) Die Vertragsparteien dürfen für dasselbe Erzeugnis nicht gleichzeitig eine landwirtschaftsbezogene Schutzmaßnahme nach diesem Artikel und eine der folgenden Maßnahmen ergreifen oder beibehalten:

a) eine bilaterale Schutzmaßnahme nach Artikel 3.1,

b) eine Maßnahme nach Artikel XIX des GATT 1994 und nach dem Übereinkommen über Schutzmaßnahmen oder

c) eine besondere Schutzmaßnahme nach Artikel 5 des Übereinkommens über die Landwirtschaft.

(5) Die Vertragsparteien führen etwaige landwirtschaftsbezogene Schutzmaßnahmen in transparenter Weise ein. Binnen 60 Tagen nach Ergreifung einer landwirtschaftsbezogenen Schutzmaßnahme benachrichtigt die ergreifende Vertragspartei die andere Vertragspartei schriftlich und stellt ihr die für die Ergreifung maßgebenden Daten zur Verfügung. Auf schriftliches Ersuchen der ausführenden Vertragspartei konsultieren die Vertragsparteien einander über die Anwendung der Maßnahme.

(6) Die Umsetzung und Durchführung dieses Artikels kann in dem in Artikel 2.16 (Ausschuss "Warenhandel") genannten Ausschuss "Warenhandel" erörtert und überarbeitet werden.

(7) Eine Vertragspartei darf in folgenden Fällen keine landwirtschaftsbezogene Schutzmaßnahme für ein landwirtschaftliches Ursprungserzeugnis ergreifen oder beibehalten:

a) wenn die Frist abgelaufen ist, die in den Bestimmungen für landwirtschaftsbezogene Schutzmaßnahmen in ihrem Stufenplan in Anhang 3 festgesetzt ist, oder

b) wenn die Maßnahme den Kontingentszollsatz für ein Erzeugnis erhöht, das nach Anlage 2-A-1 ihres Stufenplans in Anhang 2-A (Abschaffung der Zölle) einem Zollkontingent unterliegt.

(8) Lieferungen der betreffenden Erzeugnisse, die sich aufgrund eines Vertrags, der noch vor Einführung eines Zusatzzolls nach den Absätzen 1 bis 4 geschlossen wurde, auf dem Transport befinden, sind von dem Zusatzzoll befreit, sofern sie im darauf folgenden Jahr auf das Einfuhrvolumen der betreffenden Erzeugnisse zwecks Auslösung der Anwendung des Absatzes 1 in dem betreffenden Jahr angerechnet werden können.

ABSCHNITT C

Generelle Schutzmaßnahmen

Artikel 3.7

Generelle Schutzmaßnahmen

(1) Jede Vertragspartei behält ihre Rechte und Pflichten aus Artikel XIX des GATT 1994 und aus dem Übereinkommen über Schutzmaßnahmen. Soweit dieser Artikel nichts anderes bestimmt, erwachsen den Vertragsparteien aus diesem Abkommen keine zusätzlichen Rechte oder Pflichten in Bezug auf Maßnahmen nach Artikel XIX des GATT 1994 und nach dem Übereinkommen über Schutzmaßnahmen.

(2) Die Vertragspartei, die Schutzmaßnahmen beabsichtigt, erteilt der anderen Vertragspartei, sofern diese ein wesentliches Interesse hat, auf ihr Ersuchen unverzüglich, ad hoc und schriftlich alle sachdienlichen Auskünfte über die Einleitung einer auf Schutzmaßnahmen gerichteten Untersuchung sowie über die vorläufigen und endgültigen Untersuchungsergebnisse.

(3) Für die Zwecke dieses Artikels hat eine Vertragspartei ein wesentliches Interesse, wenn sie im vorangegangenen Dreijahreszeitraum gemessen am absoluten Volumen oder am Wert zu den fünf größten Lieferanten der eingeführten Waren gehörte.

(4) Die Vertragsparteien dürfen die folgenden Maßnahmen nicht gleichzeitig bei derselben Ware anwenden:

a) eine bilaterale Schutzmaßnahme nach Artikel 3.1 und

b) eine Maßnahme nach Artikel XIX des GATT 1994 und nach dem Übereinkommen über Schutzmaßnahmen.

(5) Die Vertragsparteien dürfen sich in Fragen, die sich aus diesem Abschnitt ergeben, nicht auf Kapitel Vierzehn (Streitbeilegung) berufen.

ABSCHNITT D

Antidumping- und Ausgleichszölle

Artikel 3.8

Allgemeine Bestimmungen

(1) Sofern dieses Kapitel nichts anderes bestimmt, behalten die Vertragsparteien ihre Rechten und Pflichten aus Artikel VI des GATT 1994, aus dem Übereinkommen zur Durchführung des Artikels VI des Allgemeinen Zoll- und Handelsabkommens 1994 in Anhang 1A des WTO-Übereinkommens (im Folgenden "Antidumping-Übereinkommen" genannt) und aus dem Übereinkommen über Subventionen und Ausgleichsmaßnahmen in Anhang 1A des WTO-Übereinkommens (im Folgenden "Subventionsübereinkommen" genannt).

(2) Die Vertragsparteien sind sich darin einig, dass Antidumping- und Ausgleichszölle in völliger Übereinstimmung mit den einschlägigen WTO-Auflagen eingesetzt werden und sich auf faire und transparente Verfahrensgrundsätze für Ursprungswaren der anderen Vertragspartei stützen sollten. Zu diesem Zweck sorgen die Vertragsparteien unmittelbar nach der Einführung vorläufiger Maßnahmen und unter allen Umständen vor der endgültigen Feststellung dafür, dass alle wesentlichen Tatsachen und Erwägungen, die die Grundlage für den Maßnahmenbeschluss bilden, vollständig und aussagekräftig bekannt gegeben werden, unbeschadet des Artikels 6 Absatz 5 des Antidumping-Übereinkommens und des Artikels 12 Absatz 4 des Subventionsübereinkommens. Die Bekanntgabe hat schriftlich zu erfolgen und muss interessierten Parteien genügend Zeit zur Stellungnahme lassen.

(3) Um größtmögliche Effizienz bei der Durchführung von Antidumping- und Ausgleichszolluntersuchungen zu gewährleisten und insbesondere zwecks angemessener Wahrung des Anspruchs auf rechtliches Gehör, erklären sich die Vertragsparteien damit einverstanden, dass die Unterlagen zu Antidumping- und Ausgleichszolluntersuchungen in englischer Sprache vorgelegt werden. Unbeschadet der Bestimmungen dieses Absatzes kann Korea eine schriftliche Klarstellung in koreanischer Sprache verlangen, wenn

a) sich den koreanischen Untersuchungsbehörden der Sinn der vorgelegten Unterlagen für die Zwecke der Antidumping- oder Ausgleichszolluntersuchung nicht hinreichend erschließt und

b) das Ersuchen strikt auf den Teil beschränkt bleibt, der für die Zwecke der Antidumping- oder Ausgleichszolluntersuchung nicht hinreichend klar ist.

(4) Sofern es die Durchführung der Untersuchung nicht unnötig verzögert, wird den interessierten Parteien Gelegenheit zur Anhörung gegeben, damit sie ihre Position in den Antidumping- oder Ausgleichszolluntersuchungen darlegen können.

Artikel 3.9

Notifikation

(1) Geht bei den zuständigen Behörden einer Vertragspartei ein mit den erforderlichen Unterlagen versehener Antidumpingantrag im Zusammenhang mit Einfuhren aus der anderen Vertragspartei ein, so notifiziert die Vertragspartei spätestens 15 Tage vor Einleitung einer Untersuchung der anderen Vertragspartei schriftlich den Zugang des Antrags.

(2) Geht bei den zuständigen Behörden einer Vertragspartei ein mit den erforderlichen Unterlagen versehener Ausgleichszollantrag im Zusammenhang mit Einfuhren aus der anderen Vertragspartei ein, so notifiziert die Vertragspartei vor Beginn einer Untersuchung der anderen Vertragspartei schriftlich den Zugang des Antrags und gesteht ihr eine Sitzung mit ihren zuständigen Behörden zwecks Konsultation über den Antrag zu.

Artikel 3.10

Berücksichtigung des öffentlichen Interesses

Die Vertragsparteien sind bemüht, dem öffentlichen Interesse Rechnung zu tragen, bevor sie einen Antidumping- oder Ausgleichszoll einführen.

Artikel 3.11

Untersuchung nach Beendigung einer Maßnahme aufgrund einer Überprüfung

Die Vertragsparteien kommen überein, Anträge auf Einleitung einer Antidumpinguntersuchung besonders sorgfältig zu prüfen, wenn sie Ursprungswaren der anderen Vertragspartei betreffen, gegen die Antidumpingmaßnahmen in Kraft waren, welche in den vorangegangenen 12 Monaten aufgrund einer Überprüfung außer Kraft gesetzt wurden. Die Untersuchung wird nur dann eingeleitet, wenn die Vorabprüfung ergibt, dass sich die Umstände verändert haben.

Artikel 3.12

Kumulative Beurteilung

Falls Einfuhren aus mehr als einem Land zum gleichen Zeitpunkt Gegenstand einer Antidumping- oder Ausgleichszolluntersuchung sind, prüfen die Vertragsparteien mit besonderer Sorgfalt, ob die kumulative Beurteilung der Auswirkungen der Einfuhren der anderen Vertragspartei angemessen ist angesichts der Bedingungen, die für den Wettbewerb zwischen den eingeführten Waren sowie für den Wettbewerb zwischen den eingeführten Waren und den gleichartigen inländischen Waren herrschen.

Artikel 3.13

Anwendung des Geringfügigkeitsgrundsatzes bei der Überprüfung

(1) Eine nach Artikel 11 des Antidumping-Übereinkommens zu überprüfende Maßnahme wird außer Kraft gesetzt, wenn festgestellt wird, dass die voraussichtlich wiederauftretende Dumpingspanne unterhalb der Geringfügigkeitsschwelle nach Artikel 5 Absatz 8 des Antidumping-Übereinkommens liegt.

(2) Falls individuelle Dumpingspannen nach Artikel 9 Absatz 5 des Antidumping-Übereinkommens ermittelt werden, sind Ausführer oder Hersteller in der ausführenden Vertragspartei vom Zoll befreit, bei denen anhand repräsentativer Ausfuhrverkäufe festgestellt wird, dass ihre Dumpingspanne unterhalb der Geringfügigkeitsschwelle nach Artikel 5 Absatz 8 des Antidumping-Übereinkommens liegt.

Artikel 3.14

Regel des niedrigeren Zollsatzes

Führt eine Vertragspartei einen Antidumping- oder Ausgleichszoll ein, darf dieser Zoll die Dumpingspanne beziehungsweise die Spanne der anfechtbaren Subventionen nicht überschreiten; außerdem sollte er niedriger sein als diese Spanne, falls ein niedrigerer Zollsatz ausreicht, um die Schädigung des inländischen Wirtschaftszweigs zu beseitigen.

Artikel 3.15

Streitbeilegung

Die Vertragsparteien dürfen sich in Fragen, die sich aus diesem Abschnitt ergeben, nicht auf Kapitel Vierzehn (Streitbeilegung) berufen.

ABSCHNITT E

Institutionelle Bestimmungen

Artikel 3.16

Arbeitsgruppe "Zusammenarbeit bei handelspolitischen Schutzmaßnahmen"

(1) Die nach Artikel 15.3 Absatz 1 (Arbeitsgruppen) eingesetzte Arbeitsgruppe "Zusammenarbeit bei handelspolitischen Schutzmaßnahmen" ist ein Dialogforum für die Zusammenarbeit bei handelspolitischen Schutzmaßnahmen.

(2) The functions of the Working Group shall be to:

a) Verbesserung der gegenseitigen Kenntnis und des gegenseitigen Verständnisses der Gesetze, Strategien und Verfahren auf dem Gebiet handelspolitischer Schutzmaßnahmen,

b) Überwachung der Durchführung dieses Kapitels,

c) Verbesserung der Zusammenarbeit zwischen den Behörden der Vertragsparteien, die für Fragen im Zusammenhang mit handelspolitischen Schutzmaßnahmen zuständig sind,

d) Funktion als Informationsaustauschforum der Vertragsparteien im Zusammenhang mit Antidumping-, Antisubventions-, Ausgleichs- und Schutzmaßnahmen,

e) Funktion als Diskussionsforum der Vertragsparteien für sonstige wichtige Fragen von gegenseitigem Interesse wie z. B.

i) internationale Angelegenheiten im Zusammenhang mit handelspolitischen Schutzmaßnahmen, darunter Themen, die die Verhandlungen über WTO-Regeln im Rahmen der Doha-Runde betreffen, und

ii) Vorgehensweisen der zuständigen Behörden der Vertragsparteien bei Antidumping- und Ausgleichszolluntersuchungen, z. B. Umgang mit "verfügbaren Informationen" und Abwicklung von Prüfungsverfahren, und

f) Zusammenarbeit in allen sonstigen Angelegenheiten, über deren Notwendigkeit sich die Vertragsparteien einig sind.

(3) Die Arbeitsgruppe trifft sich normalerweise in jährlichem Rhythmus; bei Bedarf können auf Ersuchen einer Vertragspartei weitere Sitzungen einberufen werden.

KAPITEL VIER

TECHNISCHE HANDELSHEMMNISSE

Artikel 4.1

Bekräftigung des Übereinkommens über technische Handelshemmnisse

Die Vertragsparteien bekräftigen ihre gegenseitigen Rechte und Pflichten aus dem Übereinkommen über technische Handelshemmnisse (Technical Barriers to Trade, TBT) in Anhang 1A des WTO-Übereinkommens (im Folgenden "TBT-Übereinkommen" genannt), das mutatis mutandis Bestandteil dieses Abkommens ist.

Artikel 4.2

Geltungsbereich und Begriffsbestimmungen

(1) Dieses Kapitel gilt bei der Ausarbeitung, Annahme und Anwendung von Normen, technischen Vorschriften und Konformitätsbewertungsverfahren im Sinne des TBT-Übereinkommens, die sich auf den Warenhandel zwischen den Vertragsparteien auswirken können.

(2) Ungeachtet des Absatzes 1 gilt dieses Kapitel nicht für:

a) technische Spezifikationen, die von staatlichen Stellen für Produktions- oder Verbrauchszwecke staatlicher Stellen ausgearbeitet werden, oder

b) gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen im Sinne von Anhang A des Übereinkommens über die Anwendung gesundheitspolizeilicher und pflanzenschutzrechtlicher Maßnahmen (Sanitary and Phytosanitary Measures, SPS) in Anhang 1A des WTO-Übereinkommens (im Folgenden "SPS-Übereinkommen" genannt).

(3) Für die Zwecke dieses Kapitels gelten die Begriffsbestimmungen in Anhang 1 des TBT-Übereinkommens.

Artikel 4.3

Bilaterale Zusammenarbeit

(1) Die Vertragsparteien intensivieren ihre Zusammenarbeit im Bereich Normen, technische Vorschriften und Konformitätsbewertungsverfahren, um das gegenseitige Verständnis der jeweiligen Systeme zu verbessern und den Zugang zu den jeweiligen Märkten zu erleichtern. Zu diesem Zweck können sie Regulierungsdialoge sowohl auf Querschnitts- als auch auf Sektorebene in Gang setzen.

(2) Bei der bilateralen Zusammenarbeit sind die Vertragsparteien bestrebt, handelserleichternde Initiativen auszumachen, zu entwickeln und zu fördern, die unter anderem auf Folgendes ausgerichtet sein können:

a) Vertiefung der Zusammenarbeit in Regulierungsfragen beispielsweise durch den Austausch von Informationen, Erfahrungen und Daten sowie durch wissenschaftlich-technische Zusammenarbeit, um die Qualität und das Niveau ihrer technischen Vorschriften zu verbessern und die Regulierungsressourcen effizient einzusetzen,

b) gegebenenfalls Vereinfachung von technischen Vorschriften, Normen und Konformitätsbewertungsverfahren,

c) sofern die Vertragsparteien sich darauf verständigen und es ihnen angemessen erscheint, beispielsweise in Bereichen, in denen keine internationalen Normen existieren, Vermeidung unnötiger Unterschiede bei der Regulierung und Konformitätsbewertung und Hinarbeit auf konvergierende oder aufeinander abgestimmte technische Anforderungen und

d) Förderung und Unterstützung der bilateralen Zusammenarbeit zwischen den jeweiligen öffentlichen oder privaten Organisationen, die für Messwesen, Normung, Prüfung, Zertifizierung und Akkreditierung zuständig sind.

(3) Unterbreitet eine Vertragspartei Vorschläge zur Zusammenarbeit nach den Bedingungen dieses Kapitels, so prüft die andere Vertragspartei dieses Ersuchen in gebührender Weise.

Artikel 4.4

Technische Vorschriften

(1) Die Vertragsparteien kommen überein, den Grundsatz der guten Regulierungspraxis bestmöglich anzuwenden, so wie es das TBT-Übereinkommen vorsieht. Dies bedeutet insbesondere, dass die Vertragsparteien

a) ihrer Transparenzpflicht nachkommen, so wie es das TBT-Übereinkommen verlangt,

b) internationale Normen als Grundlage für technische Vorschriften wie auch für Konformitätsbewertungsverfahren verwenden, es sei denn, die betreffenden internationalen Normen sind zur Verwirklichung ihrer legitimen Ziele ineffizient oder ungeeignet, und falls sie keine internationalen Normen als Grundlage verwenden, dass sie der anderen Vertragspartei auf deren Ersuchen erläutern, warum die betreffenden Normen als ineffizient oder ungeeignet zur Erreichung des angestrebten Ziels angesehen werden,

c) soweit sie eine technische Vorschrift erlassen haben oder den Erlass vorschlagen, der anderen Vertragspartei auf deren Ersuchen verfügbare Informationen über den Zweck, die Rechtsgrundlage und die Gründe für die technische Vorschrift vorlegen,

d) Instrumente schaffen, die den Wirtschaftsbeteiligten der anderen Vertragspartei den Zugang zu besseren Informationen über technische Vorschriften ermöglichen (auch über eine öffentliche Website), und insbesondere der anderen Vertragspartei oder deren Wirtschaftsbeteiligten auf Ersuchen unverzüglich schriftliche Informationen und, soweit angebracht und verfügbar, schriftliche Leitlinien bezüglich der Einhaltung ihrer technischen Vorschriften zur Verfügung stellen,

e) den Auffassungen der anderen Vertragspartei gebührend Rechnung tragen, wenn ein Teil des Entwicklungsverfahrens für eine technische Vorschrift Gegenstand eines öffentlichen Konsultationsverfahrens ist, und auf Ersuchen schriftlich auf die Stellungnahme der anderen Vertragspartei antworten,

f) bei einer Notifizierung nach den Bestimmungen des TBT-Übereinkommens der anderen Vertragspartei eine Frist von mindestens 60 Tagen einräumen, damit diese schriftlich zu dem Vorschlag Stellung nehmen kann, und

g) den Wirtschaftsbeteiligten der anderen Vertragspartei eine ausreichende Anpassungsfrist zwischen der Veröffentlichung technischer Vorschriften und deren Inkrafttreten einräumen, außer wenn dringende Probleme der Sicherheit, der Gesundheit, des Umweltschutzes oder der nationalen Sicherheit auftreten oder aufzutreten drohen, und, soweit möglich, zumutbaren Ersuchen um Verlängerung der Stellungnahmefrist angemessen Rechnung tragen.

(2) Jede Vertragspartei stellt sicher, dass sich Wirtschaftsbeteiligte und andere interessierte Personen der anderen Vertragspartei an allen förmlichen öffentlichen Konsultationsverfahren im Zusammenhang mit der Erarbeitung technischer Vorschriften beteiligen dürfen, und dies zu Bedingungen, die nicht weniger günstig sind als die Bedingungen, die sie ihren eigenen juristischen und natürlichen Personen einräumt.

(3) Jede Vertragspartei bemüht sich, technische Vorschriften einheitlich und konsequent auf ihrem gesamten Gebiet anzuwenden. Setzt Korea die EU-Vertragspartei über eine Handelsangelegenheit in Kenntnis, die sich aus Abweichungen zwischen den Rechtsvorschriften der Mitgliedstaaten der Europäischen Union zu ergeben scheinen, welche nach Einschätzung Koreas nicht mit dem Vertrag über die Arbeitsweise der Europäischen Union vereinbar sind, so bemüht sich die EU-Vertragspartei nach besten Kräften, sich zügig mit der Angelegenheit zu befassen.

Artikel 4.5

Normen

(1) Die Vertragsparteien bekräftigen ihre Verpflichtungen aus Artikel 4 Absatz 1 des TBT-Übereinkommens, wonach sie sicherstellen müssen, dass ihre Normenorganisationen den Verhaltenskodex für die Ausarbeitung, Annahme und Anwendung von Normen in Anhang 3 des TBT-Übereinkommens annehmen und einhalten; sie beachten ferner den Beschluss des WTO-Ausschusses für technische Handelshemmnisse über Grundsätze für die Ausarbeitung internationaler Normen, Leitlinien und Empfehlungen im Zusammenhang mit den Artikeln 2 und 5 sowie Anhang 3 des Übereinkommens (Decision of the Committee on Principles for the Development of International Standards, Guides and Recommendations with relation to Articles 2, 5 and Annex 3 of the Agreement); dieser Beschluss ist wiedergegeben in Abschnitt IX der Beschlüsse und Empfehlungen dieses Ausschusses seit 1. Januar 1995 (Decisions and Recommendations adopted by the Committee since 1 January 1995, G/TBT/1/rev.8, 23 May 2002, Section IX).

(2) Die Vertragsparteien verpflichten sich, Informationen auszutauschen über

a) ihren Rückgriff auf Normen bei technischen Vorschriften,

b) ihre Normungsverfahren und den Grad der Verwendung internationaler Normen als Grundlage für ihre nationalen und regionalen Normen, und

c) Kooperationsvereinbarungen der Vertragsparteien im Bereich der Normung, beispielsweise Informationen über Normungsaspekte in Freihandelsabkommen mit Dritten.

Artikel 4.6

Konformitätsbewertung und Akkreditierung

(1) Die Vertragsparteien erkennen die Existenz eines breiten Spektrums von Instrumenten an, die die Anerkennung der Ergebnisse der im Gebiet der anderen Vertragspartei durchgeführten Konformitätsbewertungsverfahren erleichtern; dazu zählen unter anderem

a) Vereinbarungen über die gegenseitige Anerkennung der Ergebnisse von Konformitätsbewertungsverfahren bei bestimmten technischen Vorschriften, die von im Gebiet der anderen Vertragspartei ansässigen Stellen durchgeführt werden,

b) Akkreditierungsverfahren für die Zulassung von Konformitätsbewertungsstellen, die im Gebiet der anderen Vertragspartei ansässig sind,

c) staatliche Benennung von Konformitätsbewertungsstellen, die im Gebiet der anderen Vertragspartei ansässig sind,

d) Anerkennung der Ergebnisse von im Gebiet der anderen Vertragspartei durchgeführten Konformitätsbewertungsverfahren durch eine Vertragspartei,

e) freiwillige Vereinbarungen zwischen den Konformitätsbewertungsstellen im Gebiet der Vertragsparteien, und

f) Anerkennung der Konformitätserklärung eines Lieferanten durch die einführende Vertragspartei.

(2) Unter besonderer Würdigung dieser Aspekte verpflichten sich die Vertragsparteien,

a) ihren Informationsaustausch über diese und vergleichbare Instrumente zu verstärken, um die Anerkennung der Ergebnisse von Konformitätsbewertungen zu erleichtern,

b) Informationen über Konformitätsbewertungsverfahren auszutauschen, insbesondere Informationen über die Kriterien für die Auswahl geeigneter Konformitätsbewertungsverfahren bei bestimmten Waren,

c) Informationen über ihre Akkreditierungspolitik auszutauschen und zu überdenken, wie internationale Akkreditierungsnormen sowie internationale Vereinbarungen, in die die Akkreditierungsstellen der Vertragsparteien involviert sind, sich bestmöglich einsetzen lassen, beispielsweise durch Einbeziehung der Internationalen Vereinigung von Akkreditierungsstellen für Laboratorien und Inspektionsstellen (International Laboratory Accreditation Co-operation) und des Internationalen Akkreditierungsforums (International Accreditation Forum), und

d) im Einklang mit Artikel 5 Unterabsatz 1.2 des TBT-Übereinkommens keine Konformitätsbewertungsverfahren vorzuschreiben, die strenger als nötig sind.

(3) Die Grundsätze und Verfahrensweisen nach Artikel 4.4, die für die Entwicklung und Annahme technischer Vorschriften festgelegt wurden, um unnötige Handelshemmnisse auszuschließen und Transparenz und Diskriminierungsfreiheit zu gewährleisten, gelten auch für obligatorische Konformitätsbewertungsverfahren.

Artikel 4.7

Marktüberwachung

Die Vertragsparteien verpflichten sich zum Meinungsaustausch über Tätigkeiten im Zusammenhang mit Marktüberwachung und Rechtsdurchsetzung.

Artikel 4.8

Gebühren für die Konformitätsbewertung

Die Vertragsparteien bekräftigen ihre Verpflichtung nach Artikel 5 Unterabsatz 2.5 des TBT-Übereinkommens, wonach die Gebühren für die obligatorische Konformitätsbewertung eingeführter Waren in angemessenem Verhältnis zu den Gebühren für die Konformitätsbewertung gleichartiger Waren inländischen oder drittländischen Ursprungs stehen müssen, wobei die Kommunikations-, Transport- und sonstigen Kosten, die sich aus der Entfernung zwischen dem Standort des Anmelderunternehmens und der Konformitätsbewertungsstelle ergeben, zu berücksichtigen sind; sie verpflichten sich ferner, diesen Grundsatz in den von diesem Kapitel betroffenen Bereichen anzuwenden.

Artikel 4.9

Kennzeichnung und Etikettierung

(1) Die Vertragsparteien nehmen die Bestimmungen von Anhang 1 Absatz 1 des TBT-Übereinkommens zur Kenntnis, wonach eine technische Vorschrift unter anderem oder ausschließlich Festlegungen über Kennzeichnungs- oder Etikettierungserfordernisse enthalten kann, und vereinbaren, dass sie, sofern ihre technischen Vorschriften obligatorische Kennzeichnungs- oder Etikettierungsauflagen enthalten, die Grundsätze des Artikels 2 Absatz 2 des TBT-Übereinkommens beachten, wonach technische Vorschriften nicht in der Absicht oder mit der Wirkung ausgearbeitet werden dürfen, unnötige Hemmnisse für den internationalen Handel zu schaffen, und nicht handelsbeschränkender sein dürfen als notwendig, um ein berechtigtes Ziel zu erreichen.

(2) Die Vertragsparteien vereinbaren insbesondere Folgendes: Wenn eine Vertragspartei eine obligatorische Kennzeichnung oder Etikettierung für Waren vorschreibt,

a) bemüht sich diese Vertragspartei, die Kennzeichnungs- oder Etikettierungsauflagen auf ein Minimum zu beschränken, es sei denn, die Kennzeichnung oder Etikettierung ist für den Verbraucher oder Verwender der Ware von Wichtigkeit. Verfolgt die Etikettierung andere, beispielsweise steuerliche Zwecke, ist die Auflage so abzufassen, dass sie nicht handelsbeschränkender ist als notwendig, um ein berechtigtes Ziel zu erreichen;

b) kann diese Vertragspartei zwar die Form eines Kennzeichens oder Etiketts vorgeben, verlangt diesbezüglich aber keine vorherige Genehmigung, Registrierung oder Zertifizierung. Das Recht der Vertragspartei, eine vorherige Genehmigung der auf dem Etikett oder Kennzeichen aufgrund einschlägiger inländischer Vorschriften anzugebenden besonderen Informationen vorzuschreiben, bleibt von dieser Bestimmung unberührt;

c) erteilt diese Vertragspartei einem Wirtschaftsbeteiligten der anderen Vertragspartei ohne unnötige Verzögerung und diskriminierungsfrei eine eindeutige Identifikationsnummer, falls sie deren Verwendung vorschreibt;

d) darf diese Vertragspartei verlangen, dass die Angaben auf den Kennzeichen oder Etiketten in einer bestimmten Sprache erfolgen. Haben sich die Vertragsparteien auf eine internationale Klassifikation verständigt, so kann auch diese verwendet werden. Die gleichzeitige Verwendung weiterer Sprachen ist erlaubt, sofern die Angaben in diesen anderen Sprachen mit den Angaben in der zuerst bestimmten Sprache übereinstimmen oder die Angaben in einer zusätzlichen Sprache keine irreführenden Aussagen über die Ware treffen, und

e) ist diese Vertragspartei bestrebt, falls ihres Erachtens dadurch keine berechtigten Ziele im Sinne des TBT-Übereinkommens gefährdet werden, nicht-dauerhafte oder ablösbare Etiketten zuzulassen oder die Kennzeichnung oder Etikettierung in den Begleitunterlagen statt physisch mit der Ware verbunden zu erlauben.

Artikel 4.10

Koordinierungssystem

(1) Die Vertragsparteien kommen überein, Koordinatoren auf dem Gebiet technischer Handelshemmnisse (TBT-Koordinatoren) zu ernennen und die andere Vertragspartei in geeigneter Weise zu benachrichtigen, wenn ein neuer TBT-Koordinator ernannt wird. Die TBT-Koordinatoren arbeiten zusammen, um die Umsetzung dieses Kapitels sowie die Zusammenarbeit zwischen den Vertragsparteien in allen diesbezüglichen Fragen zu erleichtern.

(2) Ein TBT-Koordinator hat unter anderem die Aufgabe,

a) die Umsetzung und Anwendung dieses Kapitels zu überwachen, sich unverzüglich mit einer Angelegenheit zu befassen, die eine Vertragspartei im Zusammenhang mit der Ausarbeitung, Annahme, Anwendung und Durchsetzung von Normen, technischen Vorschriften und Konformitätsbewertungsverfahren vorbringt, und auf Ersuchen einer Vertragspartei Gespräche über alle Fragen aufzunehmen, die sich aus diesem Kapitel ergeben,

b) die Zusammenarbeit bei der Ausarbeitung und Verbesserung von Normen, technischen Vorschriften und Konformitätsbewertungsverfahren zu verbessern,

c) nach Bedarf für das Ingangsetzen von Regulierungsdialogen nach Artikel 4.3 zu sorgen,

d) für die Einsetzung von Arbeitsgruppen zu sorgen, die im gegenseitigen Einvernehmen der Vertragsparteien Sachverständige und Interessenträger von nichtstaatlicher Seite einbeziehen oder konsultieren können,

e) Informationen über Entwicklungen in nichtstaatlichen, regionalen und multilateralen Foren auszutauschen, die einen Bezug zu Normen, technischen Vorschriften und Konformitätsbewertungsverfahren aufweisen, und

f) dieses Kapitel im Lichte etwaiger Entwicklungen im Rahmen des TBT-Übereinkommens zu überprüfen.

(3) Die TBT-Koordinatoren tauschen sich auf jedem vereinbarten Weg aus, der sich zur effizienten und effektiven Ausübung ihrer Funktionen anbietet.

KAPITEL FÜNF

GESUNDHEITSPOLIZEILICHE UND PFLANZENSCHUTZRECHTLICHE MASSNAHMEN

Artikel 5.1

Ziel

(1) Dieses Kapitel hat zum Ziel, die negativen Auswirkungen gesundheitspolizeilicher und pflanzenschutzrechtlicher Maßnahmen auf den Handel möglichst gering zu halten und gleichzeitig die Gesundheit von Menschen, Tieren und Pflanzen im Gebiet der Vertragsparteien zu schützen.

(2) Darüber hinaus zielt dieses Kapitel auf eine bessere Zusammenarbeit zwischen den Vertragsparteien in Tierschutzfragen ab unter Berücksichtigung verschiedener Faktoren wie den Bedingungen der Viehwirtschaft im Gebiet der Vertragsparteien.

Artikel 5.2

Geltungsbereich

Dieses Kapitel gilt für alle gesundheitspolizeilichen und pflanzenschutzrechtlichen Maßnahmen einer Vertragspartei, die sich mittelbar oder unmittelbar auf den Handel zwischen den Vertragsparteien auswirken können.

Artikel 5.3

Begriffsbestimmung

Für die Zwecke dieses Kapitels sind gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen alle in Anhang A Absatz 1 des SPS-Übereinkommens definierten Maßnahmen.

Artikel 5.4

Rechte und Pflichten

Die Vertragsparteien bekräftigen ihre Rechte und Pflichten aus dem SPS-Übereinkommen.

Artikel 5.5

Transparenz und Informationsaustausch

Die Vertragsparteien:

a) gewährleisten Transparenz bei gesundheitspolizeilichen und pflanzenschutzrechtlichen Maßnahmen im Handelsverkehr,

b) vertiefen das gegenseitige Verständnis der gesundheitspolizeilichen und pflanzenschutzrechtlichen Maßnahmen und ihrer Anwendung,

c) tauschen Informationen über Angelegenheiten aus, die die Entwicklung und Anwendung gesundheitspolizeilicher und pflanzenschutzrechtlicher Maßnahmen betreffen, welche sich auf den Handel zwischen den Vertragsparteien auswirken oder auswirken können, in dem Bestreben, deren negative Auswirkungen auf den Handel möglichst gering zu halten, und

d) teilen auf Ersuchen einer Vertragspartei mit, welche Bedingungen für die Einfuhr bestimmter Waren gelten.

Artikel 5.6

Internationale Normen

Die Vertragsparteien:

a) entwickeln auf Ersuchen einer Vertragspartei ein gemeinsames Verständnis der Anwendung internationaler Normen in Bereichen, die sich auf den Handel zwischen den Vertragsparteien auswirken oder auswirken können, in dem Bestreben, negative Auswirkungen auf den gegenseitigen Handel möglichst gering zu halten, und

b) arbeiten zusammen bei der Entwicklung internationaler Normen, Leitlinien und Empfehlungen.

Artikel 5.7

Einfuhrbedingungen

(1) Die allgemeinen Einfuhrbedingungen einer Vertragspartei gelten für das gesamte Gebiet der anderen Vertragspartei.

(2) Die einführende Vertragspartei darf gegenüber der ausführenden Vertragspartei oder Teilen davon zusätzliche Sondereinfuhrbedingungen aufstellen, nachdem sie im Einklang mit dem SPS-Übereinkommen, der Codex-Alimentarius-Kommission, der Weltorganisation für Tiergesundheit (im Folgenden "OIE" genannt) sowie dem Internationalen Pflanzenschutzübereinkommen (im Folgenden "IPPC" genannt — International Plant Protection Convention) über den Gesundheitszustand von Pflanzen oder Tieren der ausführenden Vertragspartei oder Teilen davon befunden hat.

Artikel 5.8

Tier- und pflanzengesundheitliche Maßnahmen

(1) Die Vertragsparteien anerkennen das Konzept von schädlings- oder krankheitsfreien Gebieten und Gebieten mit geringem Auftreten von Schädlingen oder Krankheiten im Einklang mit dem SPS-Übereinkommen und den Normen der OIE und des IPPC; ferner stellen sie ein geeignetes Verfahren für die Anerkennung derartiger Gebiete auf, wobei sie den einschlägigen internationalen Normen, Leitlinien und Empfehlungen Rechnung tragen.

(2) Bei der Festlegung derartiger Gebiete stützen sich die Vertragsparteien auf Faktoren wie geografische Lage, Ökosysteme, epidemiologische Überwachung und Wirksamkeit gesundheitspolizeilicher oder pflanzenschutzrechtlicher Kontrollen in diesen Gebieten.

(3) Die Vertragsparteien gehen eine enge Zusammenarbeit bei der Festlegung von schädlings- oder krankheitsfreien Gebieten und Gebieten mit geringem Auftreten von Schädlingen oder Krankheiten ein, damit das gegenseitige Vertrauen in die jeweiligen Verfahren zur Festlegung derartiger Gebiete gestärkt wird. Die Vertragsparteien sind bestrebt, diese vertrauensbildenden Maßnahmen binnen rund zwei Jahren nach Inkrafttreten dieses Abkommens abzuschließen. Der erfolgreiche Abschluss der vertrauensbildenden Zusammenarbeit wird von dem in Artikel 5.10 genannten Ausschuss "Gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen" bestätigt.

(4) Bei der Festlegung derartiger Gebiete stützt die einführende Vertragspartei ihren Befund über den Gesundheitszustand von Pflanzen oder Tieren der ausführenden Vertragspartei oder Teilen davon grundsätzlich auf die Informationen, die die ausführende Vertragspartei nach dem SPS-Übereinkommen und den Normen der OIE und des IPPC bereitstellt, und trägt dem Befund der ausführenden Vertragspartei Rechnung. Lehnt in diesem Zusammenhang eine Vertragspartei den Befund der anderen Vertragspartei ab, so legt die ablehnende Vertragspartei ihre Gründe dar und ist zu Konsultationen bereit.

(5) Die ausführende Vertragspartei belegt gegenüber der einführenden Vertragspartei mit dem notwendigen Beweismaterial, dass die betreffenden Gebiete schädlings- oder krankheitsfreie Gebiete oder Gebiete mit geringem Auftreten von Schädlingen oder Krankheiten sind und der Voraussicht nach bleiben. Zu diesem Zweck erhält die einführende Vertragspartei auf Ersuchen angemessene Zugangsmöglichkeiten, um entsprechende Kontroll-, Prüf- und sonstige einschlägige Verfahren durchzuführen.

Artikel 5.9

Zusammenarbeit beim Tierschutz

Die Vertragsparteien:

a) tauschen Informationen, Fachwissen und Erfahrungen auf dem Gebiet des Tierschutzes aus und verabschieden einen Arbeitsplan für diesbezügliche Tätigkeiten und

b) arbeiten bei der Ausarbeitung von Tierschutznormen in internationalen Foren zusammen, insbesondere in Bezug auf die Betäubung und Schlachtung von Tieren.

Artikel 5.10

Ausschuss "Gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen"

(1) Der nach Artikel 15.2 Absatz 1 (Sonderausschüsse) eingesetzte Ausschuss "Gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen" hat folgende Zuständigkeiten:

a) Erarbeitung der zur Umsetzung dieses Kapitels erforderlichen Verfahren und Vereinbarungen,

b) Überwachung der Fortschritte bei der Umsetzung dieses Kapitels,

c) Bestätigung des erfolgreichen Abschlusses der vertrauensbildenden Zusammenarbeit nach Artikel 5.8 Absatz 3,

d) Erarbeitung von Verfahren für die Zulassung von Betrieben für Erzeugnisse tierischen Ursprungs und gegebenenfalls von Fertigungsstätten für Erzeugnisse pflanzlichen Ursprungs und

e) Funktion als Forum für die Erörterung von Schwierigkeiten, die sich aus der Anwendung bestimmter gesundheitspolizeilicher oder pflanzenschutzrechtlicher Maßnahmen ergeben, mit der Zielsetzung, beiderseits annehmbare Lösungen zu finden. Dazu wird der Ausschuss auf Ersuchen einer Vertragspartei kurzfristig einberufen, um Beratungen durchzuführen.

(2) Der Ausschuss setzt sich aus Vertretern der Vertragsparteien zusammen und tritt einmal pro Jahr zu einem einvernehmlich festgelegten Zeitpunkt zusammen. Auch der Sitzungsort wird einvernehmlich festgelegt. Die Vertragsparteien verständigen sich vor den Sitzungen auf die Tagesordnung. Die Vertragsparteien führen abwechselnd den Vorsitz.

Artikel 5.11

Streitbeilegung

Die Vertragsparteien dürfen sich in Fragen, die sich aus diesem Abschnitt ergeben, nicht auf Kapitel Vierzehn (Streitbeilegung) berufen.

KAPITEL SECHS

ZOLL- UND HANDELSERLEICHTERUNGEN

Artikel 6.1

Ziele und Grundsätze

Zwecks Erleichterung des Handels und Förderung der Zollzusammenarbeit auf bilateraler und multilateraler Grundlage vereinbaren die Vertragsparteien, zusammenzuarbeiten und Vorschriften und Verfahren für die Ein-, Aus- und Durchfuhr von Waren gestützt auf folgende Ziele und Grundsätze einzuführen und anzuwenden:

a) Um zu gewährleisten, dass die Vorschriften und Verfahren für die Ein-, Aus- und Durchfuhr von Waren effizient und verhältnismäßig sind,

i) führt jede Vertragspartei beschleunigte Zollverfahren ein oder behält diese bei und wendet weiterhin angemessene Zollkontroll- und Auswahlverfahren an,

ii) sind die Ein-, Aus- und Durchfuhrvorschriften und -verfahren verwaltungstechnisch nicht belastender oder handelsbeschränkender als zur Erreichung legitimer Ziele nötig,

iii) sorgt jede Vertragspartei für eine Warenabfertigung mit möglichst wenig Unterlagen und macht den Zollkunden elektronische Systeme zugänglich,

iv) setzt jede Vertragspartei Informationstechnik ein, um die Verfahren zur Überlassung der Waren zu beschleunigen,

v) stellt jede Vertragspartei sicher, dass ihre mit Grenzkontrollen, einschließlich Ein-, Aus- und Durchfuhrangelegenheiten, befassten Zollbehörden und -einrichtungen zusammenarbeiten und ihre Tätigkeit koordinieren, und

vi) sorgt jede Vertragspartei dafür, dass der Einsatz von Zollagenten fakultativ ist;

b) die Ein-, Aus- und Durchfuhrvorschriften und -verfahren stützen sich auf von den Vertragsparteien anerkannte internationale Handels- und Zollübereinkünfte und -normen:

i) internationale Handels- und Zollübereinkünfte und -normen bilden die Grundlage für Ein-, Aus- und Durchfuhrvorschriften und -verfahren, soweit derartige Übereinkünfte und Normen existieren, es sei denn, sie erweisen sich als ungeeignet oder ineffizient zur Erreichung der angestrebten legitimen Ziele, und

ii) Datenauflagen und Prozesse werden schrittweise nach dem Zolldatenmodell der Weltzollorganisation (im Folgenden "WZO" genannt) und damit im Zusammenhang stehenden WZO-Empfehlungen und -Leitlinien genutzt und angewandt;

c) die Vorschriften und Verfahren sind für Einführer, Ausführer und sonstige interessierte Parteien transparent;

d) jede Vertragspartei tauscht sich zügig mit Wirtschaftsvertretern und anderen interessierten Parteien aus, auch vor Annahme wichtiger neuer Vorschriften und Verfahren oder diesbezüglicher Änderungen;

e) Grundsätze und Verfahren des Risikomanagements werden genutzt, um die Bemühungen zur Erfüllung der Anforderungen auf Geschäftsvorgänge auszurichten, die entsprechende Aufmerksamkeit verdienen;

f) die Vertragsparteien arbeiten zusammen, um die Anwendung und Einhaltung der mit diesem Abkommen vereinbarten handelserleichternden Maßnahmen zu fördern, und tauschen diesbezügliche Informationen aus, und

g) die handelserleichternden Maßnahmen stehen der Erfüllung legitimer politischer Ziele wie dem Schutz der inneren Sicherheit, der Gesundheit oder der Umwelt nicht entgegen.

Artikel 6.2

Überlassung von Waren

(1) Zwecks Erleichterung des gegenseitigen Handels führt jede Vertragspartei vereinfachte und effiziente Zoll- und sonstige handelsbezogene Vorschriften und Verfahren ein und wendet diese an.

(2) Nach Absatz 1 sorgt jede Vertragspartei dafür, dass ihre Zollbehörden, Grenzdienststellen und sonstigen zuständigen Behörden Vorschriften und Verfahren anwenden, die

a) die Überlassung einer Ware innerhalb einer Frist ermöglichen, die nicht länger ist als zur Einhaltung der Zoll- und sonstigen handelsbezogenen Gesetze und Formalitäten erforderlich. Jede Vertragspartei arbeitet darauf hin, ihre Überlassungsfristen weiter zu verkürzen;

b) die elektronische Anmeldung und anschließende Datenverarbeitung bereits vor der physischen Ankunft der Ware ermöglichen — "Datenverarbeitung vor Warenankunft" —, damit die Ware bei ihrer Ankunft überlassen werden kann;

c) den Einführern ermöglichen, die zollbehördliche Überlassung bereits vor — und unbeschadet — der abschließenden Ermittlung der geltenden Zölle, Abgaben und Gebühren durch die Zollbehörde zu erwirken [3], und

d) die Überführung in den zollrechtlich freien Verkehr am Ankunftsort ohne vorübergehende Einlagerung in einem Zolllager oder einer anderen Einrichtung ermöglichen.

Artikel 6.3

Vereinfachte Zollverfahren

Die Vertragsparteien bemühen sich um die Anwendung vereinfachter Ein- und Ausfuhrverfahren für Händler oder Wirtschaftsbeteiligte, die bestimmte von einer Vertragspartei festgelegte Kriterien erfüllen; sie sorgen insbesondere für die beschleunigte Überlassung und Abfertigung von Waren samt vorgezogener elektronischer Anmeldung und Datenverarbeitung vor der physischen Ankunft der Sendungen, für eine weniger häufige Warenbeschau sowie für die Erleichterung des Handels im Hinblick beispielsweise auf vereinfachte Erklärungen mit möglichst wenig Unterlagen.

Artikel 6.4

Risikomanagement

Jede Vertragspartei setzt, wenn möglich elektronische, Risikomanagementverfahren für die Risikoanalyse und -erkennung ein, die es den Zollbehörden ermöglichen, sich bei ihrer Kontrolltätigkeit auf Hochrisikowaren zu konzentrieren, und die die Abfertigung und den Verkehr von Waren mit geringem Risiko vereinfachen. Für ihre Risikomanagementverfahren zieht jede Vertragspartei das überarbeitete Internationale Übereinkommen zur Vereinfachung und Harmonisierung der Zollverfahren von 1999 (im Folgenden "Kyoto-Übereinkommen" genannt) und die Leitlinien der WZO zum Risikomanagement heran.

Artikel 6.5

Transparenz

(1) Jede Vertragspartei stellt sicher, dass ihre Zoll- und sonstigen handelsbezogenen Gesetze, Vorschriften und allgemeinen Verwaltungsverfahren sowie andere Anforderungen, einschließlich Gebühren und Belastungen, allen interessierten Parteien auf einem amtlich bekannt gegebenen Weg und, wenn möglich und realisierbar, über eine amtliche Website problemlos zugänglich sind.

(2) Jede Vertragspartei richtet mindestens eine Kontakt- oder Auskunftsstelle ein, an die sich interessierte Parteien mit Anfragen zu Zoll- und sonstigen handelsbezogenen Angelegenheiten wenden können.

(3) Jede Vertragspartei tauscht sich mit Wirtschaftsvertretern und anderen interessierten Parteien aus und stellt ihnen Informationen zur Verfügung. Konsultationen und Informationen dieser Art betreffen wichtige neue Vorschriften und Verfahren oder diesbezügliche Änderungen; es wird die Möglichkeit eingeräumt, vor ihrer Annahme dazu Stellung zu nehmen.

Artikel 6.6

Verbindliche Auskünfte

(1) Auf schriftliches Ersuchen von Händlern gibt jede Vertragspartei vor der Einfuhr einer Ware in ihr Gebiet durch ihre Zollbehörden verbindliche schriftliche Auskünfte auf der Grundlage ihrer Gesetze und sonstigen Vorschriften über die zolltarifliche Einreihung, über Ursprungsregeln oder über sonstige diesbezügliche Angelegenheiten ihres Ermessens.

(2) Vorbehaltlich etwaiger Vertraulichkeitsanforderungen in ihren Gesetzen und sonstigen Vorschriften veröffentlicht jede Vertragspartei ihre verbindlichen schriftlichen Auskünfte über die zolltarifliche Einreihung oder sonstige diesbezügliche Angelegenheiten ihres Ermessens, beispielsweise im Internet.

(3) Zur Erleichterung des Handels unterrichten die Vertragsparteien einander regelmäßig im Rahmen des bilateralen Dialogs über Änderungen ihrer Rechtsvorschriften in Bezug auf Angelegenheiten nach den Absätzen 1 und 2.

Artikel 6.7

Rechtsbehelfsverfahren

(1) Jede Vertragspartei stellt sicher, dass Personen, die von Befunden bezüglich Zollfragen und sonstiger Ein-, Aus- und Durchfuhrvorschriften und -verfahren betroffen sind, eine Überprüfung beantragen oder einen Rechtsbehelf gegen diese Befunde einlegen können. Eine Vertragspartei kann vorschreiben, dass zunächst dieselbe Dienststelle, ihre Aufsichtsbehörde oder eine Justizbehörde über einen Rechtsbehelf verhandelt, bevor eine übergeordnete unabhängige Stelle, beispielsweise eine Justizbehörde oder ein Verwaltungsgericht, eine Überprüfung vornimmt.

(2) Der Hersteller oder Ausführer kann der die Verwaltungsüberprüfung durchführenden Vertragspartei auf direktem Wege Informationen zukommen lassen, wenn die überprüfende Behörde ihn darum ersucht. Der die Informationen bereitstellende Ausführer oder Hersteller kann von der die Verwaltungsüberprüfung durchführenden Vertragspartei verlangen, dass sie die bereitgestellten Informationen nach ihren Gesetzen und sonstigen Vorschriften als vertraulich behandelt.

Artikel 6.8

Vertraulichkeit

(1) Alle Auskünfte, die Personen oder Behörden einer Vertragspartei den Behörden der anderen Vertragspartei nach den Bestimmungen dieses Kapitels erteilen, auch solche, die nach Artikel 6.7 angefordert werden, sind nach Maßgabe der Gesetze und sonstigen Vorschriften der jeweiligen Vertragspartei als vertraulich oder als nur für den Dienstgebrauch bestimmt zu behandeln. Sie unterliegen dem Dienstgeheimnis und genießen den Schutz der für solche Auskünfte geltenden Gesetze und sonstigen Vorschriften der empfangenden Vertragspartei.

(2) Personenbezogene Daten dürfen nur ausgetauscht werden, wenn die empfangende Vertragspartei zusagt, diese Daten in mindestens gleichem Maße zu schützen, wie es die bereitstellende Vertragspartei in dem betreffenden Fall tun würde. Die die Daten übermittelnde Person darf keine strengeren Anforderungen stellen, als nach für sie geltendem Recht zulässig ist.

(3) Auskünfte nach Absatz 1 dürfen von den Behörden der empfangenden Vertragspartei ausschließlich für die Zwecke verwendet werden, für die sie übermittelt wurden, es sei denn, die übermittelnde Person oder Behörde stimmt einer anderen Verwendung ausdrücklich zu.

(4) Auskünfte nach Absatz 1 dürfen nur mit der ausdrücklichen Zustimmung der übermittelnden Person oder Behörde veröffentlicht oder gegenüber Dritten offen gelegt werden, es sei denn, die Vertragspartei, die sie im Zusammenhang mit Gerichtsverfahren erhalten hat, ist nach den für sie geltenden Gesetzen und sonstigen Vorschriften dazu verpflichtet oder befugt. Eine derartige Offenlegung wird der auskunfterteilenden Person oder Behörde nach Möglichkeit im Voraus mitgeteilt.

(5) Behörden einer Vertragspartei, die Auskünfte nach den Bestimmungen dieses Kapitels anfordern, unterrichten die um die Auskunft ersuchten Personen über die Möglichkeit einer Offenlegung im Zusammenhang mit Gerichtsverfahren.

(6) Beantragen Dritte oder andere Behörden die Offenlegung der betreffenden Auskünfte, so ergreift die anfordernde Vertragspartei gegebenenfalls alle ihr nach den geltenden Gesetzen und sonstigen Vorschriften zur Verfügung stehenden Maßnahmen, um die Vertraulichkeit der Auskünfte zu wahren und die personenbezogenen Daten zu schützen, es sei denn, die auskunfterteilende Person stimmt einer anderen Vorgehensweise zu.

Artikel 6.9

Gebühren und Belastungen

Für Gebühren und Belastungen jeglicher Art, ausgenommen Zölle sowie die von der Begriffsbestimmung für Zölle nach Artikel 2.3 (Zölle) ausgenommenen Aufschläge, die im Zusammenhang mit der Ein- oder Ausfuhr erhoben werden, gilt Folgendes:

a) Gebühren und Belastungen dürfen nur für Dienstleistungen im Zusammenhang mit der jeweiligen Ein- oder Ausfuhr erhoben werden oder für Formalitäten, die zum Zwecke der Ein- oder Ausfuhr erforderlich sind;

b) Gebühren und Belastungen dürfen die Kosten der erbrachten Dienstleistung nicht überschreiten;

c) Gebühren und Belastungen dürfen nicht nach dem Wert berechnet werden;

d) für konsularische Dienste dürfen keine Gebühren und Belastungen erhoben werden;

e) die Angaben über Gebühren und Belastungen sind auf einem amtlich bekannt gegebenen Weg öffentlich bereitzustellen und, wenn möglich und realisierbar, auf einer amtlichen Website. Diese Angaben müssen die Begründung enthalten, warum die Gebühr oder Belastung für die Dienstleistung erhoben wird, des Weiteren sind die zuständige Behörde, die anfallenden Gebühren und Belastungen sowie der Zahlungszeitpunkt und die Zahlungsart aufzuführen, und

f) Gebühren und Belastungen dürfen erst geändert oder neu erhoben werden, wenn die Informationen nach Buchstabe e veröffentlicht und problemlos zugänglich sind.

Artikel 6.10

Vorversandkontrollen

Die Vertragsparteien verzichten auf die Durchführung von Vorversandkontrollen oder gleichwertigen Maßnahmen.

Artikel 6.11

Nachträgliche Zollkontrolle

Jede Vertragspartei räumt den Händlern die Möglichkeit ein, effiziente nachträgliche Zollkontrollen in Anspruch zu nehmen. Die nachträglichen Zollkontrollen dürfen für die Händler nicht mit unzulässigen oder ungerechtfertigten Auflagen oder Belastungen verbunden sein.

Artikel 6.12

Zollwertermittlung

Das WTO-Übereinkommen über den Zollwert ist ohne die Vorbehalte und Möglichkeiten seines Artikels 20 und seines Anhangs III Absätze 2 bis 4 mutatis mutandis Bestandteil dieses Abkommens.

Artikel 6.13

Zusammenarbeit im Zollwesen

(1) Die Vertragsparteien verbessern ihre Zusammenarbeit in Zoll- und zollbezogenen Fragen.

(2) Die Vertragsparteien verpflichten sich, handelserleichternde Maßnahmen in Zollfragen auszuarbeiten, wobei sie den diesbezüglichen Arbeiten internationaler Organisationen Rechnung tragen. Dies kann die Erprobung neuer Zollverfahren beinhalten.

(3) Die Vertragsparteien bekräftigen ihre Verpflichtung, den rechtmäßigen Warenverkehr zu erleichtern, und tauschen Fachwissen über Maßnahmen zur Verbesserung der Zolltechniken und -verfahren und über EDV-Systeme aus, um dieser Verpflichtung nach den Bestimmungen dieses Abkommens nachzukommen.

(4) Die Vertragsparteien verpflichten sich:

a) die im Handel verwendeten Unterlagen und Datenelemente im Einklang mit internationalen Normen zu harmonisieren, um den bilateralen Handelsverkehr in zollbezogenen Fragen der Ein-, Aus- und Durchfuhr von Waren zu erleichtern,

b) die Zusammenarbeit zwischen ihren Zolllabors und wissenschaftlichen Abteilungen zu vertiefen und auf die Harmonisierung von Zolllaborverfahren hinzuarbeiten,

c) Zollmitarbeiter/innen auszutauschen,

d) gemeinsam Fortbildungsveranstaltungen über zollbezogene Angelegenheiten für Mitarbeiter zu organisieren, die direkt an Zollverfahren beteiligt sind,

e) wirksame Instrumente zur Kommunikation mit den Akteuren in Wirtschaft und Handel zu entwickeln,

f) sich im Rahmen der praktischen Durchführbarkeit gegenseitig bei der zolltariflichen Einreihung, der Zollwertermittlung und der Ursprungsbestimmung zum Zwecke der Zollpräferenzbehandlung eingeführter Waren zu unterstützen,

g) die entschiedene und effiziente Durchsetzung der Rechte des geistigen Eigentums durch die Zollbehörden bei der Einfuhr, Ausfuhr, Wiederausfuhr, Durchfuhr, Umladung und bei sonstigen Zollverfahren zu unterstützen, insbesondere, wenn nachgeahmte Waren betroffen sind, und

h) die Sicherheit von Seecontainern und sonstigen Sendungen jeder Herkunft zu verbessern, die in die Vertragsparteien eingeführt oder dort umgeladen werden oder sich dort auf der Durchfuhr befinden, und zwar bei gleichzeitiger Erleichterung des Handels. Die Vertragsparteien kommen überein, dass die Zielsetzung der stärkeren und breiteren Zusammenarbeit unter anderem auch darin besteht,

i) die zollbezogenen Aspekte bei der Sicherung der logistischen Kette im internationalen Handel gemeinsam zu vertiefen und

ii) eine bestmögliche Koordinierung der Standpunkte in den multilateralen Gremien zu erreichen, in denen Fragen zur Containersicherheit in geeigneter Weise zur Sprache gebracht und erörtert werden können.

(5) Die Vertragsparteien erkennen an, dass ihre technische Zusammenarbeit für die einfachere Erfüllung der Verpflichtungen aus diesem Abkommen und für die bestmögliche Erleichterung des Handels unabdingbar ist. Die Vertragsparteien kommen überein, über ihre Zollverwaltungen ein Programm zur technischen Zusammenarbeit in Zoll- und zollbezogenen Bereichen zu entwickeln, bei dem sie sich gemeinsam auf den Umfang, die Zeitplanung und die Kosten der Kooperationsmaßnahmen verständigen.

(6) Mit Hilfe ihrer Zollverwaltungen und sonstigen für Grenzangelegenheiten zuständigen Stellen durchsuchen die Vertragsparteien einschlägige internationale Vorhaben zur Handelserleichterung, darunter die Arbeiten der WTO und der WZO, auf Bereiche, in denen weitere gemeinsame Maßnahmen den Handel zwischen den Vertragsparteien erleichtern und gemeinsame multilaterale Ziele fördern würden. Die Vertragsparteien verständigen sich, wo immer möglich, auf gemeinsame Standpunkte in internationalen Organisationen, die sich mit Zollfragen und Handelserleichterungen befassen, insbesondere in der WTO und der WZO.

(7) Die Vertragsparteien unterstützen einander bei der Um- und Durchsetzung dieses Kapitels, des Protokolls über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen sowie ihrer Gesetze und sonstigen Vorschriften im Zollbereich.

Artikel 6.14

Amtshilfe im Zollbereich

(1) Die Vertragsparteien leisten einander Amtshilfe im Zollbereich nach Maßgabe des Protokolls über die gegenseitige Amtshilfe im Zollbereich.

(2) Die Vertragsparteien dürfen sich in Fragen, die sich aus Artikel 9 Absatz 1 des Protokolls über die gegenseitige Amtshilfe im Zollbereich ergeben, nicht auf Kapitel Vierzehn (Streitbeilegung) berufen.

Artikel 6.15

Zollkontaktstellen

(1) Die Vertragsparteien tauschen Verzeichnisse benannter Stellen aus, die bei Fragen kontaktiert werden können, die sich aus diesem Kapitel und dem Protokoll über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen ergeben.

(2) Die Zollkontaktstellen sind bestrebt, operative Sachverhalte, die in diesem Kapitel geregelt sind, im Rahmen von Konsultationen zu klären. Wenn die Kontaktstellen einen Sachverhalt nicht klären können, wird die Angelegenheit an den in diesem Kapitel genannten Zollausschuss verwiesen.

Artikel 6.16

Zollausschuss

(1) Der nach Artikel 15.2 Absatz 1 (Sonderausschüsse) eingesetzte Zollausschuss stellt das ordnungsgemäße Funktionieren dieses Kapitels, des Protokolls über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen und des Protokolls über die gegenseitige Amtshilfe im Zollbereich sicher; darüber hinaus geht er allen Fragen nach, die sich aus ihrer Anwendung ergeben. Er untersteht in Angelegenheiten, die in diesem Abkommen geregelt sind, dem Handelsauschuss, der nach Artikel 15.1 Absatz 1 (Handelsausschuss) eingesetzt wird.

(2) Dem Zollausschuss gehören Vertreter der Zollbehörden der Vertragsparteien an, ferner Vertreter sonstiger Behörden, die für Zollangelegenheiten und Fragen der Handelserleichterung, für die Durchführung des Protokolls über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen sowie des Protokolls über die gegenseitige Amtshilfe im Zollbereich zuständig sind.

(3) Der Zollausschuss gibt sich eine Geschäftsordnung und tritt in jährlichem Wechsel an einem in einer der Vertragsparteien gelegenen Ort zusammen.

(4) Auf Ersuchen einer Vertragspartei trifft sich der Zollausschuss zur Erörterung und Beilegung von Differenzen, die zwischen den Vertragsparteien aufgrund von Angelegenheiten auftreten können, die in diesem Kapitel, im Protokoll über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen und im Protokoll über die gegenseitige Amtshilfe im Zollbereich geregelt sind; dazu zählen auch Fragen der Handelserleichterung, der zolltariflichen Einreihung, des Warenursprungs und der Amtshilfe in Zollbelangen, insbesondere soweit sie die Artikel 7 und 8 des Protokolls über die gegenseitige Amtshilfe im Zollbereich betreffen.

(5) Der Zollausschuss darf Entschließungen verabschieden, Empfehlungen aussprechen und Stellungnahmen abgeben, die ihm zum Erreichen der gemeinsamen Ziele und zum reibungslosen Funktionieren der mit diesem Kapitel, dem Protokoll über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen sowie dem Protokoll über die gegenseitige Amtshilfe im Zollbereich eingeführten Instrumente notwendig erscheinen.

KAPITEL SIEBEN

DIENSTLEISTUNGSHANDEL, NIEDERLASSUNG UND ELEKTRONISCHER GESCHÄFTSVERKEHR

ABSCHNITT A

Allgemeine Bestimmungen

Artikel 7.1

Ziel und Geltungsbereich

(1) Die Vertragsparteien bekräftigen ihre Rechte und Pflichten aus dem WTO-Übereinkommen und schaffen die erforderlichen Grundlagen für die schrittweise gegenseitige Liberalisierung des Dienstleistungshandels und der Niederlassung und für die Zusammenarbeit auf dem Gebiet des elektronischen Geschäftsverkehrs.

(2) Dieses Kapitel ist nicht so auszulegen, als enthalte es Verpflichtungen hinsichtlich des öffentlichen Beschaffungswesens.

(3) Dieses Kapitel gilt nicht für Subventionen oder Zuschüsse, die von einer Vertragspartei gewährt werden; dazu zählen auch staatlich geförderte Darlehen, Bürgschaften und Versicherungen.

(4) Im Einklang mit diesem Kapitel behält jede Vertragspartei ihr Regulierungsrecht und ihr Recht, neue Vorschriften zu erlassen, um legitime politische Ziele zu erreichen.

(5) Dieses Kapitel gilt weder für Maßnahmen, die natürliche Personen betreffen, welche sich um Zugang zum Beschäftigungsmarkt einer Vertragspartei bemühen, noch für Maßnahmen, die die Staatsangehörigkeit, den Daueraufenthalt oder die Dauerbeschäftigung betreffen.

(6) Dieses Kapitel hindert eine Vertragspartei nicht daran, Maßnahmen zur Regelung der Einreise oder des vorübergehenden Aufenthalts natürlicher Personen in ihrem Gebiet zu treffen, einschließlich solcher Maßnahmen, die zum Schutz der Unversehrtheit ihrer Grenzen und zur Gewährleistung des ordnungsgemäßen grenzüberschreitenden Verkehrs natürlicher Personen erforderlich sind; jedoch dürfen solche Maßnahmen nicht auf eine Weise angewendet werden, dass sie die Handelsvorteile, die der anderen Vertragspartei aufgrund einer besonderen Verpflichtung aus diesem Kapitel oder seinen Anhängen erwachsen, zunichte machen oder schmälern [4].

Artikel 7.2

Begriffsbestimmungen

Für die Zwecke dieses Kapitels gelten folgende Begriffsbestimmungen:

a) Maßnahme ist jede Maßnahme einer Vertragspartei, unabhängig davon, ob sie in Form eines Gesetzes, einer sonstigen Vorschrift, einer Regel, eines Verfahrens, eines Beschlusses, eines Verwaltungsakts oder in sonstiger Form getroffen wird;

b) von einer Vertragspartei eingeführte oder aufrechterhaltene Maßnahmen sind Maßnahmen einer der folgenden Stellen:

i) zentrale, regionale oder örtliche Regierungen und Behörden oder

ii) nichtstaatliche Stellen in Ausübung der ihnen von einer zentralen, regionalen oder örtlichen Regierung oder Behörde übertragenen Befugnisse;

c) Person ist eine natürliche oder eine juristische Person;

d) natürliche Person ist eine Person, die nach den jeweiligen internen Rechtsvorschriften die Staatsangehörigkeit Koreas oder eines Mitgliedstaats der Europäischen Union besitzt;

e) juristische Person ist eine nach geltendem Recht ordnungsgemäß gegründete oder anderweitig errichtete rechtsfähige Organisationseinheit unabhängig davon, ob sie der Gewinnerzielung dient und ob sie sich in privatem oder staatlichem Eigentum befindet, einschließlich Kapitalgesellschaften, treuhänderisch tätiger Einrichtungen, Personengesellschaften, Jointventures, Einzelunternehmen und Verbänden;

f) juristische Person einer Vertragspartei ist

i) eine juristische Person, die nach den Rechtsvorschriften eines Mitgliedstaats der Europäischen Union oder Koreas gegründet wurde und ihren satzungsmäßigen Sitz, ihre Hauptverwaltung [5] oder den Schwerpunkt ihrer wirtschaftlichen Tätigkeit im Geltungsbereich des Vertrags über die Europäische Union und des Vertrags über die Arbeitsweise der Europäischen Union beziehungsweise in Korea hat. Hat die juristische Person lediglich ihren satzungsmäßigen Sitz oder ihre Hauptverwaltung im Geltungsbereich des Vertrags über die Europäische Union und des Vertrags über die Arbeitsweise der Europäischen Union oder in Korea, gilt sie nicht als juristische Person der Europäischen Union beziehungsweise Koreas, es sei denn, sie tätigt im Geltungsbereich des Vertrags über die Europäische Union und des Vertrags über die Arbeitsweise der Europäischen Union beziehungsweise in Korea in erheblichem Umfang Geschäfte [6], oder

ii) im Falle einer Niederlassung im Sinne des Artikels 7.9 Buchstabe a eine juristische Person, die im Eigentum oder unter der Kontrolle einer natürlichen Person der EU-Vertragspartei beziehungsweise Koreas oder einer juristischen Person der Europäischen Union beziehungsweise Koreas im Sinne von Ziffer i steht.

Eine juristische Person

i) steht im Eigentum von Personen der EU-Vertragspartei oder Koreas, wenn sich mehr als 50 v. H. ihres Eigenkapitals im wirtschaftlichen Eigentum von Personen der EU-Vertragspartei beziehungsweise Koreas befinden,

ii) steht unter der Kontrolle von Personen der EU-Vertragspartei oder Koreas, wenn solche Personen befugt sind, die Mehrheit ihrer Direktoren zu benennen oder ihre Tätigkeit auf andere Weise rechtlich zu bestimmen,

iii) ist verbunden mit einer anderen Person, wenn sie die Kontrolle über die andere Person ausübt oder unter deren Kontrolle steht oder wenn sie und die andere Person beide unter der Kontrolle derselben Person stehen;

g) ungeachtet des Buchstabens f fallen Reedereien, die außerhalb der EU-Vertragspartei oder Koreas niedergelassen sind und unter der Kontrolle von Staatsangehörigen eines Mitgliedstaats der Europäischen Union beziehungsweise von Staatsangehörigen Koreas stehen, ebenfalls unter dieses Abkommen, sofern ihre Schiffe in diesem Mitgliedstaat der Europäischen Union beziehungsweise in Korea nach den dort geltenden Rechtsvorschriften registriert sind und unter der Flagge eines Mitgliedstaats der Europäischen Union beziehungsweise Koreas fahren [7];

h) Abkommen über wirtschaftliche Integration ist ein Abkommen, mit dem Dienstleistungshandel und Niederlassung nach den WTO-Regeln, insbesondere den Artikeln V und Vbis des GATS, in erheblichem Umfang liberalisiert werden;

i) Luftfahrzeugreparatur- und -wartungsdienstleistungen bezeichnet derartige Arbeiten an einem aus dem Verkehr gezogenen Luftfahrzeug oder Luftfahrzeugteil und schließt die von den Luftfahrtunternehmen durchgeführten Wartungsarbeiten aus;

j) Dienstleistungen computergesteuerter Buchungssysteme (im Folgenden "CRS" für "Computer Reservation Systems" genannt) bezeichnet Dienstleistungen, die mit Hilfe computergestützter Systeme erbracht werden, welche Informationen über die Flugpläne von Luftfahrtunternehmen, die Verfügbarkeit von Beförderungskapazitäten, Flugpreise und Flugpreisregelungen enthalten und mit deren Hilfe Buchungen vorgenommen oder Flugscheine ausgestellt werden können;

k) Verkauf und Vermarktung von Luftverkehrsdienstleistungen bezeichnet die Möglichkeiten des betreffenden Luftfahrtunternehmens zum freien Verkauf und zur freien Vermarktung seiner Luftverkehrsdienstleistungen einschließlich aller Aspekte der Vermarktung wie Marktforschung, Werbung und Vertrieb. Darunter fallen nicht die Festsetzung von Preisen für Luftverkehrsdienstleistungen und die dafür geltenden Bedingungen, und

l) Dienstleister ist jede Person, die eine Dienstleistung erbringt oder erbringen will, auch als Investor.

Artikel 7.3

Ausschuss "Dienstleistungshandel, Niederlassung und elektronischer Geschäftsverkehr"

(1) Der nach Artikel 15.2 Absatz 1 (Sonderausschüsse) eingesetzte Ausschuss "Dienstleistungshandel, Niederlassung und elektronischer Geschäftsverkehr" setzt sich aus Vertretern der Vertragsparteien zusammen. Die Hauptvertreter der Vertragsparteien für den Ausschuss sind je ein Beamter/eine Beamtin der für die Durchführung dieses Kapitels zuständigen Behörden.

(2) Der Ausschuss

a) überwacht und bewertet die Durchführung dieses Kapitels,

b) befasst sich auf Ersuchen einer Vertragspartei mit Fragen, die sich aus diesem Kapitel ergeben, und

c) räumt einschlägigen Behörden Möglichkeiten ein, Informationen über aufsichtsrechtliche Maßnahmen im Zusammenhang mit Artikel 7.46 auszutauschen.

ABSCHNITT B

Grenzüberschreitende Erbringung von Dienstleistungen

Artikel 7.4

Geltungsbereich und Begriffsbestimmungen

(1) Dieser Abschnitt gilt für Maßnahmen der Vertragsparteien, die sich auf die grenzüberschreitenden Leistungen aller Dienstleistungssektoren mit Ausnahme folgender Bereiche auswirken:

a) audiovisuelle Dienstleistungen [8],

b) Seekabotage im Inlandsverkehr und

c) inländische und internationale Luftverkehrsdienstleistungen im Linien- wie im Gelegenheitsluftverkehr sowie Dienstleistungen, die in direktem Zusammenhang mit der Ausübung von Verkehrsrechten stehen, ausgenommen:

i) Luftfahrzeugreparatur- und -wartungsdienstleistungen,

ii) Verkauf und Vermarktung von Luftverkehrsdienstleistungen,

iii) Dienstleistungen computergesteuerter Buchungssysteme (CRS) und

iv) sonstige Hilfsdienstleistungen für den Luftverkehr, wie Bodenabfertigungsdienste, Dienstleistungen der Vermietung von Luftfahrzeugen mit Besatzung und Flughafenverwaltung.

(2) Maßnahmen, die sich auf die grenzüberschreitende Erbringung von Dienstleistungen auswirken, beinhalten Maßnahmen mit Auswirkungen auf

a) die Produktion, den Vertrieb, die Vermarktung, den Verkauf und die Bereitstellung einer Dienstleistung,

b) den Kauf, die Bezahlung oder die Nutzung einer Dienstleistung,

c) den Zugang zu und die Nutzung, im Zusammenhang mit der Erbringung einer Dienstleistung, von Netzen oder Dienstleistungen, die die Vertragsparteien der Öffentlichkeit allgemein anbieten müssen, und

d) die Anwesenheit eines Dienstleisters der einen Vertragspartei im Gebiet der anderen Vertragspartei.

(3) Für die Zwecke dieses Abschnitts gelten folgende Begriffsbestimmungen:

a) Grenzüberschreitende Erbringung von Dienstleistungen ist die Erbringung einer Dienstleistung

i) aus dem Gebiet der einen Vertragspartei in das Gebiet der anderen Vertragspartei und

ii) im Gebiet der einen Vertragspartei für einen Dienstleistungsempfänger der anderen Vertragspartei,

b) Dienstleistungen schließt jede Art von Dienstleistungen in jedem Sektor ein mit Ausnahme solcher, die in Ausübung hoheitlicher Gewalt erbracht werden, und

c) in Ausübung hoheitlicher Gewalt erbrachte Dienstleistung ist jede Art von Dienstleistung, die weder zu kommerziellen Zwecken noch im Wettbewerb mit einem oder mehreren Dienstleistern erbracht wird.

Artikel 7.5

Marktzugang

(1) Hinsichtlich des Marktzugangs durch grenzüberschreitende Erbringung von Dienstleistungen gewährt jede Vertragspartei den Dienstleistungen und Dienstleistern der anderen Vertragspartei eine Behandlung, die nicht weniger günstig ist als die Behandlung nach Maßgabe der Bestimmungen, Beschränkungen und Bedingungen, die in den besonderen Verpflichtungen in Anhang 7-A vereinbart und aufgeführt sind.

(2) In Sektoren, in denen Marktzugangsverpflichtungen übernommen werden, werden die Maßnahmen, die eine Vertragspartei weder regional noch für ihr gesamtes Gebiet einführen oder aufrechterhalten darf, sofern in Anhang 7-A nichts anderes festgelegt ist, wie folgt definiert:

a) Beschränkungen der Anzahl der Dienstleister in Form von zahlenmäßigen Quoten, Monopolen oder Dienstleistern mit ausschließlichen Rechten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung [9],

b) Beschränkungen des Gesamtwerts der Dienstleistungsgeschäfte oder des Betriebsvermögens in Form zahlenmäßiger Quoten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung und

c) Beschränkungen der Gesamtzahl der Dienstleistungen oder des Gesamtvolumens erbrachter Dienstleistungen durch Festsetzung bestimmter zahlenmäßiger Einheiten in Form von Quoten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung [10].

Artikel 7.6

Inländerbehandlung

(1) In den Sektoren, in denen Marktzugangsverpflichtungen nach Anhang 7-A gelten, gewährt jede Vertragspartei unter den darin festgelegten Bedingungen und Vorbehalten den Dienstleistungen und Dienstleistern der anderen Vertragspartei hinsichtlich aller Maßnahmen, die die Erbringung grenzüberschreitender Dienstleistungen betreffen, eine Behandlung, die nicht weniger günstig ist als die Behandlung, die sie ihren eigenen gleichen Dienstleistungen und Dienstleistern gewährt.

(2) Eine Vertragspartei kann das Erfordernis des Absatzes 1 dadurch erfüllen, dass sie den Dienstleistungen und Dienstleistern der anderen Vertragspartei eine Behandlung gewährt, die mit der Behandlung, die sie ihren eigenen gleichen Dienstleistungen und Dienstleistern gewährt, entweder formal identisch ist oder sich formal von ihr unterscheidet.

(3) Eine formal identische oder formal unterschiedliche Behandlung gilt dann als weniger günstig, wenn sie die Wettbewerbsbedingungen zugunsten der Dienstleistungen oder Dienstleister der einen Vertragspartei gegenüber gleichen Dienstleistungen oder Dienstleistern der anderen Vertragspartei verändert.

(4) Die nach diesem Artikel übernommenen besonderen Verpflichtungen sind nicht dahingehend auszulegen, dass eine Vertragspartei Ausgleich für etwaige natürliche Wettbewerbsnachteile gewähren muss, die sich daraus ergeben, dass die betreffenden Dienstleistungen oder Dienstleister aus dem Ausland stammen.

Artikel 7.7

Verpflichtungslisten

(1) Die nach diesem Abschnitt von jeder Vertragspartei liberalisierten Sektoren und die für Dienstleistungen und Dienstleister der anderen Vertragspartei in diesen Sektoren geltenden, als Vorbehalte formulierten Beschränkungen des Marktzugangs und der Inländerbehandlung sind in den Verpflichtungslisten in Anhang 7-A aufgeführt.

(2) Keine Vertragspartei führt gegenüber Dienstleistungen oder Dienstleistern der anderen Vertragspartei neue diskriminierende Maßnahmen oder Maßnahmen ein, die stärker diskriminierend sind als die Behandlung, die entsprechend den nach Absatz 1 eingegangenen besonderen Verpflichtungen gewährt wird.

Artikel 7.8

Meistbegünstigung [11]

(1) Bei allen unter diesen Abschnitt fallenden Maßnahmen, die die grenzüberschreitende Erbringung von Dienstleistungen betreffen, gewährt jede Vertragspartei vorbehaltlich anders lautender Bestimmungen dieses Artikels den Dienstleistungen und Dienstleistern der anderen Vertragspartei eine Behandlung, die nicht weniger günstig ist als die Behandlung, die sie gleichen Dienstleistungen und Dienstleistern eines Drittlandes im Rahmen eines nach Inkrafttreten dieses Abkommens unterzeichneten Abkommens über wirtschaftliche Integration gewährt.

(2) Die sich aus einem Abkommen über regionale wirtschaftliche Integration ergebende Behandlung, die eine Vertragspartei Dienstleistungen und Dienstleistern einer dritten Partei gewährt, ist nur dann von der Auflage des Absatzes 1 ausgenommen, wenn diese Behandlung aufgrund sektorspezifischer oder horizontaler Verpflichtungen gewährt wird, für die das Abkommen über regionale wirtschaftliche Integration ein Verpflichtungsniveau vorsieht, das deutlich über dem Niveau der in diesem Abschnitt eingegangenen, in Anhang 7-B aufgeführten Verpflichtungen liegt.

(3) Unbeschadet des Absatzes 2 gelten die sich aus Absatz 1 ergebenden Verpflichtungen nicht für Behandlungen

a) im Rahmen von Maßnahmen zur Anerkennung von Befähigungsnachweisen, Zulassungen oder aufsichtsrechtlichen Maßnahmen nach Artikel VII des GATS oder seiner Anlage zu Finanzdienstleistungen,

b) im Rahmen einer internationalen Übereinkunft, die sich ausschließlich oder hauptsächlich auf die Besteuerung bezieht, oder

c) im Rahmen von Maßnahmen, für die eine der in Anhang 7-C aufgeführten Ausnahmen von der Meistbegünstigung gilt.

(4) Dieses Kapitel ist nicht dahingehend auszulegen, dass es eine Vertragspartei daran hindert, angrenzenden Ländern Vorteile zu gewähren oder einzuräumen, um, beschränkt auf das unmittelbare Grenzgebiet, den Austausch von örtlich erbrachten und genutzten Dienstleistungen zu erleichtern.

ABSCHNITT C

Niederlassung

Artikel 7.9

Begriffsbestimmungen

Für die Zwecke dieses Abschnitts gelten folgende Begriffsbestimmungen:

a) Niederlassung ist

i) die Errichtung, der Erwerb oder die Fortführung einer juristischen Person [12] oder

ii) die Errichtung oder die Fortführung einer Zweigniederlassung oder Repräsentanz

im Gebiet einer Vertragspartei zum Zweck der Ausübung einer Wirtschaftstätigkeit;

b) Investor ist jede Person, die durch Begründung einer Niederlassung eine Wirtschaftstätigkeit ausüben möchte oder ausübt [13];

c) Wirtschaftstätigkeit umfasst alle Tätigkeiten wirtschaftlicher Art mit Ausnahme von in Ausübung hoheitlicher Gewalt durchgeführten Tätigkeiten, d. h. von Tätigkeiten, die weder zu kommerziellen Zwecken noch im Wettbewerb mit einem oder mehreren Wirtschaftsbeteiligten durchgeführt werden;

d) Tochtergesellschaft einer juristischen Person einer Vertragspartei ist eine juristische Person, die von einer anderen juristischen Person dieser Vertragspartei tatsächlich kontrolliert wird, und

e) Zweigniederlassung einer juristischen Person ist ein Geschäftssitz ohne Rechtspersönlichkeit, der auf Dauer als Außenstelle eines Stammhauses hervortritt, eine Geschäftsführung hat und sachlich so ausgestattet ist, dass er in der Weise Geschäfte mit Dritten tätigen kann, dass diese, obgleich sie wissen, dass möglicherweise ein Rechtsverhältnis mit dem im Ausland ansässigen Stammhaus begründet wird, sich nicht unmittelbar an dieses Stammhaus zu wenden brauchen.

Artikel 7.10

Geltungsbereich

Zwecks Verbesserung der zwischen den Vertragsparteien geltenden Rahmenbedingungen für Investitionen, insbesondere der Bedingungen für die Niederlassung, gilt dieser Abschnitt für Maßnahmen der Vertragsparteien, die die Niederlassung [14] in allen Wirtschaftstätigkeiten mit Ausnahme folgender Bereiche betreffen:

a) Abbau, Verarbeitung und Aufbereitung [15] von Kernmaterial,

b) Herstellung von Waffen, Munition und Kriegsmaterial [16] oder Handel damit,

c) audiovisuelle Dienstleistungen [17],

d) Seekabotage im Inlandsverkehr und

e) inländische und internationale Luftverkehrsdienstleistungen im Linien- wie im Gelegenheitsluftverkehr sowie Dienstleistungen, die in direktem Zusammenhang mit der Ausübung von Verkehrsrechten stehen, ausgenommen:

i) Luftfahrzeugreparatur- und -wartungsdienstleistungen,

ii) Verkauf und Vermarktung von Luftverkehrsdienstleistungen,

iii) Dienstleistungen computergesteuerter Buchungssysteme (CRS) und

iv) sonstige Hilfsdienstleistungen für den Luftverkehr, wie Bodenabfertigung, Vermietung von Luftfahrzeugen mit Besatzung und Flughafenverwaltung.

Artikel 7.11

Marktzugang

(1) Hinsichtlich des Marktzugangs durch Niederlassung gewährt jede Vertragspartei den Niederlassungen und Investoren der anderen Vertragspartei eine Behandlung, die nicht weniger günstig ist als die Behandlung nach Maßgabe der Bestimmungen, Beschränkungen und Bedingungen, die in den besonderen Verpflichtungen in Anhang 7-A vereinbart und aufgeführt sind.

(2) In Sektoren, in denen Marktzugangsverpflichtungen übernommen werden, werden die Maßnahmen, die eine Vertragspartei weder regional noch für ihr gesamtes Gebiet einführen oder aufrechterhalten darf, sofern in Anhang 7-A nichts anderes festgelegt ist, wie folgt definiert:

a) Beschränkungen der Anzahl der Niederlassungen in Form von zahlenmäßigen Quoten, Monopolen, ausschließlichen Rechten oder anderen Vorschriften für Niederlassungen wie wirtschaftliche Bedarfsprüfungen,

b) Beschränkungen des Gesamtwerts der Geschäfte oder des Betriebsvermögens in Form zahlenmäßiger Quoten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung,

c) Beschränkungen der Gesamtzahl der Geschäftsvorgänge oder des Gesamtvolumens der Produktion durch Festsetzung bestimmter zahlenmäßiger Einheiten in Form von Quoten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung [18],

d) Beschränkungen der Beteiligung ausländischen Kapitals durch Festsetzung einer prozentualen Höchstgrenze für ausländische Beteiligungen oder für den Gesamtwert einzelner oder zusammengefasster ausländischer Investitionen,

e) Maßnahmen, die bestimmte Formen rechtlicher Einheiten oder von Jointventures, durch die ein Investor der anderen Vertragspartei eine Wirtschaftstätigkeit ausüben kann, beschränken oder vorschreiben, und

f) Beschränkungen der Gesamtzahl natürlicher Personen, ausgenommen Personal in Schlüsselpositionen und Praktikanten mit Abschluss nach der Definition in Artikel 7.17, die in einem bestimmten Sektor beschäftigt werden dürfen oder die ein Investor beschäftigen darf und die zur Ausübung der Wirtschaftstätigkeit erforderlich sind und in direktem Zusammenhang damit stehen, in Form zahlenmäßiger Quoten oder des Erfordernisses einer wirtschaftlichen Bedarfsprüfung.

Artikel 7.12

Inländerbehandlung [19]

(1) In den in Anhang 7-A aufgeführten Sektoren gewährt jede Vertragspartei unter den darin festgelegten Bedingungen und Vorbehalten den Niederlassungen und Investoren der anderen Vertragspartei hinsichtlich aller Maßnahmen, die die Niederlassung betreffen, eine Behandlung, die nicht weniger günstig ist als die Behandlung, die sie ihren eigenen gleichen Niederlassungen und Investoren gewährt.

(2) Eine Vertragspartei kann das Erfordernis des Absatzes 1 dadurch erfüllen, dass sie Niederlassungen und Investoren der anderen Vertragspartei eine Behandlung gewährt, die mit der Behandlung, die sie ihren eigenen gleichen Niederlassungen und Investoren gewährt, entweder formal identisch ist oder sich formal von ihr unterscheidet.

(3) Eine formal identische oder formal unterschiedliche Behandlung gilt dann als weniger günstig, wenn sie die Wettbewerbsbedingungen zugunsten der Niederlassungen oder Investoren der einen Vertragspartei gegenüber gleichen Niederlassungen oder Investoren der anderen Vertragspartei verändert.

(4) Die nach diesem Artikel übernommenen besonderen Verpflichtungen sind nicht dahingehend auszulegen, dass eine Vertragspartei Ausgleich für etwaige natürliche Wettbewerbsnachteile gewähren muss, die sich daraus ergeben, dass die betreffenden Niederlassungen oder Investoren aus dem Ausland stammen.

Artikel 7.13

Verpflichtungslisten

(1) Die nach diesem Abschnitt von jeder Vertragspartei liberalisierten Sektoren und die für Niederlassungen und Investoren der anderen Vertragspartei in diesen Sektoren geltenden, als Vorbehalte formulierten Beschränkungen des Marktzugangs und der Inländerbehandlung sind in den Verpflichtungslisten in Anhang 7-A aufgeführt.

(2) Keine Vertragspartei führt gegenüber Niederlassungen und Investoren der anderen Vertragspartei neue diskriminierende Maßnahmen oder Maßnahmen ein, die stärker diskriminierend sind als die Behandlung, die entsprechend den nach Absatz 1 eingegangenen besonderen Verpflichtungen gewährt wird.

Artikel 7.14

Meistbegünstigung [20]

(1) Bei allen unter diesen Abschnitt fallenden Maßnahmen, die die Niederlassung betreffen, gewährt jede Vertragspartei vorbehaltlich anders lautender Bestimmungen dieses Artikels den Niederlassungen und Investoren der anderen Vertragspartei eine Behandlung, die nicht weniger günstig ist als die Behandlung, die sie gleichen Niederlassungen und Investoren eines Drittlandes im Rahmen eines nach Inkrafttreten dieses Abkommens unterzeichneten Abkommens über wirtschaftliche Integration gewährt [21].

(2) Die sich aus einem Abkommen über regionale wirtschaftliche Integration ergebende Behandlung, die eine Vertragspartei Niederlassungen und Investoren einer dritten Partei gewährt, ist nur dann von der Auflage des Absatzes 1 ausgenommen, wenn diese Behandlung aufgrund sektorspezifischer oder horizontaler Verpflichtungen gewährt wird, für die das Abkommen über regionale wirtschaftliche Integration ein Verpflichtungsniveau vorsieht, das deutlich über dem Niveau der in diesem Abschnitt eingegangenen, in Anhang 7-B aufgeführten Verpflichtungen liegt.

(3) Unbeschadet des Absatzes 2 gelten die sich aus Absatz 1 ergebenden Verpflichtungen nicht für Behandlungen

a) im Rahmen von Maßnahmen zur Anerkennung von Befähigungsnachweisen, Zulassungen oder aufsichtsrechtlichen Maßnahmen nach Artikel VII des GATS oder seiner Anlage zu Finanzdienstleistungen,

b) im Rahmen einer internationalen Übereinkunft, die sich ausschließlich oder hauptsächlich auf die Besteuerung bezieht, oder

c) im Rahmen von Maßnahmen, für die eine der in Anhang 7-C aufgeführten Ausnahmen von der Meistbegünstigung gilt.

(4) Dieses Kapitel ist nicht dahingehend auszulegen, dass es eine Vertragspartei daran hindert, angrenzenden Ländern Vorteile zu gewähren oder einzuräumen, um, beschränkt auf das unmittelbare Grenzgebiet, den Austausch von örtlich erbrachten und genutzten Dienstleistungen zu erleichtern.

Artikel 7.15

Andere Übereinkünfte

Dieses Kapitel ist nicht dahingehend auszulegen, dass es:

a) das Recht von Investoren der Vertragsparteien beschränkt, eine günstigere Behandlung in Anspruch zu nehmen, die in einem bestehenden oder künftigen internationalen Abkommen über Investitionen vorgesehen ist, bei dem einer der Mitgliedstaaten der Europäischen Union und Korea Vertragsparteien sind, und

b) die völkerrechtlichen Verpflichtungen der Vertragsparteien aus solchen Abkommen, die Investoren der Vertragsparteien eine günstigere Behandlung gewähren als die in diesem Abkommen vorgesehene Behandlung, außer Kraft setzt.

Artikel 7.16

Überprüfung der rechtlichen Rahmenbedingungen für Investitionen

(1) Im Hinblick auf die schrittweise Liberalisierung der Investitionen überprüfen die Vertragsparteien die rechtlichen Rahmenbedingungen [22] und das Umfeld für Investitionen sowie die Investitionsströme zwischen ihren Gebieten im Einklang mit ihren Verpflichtungen aus internationalen Abkommen spätestens drei Jahre nach Inkrafttreten dieses Abkommens und danach in regelmäßigen Abständen.

(2) Im Rahmen der Überprüfung nach Absatz 1 bewerten die Vertragsparteien möglicherweise aufgetretene Investitionshemmnisse und leiten Verhandlungen über die Beseitigung dieser Hemmnisse mit dem Ziel ein, die Bestimmungen dieses Kapitels auch im Hinblick auf allgemeine Grundsätze des Investitionsschutzes zu vertiefen.

ABSCHNITT D

Vorübergehende Präsenz natürlicher Personen zu Geschäftszwecken

Artikel 7.17

Geltungsbereich und Begriffsbestimmungen

(1) Dieser Abschnitt gilt vorbehaltlich des Artikels 7.1 Absatz 5 für Maßnahmen der Vertragsparteien, die die Einreise von Personal in Schlüsselpositionen, Praktikanten mit Abschluss, Verkäufern von Unternehmensdienstleistungen, Erbringern vertraglicher Dienstleistungen und Freiberuflern in ihre Gebiete und deren vorübergehenden Aufenthalt in diesen Gebieten betreffen.

(2) Für die Zwecke dieses Abschnitts gelten folgende Begriffsbestimmungen:

a) Personal in Schlüsselpositionen sind natürliche Personen, die bei einer keine gemeinnützige Einrichtung darstellenden juristischen Person einer Vertragspartei beschäftigt und für die Begründung oder die ordnungsgemäße Kontrolle, Verwaltung und den ordnungsgemäßen Betrieb einer Niederlassung verantwortlich sind. Personal in Schlüsselpositionen umfasst Geschäftsreisende, die für die Begründung einer Niederlassung zuständig sind, und unternehmensintern versetzte Personen;

i) Geschäftsreisende sind natürliche Personen in Führungspositionen, die für die Begründung einer Niederlassung zuständig sind. Sie tätigen keine Direktgeschäfte mit der breiten Öffentlichkeit und erhalten keine Vergütung aus einer Quelle innerhalb der aufgesuchten Vertragspartei; und

ii) unternehmensintern versetzte Personen sind natürliche Personen, die seit mindestens einem Jahr bei einer juristischen Person einer Vertragspartei beschäftigt oder an ihr beteiligt sind (ohne Mehrheitsaktionäre zu sein) und vorübergehend in eine Niederlassung (einschließlich Tochtergesellschaften, verbundene Unternehmen oder Zweigniederlassungen) im Gebiet der anderen Vertragspartei versetzt werden. Die betreffende natürliche Person gehört zu einer der folgenden Kategorien:

Führungskräfte

Natürliche Personen in Führungspositionen in einer juristischen Person, die in erster Linie die Niederlassung leiten, unter der allgemeinen Aufsicht des Vorstands oder der Aktionäre beziehungsweise Anteilseigner stehen und Weisungen hauptsächlich von ihnen erhalten; zu ihren Kompetenzen gehören:

A) die Leitung der Niederlassung oder einer Abteilung oder Unterabteilung der Niederlassung,

B) die Überwachung und Kontrolle der Arbeit des anderen aufsichtführenden Personals und der Fach- und Verwaltungskräfte und

C) die persönliche Befugnis zur Einstellung und Entlassung oder zur Empfehlung der Einstellung und Entlassung oder sonstiger Personalentscheidungen.

Fachkräfte

In einer juristischen Person beschäftigte natürliche Personen mit außergewöhnlichen Kenntnissen, die für Produktion, Forschungsausrüstung, Verfahren oder Verwaltung der Niederlassung unerlässlich sind. Bei der Bewertung dieser Kenntnisse wird neben besonderen Kenntnissen bezüglich der Niederlassung eine hohe Qualifikation für bestimmte Arbeiten oder Aufgaben, die spezifische technische Kenntnisse erfordern, sowie die Zugehörigkeit zu einem zulassungspflichtigen Beruf berücksichtigt.

b) Praktikanten mit Abschluss sind natürliche Personen, die seit mindestens einem Jahr bei einer juristischen Person einer Vertragspartei beschäftigt sind, über einen Hochschulabschluss verfügen und für Zwecke des beruflichen Fortkommens oder zur Ausbildung in Geschäftstechniken oder -methoden vorübergehend in eine Niederlassung im Gebiet der anderen Vertragspartei versetzt werden [23];

c) Verkäufer von Unternehmensdienstleistungen sind natürliche Personen, die Vertreter eines Dienstleisters einer Vertragspartei sind und zur Aushandlung oder zum Abschluss von Dienstleistungsaufträgen für diesen Dienstleister um vorübergehende Einreise in das Gebiet der anderen Vertragspartei ersuchen. Sie sind nicht im Direktverkauf an die breite Öffentlichkeit beschäftigt und erhalten keine Vergütung aus einer Quelle innerhalb der aufgesuchten Vertragspartei;

d) Erbringer vertraglicher Dienstleistungen sind natürliche Personen, die bei einer juristischen Person einer Vertragspartei beschäftigt sind, die im Gebiet der anderen Vertragspartei über keine Niederlassung verfügt und mit einem Endverbraucher in der letztgenannten Vertragspartei einen Bona-fide-Vertrag über die Erbringung von Dienstleistungen geschlossen hat, zu dessen Erfüllung die vorübergehende Präsenz ihrer Beschäftigten in dieser Vertragspartei erforderlich ist [24]; und

e) Freiberufler sind natürliche Personen, die eine Dienstleistung erbringen und im Gebiet einer Vertragspartei als Selbständige niedergelassen sind, im Gebiet der anderen Vertragspartei über keine Niederlassung verfügen und mit einem Endverbraucher in der letztgenannten Vertragspartei einen Bona-fide-Vertrag über die Erbringung von Dienstleistungen geschlossen haben, zu dessen Erfüllung ihre vorübergehende Präsenz in dieser Vertragspartei erforderlich ist [25].

Artikel 7.18

Personal in Schlüsselpositionen und Praktikanten mit Abschluss

(1) In den nach Abschnitt C liberalisierten Sektoren gestattet jede Vertragspartei den Investoren der anderen Vertragspartei unter den in Anhang 7-A aufgeführten Vorbehalten, natürliche Personen dieser anderen Vertragspartei in ihre Niederlassung zu versetzen, vorausgesetzt, bei diesen Beschäftigten handelt es sich um Personal in Schlüsselpositionen oder um Praktikanten mit Abschluss im Sinne des Artikels 7.17. Die vorübergehende Einreise und der vorübergehende Aufenthalt von Personal in Schlüsselpositionen und Praktikanten mit Abschluss ist im Fall von unternehmensintern versetzten Personen auf einen Zeitraum von drei Jahren [26], im Fall von Geschäftsreisenden auf 90 Tage je Zwölfmonatszeitraum [27] und im Fall von Praktikanten mit Abschluss auf ein Jahr begrenzt.

(2) Für die nach Abschnitt C liberalisierten Sektoren werden die Maßnahmen, die eine Vertragspartei nicht aufrechterhalten oder einführen darf, sofern in Anhang 7-A nichts anderes festgelegt ist, definiert als Beschränkungen der Gesamtzahl natürlicher Personen, die ein Investor in einem bestimmten Sektor als Personal in Schlüsselpositionen oder Praktikanten mit Abschluss versetzen darf, durch zahlenmäßige Quoten oder eine vorgeschriebene wirtschaftliche Bedarfsprüfung und als diskriminierende Beschränkungen [28].

Artikel 7.19

Verkäufer von Unternehmensdienstleistungen

In den nach Abschnitt B oder C liberalisierten Sektoren gestattet jede Vertragspartei Verkäufern von Unternehmensdienstleistungen unter den in Anhang 7-A aufgeführten Vorbehalten die vorübergehende Einreise und den vorübergehenden Aufenthalt für einen Zeitraum von bis zu 90 Tagen je Zwölfmonatszeitraum [29].

Artikel 7.20

Erbringer vertraglicher Dienstleistungen und Freiberufler

(1) Die Vertragsparteien bekräftigen ihre jeweiligen im Rahmen des GATS eingegangenen Verpflichtungen in Bezug auf die vorübergehende Einreise und den vorübergehenden Aufenthalt von Erbringern vertraglicher Dienstleistungen und von Freiberuflern.

(2) Spätestens zwei Jahre nach dem Abschluss der Verhandlungen gemäß Artikel XIX des GATS und gemäß der Ministererklärung der WTO-Ministerkonferenz vom 14. November 2001 erlässt der Handelsausschuss einen Beschluss, der eine Liste der Verpflichtungen hinsichtlich des Zugangs von Erbringern vertraglicher Dienstleistungen und von Freiberuflern einer Vertragspartei zum Gebiet der anderen Vertragspartei enthält. Die Verpflichtungen berücksichtigen die Ergebnisse dieser GATS-Verhandlungen und sind für beide Seiten vorteilhaft und handelspolitisch sinnvoll.

ABSCHNITT E

Regelungsrahmen

Unterabschnitt A

Allgemein anwendbare Bestimmungen

Artikel 7.21

Gegenseitige Anerkennung

(1) Dieses Kapitel hindert die Vertragsparteien nicht daran vorzuschreiben, dass natürliche Personen die erforderlichen Befähigungsnachweise und/oder die erforderliche Berufserfahrung besitzen müssen, die in dem Gebiet, in dem die Dienstleistung erbracht werden soll, für den betreffenden Tätigkeitsbereich festgelegt sind.

(2) Die Vertragsparteien ermutigen die zuständigen repräsentativen Berufsverbände in ihrem jeweiligen Gebiet, gemeinsam Empfehlungen über die gegenseitige Anerkennung auszuarbeiten und dem Handelsausschuss vorzulegen, die darauf abzielen, dass die von jeder Vertragspartei für die Genehmigung, Zulassung, Geschäftstätigkeit und Zertifizierung von Dienstleistern und Investoren in Dienstleistungssektoren sowie insbesondere im Bereich der freiberuflichen Dienstleistungen, einschließlich der vorübergehenden Zulassung, angewandten Kriterien durch die Dienstleister und Investoren in Dienstleistungssektoren vollständig oder teilweise erfüllt werden.

(3) Nach Eingang einer der in Absatz 2 genannten Empfehlungen prüft der Handelsausschuss die Empfehlung innerhalb einer angemessenen Frist darauf, ob sie mit diesem Abkommen vereinbar ist.

(4) Wird eine der in Absatz 2 genannten Empfehlungen nach dem Verfahren des Absatzes 3 als mit diesem Abkommen vereinbar erachtet und stimmen die einschlägigen Vorschriften der Vertragsparteien hinreichend überein, so handeln die Vertragsparteien im Hinblick auf die Umsetzung dieser Empfehlung über ihre zuständigen Behörden eine Vereinbarung über die gegenseitige Anerkennung (im Folgenden "MRA" für "Mutual Recognition Agreement" genannt) der Anforderungen, Befähigungsnachweise, Zulassungen und sonstiger Vorschriften aus.

(5) Eine solche Vereinbarung muss mit den einschlägigen Bestimmungen des WTO-Übereinkommens und insbesondere mit Artikel VII des GATS im Einklang stehen.

(6) Die nach Artikel 15.3 Absatz 1 (Arbeitsgruppen) eingesetzte Arbeitsgruppe "MRA" untersteht dem Handelsausschuss und setzt sich aus Vertretern der Vertragsparteien zusammen. Sofern die Vertragsparteien nichts anderes vereinbaren, tritt die Arbeitsgruppe innerhalb eines Jahres nach Inkrafttreten dieses Abkommens mit dem Ziel zusammen, die in Absatz 2 genannten Tätigkeiten zu unterstützen.

a) Die Arbeitsgruppe sollte für Dienstleistungen im Allgemeinen und gegebenenfalls für einzelne Dienstleistungen Folgendes prüfen:

i) Verfahren, mit denen die zuständigen Vertretungsorgane in ihrem jeweiligen Gebiet zur Prüfung ihres Interesses an der gegenseitigen Anerkennung ermutigt werden können, und

ii) Verfahren, mit denen die Ausarbeitung von Empfehlungen über die gegenseitige Anerkennung durch die zuständigen Vertretungsorgane gefördert werden kann.

b) Die Arbeitsgruppe fungiert als Kontaktstelle für Fragen im Zusammenhang mit der gegenseitigen Anerkennung, die von den zuständigen repräsentativen Berufsverbänden der Vertragsparteien angesprochen werden.

Artikel 7.22

Transparenz und vertrauliche Informationen

(1) Die Vertragsparteien beantworten mithilfe der nach Kapitel Zwölf (Transparenz) eingerichteten Mechanismen unverzüglich alle Ersuchen der anderen Vertragspartei um konkrete Informationen:

a) über internationale Übereinkünfte, einschließlich Übereinkünfte über die gegenseitige Anerkennung, die unter dieses Kapitel fallende Angelegenheiten betreffen oder berühren, und

b) über Normen und Kriterien für die Zulassung und Zertifizierung von Dienstleistern, einschließlich Informationen über die entsprechende Regulierungsbehörde oder andere Stelle, die hinsichtlich dieser Normen und Kriterien zu konsultieren ist. Zu diesen Normen und Kriterien gehören Anforderungen an Ausbildung, Prüfung, Erfahrung, Verhalten und Berufsethos, berufliche Entwicklung und Rezertifizierung, Geschäftstätigkeitsfeld, Kenntnis der örtlichen Gegebenheiten und Verbraucherschutz.

(2) Dieses Übereinkommen verpflichtet die Vertragsparteien nicht, vertrauliche Informationen bereitzustellen, deren Offenlegung die Durchsetzung von Gesetzen behindern oder in sonstiger Weise dem öffentlichen Interesse zuwiderlaufen oder die berechtigten Geschäftsinteressen bestimmter öffentlicher oder privater Unternehmen schädigen würde.

(3) Die Regulierungsbehörden der Vertragsparteien machen die geltenden Bestimmungen für die Stellung von Anträgen im Zusammenhang mit der Erbringung von Dienstleistungen einschließlich der Bestimmungen über gegebenenfalls vorzulegende Unterlagen öffentlich zugänglich.

(4) Die Regulierungsbehörde einer Vertragspartei erteilt dem Antragsteller auf Anfrage Auskunft über den Stand der Bearbeitung seines Antrags. Benötigt die Behörde zusätzliche Angaben des Antragstellers, so teilt sie ihm dies unverzüglich mit.

(5) Eine Regulierungsbehörde, die einen Antrag abgelehnt hat, erteilt dem abgewiesenen Antragsteller auf Anfrage so weit wie möglich Auskunft über die Gründe für die Ablehnung des Antrags.

(6) Die Regulierungsbehörde einer Vertragspartei erlässt innerhalb von 120 Tagen eine Verwaltungsentscheidung über einen vollständigen Antrag eines Investors oder eines Erbringers grenzüberschreitender Dienstleistungen der anderen Vertragspartei im Zusammenhang mit der Erbringung einer Dienstleistung und unterrichtet den Antragsteller umgehend über die Entscheidung. Ein Antrag gilt erst dann als vollständig, wenn alle einschlägigen Anhörungen stattgefunden haben und alle erforderlichen Informationen eingegangen sind. Kann innerhalb von 120 Tagen keine Entscheidung getroffen werden, so teilt die Regulierungsbehörde dies dem Antragsteller unverzüglich mit und bemüht sich anschließend, innerhalb einer angemessenen Frist zu einer Entscheidung zu gelangen.

Artikel 7.23

Innerstaatliche Vorschriften

(1) Bedarf die Erbringung einer Dienstleistung oder eine Niederlassung, für die eine besondere Verpflichtung übernommen wurde, der Genehmigung, so unterrichten die zuständigen Behörden einer Vertragspartei innerhalb einer angemessenen Frist nach der Vorlage eines nach den innerstaatlichen Gesetzen und sonstigen Vorschriften als vollständig erachteten Antrags den Antragsteller über die Entscheidung über den Antrag. Auf Antrag des Antragstellers unterrichten die zuständigen Behörden der Vertragspartei diesen unverzüglich über den Stand der Bearbeitung des Antrags.

(2) Von jeder Vertragspartei werden gerichtliche, schiedsrichterliche oder administrative Instanzen oder Verfahren eingerichtet oder unterhalten, die auf Antrag eines betroffenen Investors oder Dienstleisters eine umgehende Überprüfung von die Niederlassung, die grenzüberschreitende Erbringung von Dienstleistungen oder die vorübergehende Präsenz natürlicher Personen zu Geschäftszwecken betreffenden Verwaltungsentscheidungen sicherstellen und in begründeten Fällen geeignete Abhilfemaßnahmen gewährleisten. Können solche Verfahren nicht unabhängig von der Behörde durchgeführt werden, die für die Verwaltungsentscheidung zuständig ist, so tragen die Vertragsparteien Sorge dafür, dass die Verfahren tatsächlich eine objektive und unparteiische Überprüfung gewährleisten.

(3) Damit Maßnahmen, die Qualifikationserfordernisse und -verfahren, technische Normen und Zulassungserfordernisse betreffen, keine unnötigen Hemmnisse für den Dienstleistungshandel darstellen, bemüht sich jede Vertragspartei unter Anerkennung des Rechts, im Interesse von Gemeinwohlzielen die Erbringung von Dienstleistungen zu regulieren und neue Vorschriften hierfür einzuführen, für die einzelnen Sektoren in angemessener Weise zu gewährleisten, dass diese Maßnahmen

a) auf objektiven und transparenten Kriterien wie Kompetenz und Fähigkeit zur Erbringung der Dienstleistung beruhen und

b) im Fall von Zulassungsverfahren nicht an sich die Erbringung der Dienstleistung beschränken.

(4) Dieser Artikel wird erforderlichenfalls nach Konsultationen zwischen den Vertragsparteien dahingehend geändert, dass die Ergebnisse der Verhandlungen nach Artikel VI Absatz 4 des GATS oder die Ergebnisse ähnlicher Verhandlungen in anderen multilateralen Gremien, an denen beide Vertragsparteien teilnehmen, in dieses Abkommen aufgenommen werden, sobald sie wirksam werden.

Artikel 7.24

Governance

Jede Vertragspartei stellt sicher, soweit dies praktisch durchführbar ist, dass in ihrem Gebiet international vereinbarte Standards für die Regulierung und die Aufsicht im Finanzdienstleistungssektor sowie für die Bekämpfung von Steuerumgehung und -vermeidung umgesetzt und angewandt werden. International vereinbarte Standards dieser Art sind unter anderem die Grundsätze für eine wirksame Bankenaufsicht (Core Principle for Effective Banking Supervision) des Basler Ausschusses für Bankenaufsicht, die am 3. Oktober 2003 in Singapur angenommenen Grundsätze für die Versicherungsaufsicht und Methodik (Insurance Core Principles and Methodology) der Internationalen Vereinigung der Versicherungsaufsichtsbehörden, die Ziele und Grundsätze der Wertpapieraufsicht (Objectives and Principles of Securities Regulation) der Internationalen Organisation der Wertpapieraufsichtsbehörden, das Abkommen zum Informationsaustausch in Steuersachen (Agreement on Exchange of Information on Tax Matters) der Organisation für wirtschaftliche Zusammenarbeit und Entwicklung (im Folgenden "OECD" genannt), die Erklärung zu Transparenz und Informationsaustausch für Besteuerungszwecke (Statement on Transparency and Exchange of Information for Tax Purposes) der G-20 sowie die Vierzig Empfehlungen zur Bekämpfung von Geldwäsche (Forty Recommendations on Money Laundering) und die Neun Sonderempfehlungen zur Bekämpfung von Terrorismusfinanzierung (Nine Special Recommendations on Terrorist Financing) der Arbeitsgruppe Finanzielle Maßnahmen.

Unterabschnitt B

Computerdienstleistungen

Artikel 7.25

Computerdienstleistungen

(1) Bei der Liberalisierung des Handels mit Computerdienstleistungen nach den Abschnitten B bis D stimmen die Vertragsparteien der in den folgenden Absätzen festgelegten Vereinbarung zu.

(2) CPC [30] 84, der von den Vereinten Nationen verwendete Code für die Beschreibung von Computer- und verwandten Dienstleistungen, umfasst die grundlegenden Funktionen der Bereitstellung sämtlicher Computer- und verwandten Dienstleistungen einschließlich Computerprogrammen als Gesamtheit der Anweisungen und/oder Befehle, die für den Betrieb oder die Kommunikation von Computern notwendig sind (einschließlich ihrer Entwicklung und Implementierung), die Verarbeitung und Speicherung von Daten sowie verwandte Dienstleistungen wie Beratung und Schulung von Kundenmitarbeitern. Die technologische Entwicklung hat dazu geführt, dass diese Dienstleistungen zunehmend als Bündel oder Pakete verwandter Dienstleistungen angeboten werden, die mehrere oder alle dieser grundlegenden Funktionen beinhalten können. So ergeben sich Dienstleistungen wie Web- oder Domainhosting, Datamining (Datenschürfung) und Gridcomputing (Nutzung verteilter IT-Ressourcen) jeweils aus einer Kombination grundlegender Funktionen im Bereich der Computerdienstleistungen.

(3) Computer- und verwandte Dienstleistungen umfassen unabhängig davon, ob sie über ein Netz einschließlich Internet erbracht werden, die folgenden Leistungen:

a) Beratung, Entwicklung von Strategien, Analyse, Planung, Erstellung von Spezifikationen, Entwurf, Entwicklung, Installierung, Implementierung, Integrierung, Testen, Suche nach und Beseitigung von Fehlern, Aktualisierung, Support, technische Unterstützung oder Verwaltung von Computern oder Computersystemen oder für Computer oder Computersysteme,

b) Entwicklung oder Bereitstellung von Computerprogrammen sowie Beratung, Entwicklung von Strategien, Analyse, Planung, Erstellung von Spezifikationen, Entwurf, Entwicklung, Installierung, Implementierung, Integrierung, Testen, Suche nach und Beseitigung von Fehlern, Aktualisierung, Anpassung, Wartung, Support, technische Unterstützung, Verwaltung oder Nutzung von Computerprogrammen oder für Computerprogramme,

c) Datenverarbeitung, Datenspeicherung, Datahosting oder Datenbankdienstleistungen,

d) Wartung und Instandsetzung von Büromaschinen und -einrichtungen einschließlich Computern oder

e) Schulungen für Kundenmitarbeiter im Zusammenhang mit Computerprogrammen, Computern oder Computersystemen, die keiner anderen Kategorie zugeordnet sind.

(4) Computer- und verwandte Dienstleistungen ermöglichen auch die elektronische und anderweitige Erbringung anderer Dienstleistungen, etwa von Bankdienstleistungen. Die Vertragsparteien erkennen an, dass deutlich unterschieden werden muss zwischen der infrastrukturellen Dienstleistung wie Webhosting oder Anwendungshosting und der eigentlichen inhaltlichen Dienstleistung wie etwa der Bankdienstleistung, die elektronisch erbracht wird, und dass in solchen Fällen die eigentliche inhaltliche Dienstleistung nicht unter den Code CPC 84 fällt.

Unterabschnitt C

Post- und Kurierdienste

Artikel 7.26

Regelungsgrundsätze

Um den Wettbewerb im Bereich von nicht einem Monopol vorbehaltenen Post- und Kurierdiensten in jeder Vertragspartei zu gewährleisten, legt der Handelsausschuss spätestens drei Jahre nach Inkrafttreten dieses Abkommens die Grundsätze des Regelungsrahmens für diese Dienste fest. Mithilfe dieser Grundsätze sollen Fragen im Zusammenhang mit wettbewerbswidrigen Praktiken, Universaldienst, Einzellizenzen und der Art der Regulierungsbehörde geregelt werden [31].

Unterabschnitt D

Telekommunikationsdienste

Artikel 7.27

Geltungsbereich und Begriffsbestimmungen

(1) In diesem Unterabschnitt werden die Grundsätze des Regelungsrahmens für die nach den Abschnitten B bis D dieses Kapitels liberalisierten Basistelekommunikationsdienste [32], ausgenommen Rundfunk, festgelegt.

(2) Für die Zwecke dieses Unterabschnitts gelten folgende Begriffsbestimmungen:

a) Telekommunikationsdienste sind alle Dienstleistungen, die in der Übertragung und dem Empfang von elektromagnetischen Signalen bestehen, umfassen jedoch nicht die Wirtschaftstätigkeit, die in der Bereitstellung von Inhalten besteht, für deren Übermittlung Telekommunikation erforderlich ist;

b) öffentlicher Telekommunikationsdienst ist jede Art von Telekommunikationsdienst, der nach dem ausdrücklichen oder tatsächlichen Willen einer Vertragspartei der Öffentlichkeit im Allgemeinen angeboten werden muss;

c) öffentliches Telekommunikationsnetz ist die öffentliche Telekommunikationsinfrastruktur, welche die Telekommunikation zwischen und unter zwei oder mehr definierten Netzabschlüssen ermöglicht;

d) Regulierungsbehörde im Telekommunikationssektor ist eine Stelle, die mit der in diesem Unterabschnitt angeführten Regulierung der Telekommunikation betraut ist;

e) wesentliche Einrichtungen sind Einrichtungen eines öffentlichen Telekommunikationsnetzes und -dienstes,

i) die ausschließlich oder überwiegend von einem einzigen Anbieter oder einer begrenzten Anzahl von Anbietern von Dienstleistungen bereitgestellt werden und

ii) die bei der Erbringung einer Dienstleistung wirtschaftlich oder technisch praktisch nicht ersetzt werden können;

f) Hauptanbieter im Telekommunikationssektor ist ein Anbieter, der durch seine Kontrolle der wesentlichen Einrichtungen oder aufgrund seiner Stellung auf dem Markt die Bedingungen für eine Beteiligung an dem relevanten Markt für Telekommunikationsdienstleistungen (hinsichtlich des Preises und der Erbringung) erheblich beeinflussen kann;

g) Zusammenschaltung ist die Herstellung einer Verbindung zu Anbietern, die öffentliche Telekommunikationsnetze oder -dienste bereitstellen, damit die Nutzer des einen Anbieters mit den Nutzern eines anderen Anbieters kommunizieren können und Zugang zu den von diesem angebotenen Diensten erhalten, wenn hierfür besondere Verpflichtungen eingegangen wurden;

h) Universaldienst ist das Angebot an Diensten, das allen Nutzern im Gebiet einer Vertragspartei unabhängig von ihrem Standort zu einem erschwinglichen Preis zur Verfügung stehen muss [33];

i) Endnutzer ist ein Endverbraucher oder Teilnehmer eines öffentlichen Telekommunikationsdienstes, einschließlich eines Dienstleisters, bei dem es sich nicht um einen Anbieter öffentlicher Telekommunikationsdienste handelt;

j) nichtdiskriminierend ist eine Behandlung, die nicht weniger günstig ist als die Behandlung, die einem anderen Nutzer gleicher öffentlicher Telekommunikationsnetze oder -dienste unter gleichen Umständen eingeräumt wird, und

k) Nummernübertragbarkeit ist die Möglichkeit für Endnutzer öffentlicher Telekommunikationsdienste, ohne Beeinträchtigung von Qualität, Zuverlässigkeit oder Komfort bei einem Wechsel zwischen zur selben Kategorie gehörenden Anbietern öffentlicher Telekommunikationsdienste am selben Standort dieselben Rufnummern zu behalten.

Artikel 7.28

Regulierungsbehörde

(1) Die Regulierungsbehörden für Telekommunikationsdienstleistungen sind von den Anbietern der Telekommunikationsdienste rechtlich und organisatorisch unabhängig.

(2) Die Regulierungsbehörde muss mit ausreichenden Befugnissen zur Regulierung des Telekommunikationssektors ausgestattet sein. Die Aufgaben einer Regulierungsbehörde werden in klarer Form für die Öffentlichkeit leicht zugänglich gemacht, insbesondere dann, wenn sie mehr als einer Stelle übertragen sind.

(3) Die Entscheidungen und Verfahren der Regulierungsbehörde sind allen Marktteilnehmern gegenüber unparteiisch.

Artikel 7.29

Genehmigung zur Erbringung von Telekommunikationsdiensten

(1) Die Erbringung von Dienstleistungen wird, soweit praktisch durchführbar, nach einem vereinfachten Genehmigungsverfahren genehmigt.

(2) Zur Regelung von Fragen der Zuweisung von Frequenzen, Nummern und Wegerechten kann eine Lizenz erforderlich sein. Die Voraussetzungen und Bedingungen für eine solche Lizenz werden der Öffentlichkeit zugänglich gemacht.

(3) Soweit eine Lizenz erforderlich ist,

a) werden alle Lizenzierungskriterien und der vernünftig bemessene Zeitraum, der normalerweise erforderlich ist, um eine Entscheidung über einen Lizenzantrag zu treffen, der Öffentlichkeit bekannt gemacht;

b) werden die Gründe für die Verweigerung einer Lizenz dem Antragsteller auf Anfrage schriftlich mitgeteilt, und

c) dürfen die von einer Vertragspartei für die Erteilung einer Lizenz verlangten Lizenzgebühren [34] nicht die Verwaltungskosten übersteigen, die normalerweise mit der Verwaltung, der Kontrolle und der Durchsetzung der gültigen Lizenzen verbunden sind. [35]

Artikel 7.30

Für Hauptanbieter geltende Regeln zum Schutz des Wettbewerbs

Es werden geeignete Maßnahmen aufrechterhalten, um zu verhindern, dass Anbieter, die allein oder gemeinsam einen Hauptanbieter darstellen, wettbewerbswidrige Praktiken aufnehmen oder weiterverfolgen. Zu diesen wettbewerbswidrigen Praktiken gehören insbesondere

a) wettbewerbswidrige Quersubventionierung [36],

b) die Nutzung von von anderen Wettbewerbern erlangten Informationen in einer Art und Weise, die zu wettbewerbswidrigen Ergebnissen führt, und

c) das nicht rechtzeitige Zurverfügungstellen technischer Informationen über wesentliche Einrichtungen und geschäftlich relevante Informationen für andere Diensteanbieter, die diese für die Erbringung von Dienstleistungen benötigen.

Artikel 7.31

Zusammenschaltung

(1) Jede Vertragspartei stellt sicher, dass die Anbieter öffentlicher Telekommunikationsnetze oder -dienste in ihrem Gebiet den Anbietern öffentlicher Telekommunikationsdienste der anderen Vertragspartei direkt oder indirekt innerhalb desselben Gebiets die Möglichkeit geben, eine Zusammenschaltung auszuhandeln. Vereinbarungen zur Zusammenschaltung sollten grundsätzlich nach wirtschaftlichen Gesichtspunkten zwischen den betreffenden Unternehmen ausgehandelt werden.

(2) Die Regulierungsbehörden stellen sicher, dass Anbieter, die bei den Verhandlungen über Zusammenschaltungsvereinbarungen Informationen von einem anderen Unternehmen erhalten, diese nur für den Zweck nutzen, für den sie übermittelt wurden, und stets die Vertraulichkeit der übermittelten oder gespeicherten Informationen wahren.

(3) Die Zusammenschaltung mit einem Hauptanbieter wird an jedem Punkt im Netz gewährleistet, an dem dies technisch machbar ist. Die Zusammenschaltung erfolgt

a) unter nichtdiskriminierenden Voraussetzungen und Bedingungen (einschließlich der technischen Normen und Spezifikationen), zu nichtdiskriminierenden Tarifen und in einer Qualität, die nicht weniger günstig ist als die Qualität, die der Hauptanbieter für seine eigenen gleichen Dienste oder für gleiche Dienste nichtverbundener Diensteanbieter oder für gleiche Dienste seiner Tochtergesellschaften oder sonstiger verbundener Unternehmen bietet;

b) rechtzeitig, unter Voraussetzungen und Bedingungen (einschließlich der technischen Normen und Spezifikationen) und zu kostenorientierten Tarifen, die transparent, angemessen, wirtschaftlich gerechtfertigt und weit genug aufgegliedert sind, damit der Anbieter nicht für Netzkomponenten oder Einrichtungen zahlen muss, die er für die zu erbringende Dienstleistung nicht benötigt, und

c) auf Anfrage außer an den Netzabschlusspunkten, die der Mehrheit der Nutzer angeboten werden, auch an zusätzlichen Punkten zu Tarifen, die den Kosten für die erforderlichen zusätzlichen Einrichtungen Rechnung tragen.

(4) Die Verfahren für die Zusammenschaltung mit einem Hauptanbieter werden der Öffentlichkeit zugänglich gemacht.

(5) Die Hauptanbieter machen entweder ihre Zusammenschaltungsvereinbarungen oder ihre Standardzusammenschaltungsangebote der Öffentlichkeit zugänglich [37].

Artikel 7.32

Nummernübertragbarkeit

Jede Vertragspartei stellt sicher, dass die Anbieter öffentlicher Telekommunikationsdienste in ihrem Gebiet, ausgenommen Anbieter von VoIP-Diensten (Voice over Internet Protocol), unter angemessenen Voraussetzungen und zu angemessenen Bedingungen Nummernübertragbarkeit anbieten, soweit dies technisch möglich ist.

Artikel 7.33

Zuweisung und Nutzung knapper Ressourcen

(1) Alle Verfahren für die Zuweisung und Nutzung knapper Ressourcen einschließlich Frequenzen, Nummern und Wegerechten werden objektiv, rechtzeitig, transparent und ohne Diskriminierung durchgeführt.

(2) Der aktuelle Stand zugewiesener Frequenzbereiche wird öffentlich zugänglich gemacht; die genaue Ausweisung der für bestimmte staatliche Nutzungen zugewiesenen Frequenzen ist jedoch nicht erforderlich.

Artikel 7.34

Universaldienst

(1) Jede Vertragspartei kann die Universaldienstverpflichtungen festlegen, die sie beizubehalten wünscht.

(2) Solche Verpflichtungen gelten nicht von vornherein als wettbewerbswidrig, sofern sie auf transparente, objektive und nichtdiskriminierende Weise gehandhabt werden. Darüber hinaus muss mit solchen Verpflichtungen wettbewerbsneutral umgegangen werden und sie dürfen keine größeren Lasten auferlegen, als für die Art des von jeder Vertragspartei festgelegten Universaldienstes erforderlich ist.

Artikel 7.35

Vertraulichkeit der Informationen

Jede Vertragspartei stellt die Vertraulichkeit der mit öffentlichen Telekommunikationsnetzen und öffentlich zugänglichen Telekommunikationsdiensten erfolgenden Kommunikation und der damit verbundenen Verkehrsdaten sicher, ohne den Handel mit Dienstleistungen zu beschränken.

Artikel 7.36

Streitbeilegung im Telekommunikationsbereich

Anrufung

(1) Jede Vertragspartei stellt sicher, dass

a) Diensteanbieter eine Regulierungsbehörde oder eine andere zuständige Stelle der Vertragspartei anrufen können, um Streitigkeiten zwischen Diensteanbietern oder zwischen Diensteanbietern und Nutzern in Angelegenheiten dieses Unterabschnitts beizulegen, und

b) bei Streitigkeiten zwischen Anbietern von Telekommunikationsnetzen oder -diensten im Zusammenhang mit den sich aus diesem Unterabschnitt ergebenden Rechten und Pflichten eine einschlägige Regulierungsbehörde auf Antrag einer der Streitparteien eine verbindliche Entscheidung trifft, damit die Streitigkeit schnellstmöglich, in jedem Fall aber innerhalb einer angemessenen Frist beigelegt werden kann.

Rechtsbehelf und gerichtliche Überprüfung

(2) Ein Diensteanbieter, dessen rechtlich geschützte Interessen durch eine Entscheidung einer Regulierungsbehörde beeinträchtigt werden,

a) kann gegen diese Entscheidung bei einer Beschwerdestelle einen Rechtsbehelf einlegen [38]. Hat die Beschwerdestelle keinen gerichtlichen Charakter, so sind ihre Entscheidungen stets schriftlich zu begründen; ferner unterliegen ihre Entscheidungen einer Überprüfung durch eine unparteiische und unabhängige Justizbehörde. Entscheidungen der Beschwerdestellen werden wirksam durchgesetzt; und

b) kann die Entscheidung durch eine unparteiische und unabhängige Justizbehörde der Vertragspartei überprüfen lassen. Die Vertragsparteien dürfen nicht zulassen, dass ein Antrag auf gerichtliche Überprüfung die Nichtbefolgung der Entscheidung der Regulierungsbehörde begründet, es sei denn, diese Entscheidung wird von der zuständigen Justizbehörde ausgesetzt.

Unterabschnitt E

Finanzdienstleistungen

Artikel 7.37

Geltungsbereich und Begriffsbestimmungen

(1) In diesem Unterabschnitt werden die Grundsätze des Regelungsrahmens für alle nach den Abschnitten B bis D liberalisierten Finanzdienstleistungen festgelegt.

(2) Für die Zwecke dieses Unterabschnitts gelten folgende Begriffsbestimmungen:

Finanzdienstleistungen sind alle Dienstleistungen finanzieller Art, die von einem Finanzdienstleister einer Vertragspartei angeboten werden. Zu den Finanzdienstleistungen zählen folgende Tätigkeiten:

a) Versicherungsdienstleistungen und versicherungsbezogene Dienstleistungen:

i) Direktversicherung (einschließlich Mitversicherung):

A) Lebensversicherung,

B) Sachversicherung;

ii) Rückversicherung und Folgerückversicherung;

iii) Versicherungsvermittlung wie Leistungen von Versicherungsmaklern und -agenturen und

iv) versicherungsbezogene Hilfsdienstleistungen wie Beratung, Versicherungsmathematik, Risikobewertung und Schadensregulierung, und

b) Bank- und sonstige Finanzdienstleistungen (ausgenommen Versicherungsdienstleistungen):

i) Annahme von Spareinlagen und sonstigen rückzahlbaren Einlagen von Kunden;

ii) Ausreichung von Krediten jeder Art einschließlich Verbraucherkredit, Hypothekenkredit, Factoring und Finanzierung von Handelsgeschäften;

iii) Finanzleasing;

iv) sämtliche Zahlungs- und Überweisungsdienstleistungen einschließlich Kredit- und Scheckkarten, Reiseschecks und Bankwechsel;

v) Bürgschaften und Verpflichtungen;

vi) Geschäfte für eigene und für Kundenrechnung an Börsen, im Schalterverkehr oder in sonstiger Form mit:

A) Geldmarkttiteln (einschließlich Schecks, Wechsel, Einlagenzertifikate),

B) Devisen,

C) derivativen Instrumenten, darunter Futures und Optionen,

D) Wechselkurs- und Zinstiteln einschließlich Swaps, Kurssicherungsvereinbarungen,

E) begebbaren Wertpapieren und

F) sonstigen begebbaren Instrumenten und Finanzanlagen einschließlich ungeprägtem Gold;

vii) Beteiligung an Emissionen von Wertpapieren jeder Art einschließlich Übernahme und Platzierung von Emissionen als (öffentlicher oder privater) Finanzmakler sowie Erbringung von Dienstleistungen im Zusammenhang mit derartigen Emissionen;

viii) Geldmaklergeschäfte;

ix) Vermögensverwaltung wie Kassenhaltung und Bestandsverwaltung, alle Formen von kollektivem Anlagemanagement, Pensionsfondsverwaltung, Depotverwahrung, Auftrags- und Treuhandverwaltung;

x) Saldenausgleichs- und Verrechnungsdienstleistungen im Zusammenhang mit Finanzanlagen einschließlich Wertpapieren, derivativen Instrumenten und sonstigen begebbaren Instrumenten;

xi) Bereitstellung und Übermittlung von Finanzinformationen, Verarbeitung von Finanzdaten und Bereitstellung einschlägiger Software und

xii) Beratungs-, Vermittlungs- und sonstige Zusatzfinanzdienstleistungen in Bezug auf sämtliche unter den Ziffern i bis xi aufgeführte Tätigkeiten, einschließlich Kreditauskunft und Bonitätsprüfung, Anlage- und Vermögensbestandsanalyse und -beratung, Beratung über Akquisition, Unternehmensumstrukturierung und -Strategien;

Finanzdienstleister ist eine natürliche oder juristische Person einer Vertragspartei, die Finanzdienstleistungen erbringen möchte oder erbringt, jedoch keine öffentliche Stelle ist;

öffentliche Stelle ist

a) eine Regierung, eine Zentralbank oder eine Währungsbehörde einer Vertragspartei oder eine im Eigentum einer Vertragspartei stehende oder von ihr beherrschte Stelle, die hauptsächlich mit der Ausübung hoheitlicher Aufgaben oder von Tätigkeiten für hoheitliche Zwecke befasst ist, nicht jedoch eine Stelle, die hauptsächlich mit der Erbringung von Finanzdienstleistungen zu kommerziellen Bedingungen befasst ist, oder

b) eine private Stelle, die Aufgaben wahrnimmt, die normalerweise von einer Zentralbank oder Währungsbehörde wahrgenommen werden, wenn sie solche Aufgaben ausübt;

neue Finanzdienstleistung ist eine Dienstleistung finanzieller Art, einschließlich Dienstleistungen in Bezug auf bestehende und neue Produkte oder auf die Art und Weise, in der ein Produkt geliefert wird, die im Gebiet der einen Vertragspartei von keinem Finanzdienstleister erbracht wird, die jedoch im Gebiet der anderen Vertragspartei erbracht wird.

Artikel 7.38

Aufsichtsrechtliche Ausnahmeregelung [39]

(1) Jede Vertragspartei kann aus aufsichtsrechtlichen Gründen [40] unter anderem folgende Maßnahmen einführen oder aufrechterhalten:

a) Maßnahmen zum Schutz von Investoren, Einlegern, Versicherungsnehmern oder Personen, denen gegenüber ein Finanzdienstleister treuhänderische Pflichten hat, und

b) Maßnahmen zur Gewährleistung der Integrität und Stabilität des Finanzsystems der Vertragspartei.

(2) Diese Maßnahmen dürfen nicht belastender sein als zur Erreichung ihrer Ziele notwendig, und wenn sie nicht mit den übrigen Bestimmungen dieses Abkommens im Einklang stehen, dürfen sie nicht als Mittel zur Umgehung der Zusagen oder Verpflichtungen der Vertragsparteien aufgrund dieser Bestimmungen genutzt werden.

(3) Dieses Abkommen ist nicht dahingehend auszulegen, dass es eine Vertragspartei verpflichtet, Informationen über die Geschäfte und Bücher einzelner Kunden offenzulegen oder vertrauliche oder geschützte Informationen preiszugeben, die sich im Besitz öffentlicher Stellen befinden.

(4) Unbeschadet anderer Möglichkeiten der aufsichtsrechtlichen Regelung des grenzüberschreitenden Finanzdienstleistungsverkehrs kann eine Vertragspartei die Eintragung von Erbringern grenzüberschreitender Finanzdienstleistungen der anderen Vertragspartei sowie von Finanzinstrumenten vorschreiben.

Artikel 7.39

Transparenz

Die Vertragsparteien erkennen an, dass transparente Rechtsvorschriften und Maßnahmen, die die Tätigkeit von Finanzdienstleistern regeln, für die Erleichterung des Zugangs ausländischer Finanzdienstleister zu den jeweiligen Märkten und ihrer Geschäftstätigkeit auf diesen Märkten von Bedeutung sind. Jede Vertragspartei verpflichtet sich, die Transparenz der Regulierung von Finanzdienstleistungen zu fördern.

Artikel 7.40

Selbstregulierungsorganisationen

Verlangt eine Vertragspartei, dass Finanzdienstleister einer anderen Vertragspartei Mitglied einer Selbstregulierungsorganisation, einer Wertpapierbörse oder eines Terminkontraktmarkts, einer Verrechnungsstelle oder einer anderen Organisation oder Vereinigung sind oder daran beteiligt sind oder Zugang dazu haben, um auf der gleichen Grundlage wie die Finanzdienstleister der betreffenden Vertragspartei Finanzdienstleistungen erbringen zu können, oder stattet die Vertragspartei solche Einrichtungen unmittelbar oder mittelbar mit Vorrechten oder Vorteilen für die Erbringung von Finanzdienstleistungen aus, so stellt die Vertragspartei sicher, dass diese Selbstregulierungsorganisationen den Verpflichtungen nach den Artikeln 7.6, 7.8, 7.12 und 7.14 nachkommen.

Artikel 7.41

Zahlungs- und Verrechnungssysteme

Unter Bedingungen, zu denen die Inländerbehandlung gewährt wird, gewährt jede Vertragspartei den Finanzdienstleistern der anderen Vertragspartei, die in ihrem Gebiet niedergelassen sind, Zugang zu den von öffentlichen Stellen betriebenen Zahlungs- und Verrechnungssystemen sowie zu offiziellen Finanzierungs- und Refinanzierungsmöglichkeiten, die für die normale Ausübung der üblichen Geschäftstätigkeit zur Verfügung stehen. Mit diesem Artikel ist nicht beabsichtigt, Zugang zu den für Notfälle vorgesehenen letzten Finanzierungsmöglichkeiten einer Vertragspartei zu gewähren.

Artikel 7.42

Neue Finanzdienstleistungen

Jede Vertragspartei gestattet den in ihrem Gebiet niedergelassenen Finanzdienstleistern der anderen Vertragspartei, neue Finanzdienstleistungen zu erbringen, die die Vertragspartei ihren eigenen Finanzdienstleistern unter gleichen Umständen nach ihrem jeweiligen Recht zu erbringen gestatten würde, sofern die Einführung der neuen Finanzdienstleistung nicht den Erlass neuer oder die Änderung bestehender Rechtsvorschriften erfordert. Eine Vertragspartei kann bestimmen, in welcher institutionellen und rechtlichen Form die Dienstleistung erbracht werden kann, und eine Genehmigung für die Erbringung der Dienstleistung verlangen. Wird eine Genehmigung verlangt, so wird über ihre Erteilung innerhalb einer angemessenen Frist entschieden; die Genehmigung kann nur aus aufsichtsrechtlichen Gründen abgelehnt werden.

Artikel 7.43

Datenverarbeitung

Spätestens zwei Jahre nach Inkrafttreten dieses Abkommens, auf keinen Fall jedoch später als zu dem Zeitpunkt, an dem vergleichbare, sich aus anderen Abkommen über wirtschaftliche Integration ergebende Verpflichtungen wirksam werden,

a) gestattet jede Vertragspartei den in ihrem Gebiet niedergelassenen Finanzdienstleistern der anderen Vertragspartei, Informationen in elektronischer oder sonstiger Form für die Zwecke der Datenverarbeitung in ihr Gebiet und aus ihrem Gebiet zu übertragen, sofern diese Datenverarbeitung für den gewöhnlichen Geschäftsverkehr des betreffenden Finanzdienstleisters erforderlich ist, und

b) bekräftigt jede Vertragspartei ihre Verpflichtung [41] zum Schutz der Grundrechte und der Grundfreiheiten der Personen und ergreift ausreichende Maßnahmen für den Schutz der Privatsphäre, insbesondere bei der Übermittlung personenbezogener Daten.

Artikel 7.44

Besondere Ausnahmen

(1) Dieses Kapitel ist nicht dahingehend auszulegen, dass es eine Vertragspartei einschließlich ihrer öffentlichen Stellen an der alleinigen Ausübung oder Erbringung von Tätigkeiten oder Dienstleistungen in ihrem Gebiet hindert, die Teil einer staatlichen Alterssicherung oder eines gesetzlichen Systems der sozialen Sicherheit sind, außer in den Fällen, in denen diese Tätigkeiten nach ihren internen Rechtsvorschriften von Finanzdienstleistern im Wettbewerb mit öffentlichen Stellen oder privaten Einrichtungen ausgeübt werden können.

(2) Dieses Abkommen gilt nicht für Tätigkeiten einer Zentralbank oder einer Währungsbehörde oder einer sonstigen öffentlichen Stelle im Rahmen der Geld- oder Währungspolitik.

(3) Dieses Kapitel ist nicht dahingehend auszulegen, dass es eine Vertragspartei einschließlich ihrer öffentlichen Stellen an der alleinigen Ausübung oder Erbringung von Tätigkeiten oder Dienstleistungen in ihrem Gebiet für Rechnung oder mit Garantie oder unter Verwendung finanzieller Mittel der Vertragspartei einschließlich ihrer öffentlichen Stellen hindert, außer in den Fällen, in denen diese Tätigkeiten nach ihren internen Rechtsvorschriften von Finanzdienstleistern im Wettbewerb mit öffentlichen Stellen oder privaten Einrichtungen ausgeübt werden können.

Artikel 7.45

Streitbeilegung

(1) Kapitel Vierzehn (Streitbeilegung) findet Anwendung auf die Beilegung von ausschließlich im Rahmen dieses Kapitels auftretenden Streitigkeiten über Finanzdienstleistungen, sofern in diesem Artikel nichts anderes bestimmt ist.

(2) Der Handelsausschuss stellt spätestens sechs Monate nach Inkrafttreten dieses Abkommens eine Liste mit 15 Personen auf. Jede Vertragspartei schlägt fünf Personen vor; ferner wählen die Vertragsparteien fünf Personen aus, die nicht die Staatsangehörigkeit einer Vertragspartei besitzen und die im Schiedspanel den Vorsitz führen sollen. Diese Personen verfügen über Fachwissen oder Erfahrung in Finanzdienstleistungsrecht oder -praxis, wozu die Regulierung von Finanzdienstleistern gehören kann, und halten sich an Anhang 14-C (Verhaltenskodex für die Mitglieder der Schiedspanels und die Vermittler).

(3) Werden die Mitglieder des Panels nach Artikel 14.5 Absatz 3 (Einsetzung des Schiedspanels), Artikel 14.9 Absatz 3 (Angemessene Frist für die Durchführung der Entscheidung), Artikel 14.10 Absatz 3 (Überprüfung der Maßnahmen zur Durchführung der Entscheidung des Schiedspanels), Artikel 14.11 Absatz 4 (Vorläufige Abhilfemaßnahmen im Falle der Nichtdurchführung der Entscheidung), Artikel 14.12 Absatz 3 (Überprüfung der Durchführungsmaßnahmen nach der Aussetzung der Verpflichtungen), Artikel 6.1, 6.3 und 6.4 (Ersetzung) des Anhangs 14-B (Verfahrensordnung für das Schiedsverfahren) durch das Los bestimmt, so erfolgt die Auswahl aus der nach Absatz 2 aufgestellten Liste.

(4) Kommt ein Panel zu dem Schluss, dass eine Maßnahme gegen dieses Abkommen verstößt, und wirkt sich die strittige Maßnahme auf den Finanzdienstleistungssektor und einen anderen Sektor aus, so kann die Beschwerdeführerin unbeschadet des Artikels 14.11 Vorteile im Finanzdienstleistungssektor aussetzen, die von gleicher Wirkung sind wie die Maßnahme in ihrem Finanzdienstleistungssektor. Wirkt sich eine solche Maßnahme nur auf einen anderen als den Finanzdienstleistungssektor aus, so kann die Beschwerdeführerin keine Vorteile im Finanzdienstleistungssektor aufheben.

Artikel 7.46

Anerkennung

(1) Eine Vertragspartei kann bei der Festlegung, wie ihre den Bereich Finanzdienstleistungen betreffenden Maßnahmen anzuwenden sind, aufsichtsrechtliche Maßnahmen der anderen Vertragspartei anerkennen. Diese Anerkennung kann im Wege der Harmonisierung oder auf andere Weise erreicht werden und kann auf einer Übereinkunft oder Vereinbarung zwischen den Vertragsparteien beruhen oder einseitig gewährt werden.

(2) Eine Vertragspartei, die Vertragspartei einer Übereinkunft oder Vereinbarung der in Absatz 1 genannten Art mit einer dritten Partei ist, sei es zum Zeitpunkt des Inkrafttretens dieses Abkommens oder später, gibt der anderen Vertragspartei in geeigneter Form Gelegenheit, ihren Beitritt zu dieser Übereinkunft oder Vereinbarung oder eine vergleichbare Übereinkunft oder Vereinbarung mit ihr auszuhandeln, die eine gleichwertige Regelung, eine gleichwertige Überwachung und Umsetzung dieser Regelung und gegebenenfalls gleichwertige Verfahren für den Informationsaustausch zwischen den Vertragsparteien der Übereinkunft oder Vereinbarung vorsieht. Gewährt eine Vertragspartei die Anerkennung einseitig, so gibt sie der anderen Vertragspartei in geeigneter Form Gelegenheit nachzuweisen, dass die Voraussetzungen dafür erfüllt sind.

Unterabschnitt F

Internationale Seeverkehrsdienstleistungen

Artikel 7.47

Geltungsbereich, Begriffsbestimmungen und Grundsätze

(1) In diesem Unterabschnitt werden die Grundsätze für die Liberalisierung der Dienstleistungen im internationalen Seeverkehr nach den Abschnitten B bis D festgelegt.

(2) Für die Zwecke dieses Unterabschnitts gelten folgende Begriffsbestimmungen:

a) Internationaler Seeverkehr umfasst Beförderungsvorgänge im Haus-Haus-Verkehr, der die Beförderung von Gütern mit mehr als einem Verkehrsträger darstellt, mit einem einzigen Frachtpapier, bei denen ein Teil der Strecke auf See zurückgelegt wird, und umfasst das Recht, zu diesem Zweck Verträge direkt mit Erbringern von Dienstleistungen anderer Verkehrsträger zu schließen;

b) Frachtumschlag sind Tätigkeiten von Stauereien, einschließlich Terminalbetreibern, jedoch ohne die direkten Tätigkeiten von Hafenarbeitern, wenn diese von den Stauereien oder Terminalbetreibern organisatorisch unabhängig sind. Zu den Frachtumschlagstätigkeiten gehören die Organisation und Überwachung

i) des Ladens/Löschens von Schiffen,

ii) des Laschens/Entlaschens von Frachtgut und

iii) der Entgegennahme/Auslieferung und der sicheren Verwahrung von Frachtgut vor der Versendung oder nach dem Löschen;

c) Zollabfertigung (oder "Dienstleistung von Zollagenten") ist die Erfüllung der Zollförmlichkeiten für die Einfuhr, Ausfuhr oder Durchfuhr von Frachtgut für einen anderen, unabhängig davon, ob dies die Haupttätigkeit des Dienstleisters ist oder eine übliche Ergänzung seiner Haupttätigkeit;

d) Bereitstellung von Containerstellplätzen und Zwischenlagerung von Containern ist die Lagerung von Containern im Hafengebiet im Hinblick auf ihre Be-/Entladung, Reparatur und Bereitstellung für die Versendung, und

e) Schiffsagenturdienste sind die Tätigkeiten eines Agenten in einem bestimmten geografischen Gebiet als Vertretung der Geschäftsinteressen einer oder mehrerer Schifffahrtslinien oder Reedereien zu folgenden Zwecken:

i) Vermarktung und Verkauf von Seeverkehrsdiensten und damit verbundenen Leistungen, von Preisangebot bis Rechnungsstellung, und Ausstellung von Konnossementen im Namen der Unternehmen, Auftragsvergabe für die erforderlichen Anschlussleistungen, Ausfertigung von Dokumenten und Erteilung von geschäftlichen Auskünften, und

ii) organisatorische Tätigkeiten im Namen der Unternehmen im Hinblick auf den Hafenaufenthalt des Schiffes oder die Übernahme von Frachtgut, wenn erforderlich.

(3) Angesichts des zwischen den Vertragsparteien erreichten Niveaus der Liberalisierung im internationalen Seeverkehr

a) wenden die Vertragsparteien den Grundsatz des ungehinderten Zugangs zum internationalen Seeverkehrsmarkt und zum internationalen Seehandel auf kommerzieller und diskriminierungsfreier Basis wirksam an und

b) gewährt jede Vertragspartei den unter der Flagge der anderen Vertragspartei fahrenden oder von Dienstleistern der anderen Vertragspartei betriebenen Schiffen unter anderem für den Zugang zu den Häfen, die Benutzung ihrer Infrastruktur und die Inanspruchnahme der dort angebotenen Hilfsdienstleistungen sowie die diesbezüglichen Gebühren und sonstigen Abgaben, die Zollerleichterungen, die Zuweisung von Liegeplätzen sowie von Lade- und Löscheinrichtungen eine Behandlung, die nicht weniger günstig ist als die ihren eigenen Schiffen gewährte Behandlung.

(4) In Anwendung dieser Grundsätze

a) nehmen die Vertragsparteien in künftige bilaterale Abkommen mit Dritten über Seeverkehrsdienstleistungen, einschließlich des Verkehrs mit trockenen und flüssigen Massengütern und des Linienverkehrs, keine Ladungsanteilvereinbarungen auf und aktivieren solche gegebenenfalls in früheren bilateralen Abkommen bestehenden Ladungsanteilvereinbarungen nicht, und

b) heben die Vertragsparteien bei Inkrafttreten dieses Abkommens alle einseitigen Maßnahmen sowie alle administrativen, technischen und sonstigen Hemmnisse, die den freien und fairen Wettbewerb beschränken oder eine verschleierte Beschränkung darstellen oder Diskriminierungen hinsichtlich der Dienstleistungsfreiheit im internationalen Seeverkehr bewirken könnten, auf und führen keine neuen ein.

(5) Jede Vertragspartei gestattet den Erbringern internationaler Seeverkehrsdienstleistungen der anderen Vertragspartei im Einklang mit den in ihrer Verpflichtungsliste festgelegten Bedingungen, in ihrem Gebiet eine Niederlassung unter Bedingungen für die Niederlassung und die Geschäftstätigkeit zu betreiben, die nicht weniger günstig sind als die Bedingungen, die ihren eigenen Dienstleistern oder den Dienstleistern eines Drittlandes gewährt werden, je nachdem, welche Bedingungen günstiger sind.

(6) Jede Vertragspartei stellt den Erbringern internationaler Seeverkehrsdienstleistungen der anderen Vertragspartei zu angemessenen und nichtdiskriminierenden Bedingungen am Hafen die folgenden Leistungen bereit:

a) Lotsendienste,

b) Schub- und Schleppboothilfe,

c) Bevorratung,

d) Betankung und Wasserversorgung,

e) Abfall- und Ballastentsorgung,

f) Dienstleistungen des Hafenmeisters,

g) Navigationshilfen und

h) landgestützte Betriebsdienste, die für den Betrieb des Schiffes unerlässlich sind, einschließlich Kommunikation, Wasser- und Stromversorgung, Einrichtungen für dringende Reparaturen, Ankerplätze, Liegeplätze und Anlegedienste.

ABSCHNITT F

Elektronischer Geschäftsverkehr

Artikel 7.48

Ziel und Grundsätze

(1) Die Vertragsparteien erkennen an, dass der elektronische Geschäftsverkehr Wirtschaftswachstum schafft und neue Geschäftsmöglichkeiten eröffnet, dass Hindernisse für seine Nutzung und Entwicklung vermieden werden müssen und dass das WTO-Übereinkommen auf Maßnahmen im Bereich des elektronischen Geschäftsverkehrs anwendbar ist, und kommen überein, die Entwicklung des elektronischen Geschäftsverkehrs zwischen den Vertragsparteien zu fördern, insbesondere durch Zusammenarbeit in den Fragen, die der elektronische Geschäftsverkehr im Rahmen dieses Kapitels aufwirft.

(2) Die Vertragsparteien stimmen darin überein, dass die Entwicklung des elektronischen Geschäftsverkehrs in jeder Hinsicht mit den internationalen Datenschutznormen vereinbar sein muss, damit gewährleistet ist, dass die Nutzer Vertrauen in den elektronischen Geschäftsverkehr haben.

(3) Die Vertragsparteien vereinbaren, auf Lieferungen, die auf elektronischem Weg erfolgen, keinen Zoll zu erheben [42].

Artikel 7.49

Zusammenarbeit in Regelungsfragen

(1) Die Vertragsparteien pflegen einen Dialog über durch den elektronischen Geschäftsverkehr aufgeworfene Regelungsfragen, bei dem unter anderem folgende Punkte behandelt werden:

a) die Anerkennung von für die Öffentlichkeit ausgestellten Zertifikaten für elektronische Signaturen und die Erleichterung grenzüberschreitender Zertifizierungsdienste,

b) die Verantwortlichkeit von Vermittlern bei der Übermittlung oder Speicherung von Informationen,

c) die Behandlung nicht angeforderter elektronischer kommerzieller Kommunikation,

d) der Verbraucherschutz im Bereich des elektronischen Geschäftsverkehrs,

e) die Entwicklung des papierlosen Handels und

f) andere Sachverhalte, die für die Entwicklung des elektronischen Geschäftsverkehrs von Bedeutung sind.

(2) Der Dialog kann den Austausch von Informationen über die jeweiligen Rechtsvorschriften der Vertragsparteien zu diesen Punkten sowie von Informationen über die Durchführung dieser Rechtsvorschriften umfassen.

ABSCHNITT G

Ausnahmen

Artikel 7.50

Ausnahmen

Unter der Voraussetzung, dass die Maßnahmen nicht so angewandt werden, dass sie zu einer willkürlichen oder ungerechtfertigten Diskriminierung zwischen den Ländern, soweit gleiche Umstände gegeben sind, oder zu einer verschleierten Beschränkung der Niederlassung oder der grenzüberschreitenden Erbringung von Dienstleistungen führen, ist dieses Kapitel nicht dahingehend auszulegen, dass es die Vertragsparteien hindert, Maßnahmen zu treffen und durchzusetzen,

a) die erforderlich sind, um die öffentliche Sicherheit oder Sittlichkeit zu schützen oder die öffentliche Ordnung aufrechtzuerhalten [43];

b) die erforderlich sind, um das Leben oder die Gesundheit von Menschen, Tieren oder Pflanzen zu schützen;

c) die die Erhaltung der nicht regenerativen natürlichen Ressourcen betreffen, sofern diese Maßnahmen in Verbindung mit Beschränkungen für inländische Investoren oder für die Erbringung oder Nutzung von Dienstleistungen im Inland angewandt werden;

d) die für den Schutz nationalen Kulturguts von künstlerischem, geschichtlichem oder archäologischem Wert erforderlich sind;

e) die erforderlich sind, um die Befolgung von Gesetzen oder sonstigen Vorschriften zu gewährleisten, die nicht im Widerspruch zu diesem Kapitel stehen, einschließlich solcher

i) zur Verhinderung irreführender und betrügerischer Geschäftspraktiken oder zur Behandlung der Folgen einer Nichterfüllung von Verträgen,

ii) zum Schutz des Persönlichkeitsrechts des Einzelnen bei der Verarbeitung und Weitergabe personenbezogener Daten und zum Schutz der Vertraulichkeit persönlicher Aufzeichnungen und Konten,

iii) zur Gewährleistung der Sicherheit;

f) die nicht mit den Artikeln 7.6 und 7.12 vereinbar sind, vorausgesetzt, das Ziel der unterschiedlichen Behandlung besteht darin, eine gerechte oder wirksame [44] Festsetzung oder Erhebung direkter Steuern in Bezug auf Wirtschaftstätigkeiten, Investoren oder Dienstleister der anderen Vertragspartei zu gewährleisten.

KAPITEL ACHT

ZAHLUNGEN UND KAPITALVERKEHR

Artikel 8.1

Laufende Zahlungen

Die Vertragsparteien verpflichten sich, alle Leistungsbilanzzahlungen und -transfers zwischen Gebietsansässigen der Vertragsparteien in frei konvertierbarer Währung im Einklang mit dem Übereinkommen über den Internationalen Währungsfonds zu genehmigen und auf diesbezügliche Beschränkungen zu verzichten.

Artikel 8.2

Kapitalverkehr

(1) Hinsichtlich der Kapitalbilanztransaktionen verpflichten sich die Vertragsparteien, den freien Kapitalverkehr im Zusammenhang mit nach den Rechtsvorschriften des Empfängerstaats getätigten Direktinvestitionen, mit Investitionen und anderen nach Kapitel Sieben (Dienstleistungshandel, Niederlassung und elektronischer Geschäftsverkehr) liberalisierten Transaktionen und mit der Liquidation und Rückführung dieses investierten Kapitals und etwaiger daraus erzielter Gewinne nicht zu beschränken.

(2) Unbeschadet anderer Bestimmungen dieses Abkommens gewährleisten die Vertragsparteien in Bezug auf Transaktionen, die keine Kapitalbilanztransaktionen im Sinne des Absatzes 1 darstellen, Investoren der anderen Vertragspartei nach den Rechtsvorschriften des Empfängerstaats den freien Kapitalverkehr unter anderem im Zusammenhang mit

a) Krediten für Handelsgeschäfte einschließlich Dienstleistungen, an denen ein Gebietsansässiger einer Vertragspartei beteiligt ist,

b) Finanzkrediten oder

c) Kapitalbeteiligungen an juristischen Personen ohne die Absicht, dauerhafte Wirtschaftsbeziehungen zu schaffen oder aufrechtzuerhalten.

(3) Unbeschadet anderer Bestimmungen dieses Abkommens führen die Vertragsparteien keine neuen Beschränkungen des Kapitalverkehrs zwischen Gebietsansässigen der Vertragsparteien ein und verschärfen die bestehenden Regelungen nicht.

(4) Die Vertragsparteien können Konsultationen aufnehmen, um zur Verwirklichung der Ziele dieses Abkommens den Kapitalverkehr zwischen den Vertragsparteien weiter zu erleichtern.

Artikel 8.3

Ausnahmen

Unter der Voraussetzung, dass die Maßnahmen nicht so angewandt werden, dass sie zu einer willkürlichen oder ungerechtfertigten Diskriminierung zwischen den Ländern, soweit gleiche Umstände gegeben sind, oder zu einer verschleierten Beschränkung des Kapitalverkehrs führen, ist dieses Kapitel nicht dahingehend auszulegen, dass es die Vertragsparteien hindert, Maßnahmen zu treffen und durchzusetzen,

a) die erforderlich sind, um die öffentliche Sicherheit und Sittlichkeit zu schützen oder die öffentliche Ordnung aufrechtzuerhalten, oder

b) die erforderlich sind, um die Einhaltung von Gesetzen oder sonstigen Vorschriften zu gewährleisten, die nicht im Widerspruch zu diesem Kapitel stehen, einschließlich Maßnahmen, die Folgendes betreffen:

i) die Verhinderung strafbarer Handlungen, irreführender und betrügerischer Geschäftspraktiken oder die Behandlung der Folgen einer Nichterfüllung von Verträgen (Konkurs, Insolvenz und Schutz der Gläubigerrechte),

ii) zur Gewährleistung der Integrität und Stabilität des Finanzsystems einer Vertragspartei eingeführte oder aufrechterhaltene Maßnahmen,

iii) die Emission von und den Handel mit Wertpapieren, Optionen, Futures oder anderen Derivaten,

iv) die finanzielle Berichterstattung oder die Aufzeichnung von Transfers, falls zur Unterstützung der Strafverfolgungs- oder Finanzregulierungsbehörden erforderlich, oder

v) die Gewährleistung der Einhaltung von in Gerichts- oder Verwaltungsverfahren erlassenen Verfügungen oder Urteilen.

Artikel 8.4

Schutzmaßnahmen

(1) In Ausnahmefällen, in denen die Zahlungen und der Kapitalverkehr zwischen den Vertragsparteien ernste Schwierigkeiten für die Durchführung der Währungs- oder Wechselkurspolitik [45] in Korea oder in einem oder mehreren Mitgliedstaaten der Europäischen Union verursachen oder zu verursachen drohen, können unbedingt notwendige Schutzmaßnahmen [46] hinsichtlich des Kapitalverkehrs von den betroffenen Vertragsparteien [47] für einen Zeitraum von höchstens sechs Monaten [48] ergriffen werden.

(2) Der Handelsausschuss wird unverzüglich über alle ergriffenen Schutzmaßnahmen und so bald wie möglich über einen Zeitplan für die Aufhebung dieser Maßnahmen informiert.

KAPITEL NEUN

ÖFFENTLICHES BESCHAFFUNGSWESEN

Artikel 9.1

Allgemeine Bestimmungen

(1) Die Vertragsparteien bekräftigen ihre Rechte und Pflichten aus dem Übereinkommen über das öffentliche Beschaffungswesen in Anhang 4 des WTO-Übereinkommens (im Folgenden "GPA 1994" für "Government Procurement Agreement" von 1994 genannt) sowie ihr Interesse an einer weiteren Ausweitung der bilateralen Handelsmöglichkeiten auf den öffentlichen Beschaffungsmärkten der Vertragsparteien.

(2) Die Vertragsparteien erkennen ihr gemeinsames Interesse an der Förderung der internationalen Liberalisierung der öffentlichen Beschaffungsmärkte im Rahmen des regelbasierten internationalen Handelssystems an. Die Vertragsparteien arbeiten bei der Überprüfung nach Artikel XXIV Absatz 7 des GPA 1994 sowie in anderen zuständigen internationalen Gremien weiterhin zusammen.

(3) Dieses Kapitel ist nicht dahingehend auszulegen, dass es die Rechte und Pflichten der Vertragsparteien aus dem GPA 1994 oder einem Nachfolgeübereinkommen außer Kraft setzt.

(4) Auf alle unter dieses Kapitel fallenden Beschaffungen wenden die Vertragsparteien den vorläufig vereinbarten überarbeiteten Wortlaut des GPA [49] (im Folgenden "überarbeitetes GPA" genannt) an, mit folgenden Ausnahmen:

a) Meistbegünstigung für Waren, Dienstleistungen und Anbieter einer anderen Vertragspartei (Artikel IV Absatz 1 Buchstabe b und Absatz 2 des überarbeiteten GPA),

b) besondere und differenzierte Behandlung von Entwicklungsländern (Artikel V des überarbeiteten GPA),

c) Teilnahmebedingungen (Artikel VIII Absatz 2 des überarbeiteten GPA); diese werden durch Folgendes ersetzt: Es wird nicht vorgeschrieben, dass ein Anbieter einer Vertragspartei nur dann an einer Ausschreibung teilnehmen oder den Zuschlag erhalten kann, wenn er bereits einen Auftrag oder mehrere Aufträge einer Beschaffungsstelle der anderen Vertragspartei erhalten hat, oder dass der Anbieter bereits über Berufserfahrung im Gebiet der betreffenden Vertragspartei verfügen muss, es sei denn, die Berufserfahrung ist für die Erfüllung der Anforderungen der Ausschreibung unerlässlich;

d) Institutionen (Artikel XXI des überarbeiteten GPA) und

e) Schlussbestimmungen (Artikel XXII des überarbeiteten GPA).

(5) Für die Zwecke der Anwendung des überarbeiteten GPA nach Absatz 4 gelten folgende Begriffsbestimmungen:

a) "Übereinkommen" im überarbeiteten GPA bedeutet "Kapitel", aber "Länder, die nicht Vertragsparteien dieses Übereinkommens sind" bedeutet "Nicht-Vertragsparteien" und "Vertragspartei des Übereinkommens" bedeutet "Vertragspartei",

b) "andere Vertragsparteien" im überarbeiteten GPA bedeutet "die andere Vertragspartei" und

c) "der Ausschuss" im überarbeiteten GPA bedeutet "die Arbeitsgruppe".

Artikel 9.2

Geltungsbereich

(1) Unter dieses Kapitel fallen alle Beschaffungen, die unter die Anhänge der beiden Vertragsparteien zum GPA 1994 und dazugehörige Anmerkungen fallen, einschließlich Änderungen oder Ersetzungen.

(2) Für die Zwecke dieses Abkommens unterliegen Build-Operate-Transfer-Verträge (im Folgenden "BOT-Verträge" genannt) und öffentliche Baukonzessionen im Sinne des Anhangs 9 den Bestimmungen des Anhangs 9.

Artikel 9.3

Arbeitsgruppe "Öffentliches Beschaffungswesen"

Die nach Artikel 15.3 Absatz 1 (Arbeitsgruppen) eingesetzte Arbeitsgruppe "Öffentliches Beschaffungswesen" tritt nach einvernehmlicher Vereinbarung oder auf Antrag einer Vertragspartei zusammen, um

a) Fragen im Zusammenhang mit dem öffentlichen Beschaffungswesen und BOT-Verträgen oder öffentlichen Baukonzessionen, die ihr von einer Vertragspartei vorgelegt werden, zu prüfen,

b) Informationen über das öffentliche Beschaffungswesen und Möglichkeiten für BOT-Verträge oder öffentliche Baukonzessionen in den Vertragsparteien auszutauschen und

c) sonstige Fragen im Zusammenhang mit dem Funktionieren dieses Kapitels zu erörtern.

KAPITEL ZEHN

GEISTIGES EIGENTUM

ABSCHNITT A

Allgemeine Bestimmungen

Artikel 10.1

Ziele

Die Ziele dieses Kapitels bestehen darin,

a) die Produktion und Vermarktung innovativer und kreativer Produkte in den Vertragsparteien zu erleichtern und

b) ein angemessenes und wirksames Schutz- und Durchsetzungsniveau für Rechte des geistigen Eigentums sicherzustellen.

Artikel 10.2

Art und Umfang der Pflichten

(1) Die Vertragsparteien gewährleisten die angemessene und wirksame Durchführung der das geistige Eigentum betreffenden internationalen Verträge, deren Vertragsparteien sie sind, einschließlich des Übereinkommens über handelsbezogene Aspekte der Rechte des geistigen Eigentums in Anhang 1C des WTO-Übereinkommens (im Folgenden "TRIPS-Übereinkommen" genannt). Die Bestimmungen dieses Kapitels ergänzen und präzisieren die Rechte und Pflichten der Vertragsparteien nach dem TRIPS-Übereinkommen.

(2) Für die Zwecke dieses Abkommens gehören zu den Rechten des geistigen Eigentums:

a) Urheberrechte, einschließlich Urheberrechten an Computerprogrammen und Datenbanken, und verwandte Schutzrechte,

b) Rechte an Patenten,

c) Marken,

d) Dienstleistungsmarken,

e) Muster und Modelle,

f) Layout-Designs (Topografien) integrierter Schaltkreise,

g) geografische Angaben,

h) Pflanzensorten und

i) Schutz nicht offenbarter Informationen.

(3) Der Schutz des geistigen Eigentums umfasst den Schutz gegen unlauteren Wettbewerb im Sinne des Artikels 10bis der Pariser Verbandsübereinkunft zum Schutz des gewerblichen Eigentums (1967) (im Folgenden "Pariser Verbandsübereinkunft" genannt).

Artikel 10.3

Technologietransfer

(1) Die Vertragsparteien kommen überein, Meinungen und Informationen über ihre Praxis und ihre Politik im Bereich des Technologietransfers innerhalb ihrer Gebiete und mit Drittländern auszutauschen. Hierzu zählen insbesondere Maßnahmen zur Erleichterung von Informationsfluss, Unternehmenspartnerschaften, Lizenzierung und Vergabe von Unteraufträgen. Besondere Aufmerksamkeit wird den notwendigen Voraussetzungen für die Schaffung angemessener Rahmenbedingungen für den Technologietransfer in den Empfängerländern gewidmet; dazu zählen Fragen wie die Entwicklung des Humankapitals und des Rechtsrahmens.

(2) Jede Vertragspartei ergreift gegebenenfalls Maßnahmen, um Lizenzierungspraktiken oder Bedingungen in Bezug auf Rechte des geistigen Eigentums zu verhindern oder zu kontrollieren, die den internationalen Technologietransfer beeinträchtigen könnten und die einen Missbrauch von Rechten des geistigen Eigentums durch die Rechteinhaber darstellen.

Artikel 10.4

Erschöpfung

Den Vertragsparteien steht es frei, ihre eigenen Regeln für die Erschöpfung von Rechten des geistigen Eigentums aufzustellen.

ABSCHNITT B

Normen in Bezug auf Rechte des geistigen Eigentums

Unterabschnitt A

Urheberrecht und verwandte Schutzrechte

Artikel 10.5

Gewährter Schutz

Die Vertragsparteien erfüllen folgende Bestimmungen:

a) Artikel 1 bis 22 des Internationalen Abkommens über den Schutz der ausübenden Künstler, der Hersteller von Tonträgern und der Sendeunternehmen (1961) (im Folgenden "Rom-Abkommen" genannt),

b) Artikel 1 bis 18 der Berner Übereinkunft zum Schutz von Werken der Literatur und Kunst (1971) (im Folgenden "Berner Übereinkunft" genannt),

c) Artikel 1 bis 14 des Urheberrechtsvertrags (1996) (im Folgenden "WCT" für "World Copyright Treaty" genannt) der Weltorganisation für geistiges Eigentum (im Folgenden "WIPO" für "World Intellectual Property Organisation" genannt) und

d) Artikel 1 bis 23 des WIPO-Vertrags über Darbietungen und Tonträger (1996) (im Folgenden "WPPT" für "WIPO Performances and Phonograms Treaty" genannt).

Artikel 10.6

Dauer der Urheberrechte

Jede Vertragspartei stellt sicher, dass die Schutzdauer des Urheberrechts an einem Werk, wenn sie auf der Grundlage der Lebensdauer einer natürlichen Person berechnet wird, mindestens die Lebensdauer des Urhebers und 70 Jahre nach seinem Tod umfasst.

Artikel 10.7

Sendeunternehmen

(1) Die Rechte der Sendeunternehmen erlöschen frühestens 50 Jahre nach der Erstsendung, unabhängig davon, ob es sich hierbei um drahtlose oder drahtgebundene, über Kabel oder durch Satelliten vermittelte Sendungen handelt.

(2) Die Vertragsparteien dürfen keine Weiterverbreitung von (über terrestrische Systeme, Kabel oder Satellit ausgestrahlten) Fernsehsignalen zulassen ohne Erlaubnis des Inhabers oder der Inhaber, falls vorhanden, der Rechte am Signalinhalt und am Signal [50].

Artikel 10.8

Zusammenarbeit auf dem Gebiet der kollektiven Rechteverwaltung

Die Vertragsparteien bemühen sich, den Abschluss von Vereinbarungen zwischen ihren jeweiligen Verwertungsgesellschaften zu erleichtern mit dem Ziel, den gegenseitigen Zugang und die Bereitstellung von Inhalten zwischen den Vertragsparteien zu vereinfachen sowie den gegenseitigen Transfer von Gebühren für die Nutzung der Werke oder anderer urheberrechtlich geschützter Gegenstände der Vertragsparteien zu gewährleisten. Die Vertragsparteien bemühen sich, ein hohes Maß an Rationalisierung zu erreichen und die Transparenz im Hinblick auf die Wahrnehmung der Aufgaben ihrer jeweiligen Verwertungsgesellschaften zu verbessern.

Artikel 10.9

Rundfunk und öffentliche Wiedergabe

(1) Für die Zwecke dieses Artikels gelten folgende Begriffsbestimmungen:

a) Sendung bedeutet die drahtlose Übertragung von Tönen oder von Bildern und Tönen oder deren Darstellungen zum Zwecke des Empfangs durch die Öffentlichkeit; die Übertragung über Satellit ist ebenfalls eine "Sendung"; die Übertragung verschlüsselter Signale ist eine "Sendung", soweit die Mittel zur Entschlüsselung der Öffentlichkeit von dem Sendeunternehmen oder mit dessen Zustimmung zur Verfügung gestellt werden; und

b) öffentliche Wiedergabe bedeutet die öffentliche Übertragung der Töne einer Darbietung oder der auf einem Tonträger aufgezeichneten Töne oder Darstellungen von Tönen auf einem anderen Wege als durch Sendung. Für die Zwecke des Absatzes 5 umfasst "öffentliche Wiedergabe" das öffentliche Hörbarmachen der auf einem Tonträger aufgezeichneten Töne oder Darstellungen von Tönen.

(2) Jede Vertragspartei gewährt ausübenden Künstlern das ausschließliche Recht, drahtlos übertragene Sendungen und die öffentliche Wiedergabe ihrer Darbietungen zu erlauben oder zu verbieten, es sei denn, die Darbietung ist selbst bereits eine gesendete Darbietung oder beruht auf einer Aufzeichnung.

(3) Jede Vertragspartei gewährt ausübenden Künstlern und Tonträgerherstellern das Recht auf eine einzige angemessene Vergütung, wenn ein zu gewerblichen Zwecken veröffentlichter Tonträger oder ein Vervielfältigungsstück eines solchen Tonträgers für drahtlos übertragene Sendungen oder eine öffentliche Wiedergabe benutzt wird.

(4) Jede Vertragspartei bestimmt in ihren Rechtsvorschriften, dass ausübende Künstler oder Tonträgerhersteller oder beide von dem Benutzer die Zahlung der einzigen angemessenen Vergütung verlangen. Die Vertragsparteien können Rechtsvorschriften erlassen, die in Ermangelung einer Vereinbarung zwischen ausübenden Künstlern und Tonträgerherstellern die Bedingungen festlegen, nach denen die einzige angemessene Vergütung zwischen ausübenden Künstlern und Tonträgerherstellern aufzuteilen ist.

(5) Jede Vertragspartei gewährt Sendeunternehmen das ausschließliche Recht, Folgendes zu erlauben oder zu verbieten:

a) die Weitersendung ihrer Sendungen,

b) die Aufzeichnung ihrer Sendungen und

c) die öffentliche Wiedergabe ihrer Fernsehsendungen, wenn sie an Orten stattfindet, die der Öffentlichkeit gegen Zahlung eines Eintrittsgeldes zugänglich sind. Die Bedingungen für die Ausübung des Rechts sind in den internen Rechtsvorschriften des Staates zu regeln, in dem der Schutz dieses Rechts beansprucht wird.

Artikel 10.10

Folgerecht

Die Vertragsparteien kommen überein, Meinungen und Informationen über ihre Praxis und ihre Politik auf dem Gebiet des Folgerechts auszutauschen. Innerhalb von zwei Jahren nach Inkrafttreten dieses Abkommens nehmen die Vertragsparteien Konsultationen auf, um zu prüfen, ob die Einführung eines Folgerechts in Korea erstrebenswert und möglich ist.

Artikel 10.11

Beschränkungen und Ausnahmen

Die Vertragsparteien können in bestimmten Sonderfällen, in denen die normale Verwertung des Werks nicht beeinträchtigt wird und die berechtigten Interessen der Rechteinhaber nicht ungebührlich verletzt werden, in ihren jeweiligen Rechtsvorschriften Beschränkungen oder Ausnahmen von den Rechten vorsehen, die den in Artikel 10.5 bis 10.10 genannten Rechteinhabern gewährt werden.

Artikel 10.12

Schutz von technischen Maßnahmen

(1) Jede Vertragspartei sieht einen angemessenen Rechtsschutz gegen die Umgehung wirksamer technischer Maßnahmen durch eine Person vor, der bekannt ist oder den Umständen nach bekannt sein muss, dass sie dieses Ziel verfolgt.

(2) Jede Vertragspartei sieht einen angemessenen Rechtsschutz gegen die Herstellung, die Einfuhr, die Verbreitung, den Verkauf, die Vermietung, die Werbung im Hinblick auf Verkauf oder Vermietung und den Besitz zu kommerziellen Zwecken von Vorrichtungen, Erzeugnissen oder Bestandteilen sowie die Erbringung von Dienstleistungen vor,

a) die Gegenstand einer Verkaufsförderung, Werbung oder Vermarktung mit dem Ziel der Umgehung wirksamer technischer Maßnahmen sind,

b) die, abgesehen von der Umgehung wirksamer technischer Maßnahmen, nur einen begrenzten wirtschaftlichen Zweck oder Nutzen haben oder

c) die hauptsächlich entworfen, hergestellt, angepasst oder erbracht werden, um die Umgehung wirksamer technischer Maßnahmen zu ermöglichen oder zu erleichtern.

(3) Für die Zwecke dieses Abkommens sind technische Maßnahmen alle Technologien, Vorrichtungen oder Bestandteile, die im normalen Betrieb dazu bestimmt sind, Werke oder sonstige Schutzgegenstände betreffende Handlungen zu verhindern oder einzuschränken, die nicht von der Person genehmigt worden sind, die Inhaber der Urheberrechte oder der dem Urheberrecht verwandten, in den jeweiligen Rechtsvorschriften der Vertragsparteien verankerten Schutzrechte ist. Technische Maßnahmen sind als wirksam anzusehen, soweit die Nutzung eines geschützten Werks oder eines sonstigen Schutzgegenstands von den Rechteinhabern durch eine Zugangskontrolle oder einen Schutzmechanismus wie Verschlüsselung, Verzerrung oder sonstige Umwandlung des Werks oder sonstigen Schutzgegenstands oder einen Mechanismus zur Kontrolle der Vervielfältigung, die die Erreichung des Schutzziels sicherstellen, unter Kontrolle gehalten wird.

(4) Jede Vertragspartei kann für Maßnahmen zur Durchführung der Absätze 1 und 2 unter Beachtung ihrer Rechtsvorschriften und der einschlägigen, in Artikel 10.5 aufgeführten internationalen Übereinkünfte Ausnahmen und Beschränkungen vorsehen.

Artikel 10.13

Schutz von Informationen für die Rechtewahrnehmung

(1) Jede Vertragspartei sieht einen angemessenen rechtlichen Schutz gegen Personen vor, die wissentlich unbefugt eine der nachstehenden Handlungen vornehmen:

a) die Entfernung oder Änderung elektronischer Informationen für die Wahrnehmung der Rechte oder

b) die Verbreitung, Einfuhr zur Verbreitung, Sendung, öffentliche Wiedergabe oder öffentliche Zugänglichmachung von Werken oder sonstigen unter dieses Abkommen fallenden Schutzgegenständen, bei denen elektronische Informationen für die Wahrnehmung der Rechte unbefugt entfernt oder geändert wurden,

wobei ihnen bekannt ist oder den Umständen nach bekannt sein muss, dass sie dadurch die Verletzung von Urheberrechten oder dem Urheberrecht verwandten, in den Rechtsvorschriften der jeweiligen Vertragspartei verankerten Schutzrechten ermöglichen, erleichtern oder verschleiern.

(2) Für die Zwecke dieses Abkommens sind Informationen für die Rechtewahrnehmung die von Rechteinhabern stammenden Informationen, die die in diesem Abkommen bezeichneten Werke oder Schutzgegenstände, den Urheber oder jeden anderen Rechteinhaber identifizieren, oder Informationen über die Modalitäten und Bedingungen für die Nutzung der Werke oder Schutzgegenstände sowie die Zahlen oder Codes, durch die derartige Informationen ausgedrückt werden.

(3) Absatz 2 gilt, wenn irgendeine der betreffenden Informationen an einem Vervielfältigungsstück eines Werks oder eines sonstigen Schutzgegenstands, der in diesem Abkommen genannt wird, angebracht wird oder im Zusammenhang mit der öffentlichen Wiedergabe eines solchen Werks oder Schutzgegenstands erscheint.

Artikel 10.14

Übergangsbestimmung

Korea setzt die in den Artikeln 10.6 und 10.7 genannten Verpflichtungen innerhalb von zwei Jahren nach Inkrafttreten dieses Abkommens vollständig um.

Unterabschnitt B

Marken

Artikel 10.15

Eintragungsverfahren

Die Europäische Union und Korea sehen ein System zur Eintragung von Marken vor, bei dem die Begründung für die Ablehnung einer Markeneintragung schriftlich mitgeteilt wird und dem Antragsteller auf elektronischem Weg übermittelt werden kann; der Antragsteller erhält die Möglichkeit, gegen diese Ablehnung Beschwerde einzulegen und eine endgültige Ablehnung vor Gericht anzufechten. Die Europäische Union und Korea schaffen ferner die Möglichkeit für interessierte Parteien, gegen Markenanmeldungen Widerspruch einzulegen. Die Europäische Union und Korea stellen eine öffentlich zugängliche elektronische Datenbank bereit, in der Markenanmeldungen und Markeneintragungen erfasst werden.

Artikel 10.16

Internationale Übereinkünfte

Die Europäische Union und Korea erfüllen die Bestimmungen des Vertrags über das Markenrecht (1994) und unternehmen alle zumutbaren Anstrengungen, um die Bestimmungen des Vertrags von Singapur zum Markenrecht (2006) zu erfüllen.

Artikel 10.17

Ausnahmen von den Rechten aus einer Marke

Jede Vertragspartei sieht die lautere Benutzung beschreibender Angaben als begrenzte Ausnahme von den Rechten aus einer Marke vor und kann weitere begrenzte Ausnahmen vorsehen, sofern die begrenzten Ausnahmen die berechtigten Interessen des Inhabers der Marke und Dritter berücksichtigen.

Unterabschnitt C

Geografische Angaben [51], [52]

Artikel 10.18

Anerkennung geografischer Angaben für landwirtschaftliche Erzeugnisse, Lebensmittel und Wein

(1) Nach Prüfung des Gesetzes zur Qualitätskontrolle landwirtschaftlicher Erzeugnisse ("Agricultural Products Quality Control Act") mit seinen Durchführungsvorschriften, soweit es sich auf die Eintragung, die Kontrolle und den Schutz geografischer Angaben für landwirtschaftliche Erzeugnisse und Lebensmittel in Korea bezieht, gelangt die Europäische Union zu dem Schluss, dass dieses Gesetz die in Absatz 6 aufgeführten Vorgaben erfüllt.

(2) Nach Prüfung der Verordnung (EG) Nr. 510/2006 des Rates mit ihren Durchführungsvorschriften zur Eintragung, zur Kontrolle und zum Schutz von geografischen Angaben für Agrarerzeugnisse und Lebensmittel in der Europäischen Union und der Verordnung (EG) Nr. 1234/2007 des Rates über die gemeinsame Organisation des Weinmarktes gelangt Korea zu dem Schluss, dass diese Rechtsvorschriften die in Absatz 6 aufgeführten Vorgaben erfüllen.

(3) Nach Prüfung einer Zusammenfassung der Spezifikationen der landwirtschaftlichen Erzeugnisse und Lebensmittel, die den in Anhang 10-A aufgeführten geografischen Angaben Koreas entsprechen, welche von Korea nach dem in Absatz 1 genannten Gesetz eingetragen wurden, verpflichtet sich die Europäische Union, den in Anhang 10-A aufgeführten geografischen Angaben Koreas das in diesem Kapitel festgelegte Schutzniveau zu gewähren.

(4) Nach Prüfung einer Zusammenfassung der Spezifikationen der landwirtschaftlichen Erzeugnisse und Lebensmittel, die den in Anhang 10-A aufgeführten geografischen Angaben der Europäischen Union entsprechen, welche von der Europäischen Union nach den in Absatz 2 genannten Rechtsvorschriften eingetragen wurden, verpflichtet sich Korea, den in Anhang 10-A aufgeführten geografischen Angaben der Europäischen Union das in diesem Kapitel festgelegte Schutzniveau zu gewähren.

(5) Absatz 3 gilt für geografische Angaben für Weine im Hinblick auf nach Artikel 10.24 hinzugefügte geografische Angaben.

(6) Die Europäische Union und Korea kommen überein, dass die in den Absätzen 1 und 2 genannten Vorgaben für die Eintragung und Kontrolle geografischer Angaben die Folgenden sind:

a) ein Register der im jeweiligen Gebiet geschützten geografischen Angaben,

b) ein Verwaltungsverfahren, mit dem überprüft wird, ob geografische Angaben eine Ware als aus einem Gebiet, einer Gegend oder einem Ort einer Vertragspartei stammend kennzeichnen, wenn eine bestimmte Qualität, der Ruf oder eine sonstige Eigenschaft der Ware im Wesentlichen auf ihrer geografischen Herkunft beruht,

c) das Erfordernis, dass ein eingetragener Name einem spezifischen Erzeugnis oder spezifischen Erzeugnissen entspricht, für das/die eine Produktspezifikation festgelegt wurde, die nur durch ein ordnungsgemäßes Verwaltungsverfahren geändert werden kann,

d) Vorschriften zur Produktionskontrolle,

e) Rechtsvorschriften, in denen festgelegt ist, dass ein eingetragener Name von jedem Marktteilnehmer verwendet werden kann, der landwirtschaftliche Erzeugnisse oder Lebensmittel vermarktet, die der betreffenden Spezifikation entsprechen, und

f) ein Einspruchsverfahren, das die Berücksichtigung der berechtigten Interessen früherer Namensverwender ermöglicht, unabhängig davon, ob diese Namen als eine Form des geistigen Eigentums geschützt sind oder nicht.

Artikel 10.19

Anerkennung spezifischer geografischer Angaben für Weine [53], aromatisierte Weine [54] und Spirituosen [55]

(1) In Korea werden die in Anhang 10-B aufgeführten geografischen Angaben der Europäischen Union geschützt, wenn die betreffenden Erzeugnisse diese geografischen Angaben im Einklang mit den einschlägigen Rechtsvorschriften der Europäischen Union über geografische Angaben führen.

(2) In der Europäischen Union werden die in Anhang 10-B aufgeführten geografischen Angaben Koreas geschützt, wenn die betreffenden Erzeugnisse diese geografischen Angaben im Einklang mit den einschlägigen Rechtsvorschriften Koreas über geografische Angaben führen.

Artikel 10.20

Verwendungsrecht

Ein nach diesem Unterabschnitt geschützter Name kann von jedem Marktteilnehmer verwendet werden, der landwirtschaftliche Erzeugnisse, Lebensmittel, Weine, aromatisierte Weine oder Spirituosen vermarktet, die der betreffenden Spezifikation entsprechen.

Artikel 10.21

Schutzumfang

(1) Die in den Artikeln 10.18 und 10.19 genannten geografischen Angaben werden geschützt gegen

a) die Benutzung irgendeines Mittels in der Bezeichnung oder Aufmachung einer Ware, das auf eine das Publikum hinsichtlich der geografischen Herkunft der Ware irreführende Weise angibt oder nahe legt, dass die fragliche Ware ihren Ursprung in einem anderen geografischen Gebiet als dem wahren Ursprungsort hat,

b) die Verwendung einer geografischen Angabe zur Kennzeichnung einer Ware für eine gleichartige Ware [56], die ihren Ursprung nicht an dem durch die fragliche geografische Angabe bezeichneten Ort hat, selbst wenn der wahre Ursprung der Ware angegeben oder die geografische Angabe in Übersetzung oder Transkription oder zusammen mit Ausdrücken wie "Art", "Typ", "Stil", "Imitation" oder dergleichen verwendet wird, und

c) jede andere Benutzung, die eine unlautere Wettbewerbshandlung im Sinne des Artikels 10bis der Pariser Verbandsübereinkunft darstellt.

(2) Die Bestimmungen dieses Abkommens lassen das Recht von Personen unberührt, im geschäftlichen Verkehr ihren Namen oder den Namen ihres Geschäftsvorgängers zu verwenden, sofern dieser Name nicht in einer die Verbraucher irreführenden Weise verwendet wird.

(3) Sind geografische Angaben der Vertragsparteien homonym, so wird jeder Angabe Schutz gewährt, sofern sie in gutem Glauben verwendet wurde. Die Arbeitsgruppe "Geografische Angaben" legt die praktischen Verwendungsbedingungen fest, unter denen die homonymen geografischen Angaben voneinander unterschieden werden, und berücksichtigt dabei die Notwendigkeit sicherzustellen, dass die betroffenen Erzeuger angemessen behandelt und die Verbraucher nicht irregeführt werden. Ist eine durch dieses Abkommen geschützte geografische Angabe mit einer geografischen Angabe eines Drittlandes homonym, so legt jede Vertragspartei die praktischen Verwendungsbedingungen fest, unter denen die homonymen geografischen Angaben voneinander unterschieden werden, und berücksichtigt dabei die Notwendigkeit sicherzustellen, dass die betroffenen Erzeuger angemessen behandelt und die Verbraucher nicht irregeführt werden.

(4) Dieses Abkommen verpflichtet die Europäische Union oder Korea nicht, eine geografische Angabe zu schützen, die in ihrem Ursprungsland nicht oder nicht mehr geschützt ist oder dort nicht mehr verwendet wird.

(5) Der Schutz einer geografischen Angabe nach diesem Artikel lässt die fortgesetzte Benutzung einer Marke unberührt, die vor dem Tag des Antrags auf Schutz oder Anerkennung der geografischen Angabe im Gebiet einer Vertragspartei angemeldet, eingetragen oder, falls dies in den einschlägigen Rechtsvorschriften vorgesehen ist, durch Benutzung erworben wurde, sofern keine Gründe für die Ungültigerklärung oder den Verfall der Marke nach den Rechtsvorschriften der betroffenen Vertragspartei vorliegen. Der Tag des Antrags auf Schutz oder Anerkennung der geografischen Angabe wird nach Artikel 10.23 Absatz 2 festgelegt.

Artikel 10.22

Durchsetzung des Schutzes

Die Vertragsparteien setzen den in den Artikeln 10.18 bis 10.23 vorgesehenen Schutz aus eigener Initiative mittels geeigneter Maßnahmen ihrer Behörden durch. Sie setzen diesen Schutz auch auf Antrag einer interessierten Partei durch.

Artikel 10.23

Verhältnis zu Marken

(1) Die Eintragung einer Marke, auf die einer der in Artikel 10.21 Absatz 1 aufgeführten Sachverhalte in Bezug auf eine geschützte geografische Angabe für gleichartige Waren zutrifft, wird von den Vertragsparteien abgelehnt oder für ungültig erklärt, wenn der Antrag auf Eintragung der Marke nach dem Tag des Antrags auf Schutz oder Anerkennung der geografischen Angabe in dem betreffenden Gebiet gestellt wird.

(2) Für die Zwecke des Absatzes 1 gilt Folgendes:

a) Für die in den Artikeln 10.18 und 10.19 genannten geografischen Angaben ist der Tag des Antrags auf Schutz oder Anerkennung der Tag des Inkrafttretens dieses Abkommens, und

b) für die in Artikel 10.24 genannten geografischen Angaben ist der Tag des Antrags auf Schutz oder Anerkennung der Tag, an dem bei einer Vertragspartei ein Antrag der anderen Vertragspartei auf Schutz oder Anerkennung einer geografischen Angabe eingeht.

Artikel 10.24

Aufnahme zusätzlicher zu schützender geografischer Angaben [57]

(1) Die Europäische Union und Korea kommen überein, zusätzliche zu schützende geografische Angaben nach dem in Artikel 10.25 festgelegten Verfahren in die Anhänge 10-A und 10-B aufzunehmen.

(2) Die Europäische Union und Korea kommen überein, Anträge der anderen Vertragspartei auf Aufnahme zusätzlicher zu schützender geografischer Angaben in die Anhänge unverzüglich zu bearbeiten.

(3) Ein Name darf nicht als geografische Angabe eingetragen werden, wenn er mit dem Namen einer Pflanzensorte, einschließlich einer Rebsorte, oder einer Tierrasse kollidiert und deshalb geeignet ist, den Verbraucher in Bezug auf den tatsächlichen Ursprung des Erzeugnisses irrezuführen.

Artikel 10.25

Arbeitsgruppe "Geografische Angaben"

(1) Die nach Artikel 15.3 Absatz 1 (Arbeitsgruppen) eingesetzte Arbeitsgruppe "Geografische Angaben" tritt nach einvernehmlicher Vereinbarung oder auf Antrag einer Vertragspartei zusammen, um die Zusammenarbeit zwischen den Vertragsparteien und den Dialog über geografische Angaben zu intensivieren. Die Arbeitsgruppe kann einvernehmlich Empfehlungen aussprechen und Beschlüsse annehmen.

(2) Die Sitzungen finden abwechselnd im Gebiet einer der Vertragsparteien statt. Termin, Ort und Modalitäten der Sitzungen der Arbeitsgruppe, die auch per Videokonferenz abgehalten werden können, werden von den Vertragsparteien gemeinsam festgelegt; die Arbeitsgruppe tritt jedoch spätestens 90 Tage nach der Antragstellung zusammen.

(3) Die Arbeitsgruppe kann beschließen,

a) die Anhänge 10-A und 10-B zu ändern, indem einzelne geografische Angaben der Europäischen Union oder Koreas hinzugefügt werden, die, gegebenenfalls nach Abschluss des entsprechenden, in Artikel 10.18 Absätze 3 und 4 genannten Verfahrens, auch von der anderen Vertragspartei als geografische Angaben eingestuft und in ihrem Gebiet geschützt werden;

b) die unter Buchstabe a genannten Anhänge zu ändern [58], indem einzelne geografische Angaben gestrichen werden, die in der Vertragspartei ihres Ursprungs [59] nicht mehr geschützt sind oder die nach den geltenden Rechtsvorschriften nicht mehr die Voraussetzungen erfüllen, um in der anderen Vertragspartei als geografische Angabe betrachtet zu werden, und

c) dass eine Bezugnahme auf eine Rechtsvorschrift in diesem Abkommen als Bezugnahme auf die betreffende Rechtsvorschrift in ihrer ab einem bestimmten Zeitpunkt nach Inkrafttreten dieses Abkommens geltenden geänderten und ersetzten Fassung gilt.

(4) Die Arbeitsgruppe stellt ferner das ordnungsgemäße Funktionieren dieses Unterabschnitts sicher und kann alle Fragen im Zusammenhang mit seiner Durchführung und Anwendung prüfen. Ihre Aufgaben sind insbesondere:

a) der Austausch von Informationen über die Entwicklung der Rechtsetzung und der Politik auf dem Gebiet der geografischen Angaben,

b) der Austausch von Informationen über einzelne geografische Angaben zwecks Prüfung ihres Schutzes gemäß diesem Abkommen und

c) der Austausch von Informationen zum bestmöglichen Funktionieren dieses Abkommens.

(5) Die Arbeitsgruppe kann alle Fragen von gemeinsamem Interesse im Bereich der geografischen Angaben erörtern.

Artikel 10.26

Einzelanträge auf Schutz geografischer Angaben

Die Bestimmungen dieses Unterabschnitts lassen das Recht unberührt, die Anerkennung und den Schutz einer geografischen Angabe nach den einschlägigen Rechtsvorschriften der Europäischen Union oder Koreas zu beantragen.

Unterabschnitt D

Muster und Modelle

Artikel 10.27

Schutz eingetragener Muster und Modelle

(1) Die Europäische Union und Korea sehen den Schutz unabhängig geschaffener Muster und Modelle vor, die neu sind und originär sind oder Eigenart haben [60].

(2) Dieser Schutz erfolgt durch Eintragung und verleiht den Inhabern ausschließliche Rechte nach Maßgabe dieses Unterabschnitts.

Artikel 10.28

Rechte aus der Eintragung

Der Inhaber eines geschützten Musters oder Modells ist berechtigt, Dritten zumindest zu verbieten, ohne seine Zustimmung Gegenstände herzustellen, zum Verkauf anzubieten, zu verkaufen, einzuführen, auszuführen oder zu benutzen, die das geschützte Muster oder Modell tragen oder in die es aufgenommen wurde, wenn diese Handlungen zu gewerblichen Zwecken vorgenommen werden, die normale Verwertung des Musters oder Modells über Gebühr beeinträchtigen oder mit den Gepflogenheiten des redlichen Geschäftsverkehrs unvereinbar sind.

Artikel 10.29

Schutz nicht eingetragener Erscheinungsformen

Die Europäische Union und Korea stellen die rechtlichen Mittel für ein Verbot der Verwendung nicht eingetragener Erscheinungsformen eines Erzeugnisses bereit, jedoch nur, wenn die angefochtene Verwendung das Ergebnis einer Nachahmung der nicht eingetragenen Erscheinungsform eines solchen Erzeugnisses ist [61]. Zu Verwendungen dieser Art gehören zumindest die Präsentation [62], die Einfuhr oder die Ausfuhr von Waren.

Artikel 10.30

Schutzdauer

(1) Die Schutzdauer in den Vertragsparteien beträgt mindestens 15 Jahre ab dem Zeitpunkt der Eintragung.

(2) Die Schutzdauer für nicht eingetragene Erscheinungsformen in der Europäischen Union und in Korea beträgt mindestens drei Jahre.

Artikel 10.31

Ausnahmen

(1) Die Europäische Union und Korea können begrenzte Ausnahmen vom Schutz von Mustern und Modellen vorsehen, sofern solche Ausnahmen nicht unangemessen im Widerspruch zur normalen Verwertung geschützter Muster und Modelle stehen und die berechtigten Interessen des Inhabers des geschützten Musters oder Modells nicht unangemessen beeinträchtigen, wobei auch die berechtigten Interessen Dritter zu berücksichtigen sind.

(2) Der Schutz erstreckt sich nicht auf Muster oder Modelle, die im Wesentlichen aufgrund technischer oder funktionaler Überlegungen vorgegeben sind.

(3) Es besteht kein Recht an einem Muster oder Modell, wenn es gegen die öffentliche Ordnung oder gegen die guten Sitten verstößt.

Artikel 10.32

Verhältnis zum Urheberrecht

Ein Muster oder Modell, das durch ein in der Europäischen Union oder in Korea gemäß diesem Unterabschnitt eingetragenes Musterrecht geschützt ist, ist auch nach dem im Gebiet der Vertragsparteien geltenden Urheberrecht von dem Tag an schutzfähig, an dem das Muster oder Modell geschaffen oder in irgendeiner Form festgelegt wurde [63].

Unterabschnitt E

Patente

Artikel 10.33

Internationale Übereinkunft

Die Vertragsparteien unternehmen alle zumutbaren Anstrengungen, um die Artikel 1 bis 16 des Vertrags über das Patentrecht (2000) zu befolgen.

Artikel 10.34

Patente und öffentliche Gesundheit

(1) Die Vertragsparteien erkennen die Bedeutung der am 14. November 2001 von der WTO-Ministerkonferenz angenommenen Erklärung zum TRIPS-Übereinkommen und zur öffentlichen Gesundheit (im Folgenden "Doha-Erklärung" genannt) an. Im Hinblick auf die Auslegung und Wahrnehmung der sich aus diesem Unterabschnitt ergebenden Rechte und Pflichten sind die Vertragsparteien berechtigt, sich auf die Doha-Erklärung zu berufen.

(2) Jede Vertragspartei trägt dazu bei, die Entscheidung des Allgemeinen Rates der WTO vom 30. August 2003 zu Absatz 6 der Doha-Erklärung sowie das am 6. Dezember 2005 in Genf unterzeichnete Protokoll zur Änderung des TRIPS-Übereinkommens umzusetzen und hält deren Bestimmungen ein.

Artikel 10.35

Verlängerung der Dauer der Rechte aus dem Patentschutz

(1) Die Vertragsparteien erkennen an, dass Arzneimittel [64] und Pflanzenschutzmittel [65], die in ihrem jeweiligen Gebiet durch ein Patent geschützt sind, ein behördliches Genehmigungs- oder Eintragungsverfahren durchlaufen müssen, bevor sie auf ihren Märkten in den Verkehr gebracht werden.

(2) Die Vertragsparteien gewähren auf Antrag des Patentinhabers eine Verlängerung der Dauer der Rechte aus dem Patentschutz, um für den Patentinhaber einen Ausgleich für die Verkürzung der effektiven Schutzfrist zu schaffen, die aus der ersten Genehmigung für das Inverkehrbringen des Produkts auf ihren jeweiligen Märkten resultiert. Die Verlängerung der Dauer der Rechte aus dem Patentschutz beträgt höchstens fünf Jahre [66].

Artikel 10.36

Schutz der mit einem Antrag auf Zulassung von Arzneimitteln [67] vorgelegten Daten

(1) Die Vertragsparteien gewährleisten, dass Daten, die mit einem Antrag auf Zulassung eines Arzneimittels vorgelegt werden, vertraulich behandelt, nicht offenbart und nicht als Grundlage für weitere Anträge auf Zulassung verwendet werden.

(2) Zu diesem Zweck stellen die Vertragsparteien in ihren jeweiligen Rechtsvorschriften sicher, dass im Einklang mit Artikel 39 des TRIPS-Übereinkommens Daten über Sicherheit und Wirksamkeit, die von einem Antragsteller erstmals mit einem Antrag auf Zulassung eines neuen Arzneimittels im Gebiet einer Vertragspartei vorgelegt werden, nicht für die Erteilung einer anderen Arzneimittelzulassung verwendet werden, es sei denn, es liegt ein Nachweis der ausdrücklichen Zustimmung des Zulassungsinhabers zur Verwendung dieser Daten vor.

(3) Der Datenschutz sollte für einen Zeitraum von mindestens fünf Jahren ab dem Datum der Erstzulassung im Gebiet einer Vertragspartei gelten.

Artikel 10.37

Schutz der mit einem Antrag auf Zulassung von Pflanzenschutzmitteln vorgelegten Daten

(1) Die Vertragsparteien legen die Sicherheits- und Wirksamkeitsanforderungen fest, bevor sie das Inverkehrbringen von Pflanzenschutzmitteln auf ihren jeweiligen Märkten genehmigen.

(2) Die Vertragsparteien gewährleisten, dass Testergebnisse, Studienberichte oder Informationen, die von einem Antragsteller erstmals mit einem Antrag auf Zulassung eines Pflanzenschutzmittels vorgelegt werden, nicht von Dritten oder den zuständigen Behörden zugunsten anderer Personen verwendet werden, die die Zulassung eines Pflanzenschutzmittels anstreben, es sei denn, es liegt ein Nachweis der ausdrücklichen Zustimmung des Erstantragstellers zur Verwendung dieser Daten vor. Dieser Schutz wird im Folgenden als Datenschutz bezeichnet.

(3) Der Datenschutz sollte für einen Zeitraum von mindestens 10 Jahren ab dem Datum der Erstzulassung im Gebiet einer Vertragspartei gelten.

Artikel 10.38

Durchführung

Die Vertragsparteien treffen die erforderlichen Maßnahmen, um die uneingeschränkte Wirksamkeit des in diesem Unterabschnitt vorgesehenen Schutzes zu gewährleisten; sie arbeiten in dieser Hinsicht aktiv zusammen und führen einen konstruktiven Dialog.

Unterabschnitt F

Sonstige Bestimmungen

Artikel 10.39

Pflanzensorten

Jede Vertragspartei trifft Maßnahmen zum Schutz von Pflanzensorten und erfüllt die Bestimmungen des Internationalen Übereinkommens zum Schutz von Pflanzenzüchtungen (1991).

Artikel 10.40

Genetische Ressourcen, überliefertes Wissen und Folklore

(1) Vorbehaltlich ihrer Rechtsvorschriften achten, bewahren und erhalten die Vertragsparteien Kenntnisse, Innovationen und Gebräuche der autochthonen und lokalen Bevölkerungsgruppen mit traditionellen Lebensformen, die für die Erhaltung und nachhaltige Nutzung der biologischen Vielfalt wichtig sind, und fördern mit dem Einverständnis und unter Mitwirkung der Träger dieser Kenntnisse, Innovationen und Gebräuche deren breitere Anwendung und unterstützen die gerechte Aufteilung des Nutzens aus der Anwendung dieser Kenntnisse, Innovationen und Gebräuche.

(2) Die Vertragsparteien kommen überein, regelmäßig Meinungen und Informationen über die folgenden einschlägigen multilateralen Gespräche auszutauschen:

a) über die Fragen, die im zwischenstaatlichen WIPO-Ausschuss für genetische Ressourcen, überliefertes Wissen und Folklore erörtert werden,

b) über die im Rahmen der WTO erörterten Fragen im Zusammenhang mit dem Verhältnis zwischen dem TRIPS-Übereinkommen und dem Übereinkommen über die biologische Vielfalt (im Folgenden "CBD" genannt), dem Schutz überlieferten Wissens und der Folklore, und

c) über die im Rahmen des CBD erörterten Fragen im Zusammenhang mit einer internationalen Regelung für den Zugang zu genetischen Ressourcen und den Vorteilsausgleich.

(3) Nach Abschluss der in Absatz 2 genannten einschlägigen multilateralen Gespräche vereinbaren die Vertragsparteien auf Ersuchen einer der Vertragsparteien, diesen Artikel im Handelsausschuss im Lichte der Ergebnisse und Schlussfolgerungen dieser multilateralen Gespräche zu überprüfen. Der Handelsausschuss kann die zur Umsetzung der Überprüfungsergebnisse erforderlichen Beschlüsse fassen.

ABSCHNITT C

Durchsetzung der Rechte des geistigen Eigentums

Artikel 10.41

Allgemeine Verpflichtungen

(1) Die Vertragsparteien bestätigen ihre Verpflichtungen im Rahmen des TRIPS-Übereinkommens, insbesondere des Teils III, und stellen sicher, dass die folgenden ergänzenden Maßnahmen, Verfahren und Rechtsbehelfe in ihren Rechtsvorschriften verankert sind, damit gegen jede Verletzung der in diesem Abkommen festgelegten Rechte des geistigen Eigentums [68] wirksam vorgegangen werden kann.

(2) Die Maßnahmen, Verfahren und Rechtsbehelfe

a) umfassen Eilverfahren zur Verhinderung von Verletzungshandlungen und Rechtsbehelfe zur Abschreckung gegen weitere Verletzungshandlungen,

b) müssen fair und gerecht sein,

c) dürfen nicht unnötig kompliziert oder kostspielig sein und keine unangemessenen Fristen oder ungerechtfertigten Verzögerungen mit sich bringen und sie

d) müssen wirksam, verhältnismäßig und abschreckend sein und so angewandt werden, dass die Einrichtung von Schranken für den rechtmäßigen Handel vermieden wird und die Gewähr gegen ihren Missbrauch gegeben ist.

Artikel 10.42

Antragsberechtigte

Jede Vertragspartei räumt den folgenden Personen das Recht ein, die in diesem Abschnitt und in Teil III des TRIPS-Übereinkommens vorgesehenen Maßnahmen, Verfahren und Rechtsbehelfe zu beantragen:

a) den Inhabern von Rechten des geistigen Eigentums nach den Bestimmungen des geltenden Rechts,

b) allen anderen Personen, die zur Nutzung solcher Rechte befugt sind, insbesondere Lizenznehmern, soweit dies nach den Bestimmungen des anwendbaren Rechts zulässig ist und mit ihnen im Einklang steht,

c) Verwertungsgesellschaften mit ordnungsgemäß anerkannter Befugnis zur Vertretung von Inhabern von Rechten des geistigen Eigentums, soweit dies nach den Bestimmungen des anwendbaren Rechts zulässig ist und mit ihnen im Einklang steht, und

d) einer Vereinigung oder einem Verband, die den Rechtsstatus und die Befugnis haben, diese Rechte geltend zu machen, soweit dies nach den Bestimmungen des anwendbaren Rechts zulässig ist und mit ihnen im Einklang steht.

Unterabschnitt A

Zivilrechtliche Maßnahmen, Verfahren und Rechtsbehelfe

Artikel 10.43

Beweise

Im Falle einer Verletzung von Rechten des geistigen Eigentums in gewerblichem Ausmaß räumt jede Vertragspartei den zuständigen Gerichten die Möglichkeit ein, in geeigneten Fällen auf Antrag einer Partei die Vorlage von in der Verfügungsgewalt der gegnerischen Partei befindlichen Bank-, Finanz- oder Handelsunterlagen anzuordnen, sofern der Schutz vertraulicher Informationen gewährleistet wird.

Artikel 10.44

Einstweilige Maßnahmen zur Beweissicherung

(1) Jede Vertragspartei stellt sicher, dass die zuständigen Gerichte auch schon vor Einleitung eines Verfahrens in der Sache auf Antrag einer Partei, die alle vernünftigerweise verfügbaren Beweismittel zur Begründung ihrer Ansprüche, dass ihre Rechte des geistigen Eigentums verletzt worden sind oder verletzt zu werden drohen, vorgelegt hat, schnelle und wirksame einstweilige Maßnahmen zur Sicherung der rechtserheblichen Beweismittel hinsichtlich der behaupteten Verletzung anordnen können, sofern der Schutz vertraulicher Informationen gewährleistet wird.

(2) Jede Vertragspartei kann vorsehen, dass derartige Maßnahmen die ausführliche Beschreibung mit oder ohne Einbehaltung von Mustern oder die dingliche Beschlagnahme der rechtsverletzenden Waren sowie gegebenenfalls der für die Herstellung oder den Vertrieb dieser Waren notwendigen Werkstoffe und Geräte und der zugehörigen Unterlagen umfassen. Diese Maßnahmen werden gegebenenfalls ohne Anhörung der anderen Partei getroffen, insbesondere dann, wenn durch eine Verzögerung dem Rechteinhaber wahrscheinlich ein nicht wieder gutzumachender Schaden entstünde oder wenn nachweislich die Gefahr besteht, dass Beweise vernichtet werden.

Artikel 10.45

Recht auf Auskunft

(1) Jede Vertragspartei stellt sicher, dass die zuständigen Gerichte in zivilrechtlichen Verfahren wegen Verletzung eines Rechts des geistigen Eigentums auf einen begründeten und die Verhältnismäßigkeit wahrenden Antrag des Klägers hin anordnen können, dass Auskünfte über den Ursprung und die Vertriebswege von Waren oder Dienstleistungen, die ein Recht des geistigen Eigentums verletzen, von dem Verletzer und/oder jeder anderen Person, die Partei oder Zeuge in einem Rechtsstreit ist, erteilt werden.

a) Im Sinne dieses Absatzes ist "jede andere Person" eine Person, die

i) nachweislich rechtsverletzende Waren in gewerblichem Ausmaß in ihrem Besitz hatte,

ii) nachweislich rechtsverletzende Dienstleistungen in gewerblichem Ausmaß in Anspruch genommen hat,

iii) nachweislich für rechtsverletzende Tätigkeiten genutzte Dienstleistungen in gewerblichem Ausmaß erbracht hat oder

iv) nach Angaben der unter Buchstabe a genannten Person an der Herstellung, der Erzeugung oder dem Vertrieb solcher Waren oder an der Erbringung solcher Dienstleistungen beteiligt war.

b) Die Auskünfte beinhalten, soweit angebracht,

i) die Namen und Adressen der Hersteller, Erzeuger, Vertreiber, Lieferer und anderer Vorbesitzer der Waren oder Dienstleistungen sowie der gewerblichen Abnehmer und Verkaufsstellen, für die sie bestimmt waren, oder

ii) Angaben über die Mengen der hergestellten, erzeugten, ausgelieferten, erhaltenen oder bestellten Waren und über die Preise, die für die betreffenden Waren oder Dienstleistungen gezahlt wurden.

(2) Dieser Artikel gilt unbeschadet anderer gesetzlicher Bestimmungen, die

a) dem Rechteinhaber weitergehende Auskunftsrechte einräumen,

b) die Verwendung der nach diesem Artikel erteilten Auskünfte in zivil- oder strafrechtlichen Verfahren regeln,

c) die Haftung wegen Missbrauchs des Auskunftsrechts regeln,

d) die Verweigerung von Auskünften zulassen, mit denen die in Absatz 1 genannte Person gezwungen würde, ihre Beteiligung oder die Beteiligung naher Verwandter an einer Verletzung eines Rechts des geistigen Eigentums zuzugeben, oder

e) den Schutz der Vertraulichkeit von Informationsquellen oder die Verarbeitung personenbezogener Daten regeln.

Artikel 10.46

Einstweilige Maßnahmen und Sicherungsmaßnahmen

(1) Jede Vertragspartei stellt sicher, dass die Gerichte die Möglichkeit haben, auf Antrag des Antragstellers eine einstweilige Maßnahme anzuordnen, um eine drohende Verletzung eines Rechts des geistigen Eigentums zu verhindern oder einstweilig und, sofern ihre Rechtsvorschriften dies vorsehen, in geeigneten Fällen unter Verhängung von Zwangsgeldern die Fortsetzung angeblicher Verletzungen dieses Rechts zu untersagen oder die Fortsetzung an die Stellung von Sicherheiten zu knüpfen, die die Entschädigung des Rechteinhabers sicherstellen sollen. Eine einstweilige Maßnahme kann auch gegen eine Mittelsperson [69] angeordnet werden, deren Dienste von einem Dritten zwecks Verletzung eines Urheberrechts, eines verwandten Schutzrechts, einer Marke oder einer geografischen Angabe in Anspruch genommen werden.

(2) Eine einstweilige Maßnahme kann auch zwecks Beschlagnahme der Waren angeordnet werden, bei denen der Verdacht auf Verletzung eines Rechts des geistigen Eigentums besteht, um deren Inverkehrbringen und Umlauf auf den Vertriebswegen zu verhindern.

(3) Im Falle von Rechtsverletzungen in gewerblichem Ausmaß stellt jede Vertragspartei sicher, dass die zuständigen Gerichte die Möglichkeit haben, die vorsorgliche Beschlagnahme beweglichen und unbeweglichen Vermögens des angeblichen Verletzers einschließlich der Sperrung seiner Bankkonten und der Beschlagnahme sonstiger Vermögenswerte anzuordnen, wenn der Antragsteller glaubhaft macht, dass die Erfüllung seiner Schadensersatzforderung fraglich ist.

Artikel 10.47

Abhilfemaßnahmen

(1) Jede Vertragspartei stellt sicher, dass die zuständigen Gerichte auf Antrag des Antragstellers die Vernichtung von Waren, die nach ihren Feststellungen ein Recht des geistigen Eigentums verletzen, sowie jede andere Maßnahme unbeschadet etwaiger Schadensersatzansprüche des Rechteinhabers aus der Verletzung sowie ohne Entschädigung irgendwelcher Art anordnen können, um solche Waren endgültig aus den Vertriebswegen zu entfernen. Gegebenenfalls können die zuständigen Gerichte auch die Vernichtung von Materialien und Geräten anordnen, die vorwiegend zur Schaffung oder Herstellung solcher Waren verwendet werden.

(2) Die Gerichte ordnen an, dass die betreffenden Maßnahmen auf Kosten des Verletzers durchgeführt werden, es sei denn, es werden besondere Gründe geltend gemacht, die dagegen sprechen.

(3) Bei der Prüfung eines Antrags auf Abhilfemaßnahmen sind die Notwendigkeit eines angemessenen Verhältnisses zwischen der Schwere der Rechtsverletzung und den angeordneten Rechtsbehelfen sowie die Interessen Dritter zu berücksichtigen.

Artikel 10.48

Unterlassungsanordnungen

(1) Jede Vertragspartei stellt sicher, dass die zuständigen Gerichte bei Feststellung einer Verletzung eines Rechts des geistigen Eigentums gegen den Verletzer eine Unterlassungsanordnung erlassen können, die ihm die weitere Verletzung des betreffenden Rechts untersagt.

(2) Sofern dies in den Rechtsvorschriften vorgesehen ist, werden im Falle der Missachtung einer Unterlassungsanordnung in geeigneten Fällen Zwangsgelder verhängt, um ihre Einhaltung zu gewährleisten. Jede Vertragspartei stellt außerdem sicher, dass die Rechteinhaber Unterlassungsanordnungen gegen Mittelspersonen [70] beantragen können, deren Dienste von einem Dritten zwecks Verletzung eines Urheberrechts, eines verwandten Schutzrechts, einer Marke oder einer geografischen Angabe in Anspruch genommen werden.

Artikel 10.49

Ersatzmaßnahmen

Jede Vertragspartei kann vorsehen, dass die zuständigen Gerichte in geeigneten Fällen und auf Antrag der Person, der die in den Artikeln 10.47 oder 10.48 vorgesehenen Maßnahmen auferlegt werden könnten, anordnen können, dass anstelle der Anwendung der in den Artikeln 10.47 oder 10.48 genannten Maßnahmen eine Abfindung an die geschädigte Partei zu zahlen ist, sofern die betreffende Person weder vorsätzlich noch fahrlässig gehandelt hat, ihr aus der Durchführung der betreffenden Maßnahmen ein unverhältnismäßig großer Schaden entstehen würde und die Zahlung einer Abfindung an die geschädigte Partei als angemessene Entschädigung erscheint.

Artikel 10.50

Schadensersatz

(1) Jede Vertragspartei stellt sicher, dass die Gerichte bei der Festsetzung des Schadensersatzes wie folgt verfahren:

a) sie berücksichtigen alle in Frage kommenden Aspekte, wie die negativen wirtschaftlichen Auswirkungen, einschließlich der Gewinneinbußen für die geschädigte Partei und der zu Unrecht erzielten Gewinne des Verletzers, sowie in geeigneten Fällen auch andere als die rein wirtschaftlichen Faktoren, wie den immateriellen Schaden für den Rechteinhaber oder

b) sie können stattdessen in geeigneten Fällen den Schadensersatz als Pauschalbetrag festsetzen, und zwar auf der Grundlage von Faktoren wie mindestens dem Betrag der Vergütung oder Gebühr, die der Verletzer hätte entrichten müssen, wenn er die Erlaubnis zur Nutzung des betreffenden Rechts des geistigen Eigentums eingeholt hätte.

(2) Für Fälle, in denen der Verletzer eine Verletzungshandlung vorgenommen hat, ohne dass er dies wusste oder vernünftigerweise hätte wissen müssen, können die Vertragsparteien die Möglichkeit vorsehen, dass die Gerichte die Herausgabe der Gewinne oder die Zahlung von Schadensersatz anordnen, dessen Höhe im Voraus festgesetzt werden kann.

(3) In zivilrechtlichen Verfahren kann jede Vertragspartei zumindest für durch Urheberrechte oder verwandte Schutzrechte geschützte Werke, Tonträger und Darbietungen sowie in Fällen von Markennachahmungen das Recht auf einen im Voraus festgesetzten Schadensersatz vorsehen oder aufrechterhalten, das der Rechteinhaber in Anspruch nehmen kann.

Artikel 10.51

Prozesskosten

Jede Vertragspartei stellt sicher, dass angemessene und verhältnismäßige Prozesskosten und sonstige, der obsiegenden Partei entstandene Ausgaben in der Regel von der unterlegenen Partei getragen werden, sofern Billigkeitsgründe dem nicht entgegenstehen.

Artikel 10.52

Veröffentlichung von Gerichtsentscheidungen

Jede Vertragspartei stellt sicher, dass die Gerichte bei Verletzungen von Rechten des geistigen Eigentums gegebenenfalls auf Antrag des Antragstellers und auf Kosten des Verletzers geeignete Maßnahmen zur Verbreitung von Informationen über die betreffende Entscheidung, einschließlich der Bekanntmachung und der vollständigen oder teilweisen Veröffentlichung, anordnen können. Jede Vertragspartei kann andere, den besonderen Umständen angemessene Zusatzmaßnahmen, einschließlich öffentlichkeitswirksamer Anzeigen, vorsehen.

Artikel 10.53

Urheber- oder Inhabervermutung

In zivilrechtlichen Verfahren über Urheberrechte oder verwandte Schutzrechte gewährleistet jede Vertragspartei die Rechtsvermutung, dass bis zum Beweis des Gegenteils die Person oder Einrichtung, deren Name als Autor eines Werks oder Gegenstands oder als Inhaber eines verwandten Schutzrechts in Bezug auf ein Werk oder Gegenstand in der üblichen Weise angegeben ist, der rechtmäßige Inhaber des betreffenden Rechts ist.

Unterabschnitt B

Strafrechtliche Durchsetzung

Artikel 10.54

Anwendungsbereich der strafrechtlichen Durchsetzung

Jede Vertragspartei sieht Strafverfahren und Strafen vor, die zumindest bei vorsätzlicher Nachahmung von Markenwaren und vorsätzlicher unerlaubter Herstellung von Waren, die durch ein Urheberrecht oder ein verwandtes Schutzrecht [71] geschützt sind, in gewerbsmäßigem Umfang Anwendung finden.

Artikel 10.55

Nachahmung geografischer Angaben sowie von Mustern und Modellen

Vorbehaltlich ihrer Rechtsvorschriften, verfassungsrechtlichen Bestimmungen und sonstigen Vorschriften prüft jede Vertragspartei die Einführung von Maßnahmen, die die strafrechtliche Haftung für die Nachahmung geografischer Angaben sowie von Mustern und Modellen vorsehen.

Artikel 10.56

Haftung juristischer Personen

(1) Jede Vertragspartei trifft im Einklang mit ihren Rechtsgrundsätzen die gegebenenfalls erforderlichen Maßnahmen, um die Haftung juristischer Personen für die in Artikel 10.54 genannten strafbaren Handlungen vorzusehen.

(2) Diese Haftung berührt nicht die strafrechtliche Haftung der natürlichen Personen, die die strafbaren Handlungen begangen haben.

Artikel 10.57

Beihilfe

Die Bestimmungen dieses Unterabschnitts gelten für die Beihilfe zu den in Artikel 10.54 genannten strafbaren Handlungen.

Artikel 10.58

Beschlagnahme

Im Falle einer strafbaren Handlung nach Artikel 10.54 sieht jede Vertragspartei vor, dass ihre zuständigen Behörden die Befugnis haben, die Beschlagnahme von Waren, bei denen der Verdacht besteht, dass es sich um nachgeahmte Markenwaren oder um unerlaubt hergestellte urheberrechtlich geschützte Waren handelt, von Materialien und Geräten, die vornehmlich zur Ausübung der behaupteten strafbaren Handlung gedient haben, von einschlägigen Beweisen für die behauptete strafbare Handlung sowie von allen Vermögenswerten anzuordnen, die direkt oder indirekt aus der Verletzungshandlung stammen oder dadurch erlangt werden.

Artikel 10.59

Sanktionen

Für die strafbaren Handlungen nach Artikel 10.54 sieht jede Vertragspartei Sanktionen vor, die auch wirksame, verhältnismäßige und abschreckende Haft- und/oder Geldstrafen umfassen.

Artikel 10.60

Einziehung

(1) Im Falle einer strafbaren Handlung nach Artikel 10.54 sieht jede Vertragspartei vor, dass ihre zuständigen Behörden die Befugnis haben, die Einziehung und/oder Vernichtung aller nachgeahmten Markenwaren oder unerlaubt hergestellten urheberrechtlich geschützten Waren, Materialien und Geräte, die vornehmlich zur Schaffung nachgeahmter Markenwaren oder unerlaubt hergestellter urheberrechtlich geschützter Waren gedient haben, sowie der Vermögenswerte anzuordnen, die direkt oder indirekt aus der Verletzungshandlung stammen oder dadurch erlangt werden.

(2) Jede Vertragspartei stellt sicher, dass die nachgeahmten Markenwaren und die unerlaubt hergestellten urheberrechtlich geschützten Waren, die nach den Bestimmungen dieses Artikels eingezogen und nicht vernichtet wurden, außerhalb der Vertriebswege entsorgt werden, sofern die Waren nicht die Gesundheit und Sicherheit von Menschen gefährden.

(3) Jede Vertragspartei gewährleistet ferner, dass bei einer Einziehung und Vernichtung nach den Bestimmungen dieses Artikels der Beklagte keinerlei Entschädigung erhält.

(4) Jede Vertragspartei kann vorsehen, dass ihre Gerichte die Befugnis haben, die Einziehung von Vermögenswerten in einer Höhe anzuordnen, die dem Wert der Vermögenswerte entspricht, die direkt oder indirekt aus der Verletzungshandlung stammen oder dadurch erlangt wurden.

Artikel 10.61

Rechte Dritter

Jede Vertragspartei gewährleistet, dass die Rechte Dritter ordnungsgemäß geschützt und gewahrt werden.

Unterabschnitt C

Haftung der Anbieter von Online-Diensten

Artikel 10.62

Haftung der Anbieter von Online-Diensten [72]

Die Vertragsparteien erkennen an, dass Dritte die Dienste von Vermittlern für rechtsverletzende Tätigkeiten nutzen können. Um den freien Datenverkehr für Informationsdienste zu gewährleisten und gleichzeitig die Rechte des geistigen Eigentums im digitalen Umfeld durchzusetzen, ergreift jede Vertragspartei für Vermittler die in den Artikeln 10.63 bis 10.66 genannten Maßnahmen, sofern die Vermittler in keiner Weise mit der übermittelten Information in Verbindung stehen.

Artikel 10.63

Haftung der Anbieter von Online-Diensten: "Reine Durchleitung"

(1) Die Vertragsparteien stellen sicher, dass im Fall eines Dienstes der Informationsgesellschaft, der darin besteht, von einem Nutzer gelieferte Informationen in einem Kommunikationsnetz zu übermitteln oder Zugang zu einem Kommunikationsnetz zu vermitteln, der Diensteanbieter nicht für die übermittelten Informationen haftbar ist, sofern der Anbieter

a) die Übermittlung nicht veranlasst,

b) den Adressaten der übermittelten Informationen nicht auswählt und

c) die übermittelten Informationen nicht auswählt oder verändert.

(2) Die Übermittlung von Informationen und die Vermittlung eines Zugangs nach Absatz 1 umfassen auch die automatische, kurzzeitige Zwischenspeicherung der übermittelten Informationen, soweit dies nur zur Durchführung der Übermittlung im Kommunikationsnetz geschieht und die Informationen nicht länger gespeichert werden, als es für die Übermittlung üblicherweise erforderlich ist.

(3) Dieser Artikel lässt die Möglichkeit unberührt, dass eine Justiz- oder Verwaltungsbehörde im Einklang mit den Rechtssystemen der Vertragsparteien vom Diensteanbieter verlangt, eine Rechtsverletzung abzustellen oder zu verhindern.

Artikel 10.64

Haftung der Anbieter von Online-Diensten: "Caching"

(1) Die Vertragsparteien stellen sicher, dass im Fall eines Dienstes der Informationsgesellschaft, der darin besteht, von einem Nutzer gelieferte Informationen in einem Kommunikationsnetz zu übermitteln, der Diensteanbieter nicht für die automatische, vorübergehende Zwischenspeicherung haftbar ist, die dem alleinigen Zweck dient, die Übermittlung der Information an andere Nutzer auf deren Anfrage hin effizienter zu gestalten, sofern der Diensteanbieter folgende Voraussetzungen erfüllt:

a) er verändert nicht die Information,

b) er erfüllt die Bedingungen für den Zugang zu der Information,

c) er beachtet die Regeln für die Aktualisierung der Information, die in weithin anerkannten und verwendeten Industriestandards festgelegt sind,

d) er beeinträchtigt nicht die erlaubte Anwendung von Technologien zur Sammlung von Daten über die Nutzung der Information, die in weithin anerkannten und verwendeten Industriestandards festgelegt sind, und

e) er handelt zügig, um eine von ihm gespeicherte Information zu entfernen oder den Zugang zu ihr zu sperren, sobald er tatsächliche Kenntnis davon erhält, dass die Information am ursprünglichen Ausgangsort der Übertragung aus dem Netz entfernt wurde oder der Zugang zu ihr gesperrt wurde oder eine Justiz- oder Verwaltungsbehörde die Entfernung oder Sperrung angeordnet hat.

(2) Dieser Artikel lässt die Möglichkeit unberührt, dass eine Justiz- oder Verwaltungsbehörde im Einklang mit den Rechtssystemen der Vertragsparteien vom Diensteanbieter verlangt, eine Rechtsverletzung abzustellen oder zu verhindern.

Artikel 10.65

Haftung der Anbieter von Online-Diensten: "Hosting"

(1) Die Vertragsparteien stellen sicher, dass im Fall eines Dienstes der Informationsgesellschaft, der in der Speicherung einer von einem Nutzer gelieferten Information besteht, der Diensteanbieter nicht für die im Auftrag eines Nutzers gespeicherten Informationen haftbar ist, sofern der Diensteanbieter folgende Voraussetzungen erfüllt:

a) er hat keine tatsächliche Kenntnis von der rechtswidrigen Tätigkeit oder Information und ist sich, was Schadensersatzansprüche anbelangt, keiner Tatsachen oder Umstände bewusst, aus denen die rechtswidrige Tätigkeit oder Information offensichtlich wird, oder

b) er wird, sobald er diese Kenntnis oder dieses Bewusstsein erlangt, unverzüglich tätig, um die Information zu entfernen oder den Zugang zu ihr zu sperren.

(2) Absatz 1 findet keine Anwendung, wenn der Nutzer dem Diensteanbieter untersteht oder von ihm beaufsichtigt wird.

(3) Dieser Artikel lässt die Möglichkeit unberührt, dass eine Justiz- oder Verwaltungsbehörde im Einklang mit den Rechtssystemen der Vertragsparteien vom Diensteanbieter verlangt, eine Rechtsverletzung abzustellen oder zu verhindern, oder dass die Vertragsparteien Verfahren für die Entfernung einer Information oder die Sperrung des Zugangs zu ihr festlegen.

Artikel 10.66

Keine allgemeine Überwachungspflicht

(1) Die Vertragsparteien erlegen Anbietern von Diensten im Sinne der Artikel 10.63 bis 10.65 keine allgemeine Verpflichtung auf, die von ihnen übermittelte oder gespeicherte Information zu überwachen oder aktiv nach Tatsachen oder Umständen zu forschen, die auf eine rechtswidrige Tätigkeit hinweisen.

(2) Die Vertragsparteien können Anbieter von Diensten der Informationsgesellschaft dazu verpflichten, die zuständigen Behörden unverzüglich über mutmaßlich rechtswidrige Tätigkeiten, die von Nutzern ihres Dienstes ausgeübt, oder mutmaßlich rechtswidrige Informationen, die von Nutzern ihres Dienstes geliefert werden, zu unterrichten oder den zuständigen Behörden auf Anfrage Informationen zu übermitteln, anhand deren die Nutzer ihres Dienstes, mit denen sie Vereinbarungen über die Speicherung geschlossen haben, ermittelt werden können.

Unterabschnitt D

Sonstige Bestimmungen

Artikel 10.67

Grenzmaßnahmen

(1) Sofern in diesem Abschnitt nichts anderes bestimmt ist, legt jede Vertragspartei Verfahren [73] fest, nach denen ein Rechteinhaber, der den begründeten Verdacht hat, dass es zur Einfuhr, Ausfuhr, Wiederausfuhr, Überführung in den Zolltransit, Umladung, Verbringung in eine Freizone [74],Überführung in ein zollrechtliches Nichterhebungsverfahren [75] oder in ein Zollfreilager von Waren kommen kann, die ein Recht des geistigen Eigentums verletzen [76], bei den zuständigen Justiz- oder Verwaltungsbehörden schriftlich beantragen kann, dass die Zollbehörden die Freigabe dieser Waren in den freien Verkehr aussetzen oder die Waren einbehalten.

(2) Für den Fall, dass die Zollbehörden während ihrer Tätigkeit und bevor ein Rechteinhaber einen Antrag eingereicht hat oder einem solchen stattgegeben wurde, den ausreichend begründeten Verdacht haben, dass Waren ein Recht des geistigen Eigentums verletzen, stellen die Vertragsparteien sicher, dass die Zollbehörden die Freigabe der Waren aussetzen oder diese einbehalten können, damit der Rechteinhaber einen Antrag auf Tätigwerden der Behörden nach Absatz 1 stellen kann.

(3) Die zur Erfüllung der in Teil III Abschnitt 4 des TRIPS-Übereinkommens festgelegten Rechte und Pflichten des Einführers gelten auch für den Ausführer oder gegebenenfalls den Besitzer [77] der Waren.

(4) Korea kommt der in den Absätzen 1 und 2 genannten Verpflichtung in Bezug auf Buchstabe c Ziffern i und iii der Fußnote 27 innerhalb von zwei Jahren nach Inkrafttreten dieses Abkommens vollständig nach.

Artikel 10.68

Verhaltenskodizes

Die Vertragsparteien wirken darauf hin, dass

a) die Handels- oder Berufsverbände oder -organisationen Verhaltenskodizes ausarbeiten, die zur Durchsetzung der Rechte des geistigen Eigentums beitragen, indem sie insbesondere die Anbringung eines Codes auf optischen Speicherplatten empfehlen, anhand dessen festzustellen ist, wo sie hergestellt wurden, und

b) den zuständigen Behörden der Vertragsparteien die Entwürfe der Verhaltenskodizes und etwaige Gutachten über deren Anwendung übermittelt werden.

Artikel 10.69

Zusammenarbeit

(1) Die Vertragsparteien kommen überein, mit dem Ziel zusammenzuarbeiten, die Erfüllung der Zusagen und Verpflichtungen dieses Kapitels zu unterstützen. Die Zusammenarbeit umfasst unter anderem folgende Tätigkeiten:

a) Informationsaustausch über den Rechtsrahmen für Rechte des geistigen Eigentums und über Regeln zum Schutz und zur Durchsetzung dieser Rechte; Erfahrungsaustausch über Fortschritte bei der Rechtsetzung,

b) Erfahrungsaustausch über die Durchsetzung von Rechten des geistigen Eigentums,

c) Erfahrungsaustausch über die Durchsetzung dieser Rechte auf zentraler und subzentraler Ebene durch die Zollbehörden, die Polizei sowie durch Verwaltungs- und Justizstellen; Koordinierung, auch mit anderen Ländern, um die Ausfuhr nachgeahmter Waren zu verhindern,

d) Kompetenz- und Organisationsaufbau und

e) Förderung und Verbreitung von Informationen über die Rechte des geistigen Eigentums, unter anderem in Geschäftskreisen und in der Zivilgesellschaft; Förderung der Öffentlichkeitsarbeit bei Verbrauchern und Rechteinhabern.

(2) Unbeschadet des Absatzes 1 und ergänzend dazu kommen die Europäische Union und Korea überein, einen fruchtbaren Dialog über die Rechte des geistigen Eigentums (IP-Dialog) in Gang zu setzen und zu unterhalten, bei dem Fragen im Zusammenhang mit dem Schutz und der Durchsetzung von Rechten des geistigen Eigentums nach diesem Kapitel sowie weitere einschlägige Themen behandelt werden.

KAPITEL ELF

WETTBEWERB

ABSCHNITT A

Wettbewerb

Artikel 11.1

Grundsätze

(1) Die Vertragsparteien erkennen die Bedeutung eines freien und unverfälschten Wettbewerbs in ihren Handelsbeziehungen an. Sie verpflichten sich, ihr Wettbewerbsrecht in einer Weise anzuwenden, die verhindert, dass die Vorteile aus der Liberalisierung des Warenhandels, des Dienstleistungshandels und der Niederlassung durch wettbewerbsfeindliche Geschäftsgebaren oder Geschäftsvorgänge aufgehoben oder zunichte gemacht werden.

(2) Die Vertragsparteien wenden in ihren Gebieten ein umfassendes Wettbewerbsrecht an, das wirksam gegen einschränkende Vereinbarungen, abgestimmte Verhaltensweisen [78] und die missbräuchliche Ausnutzung einer marktbeherrschenden Stellung durch ein oder mehrere Unternehmen vorgeht und Unternehmenszusammenschlüsse wirksam kontrolliert.

(3) Die Vertragsparteien stimmen darin überein, dass die folgenden wettbewerbsbeschränkenden Praktiken insofern mit dem ordnungsgemäßen Funktionieren dieses Abkommens unvereinbar sind, als sie geeignet sind, ihren gegenseitigen Handel zu beeinträchtigen:

a) Vereinbarungen zwischen Unternehmen, Beschlüsse von Unternehmensverbänden und abgestimmte Verhaltensweisen, die im gesamten Gebiet der jeweiligen Vertragspartei oder in einem wesentlichen Teil dieses Gebietes die Verhinderung, Einschränkung oder Verzerrung des Wettbewerbs bezwecken oder bewirken,

b) die missbräuchliche Ausnutzung einer marktbeherrschenden Stellung im gesamten Gebiet der jeweiligen Vertragspartei oder in einem wesentlichen Teil dieses Gebiets durch ein oder mehrere Unternehmen oder

c) Unternehmenszusammenschlüsse, die insbesondere durch die Schaffung oder den Ausbau einer marktbeherrschenden Stellung im gesamten Gebiet der jeweiligen Vertragspartei oder in einem wesentlichen Teil dieses Gebiets einen wirksamen Wettbewerb erheblich behindern.

Artikel 11.2

Begriffsbestimmungen

Für die Zwecke dieses Abschnitts umfasst der Begriff Wettbewerbsrecht:

a) im Falle der Europäischen Union die Artikel 101, 102 und 106 des Vertrags über die Arbeitsweise der Europäischen Union und die Verordnung (EG) Nr. 139/2004 des Rates über die Kontrolle von Unternehmenszusammenschlüssen sowie die entsprechenden Durchführungsverordnungen und Änderungen,

b) im Falle von Korea den "Monopoly Regulation and Fair Trade Act" sowie die entsprechenden Durchführungsverordnungen und Änderungen und

c) alle Änderungen der in diesem Artikel genannten Rechtsinstrumente, die nach Inkrafttreten dieses Abkommens vorgenommen werden.

Artikel 11.3

Durchführung

(1) Die Vertragsparteien unterhalten eine oder mehrere Behörden, die für die Durchführung des Wettbewerbsrechts nach Artikel 11.2 zuständig und angemessen ausgestattet sind.

(2) Die Vertragsparteien erkennen an, wie wichtig eine transparente, fristgemäße und diskriminierungsfreie Anwendung ihres Wettbewerbsrechts ist, bei der die Grundsätze des fairen Verfahrens und des Rechts auf Verteidigung für die betroffenen Parteien respektiert werden.

(3) Auf Ersuchen einer Vertragspartei stellt die andere Vertragspartei öffentliche Informationen über ihre Maßnahmen zur Durchführung des Wettbewerbsrechts und über ihre Rechtsvorschriften im Zusammenhang mit den sich aus diesem Abschnitt ergebenden Verpflichtungen zur Verfügung.

Artikel 11.4

Öffentliche Unternehmen und Unternehmen mit besonderen Rechten [79] oder ausschließlichen Rechten

(1) Für öffentliche Unternehmen und Unternehmen mit besonderen oder ausschließlichen Rechten gilt Folgendes:

a) die Vertragsparteien erlassen keine Maßnahmen oder erhalten keine Maßnahmen aufrecht, die den Grundsätzen nach Artikel 11.1 zuwiderlaufen, und

b) sie stellen sicher, dass diese Unternehmen dem Wettbewerbsrecht nach Artikel 11.2 unterliegen,

soweit die Anwendung dieser Grundsätze und des Wettbewerbsrechts die Erfüllung der diesen Unternehmen übertragenen besonderen Aufgaben weder rechtlich noch tatsächlich behindert.

(2) Absatz 1 ist nicht dahingehend auszulegen, dass eine Vertragspartei daran gehindert wird, ein öffentliches Unternehmen zu gründen oder beizubehalten, Unternehmen besondere oder ausschließliche Rechte einzuräumen oder solche Rechte aufrechtzuerhalten.

Artikel 11.5

Staatliche Monopole

(1) Jede Vertragspartei formt staatliche Handelsmonopole so um, dass die Herstellungs- und Vermarktungsbedingungen für Waren keine Maßnahmen enthalten, die zwischen natürlichen und juristischen Personen der beiden Vertragsparteien diskriminieren [80].

(2) Absatz 1 ist nicht dahingehend auszulegen, dass eine Vertragspartei daran gehindert wird, ein staatliches Monopol zu gründen oder beizubehalten.

(3) Dieser Artikel lässt die in Kapitel Neun (Öffentliches Beschaffungswesen) aufgeführten Rechte und Pflichten unberührt.

Artikel 11.6

Zusammenarbeit

(1) Die Vertragsparteien stimmen darin überein, dass Zusammenarbeit und Koordinierung zwischen ihren jeweiligen Wettbewerbsbehörden wichtig sind, um das Wettbewerbsrecht noch wirksamer durchzusetzen und die Ziele dieses Abkommens zu verwirklichen, indem der Wettbewerb gefördert und wettbewerbsfeindliche Geschäftsgebaren oder Geschäftsvorgänge eingeschränkt werden.

(2) Die Zusammenarbeit der Vertragsparteien erstreckt sich auf ihre jeweilige Durchsetzungspraxis und die Durchsetzung ihres Wettbewerbsrechts, unter anderem durch Zusammenarbeit der Wettbewerbsbehörden, Notifikationen, Konsultationen und den Austausch nicht vertraulicher Informationen auf der Grundlage des am 23. Mai 2009 unterzeichneten Abkommens zwischen der Europäischen Gemeinschaft und der Regierung der Republik Korea über die Zusammenarbeit bei wettbewerbswidrigen Verhaltensweisen.

Artikel 11.7

Konsultationen

(1) Sofern das in Artikel 11.6 Absatz 2 genannte Abkommen keine spezifischeren Bestimmungen enthält, nimmt eine Vertragspartei auf Ersuchen der anderen Vertragspartei Konsultationen über deren Stellungnahmen auf, um die gegenseitige Verständigung zwischen den Vertragsparteien zu fördern oder spezifische Fragen zu diesem Abschnitt zu erörtern. Die andere Vertragspartei gibt in ihrem Ersuchen gegebenenfalls an, inwiefern die Frage den Handel zwischen den Vertragsparteien betrifft.

(2) Auf Ersuchen einer Vertragspartei erörtern die Vertragsparteien unverzüglich jede Frage, die sich aus der Auslegung oder Anwendung dieses Abschnitts ergibt.

(3) Um im Rahmen der Konsultationen eine Diskussion über die betreffende Frage zu erleichtern, bemüht sich jede Vertragspartei, der anderen Vertragspartei einschlägige, nicht vertrauliche Informationen zur Verfügung zu stellen.

Artikel 11.8

Streitbeilegung

Die Vertragsparteien dürfen sich in Fragen, die sich aus diesem Abschnitt ergeben, nicht auf Kapitel Vierzehn (Streitbeilegung) berufen.

ABSCHNITT B

Subventionen

Artikel 11.9

Grundsätze

Die Vertragsparteien kommen überein, sich nach besten Kräften darum zu bemühen, durch Subventionen verursachte Wettbewerbsverzerrungen, soweit sie den internationalen Handel beeinträchtigen, durch die Anwendung ihres Wettbewerbsrechts oder auf sonstige Weise zu beseitigen und das Auftreten von Wettbewerbsverzerrungen zu verhindern.

Artikel 11.10

Begriffsbestimmungen der Subvention und der Spezifizität

(1) Eine Subvention ist eine Maßnahme, bei der die Bedingungen nach Artikel 1.1 des Subventionsübereinkommens erfüllt sind.

(2) Eine Subvention gilt als spezifisch, wenn sie unter Artikel 2 des Subventionsübereinkommens fällt. Eine Subvention unterliegt diesem Abschnitt nur insofern, als sie im Sinne des Artikels 2 des Subventionsübereinkommens als spezifisch gilt.

Artikel 11.11

Verbotene Subventionen [81], [82]

Die folgenden Subventionen gelten nach Artikel 2 des Subventionsübereinkommens als spezifisch und sind für die Zwecke dieses Abkommens insofern verboten, als sie den internationalen Handel der Vertragsparteien beeinträchtigen [83]:

a) Subventionen, die im Rahmen einer Rechtsvereinbarung gewährt werden, bei der eine Regierung oder eine öffentliche Einrichtung für die Deckung von Schulden oder Verbindlichkeiten bestimmter Unternehmen im Sinne des Artikels 2.1 des Subventionsübereinkommens haftet, wobei weder die Höhe dieser Schulden und Verbindlichkeiten noch die Dauer dieser Haftung rechtlich oder tatsächlich begrenzt sind, und

b) Subventionen (wie Krediten und Bürgschaften, Barzuschüsse, Kapitalzuführungen, Bereitstellung von Vermögenswerten unter dem Marktpreis oder Steuerbefreiungen) für insolvente oder angeschlagene Unternehmen ohne einen überzeugenden, auf realistische Annahmen gestützten Sanierungsplan, der die langfristige Erholung des insolventen oder angeschlagenen Unternehmens innerhalb einer angemessenen Frist gewährleistet, und ohne eine beträchtliche Eigenbeteiligung des Unternehmens an den Sanierungskosten. Diese Bestimmungen hindern die Vertragsparteien nicht daran, Subventionen als vorübergehende Liquiditätshilfe in Form von Kreditbürgschaften oder von Krediten zu gewähren, die auf den Betrag begrenzt sind, der erforderlich ist, um ein angeschlagenes Unternehmen so lange geschäftsfähig zu erhalten, bis ein Sanierungs- oder Liquidationsplan ausgearbeitet ist.

Buchstabe b gilt nicht für Subventionen, die als Ausgleich für die Erfüllung gemeinwirtschaftlicher Verpflichtungen oder dem Steinkohlebergbau gewährt werden.

Artikel 11.12

Transparenz

(1) Jede Vertragspartei sorgt für Transparenz im Bereich der Subventionen. Zu diesem Zweck erstattet jede Vertragspartei der anderen Vertragspartei jährlich Bericht über den Gesamtbetrag, die verschiedenen Arten und die sektorale Verteilung von Subventionen, die spezifisch sind und den internationalen Handel beeinträchtigen könnten. Die Berichterstattung sollte Informationen über das Ziel, die Form, den Betrag oder den Finanzplan und möglichst auch über den Empfänger der von einer Regierung oder einer öffentlichen Einrichtung gewährten Subvention umfassen.

(2) Der Bericht gilt als vorgelegt, wenn er bis zum 31. Dezember des folgenden Kalenderjahres an die andere Vertragspartei übermittelt wird oder wenn die einschlägigen Informationen bis zu diesem Zeitpunkt auf einer Internet-Website öffentlich zugänglich sind.

(3) Auf Ersuchen einer Vertragspartei erteilt die andere Vertragspartei weitergehende Auskünfte über alle Subventionsregelungen und über bestimmte Einzelfälle von Subventionen, die spezifisch sind. Die Vertragsparteien berücksichtigen bei diesem Informationsaustausch die Beschränkungen, die die Wahrung des Berufs- und Geschäftsgeheimnisses auferlegt.

Artikel 11.13

Verhältnis zum WTO-Übereinkommen

Das Recht einer Vertragspartei, nach Maßgabe der einschlägigen Bestimmungen des WTO-Übereinkommens gegen eine von der anderen Vertragspartei gewährte Subvention handelspolitische Schutzmaßnahmen einzuführen, ein Streitbeilegungsverfahren in Anspruch zu nehmen oder eine andere angemessene Maßnahme zu ergreifen, bleibt von den Bestimmungen dieses Abschnitts unberührt.

Artikel 11.14

Überwachung und Überprüfung

Die Vertragsparteien überprüfen laufend die in diesem Abschnitt aufgeführten Angelegenheiten. Jede Vertragspartei kann den Handelsausschuss damit befassen. Die Vertragsparteien kommen überein, die bei der Umsetzung dieses Abschnitts erzielten Fortschritte nach Inkrafttreten dieses Abkommens alle zwei Jahre zu überprüfen, sofern beide Vertragsparteien nichts anderes vereinbaren.

Artikel 11.15

Geltungsbereich

(1) Die Artikel 11.9 bis 11.14 gelten für Subventionen, die für Waren gewährt werden; ausgenommen sind Fischereisubventionen, Subventionen für unter Anhang 1 des Landwirtschaftsübereinkommens fallende Erzeugnisse sowie andere unter das Landwirtschaftsübereinkommen fallende Subventionen.

(2) Die Vertragsparteien bemühen sich nach Kräften, Regeln für die Subventionsvergabe im Dienstleistungsbereich auszuarbeiten, wobei sie die Entwicklungen auf multilateraler Ebene berücksichtigen und auf Ersuchen der jeweils anderen Vertragspartei Informationen austauschen. Die Vertragsparteien kommen überein, innerhalb von drei Jahren nach Inkrafttreten dieses Abkommens einen ersten Erfahrungsaustausch zum Thema Subventionsvergabe im Dienstleistungsbereich abzuhalten.

KAPITEL ZWÖLF

TRANSPARENZ

Artikel 12.1

Begriffsbestimmungen

Für die Zwecke dieses Kapitels gelten folgende Begriffsbestimmungen:

Allgemeingültige Maßnahmen sind alle allgemeinen oder abstrakten Handlungen, Verfahren, Auslegungen oder sonstigen Anforderungen, einschließlich nicht verbindlicher Maßnahmen. Entscheidungen, die an eine bestimmte Person gerichtet sind, zählen nicht dazu; und

interessierte Personen sind alle natürlichen oder juristischen Personen, denen im Rahmen von allgemeingültigen Maßnahmen Rechte und Pflichten im Sinne des Artikels 12.2 übertragen werden können.

Artikel 12.2

Ziel und Geltungsbereich

Die Vertragsparteien erkennen an, dass sich ihr jeweiliger Regelungsrahmen auf ihren gegenseitigen Handel auswirken kann, und streben für die Wirtschaftsbeteiligten, insbesondere für in ihren Gebieten geschäftstätige kleine Akteure, ein effizientes und verlässliches Regelungsumfeld an. Sie bekräftigen ihre jeweiligen Pflichten aus dem WTO-Übereinkommen und legen präzisere Vorgaben und verbesserte Regelungen für die Bereiche Transparenz, Konsultation und bessere Verwaltung allgemeingültiger Maßnahmen fest, sofern sich diese Maßnahmen auf eine unter dieses Abkommen fallende Angelegenheit auswirken können.

Artikel 12.3

Veröffentlichung

(1) Jede Vertragspartei stellt für allgemeingültige Maßnahmen, die sich auf eine unter dieses Abkommen fallende Angelegenheit auswirken können, Folgendes sicher:

a) Die Maßnahmen sind für interessierte Personen ohne weiteres über ein offiziell benanntes, nach Möglichkeit elektronisches Medium ohne Diskriminierung zugänglich, so dass sich interessierte Personen und die andere Vertragspartei damit vertraut machen können;

b) die Vertragsparteien erläutern die Gründe für solche Maßnahmen und ihr Ziel, und

c) sie gewährleisten eine ausreichende Frist zwischen der Veröffentlichung und dem Inkrafttreten solcher Maßnahmen, wobei sie die Anforderungen der Rechtssicherheit, des Vertrauensschutzes und der Verhältnismäßigkeit gebührend berücksichtigen.

(2) Jede Vertragspartei:

a) bemüht sich, allgemeingültige Maßnahmen, deren Annahme oder Änderung sie vorschlagen, vorab zu veröffentlichen, und zwar einschließlich einer Erläuterung der Gründe für den Vorschlag und seines Ziels,

b) räumt interessierten Personen angemessene Möglichkeiten ein, zu den vorgeschlagenen Maßnahmen Stellung zu nehmen, wobei sie insbesondere gewährleistet, dass die Fristen dafür ausreichend sind, und

c) bemüht sich, die Stellungnahmen interessierter Personen zu solchen vorgeschlagenen Maßnahmen zu berücksichtigen.

Artikel 12.4

Anfragen und Kontaktstellen

(1) Um Anfragen interessierter Personen zu vorgeschlagenen oder geltenden allgemeingültigen Maßnahmen, die sich auf Angelegenheiten dieses Abkommens auswirken können, sowie zu deren Anwendung zu beantworten, führt jede Vertragspartei geeignete Mechanismen ein und behält diese bei. Anfragen können über im Rahmen dieses Abkommens eingerichtete Auskunfts- oder Kontaktstellen, gegebenenfalls auch im Wege anderer Mechanismen, gestellt werden.

(2) Sofern in ihren Rechts- und Verwaltungsvorschriften nichts anderes bestimmt ist, erkennen die Vertragsparteien an, dass Antworten nach Absatz 1 lediglich Informationszwecken dienen und weder endgültig noch rechtsverbindlich sein können.

(3) Auf Ersuchen einer Vertragspartei gibt die andere Vertragspartei umgehend Auskunft und beantwortet Fragen zu geltenden oder vorgeschlagenen allgemeingültigen Maßnahmen, die nach Auffassung der ersuchenden Vertragspartei die Wirkungsweise dieses Abkommens beeinträchtigen könnten, und zwar unabhängig davon, ob die ersuchende Vertragspartei vorab von der Maßnahme in Kenntnis gesetzt wurde.

(4) Jede Vertragspartei bemüht sich, interessierten Personen der anderen Vertragspartei Auskunfts- oder Kontaktstellen zu benennen oder solche Stellen einzurichten und diese damit zu beauftragen, für Probleme, die sich möglicherweise für diese Personen aus der Anwendung allgemeingültiger Maßnahmen ergeben, eine geeignete Lösung zu finden. Die entsprechenden Verfahren sollten leicht zugänglich, zeitlich begrenzt, ergebnisorientiert und transparent sein. Von den Vertragsparteien eingeführte oder beibehaltene Rechtsbehelfsverfahren bleiben davon unberührt. Desgleichen bleiben die sich aus Kapitel Vierzehn (Streitbeilegung) und Anhang 14-A (Vermittlungsverfahren für nichttarifäre Maßnahmen) ergebenden Rechte und Pflichten der Vertragsparteien davon unberührt.

Artikel 12.5

Verwaltungsverfahren

Damit alle allgemeingültigen Maßnahmen, die sich auf Angelegenheiten dieses Abkommens auswirken können, in folgerichtiger, unvoreingenommener und vertretbarer Weise verwaltet werden können, verfährt jede Vertragspartei bei der Anwendung dieser Maßnahmen auf bestimmte Personen, Waren oder Dienstleistungen der anderen Vertragspartei im Einzelfall wie folgt:

a) sie bemüht sich, interessierte Personen der anderen Vertragspartei, die von einem Verfahren unmittelbar betroffen sind, rechtzeitig und gemäß ihren Verfahrensvorschriften über die Einleitung des Verfahrens zu unterrichten; dabei gibt sie die Art des Verfahrens an und fügt eine Erklärung zur Rechtsgrundlage, nach der das Verfahren eingeleitet wird, sowie eine allgemeine Darstellung aller strittigen Fragen bei;

b) vor einer abschließenden Verwaltungsmaßnahme gibt sie den interessierten Personen ausreichend Gelegenheit, Fakten und Gründe zur Untermauerung ihrer Standpunkte vorzulegen, sofern dies mit den Fristen, der Art des Verfahrens und dem öffentlichen Interesse vereinbar ist, und

c) sie stellt sicher, dass sich die Verfahren auf ihre jeweiligen Rechtsvorschriften stützen und mit ihnen im Einklang stehen.

Artikel 12.6

Überprüfung und Rechtsbehelf

(1) Von jeder Vertragspartei werden gerichtliche, gerichtsähnliche oder administrative Instanzen oder Verfahren eingerichtet oder beibehalten, damit Verwaltungsmaßnahmen, die Angelegenheiten dieses Abkommens betreffen, umgehend überprüft und in begründeten Fällen korrigiert werden können. Diese Instanzen sind unparteiisch, von der mit der Durchführung von Verwaltungsmaßnahmen betrauten Dienststelle oder Behörde unabhängig und haben kein wesentliches Interesse am Ausgang der Angelegenheit.

(2) Jede Vertragspartei stellt sicher, dass die Verfahrensparteien vor solchen Gerichten oder in solchen Verfahren:

a) ausreichend Gelegenheit haben, ihre jeweiligen Standpunkte zu unterstützen oder zu verteidigen, und

b) Anspruch auf eine Entscheidung haben, die sich auf Beweise und öffentlich zugängliche Unterlagen oder, sofern ihre nationalen Rechtsvorschriften dies vorsehen, auf die Akten der betreffenden Verwaltungsbehörde stützt.

(3) Vorbehaltlich eines in ihren Rechtsvorschriften vorgesehenen Rechtsbehelfs oder einer weiteren Überprüfung stellt jede Vertragspartei sicher, dass die Dienststelle oder Behörde die betreffende Entscheidung umsetzt und sich in ihrer Verwaltungspraxis hinsichtlich der fraglichen Verwaltungsmaßnahme maßgeblich daran orientiert.

Artikel 12.7

Qualität und Effizienz von Rechtsvorschriften und gute Verwaltungspraxis

(1) Die Vertragsparteien vereinbaren, zur Steigerung der Qualität und Effizienz von Rechtsvorschriften zusammenzuarbeiten; unter anderem tauschen sie dazu Informationen über die Reform ihrer jeweiligen Rechtsvorschriften und deren Folgenabschätzung sowie über entsprechende bewährte Praktiken aus.

(2) Die Parteien bekennen sich zu den Grundsätzen der guten Verwaltungspraxis und kommen überein, zu deren Förderung zusammenzuarbeiten, unter anderem durch den Austausch von Informationen und bewährten Praktiken.

Artikel 12.8

Nichtdiskriminierung

Auf interessierte Personen der anderen Vertragspartei wendet jede Vertragspartei Transparenzstandards an, die nicht weniger günstig sind als die Standards, die sie ihren eigenen interessierten Personen, den interessierten Personen eines Drittlandes oder irgendeinem Drittland — je nachdem, welche Standards höher sind — gewähren.

KAPITEL DREIZEHN

HANDEL UND NACHHALTIGE ENTWICKLUNG

Artikel 13.1

Hintergrund und Ziele

(1) Unter Hinweis auf die Agenda 21 (VN-Konferenz für Umwelt und Entwicklung, 1992), den Johannesburg-Aktionsplan für nachhaltige Entwicklung (2002) und die Ministererklärung des Wirtschafts- und Sozialrates der Vereinten Nationen über Vollbeschäftigung und menschenwürdige Arbeit (2006) bekräftigen die Vertragsparteien ihr Bekenntnis zur Förderung der Entwicklung des internationalen Handels in einer Form, die das Ziel einer nachhaltigen Entwicklung näher bringt, und sind bestrebt, die Einbeziehung und Berücksichtigung dieses Ziels auf allen Ebenen ihrer Handelsbeziehungen zu gewährleisten.

(2) Die Vertragsparteien erkennen an, dass die wirtschaftliche und soziale Entwicklung und der Umweltschutz Komponenten einer nachhaltigen Entwicklung sind, die sich gegenseitig beeinflussen und verstärken. Sie betonen, dass eine Zusammenarbeit in handelsbezogenen sozialen und umweltspezifischen Fragen als Bestandteil eines Gesamtkonzepts für die Bereiche Handel und nachhaltige Entwicklung von Vorteil ist.

(3) Die Vertragsparteien erkennen an, dass sie mit diesem Kapitel nicht die Absicht verfolgen, die Arbeits- oder Umweltnormen der Vertragsparteien zu harmonisieren, sondern dass sie ihre Handelsbeziehungen und ihre Zusammenarbeit dahingehend intensivieren möchten, dass eine nachhaltige Entwicklung im Sinne der Absätze 1 und 2 gefördert wird.

Artikel 13.2

Geltungsbereich

(1) Sofern in diesem Kapitel nichts anderes bestimmt ist, gelten seine Bestimmungen für von den Vertragsparteien getroffene oder aufrechterhaltene Maßnahmen, die Handelsaspekte umwelt- und arbeitsspezifischer Fragen [84] im Zusammenhang mit Artikel 13.1 Absätze 1 und 2 betreffen.

(2) Die Vertragsparteien betonen, dass Umwelt- und Arbeitsnormen nicht für protektionistische Zwecke genutzt werden sollten. Sie halten fest, dass ihre komparativen Vorteile keinesfalls in Frage gestellt werden sollten.

Artikel 13.3

Regelungsrecht und Schutzniveau

Unter Anerkennung des Rechts einer jeden Vertragspartei, ihre eigenen Umweltschutz- und Arbeitsschutzniveaus zu bestimmen und ihre Gesetze und Politikvorhaben für diese Bereiche entsprechend festzulegen oder zu ändern, bemüht sich jede Vertragspartei sicherzustellen, dass diese Gesetze und Politikvorhaben ein hohes Umweltschutz- und Arbeitsschutzniveau vorsehen und fördern, welches mit den in den Artikeln 13.4 und 13.5 aufgeführten international anerkannten Normen oder Vereinbarungen im Einklang steht, und ist bestrebt, diese Gesetze und Politikvorhaben weiter zu verbessern.

Artikel 13.4

Multilaterale Arbeitsnormen und Arbeitsvereinbarungen

(1) Die Vertragsparteien erkennen an, dass eine internationale Zusammenarbeit und internationale Vereinbarungen in den Bereichen Beschäftigung und Arbeit als Antwort der internationalen Gemeinschaft auf die wirtschaftlichen, beschäftigungs-spezifischen and sozialen Herausforderungen und Chancen der Globalisierung von großer Bedeutung sind. Sie verpflichten sich, soweit angebracht, sich in handelsbezogenen Arbeits- und Beschäftigungsfragen von beiderseitigem Interesse zu konsultieren und zusammenzuarbeiten.

(2) Die Vertragsparteien bekräftigen ihre Zusage im Rahmen der Ministererklärung des Wirtschafts- und Sozialrates der Vereinten Nationen über Vollbeschäftigung und menschenwürdige Arbeit (2006), die produktive Vollbeschäftigung und eine menschenwürdige Arbeit für alle als Schlüsselelement der nachhaltigen Entwicklung aller Länder und als vorrangiges Ziel für die internationale Zusammenarbeit anzuerkennen und die Entwicklung des internationalen Handels dahingehend zu unterstützen, dass eine produktive Vollbeschäftigung und eine menschenwürdige Arbeit für alle, also für Männer, Frauen und junge Menschen, gefördert wird.

(3) Die Vertragsparteien verpflichten sich, gemäß ihren Verpflichtungen als IAO-Mitglieder und gemäß der von der Internationalen Arbeitskonferenz auf ihrer 86. Tagung im Jahr 1998 angenommenen IAO-Erklärung über grundlegende Prinzipien und Rechte bei der Arbeit und ihre Folgemaßnahmen, in ihren Rechtsvorschriften und Praktiken die folgenden Prinzipien grundlegender Rechte zu respektieren, zu fördern und umzusetzen:

a) Vereinigungsfreiheit und effektive Anerkennung des Rechts zu Kollektivverhandlungen,

b) Beseitigung aller Formen von Zwangs- oder Pflichtarbeit,

c) effektive Abschaffung der Kinderarbeit und

d) Beseitigung der Diskriminierung in Beschäftigung und Beruf.

Die Vertragsparteien bekräftigen ihre Verpflichtung, die von Korea und den Mitgliedstaaten der Europäischen Union ratifizierten IAO-Übereinkommen wirksam umzusetzen. Sie streben beständig und nachhaltig die Ratifizierung der Kernübereinkommen der IAO sowie der übrigen von der IAO als aktuell eingestuften Übereinkommen an.

Artikel 13.5

Multilaterale Umweltübereinkommen

(1) Die Vertragsparteien erkennen an, dass eine verantwortungsvolle internationale Umweltpolitik und internationale Umweltübereinkommen als Antwort der internationalen Gemeinschaft auf globale oder regionale Umweltprobleme von großer Bedeutung sind und verpflichten sich, soweit angebracht, sich bei Verhandlungen über handelsbezogene Umweltfragen von beiderseitigem Interesse zu konsultieren und zusammenzuarbeiten.

(2) Die Vertragsparteien bekräftigen ihre Zusage, in ihren Rechtsvorschriften und Praktiken die multilateralen Umweltübereinkommen, deren Vertragsparteien sie sind, wirksam umzusetzen.

(3) Die Vertragsparteien bekräftigen ihre Verpflichtung auf das oberste Ziel des Rahmenübereinkommens der Vereinten Nationen über Klimaänderungen und des beigefügten Kyoto-Protokolls. Sie verpflichten sich, bei der Ausarbeitung des künftigen internationalen Rahmenwerks für Klimaänderungen gemäß dem Bali-Aktionsplan [85] zusammenzuarbeiten.

Artikel 13.6

Förderung einer nachhaltigen Entwicklung durch den Handel

(1) Die Vertragsparteien bekräftigen erneut, dass der Handel eine nachhaltige Entwicklung in allen ihren Aspekten fördern sollte. Sie anerkennen die positive Rolle, die arbeitsrechtliche Mindestnormen und menschenwürdige Arbeit für wirtschaftliche Effizienz, Innovation und Produktivität spielen können, und unterstreichen den Wert größerer politischer Kohärenz zwischen Handelspolitik auf der einen und Beschäftigungs- und Arbeitspolitik auf der anderen Seite.

(2) Die Vertragsparteien setzen sich dafür ein, den Handel mit umweltfreundlichen Produkten und Dienstleistungen (beispielsweise Umwelttechnologien, nachhaltige erneuerbare Energien, energieeffiziente Produkte und Dienstleistungen sowie Produkte mit Öko-Kennzeichnung) und diesbezügliche ausländische Direktinvestitionen zu erleichtern und zu fördern, indem sie unter anderem entsprechende nichttärifäre Hemmnisse angehen. Sie bemühen sich, den Handel mit Waren zu erleichtern und zu fördern, die zu einer nachhaltigen Entwicklung beitragen; dazu zählen Waren, die über Handelsformen wie den fairen Handel oder den ethischen Handel vertrieben werden, und Waren, bei deren Herstellung und Vertrieb sozialverantwortliches Handeln und die Rechenschaftspflicht von Unternehmen maßgebend sind.

Artikel 13.7

Aufrechterhaltung des Schutzniveaus bei der Anwendung und Durchsetzung von Gesetzen, sonstigen Vorschriften oder Normen

(1) Eine Vertragspartei unterlässt es nicht, ihr Umwelt- und Arbeitsrecht in einer den Handel oder die Investitionen zwischen den Vertragsparteien beeinflussenden Weise durch anhaltende oder wiederkehrende Maßnahmen oder durch den Verzicht auf Maßnahmen wirksam durchzusetzen.

(2) Eine Vertragspartei mindert oder reduziert nicht den in ihrem jeweiligen Recht garantierten Umwelt- oder Arbeitsschutz, um den Handel oder die Investitionen zu fördern, indem sie in einer den Handel oder die Investitionen zwischen den Vertragsparteien beeinflussenden Weise von der Anwendung ihrer Gesetze, sonstigen Vorschriften oder Normen absieht oder abweicht oder diese Möglichkeiten vorsieht.

Artikel 13.8

Wissenschaftliche Informationen

Die Vertragsparteien erkennen an, dass die Berücksichtigung wissenschaftlicher und technischer Informationen und der einschlägigen internationalen Normen, Leitlinien und Empfehlungen bei der Ausarbeitung und Durchführung von Maßnahmen zum Schutz der Umwelt und der sozialen Bedingungen, die den Handel zwischen den Vertragsparteien beeinflussen, von großer Bedeutung ist.

Artikel 13.9

Transparenz

Die Vertragsparteien kommen überein, im Einklang mit ihren nationalen Rechtsvorschriften alle Maßnahmen zum Schutz der Umwelt und der Arbeitsbedingungen, die den Handel zwischen den Vertragsparteien beeinflussen, in transparenter Art und Weise auszuarbeiten, einzuführen und umzusetzen, sie rechtzeitig anzukündigen, eine öffentliche Konsultation dazu durchzuführen und nichtstaatliche Akteure, einschließlich des Privatsektors, rechtzeitig und in angemessener Weise zu informieren und zu konsultieren.

Artikel 13.10

Überprüfung der Auswirkungen auf die Nachhaltigkeit

Die Vertragsparteien verpflichten sich, die Auswirkungen der Durchführung dieses Abkommens auf die nachhaltige Entwicklung einschließlich der Förderung der menschenwürdigen Arbeit, über ihre partizipativen Verfahren und Institutionen sowie diejenigen, die im Rahmen dieses Abkommens eingerichtet werden, zu überprüfen, zu überwachen und zu bewerten, beispielsweise anhand von handelsbezogenen Nachhaltigkeitsprüfungen.

Artikel 13.11

Zusammenarbeit

In Anerkennung der Bedeutung einer Zusammenarbeit in handelsbezogenen Fragen der Sozial- und Umweltpolitik für die Erreichung der Ziele dieses Abkommens verpflichten sich die Vertragsparteien, Kooperationsmaßnahmen nach Anhang 13 einzuleiten.

Artikel 13.12

Institutioneller Mechanismus

(1) Jede Vertragspartei benennt eine Verwaltungsstelle, die für die Zwecke der Durchführung dieses Kapitels der anderen Vertragspartei als Kontaktstelle dient.

(2) Dem nach Artikel 15.2 Absatz 1 (Sonderausschüsse) eingesetzten Ausschuss "Handel und nachhaltige Entwicklung" gehören hohe Verwaltungsbeamte der Vertragsparteien an.

(3) Der Ausschuss tritt innerhalb des ersten Jahres nach Inkrafttreten dieses Abkommens und danach bei Bedarf zusammen, um die Durchführung dieses Kapitels, einschließlich der Kooperationsmaßnahmen nach Anhang 13 zu überprüfen.

(4) Jede Vertragspartei setzt mindestens eine Nationale Beratungsgruppe "Nachhaltige Entwicklung (Umwelt und Arbeit)" ein, deren Aufgabe es ist, die Durchführung dieses Kapitels beratend zu unterstützen.

(5) Der/den Nationalen Beratungsgruppe/n gehören unabhängige repräsentative Organisationen der Zivilgesellschaft an, wobei die Bereiche Umwelt, Arbeit sowie Unternehmerverbände und andere relevante Interessenträger in einem ausgewogenen Verhältnis vertreten sind.

Artikel 13.13

Zivilgesellschaftlicher Dialog

(1) Die Mitglieder der Nationalen Beratungsgruppe/n einer jeden Vertragspartei treffen sich in einem zivilgesellschaftlichen Forum, um einen Dialog über Fragen einer nachhaltigen Entwicklung der Handelsbeziehungen zwischen den Vertragsparteien zu führen. Sofern von den Vertragsparteien nichts anderes vereinbart wird, tritt das zivilgesellschaftliche Forum einmal jährlich zusammen. Die Vertragsparteien befinden spätestens ein Jahr nach Inkrafttreten dieses Abkommens durch Beschluss des Ausschusses "Handel und nachhaltige Entwicklung" über die Arbeitweise des zivilgesellschaftlichen Forums.

(2) Die Nationale/n Beratungsgruppe/n wählt/wählen die Vertreter aus ihren Mitgliedern, wobei die relevanten Interessenträger nach Artikel 13.12 Absatz 5 in einem ausgewogenen Verhältnis vertreten sind.

(3) Die Vertragsparteien können dem zivilgesellschaftlichen Forum einen Bericht über den Stand der Durchführung dieses Kapitels vorlegen. Die Auffassungen, Stellungnahmen oder Feststellungen des zivilgesellschaftlichen Forums können den Vertragsparteien entweder direkt oder über die Nationale/n Beratungsgruppe/n unterbreitet werden.

Artikel 13.14

Konsultationen auf Regierungsebene

(1) Eine Vertragspartei kann bei der Kontaktstelle der anderen Vertragspartei schriftlich um Konsultationen über Fragen ersuchen, die sich im Rahmen dieses Kapitels stellen und von beiderseitigem Interesse sind; dazu zählen auch die Mitteilungen der Nationalen Beratungsgruppe/n nach Artikel 13.12. Die Konsultationen werden unmittelbar nach der Übermittlung des Ersuchens aufgenommen.

(2) Die Vertragsparteien bemühen sich stets, eine für beide Seiten zufrieden stellende Lösung zu finden. Sie stellen sicher, dass dabei die Tätigkeiten der IAO oder relevanter multilateraler Umweltorganisationen oder -gremien berücksichtigt werden und dadurch die Zusammenarbeit und die Kohärenz zwischen der Arbeit der Vertragsparteien und diesen Organisationen gefördert wird. Sofern die Vertragsparteien dies vereinbaren, können sie diese Organisationen oder Gremien gegebenenfalls konsultieren.

(3) Vertritt eine Vertragspartei die Auffassung, dass die Frage einer eingehenderen Erörterung bedarf, kann sie bei der Kontaktstelle der anderen Vertragspartei schriftlich darum ersuchen, dass der Ausschuss "Handel und nachhaltige Entwicklung" einberufen wird und über die Frage befindet. Der Ausschuss tritt umgehend zusammen und bemüht sich um eine einvernehmliche Lösung. Sofern der Ausschuss nichts anderes beschließt, wird seine Entscheidung veröffentlicht.

(4) Der Ausschuss kann entweder eine oder beide Nationalen Beratungsgruppen konsultieren, jede Vertragspartei kann ihre eigene/n Nationale/n Beratungsgruppe/n konsultieren. Eine Nationale Beratungsgruppe einer Vertragspartei kann auch von sich aus der betreffenden Vertragspartei oder dem Ausschuss Mitteilungen unterbreiten.

Artikel 13.15

Sachverständigengruppe

(1) Sofern die Vertragsparteien nichts anderes vereinbaren, kann eine Vertragspartei 90 Tage nach Übermittlung eines Konsultationsersuchens nach Artikel 13.14 Absatz 1 zur Prüfung einer Frage, für die im Wege der Konsultationen auf Regierungsebene keine zufrieden stellende Lösung gefunden wurde, die Einberufung einer Sachverständigengruppe beantragen. Die Vertragsparteien können der Sachverständigengruppe Stellungnahmen unterbreiten. Die Sachverständigengruppe sollte nach eigenem Ermessen von beiden Vertragsparteien, der/den Nationalen Beratungsgruppe/n oder von internationalen Organisationen nach Artikel 13.14 Informationen und Ratschläge einholen. Sie tritt binnen zwei Monaten nach Übermittlung des Antrags einer Vertragspartei zusammen.

(2) Die nach dem Verfahren gemäß Absatz 3 ausgewählte Sachverständigengruppe stellt ihr Fachwissen für die Durchführung dieses Kapitels zur Verfügung. Sofern nichts anderes vereinbart wird, legt sie den Vertragsparteien innerhalb von 90 Tagen nach der Auswahl des letzten Sachverständigen einen Bericht vor. Die Vertragsparteien bemühen sich nach besten Kräften, die Ratschläge oder Empfehlungen der Sachverständigengruppe zur Durchführung dieses Kapitels zu berücksichtigen. Die Umsetzung der Empfehlungen der Sachverständigengruppe wird vom Ausschuss "Handel und nachhaltige Entwicklung" überwacht. Der Bericht der Sachverständigengruppe wird der/den Nationalen Beratungsgruppe/n der Vertragsparteien vorgelegt. Für vertrauliche Informationen gelten die Grundsätze nach Anhang 14-B (Verfahrensordnung für das Schiedsverfahren).

(3) Bei Inkrafttreten dieses Abkommens einigen sich die Vertragsparteien auf eine Liste von mindestens 15 Personen, die auf dem Gebiet dieses Kapitels über Fachwissen verfügen; mindestens fünf dieser Personen besitzen nicht die Staatsangehörigkeit einer der beiden Vertragsparteien; diese führen den Vorsitz in der Sachverständigengruppe. Die Sachverständigen müssen von beiden Vertragsparteien oder den in der/den Nationalen Beratungsgruppe/n vertretenen Organisationen unabhängig sein, sie dürfen ihnen nicht nahe stehen und auch keine Weisungen von ihnen entgegennehmen. Jede Vertragspartei wählt aus der Liste innerhalb von 30 Tagen nach Eingang des Ersuchens um Einsetzung einer Sachverständigengruppe einen Sachverständigen aus. Gelingt es einer Vertragspartei nicht, ihren Sachverständigen innerhalb dieser Frist auszuwählen, so wählt die andere Vertragspartei aus der Liste einen Staatsangehörigen der Vertragspartei aus, die keinen Sachverständigen ausgewählt hat. Die beiden ausgewählten Sachverständigen bestimmen den Vorsitzenden; dieser besitzt nicht die Staatsangehörigkeit einer der beiden Vertragsparteien.

Artikel 13.16

Streitbeilegung

Für Fragen, die sich aus diesem Kapitel ergeben, nehmen die Vertragsparteien nur die in den Artikeln 13.14 und 13.15 vorgesehenen Verfahren in Anspruch.

KAPITEL VIERZEHN

STREITBEILEGUNG

ABSCHNITT A

Ziel und Geltungsbereich

Artikel 14.1

Ziel

Ziel dieses Kapitels ist es, Streitigkeiten zwischen den Vertragsparteien über die Anwendung dieses Abkommens nach Treu und Glauben zu vermeiden und soweit möglich einvernehmlich beizulegen.

Artikel 14.2

Geltungsbereich

Sofern nichts anderes bestimmt ist, gilt dieses Kapitel für alle Streitigkeiten über die Auslegung und Anwendung dieses Abkommens [86].

ABSCHNITT B

Konsultationen

Artikel 14.3

Konsultationen

(1) Die Vertragsparteien bemühen sich, Streitigkeiten über die Auslegung und Anwendung der in Artikel 14.2 genannten Bestimmungen dadurch beizulegen, dass sie nach Treu und Glauben Konsultationen aufnehmen, um eine einvernehmliche Lösung zu erzielen.

(2) Zur Aufnahme von Konsultationen übermittelt eine Vertragspartei der anderen Vertragspartei ein schriftliches Ersuchen, in dem sie die strittigen Maßnahmen sowie die Bestimmungen des Abkommens aufführt, die ihrer Auffassung nach anzuwenden sind. Dem Handelsausschuss wird eine Kopie des Konsultationsersuchens übermittelt.

(3) Die Konsultationen werden innerhalb von 30 Tagen nach dem Tag der Übermittlung des Ersuchens aufgenommen und finden, sofern die Vertragsparteien nichts anderes vereinbaren, im Gebiet der Beschwerdegegnerin statt. Sie gelten 30 Tage nach dem Tag der Übermittlung des Ersuchens als abgeschlossen, sofern die Vertragsparteien nicht vereinbaren, sie fortzusetzen. Alle während der Konsultationen offen gelegten Informationen bleiben vertraulich.

(4) Konsultationen in dringenden Fällen, unter anderem wenn es sich um leicht verderbliche oder saisonabhängige Waren [87] handelt, werden innerhalb von 15 Tagen nach dem Tag der Übermittlung des Ersuchens aufgenommen und gelten 15 Tage nach dem Tag der Übermittlung des Ersuchens als abgeschlossen.

(5) Sind innerhalb der Fristen nach den Absätzen 3 oder 4 keine Konsultationen aufgenommen worden oder sind die Konsultationen abgeschlossen worden, ohne dass eine einvernehmliche Lösung erzielt wurde, kann die Beschwerdeführerin um Einsetzung eines Schiedspanels nach Artikel 14.4 ersuchen.

ABSCHNITT C

Streitbeilegungsverfahren

Unterabschnitt A

Schiedsverfahren

Artikel 14.4

Einleitung des Schiedsverfahrens

(1) Ist es den Vertragsparteien nicht gelungen, die Streitigkeit im Wege von Konsultationen nach Artikel 14.3 beizulegen, so kann die Beschwerdeführerin um Einsetzung eines Schiedspanels ersuchen.

(2) Das Ersuchen um Einsetzung eines Schiedspanels muss schriftlich an die Beschwerdegegnerin und an den Handelsausschuss gerichtet werden. Die Beschwerdeführerin muss in ihrem Ersuchen die strittige Maßnahme aufführen und darlegen, inwiefern sie gegen die in Artikel 14.2 genannten Bestimmungen verstößt.

Artikel 14.5

Einsetzung des Schiedspanels

(1) Ein Schiedspanel setzt sich aus drei Schiedsrichtern zusammen.

(2) Innerhalb von 10 Tagen nach dem Tag, an dem das Ersuchen um Einsetzung eines Schiedspanels dem Handelsausschuss übermittelt wurde, nehmen die Vertragsparteien Konsultationen auf, um eine Einigung über die Zusammensetzung des Schiedspanels zu erzielen.

(3) Können die Vertragsparteien innerhalb der in Absatz 2 genannten Frist keine Einigung über die Zusammensetzung des Schiedspanels erzielen, so kann jede Vertragspartei den Vorsitzenden des Handelsausschusses oder seinen Stellvertreter ersuchen, alle drei Mitglieder per Losentscheid aus der nach Artikel 14.18 aufgestellten Liste auszuwählen, eines unter den von der Beschwerdeführerin benannten Personen, eines unter den von der Beschwerdegegnerin benannten Personen und eines unter den von den Vertragsparteien für den Vorsitz benannten Personen. Erzielen die Vertragsparteien nur Einigung über ein oder zwei Mitglieder des Schiedspanels, so werden die übrigen Mitglieder nach dem gleichen Verfahren ausgewählt.

(4) Als Tag der Einsetzung des Schiedspanels gilt der Tag, an dem die drei Schiedsrichter ausgewählt sind.

Artikel 14.6

Zwischenbericht des Schiedspanels

(1) Das Schiedspanel legt den Vertragsparteien innerhalb von 90 Tagen nach dem Tag seiner Einsetzung einen Zwischenbericht vor, in dem die Sachverhaltsfeststellungen, die Anwendbarkeit der einschlägigen Bestimmungen und die wesentliche Begründung seiner Feststellungen und Empfehlungen dargelegt sind. Kann diese Frist nach Auffassung des Panels nicht eingehalten werden, so muss der Vorsitzende dies den Vertragsparteien und dem Handelsausschuss schriftlich notifizieren und ihnen die Gründe für die Verzögerung sowie den Tag mitteilen, an dem das Panel beabsichtigt, seinen Zwischenbericht vorzulegen. Der Zwischenbericht darf keinesfalls später als 120 Tage nach dem Tag der Einsetzung des Schiedspanels vorgelegt werden.

(2) Jede Vertragspartei kann innerhalb von 14 Tagen nach der Vorlage schriftlich beantragen, dass das Schiedspanel konkrete Aspekte des Zwischenberichtes überprüft.

(3) In dringenden Fällen, unter anderem wenn leicht verderbliche oder saisonabhängige Waren betroffen sind, unternimmt das Schiedspanel alle Anstrengungen, um seinen Zwischenbericht vorzulegen, und jede Vertragspartei kann innerhalb der Hälfte der unter den Absätzen 1 und 2 genannten Fristen schriftlich beantragen, dass das Schiedspanel konkrete Aspekte des Zwischenberichts überprüft.

(4) Nach Prüfung aller schriftlichen Stellungnahmen der Vertragsparteien zu dem Zwischenbericht kann das Schiedspanel seinen Bericht ändern und weitere, seines Erachtens erforderliche Prüfungen durchführen. Die endgültige Entscheidung des Schiedspanels enthält eine Erörterung der bei der Zwischenprüfung vorgelegten Beweisführung.

Artikel 14.7

Entscheidung des Schiedspanels

(1) Das Schiedspanel legt seine Entscheidung innerhalb von 120 Tagen nach dem Tag seiner Einsetzung den Vertragsparteien und dem Handelsausschuss vor. Kann diese Frist nach Auffassung des Panels nicht eingehalten werden, so muss der Vorsitzende dies den Vertragsparteien und dem Handelsausschuss schriftlich notifizieren und ihnen die Gründe für die Verzögerung sowie den Tag mitteilen, an dem das Panel beabsichtigt, seine Entscheidung vorzulegen. Die Entscheidung darf keinesfalls später als 150 Tage nach dem Tag der Einsetzung des Schiedspanels vorgelegt werden.

(2) In dringenden Fällen, unter anderem wenn leicht verderbliche oder saisonabhängige Waren betroffen sind, unternimmt das Schiedspanel alle Anstrengungen, damit es seine Entscheidung innerhalb von 60 Tagen nach dem Tag seiner Einsetzung vorlegen kann. Sie sollte keinesfalls später als 75 Tage nach dem Tag seiner Einsetzung vorgelegt werden. Das Schiedspanel kann innerhalb von 10 Tagen nach dem Tag seiner Einsetzung vorab entscheiden, ob es den Fall als dringend ansieht.

Unterabschnitt B

Durchführung der Entscheidung

Artikel 14.8

Durchführung der Entscheidung des Schiedspanels

Jede Vertragspartei trifft die erforderlichen Maßnahmen, um die Entscheidung des Schiedspanels nach Treu und Glauben durchzuführen, und die Vertragsparteien bemühen sich, eine Einigung über die Frist für die Durchführung der Entscheidung zu erzielen.

Artikel 14.9

Angemessene Frist für die Durchführung der Entscheidung

(1) Spätestens 30 Tage nach Vorlage der Entscheidung des Schiedspanels an die Vertragsparteien notifiziert die Beschwerdegegnerin der Beschwerdeführerin und dem Handelsausschuss die Frist, die sie für die Durchführung der Entscheidung benötigt.

(2) Im Falle von Meinungsverschiedenheiten zwischen den Vertragsparteien über die angemessene Frist für die Durchführung der Entscheidung des Schiedspanels kann die Beschwerdeführerin innerhalb von 20 Tagen nach der Notifikation gemäß Absatz 1 durch die Beschwerdegegnerin das ursprüngliche Schiedspanel schriftlich ersuchen, eine angemessene Frist festzulegen. Das Ersuchen wird der anderen Vertragspartei und dem Handelsausschuss notifiziert. Das Schiedspanel legt seine Entscheidung innerhalb von 20 Tagen nach dem Tag der Übermittlung des Ersuchens den Vertragsparteien und dem Handelsausschuss vor.

(3) Für den Fall, dass ein Mitglied des ursprünglichen Schiedspanels nicht länger zur Verfügung steht, finden die Verfahren des Artikels 14.5 Anwendung. Die Vorlage der Entscheidung des Schiedspanels erfolgt innerhalb einer Frist von 35 Tagen ab dem Tag, an dem das Ersuchen nach Absatz 2 übermittelt wurde.

(4) Die Beschwerdegegnerin informiert die Beschwerdeführerin spätestens einen Monat vor Ablauf der angemessenen Frist schriftlich über ihre Fortschritte bei der Durchführung der Entscheidung des Schiedspanels.

(5) Die angemessene Frist kann von den Vertragsparteien im gegenseitigen Einvernehmen verlängert werden.

Artikel 14.10

Überprüfung der Maßnahmen zur Durchführung der Entscheidung des Schiedspanels

(1) Die Beschwerdegegnerin notifiziert der Beschwerdeführerin und dem Handelsausschuss vor Ablauf der angemessenen Frist die Maßnahmen, die sie getroffen hat, um die Entscheidung des Schiedspanels durchzuführen.

(2) Kommt es zwischen den Vertragsparteien zu Meinungsverschiedenheiten über das Bestehen einer Maßnahme oder über die Vereinbarkeit von nach Absatz 1 notifizierten Maßnahmen mit den Bestimmungen des Artikels 14.2, so kann die Beschwerdeführerin das ursprüngliche Schiedspanel schriftlich ersuchen, diese Frage zu entscheiden. In dem Ersuchen muss die strittige Maßnahme aufgeführt und es muss dargelegt werden, inwiefern sie gegen die Bestimmungen des Artikels 14.2 verstößt. Das Schiedspanel legt seine Entscheidung innerhalb von 45 Tagen nach dem Tag vor, an dem das Ersuchen übermittelt wurde.

(3) Für den Fall, dass ein Mitglied des ursprünglichen Schiedspanels nicht länger zur Verfügung steht, finden die Verfahren des Artikels 14.5 Anwendung. Die Entscheidung des Schiedspanels wird innerhalb einer Frist von 60 Tagen ab dem Tag, an dem das Ersuchen nach Absatz 2 übermittelt wurde, vorgelegt.

Artikel 14.11

Vorläufige Abhilfemaßnahmen im Falle der Nichtdurchführung der Entscheidung

(1) Hat die Beschwerdegegnerin bei Ablauf der angemessenen Frist keine Maßnahmen notifiziert, die sie getroffen hat, um die Entscheidung des Schiedspanels durchzuführen, oder stellt das Schiedspanel fest, dass die nach Artikel 14.10 Absatz 1 notifizierten Maßnahmen nicht mit den Verpflichtungen dieser Vertragspartei nach Artikel 14.2 vereinbar sind, so legt die Beschwerdegegnerin auf Ersuchen der Beschwerdeführerin ein Angebot für einen vorläufigen Ausgleich vor.

(2) Ist innerhalb von 30 Tagen nach Ablauf der angemessenen Frist oder nach der Vorlage der Entscheidung des Schiedspanels nach Artikel 14.10, dass keine Durchführungsmaßnahme ergriffen wurde oder dass die nach Artikel 14.10 Absatz 1 notifizierte Maßnahme nicht mit den Bestimmungen des Artikels 14.2 vereinbar ist, keine Einigung über einen Ausgleich erzielt worden, so ist die Beschwerdeführerin nach einer Notifikation an die Beschwerdegegnerin und den Handelsausschuss berechtigt, die Erfüllung der sich aus den Bestimmungen des Artikels 14.2 ergebenden Verpflichtungen in einem Umfang auszusetzen, der dem durch den Verstoß zunichte gemachten oder geschmälerten Vorteil entspricht. In der Notifikation gibt die Beschwerdeführerin an, in welchem Umfang sie die Erfüllung der Verpflichtungen auszusetzen beabsichtigt. Die Beschwerdeführerin kann die Aussetzung 10 Tage nach dem Tag der Notifikation einleiten, sofern die Beschwerdegegnerin nicht nach Absatz 4 um ein Schiedsverfahren ersucht hat.

(3) Zur Aussetzung der Erfüllung von Verpflichtungen kann die Beschwerdeführerin ihre Zollsätze bis zur Höhe der für andere WTO-Mitglieder geltenden Zollsätze anheben, und zwar für ein Handelsvolumen, das so festzulegen ist, dass das Handelsvolumen multipliziert mit der Differenz der Zollsätze dem Wert des durch den Verstoß zunichte gemachten oder geschmälerten Vorteils entspricht.

(4) Ist die Beschwerdegegnerin der Auffassung, dass der Umfang der Aussetzung nicht dem durch den Verstoß zunichte gemachten oder geschmälerten Vorteil entspricht, so kann sie das ursprüngliche Schiedspanel schriftlich ersuchen, diese Frage zu entscheiden. Das Ersuchen wird der Beschwerdeführerin und dem Handelsausschuss vor Ablauf der in Absatz 2 genannten Frist von 10 Tagen notifiziert. Das ursprüngliche Schiedspanel legt seine Entscheidung über den Umfang der ausgesetzten Erfüllung der Verpflichtungen den Vertragsparteien und dem Handelsausschuss innerhalb von 30 Tagen nach dem Tag vor, an dem das Ersuchen übermittelt wurde. Die Erfüllung der Verpflichtungen wird nicht ausgesetzt, bis das ursprüngliche Schiedspanel seine Entscheidung vorgelegt hat; jede Aussetzung muss mit der Entscheidung des Schiedspanels vereinbar sein.

(5) Für den Fall, dass ein Mitglied des ursprünglichen Schiedspanels nicht länger zur Verfügung steht, finden die Verfahren des Artikels 14.5 Anwendung. Die Entscheidung des Schiedspanels wird innerhalb einer Frist von 45 Tagen ab dem Tag, an dem das Ersuchen nach Absatz 4 übermittelt wurde, vorgelegt.

(6) Die Aussetzung der Erfüllung von Verpflichtungen ist vorübergehend und wird nur so lange aufrechterhalten, bis die gegen die Bestimmungen des Artikels 14.2 verstoßenden Maßnahmen aufgehoben oder dahingehend geändert wurden, dass sie mit den Bestimmungen des Artikels 14.12 im Einklang stehen, oder bis die Vertragsparteien eine Einigung über die Beilegung der Streitigkeit erzielt haben.

Artikel 14.12

Überprüfung der Durchführungsmaßnahmen nach Aussetzung der Erfüllung von Verpflichtungen

(1) Die Beschwerdegegnerin notifiziert der Beschwerdeführerin und dem Handelsausschuss die Maßnahmen, die sie zur Durchführung der Entscheidung des Schiedspanels getroffen hat, sowie ihr Ersuchen, die Aussetzung der Erfüllung von Verpflichtungen seitens der Beschwerdeführerin aufzuheben.

(2) Erzielen die Vertragsparteien nicht innerhalb von 30 Tagen nach dem Tag der Notifikation eine Einigung über die Vereinbarkeit der notifizierten Maßnahme mit den Bestimmungen des Artikels 14.2, so ersucht die Beschwerdeführerin das ursprüngliche Schiedspanel schriftlich, diese Frage zu entscheiden. Das Ersuchen wird der Beschwerdegegnerin und dem Handelsausschuss notifiziert. Das Schiedspanel legt seine Entscheidung innerhalb von 45 Tagen nach dem Tag, an dem das Ersuchen übermittelt wurde, den Vertragsparteien und dem Handelsausschuss vor. Stellt das Schiedspanel fest, dass die Durchführungsmaßnahme mit den Bestimmungen des Artikels 14.2 vereinbar ist, so wird die Aussetzung der Erfüllung von Verpflichtungen aufgehoben.

(3) Für den Fall, dass ein Mitglied des ursprünglichen Schiedspanels nicht länger zur Verfügung steht, finden die Verfahren des Artikels 14.5 Anwendung. Die Entscheidung des Schiedspanels wird innerhalb einer Frist von 60 Tagen ab dem Tag, an dem das Ersuchen nach Absatz 2 übermittelt wurde, vorgelegt.

Unterabschnitt C

Gemeinsame Bestimmungen

Artikel 14.13

Einvernehmliche Lösung

Die Vertragsparteien können jederzeit eine einvernehmliche Lösung einer unter dieses Kapitel fallenden Streitigkeit vereinbaren. Sie notifizieren diese Lösung dem Handelsausschuss. Bei Annahme einer einvernehmlichen Lösung wird das Verfahren eingestellt.

Artikel 14.14

Verfahrensordnung

(1) Für unter dieses Kapitel fallende Streitbeilegungsverfahren gilt Anhang 14-B.

(2) Nach Anhang 14-B sind die Anhörungen des Schiedspanels öffentlich.

Artikel 14.15

Informationen und fachliche Beratung

Das Schiedspanel kann auf Antrag einer Vertragspartei oder von sich aus Informationen aus jeder für geeignet erachteten Quelle, auch von den an der Streitigkeit beteiligten Vertragsparteien, für das Schiedspanelverfahren einholen. Das Schiedspanel hat auch das Recht, nach eigenem Ermessen Sachverständigengutachten einzuholen. Die auf diese Weise beschafften Informationen müssen beiden Vertragsparteien offen gelegt werden; diese können dazu Stellung nehmen. Interessierte natürliche oder juristische Personen der Vertragsparteien können dem Schiedspanel nach Maßgabe des Anhangs 14-B Amicus-Curiae-Schriftsätze unterbreiten.

Artikel 14.16

Auslegungsregeln

Die Bestimmungen des Artikels 14.2 werden von den Schiedspanels nach den Auslegungsregeln des Völkerrechts einschließlich derjenigen, die im Wiener Vertragsrechtsübereinkommens kodifiziert sind, ausgelegt. Ist eine Verpflichtung aus diesem Abkommen identisch mit einer Verpflichtung aus dem WTO-Übereinkommen, so wählt das Schiedspanel eine Auslegung, die mit den einschlägigen Auslegungen in den Entscheidungen des Streitbeilegungsgremiums der WTO (im Folgenden "DSB" genannt) im Einklang steht. Die Entscheidungen des Schiedspanels können die in den Bestimmungen des Artikels 14.2 vorgesehenen Rechte und Pflichten weder ergänzen noch einschränken.

Artikel 14.17

Beschlüsse und Entscheidungen des Schiedspanels

(1) Das Schiedspanel bemüht sich nach Kräften um einvernehmliche Beschlüsse. Kann jedoch kein einvernehmlicher Beschluss erzielt werden, wird die strittige Frage durch Mehrheitsbeschluss entschieden. Abweichende Meinungen einzelner Schiedsrichter werden auf keinen Fall veröffentlicht.

(2) Alle Entscheidungen des Schiedspanels sind für die Vertragsparteien bindend; sie begründen weder Rechte noch Pflichten für natürliche oder juristische Personen. In der Entscheidung werden der festgestellte Sachverhalt, die Anwendbarkeit der einschlägigen Bestimmungen dieses Abkommens und die wichtigsten Gründe für die Feststellungen und Schlussfolgerungen aufgeführt. Sofern er nichts anderes beschließt, macht der Handelsausschuss die Entscheidungen des Schiedspanels in ihrer Gesamtheit der Öffentlichkeit zugänglich.

ABSCHNITT D

Allgemeine Bestimmungen

Artikel 14.18

Liste der Schiedsrichter

(1) Der Handelsausschuss stellt spätestens sechs Monate nach Inkrafttreten dieses Abkommens eine Liste mit 15 Personen auf, die willens und in der Lage sind, als Schiedsrichter zu fungieren. Jede Vertragspartei schlägt fünf Personen als Schiedsrichter vor. Ferner wählen die Vertragsparteien fünf Personen aus, die nicht die Staatsangehörigkeit einer Vertragspartei besitzen und die im Schiedspanel den Vorsitz führen sollen. Der Handelsausschuss gewährleistet, dass die Liste immer vollständig ist.

(2) Die Schiedsrichter müssen über Fachwissen oder Erfahrung auf den Gebieten Recht und internationaler Handel verfügen. Sie müssen unabhängig sein und in persönlicher Eigenschaft handeln, sie dürfen im Zusammenhang mit der Streitigkeit weder Weisungen einer Organisation oder Regierung entgegennehmen noch der Regierung einer Vertragspartei nahe stehen, und sie müssen die Bedingungen des Anhangs 14-C erfüllen.

Artikel 14.19

Verhältnis zu WTO-Verpflichtungen

(1) Die Inanspruchnahme der Streitbeilegungsbestimmungen dieses Kapitels lässt ein Vorgehen im Rahmen der WTO, einschließlich der Einleitung eines Streitbeilegungsverfahrens, unberührt.

(2) Hat eine Vertragspartei jedoch für eine bestimmte Maßnahme ein Streitbeilegungsverfahren nach diesem Kapitel oder nach dem WTO-Übereinkommen eingeleitet, so kann sie für dieselbe Maßnahme kein Streitbeilegungsverfahren vor dem anderen Gremium einleiten, bevor das erste Verfahren abgeschlossen ist. Darüber hinaus darf eine Vertragspartei nicht in beiden Gremien gegen die Verletzung einer Verpflichtung vorgehen, die in gleicher Form nach diesem Abkommen und dem WTO-Übereinkommen besteht. In einem solchen Fall darf die Vertragspartei nach Einleitung eines Streitbeilegungsverfahrens nicht das andere Gremium mit dem Vorgehen gegen die Verletzung einer identischen Verpflichtung nach der anderen Übereinkunft befassen, es sei denn, das zunächst befasste Gremium kann aus verfahrenstechnischen Gründen oder aus Gründen der Zuständigkeit keine Feststellungen zum Antrag auf Vorgehen gegen die Verletzung der Verpflichtung treffen.

(3) Für die Zwecke des Absatzes 2 gelten:

a) Streitbeilegungsverfahren nach dem WTO-Übereinkommen als zu dem Zeitpunkt eingeleitet, zu dem eine Vertragspartei einen Antrag auf Einsetzung eines Panels nach Artikel 6 der WTO-Vereinbarung über Regeln und Verfahren zur Beilegung von Streitigkeiten in Anhang 2 des WTO-Übereinkommens (im Folgenden "DSU" genannt) gestellt hat, und zu dem Zeitpunkt als abgeschlossen, zu dem das DSB den Panelbericht beziehungsweise den Bericht des Berufungsgremiums nach Artikel 16 beziehungsweise Artikel 17.14 der DSU annimmt, und

b) Streitbeilegungsverfahren nach diesem Kapitel als zu dem Zeitpunkt eingeleitet, zu dem eine Vertragspartei einen Antrag auf Einsetzung eines Schiedspanels nach Artikel 14.4 Absatz 1 gestellt hat, und zu dem Zeitpunkt als abgeschlossen, zu dem das Schiedspanel den Vertragsparteien und dem Handelsausschuss nach Artikel 14.7 seine Entscheidung vorgelegt hat.

(4) Dieses Abkommen schließt nicht aus, dass eine Vertragspartei eine vom DSB genehmigte Aussetzung der Erfüllung von Verpflichtungen vornimmt. Das WTO-Übereinkommen kann nicht in Anspruch genommen werden, um eine Vertragspartei daran zu hindern, die Erfüllung von Verpflichtungen nach diesem Kapitel auszusetzen.

Artikel 14.20

Fristen

(1) Alle in diesem Kapitel festgesetzten Fristen, einschließlich der Fristen für die Vorlage von Entscheidungen der Schiedspanels, werden in Kalendertagen ab dem ersten Tag berechnet, der auf die Handlungen oder Ereignisse folgt, auf die sie sich beziehen.

(2) Die in diesem Kapitel genannten Fristen können im gegenseitigen Einvernehmen der Vertragsparteien verlängert werden.

KAPITEL FÜNFZEHN

INSTITUTIONELLE, ALLGEMEINE UND SCHLUSSBESTIMMUNGEN

Artikel 15.1

Handelsausschuss

(1) Die Vertragsparteien setzen einen Handelsausschuss [88] ein, der sich aus Vertretern der EU-Vertragspartei und aus Vertretern Koreas zusammensetzt.

(2) Der Handelsausschuss tritt einmal jährlich, und zwar abwechselnd in Brüssel und Seoul, oder auf Ersuchen einer Vertragspartei zusammen. Der Vorsitz im Handelsausschuss wird vom Handelsminister Koreas und dem für den Handel zuständigen Mitglied der Europäischen Kommission oder ihren Stellvertretern gemeinsam geführt. Der Handelsausschuss legt seinen Sitzungsplan und seine Tagesordnung fest.

(3) Der Handelsausschuss:

a) gewährleistet das ordnungsgemäße Funktionieren dieses Abkommens,

b) überwacht und unterstützt die Durchführung und Anwendung dieses Abkommens und die Verwirklichung seiner allgemeinen Ziele,

c) überwacht die Arbeit aller Sonderausschüsse, Arbeitsgruppen und anderen im Rahmen dieses Abkommens eingesetzten Gremien,

d) prüft, auf welche Weise die Handelsbeziehungen zwischen den Vertragsparteien intensiviert werden können,

e) sucht unbeschadet der in Kapitel Vierzehn (Streitbeilegung) und Anhang 14-A (Vermittlungsverfahren für nichttarifäre Maßnahmen) übertragenen Rechte nach geeigneten Wegen und Methoden, um Problemen vorzubeugen, die sich in den unter dieses Abkommen fallenden Bereichen ergeben könnten, oder um Streitigkeiten zu schlichten, die bei der Auslegung oder Anwendung dieses Abkommens auftreten könnten,

f) untersucht die Entwicklung des Handels zwischen den Vertragsparteien und

g) prüft alle weiteren Fragen, die für die unter dieses Abkommen fallenden Bereiche von Interesse sind.

(4) Der Handelsausschuss kann:

a) beschließen, Sonderausschüsse, Arbeitsgruppen oder andere Gremien einzusetzen und ihnen Zuständigkeiten zu übertragen,

b) alle interessierten Parteien kontaktieren, darunter auch Organisationen des Privatsektors und der Zivilgesellschaft,

c) in Fällen, die in diesem Abkommen ausdrücklich vorgesehen sind, Änderungen zu diesem Abkommen prüfen oder Bestimmungen dieses Abkommens ändern,

d) die Bestimmungen dieses Abkommens auslegen,

e) nach Maßgabe dieses Abkommens Empfehlungen aussprechen oder Beschlüsse fassen,

f) sich eine Geschäftsordnung geben und

g) bei der Wahrnehmung seiner Aufgaben andere, von den Vertragsparteien vereinbarte Maßnahmen ergreifen.

(5) In jeder ordentlichen Sitzung des Gemischten Ausschusses erstattet der Handelsausschuss Bericht über seine eigenen Tätigkeiten und über die Tätigkeiten seiner Sonderausschüsse, Arbeitsgruppen und anderen Gremien.

(6) Unbeschadet der in Kapitel Vierzehn (Streitbeilegung) und in Anhang 14-A (Vermittlungsverfahren für nichttarifäre Maßnahmen) übertragenen Rechte kann jede Vertragspartei den Handelsausschuss mit allen Fragen befassen, die die Auslegung oder Anwendung dieses Abkommens betreffen.

(7) Legt eine Vertragspartei dem Handelsausschuss, den Sonderausschüssen, Arbeitsgruppen oder anderen Gremien Informationen vor, die nach ihren Gesetzen und sonstigen Vorschriften als vertraulich gelten, so behandelt auch die andere Vertragspartei diese Informationen als vertraulich.

(8) Die Vertragsparteien erkennen die Bedeutung von Transparenz und Offenheit an und bekräftigen ihre Praktik, die Meinungen von Mitgliedern der Öffentlichkeit zu berücksichtigen, damit sie sich bei der Durchführung dieses Abkommens auf ein breites Spektrum unterschiedlicher Sichtweisen stützen können.

Artikel 15.2

Sonderausschüsse

(1) Der Handelsausschuss setzt folgende Sonderausschüsse ein:

a) den Ausschuss für den Warenhandel nach Artikel 2.16 (Ausschuss "Warenhandel"),

b) den Ausschuss für gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen nach Artikel 5.10 (Ausschuss "Gesundheitspolizeiliche und pflanzenschutzrechtliche Maßnahmen"),

c) den Zollausschuss nach Artikel 6.16 ("Zollausschuss"). Bei Angelegenheiten, die ausschließlich unter das Zollabkommen fallen, übernimmt der Zollausschuss die Aufgaben des im Rahmen des Zollabkommens eingesetzten Gemischten Ausschusses "Zusammenarbeit im Zollbereich",

d) den Ausschuss für Dienstleistungshandel, Niederlassung und elektronischen Geschäftsverkehr nach Artikel 7.3 (Ausschuss "Dienstleistungshandel, Niederlassung und elektronischer Geschäftsverkehr"),

e) den Ausschuss "Handel und nachhaltige Entwicklung" nach Artikel 13.12 (Institutioneller Mechanismus) sowie

f) den Ausschuss "Passivveredelungszonen auf der koreanischen Halbinsel" nach Anhang IV des Protokolls über die Bestimmung des Begriffs "Erzeugnisse mit Ursprung in" oder "Ursprungserzeugnisse" und über die Methoden der Zusammenarbeit der Verwaltungen.

Die Zuständigkeit und die Aufgaben der eingesetzten Sonderausschüsse sind in den entsprechenden Kapiteln und Protokollen dieses Abkommens festgelegt.

(2) Der Handelsausschuss kann beschließen, weitere Sonderausschüsse einzusetzen, die ihn bei der Wahrnehmung seiner Aufgaben unterstützen. Er legt Zusammensetzung, Aufgaben und Funktionsweise der nach diesem Artikel eingesetzten Sonderausschüsse fest.

(3) Sofern in diesem Abkommen nichts anderes bestimmt ist, treten die Sonderausschüsse in der Regel auf geeigneter Ebene abwechselnd in Brüssel und Seoul einmal jährlich oder auf Ersuchen einer Vertragspartei oder des Handelsausschusses zusammen, wobei der Vorsitz von Vertretern Koreas und der Europäischen Union gemeinsam geführt wird. Sie legen ihren Sitzungsplan und ihre Tagesordnung einvernehmlich fest.

(4) Die Sonderausschüsse geben dem Handelsausschuss rechtzeitig vor ihren Sitzungen den Sitzungsplan und die Tagesordnung bekannt. In jeder ordentlichen Sitzung des Handelsausschusses erstatten sie Bericht über ihre Tätigkeiten. Die Einsetzung oder die Existenz eines Sonderausschusses hindert die Vertragsparteien nicht daran, den Handelsausschuss unmittelbar mit einer Angelegenheit zu befassen.

(5) Der Handelsausschuss kann beschließen, die einem Sonderausschuss übertragene Aufgabe zu ändern oder zu übernehmen oder einen Sonderausschuss aufzulösen.

Artikel 15.3

Arbeitsgruppen

(1) Der Handelsausschuss setzt folgende Arbeitsgruppen ein:

a) die Arbeitsgruppe für Kraftfahrzeuge und Teile davon nach Artikel 9 Absatz 2 (Arbeitsgruppe "Kraftfahrzeuge und Teile davon") des Anhangs 2-C (Kraftfahrzeuge und Teile davon),

b) die Arbeitsgruppe "Arzneimittel und Medizinprodukte" nach Artikel 5 Absatz 3 (Zusammenarbeit bei der Regulierung) des Anhangs 2-D (Arzneimittel und Medizinprodukte),

c) die Arbeitsgruppe "Chemikalien" nach Nummer 4 des Anhangs 2-E (Chemikalien),

d) die Arbeitsgruppe für Zusammenarbeit bei handelspolitischen Schutzmaßnahmen nach Artikel 3.16 Absatz 1 (Arbeitsgruppe "Zusammenarbeit bei handelspolitischen Schutzmaßnahmen"),

e) die Arbeitsgruppe "MRA" nach Artikel 7.21 Absatz 6 (Gegenseitige Anerkennung),

f) die Arbeitsgruppe für öffentliches Beschaffungswesen nach Artikel 9.3 (Arbeitsgruppe "Öffentliches Beschaffungswesen") sowie

g) die Arbeitsgruppe für geografische Angaben nach Artikel 10.25 (Arbeitsgruppe "Geografische Angaben").

(2) Der Handelsausschuss kann beschließen, für eine besondere Aufgabe oder einen spezifischen Fachbereich weitere Arbeitsgruppen einzusetzen. Er bestimmt die Zusammensetzung, die Aufgaben und die Funktionsweise der Arbeitsgruppen. Alle ordentlichen Sitzungen oder Ad-hoc-Sitzungen, an denen beide Vertragsparteien teilnehmen und in denen dieses Abkommen betreffende Fragen erörtert werden, gelten als Arbeitsgruppen im Sinne dieses Artikels.

(3) Sofern in diesem Abkommen nichts anderes bestimmt ist, treten die Arbeitsgruppen auf geeigneter Ebene jedes Mal zusammen, wenn die Umstände dies erfordern, sowie auf Ersuchen einer Vertragspartei oder des Handelsausschusses. Der Vorsitz in den Arbeitsgruppen wird von Vertretern Koreas und der Europäischen Union gemeinsam geführt. Die Arbeitsgruppen legen ihren Sitzungsplan und ihre Tagesordnung fest.

(4) Die Arbeitsgruppen geben dem Handelsausschuss rechtzeitig vor ihren Sitzungen den Sitzungsplan und die Tagesordnung bekannt. In jeder ordentlichen Sitzung des Handelsausschusses erstatten sie Bericht über ihre Tätigkeiten. Die Einsetzung oder die Existenz einer Arbeitsgruppe hindert die Vertragsparteien nicht daran, den Handelsausschuss unmittelbar mit einer Angelegenheit zu befassen.

(5) Der Handelsausschuss kann beschließen, die einer Arbeitsgruppe übertragene Aufgabe zu ändern oder zu übernehmen oder eine Arbeitsgruppe aufzulösen.

Artikel 15.4

Beschlussfassung

(1) Zur Verwirklichung der Ziele dieses Abkommens ist der Handelsausschuss befugt, in allen in diesem Abkommen vorgesehenen Fällen Beschlüsse zu fassen.

(2) Die Beschlüsse sind für die Vertragsparteien verbindlich; diese treffen die für die Umsetzung der Beschlüsse erforderlichen Maßnahmen. Der Handelsausschuss kann auch zweckdienliche Empfehlungen aussprechen.

(3) Die Beschlüsse und Empfehlungen des Handelsausschusses werden von den Vertragsparteien einvernehmlich ausgearbeitet.

Artikel 15.5

Änderungen

(1) Die Vertragsparteien können schriftlich vereinbaren, dieses Abkommen zu ändern. Eine Änderung tritt erst in Kraft, nachdem die Vertragsparteien durch Austausch schriftlicher Notifikationen einander die Erfüllung ihrer jeweils geltenden Rechtsvorschriften und den Abschluss ihrer Verfahren bestätigt haben, und zwar zu dem von den Vertragsparteien vereinbarten Zeitpunkt.

(2) Unbeschadet des Absatzes 1 kann der Handelsausschuss beschließen, die Anhänge, Anlagen, Protokolle und Anmerkungen zu diesem Abkommen zu ändern. Die Vertragsparteien können den Beschluss vorbehaltlich ihrer jeweils geltenden Rechtsvorschriften und Verfahren annehmen.

Artikel 15.6

Kontaktstellen

(1) Um die Kommunikation zur erleichtern und eine wirksame Durchführung dieses Abkommens sicherzustellen, benennen die Vertragsparteien zum Inkrafttreten des Abkommens Koordinatoren. Die Benennung der Koordinatoren lässt die spezifische Benennung zuständiger Behörden nach einzelnen Kapiteln dieses Abkommens unberührt.

(2) Auf Ersuchen einer Vertragspartei gibt der Koordinator der anderen Vertragspartei die für eine Angelegenheit im Zusammenhang mit der Durchführung dieses Abkommens zuständige Stelle oder den dafür zuständigen Beamten an und leistet die erbetene Unterstützung, um die Kommunikation mit der ersuchenden Vertragspartei zu erleichtern.

(3) Soweit dies nach ihren Rechtsvorschriften möglich ist, übermittelt jede Vertragspartei über ihre Koordinatoren auf Ersuchen der anderen Vertragspartei Informationen und beantwortet umgehend deren Fragen zu einer bestehenden oder vorgeschlagenen Maßnahme, die den Handel zwischen den Vertragsparteien berühren könnte.

Artikel 15.7

Steuern

(1) Dieses Abkommen ist auf Steuervorschriften nur insofern anzuwenden, als dies für die Durchführung der Bestimmungen dieses Abkommens erforderlich ist.

(2) Dieses Abkommen lässt die Rechte und Pflichten der Vertragsparteien aus Steuerübereinkünften zwischen Korea und den Mitgliedstaaten der Europäischen Union unberührt. Im Falle eines Widerspruchs zwischen diesem Abkommen und einer solchen Übereinkunft ist die betreffende Übereinkunft maßgebend, soweit dieses Abkommen im Widerspruch zu ihr steht. Besteht zwischen Korea und den einzelnen Mitgliedstaaten der Europäischen Union eine Steuerübereinkunft, so ist es ausschließlich Sache der nach dieser Übereinkunft zuständigen Behörden, gemeinsam darüber zu entscheiden, ob zwischen diesem Abkommen und der genannten Übereinkunft ein Widerspruch besteht.

(3) Dieses Abkommen ist nicht dahingehend auszulegen, dass es die Vertragsparteien daran hindert, bei der Anwendung ihrer Steuervorschriften die Steuerpflichtigen unterschiedlich zu behandeln, die sich insbesondere hinsichtlich ihres Wohnsitzes oder des Ortes, an dem ihr Kapital investiert wird, nicht in derselben Situation befinden.

(4) Dieses Abkommen ist nicht dahingehend auszulegen, dass es die Annahme oder die Durchsetzung von Maßnahmen nach den steuerrechtlichen Bestimmungen der Abkommen zur Vermeidung der Doppelbesteuerung oder sonstiger steuerrechtlicher Vereinbarungen oder des nationalen Steuerrechts verhindert, mit denen der Steuerumgehung oder Steuerhinterziehung vorgebeugt werden soll.

Artikel 15.8

Ausnahmen bezüglich der Zahlungsbilanz

(1) Bei bereits eingetretenen oder drohenden ernsten Zahlungsbilanzschwierigkeiten und externen finanziellen Schwierigkeiten kann eine Vertragspartei Beschränkungen des Waren- und Dienstleistungshandels sowie der Niederlassung einführen oder aufrechterhalten.

(2) Die Vertragsparteien bemühen sich, die Anwendung der in Absatz 1 genannten Beschränkungen zu vermeiden.

Die nach diesem Artikel eingeführten oder aufrechterhaltenen Beschränkungen müssen diskriminierungsfrei und von begrenzter Dauer sein und dürfen nicht über das zur Behebung der Zahlungsbilanzschwierigkeiten und der externen finanziellen Schwierigkeiten Notwendige hinausgehen. Sie müssen gegebenenfalls die Voraussetzungen des WTO-Übereinkommens erfüllen und mit dem Übereinkommen über den Internationalen Währungsfonds im Einklang stehen.

(3) Die Vertragspartei, die Beschränkungen aufrechterhält oder eingeführt hat oder Änderungen von Beschränkungen vorgenommen hat, notifiziert diese unverzüglich der anderen Vertragspartei und legt ihr baldmöglichst einen Zeitplan für ihre Aufhebung vor.

(4) Falls Beschränkungen eingeführt oder aufrechterhalten werden, finden im Handelsausschuss umgehend diesbezügliche Konsultationen statt. Im Rahmen dieser Konsultationen werden die Zahlungsbilanzsituation der betreffenden Vertragspartei und die nach diesem Artikel eingeführten oder aufrechterhaltenen Beschränkungen beurteilt, wobei unter anderem folgende Faktoren berücksichtigt werden:

a) Art und Ausmaß der Zahlungsbilanzschwierigkeiten und der externen finanziellen Schwierigkeiten,

b) die Außenwirtschafts- und Handelssituation oder

c) andere zur Verfügung stehende Abhilfemaßnahmen.

In den Konsultationen wird geprüft, ob die Beschränkungen mit den Absätzen 3 und 4 im Einklang stehen. Alle statistischen und sonstigen Feststellungen des Internationalen Währungsfonds (im Folgenden "IWF" genannt) zu Devisen, Währungsreserven und Zahlungsbilanz werden berücksichtigt und die Schlussfolgerungen auf die Beurteilung der Zahlungsbilanzsituation und der externen Finanzsituation der betreffenden Vertragspartei durch den IWF gestützt.

Artikel 15.9

Ausnahmen zur Wahrung der Sicherheit

Dieses Abkommen ist nicht dahingehend auszulegen, dass es:

a) eine Vertragspartei verpflichtet, Informationen zu übermitteln, deren Weitergabe ihrer Auffassung nach ihren wesentlichen Sicherheitsinteressen widersprechen würde,

b) eine Vertragspartei daran hindert, Maßnahmen zu treffen, die sie für notwendig erachtet zum Schutz ihrer wesentlichen Sicherheitsinteressen

i) im Zusammenhang mit der Herstellung von Waffen, Munition oder Kriegsmaterial oder dem Handel damit oder in Bezug auf Wirtschaftstätigkeiten, die direkt oder indirekt der Versorgung einer militärischen Einrichtung dienen,

ii) in Bezug auf spaltbare oder fusionsfähige Stoffe oder die Stoffe, aus denen sie gewonnen werden, oder

iii) im Falle eines Krieges oder bei sonstigen ernsten Krisen in den internationalen Beziehungen oder

c) die Vertragsparteien daran hindert, Maßnahmen zur Erfüllung der von ihnen übernommenen internationalen Verpflichtungen zur Wahrung von Frieden und Sicherheit in der Welt zu treffen.

Artikel 15.10

Inkrafttreten

(1) Dieses Abkommen wird von den Vertragsparteien nach ihren eigenen Verfahren genehmigt.

(2) Dieses Abkommen tritt 60 Tage nach dem Tag in Kraft, an dem die Vertragsparteien durch Austausch schriftlicher Notifikationen einander die Erfüllung ihrer jeweils geltenden Rechtsvorschriften und den Abschluss ihrer Verfahren bestätigt haben, oder zu einem von den Vertragsparteien vereinbarten anderen Zeitpunkt.

(3) Unbeschadet der Absätze 2 und 5 wenden die Vertragsparteien das Protokoll über kulturelle Zusammenarbeit ab dem ersten Tag des dritten Monats nach dem Tag an, an dem Korea seine Urkunde über die Ratifikation des am 20. Oktober 2005 in Paris angenommenen UNESCO-Übereinkommens zum Schutz und zur Förderung der Vielfalt kultureller Ausdrucksformen (im Folgenden "UNESCO-Übereinkommen" genannt) beim UNESCO-Sekretariat in Paris hinterlegt hat, es sei denn, dass Korea seine Urkunde über die Ratifikation des UNESCO-Übereinkommens bereits vor dem Austausch der in den Absätzen 2 oder 5 genannten Notifikationen hinterlegt hat.

(4) Die Notifikationen sind dem Generalsekretär des Rates der Europäischen Union und dem Außen- und Handelsministerium Koreas oder dessen Nachfolger zu übersenden.

(5) a) Dieses Abkommen wird ab dem ersten Tag des Monats vorläufig angewandt, der auf den Tag folgt, an dem die EU-Vertragspartei und Korea einander den Abschluss ihrer jeweils erforderlichen Verfahren notifiziert haben.

b) Für den Fall, dass eine Vertragspartei einige Bestimmungen dieses Abkommens nicht vorläufig anwenden kann, notifiziert sie der anderen Vertragspartei, um welche Bestimmungen es sich dabei handelt. Unbeschadet des Buchstabens a und sofern die andere Vertragspartei die erforderlichen Verfahren abgeschlossen hat und nicht innerhalb von 10 Tagen nach der Notifikation, dass einige Bestimmungen nicht vorläufig angewandt werden können, Einwand gegen die vorläufige Anwendung erhebt, werden die Bestimmungen dieses Abkommens, die in der Notifikation nicht genannt wurden, ab dem ersten Tag des Monats vorläufig angewandt, der auf die Notifikation folgt.

c) Eine Vertragspartei kann die vorläufige Anwendung durch schriftliche Notifikation an die andere Vertragspartei beenden. Die Beendung wird am ersten Tag des Monats wirksam, der auf die Notifikation folgt.

d) Wird dieses Abkommen oder werden einige Bestimmungen daraus vorläufig angewandt, so ist unter dem Begriff "Inkrafttreten dieses Abkommens" der Tag des Beginns der vorläufigen Anwendung zu verstehen.

Artikel 15.11

Dauer

(1) Dieses Abkommen wird auf unbegrenzte Zeit geschlossen.

(2) Jede Vertragspartei kann dieses Abkommen durch schriftliche Notifikation an die andere Vertragspartei kündigen.

(3) Die Kündigung wird sechs Monate nach der Notifikation nach Absatz 2 wirksam.

Artikel 15.12

Erfüllung von Verpflichtungen

(1) Die Vertragsparteien treffen die allgemeinen oder besonderen Maßnahmen, die zur Erfüllung ihrer Verpflichtungen aus diesem Abkommen erforderlich sind. Sie tragen dafür Sorge, dass die Ziele dieses Abkommens verwirklicht werden.

(2) Im Falle einer nach den allgemeinen Regeln des Völkerrechts nicht zulässigen Kündigung dieses Abkommens kann eine Vertragspartei unverzüglich geeignete Maßnahmen im Einklang mit dem Völkerrecht treffen.

Artikel 15.13

Anhänge, Anlagen, Protokolle und Anmerkungen

Die Anhänge, Anlagen, Protokolle und Anmerkungen sind Bestandteil dieses Abkommens.

Artikel 15.14

Verhältnis zu anderen Übereinkünften

(1) Sofern nichts anderes bestimmt ist, werden frühere Übereinkünfte zwischen den Mitgliedstaaten der Europäischen Union und/oder der Europäischen Union und Korea durch dieses Abkommen weder ersetzt noch aufgehoben.

(2) Dieses Abkommen ist Bestandteil der bilateralen Gesamtbeziehungen, die dem Rahmenabkommen unterliegen. Es stellt ein spezifisches Abkommen dar, mit dem die Handelsbestimmungen im Sinne des Rahmenabkommens umgesetzt werden.

(3) Das Protokoll über die gegenseitige Amtshilfe im Zollbereich ersetzt das Zollabkommen im Hinblick auf die Bestimmungen über die gegenseitige Amtshilfe.

(4) Die Vertragsparteien sind sich einig, dass dieses Abkommen sie nicht verpflichtet, in einer Art und Weise zu handeln, die nicht mit ihren Verpflichtungen aus dem WTO-Übereinkommen vereinbar ist.

Artikel 15.15

Räumlicher Geltungsbereich

(1) Dieses Abkommen gilt einerseits für die Gebiete, in denen der Vertrag über die Europäische Union und der Vertrag über die Arbeitsweise der Europäischen Gemeinschaft angewandt werden, nach Maßgabe jener Verträge, und andererseits für das Gebiet Koreas. Sofern nicht ausdrücklich etwas anderes bestimmt wird, ist in diesem Abkommen der Begriff "Gebiet" in diesem Sinn zu verstehen.

(2) Was die Bestimmungen über die Zollbehandlung von Waren anbelangt, so gilt dieses Abkommen auch für die nicht unter Absatz 1 fallenden Gebiete des Zollgebiets der EU.

Artikel 15.16

Verbindlicher Wortlaut

Dieses Abkommen ist in zwei Urschriften in bulgarischer, dänischer, deutscher, englischer, estnischer, finnischer, französischer, griechischer, italienischer, lettischer, litauischer, maltesischer, niederländischer, polnischer, portugiesischer, rumänischer, schwedischer, slowakischer, slowenischer, spanischer, tschechischer, ungarischer und koreanischer Sprache abgefasst, wobei jeder Wortlaut gleichermaßen verbindlich ist.

Съставено в Брюксел на шести октомври две хиляди и десета година.

Hecho en Bruselas, el seis de octubre de dos mil diez.

V Bruselu dne šestého října dva tisíce deset.

Udfærdiget i Bruxelles den sjette oktober to tusind og ti.

Geschehen zu Brüssel am sechsten Oktober zweitausendzehn.

Kahe tuhande kümnenda aasta oktoobrikuu kuuendal päeval Brüsselis.

Έγινε στις Βρυξέλλες, στις έξι Οκτωβρίου δύο χιλιάδες δέκα.

Done at Brussels on the sixth day of October in the year two thousand and ten.

Fait à Bruxelles, le six octobre deux mille dix.

Fatto a Bruxelles, addì sei ottobre duemiladieci.

Briselē, divi tūkstoši desmitā gada sestajā oktobrī.

Priimta du tūkstančiai dešimtų metų spalio šeštą dieną Briuselyje.

Kelt Brüsszelben, a kétezer-tizedik év október hatodik napján.

Magħmul fi Brussell, fis- sitt jum ta' Ottubru tas-sena elfejn u għaxra.

Gedaan te Brussel, de zesde oktober tweeduizend tien.

Sporządzono w Brukseli dnia szóstego października roku dwa tysiące dziesiątego.

Feito em Bruxelas, em seis de Outubro de dois mil e dez.

Întocmit la Bruxelles, la șase octombrie două mii zece.

V Bruseli dňa šiesteho októbra dvetisícdesať.

V Bruslju, dne šestega oktobra leta dva tisoč deset.

Tehty Brysselissä kuudentena päivänä lokakuuta vuonna kaksituhattakymmenen.

Som skedde i Bryssel den sjätte oktober tjugohundratio.

+++++ TIFF +++++

Voor het Koninkrijk België

Pour le Royaume de Belgique

Für das Königreich Belgien

+++++ TIFF +++++

Deze handtekening verbindt eveneens de Vlaamse Gemeenschap, de Franse Gemeenschap, de Duitstalige Gemeenschap, het Vlaamse Gewest, het Waalse Gewest en het Brussels Hoofdstedelijk Gewest.

Cette signature engage également la Communauté française, la Communauté flamande, la Communauté germanophone, la Région wallonne, la Région flamande et la Région de Bruxelles-Capitale.

Diese Unterschrift bindet zugleich die Deutschsprachige Gemeinschaft, die Flämische Gemeinschaft, die Französische Gemeinschaft, die Wallonische Region, die Flämische Region und die Region Brüssel-Hauptstadt.

За Релублика Ъьлгария

+++++ TIFF +++++

Za Českou republiku

+++++ TIFF +++++

På Kongeriget Danmarks vegne

+++++ TIFF +++++

Für die Bundesrepublik Deutschland

+++++ TIFF +++++

Eesti Vabariigi nimel

+++++ TIFF +++++

Thar cheann Na hÉireann

For Ireland

+++++ TIFF +++++

Για την Ελληνική Δημοκρατία

+++++ TIFF +++++

Por el Reino de España

+++++ TIFF +++++

Pour la République française

+++++ TIFF +++++

Per la Repubblica italiana

+++++ TIFF +++++

Για την Κυπριακή Δημοκρατία

+++++ TIFF +++++

Latvijas Republikas vārdā –

+++++ TIFF +++++

Lietuvos Respublikos vardu

+++++ TIFF +++++

Pour le Grand-Duché de Luxembourg

+++++ TIFF +++++

A Magyar Köztársaság részéről

+++++ TIFF +++++

Gћal Malta

+++++ TIFF +++++

Voor het Koninkrijk der Nederlanden

+++++ TIFF +++++

Für die Republik Österreich

+++++ TIFF +++++

W imieniu Rzeczypospolitej Polskiej

+++++ TIFF +++++

Pela República Portuguesa

+++++ TIFF +++++

Pentru România

+++++ TIFF +++++

Za Republiko Slovenijo

+++++ TIFF +++++

Za Slovenskú republiku

+++++ TIFF +++++

Suomen tasavallan puolesta

För Republiken Finland

+++++ TIFF +++++

För Konungariket Sverige

+++++ TIFF +++++

For the United Kingdom of Great Britain and Northern Ireland

+++++ TIFF +++++

За Европейския сьюз

Por la Unión Europea

Za Evropskou unii

For Den Europæiske Union

Für die Europäische Union

Euroopa Liidu nimel

Για την Ευρωπαϊκή Ένωση

For the European Union

Pour l'Union européenne

Per l'Unione europea

Eiropas Savienības vārdā –

Europos Sajungos vardu

Az Európai Unió részéről

Għall-Unjoni Ewropea

Voor de Europese Unie

W imieniu Unii Europejskiej

Pela União Europeia

Pentru Uniunea Europeană

Za Európske úniu

Za Evropsko unijo

Euroopan unionin puolesta

För Europeiska unionen

+++++ TIFF +++++

+++++ TIFF +++++

+++++ TIFF +++++

+++++ TIFF +++++

[1] "Waren" sind für die Zwecke dieses Abkommens Waren im Sinne des GATT 1994, sofern dieses Abkommen nichts anderes bestimmt.

[2] Die Vertragsparteien kommen überein, dass diese Begriffsbestimmung nicht die Behandlung berührt, die die Vertragsparteien nach dem WTO-Übereinkommen für Handelsgeschäfte einräumen können, die nach dem Grundsatz der Meistbegünstigung abgewickelt werden.

[3] Die Vertragsparteien können von einem Einführer verlangen, ausreichende Sicherheiten in Form einer Bürgschaft, einer Kaution oder einer anderen geeigneten Möglichkeit zu stellen, welche die endgültigen Zölle, Abgaben und Gebühren abdeckt, die mit der Einfuhr der Ware anfallen.

[4] Die bloße Tatsache, dass für natürliche Personen bestimmter Länder ein Visum gefordert wird, für natürliche Personen anderer Länder hingegen nicht, gilt nicht als Zunichtemachung oder Schmälerung von Handelsvorteilen aufgrund einer besonderen Verpflichtung aus diesem Kapitel und seinen Anhängen.

[5] In der Hauptverwaltung werden die endgültigen Entscheidungen getroffen.

[6] Im Einklang mit ihrer Notifikation des Vertrags zur Gründung der Europäischen Gemeinschaft bei der WTO (Dok. WT/REG39/1) vertritt die EU-Vertragspartei die Auffassung, dass das Konzept der "echten und kontinuierlichen Verbindung" mit der Wirtschaft eines Mitgliedstaates, das in Artikel 48 des EG-Vertrags Eingang gefunden hat, dem Konzept der "Tätigung von Geschäften in erheblichem Umfang" nach Artikel V Absatz 6 des GATS entspricht. Folglich dehnt die EU-Vertragspartei die Vorteile dieses Abkommens nur dann auf eine nach koreanischem Recht errichtete juristische Person aus, die lediglich ihren Sitz oder ihre Hauptverwaltung auf dem Gebiet Koreas hat, wenn eine echte und kontinuierliche Verbindung zwischen dieser juristischen Person und der Wirtschaft Koreas besteht.

[7] Die Bestimmungen dieses Buchstabens gelten nicht für die Niederlassung.

[8] Die sich aus dem Protokoll über kulturelle Zusammenarbeit ergebenden Rechte und Pflichten bleiben vom Ausschluss audiovisueller Dienstleistungen aus dem Geltungsbereich dieses Abschnitts unberührt.

[9] Dieser Unterabsatz schließt Maßnahmen ein, die einem Dienstleister der anderen Vertragspartei als Voraussetzung für die grenzüberschreitende Erbringung von Dienstleistungen eine Niederlassung im Sinne des Artikels 7.9 Buchstabe a oder die Ansässigkeit im Gebiet einer Vertragspartei vorschreiben.

[10] Dieser Unterabsatz gilt nicht für Maßnahmen einer Vertragspartei, die Vorleistungen für die grenzüberschreitende Erbringung von Dienstleistungen beschränken.

[11] Dieser Artikel ist nicht als Erweiterung des Geltungsbereichs dieses Abschnitts auszulegen.

[12] Die Begriffe "Errichtung" und "Erwerb" einer juristischen Person sind so zu verstehen, dass sie auch Kapitalbeteiligungen an juristischen Personen zur Schaffung oder Aufrechterhaltung dauerhafter Wirtschaftsbeziehungen umfassen.

[13] Wird eine Wirtschaftstätigkeit nicht unmittelbar von einer juristischen Person, sondern durch andere Formen der Niederlassung wie zum Beispiel eine Zweigniederlassung oder eine Repräsentanz ausgeübt, so erhält der Investor einschließlich der juristischen Person durch eine solche Niederlassung dennoch die Behandlung, die den Investoren im Rahmen dieses Abkommens gewährt wird. Eine solche Behandlung wird der Niederlassung zuteil, durch welche die Wirtschaftstätigkeit ausgeübt wird; sie braucht sonstigen Betriebsteilen des Investors, die außerhalb des Gebiets ansässig sind, in dem die Wirtschaftstätigkeit ausgeübt wird, nicht gewährt zu werden.

[14] Nicht unter dieses Kapitel fällt der Investitionsschutz, ausgenommen die Behandlung nach Artikel 7.12, einschließlich Verfahren zur Streitbeilegung zwischen Investor und Staat.

[15] Sicherheitshalber wird klargestellt, dass die Aufbereitung von Kernmaterial alle Tätigkeiten umfasst, die in der Internationalen Systematik der Wirtschaftstätigkeiten (International Standard Industrial Classification of all Economic Activities) in der vom Statistischen Amt der Vereinten Nationen, Statistical Papers, Series M, No 4, ISIC REV 3.1, 2002, veröffentlichten Fassung unter Code 2330 aufgeführt werden.

[16] Kriegsmaterial ist auf Produkte beschränkt, die ausschließlich für militärische Zwecke im Zusammenhang mit Kriegsführung oder Verteidigungsaktivitäten bestimmt sind und hergestellt werden.

[17] Die sich aus dem Protokoll über kulturelle Zusammenarbeit ergebenden Rechte und Pflichten bleiben vom Ausschluss audiovisueller Dienstleistungen aus dem Geltungsbereich dieses Abschnitts unberührt.

[18] Die Buchstaben a bis c beziehen sich nicht auf Maßnahmen, mit denen die Produktion eines landwirtschaftlichen Erzeugnisses beschränkt werden soll.

[19] Dieser Artikel gilt für Maßnahmen, die die Zusammensetzung des Vorstands einer Niederlassung regeln, zum Beispiel Staatsangehörigkeits- und Wohnsitzerfordernisse.

[20] Dieser Artikel ist nicht als Erweiterung des Geltungsbereichs dieses Abschnitts auszulegen.

[21] Die in diesem Absatz vorgesehene Verpflichtung erstreckt sich nicht auf die nicht unter dieses Kapitel fallenden Investitionsschutzbestimmungen, einschließlich der Bestimmungen über Verfahren zur Streitbeilegung zwischen Investor und Staat.

[22] Dazu zählen auch das vorliegende Kapitel und die Anhänge 7-A und 7-C.

[23] Von der den Praktikanten aufnehmenden Niederlassung kann verlangt werden, ein Ausbildungsprogramm zur vorherigen Genehmigung vorzulegen, das die Dauer des Aufenthalts abdeckt und mit dem nachgewiesen wird, dass der Aufenthalt zum Zwecke einer mit einem Hochschulabschluss gleichwertigen Ausbildung erfolgt.

[24] Der unter diesem Buchstaben genannte Dienstleistungsvertrag muss den Gesetzen und sonstigen Vorschriften der Vertragspartei entsprechen, in der er ausgeführt wird.

[25] Der unter diesem Buchstaben genannte Dienstleistungsvertrag muss den Gesetzen und sonstigen Vorschriften der Vertragspartei entsprechen, in der er ausgeführt wird.

[26] Eine Vertragspartei kann eine Verlängerung der zulässigen Aufenthaltsdauer nach Maßgabe der in ihrem Gebiet geltenden Gesetze und sonstigen Vorschriften gestatten.

[27] Dieser Absatz gilt unbeschadet der Rechte und Pflichten aus bilateralen Visumbefreiungsabkommen zwischen Korea und einem der Mitgliedstaaten der Europäischen Union.

[28] Sofern in Anhang 7-A nichts anderes bestimmt ist, kann eine Vertragspartei nicht vorschreiben, dass eine Niederlassung Führungspositionen mit natürlichen Personen mit einer bestimmten Staatsangehörigkeit oder mit Wohnsitz in ihrem Gebiet besetzt.

[29] Dieser Artikel gilt unbeschadet der Rechte und Pflichten aus bilateralen Visumbefreiungsabkommen zwischen Korea und einem der Mitgliedstaaten der Europäischen Union.

[30] CPC ist die Zentrale Gütersystematik (Central Products Classification) der Vereinten Nationen in der vom Statistischen Amt der Vereinten Nationen, Statistical Papers, Series M, No 77, CPC Prov, 1991, veröffentlichten Fassung.

[31] Sicherheitshalber wird klargestellt, dass dieser Artikel nicht so auszulegen ist, als solle der Regelungsrahmen der bestehenden Regulierungsbehörde in Korea, der die Leistungen privater Kurierdienste regelt, mit dem Inkrafttreten dieses Abkommens geändert werden.

[32] Diese Dienste umfassen die in Dokument MTN/GNS/W/120 unter 2. Kommunikationsdienste, C. Telekommunikationsdienste, Buchstaben a bis g aufgeführten Dienste.

[33] Über den Geltungsbereich und die Durchführung von Universaldiensten entscheiden die Vertragsparteien selbst.

[34] Lizenzgebühren umfassen keine Zahlungen bei Auktionen, Ausschreibungen oder anderen nichtdiskriminierenden Verfahren der Vergabe von Konzessionen sowie keine obligatorischen Beiträge zur Erbringung eines Universaldienstes.

[35] Buchstabe c wird spätestens fünf Jahre nach Inkrafttreten dieses Abkommens wirksam. Jede Vertragspartei stellt sicher, dass bei Inkrafttreten dieses Abkommens Lizenzgebühren auf nichtdiskriminierende Weise festgelegt und erhoben werden.

[36] Oder zweifacher Preisdruck (Margin Squeeze) im Fall der EU-Vertragspartei.

[37] Jede Vertragspartei setzt diese Verpflichtung entsprechend ihren einschlägigen Rechtsvorschriften um.

[38] Bei Streitigkeiten zwischen Diensteanbietern oder zwischen Diensteanbietern und Nutzern muss die Beschwerdestelle von den Streitparteien unabhängig sein.

[39] Alle Maßnahmen, denen im Gebiet einer Vertragpartei niedergelassene Finanzdienstleister unterliegen, die nicht durch die Finanzaufsichtsbehörde dieser Vertragspartei reguliert und beaufsichtigt werden, gelten als aufsichtsrechtliche Maßnahmen im Sinne dieses Abkommens. Sicherheitshalber wird klargestellt, dass alle Maßnahmen dieser Art im Einklang mit diesem Artikel getroffen werden.

[40] Es gilt als vereinbart, dass der Begriff "aufsichtsrechtliche Gründe" die Wahrung der Sicherheit, Solidität, Integrität und finanziellen Verantwortung der einzelnen Finanzdienstleister umfassen kann.

[41] Sicherheitshalber wird klargestellt, dass sich diese Verpflichtung auf die in der Allgemeinen Erklärung der Menschenrechte aufgeführten Rechte und Freiheiten, die Leitlinien für die Regelung personenbezogener Datenbanken (angenommen durch die Resolution 45/95 der Generalversammlung der Vereinten Nationen vom 14. Dezember 1990) und die OECD-Leitlinien für den Schutz der Vertraulichkeit und für den grenzüberschreitenden Austausch personenbezogener Daten (angenommen vom OECD-Rat am 23. September 1980) bezieht.

[42] Die Einbeziehung der Bestimmungen über den elektronischen Geschäftsverkehr in dieses Kapitel berührt nicht den Standpunkt Koreas zu der Frage, ob auf elektronischem Weg erfolgende Lieferungen als Dienstleistungs- oder Warenhandel einzustufen sind.

[43] Die Ausnahmeregelung in Bezug auf die öffentliche Ordnung kann nur in Anspruch genommen werden, wenn eine wirkliche, ausreichend schwerwiegende Bedrohung der Grundwerte der Gesellschaft vorliegt.

[44] Maßnahmen, die auf eine gerechte oder wirksame Festsetzung oder Erhebung direkter Steuern abzielen, umfassen Maßnahmen einer Vertragspartei im Rahmen ihres Steuersystems,a)die für gebietsfremde Investoren und Dienstleister gelten, in Anerkennung der Tatsache, dass sich die Steuerpflicht Gebietsfremder nach den Besteuerungsgrundlagen richtet, die aus dem Gebiet der Vertragspartei stammen oder dort belegen sind;b)die für Gebietsfremde gelten, um die Festsetzung oder Erhebung von Steuern im Gebiet der Vertragspartei zu gewährleisten;c)die für Gebietsfremde oder Gebietsansässige gelten, um Steuerflucht oder -hinterziehung zu verhindern, einschließlich Vollzugsmaßnahmen;d)die für Nutzer von Dienstleistungen gelten, die im Gebiet der anderen Vertragspartei oder von dort aus erbracht werden, um die Festsetzung oder Erhebung von Steuern aus Quellen im Gebiet der Vertragspartei zu gewährleisten;e)die unterscheiden zwischen Investoren und Dienstleistern, die hinsichtlich weltweiter Besteuerungsgrundlagen der Steuer unterliegen, und anderen Investoren und Dienstleistern, in Anerkennung des Unterschieds in der Art der Steuerbemessungsgrundlage zwischen beiden; oderf)die dazu dienen, Einkommen, Gewinn, Wertzuwachs, Verlust, Abzüge oder anrechenbare Beträge in Bezug auf gebietsansässige Personen oder Niederlassungen oder verbundene Personen oder Niederlassungen derselben Person zu ermitteln, zuzuordnen oder aufzuteilen, um die Steuergrundlage der Vertragspartei zu bewahren.Die steuerlichen Bestimmungen in diesem Absatz und in dieser Fußnote werden in Übereinstimmung mit den steuerlichen Definitionen und Begriffen oder gleichwertigen oder ähnlichen Definitionen und Begriffen des internen Rechts der Vertragspartei, die die Maßnahme trifft, ausgelegt.

[45] "Ernste Schwierigkeiten für die Durchführung der Währungs- oder Wechselkurspolitik" umfassen, jedoch nicht ausschließlich, schwerwiegende Zahlungsbilanzschwierigkeiten oder externe finanzielle Schwierigkeiten, und die Schutzmaßnahmen nach diesem Artikel gelten nicht für ausländische Direktinvestitionen.

[46] Insbesondere sollten die in diesem Artikel vorgesehenen Schutzmaßnahmen so angewandt werden, dass siea)nicht konfiskatorisch sind,b)keine dualen oder multiplen Wechselkurspraktiken darstellen,c)nicht auf andere Weise die Möglichkeit von Investoren beeinträchtigen, im Gebiet der Vertragspartei, die Schutzmaßnahmen in Bezug auf Sicherungsvermögen getroffen hat, eine Marktrendite zu erzielen,d)unnötige Schädigungen der Handelsinteressen, der wirtschaftlichen oder der finanziellen Interessen der anderen Vertragspartei vermeiden,e)nur für einen begrenzten Zeitraum gelten und im Zuge der Verbesserung der Lage, die die Einführung dieser Maßnahmen erforderlich machte, schrittweise abgebaut werden, undf)von den für die Devisenpolitik zuständigen Behörden unverzüglich veröffentlicht werden.

[47] Europäische Union oder Mitgliedstaaten der Europäischen Union oder Korea.

[48] Solange die zum Zeitpunkt der ursprünglichen Einführung der Schutzmaßnahmen oder gleichwertiger Maßnahmen herrschenden Umstände anhalten, kann die Anwendung der Schutzmaßnahmen von der betroffenen Vertragspartei um weitere sechs Monate verlängert werden. Sollten jedoch Umstände eintreten, die in so hohem Maße außergewöhnlich sind, dass eine Vertragspartei eine weitere Verlängerung der Schutzmaßnahmen wünscht, so stimmt sie ihr Vorgehen hinsichtlich einer etwaigen Verlängerung im Vorfeld mit der anderen Vertragspartei ab.

[49] In: WTO-Dokument negs 268 (Job No[1].8274) vom 19. November 2007.

[50] Für die Zwecke dieses Absatzes stellt die innerhalb des Gebiets einer Vertragspartei erfolgende Weiterübertragung über ein geschlossenes, definiertes Teilnehmernetz, das von außerhalb des Gebiets der Vertragspartei nicht zugänglich ist, keine Weiterübertragung über das Internet dar.

[51] "Geografische Angaben" in diesem Unterabschnitt sind:a)geografische Angaben, Ursprungsbezeichnungen, Qualitätsweine bestimmter Anbaugebiete und Tafelweine mit geografischer Angabe im Sinne der Verordnung (EG) Nr. 510/2006 des Rates vom 20. März 2006, der Verordnung (EG) Nr. 110/2008 des Europäischen Parlaments und des Rates vom 15. Januar 2008, der Verordnung (EWG) Nr. 1601/1991 des Rates vom 10. Juni 1991, der Verordnung (EG) Nr. 1493/1999 des Rates vom 17. Mai 1999 und der Verordnung (EG) Nr. 1234/2007 des Rates vom 22. Oktober 2007 oder der diese Verordnungen ersetzenden Bestimmungen undb)geografische Angaben im Sinne des koreanischen Gesetzes zur Qualitätskontrolle landwirtschaftlicher Erzeugnisse ("Agricultural Products Quality Control Act") (Gesetz Nr. 9759 vom 9. Juni 2009) und des koreanischen Gesetzes über die Steuer auf alkoholische Getränke ("Liquor Tax Act") (Gesetz Nr. 8852 vom 29. Februar 2008).

[52] Der Schutz geografischer Angaben nach diesem Unterabschnitt lässt andere Bestimmungen in diesem Abkommen unberührt.

[53] Weine im Sinne dieses Unterabschnitts sind unter die Position 22.04 des HS fallende Erzeugnisse, diea)mit der Verordnung (EG) Nr. 1234/2007 des Rates vom 22. Oktober 2007, der Verordnung (EG) Nr. 606/2009 der Kommission vom 10. Juli 2009 und der Verordnung (EG) Nr. 607/2009 der Kommission vom 14. Juli 2009 oder den sie ersetzenden Rechtsvorschriften im Einklang stehen oderb)mit dem koreanischen Gesetz zur Qualitätskontrolle landwirtschaftlicher Erzeugnisse ("Agricultural Products Quality Control Act") (Gesetz Nr. 9759 vom 9. Juni 2009) und dem koreanischen Gesetz über die Steuer auf alkoholische Getränke ("Liquor Tax Act") (Gesetz Nr. 8852 vom 29. Februar 2008) im Einklang stehen.

[54] Aromatisierte Weine im Sinne dieses Unterabschnitts sind unter die Position 22.05 des HS fallende Erzeugnisse, diea)mit der Verordnung (EWG) Nr. 1601/1991 des Rates vom 10. Juni 1991 oder den sie ersetzenden Rechtsvorschriften im Einklang stehen oderb)mit dem koreanischen Gesetz zur Qualitätskontrolle landwirtschaftlicher Erzeugnisse ("Agricultural Products Quality Control Act") (Gesetz Nr. 9759 vom 9. Juni 2009) und dem koreanischen Gesetz über die Steuer auf alkoholische Getränke ("Liquor Tax Act") (Gesetz Nr. 8852 vom 29. Februar 2008) im Einklang stehen.

[55] Spirituosen im Sinne dieses Unterabschnitts sind unter die Position 22.08 des HS fallende Erzeugnisse, diea)mit der Verordnung (EG) Nr. 110/2008 des Europäischen Parlaments und des Rates vom 15. Januar 2008 und der Verordnung (EWG) Nr. 1014/90 der Kommission vom 24. April 1990 oder den sie ersetzenden Rechtsvorschriften im Einklang stehen oderb)mit dem koreanischen Gesetz zur Qualitätskontrolle landwirtschaftlicher Erzeugnisse ("Agricultural Products Quality Control Act") (Gesetz Nr. 9759 vom 9. Juni 2009) und dem koreanischen Gesetz über die Steuer auf alkoholische Getränke ("Liquor Tax Act") (Gesetz Nr. 8852 vom 29. Februar 2008) im Einklang stehen.

[56] Für alle Waren ist der Begriff "gleichartige Ware" im Sinne des Artikels 23 Absatz 1 des TRIPS-Übereinkommens zu verstehen, der die Verwendung geografischer Angaben zur Kennzeichnung von Weinen für Weine regelt, die ihren Ursprung nicht an dem durch die fragliche geografische Angabe bezeichneten Ort haben, oder zur Kennzeichnung von Spirituosen für Spirituosen, die ihren Ursprung nicht an dem durch die fragliche geografische Angabe bezeichneten Ort haben.

[57] Bei Unterbreitung eines Vorschlagsa)seitens Koreas hinsichtlich eines in den Geltungsbereich der in Artikel 10.18 Absatz 2 und in den Fußnoten zu Artikel 10.19 genannten Rechtsvorschriften der Europäischen Union fallenden Ursprungserzeugnisses oderb)seitens der Europäischen Union hinsichtlich eines in den Geltungsbereich der in Artikel 10.18 Absatz 1 und in den Fußnoten zu Artikel 10.19 genannten Rechtsvorschriften Koreas fallenden Ursprungserzeugnisseszur Aufnahme einer zusätzlichen Ursprungsbezeichnung in dieses Abkommen, die von einer der Vertragsparteien durch andere als die in den Artikeln 10.18 Absatz 1 und 10.18 Absatz 2 sowie in den Fußnoten zu Artikel 10.19 genannten Rechtsvorschriften der Vertragsparteien als geografische Angabe im Sinne des Artikels 22 Absatz 1 des TRIPS-Übereinkommens anerkannt wurde, kommen die Vertragsparteien überein zu prüfen, ob die geografische Angabe nach diesem Unterabschnitt in dieses Abkommen aufgenommen werden kann.

[58] Dies bezieht sich auf die Änderung der geografischen Angabe selbst, einschließlich des Namens und der Erzeugniskategorie. Für Änderungen der in Artikel 10.18 Absätze 3 und 4 genannten Spezifikationen oder Änderungen der für die Kontrollen nach Artikel 10.18 Absatz 6 Buchstabe d zuständigen Stellen ist weiterhin ausschließlich die Vertragspartei zuständig, in der eine geografische Angabe ihren Ursprung hat. Änderungen dieser Art können informationshalber mitgeteilt werden.

[59] Für den Beschluss, den Schutz einer geografischen Angabe aufzuheben, ist weiterhin ausschließlich die Vertragspartei zuständig, in der eine geografische Angabe ihren Ursprung hat.

[60] In Korea gelten Muster und Modelle nicht als neu, wenn ein identisches oder ähnliches Muster oder Modell vor Einreichung des Antrags auf Eintragung als Muster oder Modell öffentlich bekannt war oder öffentlich verwendet wurde. In Korea gelten Muster und Modelle nicht als originell, wenn sie ohne Weiteres aus den Kombinationen von Mustern oder Modellen, die vor Einreichung des Antrags auf Eintragung als Muster oder Modell öffentlich bekannt waren oder öffentlich verwendet wurden, hätten geschaffen werden können. In der Europäischen Union gelten Muster und Modelle nicht als neu, wenn der Öffentlichkeit vor dem Tag der Einreichung des Antrags auf Eintragung eines Musters oder Modells oder vor dem Tag der Offenbarung eines nicht eingetragenen Musters oder Modells ein identisches Muster oder Modell zugänglich gemacht worden ist. In der Europäischen Union gilt ein Muster oder Modell nicht als Muster oder Modell mit Eigenart, wenn sich der Gesamteindruck, den es beim informierten Benutzer hervorruft, nicht von dem Gesamteindruck unterscheidet, den ein anderes Muster oder Modell, das der Öffentlichkeit zugänglich gemacht worden ist, bei diesem Benutzer hervorruft.

[61] Für die Zwecke dieses Artikels verstehen die Europäische Union und Korea "nicht eingetragenes Muster oder Modell" und "nicht eingetragene Erscheinungsform" als Begriffe von ähnlicher Bedeutung. Die Voraussetzungen für den Schutz "nicht eingetragener Muster und Modelle" oder "nicht eingetragener Erscheinungsformen" sind festgelegt:a)von Korea im Gesetz zur Verhinderung unlauteren Wettbewerbs und zum Schutz des Geschäftsgeheimnisses ("Unfair Competition Prevention and Trade Secret Protection Act") (Gesetz Nr. 8767 vom 21. Dezember 2007), undb)von der Europäischen Union in der Verordnung (EG) Nr. 6/2002 des Rates vom 12. Dezember 2001 über das Gemeinschaftsgeschmacksmuster, zuletzt geändert durch die Verordnung (EG) Nr. 1891/2006 des Rates vom 18. Dezember 2006.

[62] Für die Zwecke dieses Artikels versteht die Europäische Union unter "Präsentation" das "Angebot" oder das "Inverkehrbringen", und Korea versteht unter "Präsentation" die "Abtretung, Vermietung oder Ausstellung zwecks Abtretung oder Vermietung".

[63] Der Schutz eines Musters oder Modells nach dem Urheberrecht besteht nicht automatisch, sondern wird nur gewährt, wenn ein Muster oder Modell nach dem Urheberrecht schutzfähig ist.

[64] Siehe Definition in Anhang 2-D (Arzneimittel und Medizinprodukte).

[65] Pflanzenschutzmittel in der dem Verwender gelieferten Form bestehen aus Wirkstoffen, Safenern oder Synergisten oder enthalten diese und sind für einen der nachstehenden Zwecke bestimmt:a)Pflanzen oder Pflanzenerzeugnisse vor Schadorganismen zu schützen oder deren Einwirkung vorzubeugen, soweit es nicht als Hauptzweck dieser Produkte erachtet wird, eher hygienischen Zwecken als dem Schutz von Pflanzen oder Pflanzenerzeugnissen zu dienen;b)in einer anderen Weise als Nährstoffe die Lebensvorgänge von Pflanzen zu beeinflussen (z. B. Wachstumsregler);c)Pflanzenerzeugnisse zu konservieren, soweit solche Stoffe oder Zubereitungen nicht den besonderen Vorschriften der Europäischen Union über konservierende Stoffe unterliegen;d)unerwünschte Pflanzen oder Pflanzenteile, mit Ausnahme von Algen, zu vernichten, es sei denn, die Produkte werden auf dem Boden oder Wasser zum Schutz von Pflanzen ausgebracht, odere)ein unerwünschtes Wachstum von Pflanzen, mit Ausnahme von Algen, zu hemmen oder ein solches Wachstum zu verhindern, es sei denn, die Produkte werden auf dem Boden oder Wasser zum Schutz von Pflanzen ausgebracht.

[66] Dies gilt unbeschadet einer möglichen Verlängerung für Kinderarzneimittel, falls eine solche von den Vertragsparteien vorgesehen wird.

[67] Siehe Definition in Anhang 2-D (Arzneimittel und Medizinprodukte).

[68] Siehe Definition in Artikel 10.2 Absatz 2 Buchstaben a bis h.

[69] Für die Zwecke dieses Absatzes wird der Begriff "Vermittler" in den Rechtsvorschriften der Vertragsparteien definiert, er umfasst jedoch die Lieferanten oder Vertreiber von rechtsverletztenden Waren und gegebenenfalls auch die Anbieter von Online-Diensten.

[70] Für die Zwecke dieses Absatzes wird der Begriff "Vermittler" in den Rechtsvorschriften der Vertragsparteien definiert, er umfasst jedoch die Lieferanten und Vertreiber von rechtsverletztenden Waren und gegebenenfalls auch die Anbieter von Online-Diensten.

[71] Der Begriff "verwandte Schutzrechte" wird von jeder Vertragspartei im Einklang mit ihren internationalen Verpflichtungen definiert.

[72] Für die Zwecke des Dienstes nach Artikel 10.63 ist ein Diensteanbieter ein Anbieter, der die Übermittlung und die Weiterleitung von oder Verbindungen für digitale Online-Kommunikationen anbietet, wobei vom Nutzer ausgewähltes Material ohne inhaltliche Veränderung zwischen oder innerhalb von vom Nutzer festgelegten Punkten übertragen wird; für die Zwecke der Dienste nach den Artikeln 10.64 und 10.65 ist ein Diensteanbieter ein Anbieter oder Betreiber von Online-Diensten oder Netzzugängen.

[73] Es herrscht Einvernehmen darüber, dass keine Verpflichtung besteht, solche Verfahren auf die Einfuhr von Waren anzuwenden, die in einem anderen Land vom Rechteinhaber oder mit seiner Zustimmung in den Verkehr gebracht wurden.

[74] "Zolltransit, Umladung und Verbringung in eine Freizone" nach der Definition im Übereinkommen von Kyoto.

[75] Im Falle von Korea umfasst die "Überführung in ein zollrechtliches Nichterhebungsverfahren" die vorübergehende Verwendung und den Betrieb unter Zollverschluss. Im Falle der Europäischen Union umfasst die "Überführung in ein zollrechtliches Nichterhebungsverfahren" die vorübergehende Verwendung, die aktive Veredelung und das Umwandlungsverfahren unter zollamtlicher Überwachung.

[76] Für die Zwecke dieses Artikels sind Waren, die ein Recht des geistigen Eigentums verletzen,a)nachgeahmte Waren, namentlichi)Waren, einschließlich Verpackungen, auf denen unbefugt eine Marke angebracht ist, die mit einer rechtsgültig für solche Waren eingetragenen Marke identisch ist oder die sich in ihren wesentlichen Merkmalen nicht von einer solchen Marke unterscheiden lässt und die dadurch die Rechte des Inhabers der betreffenden Marke verletzt,ii)alle gegebenenfalls auch gesondert gestellten Kennzeichnungsmittel (wie Embleme, Anhänger, Aufkleber, Prospekte, Bedienungs- oder Gebrauchsanweisungen, Garantiedokumente), auf die die unter Buchstabe a Ziffer i genannten Umstände zutreffen, oderiii)mit Marken nachgeahmter Waren versehene Verpackungen, die gesondert gestellt werden und auf die die unter Buchstabe a Ziffer i genannten Umstände zutreffen,b)unerlaubt hergestellte urheberrechtlich geschützte Waren, die Vervielfältigungsstücke oder Nachbildungen sind oder solche enthalten und die ohne Zustimmung des Inhabers eines nach dem Recht einer Vertragspartei eingetragenen oder nicht eingetragenen Urheberrechts oder verwandten Schutzrechts oder ohne Zustimmung einer von dem Rechteinhaber im Herstellungsland ordnungsgemäß ermächtigten Person angefertigt werden, oderc)Waren, die nach den Rechtsvorschriften der Vertragspartei, in der der Antrag auf Tätigwerden der Zollbehörden gestellt wird,i)ein Patentrecht,ii)ein Sortenschutzrecht,iii)ein Recht an einem eingetragenen Muster oder Modell oderiv)ein Recht an einer geografischen Angabeverletzen.

[77] Einschließlich zumindest der Person, die Eigentümer der Waren ist, oder der Person, die ein gleichartiges Verfügungsrecht über die Waren besitzt.

[78] Die Anwendung dieses Artikels auf abgestimmte Verhaltensweisen regelt jede Vertragspartei in ihrem Wettbewerbsrecht.

[79] Besondere Rechte werden gewährt, wenn eine Vertragspartei die Unternehmen, die zur Lieferung von Waren oder zur Erbringung von Dienstleistungen berechtigt sind, bestimmt oder ihre Zahl auf zwei oder mehr begrenzt, ohne dabei objektive, auf dem Grundsatz der Verhältnismäßigkeit beruhende und nicht diskriminierende Kriterien zugrunde zu legen, oder wenn sie Unternehmen durch Rechts- oder Verwaltungsvorschriften Vorteile gewährt, die die Möglichkeit für andere Unternehmen, die gleiche Ware zu liefern oder die gleichen Dienstleistungen zu erbringen, spürbar beeinträchtigen.

[80] Diskriminierende Maßnahmen sind Maßnahmen, die mit der Inländerbehandlung nach den einschlägigen Bestimmungen dieses Abkommens, einschließlich der in den einschlägigen Anhängen dieses Abkommens festgelegten Bedingungen, nicht vereinbar sind.

[81] Die Vertragsparteien kommen überein, dass dieser Artikel nur für Subventionen gilt, die nach Inkrafttreten dieses Abkommens gewährt wurden.

[82] Für die Zwecke dieses Abkommens findet dieser Artikel keine Anwendung auf Subventionen, die kleinen und mittleren Unternehmen im Einklang mit den objektiven Kriterien oder Bedingungen nach Artikel 2.1 Buchstabe b und dazugehöriger Fußnote 2 des Subventionsübereinkommens gewährt wurden.

[83] Der internationale Handel der Vertragsparteien umfasst sowohl die Inlands- als auch die Ausfuhrmärkte.

[84] Wird in diesem Kapitel auf den Begriff "Arbeit" Bezug genommen, so umfasst er die für die Agenda für menschenwürdige Arbeit relevanten Bereiche, die von der Internationalen Arbeitsorganisation (im Folgenden "IAO" genannt) und in der Ministererklärung des Wirtschafts- und Sozialrates der Vereinten Nationen über Vollbeschäftigung und menschenwürdige Arbeit aus dem Jahr 2006 vereinbart wurden.

[85] Beschluss -1/CP.13 der UNFCCC, angenommen auf der dreizehnten Konferenz der Vertragsparteien des Rahmenübereinkommens der Vereinten Nationen über Klimaänderungen.

[86] Für Streitigkeiten, die das Protokoll über kulturelle Zusammenarbeit betreffen, gelten alle in diesem Kapitel enthaltenen Hinweise auf den Handelsausschuss als Hinweise auf den Ausschuss für kulturelle Zusammenarbeit.

[87] Saisonabhängige Waren sind Waren, die über einen repräsentativen Zeitraum hinweg nicht über das ganze Jahr verteilt, sondern saisonbedingt nur zu bestimmten Zeiten des Jahres eingeführt werden.

[88] Wie im Protokoll über kulturelle Zusammenarbeit erläutert, fällt das Protokoll nicht in die Zuständigkeit des Handelsausschusses; alle Funktionen des Handelsausschusses, die für die Durchführung des Protokolls relevant sind, werden vom Ausschuss für kulturelle Zusammenarbeit ausgeübt.

--------------------------------------------------

LISTE DER ANHÄNGE

Anhang 1 zu Kapitel Eins | Absichtlich frei gelassen |

Anhang 2-A zu Kapitel Zwei | Abschaffung der Zölle |

Anhang 2-B zu Kapitel Zwei | Elektronik |

Anhang 2-C zu Kapitel Zwei | Kraftfahrzeuge und Teile davon |

Anhang 2-D zu Kapitel Zwei | Arzneimittel und Medizinprodukte |

Anhang 2-E zu Kapitel Zwei | Chemikalien |

Anhang 3 zu Kapitel Drei | Landwirtschaftsbezogene Schutzmaßnahmen |

Anhang 4 zu Kapitel Vier | TBT-Koordinator |

Anhang 5 zu Kapitel Fünf | Absichtlich frei gelassen |

Anhang 6 zu Kapitel Sechs | Absichtlich frei gelassen |

Anhang 7-A zu Kapitel Sieben | Liste der Verpflichtungen |

Anhang 7-B zu Kapitel Sieben | Ausnahme von der Meistbegünstigung |

Anhang 7-C zu Kapitel Sieben | Liste der Ausnahmen von der Meistbegünstigung |

Anhang 7-D zu Kapitel Sieben | Zusätzliche Verpflichtung zu Finanzdienstleistungen |

Anhang 8 zu Kapitel Acht | Absichtlich frei gelassen |

Anhang 9 zu Kapitel Neun | BOT-Verträge und öffentliche Baukonzessionen |

Anhang 10-A zu Kapitel Zehn | Geografische Angaben für landwirtschaftliche Erzeugnisse und Lebensmittel |

Anhang 10-B zu Kapitel Zehn | Geografische Angaben für Weine, aromatisierte Weine und Spirituosen |

Anhang 11 zu Kapitel Elf | Absichtlich frei gelassen |

Anhang 12 zu Kapitel Zwölf | Absichtlich frei gelassen |

Anhang 13 zu Kapitel Dreizehn | Zusammenarbeit im Bereich Handel und nachhaltige Entwicklung |

Anhang 14-A zu Kapitel Vierzehn | Vermittlungsverfahren für nichttarifäre Maßnahmen |

Anhang 14-B zu Kapitel Vierzehn | Verfahrensordnung für das Schiedsverfahren |

Anhang 14-C zu Kapitel Vierzehn | Verhaltenskodex für die Mitglieder der Schiedspanels und die Vermittler |

Anhang 15 zu Kapitel Fünfzehn | Absichtlich frei gelassen |

--------------------------------------------------

ANHANG 1

Absichtlich frei gelassen

--------------------------------------------------

ANHANG 2-A

ABSCHAFFUNG DER ZÖLLE

1. Sofern der in diesem Anhang enthaltene Plan für die stufenweise Abschaffung der Zölle einer Vertragspartei nichts anderes bestimmt, schaffen die Vertragsparteien die Zölle nach Artikel 2.5 Absatz 1 in folgenden Stufen ab:

a) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "0" des Stufenplans einer Vertragspartei werden vollständig abgeschafft, so dass die betreffenden Waren ab dem Tag des Inkrafttretens dieses Abkommens zollfrei sind.

b) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "2" des Stufenplans einer Vertragspartei werden in drei gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

c) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "3" des Stufenplans einer Vertragspartei werden in vier gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind [1].

d) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "5" des Stufenplans einer Vertragspartei werden in sechs gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

e) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "6" des Stufenplans einer Vertragspartei werden in sieben gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

f) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "7" des Stufenplans einer Vertragspartei werden in acht gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

g) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "10" des Stufenplans einer Vertragspartei werden in elf gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

h) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "12" des Stufenplans einer Vertragspartei werden in 13 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

i) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "13" des Stufenplans einer Vertragspartei werden in 14 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

j) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "15" des Stufenplans einer Vertragspartei werden in 16 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

k) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "18" des Stufenplans einer Vertragspartei werden in 19 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

l) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "20" des Stufenplans einer Vertragspartei werden in 21 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

m) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "10-A" des Stufenplans einer Vertragspartei werden am Tag des Inkrafttretens dieses Abkommens um fünf Prozent des Basiszollsatzes gesenkt. Die Zölle werden am ersten Tag von Jahr 3 um weitere fünf Prozent des Basiszollsatzes, am ersten Tag von Jahr 4 um sieben Prozent des Basiszollsatzes und danach jährlich bis einschließlich Jahr 6 erneut um sieben Prozent des Basiszollsatzes gesenkt. Die Zölle werden am ersten Tag von Jahr 7 und am ersten Tag von Jahr 8 um jeweils weitere zehn Prozent des Basiszollsatzes gesenkt. Die Zölle werden am ersten Tag von Jahr 9 um 12 Prozent, am ersten Tag von Jahr 10 um 17 Prozent des Basiszollsatzes und am ersten Tag von Jahr 11 um 20 Prozent des Basiszollsatzes gesenkt, so dass die betreffenden Waren danach zollfrei sind.

n) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "10-B" des Stufenplans einer Vertragspartei werden am Tag des Inkrafttretens dieses Abkommens auf 20 Prozent des Wertes gesenkt und bleiben bis zum Ende von Jahr 2 bei 20 Prozent des Wertes. Ab dem ersten Tag von Jahr 3 werden die Zölle in neun gleichen jährlichen Schritten abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

o) Für Zölle auf Ursprungserzeugnisse der Positionen in Stufe "12-A" des Stufenplans einer Vertragspartei gelten von Jahr 1 bis zum Ende von Jahr 9 weiterhin die Basiszollsätze. Ab dem ersten Tag von Jahr 10 werden die Zölle in vier gleichen jährlichen Schritten abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

p) Zölle auf Ursprungserzeugnisse der Positionen in Stufe "16-A" des Stufenplans einer Vertragspartei werden ab dem Tag des Inkrafttretens dieses Abkommens in 16 gleichen jährlichen Schritten auf 30 Prozent des Wertes gesenkt; ab dem ersten Tag von Jahr 17 und danach sind die betreffenden Waren zollfrei.

q) Für Zölle auf Ursprungserzeugnisse der Positionen in Stufe "S-A" gelten die folgenden Bestimmungen:

i) Für Waren, die vom 1. Mai bis zum 15. Oktober nach Korea eingeführt werden, werden die Zölle in 18 gleichen jährlichen Schritten ab dem Tag des Inkrafttretens dieses Abkommens abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

ii) Für Waren, die vom 16. Oktober bis 30. April nach Korea eingeführt werden, werden die Zölle am Tag des Inkrafttretens dieses Abkommens auf 24 Prozent des Wertes gesenkt und bleiben bis zum Ende von Jahr 2 bei 24 Prozent des Wertes. Ab dem ersten Tag von Jahr 3 werden die Zölle in vier gleichen jährlichen Schritten abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

r) Für Zölle auf Ursprungserzeugnisse der Positionen in Stufe "S-B" gelten die folgenden Bestimmungen:

i) Für Waren, die vom 1. September bis zum Ende Februar nach Korea eingeführt werden, gilt weiterhin der Basiszollsatz.

ii) Für Waren, die vom 1. März bis zum 31. August nach Korea eingeführt werden, werden die Zölle am Tag des Inkrafttretens dieses Abkommens auf 30 Prozent des Wertes gesenkt und bleiben bis zum Ende von Jahr 2 bei 30 Prozent des Wertes. Ab dem ersten Tag von Jahr 3 werden die Zölle in sechs gleichen jährlichen Schritten abgeschafft, so dass die betreffenden Waren danach zollfrei sind.

s) Für Zölle auf Ursprungserzeugnisse der Positionen in Stufe "E" gilt weiterhin der Basiszollsatz.

t) Für Positionen in Stufe "X" gelten im Hinblick auf die Zölle in diesem Abkommen keine Verpflichtungen. Kein Bestandteil dieses Abkommens berührt Koreas Rechte und Pflichten im Hinblick auf die Umsetzung seiner Verpflichtungen nach Dokument WT/Let/492 der Welthandelsorganisation (WTO) (Certification of Modifications and Rectifications to Schedule LX-Republic of Korea, Bescheinigung der Änderungen und Berichtigungen des Zolltarifs LX der Republik Korea) vom 13. April 2005, einschließlich späterer Änderungen dieses Dokuments.

2. Der Basiszollsatz einer Position und die Stufe zur Ermittlung des für sie im jeweiligen Schritt der Zollsenkung geltenden Zollsatzes sind für die betreffende Position im Stufenplan der jeweiligen Vertragspartei angegeben.

3. Die Zollsätze in den Zwischenschritten sind mindestens auf das nächste Zehntel eines Prozentpunktes abzurunden; wird der Zollsatz in Währungseinheiten ausgedrückt, sind diese Zollsätze mindestens auf das nächste Zehntel eines Eurocent im Falle der EU-Vertragspartei und auf den nächsten koreanischen Won im Falle Koreas abzurunden.

4. Für die Zwecke dieses Anhangs und des Stufenplans einer Vertragspartei tritt die jährliche Zollsatzsenkung jeweils am ersten Tag des betreffenden Jahres, wie in Absatz 5 definiert, in Kraft.

5. Für die Zwecke dieses Anhangs und der Anlage 2-A-1 gilt:

a) Jahr 1 bezeichnet den Zeitraum von 12 Monaten ab dem Tag des Inkrafttretens dieses Abkommens.

b) Jahr 2 bezeichnet den Zeitraum von 12 Monaten ab dem 1. Jahrestag des Inkrafttretens dieses Abkommens.

c) Jahr 3 bezeichnet den Zeitraum von 12 Monaten ab dem 2. Jahrestag des Inkrafttretens dieses Abkommens.

d) Jahr 4 bezeichnet den Zeitraum von 12 Monaten ab dem 3. Jahrestag des Inkrafttretens dieses Abkommens.

e) Jahr 5 bezeichnet den Zeitraum von 12 Monaten ab dem 4. Jahrestag des Inkrafttretens dieses Abkommens.

f) Jahr 6 bezeichnet den Zeitraum von 12 Monaten ab dem 5. Jahrestag des Inkrafttretens dieses Abkommens.

g) Jahr 7 bezeichnet den Zeitraum von 12 Monaten ab dem 6. Jahrestag des Inkrafttretens dieses Abkommens.

h) Jahr 8 bezeichnet den Zeitraum von 12 Monaten ab dem 7. Jahrestag des Inkrafttretens dieses Abkommens.

i) Jahr 9 bezeichnet den Zeitraum von 12 Monaten ab dem 8. Jahrestag des Inkrafttretens dieses Abkommens.

j) Jahr 10 bezeichnet den Zeitraum von 12 Monaten ab dem 9. Jahrestag des Inkrafttretens dieses Abkommens.

k) Jahr 11 bezeichnet den Zeitraum von 12 Monaten ab dem 10. Jahrestag des Inkrafttretens dieses Abkommens.

l) Jahr 12 bezeichnet den Zeitraum von 12 Monaten ab dem 11. Jahrestag des Inkrafttretens dieses Abkommens.

m) Jahr 13 bezeichnet den Zeitraum von 12 Monaten ab dem 12. Jahrestag des Inkrafttretens dieses Abkommens.

n) Jahr 14 bezeichnet den Zeitraum von 12 Monaten ab dem 13. Jahrestag des Inkrafttretens dieses Abkommens.

o) Jahr 15 bezeichnet den Zeitraum von 12 Monaten ab dem 14. Jahrestag des Inkrafttretens dieses Abkommens.

p) Jahr 16 bezeichnet den Zeitraum von 12 Monaten ab dem 15. Jahrestag des Inkrafttretens dieses Abkommens.

q) Jahr 17 bezeichnet den Zeitraum von 12 Monaten ab dem 16. Jahrestag des Inkrafttretens dieses Abkommens.

r) Jahr 18 bezeichnet den Zeitraum von 12 Monaten ab dem 17. Jahrestag des Inkrafttretens dieses Abkommens.

s) Jahr 19 bezeichnet den Zeitraum von 12 Monaten ab dem 18. Jahrestag des Inkrafttretens dieses Abkommens.

t) Jahr 20 bezeichnet den Zeitraum von 12 Monaten ab dem 19. Jahrestag des Inkrafttretens dieses Abkommens.

u) Jahr 21 bezeichnet den Zeitraum von 12 Monaten ab dem 20. Jahrestag des Inkrafttretens dieses Abkommens.

STUFENPLAN KOREAS FÜR DEN ZOLLABBAU

Allgemeine Hinweise

1. Zusammenhang mit dem Harmonisierten Zolltarif von Korea (Harmonized Tariff Schedule of Korea, HSK). Die Positionen dieses Stufenplans werden in aller Regel anhand des HSK ausgedrückt und für ihr Verständnis (sowie zum Verständnis der mit den Unterpositionen dieses Stufenplans erfassten Waren) sind die allgemeinen Anmerkungen, die Anmerkungen zu den Abschnitten und die Anmerkungen zu den Kapiteln des HSK maßgeblich. Sofern die Positionen dieses Stufenplans mit den entsprechenden Positionen des HSK identisch sind, sind sie mit diesen als gleichbedeutend zu verstehen.

2. Basiszollsätze. Die Basiszollsätze, die in diesem Stufenplan aufgeführt sind, entsprechen den am 6. Mai 2007 geltenden Meistbegünstigungszollsätzen Koreas.

Stufenplan Koreas für den Zollabbau

HSK 2007 | Warenbezeichnung | Basiszollsatz | Zollabbaustufe | Schutzmaßnahme |

0101101000 | Pferde (für Zuchtbetrieb) | 0 | 0 | |

0101109000 | andere | 8 | 5 | |

0101901010 | Rennpferde | 8 | 5 | |

0101901090 | andere | 8 | 5 | |

0101909000 | andere | 8 | 10 | |

0102101000 | Milchkühe | 89,1 | 0 | |

0102102000 | Schlachtrinder | 89,1 | 0 | |

0102109000 | andere | 89,1 | 0 | |

0102901000 | Milchkühe | 40 | 15 | |

0102902000 | Schlachtrinder | 40 | 15 | |

0102909000 | andere | 0 | 0 | |

0103100000 | reinrassige Zuchttiere | 18 | 0 | |

0103910000 | mit einem Gewicht von weniger als 50 kg | 18 | 10 | |

0103920000 | mit einem Gewicht von 50 kg oder mehr | 18 | 10 | |

0104101000 | reinrassige Zuchttiere | 0 | 0 | |

0104109000 | andere | 8 | 0 | |

0104201000 | Milchziegen | 8 | 10 | |

0104209000 | andere | 8 | 0 | |

0105111000 | reinrassige Zuchttiere | 9 | 0 | |

0105119000 | andere | 9 | 0 | |

0105120000 | Truthühner | 9 | 0 | |

0105191010 | reinrassige Zuchttiere | 0 | 0 | |

0105191090 | andere | 18 | 0 | |

0105199000 | andere | 9 | 0 | |

0105941000 | reinrassige Zuchttiere | 9 | 0 | |

0105949000 | andere | 9 | 3 | |

0105991010 | reinrassige Zuchttiere | 0 | 0 | |

0105991090 | andere | 18 | 0 | |

0105992000 | Truthühner | 9 | 0 | |

0105999000 | andere | 9 | 0 | |

0106110000 | Primaten | 8 | 0 | |

0106120000 | Wale, Delphine und Tümmler (Säugetiere der Ordnung Cetacea); Rundschwanzseekühe (Manatis) und Gabelschwanzseekühe (Dugongs) (Säugetiere der Ordnung Sirenia) | 8 | 0 | |

0106191000 | Hunde | 8 | 3 | |

0106192010 | reinrassige Zuchttiere | 0 | 0 | |

0106192090 | andere | 8 | 0 | |

0106193000 | Hirsche | 8 | 10 | |

0106194000 | Bären | 8 | 0 | |

0106195010 | reinrassige Zuchttiere | 0 | 0 | |

0106195090 | andere | 8 | 0 | |

0106196010 | reinrassige Zuchttiere | 0 | 0 | |

0106196090 | andere | 8 | 0 | |

0106199000 | andere | 8 | 0 | |

0106201000 | Schlangen | 8 | 0 | |

0106202000 | Süßwasserschildkröten | 8 | 3 | |

0106203000 | Schildkröten | 8 | 0 | |

0106209000 | andere | 8 | 0 | |

0106310000 | Raubvögel | 8 | 5 | |

0106320000 | Papageienvögel (einschließlich Papageien, Sittiche, Aras und Kakadus) | 8 | 5 | |

0106390000 | andere | 8 | 0 | |

0106901000 | Amphibien | 8 | 0 | |

0106902010 | Honigbienen | 8 | 5 | |

0106902090 | andere | 8 | 0 | |

0106903010 | Wattwürmer | 8 | 0 | |

0106903020 | Schlammröhrenwürmer | 8 | 0 | |

0106903090 | andere | 8 | 0 | |

0106909000 | andere | 8 | 3 | |

0201100000 | ganze oder halbe Tierkörper | 40 | 15 | Siehe Anhang 3 |

0201200000 | andere Teile, mit Knochen | 40 | 15 | Siehe Anhang 3 |

0201300000 | ohne Knochen | 40 | 15 | Siehe Anhang 3 |

0202100000 | ganze oder halbe Tierkörper | 40 | 15 | Siehe Anhang 3 |

0202200000 | andere Teile, mit Knochen | 40 | 15 | Siehe Anhang 3 |

0202300000 | ohne Knochen | 40 | 15 | Siehe Anhang 3 |

0203110000 | ganze oder halbe Tierkörper | 22,5 | 5 | |

0203120000 | Schinken oder Schultern und Teile davon, mit Knochen | 22,5 | 5 | |

0203191000 | Schweinefleisch, Bauchspeck | 22,5 | 10 | Siehe Anhang 3 |

0203199000 | andere | 22,5 | 10 | Siehe Anhang 3 |

0203210000 | ganze oder halbe Tierkörper | 25 | 5 | |

0203220000 | Schinken oder Schultern und Teile davon, mit Knochen | 25 | 5 | |

0203291000 | Schweinefleisch, Bauchspeck | 25 | 10 | |

0203299000 | andere | 25 | 5 | |

0204100000 | ganze oder halbe Tierkörper von Lämmern, frisch oder gekühlt | 22,5 | 10 | |

0204210000 | ganze oder halbe Tierkörper | 22,5 | 10 | |

0204220000 | andere Teile, mit Knochen | 22,5 | 10 | |

0204230000 | ohne Knochen | 22,5 | 10 | |

0204300000 | ganze oder halbe Tierkörper von Lämmern, gefroren | 22,5 | 10 | |

0204410000 | ganze oder halbe Tierkörper | 22,5 | 10 | |

0204420000 | andere Teile, mit Knochen | 22,5 | 10 | |

0204430000 | ohne Knochen | 22,5 | 10 | |

0204501000 | frisch oder gekühlt | 22,5 | 10 | |

0204502000 | gefroren | 22,5 | 10 | |

0205001000 | frisch oder gekühlt | 27 | 10 | |

0205002000 | gefroren | 27 | 10 | |

0206100000 | von Rindern, frisch oder gekühlt | 18 | 15 | |

0206210000 | Zungen | 18 | 15 | |

0206220000 | Lebern | 18 | 15 | |

0206291000 | nur als Schwanz | 18 | 15 | |

0206292000 | Füße | 18 | 15 | |

0206299000 | andere | 18 | 15 | |

0206300000 | von Schweinen, frisch oder gekühlt | 18 | 7 | |

0206410000 | Lebern | 18 | 5 | |

0206491000 | Füße | 18 | 6 | |

0206499000 | andere | 18 | 5 | |

0206800000 | andere, frisch oder gekühlt | 18 | 15 | |

0206900000 | andere, gefroren | 18 | 15 | |

0207111000 | mit einem Gewicht von 550 g oder weniger | 18 | 12 | |

0207119000 | andere | 18 | 12 | |

0207121000 | mit einem Gewicht von 550 g oder weniger | 20 | 12 | |

0207129000 | andere | 20 | 10 | |

0207131010 | Schenkel | 18 | 10 | |

0207131020 | Brust | 18 | 10 | |

0207131030 | Flügel | 18 | 10 | |

0207131090 | andere | 18 | 10 | |

0207132010 | Leber | 22,5 | 10 | |

0207132090 | andere | 27 | 10 | |

0207141010 | Schenkel | 20 | 10 | |

0207141020 | Brust | 20 | 13 | |

0207141030 | Flügel | 20 | 13 | |

0207141090 | andere | 20 | 10 | |

0207142010 | Leber | 22,5 | 10 | |

0207142090 | andere | 27 | 10 | |

0207240000 | unzerteilt, frisch oder gekühlt | 18 | 10 | |

0207250000 | unzerteilt, gefroren | 18 | 7 | |

0207261000 | Teile | 18 | 10 | |

0207262010 | Leber | 22,5 | 10 | |

0207262090 | andere | 27 | 10 | |

0207271000 | Teile | 18 | 7 | |

0207272010 | Leber | 22,5 | 10 | |

0207272090 | andere | 27 | 10 | |

0207320000 | unzerteilt, frisch oder gekühlt | 18 | 10 | |

0207330000 | unzerteilt, gefroren | 18 | 13 | |

0207340000 | Fettlebern, frisch oder gekühlt | 22,5 | 10 | |

0207351000 | Teile | 18 | 10 | |

0207352010 | Leber | 22,5 | 10 | |

0207352090 | andere | 27 | 10 | |

0207361000 | Teile | 18 | 13 | |

0207362010 | Leber | 22,5 | 7 | |

0207362090 | andere | 27 | 10 | |

0208100000 | von Kaninchen oder Hasen | 22,5 | 10 | |

0208300000 | von Primaten | 18 | 5 | |

0208400000 | von Walen, Delphinen und Tümmlern (Säugetiere der Ordnung Cetacea); von Rundschwanzseekühen (Manatis) und Gabelschwanzseekühen (Dugongs) (Säugetiere der Ordnung Sirenia) | 30 | 3 | |

0208500000 | von Reptilien (einschließlich Schlangen und Schildkröten) | 18 | 0 | |

0208901000 | von Hirschen | 27 | 10 | |

0208909010 | von Meerestieren | 30 | 3 | |

0208909090 | andere | 18 | 10 | |

0209001000 | Schweinefett | 3 | 0 | |

0209002000 | Geflügelfett | 3 | 0 | |

0210110000 | Schinken oder Schultern und Teile davon, mit Knochen | 25 | 5 | |

0210120000 | Bäuche (Bauchspeck) und Teile davon | 30 | 5 | |

0210190000 | andere | 25 | 5 | |

0210201000 | getrocknet oder geräuchert | 27 | 15 | |

0210209000 | andere | 27 | 15 | |

0210910000 | von Primaten | 22,5 | 10 | |

0210920000 | von Walen, Delphinen und Tümmlern (Säugetiere der Ordnung Cetacea); von Rundschwanzseekühen (Manatis) und Gabelschwanzseekühen (Dugongs) (Säugetiere der Ordnung Sirenia) | 22,5 | 10 | |

0210930000 | von Reptilien (einschließlich Schlangen und Schildkröten) | 22,5 | 10 | |

0210991010 | von Rindern | 22,5 | 15 | |

0210991020 | von Schweinen | 22,5 | 5 | |

0210991030 | von Hausgeflügel | 22,5 | 10 | |

0210991090 | andere | 22,5 | 10 | |

0210999010 | Fleisch von Schafen und Ziegen | 22,5 | 10 | |

0210999020 | Fleisch von Hausgeflügel | 22,5 | 10 | |

0210999090 | andere | 22,5 | 10 | |

0301101000 | Goldkarpfen | 10 | 0 | |

0301102000 | tropische Fische | 10 | 3 | |

0301109000 | andere | 10 | 3 | |

0301911000 | Salmo trutta, Oncorhynchus mykiss, Oncorhynchus clarki, Oncorhynchus aguabonita, Oncorhynchus gilae | 10 | 7 | |

0301912000 | Oncorhynchus apache und Oncorhynchus chrysogaster | 10 | 7 | |

0301921000 | Glasaal (für Aquakultur) | 0 | 0 | |

0301929000 | andere | 30 % oder 1908 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0301930000 | Karpfen | 10 | 0 | |

0301940000 | Roter Thunfisch (Thunnus thynnus) | 10 | 3 | |

0301950000 | Südlicher Roter Thunfisch (Thunnus maccoyii) | 10 | 3 | |

0301992000 | Gelbschwanz | 10 | 3 | |

0301994010 | Brutfische (für Aquakultur) | 0 | 0 | |

0301994090 | andere | 40 % oder 2781 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0301995000 | Meeral | 10 | 5 | |

0301996000 | Hechtmuräne | 10 | 5 | |

0301997000 | Schleimaal (Eptatretus burgeri) | 10 | 3 | |

0301998000 | Plattfisch | 10 | 10 | |

0301999010 | Zackenbarsch (Epinephelus septemfasciatus) | 10 | 3 | |

0301999020 | Kugelfische | 10 | 5 | |

0301999030 | Tilapie | 10 | 0 | |

0301999040 | Felsenfisch (einschließlich Pazifischer Rotbarsch) | 10 | 5 | |

0301999051 | Brutfische (für Aquakultur) | 0 | 0 | |

0301999059 | andere | 38 | 5 | |

0301999060 | Meeräschen | 10 | 5 | |

0301999070 | Steinbeißer | 10 | 3 | |

0301999080 | Welse | 10 | 3 | |

0301999091 | Grünlinge (Hexagrammos-Arten, Agrammus-Arten) | 10 | 3 | |

0301999092 | Karausche | 10 | 3 | |

0301999093 | Lachs | 10 | 5 | |

0301999094 | Graskarpfen | 10 | 0 | |

0301999095 | Umberfisch | 36 | 10 | |

0301999099 | andere | 10 | 10 | |

0302111000 | Salmo trutta, Oncorhynchus mykiss, Oncorhynchus clarki, Oncorhynchus aguabonita, Oncorhynchus gilae | 20 | 10 | |

0302112000 | Oncorhynchus apache und Oncorhynchus chrysogaster | 20 | 10 | |

0302120000 | Pazifischer Lachs (Oncorhynchus nerka, Oncorhynchus gorbuscha, Oncorhynchus keta, Oncorhynchus tschawytscha, Oncorhynchus kisutch, Oncorhynchus masou und Oncorhynchus rhodurus), Atlantischer Lachs (Salmo salar) und Donaulachs (Hucho hucho) | 20 | 5 | |

0302190000 | andere | 20 | 5 | |

0302210000 | Heilbutt (Reinhardtius hippoglossoides, Hippoglossus hippoglossus, Hippoglossus stenolepis) | 20 | 10 | |

0302220000 | Schollen oder Goldbutt (Pleuronectes platessa) | 20 | 10 | |

0302230000 | Seezungen (Solea-Arten) | 20 | 10 | |

0302290000 | andere | 20 | 10 | |

0302310000 | Weißer Thun (Thunnus alalunga) | 20 | 3 | |

0302320000 | Gelbflossenthun (Thunnus albacares) | 20 | 3 | |

0302330000 | echter Bonito | 20 | 3 | |

0302340000 | Großaugen-Thunfisch (Thunnus obesus) | 20 | 3 | |

0302350000 | Roter Thunfisch (Thunnus thynnus) | 20 | 0 | |

0302360000 | Südlicher Roter Thunfisch (Thunnus maccoyii) | 20 | 0 | |

0302390000 | andere | 20 | 3 | |

0302400000 | Heringe (Clupea harengus, Clupea pallasii), ausgenommen Fischlebern, Fischrogen und Fischmilch | 20 | 5 | |

0302500000 | Kabeljau (Gadus morhua, Gadus ogac, Gadus macrocephalus), ausgenommen Fischlebern, Fischrogen und Fischmilch | 20 | 10 | |

0302610000 | Sardinen (Sardina pilchardus, Sardinops-Arten), Sardinellen (Sardinella-Arten), Sprotten (Sprattus sprattus) | 20 | 5 | |

0302620000 | Schellfisch (Melanogrammus aeglefinus) | 20 | 5 | |

0302630000 | Köhler (Pollachius virens) | 20 | 0 | |

0302640000 | Makrelen (Scomber scombrus, Scomber australasicus, Scomber japonicus) | 20 | 10 | |

0302650000 | Haie | 20 | 3 | |

0302660000 | Aale (Anguilla-Arten) | 20 | 10 | |

0302670000 | Schwertfisch (Xiphias gladius) | 20 | 3 | |

0302680000 | Zahnfische (Dissostichus-Arten) | 20 | 5 | |

0302691000 | Pazifischer Pollack | 20 | 10 | |

0302692000 | Gelbschwanz | 20 | 5 | |

0302693000 | Haarschwanz | 20 | 10 | |

0302694000 | Zahnbrasse | 20 | 10 | |

0302695000 | Meeral | 20 | 10 | |

0302696000 | Hechtmuräne | 20 | 5 | |

0302697000 | Stöcker | 20 | 10 | |

0302698000 | Makrelenhechte (einschließlich Halbschnäbler) | 20 | 0 | |

0302699010 | Spanische Makrele | 20 | 10 | |

0302699020 | Kugelfische | 20 | 7 | |

0302699030 | Deckfisch | 20 | 5 | |

0302699040 | Seeteufel | 20 | 10 | |

0302699090 | andere | 20 | 10 | |

0302701000 | Lebern | 20 | 3 | |

0302702000 | Fischrogen | 20 | 3 | |

0303110000 | Roter Lachs (Oncorhynchus nerka) | 10 | 5 | |

0303190000 | andere | 10 | 5 | |

0303210000 | Forellen (Salmo trutta, Oncorhynchus mykiss, Oncorhynchus clarki, Oncorhynchus aguabonita, Oncorhynchus gilae, Oncorhynchus apache und Oncorhynchus chrysogaster) | 10 | 10 | |

0303220000 | Atlantischer Lachs (Salmo salar) und Donaulachs (Hucho hucho) | 10 | 5 | |

0303290000 | andere | 10 | 5 | |

0303310000 | Heilbutt (Reinhardtius hippoglossoides, Hippoglossus hippoglossus, Hippoglossus stenolepis) | 10 | 10 | |

0303320000 | Schollen oder Goldbutt (Pleuronectes platessa) | 10 | 10 | |

0303330000 | Seezungen (Solea-Arten) | 10 | 10 | |

0303390000 | andere | 10 | Siehe Anlage 2-A-1 Absatz 5 | |

0303410000 | Weißer Thun (Thunnus alalunga) | 10 | 3 | |

0303420000 | Gelbflossenthun (Thunnus albacares) | 10 | 3 | |

0303430000 | echter Bonito | 10 | 3 | |

0303440000 | Großaugen-Thunfisch (Thunnus obesus) | 10 | 3 | |

0303450000 | Roter Thunfisch (Thunnus thynnus) | 10 | 0 | |

0303460000 | Südlicher Roter Thunfisch (Thunnus maccoyii) | 10 | 3 | |

0303490000 | andere | 10 | 3 | |

0303510000 | Heringe (Clupea harengus, Clupea pallasii) | 10 | 7 | |

0303520000 | Kabeljau (Gadus morhua, Gadus ogac, Gadus macrocephalus) | 10 | 10 | |

0303610000 | Schwertfisch (Xiphias gladius) | 10 | 3 | |

0303620000 | Zahnfische (Dissostichus-Arten) | 10 | 3 | |

0303710000 | Sardinen (Sardina pilchardus, Sardinops-Arten), Sardinellen (Sardinella-Arten), Sprotten (Sprattus sprattus) | 10 | 10 | |

0303720000 | Schellfisch (Melanogrammus aeglefinus) | 10 | 5 | |

0303730000 | Köhler (Pollachius virens) | 10 | 0 | |

0303740000 | Makrelen (Scomber scombrus, Scomber australasicus, Scomber japonicus) | 10 | 12-A | |

0303750000 | Haie | 10 | 5 | |

0303760000 | Aale (Anguilla-Arten) | 10 | 10 | |

0303770000 | Meerbarsche (Wolfsbarsche) (Dicentrarchus labrax, Dicentrarchus punctatus) | 10 | 10 | |

0303780000 | Seehechte (Merluccius-Arten, Urophycis-Arten) | 10 | 10 | |

0303791000 | Pazifischer Pollack | 30 | E | |

0303792000 | Kohlenfisch | 10 | 5 | |

0303793000 | Haarschwanz | 10 | 10 | |

0303794010 | Ziegelbarsch (Branchiostegus japonicus) | 10 | 5 | |

0303794090 | andere | 10 | 10 | |

0303795000 | Meeral | 10 | 10 | |

0303796000 | Gelbfisch | 10 | 10 | |

0303797000 | Stöcker | 10 | 10 | |

0303798000 | Makrelenhechte (einschließlich Halbschnäbler) | 34 | 10 | |

0303799010 | Spanische Makrele | 10 | 10 | |

0303799020 | Kugelfische | 10 | 10 | |

0303799030 | Meerstint | 10 | 5 | |

0303799040 | Stachelkopf (Sebastolobus macrochir) | 10 | 0 | |

0303799050 | Petersfisch | 10 | 3 | |

0303799060 | Terpug | 10 | 3 | |

0303799070 | Felsenfisch (einschließlich Pazifischer Rotbarsch) | 10 | 10-A | |

0303799080 | Hoki | 10 | 7 | |

0303799091 | Seeteufel | 10 | 10 | |

0303799092 | Schleimaal (pazifischer, atlantischer) | 10 | 7 | |

0303799093 | Echte Rochen | 10 | 10 | |

0303799094 | Milchfisch | 10 | 0 | |

0303799095 | Umberfische | 57 | E | |

0303799096 | Tiefenrochen | 10 | 10 | |

0303799097 | Sandaal | 10 | 10 | |

0303799098 | Zahnfische, außer Dissostichus-Arten | 10 | 3 | |

0303799099 | andere | 10 | 10 | |

0303801000 | Lebern | 10 | 5 | |

0303802010 | vom Pazifischen Pollack | 10 | 5 | |

0303802090 | andere | 10 | 5 | |

0304111000 | Filets | 20 | 3 | |

0304112000 | Fischsurimi | 20 | 3 | |

0304119000 | andere | 20 | 3 | |

0304121000 | Filets | 20 | 5 | |

0304122000 | Fischsurimi | 20 | 5 | |

0304129000 | andere | 20 | 5 | |

0304191010 | Filets | 20 | 10 | |

0304191020 | Fischsurimi | 20 | 5 | |

0304191090 | andere | 20 | 5 | |

0304192010 | Filets | 20 | 10 | |

0304192020 | Fischsurimi | 20 | 3 | |

0304192090 | andere | 20 | 3 | |

0304193010 | Filets | 20 | 0 | |

0304193020 | Fischsurimi | 20 | 3 | |

0304193090 | andere | 20 | 3 | |

0304199010 | Filets | 20 | 5 | |

0304199020 | Fischsurimi | 20 | 5 | |

0304199090 | andere | 20 | 5 | |

0304210000 | Schwertfisch (Xiphias gladius) | 10 | 3 | |

0304220000 | Zahnfische (Dissostichus-Arten) | 10 | 3 | |

0304291000 | vom Pazifischen Pollack | 10 | 10 | |

0304292000 | vom Meeraal | 10 | 10 | |

0304293000 | vom Kabeljau | 10 | 10 | |

0304294000 | von Schollen oder Goldbutt | 10 | 10 | |

0304295000 | vom Roten Thunfisch | 10 | 3 | |

0304296000 | von Zahnfischen, außer Dissostichus-Arten | 10 | 3 | |

0304297000 | von Tilapie | 10 | 0 | |

0304298000 | vom Feilenfisch (Stephanolepis cirrhifer) | 10 | 3 | |

0304299000 | andere | 10 | 5 | |

0304911000 | Fischsurimi, gefroren | 10 | 3 | |

0304919000 | andere | 10 | 3 | |

0304921000 | Fischsurimi, gefroren | 10 | 5 | |

0304929000 | andere | 10 | 5 | |

0304991010 | Fischsurimi, gefroren | 10 | 3 | |

0304991090 | andere | 10 | 3 | |

0304999010 | Fischsurimi, gefroren | 10 | 5 | |

0304999090 | andere | 10 | 5 | |

0305100000 | Mehl, Pulver und Pellets von Fischen, genießbar | 20 | 3 | |

0305201000 | Lebern | 20 | 3 | |

0305202000 | Fischrogen, getrocknet | 20 | 3 | |

0305203000 | Fischrogen, geräuchert | 20 | 3 | |

0305204010 | vom Pazifischen Pollack | 20 | 5 | |

0305204020 | vom Gelbfisch | 20 | 3 | |

0305204030 | von Heringen | 20 | 5 | |

0305204090 | andere | 20 | 3 | |

0305301000 | getrocknet | 20 | 3 | |

0305302000 | gesalzen oder in Salzlake | 20 | 3 | |

0305410000 | Pazifischer Lachs (Oncorhynchus nerka, Oncorhynchus gorbuscha, Oncorhynchus keta, Oncorhynchus tschawytscha, Oncorhynchus kisutch, Oncorhynchus masou und Oncorhynchus rhodurus), Atlantischer Lachs (Salmo salar) und Donaulachs (Hucho hucho) | 20 | 5 | |

0305420000 | Heringe (Clupea harengus, Clupea pallasii) | 20 | 3 | |

0305491000 | Sardellen | 20 | 5 | |

0305492000 | Pazifischer Pollack | 20 | 3 | |

0305499000 | andere | 20 | 3 | |

0305510000 | Kabeljau (Gadus morhua, Gadus ogac, Gadus macrocephalus) | 20 | 10 | |

0305591000 | Haifischflossen | 20 | 5 | |

0305592000 | Sardellen | 20 | 10 | |

0305593000 | Pazifischer Pollack | 20 | 3 | |

0305594000 | Gelbfisch | 20 | 10 | |

0305595000 | Kugelfische | 20 | 0 | |

0305596000 | Hechtmuräne | 20 | 3 | |

0305597000 | Sandaal | 20 | 5 | |

0305598000 | Dunkler Butterfisch, einschließlich Whitebait (Jungfische) | 20 | 0 | |

0305599000 | andere | 20 | 5 | |

0305610000 | Heringe (Clupea harengus, Clupea pallasii) | 20 | 3 | |

0305620000 | Kabeljau (Gadus morhua, Gadus ogac, Gadus macrocephalus) | 20 | 5 | |

0305631000 | Salzsardellen | 20 | 10 | |

0305639000 | andere | 20 | 5 | |

0305691000 | Lachse | 20 | 5 | |

0305692000 | Forellen | 20 | 10 | |

0305693000 | Haarschwanz | 20 | 5 | |

0305694000 | Sardinen | 20 | 3 | |

0305695000 | Makrelen | 20 | 10 | |

0305696000 | Gelbfisch | 20 | 10 | |

0305697000 | Stöcker | 20 | 10 | |

0305698000 | Makrelenhechte (einschließlich Halbschnäbler) | 20 | 0 | |

0305699000 | andere | 20 | 3 | |

0306110000 | Langusten (Palinurus-Arten, Panulirus-Arten, Jasus-Arten) | 20 | 3 | |

0306120000 | Hummer (Homarus-Arten) | 20 | 3 | |

0306131000 | geschält | 20 | 5 | |

0306139000 | andere | 20 | 10 | |

0306141000 | Krabbenfleisch | 20 | 10 | |

0306142000 | Königskrabben | 20 | 3 | |

0306143000 | Blaue Schwimmkrabbe | 14 | 10 | |

0306149000 | andere | 14 | 10 | |

0306190000 | andere, einschließlich Mehl, Pulver und Pellets von Krebstieren, genießbar | 20 | 10 | |

0306210000 | Langusten (Palinurus-Arten, Panulirus-Arten, Jasus-Arten) | 20 | 3 | |

0306220000 | Hummer (Homarus-Arten) | 20 | 3 | |

0306231000 | lebend, frisch oder gekühlt | 20 | 3 | |

0306232000 | getrocknet | 20 | 3 | |

0306233000 | gesalzen oder in Salzlake | 50 % oder 363 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0306241010 | Blaue Schwimmkrabbe | 20 | 10 | |

0306241020 | Arktische Seespinne | 20 | 10 | |

0306241090 | andere | 20 | 10 | |

0306242000 | getrocknet | 20 | 5 | |

0306243000 | gesalzen oder in Salzlake | 20 | 10 | |

0306291000 | lebend, frisch oder gekühlt | 20 | 10 | |

0306292000 | getrocknet | 20 | 10 | |

0306293000 | gesalzen oder in Salzlake | 20 | 5 | |

0307101011 | für die Zucht | 0 | 0 | |

0307101019 | andere | 5 | 3 | |

0307101090 | andere | 20 | 5 | |

0307102000 | gefroren | 20 | 5 | |

0307103000 | getrocknet | 20 | 5 | |

0307104000 | gesalzen oder in Salzlake | 20 | 3 | |

0307210000 | lebend, frisch oder gekühlt | 20 | 10 | |

0307291000 | gefroren | 20 | 10 | |

0307292000 | getrocknet | 20 | 10 | |

0307293000 | gesalzen oder in Salzlake | 20 | 3 | |

0307310000 | lebend, frisch oder gekühlt | 20 | 7 | |

0307391000 | gefroren | 20 | 10 | |

0307392000 | getrocknet | 20 | 10 | |

0307399000 | andere | 20 | 5 | |

0307411000 | Tintenfische | 10 | 5 | |

0307412000 | Kalmare | 10 | 10 | |

0307491010 | Tintenfische | 10 | 10 | |

0307491020 | Kalmare | 22 | E | |

0307492000 | gesalzen oder in Salzlake | 10 | 10 | |

0307493000 | getrocknet | 10 | 10 | |

0307511000 | Octopus variabilis | 20 | 7 | |

0307512000 | Vieraugenkraken | 20 | 10 | |

0307519000 | andere | 20 | 10 | |

0307591010 | Kraken | 20 | 10 | |

0307591020 | Octopus variabilis | 20 | 10 | |

0307591030 | Vieraugenkraken | 20 | 10 | |

0307591090 | andere | 20 | 3 | |

0307592000 | getrocknet | 20 | 10 | |

0307599000 | andere | 20 | 5 | |

0307600000 | Schnecken, ausgenommen Meeresschnecken | 20 | 0 | |

0307911110 | Venusmuschellaich | 20 | 3 | |

0307911190 | andere | 20 | 5 | |

0307911200 | Abalone | 20 | 7 | |

0307911300 | Turbanschnecken | 20 | 10 | |

0307911410 | für die Zucht | 0 | 0 | |

0307911490 | andere | 20 | 3 | |

0307911510 | für die Zucht | 0 | 0 | |

0307911590 | andere | 20 | 7 | |

0307911600 | Herzmuscheln | 20 | 10 | |

0307911700 | Schließmuskeln von Muscheln | 20 | 10 | |

0307911800 | Japanische Teppichmuscheln | 20 | 10 | |

0307911910 | Asiatische Körbchenmuscheln | 20 | 3 | |

0307911990 | andere | 20 | 10 | |

0307919010 | Seeigel | 20 | 5 | |

0307919020 | Seegurken | 20 | 3 | |

0307919031 | für die Zucht | 0 | 0 | |

0307919039 | andere | 20 | 5 | |

0307919040 | Quallen | 20 | 5 | |

0307919090 | andere | 20 | 10 | |

0307991110 | Herzmuscheln | 20 | 10 | |

0307991120 | Riesentrogmuscheln | 20 | 10 | |

0307991130 | Japanische Teppichmuscheln | 20 | 10 | |

0307991140 | Schließmuskeln von Muscheln | 20 | 10 | |

0307991150 | Archenmuscheln | 20 | 7 | |

0307991160 | Turbanschnecken (gefroren) | 20 | 10 | |

0307991190 | andere | 20 | 10 | |

0307991910 | Seegurken | 20 | 3 | |

0307991920 | Seescheiden | 20 | 7 | |

0307991990 | andere | 20 | 10 | |

0307992110 | Riesentrogmuscheln | 20 | 10 | |

0307992120 | Schließmuskeln von Muscheln | 20 | 10 | |

0307992130 | Japanische Teppichmuscheln | 20 | 10 | |

0307992190 | andere | 20 | 7 | |

0307992920 | Seegurken | 20 | 3 | |

0307992930 | Seescheiden | 20 | 5 | |

0307992990 | andere | 20 | 5 | |

0307993110 | Riesentrogmuscheln | 20 | 5 | |

0307993120 | Japanische Teppichmuscheln | 20 | 10 | |

0307993130 | Turbanschnecken (gesalzen oder in Salzlake) | 20 | 3 | |

0307993190 | andere | 20 | 10 | |

0307993910 | Seeigel | 20 | 3 | |

0307993920 | Seegurken | 20 | 3 | |

0307993930 | Quallen | 20 | 0 | |

0307993990 | andere | 20 | 5 | |

0401100000 | mit einem Milchfettgehalt von 1 GHT oder weniger | 36 | 15 | |

0401200000 | mit einem Milchfettgehalt von mehr als 1 bis 6 GHT | 36 | 15 | |

0401301000 | eingefrosteter Rahm | 36 | 10 | |

0401309000 | andere | 36 | 13 | |

0402101010 | Magermilchpulver | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402101090 | andere | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402109000 | andere | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402211000 | Vollmilchpulver | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402219000 | andere | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402290000 | andere | 176 | Siehe Anlage 2-A-1 Absatz 6 | |

0402911000 | evaporierte Milch | 89 | Siehe Anlage 2-A-1 Absatz 6 | |

0402919000 | andere | 89 | Siehe Anlage 2-A-1 Absatz 6 | |

0402991000 | gesüßte evaporierte Milch | 89 | Siehe Anlage 2-A-1 Absatz 6 | |

0402999000 | andere | 89 | Siehe Anlage 2-A-1 Absatz 6 | |

0403101000 | flüssig | 36 | 10 | |

0403102000 | gefroren | 36 | 10 | |

0403109000 | andere | 36 | 10 | |

0403901000 | Buttermilch | 89 | Siehe Anlage 2-A-1 Absatz 6 | |

0403902000 | saure Milch und saurer Rahm | 36 | 10 | |

0403903000 | Kefir | 36 | 10 | |

0403909000 | andere fermentierte oder gesäuerte Milch (einschließlich Rahm) | 36 | 10 | |

0404101010 | Molkepulver | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404101090 | andere | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404102110 | lactosefrei | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404102120 | demineralisiert | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404102130 | Konzentrate aus Molkenproteinen | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404102190 | andere | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404102900 | andere | 49,5 | | |

–zur Fütterung | 49,5 | 0 | |

–andere | 49,5 | Siehe Anlage 2-A-1 Absatz 7 | |

0404900000 | andere | 36 | 10 | |

0405100000 | Butter | 89 | Siehe Anlage 2-A-1 Absatz 8 | |

0405200000 | Milchstreichfette | 8 | 0 | |

0405900000 | andere | 89 | Siehe Anlage 2-A-1 Absatz 8 | |

0406101000 | Frischkäse | 36 | Siehe Anlage 2-A-1 Absatz 9 | |

0406102000 | Quark/Topfen | 36 | 10 | |

0406200000 | Käse aller Art, gerieben oder in Pulverform | 36 | Siehe Anlage 2-A-1 Absatz 9 | |

0406300000 | Schmelzkäse, weder gerieben noch in Pulverform | 36 | Siehe Anlage 2-A-1 Absatz 9 | |

0406400000 | Blauschimmelkäse und anderer Käse mit Marmorierung des Teiges, hervorgerufen durch Penicillium roqueforti | 36 | 10 | |

0406900000 | andere Käse | 36 | | |

–Cheddar | 36 | Siehe Anlage 2-A-1 Absatz 9 | |

–andere | 36 | Siehe Anlage 2-A-1 Absatz 9 | |

0407001010 | Bruteier, von reinrassigen Tieren | 27 | 10 | |

0407001090 | andere | 27 | 15 | |

0407009000 | andere | 27 | 10 | |

0408110000 | getrocknet | 27 | 13 | |

0408190000 | andere | 27 | 13 | |

0408910000 | getrocknet | 27 | 10 | |

0408991000 | von Hühnern | 41,6 | 15 | |

0408999000 | andere | 27 | 10 | |

0409000000 | natürlicher Honig | 243 % oder 1864 Won/kg, je nachdem, welcher Betrag höher ist | Siehe Anlage 2-A-1 Absatz 10 | |

0410001000 | Schildkröteneier | 8 | 0 | |

0410002000 | Salanganennester | 8 | 0 | |

0410003000 | Gelée royale | 8 | 10 | |

0410009000 | andere | 8 | 0 | |

0501000000 | Menschenhaare, roh, auch gewaschen oder entfettet; Abfälle von Menschenhaar | 3 | 0 | |

0502100000 | Borsten von Hausschweinen oder Wildschweinen und Abfälle dieser Borsten | 3 | 0 | |

0502902000 | Ziegenhaar | 3 | 0 | |

0502909000 | andere | 3 | 0 | |

0504001010 | von Rindern | 27 | 15 | |

0504001090 | andere | 27 | 13 | |

0504002000 | Blasen | 27 | 10 | |

0504003000 | Mägen | 27 | 15 | |

0505100000 | Federn von der zum Füllen verwendeten Art; Daunen | 3 | 5 | |

0505901000 | Mehl von Federn | 5 | 0 | |

0505909000 | andere | 5 | 5 | |

0506100000 | Ossein und mit Säure behandelte Knochen | 3 | 0 | |

0506901010 | von Tigern | 3 | 0 | |

0506901020 | von Rindern | 9 | 0 | |

0506901090 | andere | 3 | 0 | |

0506902000 | Mehl von Knochen | 25,6 | 10 | |

0506909000 | andere | 3 | 0 | |

0507101000 | Elfenbein vom Elefant | 8 | 0 | |

0507102000 | Hörner vom Nashorn | 8 | 0 | |

0507109000 | andere | 8 | 0 | |

0507901110 | als Ganzes | 20 | 15 | |

0507901190 | andere | 20 | 15 | |

0507901200 | Geweihe | 20 | 15 | |

0507902010 | Schildpatt und Panzer von Schildkröten | 8 | 0 | |

0507902020 | Fischbein (einschließlich Bartenfransen) | 8 | 0 | |

0507902030 | Panzer und Schuppen vom Schuppentier | 8 | 0 | |

0507902040 | Hufe und Krallen (einschließlich Klauen) | 8 | 0 | |

0507902090 | andere | 8 | 0 | |

0508001000 | Korallen | 8 | 0 | |

0508002010 | Perlmuschelschalen | 8 | 0 | |

0508002020 | Abaloneschalen | 8 | 0 | |

0508002030 | Austernschalen | 8 | 0 | |

0508002040 | Schneckenhäuser | 8 | 0 | |

0508002050 | Trocusmuschelschalen | 8 | 0 | |

0508002060 | Agoyamuschelschalen | 8 | 0 | |

0508002070 | Schalen von Süßwasserperlmuscheln (Megalonaias nervosa, Amblema plicata, Quadrula quadrula-Arten) | 8 | 0 | |

0508002090 | andere | 8 | 0 | |

0508009000 | andere | 8 | 0 | |

0510001000 | Graue Ambra | 8 | 0 | |

0510002000 | Bibergeil | 8 | 0 | |

0510003000 | Moschus | 8 | 0 | |

0510004000 | Gallenstein | 8 | 0 | |

0510005000 | Kot vom Komplexzahn-Gleithörnchen (Trogopterus xanthipes) | 8 | 0 | |

0510009010 | Pankreas | 8 | 0 | |

0510009020 | Galle | 8 | 0 | |

0510009030 | Gecko | 8 | 0 | |

0510009090 | andere | 8 | 0 | |

0511100000 | Rindersperma | 0 | 0 | |

0511911010 | Salinenkrebseier | 8 | 0 | |

0511911090 | andere | 8 | 0 | |

0511912000 | Abfälle von Fischen | 5 | 3 | |

0511919000 | andere | 8 | 5 | |

0511991000 | Tierblut | 8 | 0 | |

0511992010 | Sperma vom Schwein | 0 | 0 | |

0511992090 | anderes | 0 | 0 | |

0511993010 | von Rindern | 18 | 0 | |

0511993020 | von Schweinen | 18 | 0 | |

0511993090 | andere | 0 | 0 | |

0511994000 | Flechsen und Sehnen | 18 | 10 | |

0511995011 | zugerichtet | 3 | 0 | |

0511995019 | andere | 3 | 0 | |

0511995020 | Rosshaarabfälle | 3 | 0 | |

0511996000 | natürliche Schwämme tierischen Ursprungs | 8 | 0 | |

0511999010 | Seidenraupeneier | 18 | 0 | |

0511999020 | Seidenraupenpuppen | 8 | 0 | |

0511999030 | nicht lebende Tiere, ausgenommen Produkte von nicht lebenden Tieren des Kapitels 3 | 8 | 0 | |

0511999040 | Schnitzel und ähnliche Abfälle roher Häute oder Felle | 8 | 0 | |

0511999090 | andere | 8 | 0 | |

0601101000 | von Tulpen | 8 | 0 | |

0601102000 | von Liliengewächsen | 4 | 0 | |

0601103000 | von Dahlien | 8 | 0 | |

0601104000 | von Hyazinthen | 8 | 0 | |

0601105000 | von Gladiolen | 8 | 0 | |

0601106000 | von Iris | 8 | 0 | |

0601107000 | von Freesien | 8 | 0 | |

0601108000 | von Narzissen | 8 | 0 | |

0601109000 | andere | 8 | 0 | |

0601201000 | von Tulpen | 8 | 0 | |

0601202000 | von Liliengewächsen | 8 | 0 | |

0601203000 | von Dahlien | 8 | 0 | |

0601204000 | von Hyazinthen | 8 | 0 | |

0601205000 | von Gladiolen | 8 | 0 | |

0601206000 | Zichorienpflanzen und -wurzeln | 8 | 0 | |

0601207000 | von Iris | 8 | 0 | |

0601208000 | von Freesien | 8 | 0 | |

0601209010 | von Narzissen | 8 | 0 | |

0601209090 | andere | 8 | 0 | |

0602101000 | von Obstbäumen | 8 | 0 | |

0602109000 | andere | 8 | 5 | |

0602201000 | Apfelbäume | 18 | 0 | |

0602202000 | Birnbäume | 18 | 0 | |

0602203000 | Pfirsichbäume | 18 | 0 | |

0602204000 | Reben | 8 | 0 | |

0602205000 | Kakibäume | 8 | 0 | |

0602206000 | Zitrusbäume | 18 | 0 | |

0602207010 | Esskastanienbäume | 8 | 10 | |

0602207020 | Walnussbäume | 8 | 10 | |

0602207030 | koreanische Pinien | 8 | 10 | |

0602209000 | andere | 8 | 10 | |

0602300000 | Rhododendren und Azaleen, auch veredelt | 8 | 10 | |

0602400000 | Rosen, auch veredelt | 8 | 0 | |

0602901010 | Orchideen und Knabenkräuter (Orchis) | 8 | 0 | |

0602901020 | Nelken | 8 | 0 | |

0602901030 | Guzmania Empire | 8 | 0 | |

0602901040 | Gypsophila | 8 | 0 | |

0602901050 | Chrysanthemen | 8 | 0 | |

0602901060 | Kakteen | 8 | 0 | |

0602901090 | andere | 8 | 0 | |

0602902011 | als Bonsai | 8 | 10 | |

0602902019 | andere | 8 | 10 | |

0602902020 | Lärchen | 8 | 10 | |

0602902030 | Cryptomeria | 8 | 10 | |

0602902040 | japanische Zypresse | 8 | 10 | |

0602902050 | Pinus rigitaeda | 8 | 10 | |

0602902061 | als Bonsai | 8 | 10 | |

0602902069 | andere | 8 | 10 | |

0602902071 | als Bonsai | 8 | 10 | |

0602902079 | andere | 8 | 10 | |

0602902081 | als Bonsai | 8 | 10 | |

0602902089 | andere | 8 | 10 | |

0602902091 | als Bonsai | 8 | 10 | |

0602902099 | andere | 8 | 10 | |

0602909010 | Pfingstrosenbäume | 8 | 10 | |

0602909020 | Kamelienbäume | 8 | 10 | |

0602909030 | Maulbeerbäume | 18 | 0 | |

0602909040 | Pilzmycel | 8 | 0 | |

0602909090 | andere | 8 | 0 | |

0603110000 | Rosen | 25 | 0 | |

0603120000 | Nelken | 25 | 0 | |

0603131000 | Cymbidien | 25 | 0 | |

0603132000 | Phalaenopsis | 25 | 5 | |

0603139000 | andere | 25 | 5 | |

0603140000 | Chrysanthemen | 25 | 0 | |

0603191000 | Tulpen | 25 | 0 | |

0603192000 | Gladiolen | 25 | 0 | |

0603193000 | Liliengewächse | 25 | 0 | |

0603194000 | Gypsophila | 25 | 0 | |

0603199000 | andere | 25 | 5 | |

0603900000 | andere | 25 | 5 | |

0604100000 | Moose und Flechten | 8 | 10 | |

0604911010 | Blätter von Ginkgobäumen | 8 | 10 | |

0604911090 | andere | 8 | 10 | |

0604919000 | andere | 8 | 0 | |

0604990000 | andere | 8 | 0 | |

0701100000 | zur Aussaat | 304 | 10 | |

0701900000 | andere | 304 | E | |

0702000000 | Tomaten, frisch oder gekühlt | 45 | 7 | |

0703101000 | Speisezwiebeln | 135 % oder 180 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0703102000 | Schalotten | 27 | 0 | |

0703201000 | geschält | 360 % oder 1800 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0703209000 | andere | 360 % oder 1800 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0703901000 | Porree/Lauch | 27 | 0 | |

0703909000 | andere | 27 | 0 | |

0704100000 | Blumenkohl/Karfiol | 27 | 5 | |

0704200000 | Rosenkohl/Kohlsprossen | 27 | 10 | |

0704901000 | Kohl | 27 | 0 | |

0704902000 | Chinakohl | 27 | 5 | |

0704909000 | andere | 27 | 0 | |

0705110000 | Kopfsalat | 45 | 10 | |

0705190000 | andere | 45 | 10 | |

0705210000 | Chicorée-Witloof (Cichorium intybus var. foliosum) | 8 | 0 | |

0705290000 | andere | 8 | 0 | |

0706101000 | Karotten und Speisemöhren | 30 % oder 134 Won/kg, je nachdem, welcher Betrag höher ist | 5 | |

0706102000 | Speiserüben | 27 | 0 | |

0706901000 | Radieschen | 30 | 10 | |

0706902000 | Wasabi und Meerrettich | 27 | 0 | |

0706903000 | Codonopsis | 27 | 5 | |

0706904000 | Platycodon grandiflorum | 27 | 5 | |

0706909000 | andere | 27 | 5 | |

0707000000 | Gurken und Cornichons, frisch oder gekühlt | 27 | 0 | |

0708100000 | Erbsen (Pisum sativum) | 27 | 5 | |

0708200000 | Bohnen (Vigna-Arten, Phaseolus-Arten) | 27 | 5 | |

0708900000 | andere Hülsenfrüchte | 27 | 5 | |

0709200000 | Spargel | 27 | 0 | |

0709300000 | Auberginen | 27 | 0 | |

0709400000 | Sellerie, ausgenommen Knollensellerie | 27 | 0 | |

0709517000 | Zuchtchampignons (Agaricus bisporus) | 30 | 10 | |

0709519000 | andere | 30 | 10 | |

0709591000 | Matsutake-Pilze | 30 | 10 | |

0709592000 | Shiitake-Pilze | 45 % oder 1625 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0709593000 | Glänzender Lackporling (Ganoderma lucidum) | 30 | 10 | |

0709594000 | Austernpilze | 30 | 10 | |

0709595000 | Samtfußrüblinge (Flammulina velutipes) | 30 | 10 | |

0709596000 | Trüffeln | 27 | 10 | |

0709599000 | andere | 30 | 10 | |

0709601000 | Gemüsepaprika (bauchig) | 270 % oder 6210 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0709609000 | andere | 270 % oder 6210 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0709700000 | Gartenspinat, Neuseelandspinat und Gartenmelde | 27 | 0 | |

0709901000 | Adlerfarn | 30 | 10 | |

0709902000 | blühende Farne | 27 | 10 | |

0709903000 | Kürbisse | 27 | 0 | |

0709909000 | andere | 27 | 10 | |

0710100000 | Kartoffeln | 27 | 5 | |

0710210000 | Erbsen (Pisum sativum) | 27 | 5 | |

0710220000 | Bohnen (Vigna-Arten, Phaseolus-Arten) | 27 | 5 | |

0710290000 | andere | 27 | 5 | |

0710300000 | Gartenspinat, Neuseelandspinat und Gartenmelde | 27 | 0 | |

0710400000 | Zuckermais | 30 | 5 | |

0710801000 | Zwiebeln | 27 | 12 | |

0710802000 | Knoblauch | 27 | 15 | |

0710803000 | Bambussprossen | 27 | 10 | |

0710804000 | Karotten und Speisemöhren | 27 | 5 | |

0710805000 | Adlerfarn | 30 | 10 | |

0710806000 | Matsutake-Pilze | 27 | 12 | |

0710807000 | Früchte der Gattungen Capsicum oder Pimenta | 27 | 15 | |

0710809000 | andere | 27 | 0 | |

0710900000 | Mischungen von Gemüsen | 27 | 0 | |

0711200000 | Oliven | 27 | 0 | |

0711400000 | Gurken und Cornichons | 30 | 10 | |

0711510000 | Pilze der Gattung Agaricus | 30 | 10 | |

0711591000 | Trüffeln | 27 | 10 | |

0711599000 | andere | 30 | 10 | |

0711901000 | Knoblauch | 360 % oder 1800 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0711903000 | Bambussprossen | 27 | 10 | |

0711904000 | Karotten und Speisemöhren | 30 | 10 | |

0711905010 | Adlerfarn | 30 | 12 | |

0711905020 | blühende Farne | 27 | 10 | |

0711905091 | Früchte der Gattungen Capsicum oder Pimenta | 270 % oder 6210 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0711905099 | andere | 27 | 0 | |

0711909000 | Mischungen von Gemüsen | 27 | 0 | |

0712200000 | Zwiebeln | 135 % oder 180 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0712311000 | Zuchtchampignons (Agaricus bisporus) | 30 | 5 | |

0712319000 | andere | 30 % oder 1218 Won/kg, je nachdem, welcher Betrag höher ist | 5 | |

0712320000 | Judasohrpilze (Auricularia spp.) | 30 % oder 1218 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0712330000 | Zitterpilze (Tremella spp.) | 30 % oder 1218 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0712391010 | Matsutake-Pilze | 30 | 12 | |

0712391020 | Shiitake-Pilze | 45 % oder 1625 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0712391030 | Glänzender Lackporling (Ganoderma lucidum) | 30 % oder 842 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0712391040 | Austernpilze | 30 | 10 | |

0712391050 | Samtfußrüblinge (Winterpilze) | 30 | 10 | |

0712391090 | andere | 30 % oder 1218 Won/kg, je nachdem, welcher Betrag höher ist | 0 | |

0712392000 | Trüffeln | 27 | 10 | |

0712901000 | Knoblauch | 360 % oder 1800 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0712902010 | Adlerfarn | 30 % oder 1807 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0712902020 | Radieschen | 30 | 7 | |

0712902030 | Winterzwiebeln | 30 % oder 1159 Won/kg, je nachdem, welcher Betrag höher ist | 7 | |

0712902040 | Karotten und Speisemöhren | 30 % oder 864 Won/kg, je nachdem, welcher Betrag höher ist | 7 | |

0712902050 | Kürbisse | 30 | 10 | |

0712902060 | Kohl | 30 | 10 | |

0712902070 | Tarostängel | 30 | 10 | |

0712902080 | Süßkartoffelstängel | 30 | 7 | |

0712902091 | Zuckermais zur Aussaat | 370 | 5 | |

0712902092 | Zuckermais, ausgenommen Zuckermais zur Aussaat | 370 | 13 | |

0712902093 | Kartoffeln | 27 | 5 | |

0712902094 | blühende Farne | 30 % oder 1446 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0712902095 | Codonopsis | 30 | 7 | |

0712902099 | andere | 30 | 7 | |

0712909000 | Mischungen von Gemüsen | 27 | 0 | |

0713101000 | zur Aussaat | 27 | 5 | |

0713102000 | zu Futterzwecken | 0 | 0 | |

0713109000 | andere | 27 | 0 | |

0713200000 | Kichererbsen | 27 | 5 | |

0713311000 | zur Aussaat | 607,5 | 5 | |

0713319000 | andere | 607,5 | 15 | |

0713321000 | zur Aussaat | 420,8 | 5 | |

0713329000 | andere | 420,8 | 15 | |

0713331000 | zur Aussaat | 27 | 5 | |

0713339000 | andere | 27 | 10 | |

0713390000 | andere | 27 | 7 | |

0713400000 | Linsen | 27 | 5 | |

0713500000 | Puffbohnen (Dicke Bohnen) (Vicia faba var. major), Pferdebohnen und Ackerbohnen (Vicia faba var. equina und Vicia faba var. minor) | 27 | 5 | |

0713900000 | andere | 27 | 5 | |

0714101000 | frisch | 887,4 | 15 | |

0714102010 | Chips | 887,4 | 13 | |

0714102020 | Pellets | 887,4 | 10 | |

0714102090 | andere | 887,4 | 15 | |

0714103000 | gekühlt | 887,4 | 15 | |

0714104000 | gefroren | 45 | 5 | |

0714201000 | frisch | 385 % oder 338 Won/kg, je nachdem, welcher Betrag höher ist | 13 | |

0714202000 | getrocknet | 385 | 13 | |

0714203000 | gekühlt | 385 | 13 | |

0714204000 | gefroren | 45 | 10 | |

0714209000 | andere | 385 | 13 | |

0714901010 | gefroren | 45 | 10 | |

0714901090 | andere | 18 | 10 | |

0714909010 | gefroren | 45 | 5 | |

0714909090 | andere | 385 | 13 | |

0801110000 | getrocknet | 30 | 0 | |

0801190000 | andere | 30 | 0 | |

0801210000 | ungeschält | 30 | 0 | |

0801220000 | ohne Schale | 30 | 0 | |

0801310000 | ungeschält | 8 | 0 | |

0801320000 | ohne Schale | 8 | 0 | |

0802110000 | ungeschält | 8 | 0 | |

0802120000 | ohne Schale | 8 | 0 | |

0802210000 | ungeschält | 8 | 7 | |

0802220000 | ohne Schale | 8 | 10 | |

0802310000 | ungeschält | 45 | 15 | |

0802320000 | ohne Schale | 30 | 6 | |

0802401000 | ungeschält | 219,4 % oder 1470 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0802402000 | ohne Schale | 219,4 % oder 1470 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0802500000 | Pistazien | 30 | 0 | |

0802600000 | Macadamia-Nüsse | 30 | 7 | |

0802901010 | ungeschält | 566,8 % oder 2664 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0802901020 | ohne Schale | 566,8 % oder 2664 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0802902010 | ungeschält | 27,0 % oder 803 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0802902020 | ohne Schale | 27,0 % oder 803 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

0802909000 | andere | 30 | 7 | |

0803000000 | Bananen, einschließlich Mehlbananen, frisch oder getrocknet | 30 | 5 | |

0804100000 | Datteln | 30 | 10 | |

0804200000 | Feigen | 30 | 7 | |

0804300000 | Ananas | 30 | 10 | |

0804400000 | Avocados | 30 | 2 | |

0804501000 | Guaven | 30 | 5 | |

0804502000 | Mangofrüchte | 30 | 10 | |

0804503000 | Mangostanfrüchte | 30 | 10 | |

0805100000 | Orangen | 50 | Siehe Anlage 2-A-1 Absatz 11 | |

0805201000 [2] | koreanische Zitrusfrüchte | 144 | E | |

0805209000 [3] | andere | 144 | 15 | |

0805400000 | Pampelmusen und Grapefruits | 30 | 5 | |

0805501000 | Zitronen (Citrus limon, Citrus limonum) | 30 | 2 | |

0805502010 | Citrus aurantifolia | 30 | 10 | |

0805502020 | Citrus latifolia | 144 | 0 | |

0805900000 | andere | 144 | E | |

0806100000 | frisch | 45 | S-A | |

0806200000 | getrocknet | 21 | 0 | |

0807110000 | Wassermelonen | 45 | 12 | |

0807190000 | andere | 45 | 12 | |

0807200000 | Papaya-Früchte | 30 | 0 | |

0808100000 | Äpfel | 45 | | |

–Sorte Fuji | 45 | 20 | Siehe Anhang 3 |

–andere | 45 | 10 | Siehe Anhang 3 |

0808201000 | Birnen | 45 | | |

–asiatische Sorten | 45 | 20 | |

–andere | 45 | 10 | |

0808202000 | Quitten | 45 | 0 | |

0809100000 | Aprikosen/Marillen | 45 | 7 | |

0809200000 | Kirschen | 24 | 0 | |

0809300000 | Pfirsiche, einschließlich Nektarinen | 45 | 10 | |

|

0809401000 | Pflaumen | 45 | 10 | |

0809402000 | Schlehen | 45 | 0 | |

0810100000 | Erdbeeren | 45 | 10 | |

0810200000 | Himbeeren, Brombeeren, Maulbeeren und Loganbeeren | 45 | 12 | |

0810400000 | Preiselbeeren, Heidelbeeren und andere Früchte der Gattung Vaccinium | 45 | 10 | |

0810500000 | Kiwifrüchte | 45 | 15 | |

0810600000 | Durian | 45 | 0 | |

0810901000 | Kakifrüchte | 50 | 10 | |

0810902000 | Sharonfrüchte | 45 | 10 | |

0810903000 | Jujuben | 611,5 % oder 5800 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0810905000 | Früchte der Ume (Prunus mume) | 50 | 10 | |

0810909000 | andere | 45 | 10 | |

0811100000 | Erdbeeren | 30 | 5 | |

0811200000 | Himbeeren, Brombeeren, Maulbeeren, Loganbeeren, schwarze, weiße oder rote Johannisbeeren und Stachelbeeren | 30 | 5 | |

0811901000 | Esskastanien/Maronen | 30 | 15 | |

0811902000 | Jujuben | 30 | 13 | |

0811903000 | Pinienkerne | 30 | 15 | |

0811909000 | andere | 30 | 5 | |

0812100000 | Kirschen | 30 | 0 | |

0812901000 | Erdbeeren | 30 | 0 | |

0812909000 | andere | 30 | 0 | |

0813100000 | Aprikosen/Marillen | 45 | 0 | |

0813200000 | Pflaumen | 18 | 2 | |

0813300000 | Äpfel | 45 | 7 | |

0813401000 | Kakifrüchte | 50 | 10 | |

0813402000 | Jujuben | 611,5 % oder 5800 Won/kg, je nachdem, welcher Betrag höher ist | 15 | |

0813409000 | andere | 45 | 0 | |

0813500000 | Mischungen von getrockneten Früchten oder von Schalenfrüchten dieses Kapitels | 45 | 0 | |

0814001000 | Schalen von Zitrusfrüchten | 30 | 0 | |

0814002000 | Schalen von Melonen (einschließlich Wassermelonen) | 30 | 0 | |

0901110000 | nicht entkoffeiniert | 2 | 0 | |

0901120000 | entkoffeiniert | 2 | 0 | |

0901210000 | nicht entkoffeiniert | 8 | 5 | |

0901220000 | entkoffeiniert | 8 | 5 | |

0901901000 | Kaffeeschalen und Kaffeehäutchen | 3 | 0 | |

0901902000 | Kaffeemittel mit Kaffeegehalt | 8 | 5 | |

0902100000 | grüner Tee (nicht fermentiert) in unmittelbaren Umschließungen mit einem Inhalt von 3 kg oder weniger | 513,6 | 18 | |

0902200000 | anderer grüner Tee (nicht fermentiert) | 513,6 | 18 | |

0902300000 | schwarzer Tee (fermentiert) und teilweise fermentierter Tee, in unmittelbaren Umschließungen mit einem Inhalt von 3 kg oder weniger | 40 | 0 | |

0902400000 | anderer schwarzer Tee (fermentiert) und anderer teilweise fermentierter Tee | 40 | 0 | |

0903000000 | Mate | 25 | 5 | |

0904110000 | weder gemahlen noch sonst zerkleinert | 8 | 0 | |

0904120000 | gemahlen oder sonst zerkleinert | 8 | 0 | |

0904201000 | weder gemahlen noch sonst zerkleinert | 270 % oder 6210 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0904202000 | gemahlen oder sonst zerkleinert | 270 % oder 6210 Won/kg, je nachdem, welcher Betrag höher ist | E | |

0905000000 | Vanille | 8 | 0 | |

0906110000 | Zimt (Cinnamomum zeylanicum Blume) | 8 | 0 | |

0906191000 | Zimt, anderer als Cinnamomum zeylanicum Blume | 8 | 0 | |

0906192000 | Blüten des Zimtbaums | 8 | 0 | |

0906201000 | Zimt | 8 | 0 | |

0906202000 | Blüten des Zimtbaums | 8 | 0 | |

0907000000 | Gewürznelken, Mutternelken und Nelkenstiele | 8 | 0 | |

0908100000 | Muskatnüsse | 8 | 0 | |

0908200000 | Muskatblüte | 8 | 0 | |

0908300000 | Amomen und Kardamomen | 8 | 0 | |

0909100000 | Anis- und Sternanisfrüchte | 8 | 0 | |

0909200000 | Korianderfrüchte | 8 | 0 | |

0909300000 | Kreuzkümmelfrüchte | 8 | 0 | |

0909400000 | Kümmelfrüchte | 8 | 0 | |

0909500000 | Fenchelfrüchte; Wacholderbeeren | 8 | 0 | |

0910100000 | Ingwer | 377,3 % oder 931 Won/kg, je nachdem, welcher Betrag höher ist | 18 | |

0910200000 | Safran | 8 | 0 | |

0910300000 | Kurkuma | 8 | 0 | |

0910910000 | Mischungen im Sinne der Anmerkung 1 b zu diesem Kapitel | 8 | 0 | |

0910991000 | Thymian; Lorbeerblätter | 8 | 0 | |

0910992000 | Curry | 8 | 0 | |

0910999000 | andere | 8 | 0 | |

1001100000 | Hartweizen | 3 | 0 | |

1001901000 | Mengkorn | 3 | 0 | |

1001909010 | zur Aussaat | 1,8 | 0 | |

1001909020 | zu Futterzwecken | 0 | 0 | |

1001909030 | zum Mahlen | 1,8 | 0 | |

1001909090 | andere | 1,8 | 0 | |

1002001000 | zur Aussaat | 108,7 | 3 | |

1002009000 | andere | 3 | 0 | |

1003001000 | Braugerste | 513 | Siehe Anlage 2-A-1 Absatz 12 | Siehe Anhang 3 |

1003009010 | ungeschälte Gerste | 324 % oder 326 Won/kg, je nachdem, welcher Betrag höher ist | E | |

1003009020 | Nacktgerste | 299,7 % oder 361 Won/kg, je nachdem, welcher Betrag höher ist | E | |

1003009090 | andere | 299,7 | 13 | |

1004001000 | zur Aussaat | 554,8 | 5 | |

1004009000 | andere | 3 | 0 | |

1005100000 | zur Aussaat | 328 | 5 | |

1005901000 | zu Futterzwecken | 328 | 5 | |

1005902000 | Puffmais | 630 | 13 | |

1005909000 | andere | 328 | 13 | |

1006100000 | Rohreis (Paddy-Reis) | — | X | |

1006201000 | Nicht-Klebreis | — | X | |

1006202000 | Klebreis | — | X | |

1006301000 | Nicht-Klebreis | — | X | |

1006302000 | Klebreis | — | X | |

1006400000 | Bruchreis | — | X | |

1007001000 | zur Aussaat | 779,4 | 10 | |

1007009000 | andere | 3 | 0 | |

1008100000 | Buchweizen | 256,1 | 15 | |

1008201010 | zur Aussaat | 18 | 5 | |

1008201090 | andere | 3 | 0 | |

1008209000 | andere | 3 | 0 | |

1008300000 | Kanariensaat | 3 | 0 | |

1008900000 | Fremdgetreide | 800,3 | 15 | |

1101001000 | von Weizen | 4,2 | 3 | |

1101002000 | von Mengkorn | 5 | 0 | |

1102100000 | Mehl von Roggen | 5 | 0 | |

1102200000 | Mehl von Mais | 5 | 0 | |

1102901000 | Mehl von Gerste | 260 | 10 | |

1102902000 | Reismehl | — | X | |

1102909000 | andere | 800,3 | 15 | |

1103110000 | von Weizen | 288,2 | 10 | |

1103130000 | von Mais | 162,9 | 10 | |

1103191000 | von Gerste | 260 | 10 | |

1103192000 | von Hafer | 554,8 | 13 | |

1103193000 | von Reis | — | X | |

1103199000 | andere | 800,3 | 13 | |

1103201000 | von Weizen | 288,2 | 10 | |

1103202000 | von Reis | — | X | |

1103203000 | von Gerste | 260 | 10 | |

1103209000 | andere | 800,3 | 15 | |

1104120000 | von Hafer | 554,8 | 13 | |

1104191000 | von Reis | — | X | |

1104192000 | von Gerste | 233 | 10 | |

1104199000 | andere | 800,3 | 15 | |

1104220000 | von Hafer | 554,8 | 13 | |

1104230000 | von Mais | 167 | 10 | |

1104291000 | von Samen des Hiobstränengrases (Coix lacryma-jobi) | 800,3 | 15 | |

1104292000 | von Gerste | 126 | 10 | |

1104299000 | andere | 800,3 | 15 | |

1104301000 | von Reis | 5 | 10 | |

1104309000 | andere | 5 | 0 | |

1105100000 | Mehl, Grieß und Pulver | 304 | 13 | |

1105200000 | Flocken, Granulat und Pellets | 304 | 10 | |

1106100000 | von getrockneten Hülsenfrüchten der Position 0713 | 8 | 5 | |

1106201000 | von Pfeilwurz | 8 | 5 | |

1106209000 | andere | 8 | 5 | |

1106300000 | von Erzeugnissen des Kapitels 8 | 8 | 0 | |

1107100000 | nicht geröstet | 269 | Siehe Anlage 2-A-1 Absatz 12 | Siehe Anhang 3 |

1107201000 | geräuchert | 269 | 10 | |

1107209000 | andere | 27 | 5 | |

1108110000 | Weizenstärke | 50,9 | 5 | |

1108121000 | für Nahrungszwecke | 226 | 15 | |

1108129000 | andere | 226 | 15 | |

1108130000 | Kartoffelstärke | 455 | 15 | Siehe Anhang 3 |

1108141000 | für Nahrungszwecke | 455 | 15 | |

1108149000 | andere | 455 | 15 | |

1108191000 | von Süßkartoffeln | 241,2 | 15 | |

1108199000 | andere | 800,3 | 15 | |

1108200000 | Inulin | 800,3 | 15 | |

1109000000 | Kleber von Weizen, auch getrocknet | 8 | 0 | |

1201001000 | für Sojaöl und Ölkuchen | 487 % oder 956 Won/kg, je nachdem, welcher Betrag höher ist | 5 | |

1201009010 | für Sojabohnensprossen | 487 % oder 956 Won/kg, je nachdem, welcher Betrag höher ist | E | |

1201009090 | andere | 487 % oder 956 Won/kg, je nachdem, welcher Betrag höher ist | E | |

1202100000 | ungeschält | 230,5 | 18 | |

1202200000 | geschält, auch geschrotet | 230,5 | 18 | |

1203000000 | Kopra | 3 | 0 | |

1204000000 | Leinsamen, auch geschrotet | 3 | 0 | |

1205101000 | Samen für Futterpflanzen | 0 | 0 | |

1205109000 | andere | 10 | 0 | |

1205901000 | Samen für Futterpflanzen | 0 | 0 | |

1205909000 | andere | 10 | 0 | |

1206000000 | Sonnenblumenkerne, auch geschrotet | 25 | 0 | |

1207200000 | Baumwollsamen | 3 | 0 | |

1207400000 | Sesamsaat | 630 % oder 6660 Won/kg, je nachdem, welcher Betrag höher ist | 18 | |

1207500000 | Senfsamen | 3 | 0 | |

1207910000 | Mohnsamen | 3 | 0 | |

1207991000 | Perillasaat | 40 % oder 410 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

1207992000 | Sheanüsse (Karitenüsse) | 3 | 0 | |

1207993000 | Palmnüsse und -kerne | 3 | 0 | |

1207994000 | Rizinussamen | 3 | 0 | |

1207995000 | Saflorsamen | 3 | 0 | |

1207999000 | andere | 3 | 0 | |

1208100000 | von Sojabohnen | 3 | 0 | |

1208900000 | andere | 3 | 0 | |

1209100000 | Samen von Zuckerrüben | 0 | 0 | |

1209210000 | Samen von Luzernen | 0 | 0 | |

1209220000 | Samen von Klee (Trifolium-Arten) | 0 | 0 | |

1209230000 | Samen von Schwingel | 0 | 0 | |

1209240000 | Samen von Wiesenrispengras (Poa pratensis L.) | 0 | 0 | |

1209250000 | Samen von Weidelgras (Lolium multiflorum Lam., Lolium perenne L.) | 0 | 0 | |

1209291000 | Samen von Lupinen | 0 | 0 | |

1209292000 | Samen von Sudangras | 0 | 0 | |

1209293000 | Samen von Knaulgras | 0 | 0 | |

1209294000 | Samen von Wiesenlieschgras | 0 | 0 | |

1209299000 | andere | 0 | 0 | |

1209300000 | Samen von krautartigen Pflanzen, die hauptsächlich wegen der Blüten dieser Pflanzen gezogen werden | 0 | 0 | |

1209911010 | Zwiebelsamen | 0 | 0 | |

1209911090 | andere | 0 | 0 | |

1209912000 | Rettichsamen | 0 | 0 | |

1209919000 | andere | 0 | 0 | |

1209991010 | Samen von Eichen | 0 | 0 | |

1209991090 | andere | 0 | 0 | |

1209992000 | Samen von Obstbäumen | 0 | 0 | |

1209993000 | Samen von Tabakpflanzen | 0 | 0 | |

1209994000 | Rasensaat | 0 | 0 | |

1209999000 | andere | 0 | 0 | |

1210100000 | Hopfen (Blütenzapfen), weder gemahlen, sonst zerkleinert noch in Form von Pellets | 30 | 10 | |

1210201000 | Hopfenzapfen | 30 | 0 | |

1210202000 | Lupulin | 30 | 0 | |

1211201100 | roher Ginseng | 222,8 | E | |

1211201210 | Stammwurzeln | 222,8 | E | |

1211201220 | Haarwurzeln | 222,8 | E | |

1211201240 | Nebenwurzeln | 222,8 | E | |

1211201310 | Stammwurzeln | 754,3 | E | |

1211201320 | Haarwurzeln | 754,3 | E | |

1211201330 | Nebenwurzeln | 754,3 | E | |

1211202110 | Pulver | 18 | 15 | |

1211202120 | Tabletten oder Kapseln | 18 | 10 | |

1211202190 | andere | 18 | 15 | |

1211202210 | Pulver | 754,3 | 15 | Siehe Anhang 3 |

1211202220 | Tabletten oder Kapseln | 754,3 | 15 | Siehe Anhang 3 |

1211202290 | andere | 754,3 | 15 | Siehe Anhang 3 |

1211209100 | Blätter und Stängel von Ginseng | 754,3 | 15 | |

1211209200 | Ginsengsamen | 754,3 | 15 | |

1211209900 | andere | 754,3 | 15 | |

1211300000 | Cocablätter | 8 | 0 | |

1211400000 | Mohnstroh | 8 | 0 | |

1211901000 | Aconiti tuber | 8 | 0 | |

1211902000 | Coptidis rhizoma | 8 | 0 | |

1211903000 | Polygalae radix | 8 | 0 | |

1211904000 | Fritillariae roylei bulbus | 8 | 0 | |

1211905000 | Eucommiae cortex | 8 | 0 | |

1211906000 | Süßholzwurzeln | 8 | 0 | |

1211909010 | Amomi semen | 8 | 0 | |

1211909020 | Zizyphi semen | 8 | 0 | |

1211909030 | Quisqualis fructus | 8 | 0 | |

1211909040 | Longanae arillus | 8 | 0 | |

1211909050 | Crataegi fructus | 8 | 0 | |

1211909060 | Nelumbosamen | 8 | 0 | |

1211909070 | Pfefferminze | 8 | 0 | |

1211909080 | japanischer Pfeffer | 8 | 5 | |

1211909091 | Platycodon grandiflorum, getrocknet | 8 | 0 | |

1211909099 | andere | 8 | 0 | |

1212201010 | getrocknet | 20 | 5 | |

1212201020 | gekühlt | 20 | 3 | |

1212201030 | gefroren | 10 | 3 | |

1212201090 | andere | 20 | 5 | |

1212202010 | getrocknet | 20 | 10 | |

1212202020 | gesalzen | 20 | 5 | |

1212202030 | gekühlt | 20 | 5 | |

1212202040 | gefroren | 45 | 5 | |

1212202090 | andere | 20 | 5 | |

1212203010 | getrocknet | 20 | 5 | |

1212203020 | gekühlt | 20 | 5 | |

1212203030 | gefroren | 45 | 7 | |

1212203090 | andere | 20 | 3 | |

1212204010 | frisch | 20 | 3 | |

1212204020 | gekühlt | 20 | 3 | |

1212204030 | gefroren | 45 | 5 | |

1212204090 | andere | 20 | 3 | |

1212205010 | gesalzen | 20 | 5 | |

1212205020 | gekühlt | 20 | 5 | |

1212205030 | gefroren | 45 | 5 | |

1212205090 | andere | 20 | 5 | |

1212206010 | gefroren | 45 | 3 | |

1212206090 | andere | 20 | 3 | |

1212207011 | gefroren | 45 | 3 | |

1212207019 | andere | 20 | 3 | |

1212207021 | gefroren | 45 | 3 | |

1212207029 | andere | 20 | 3 | |

1212207031 | gefroren | 45 | 3 | |

1212207039 | andere | 20 | 3 | |

1212208011 | gefroren | 45 | 3 | |

1212208019 | andere | 20 | 3 | |

1212208021 | gefroren | 45 | 3 | |

1212208029 | andere | 20 | 3 | |

1212208031 | gefroren | 45 | 0 | |

1212208039 | andere | 20 | 0 | |

1212209011 | gefroren | 45 | 0 | |

1212209019 | andere | 20 | 0 | |

1212209091 | gefroren | 45 | 5 | |

1212209099 | andere | 20 | 5 | |

1212910000 | Zuckerrüben | 3 | 0 | |

1212991000 | nichtgeröstete Zichorienwurzeln der Varietät Cichorium intybus sativum | 8 | 0 | |

1212992000 | Kuyaku-Knolle | 8 | 0 | |

1212993000 | Blütenpollen | 8 | 0 | |

1212994000 | Zuckerrohr | 3 | 0 | |

1212995000 | Johannisbrot oder Johannisbrotkerne | 20 | 0 | |

1212996000 | Steine und Kerne von Aprikosen/Marillen, Pfirsichen (einschließlich Brugnolen und Nektarinen) oder Pflaumen | 8 | 0 | |

1212999000 | andere | 8 | 0 | |

1213000000 | Stroh und Spreu von Getreide, roh, auch gehäckselt, gemahlen, gepresst oder in Form von Pellets | 8 | 5 | |

1214101000 | zu Futterzwecken | 1 | 0 | |

1214109000 | andere | 10 | 0 | |

1214901000 | Wurzeln zu Futterzwecken | 100,5 | 15 | |

1214909011 | zu Futterzwecken | 1 | 5 | |

1214909019 | andere | 18 | 5 | |

1214909090 | andere | 100,5 | 15 | |

1301200000 | Gummi arabicum | 3 | 0 | |

1301901000 | Oleoresine | 3 | 0 | |

1301902010 | Schellack | 3 | 0 | |

1301902090 | andere | 3 | 0 | |

1301909000 | andere | 3 | 0 | |

1302110000 | Opium | 8 | 0 | |

1302120000 | von Süßholzwurzeln | 8 | 0 | |

1302130000 | von Hopfen | 30 | 0 | |

1302191110 | Extrakt vom weißen Ginseng | 20 | 13 | |

1302191120 | Extrakt vom weißen Ginseng, Pulver | 20 | 13 | |

1302191190 | andere | 20 | 10 | |

1302191210 | Extrakt vom roten Ginseng | 754,3 | 15 | Siehe Anhang 3 |

1302191220 | Extrakt vom roten Ginseng, Pulver | 754,3 | 15 | Siehe Anhang 3 |

1302191290 | anderer | 754,3 | 15 | Siehe Anhang 3 |

1302191900 | andere | 20 | 10 | |

1302192000 | Flüssigkeit aus Cashewnussschalen | 8 | 0 | |

1302193000 | Roher Saft des Lackbaums | 8 | 5 | |

1302199010 | Säfte und Auszüge von Aloen | 8 | 0 | |

1302199020 | Extrakt der Kolanuss | 8 | 0 | |

1302199091 | Vanille-Oleoresin oder Vanilleextrakt | 8 | 0 | |

1302199099 | andere | 8 | 0 | |

1302200000 | Pektinstoffe, Pektinate und Pektate | 8 | 0 | |

1302311000 | Agar-Agar, in Streifenform | 8 | 3 | |

1302312000 | Agar-Agar, in Pulverform | 8 | 5 | |

1302319000 | andere | 8 | 5 | |

1302320000 | Schleime und Verdickungsstoffe aus Johannisbrot, Johannisbrotkernen oder Guarsamen, auch modifiziert | 8 | 0 | |

1302390000 | andere | 8 | 0 | |

1401101000 | Bambus, Phyllostachys | 8 | 5 | |

1401102000 | Bambus, roh | 8 | 5 | |

1401109000 | andere | 8 | 5 | |

1401201000 | gespalten oder gezogen | 8 | 5 | |

1401209000 | andere | 8 | 5 | |

1401901000 | Rinde von Pfeilwurzstängeln | 8 | 5 | |

1401909000 | andere | 8 | 5 | |

1404200000 | Baumwoll-Linters | 3 | 0 | |

1404901000 | harte Samen, Kerne, Schalen und Nüsse, von der zum Schnitzen verwendeten Art (z. B. Steinnuss) | 3 | 10 | |

1404902010 | Rinde vom Papiermaulbeerbaum | 3 | 10 | |

1404902020 | Rinde von Edgeworthia papyrifera | 3 | 10 | |

1404902090 | andere | 3 | 10 | |

1404903010 | Blätter von Quercus dentata | 5 | 5 | |

1404903020 | Blätter von Smilax china | 5 | 5 | |

1404903090 | andere | 5 | 5 | |

1404904000 | pflanzliche Stoffe von der hauptsächlich zu Polsterzwecken verwendeten Art (z. B. Kapok, Pflanzenhaar und Seegras), auch in Lagen, mit oder ohne Unterlage aus anderen Stoffen | 3 | 10 | |

1404905000 | pflanzliche Stoffe von der hauptsächlich zum Herstellen von Besen, Bürsten oder Pinseln verwendeten Art (z. B. Besensorgho, Piassava, Reiswurzeln, Istel), auch in Strängen oder Bündeln | 3 | 10 | |

1404906010 | Galläpfel | 3 | 10 | |

1404906020 | Mandelschalen | 3 | 10 | |

1404906090 | andere | 3 | 10 | |

1404909000 | andere | 3 | 0 | |

1501001010 | mit einem Säurewert von 1 oder weniger | 3 | 0 | |

1501001090 | andere | 3 | 0 | |

1501002000 | Geflügelfett | 3 | 0 | |

1502001010 | mit einem Säurewert von 2 oder weniger | 2 | 0 | |

1502001090 | andere | 2 | 0 | |

1502009000 | andere | 3 | 0 | |

1503002000 | Schmalzöl | 3 | 0 | |

1503009000 | andere | 3 | 0 | |

1504101000 | Leberöl vom Hai sowie dessen Fraktionen | 3 | 3 | |

1504109000 | andere | 3 | 3 | |

1504200000 | Fette und Öle sowie deren Fraktionen, von Fischen, ausgenommen Leberöle | 3 | 5 | |

1504301000 | Walfischtran und seine Fraktionen | 3 | 0 | |

1504309000 | andere | 3 | 0 | |

1505001000 | Wollfett, roh | 3 | 0 | |

1505009000 | andere | 3 | 0 | |

1506001000 | Klauenöl sowie dessen Fraktionen | 3 | 0 | |

1506009000 | andere | 3 | 0 | |

1507100000 | rohes Öl, auch entschleimt | 5,4 | 10 | |

1507901000 | raffiniertes Öl | 5,4 | 5 | |

1507909000 | andere | 8 | 5 | |

1508100000 | rohes Öl | 27 | 7 | |

1508901000 | raffiniertes Öl | 27 | 5 | |

1508909000 | andere | 27 | 5 | |

1509100000 | nicht behandelt | 8 | 5 | |

1509900000 | andere | 8 | 0 | |

1510000000 | andere Öle und ihre Fraktionen, ausschließlich aus Oliven gewonnen, auch raffiniert, jedoch nicht chemisch modifiziert, einschließlich Mischungen dieser Öle oder Fraktionen mit Ölen oder Fraktionen der Position 1509 | 8 | 0 | |

1511100000 | rohes Öl | 3 | 0 | |

1511901000 | Palmolein | 2 | 0 | |

1511902000 | Palmstearin | 2 | 0 | |

1511909000 | andere | 2 | 0 | |

1512111000 | Sonnenblumenöl | 10 | 0 | |

1512112000 | Saffloröl | 8 | 0 | |

1512191010 | Sonnenblumenöl | 10 | 5 | |

1512191020 | Saffloröl | 8 | 0 | |

1512199010 | Sonnenblumenöl | 10 | 0 | |

1512199020 | Saffloröl | 8 | 5 | |

1512210000 | rohes Öl, auch von Gossypol befreit | 5,4 | 5 | |

1512291000 | raffiniertes Öl | 5,4 | 0 | |

1512299000 | andere | 8 | 5 | |

1513110000 | rohes Öl | 3 | 0 | |

1513191000 | raffiniertes Öl | 3 | 0 | |

1513199000 | andere | 3 | 0 | |

1513211000 | Palmkernöl | 5 | 0 | |

1513212000 | Babassuöl | 8 | 0 | |

1513291010 | Palmkernöl | 5 | 0 | |

1513291020 | Babassuöl | 8 | 0 | |

1513299000 | andere | 8 | 0 | |

1514110000 | rohes Öl | 8 | 10 | |

1514191000 | raffiniertes Öl | 10 | 5 | |

1514199000 | andere | 10 | 5 | |

1514911000 | anderes Raps- und Rübsenöl | 8 | 5 | |

1514912000 | Senföl | 30 | 5 | |

1514991010 | anderes Raps- und Rübsenöl | 10 | 5 | |

1514991020 | Senföl | 30 | 5 | |

1514999000 | andere | 10 | 5 | |

1515110000 | rohes Öl | 8 | 0 | |

1515190000 | andere | 8 | 5 | |

1515210000 | rohes Öl | 8 | 5 | |

1515290000 | andere | 8 | 5 | |

1515300000 | Rizinusöl und seine Fraktionen | 8 | 5 | |

1515500000 | Sesamöl und seine Fraktionen | 630 % oder 12060 Won/kg, je nachdem, welcher Betrag höher ist | 18 | |

1515901000 | Perillaöl und seine Fraktionen | 36 | 12 | |

1515909010 | Reiskleieöl und seine Fraktionen | 8 | 7 | |

1515909020 | Kamelienöl und seine Fraktionen | 8 | 5 | |

1515909030 | Jojobaöl und seine Fraktionen | 8 | 5 | |

1515909040 | Tungöl (Holzöl und seine Fraktionen) | 8 | 0 | |

1515909090 | andere | 8 | 5 | |

1516101000 | Rindertalg und seine Fraktionen | 8 | 0 | |

1516102000 | Walöl und seine Fraktionen | 8 | 0 | |

1516109000 | andere | 8 | 0 | |

1516201010 | Erdnussöl und seine Fraktionen | 36 | 5 | |

1516201020 | Sonnenblumenöl und seine Fraktionen | 36 | 5 | |

1516201030 | Raps- oder Rübsenöl und seine Fraktionen | 36 | 5 | |

1516201040 | Perillaöl und seine Fraktionen | 36 | 12 | |

1516201050 | Sesamöl und seine Fraktionen | 36 | 12 | |

1516202010 | Kokosöl (Kopraöl) und seine Fraktionen | 8 | 0 | |

1516202020 | Palmöl und seine Fraktionen | 8 | 0 | |

1516202030 | Maisöl und seine Fraktionen | 8 | 5 | |

1516202040 | Baumwollsamenöl und seine Fraktionen | 8 | 5 | |

1516202050 | Sojaöl und seine Fraktionen | 8 | 0 | |

1516202090 | andere | 8 | 5 | |

1517100000 | Margarine, ausgenommen flüssige Margarine | 8 | 3 | |

1517901000 | Kunstspeisefett | 8 | 0 | |

1517902000 | Backfett | 8 | 3 | |

1517909000 | andere | 8 | 5 | |

1518001000 | dehydriertes Rizinusöl | 8 | 5 | |

1518002000 | epoxidiertes Sojaöl | 8 | 5 | |

1518009000 | andere | 8 | 5 | |

1520000000 | Glycerin, roh; Glycerinwasser und Glycerinunterlaugen | 8 | 0 | |

1521101000 | Carnaubawachs | 8 | 0 | |

1521102000 | Palmwachs | 8 | 0 | |

1521109000 | andere | 8 | 0 | |

1521901000 | Walrat | 8 | 3 | |

1521902000 | Bienenwachs | 8 | 0 | |

1521909000 | andere | 8 | 0 | |

1522001010 | natürlich | 8 | 0 | |

1522001090 | andere | 8 | 0 | |

1522009000 | andere | 8 | 0 | |

1601001000 | Wurstwaren | 18 | 5 | |

1601009000 | andere | 30 | 5 | |

1602100000 | homogenisierte Zubereitungen | 30 | 15 | |

1602201000 | in luftdicht verschlossenen Behältnissen | 30 | 7 | |

1602209000 | andere | 30 | 7 | |

1602311000 | in luftdicht verschlossenen Behältnissen | 30 | 10 | |

1602319000 | andere | 30 | 7 | |

+++++ TIFF +++++

1602321010 | Samgetang | 30 | 10 | |

1602321090 | andere | 30 | 10 | |

1602329000 | andere | 30 | 10 | |

1602391000 | in luftdicht verschlossenen Behältnissen | 30 | 10 | |

1602399000 | andere | 30 | 10 | |

1602411000 | in luftdicht verschlossenen Behältnissen | 30 | 5 | |

1602419000 | andere | 27 | 5 | |

1602421000 | in luftdicht verschlossenen Behältnissen | 30 | 5 | |

1602429000 | andere | 27 | 5 | |

1602491000 | in luftdicht verschlossenen Behältnissen | 30 | 6 | |

1602499000 | andere | 27 | 5 | |

1602501000 | in luftdicht verschlossenen Behältnissen | 72 | 15 | |

1602509000 | andere | 72 | 15 | |

1602901000 | in luftdicht verschlossenen Behältnissen | 30 | 15 | |

1602909000 | andere | 30 | 15 | |

1603001000 | Extrakte von Fleisch | 30 | 10 | |

1603002000 | Säfte von Fleisch | 30 | 15 | |

1603003000 | Extrakte von Fischen | 30 | 3 | |

1603004000 | Säfte von Fischen | 30 | 3 | |

1603009000 | andere | 30 | 3 | |

1604111000 | in luftdicht verschlossenen Behältnissen | 20 | 5 | |

1604119000 | andere | 20 | 3 | |

1604121000 | in luftdicht verschlossenen Behältnissen | 20 | 5 | |

1604129000 | andere | 20 | 5 | |

1604131000 | in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1604139000 | andere | 20 | 3 | |

1604141011 | in Öl | 20 | 10 | |

1604141012 | gekocht | 20 | 10 | |

1604141019 | andere | 20 | 10 | |

1604141021 | in Öl | 20 | 10 | |

1604141022 | gekocht | 20 | 10 | |

1604141029 | andere | 20 | 10 | |

1604141031 | in Öl | 20 | 10 | |

1604141032 | gekocht | 20 | 10 | |

1604141039 | andere | 20 | 10 | |

1604149000 | andere | 20 | 10 | |

1604151000 | in luftdicht verschlossenen Behältnissen | 20 | 7 | |

1604159000 | andere | 20 | 7 | |

1604161000 | in luftdicht verschlossenen Behältnissen | 20 | 7 | |

1604169000 | andere | 20 | 7 | |

1604191010 | Makrelenhecht | 20 | 5 | |

1604191020 | Stöcker | 20 | 5 | |

1604191030 | Aale (Anguilla-Arten) | 20 | 5 | |

1604191090 | andere | 20 | 5 | |

1604199010 | Feilenfisch (Stephanolepis cirrhifer) | 20 | 3 | |

1604199090 | andere | 20 | 3 | |

1604201000 | Fischpasten | 20 | 3 | |

1604202000 | Fischmarinaden | 20 | 3 | |

1604203000 | Fischwürste | 20 | 3 | |

1604204010 | mit Krebsaroma | 20 | 3 | |

1604204090 | andere | 20 | 3 | |

1604209000 | andere | 20 | 5 | |

1604301000 | Kaviar | 20 | 3 | |

1604302000 | Kaviarersatz | 20 | 3 | |

1605101010 | in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1605101020 | geräuchert, ausgenommen in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1605101090 | andere | 20 | 3 | |

1605109000 | andere | 20 | 5 | |

1605201000 | in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1605209010 | geräuchert | 20 | 3 | |

1605209020 | paniert | 20 | 3 | |

1605209090 | andere | 20 | 5 | |

1605301000 | in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1605309000 | andere | 20 | 3 | |

1605401000 | in luftdicht verschlossenen Behältnissen | 20 | 3 | |

1605409000 | andere | 20 | 3 | |

1605901010 | Austern | 20 | 3 | |

1605901020 | Miesmuscheln | 20 | 5 | |

1605901030 | Japanische Teppichmuscheln | 20 | 5 | |

1605901040 | Herzmuscheln | 20 | 5 | |

1605901070 | Wellhornschnecken | 20 | 5 | |

1605901080 | Kalmare | 20 | 3 | |

1605901091 | Abalone | 20 | 3 | |

1605901092 | Turbanschnecken | 20 | 3 | |

1605901099 | andere | 20 | 5 | |

1605902010 | Kalmare | 20 | 10 | |

1605902020 | Wellhornschnecken | 20 | 5 | |

1605902030 | Herzmuscheln | 20 | 5 | |

1605902090 | andere | 20 | 3 | |

1605909010 | gewürzter Kalmar | 20 | 10 | |

1605909020 | Seegurken | 20 | 3 | |

1605909030 | Wellhornschnecken | 20 | 5 | |

1605909040 | Miesmuscheln | 20 | 7 | |

1605909090 | andere | 20 | 5 | |

1701111000 | mit einer Polarisation von 98,5° oder weniger | 3 | 0 | |

1701112000 | mit einer Polarisation von mehr als 98,5° | 3 | 0 | |

1701121000 | mit einer Polarisation von 98,5° oder weniger | 3 | 0 | |

1701122000 | mit einer Polarisation von mehr als 98,5° | 3 | 0 | |

1701910000 | mit Zusatz von Aroma- oder Farbstoffen | 40 | E | |

1701990000 | andere | 40 | 16-A | Siehe Anhang 3 |

1702111000 | Lactose | 49,5 | 5 | |

1702119000 | Lactosesirup | 20 | 10 | |

1702191000 | Lactose | 49,5 | 5 | |

1702199000 | Lactosesirup | 20 | 10 | |

1702201000 | Ahornzucker | 8 | 5 | |

1702202000 | Ahornsirup | 8 | 0 | |

1702301000 | Glucose | 8 | 5 | |

1702302000 | Glucosesirup | 8 | 5 | |

1702401000 | Glucose | 8 | 5 | |

1702402000 | Glucosesirup | 8 | 5 | |

1702500000 | chemisch reine Fructose | 8 | 5 | |

1702601000 | Fructose | 8 | 0 | |

1702602000 | Fructosesirup | 8 | 5 | |

1702901000 | Invertzuckercreme | 243 | 10 | |

1702902000 | Karamell | 8 | 0 | |

1702903000 | Maltose | 8 | 5 | |

1702909000 | andere | 8 | 5 | |

1703101000 | zur Herstellung alkoholhaltiger Flüssigkeiten | 3 | 10 | |

1703109000 | andere | 3 | 0 | |

1703901000 | zur Herstellung alkoholhaltiger Flüssigkeiten | 3 | 10 | |

1703909000 | andere | 3 | 0 | |

1704100000 | Kaugummi, auch mit Zucker überzogen | 8 | 5 | |

1704901000 | Süßholz-Auszug, nicht als Süßwaren angeboten | 8 | 10 | |

1704902010 | Pastillen | 8 | 5 | |

1704902020 | Bonbons | 8 | 5 | |

1704902090 | andere | 8 | 5 | |

1704909000 | andere | 8 | 5 | |

1801001000 | roh | 2 | 0 | |

1801002000 | geröstet | 8 | 0 | |

1802001000 | Kakaoschalen und Kakaohäutchen | 8 | 0 | |

1802009000 | andere | 8 | 0 | |

1803100000 | nicht entfettet | 5 | 0 | |

1803200000 | ganz oder teilweise entfettet | 5 | 0 | |

1804000000 | Kakaobutter, Kakaofett und Kakaoöl | 5 | 0 | |

1805000000 | Kakaopulver ohne Zusatz von Zucker oder anderen Süßmitteln | 5 | 0 | |

1806100000 | Kakaopulver mit Zusatz von Zucker oder anderen Süßmitteln | 8 | 0 | |

1806201000 | Schokolade und Schokoladeerzeugnisse | 8 | 5 | |

1806209010 | Zubereitungen aus Kakao mit einem Gehalt an Milchpulver von 50 GHT oder mehr | 8 | 5 | |

1806209090 | andere | 8 | 5 | |

1806311000 | Schokolade und Schokoladeerzeugnisse | 8 | 5 | |

1806319000 | andere | 8 | 5 | |

1806321000 | Schokolade und Schokoladeerzeugnisse | 8 | 5 | |

1806329000 | andere | 8 | 5 | |

1806901000 | Schokolade und Schokoladeerzeugnisse | 8 | 5 | |

1806902111 | aus zubereiteter Trockenmilch | 36 | 12 | |

1806902119 | andere | 40 | 12 | |

1806902191 | aus Hafermehl | 8 | 0 | |

1806902199 | andere | 8 | 0 | |

1806902210 | aus Gerstenmehl | 8 | 5 | |

1806902290 | andere | — | X | |

1806902910 | aus Malzextrakt | 30 | 5 | |

1806902920 | aus Lebensmittelzubereitungen aus Waren der Positionen 0401 bis 0404 | 36 | 10 | |

1806902991 | aus Hafermehl | 8 | 0 | |

1806902992 | aus Gerstenmehl | 8 | 5 | |

1806902999 | andere | — | X | |

1806903010 | aus Lebensmitteln, durch Aufblähen oder Rösten von Getreide oder Getreideerzeugnissen hergestellt | 5,4 | 0 | |

1806903091 | Reis in Form von Körnern | 8 | 10 | |

1806903099 | andere | 8 | 5 | |

1806909010 | Zubereitungen aus Kakao mit einem Gehalt an Milchpulver von 50 GHT oder mehr | 8 | 0 | |

1806909090 | andere | 8 | 0 | |

1901101010 | zubereitete Trockenmilch | 36 | Siehe Anlage 2-A-1 Absatz 13 | |

1901101090 | andere | 40 | Siehe Anlage 2-A-1 Absatz 13 | |

1901109010 | aus Hafermehl | 8 | 5 | |

1901109090 | andere | 8 | 0 | |

1901201000 | aus Reismehl | — | X | |

1901202000 | aus Gerstenmehl | 8 | 5 | |

1901209000 | andere | — | X | |

1901901000 | Malzextrakt | 30 | 5 | |

1901902000 | Lebensmittelzubereitungen aus Waren der Positionen 0401 bis 0404 | 36 | 10 | |

1901909010 | Hafermehl | 8 | 5 | |

1901909091 | aus Reismehl | — | X | |

1901909092 | aus Gerstenmehl | 8 | 0 | |

1901909099 | andere | — | X | |

1902111000 | Spaghetti | 8 | 5 | |

1902112000 | Makkaroni | 8 | 5 | |

1902119000 | andere | 8 | 5 | |

1902191000 | Nudeln | 8 | 0 | |

1902192000 | chinesische Fadennudeln | 45 % oder 355 Won/kg, je nachdem, welcher Betrag höher ist | 5 | |

+++++ TIFF +++++

1902193000 | Naeng Myun | 8 | 5 | |

1902199000 | andere | 8 | 0 | |

1902200000 | Teigwaren, gefüllt (auch gekocht oder in anderer Weise zubereitet) | 8 | 0 | |

+++++ TIFF +++++

1902301010 | Ramen | 8 | 0 | |

1902301090 | andere | 8 | 0 | |

1902309000 | andere | 8 | 0 | |

1902400000 | Couscous | 8 | 5 | |

1903001000 | Tapiokasago | 8 | 5 | |

1903009000 | andere | 8 | 5 | |

1904101000 | Cornflakes | 5,4 | 0 | |

1904102000 | Maischips | 5,4 | 0 | |

1904103000 | Puffreis | 5,4 | 5 | |

1904109000 | andere | 5,4 | 0 | |

1904201000 | aus Zubereitungen nach Art der "Müsli" | 45 | 0 | |

1904209000 | andere | 5,4 | 0 | |

1904300000 | Bulgur-Weizen | 8 | 0 | |

1904901010 | gekochter oder in Dampf gegarter Reis | 50 | 10 | |

1904901090 | andere | 8 | 10 | |

1904909000 | andere | 8 | 0 | |

1905100000 | Knäckebrot | 8 | 10 | |

1905200000 | Leb- und Honigkuchen und ähnliche Waren | 8 | 10 | |

1905310000 | Kekse und ähnliches Kleingebäck, gesüßt | 8 | 5 | |

1905320000 | Waffeln und Oblaten | 8 | 5 | |

1905400000 | Zwieback, geröstetes Brot und ähnliche geröstete Waren | 8 | 5 | |

1905901010 | Brot | 8 | 5 | |

1905901020 | Schiffszwieback | 8 | 10 | |

1905901030 | Backwaren und Kuchen | 8 | 5 | |

1905901040 | Kleingebäck, Kekse und Cracker | 8 | 5 | |

1905901050 | Backwaren aus Reis | 8 | 0 | |

1905901090 | andere | 8 | 5 | |

1905909010 | leere Oblatenkapseln von der für Arzneiwaren verwendeten Art | 8 | 10 | |

1905909020 | Reispapier | 8 | 5 | |

1905909090 | andere | 8 | 0 | |

2001100000 | Gurken und Cornichons | 30 | 0 | |

2001901000 | Früchte und Nüsse | 30 | 0 | |

2001909010 | Schalotten | 30 | 5 | |

2001909020 | Tomaten/Paradeiser | 30 | 5 | |

2001909030 | Blumenkohl/Karfiol | 30 | 5 | |

2001909040 | Zuckermais | 30 | 5 | |

2001909050 | eingelegte Schalotten (Rakkyo) | 30 | 5 | |

2001909060 | Knoblauch | 30 | 10 | |

2001909070 | Zwiebeln | 30 | 5 | |

2001909090 | andere | 30 | 5 | |

2002100000 | Tomaten, ganz oder in Stücken | 8 | 0 | |

2002901000 | Tomatenpaste (mit einem löslichen festen Bestandteil von 24 % oder mehr) | 5 | 0 | |

2002909000 | andere | 8 | 0 | |

2003104000 | Zuchtchampignons (Agaricus bisporus) | 20 | 0 | |

2003109000 | andere | 20 | 7 | |

2003200000 | Trüffeln | 20 | 10 | |

2003901000 | Shiitake-Pilze | 20 | 15 | |

2003902000 | Matsutake-Pilze | 20 | 15 | |

2003909000 | andere | 20 | 0 | |

2004100000 | Kartoffeln | 18 | 0 | |

2004901000 | Zuckermais | 30 | 5 | |

2004909000 | andere | 30 | 0 | |

2005101000 | pürierter Mais zur Ernährung von Kindern | 20 | 5 | |

2005109000 | andere | 20 | 5 | |

2005201000 | aus Flocken zubereitete Kroketten | 20 | 7 | |

2005209000 | andere | 20 | 5 | |

2005400000 | Erbsen (Pisum sativum) | 20 | 5 | |

2005511000 | aus Mungobohnen | 20 | 5 | |

2005512000 | aus Adzukibohnen | 20 | 5 | |

2005519000 | andere | 20 | 5 | |

2005591000 | aus Mungobohnen | 20 | 5 | |

2005592000 | aus Adzukibohnen | 20 | 5 | |

2005599000 | andere | 20 | 5 | |

2005600000 | Spargel | 20 | 10 | |

2005700000 | Oliven | 20 | 5 | |

2005800000 | Zuckermais (Zea mays var. saccharata) | 15 | 5 | |

2005910000 | Bambussprossen | 20 | 10 | |

+++++ TIFF +++++

2005991000 | Kimchi | 20 | 5 | |

2005992000 | Sauerkraut | 20 | 0 | |

2005999000 | andere | 20 | 0 | |

2006001000 | glasierte Maronen | 30 | 15 | |

2006002000 | Ananas | 30 | 5 | |

2006003000 | Ingwer | 30 | 5 | |

2006004000 | Lotuswurzeln | 30 | 5 | |

2006005000 | Erbsen (Pisum sativum) | 20 | 5 | |

2006006010 | Bohnen, ausgelöst | 20 | 5 | |

2006006090 | andere | 20 | 5 | |

2006007000 | Spargel | 20 | 5 | |

2006008000 | Oliven | 20 | 5 | |

2006009010 | Zuckermais (Zea mays var. saccharata) | 15 | 0 | |

2006009020 | Bambussprossen | 20 | 7 | |

2006009030 | aus anderem Gemüse | 20 | 5 | |

2006009090 | andere | 30 | 5 | |

2007100000 | homogenisierte Zubereitungen | 30 | 5 | |

2007911000 | Konfitüren, Fruchtgelees, Marmeladen | 30 | 5 | |

2007919000 | andere | 30 | 5 | |

2007991000 | Konfitüren, Fruchtgelees, Marmeladen | 30 | 7 | |

2007999000 | andere | 30 | 5 | |

2008111000 | Erdnussbutter | 50 | 10 | |

2008119000 | andere | 63,9 | 10 | |

2008191000 | Esskastanien/Maronen | 50 | 15 | |

2008192000 | Kokosnuss | 45 | 0 | |

2008199000 | andere | 45 | 7 | |

2008200000 | Ananas | 45 | 5 | |

2008301000 | Citrus junos | 45 | 5 | |

2008309000 | andere | 45 | 5 | |

2008400000 | Birnen | 45 | 7 | |

2008500000 | Aprikosen/Marillen | 45 | 0 | |

2008600000 | Kirschen | 45 | 7 | |

2008701000 | in luftdicht verschlossenen Behältnissen, mit Zusatz von Zucker | 50 | 7 | |

2008709000 | andere | 45 | 5 | |

2008800000 | Erdbeeren | 45 | 7 | |

2008910000 | Palmherzen | 45 | 10 | |

2008921010 | in luftdicht verschlossenen Behältnissen, mit Zusatz von Zucker | 50 | 5 | |

2008921090 | andere | 45 | 5 | |

2008922000 | Obstsalat | 45 | 5 | |

2008929000 | andere | 45 | 5 | |

2008991000 | Trauben | 45 | 5 | |

2008992000 | Äpfel | 45 | 5 | |

2008993000 | Puffmais | 45 | 7 | |

2008999000 | andere | 45 | 10 | |

2009110000 | gefroren | 54 | 3 | |

2009120000 | nicht gefroren, mit einem Brixwert von 20 oder weniger | 54 | 5 | |

2009190000 | andere | 54 | 3 | |

2009210000 | mit einem Brixwert von 20 oder weniger | 30 | 10 | |

2009290000 | andere | 30 | 7 | |

2009311000 | Zitronensaft | 50 | 5 | |

2009312000 | Limettensaft | 50 | 5 | |

2009319000 | andere | 54 | 10 | |

2009391000 | Zitronensaft | 50 | 7 | |

2009392000 | Limettensaft | 50 | 5 | |

2009399000 | andere | 54 | 10 | |

2009410000 | mit einem Brixwert von 20 oder weniger | 50 | 5 | |

2009490000 | andere | 50 | 5 | |

2009500000 | Tomatensaft | 30 | 5 | |

2009610000 | mit einem Brixwert von 30 oder weniger | 45 | 0 | |

2009690000 | andere | 45 | 0 | |

2009710000 | mit einem Brixwert von 20 oder weniger | 45 | 10 | |

2009790000 | andere | 45 | 7 | |

2009801010 | Pfirsichsaft | 50 | 10 | |

2009801020 | Erdbeersaft | 50 | 10 | |

2009801090 | andere | 50 | 7 | |

2009802000 | Gemüsesaft | 30 | 5 | |

2009901010 | vorwiegend auf der Grundlage von Orangensaft | 50 | 7 | |

2009901020 | vorwiegend auf der Grundlage von Apfelsaft | 50 | 10 | |

2009901030 | vorwiegend auf der Grundlage von Traubensaft | 50 | 12 | |

2009901090 | andere | 50 | 7 | |

2009902000 | von Gemüse | 30 | 0 | |

2009909000 | andere | 50 | 10 | |

2101110000 | Auszüge, Essenzen und Konzentrate | 8 | 5 | |

2101121000 | löslicher Kaffee | 8 | 5 | |

2101129010 | Milch, Rahm oder deren Ersatzstoffe enthaltend | 8 | 5 | |

2101129090 | andere | 8 | 5 | |

2101201000 | Zucker, Zitrone oder deren Ersatzstoffe enthaltend | 40 | 7 | |

2101209000 | andere | 40 | 7 | |

2101301000 | von Gerste | 8 | 5 | |

2101309000 | andere | 8 | 5 | |

2102101000 | Bierhefen | 8 | 0 | |

2102102000 | Brennereihefen | 8 | 10 | |

2102103000 | Backhefen | 8 | 5 | |

2102104000 | ausgewählte Mutterhefen (Hefekulturen) | 8 | 0 | |

2102109000 | andere | 8 | 5 | |

2102201000 | Hefen, nicht lebend | 8 | 5 | |

+++++ TIFF +++++

2102202000 | Nulook | 8 | 10 | |

2102203010 | in Form von Tabletten | 8 | 0 | |

2102203090 | andere | 8 | 0 | |

2102204010 | in Form von Tabletten | 8 | 0 | |

2102204090 | andere | 8 | 5 | |

2102209000 | andere | 8 | 5 | |

2102300000 | zubereitete Backtriebmittel in Pulverform | 8 | 0 | |

2103100000 | Sojasoße | 8 | 5 | |

2103201000 | Tomatenketchup | 8 | 0 | |

2103202000 | Tomatensoßen | 45 | 0 | |

2103301000 | Senfmehl | 8 | 0 | |

2103302000 | Senf (einschließlich zubereitetes Senfmehl) | 8 | 0 | |

2103901010 | Bohnenpaste | 8 | 10 | |

2103901020 | chinesische Bohnenpaste | 8 | 10 | |

2103901030 | scharfe Bohnenpaste | 45 | 5 | |

2103901090 | andere | 45 | 5 | |

2103909010 | Mayonnaise | 8 | 10 | |

2103909020 | Instant-Curry | 45 | 5 | |

2103909030 | zusammengesetzte Würzmittel | 45 | 15 | |

+++++ TIFF +++++

2103909040 | Maejoo | 16 % oder 64 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

2103909090 | andere | 45 | 15 | |

2104101000 | aus Fleisch | 18 | 7 | |

2104102000 | aus Fisch | 30 | 5 | |

2104103000 | aus Gemüse | 18 | 5 | |

2104109000 | andere | 18 | 5 | |

2104200000 | zusammengesetzte homogenisierte Lebensmittelzubereitungen | 30 | 5 | |

2105001010 | nicht kakaohaltig | 8 | 7 | |

2105001090 | andere | 8 | 7 | |

2105009010 | nicht kakaohaltig | 8 | 5 | |

2105009090 | andere | 8 | 5 | |

2106101000 | Bohnenquark | 8 | 5 | |

2106109010 | mit einem Proteingehalt von nicht weniger als 48 GHT | 8 | 0 | |

2106109090 | andere | 8 | 0 | |

2106901010 | Grundlage für Cola | 8 | 0 | |

2106901020 | Grundlage für Getränke aus Fruchtaromen | 8 | 5 | |

2106901090 | andere | 8 | 0 | |

2106902000 | Zuckersirupe, aromatisiert oder gefärbt | 8 | 0 | |

2106903011 | Ginsengtee | 8 | 10 | |

2106903019 | andere | 8 | 0 | |

2106903021 | roter Ginsengtee | 754,3 | 10 | |

2106903029 | andere | 754,3 | 10 | |

2106904010 | Gim-Algen (Porphyra) | 8 | 5 | |

2106904090 | andere | 8 | 5 | |

2106909010 | Kaffeeweisser | 8 | 5 | |

2106909020 | Zubereitungen auf der Grundlage von Butter | 8 | 7 | |

2106909030 | Zubereitungen zur Verwendung bei der Herstellung von Eiscreme | 8 | 5 | |

2106909040 | autolysierte Hefe und andere Hefeextrakte | 8 | 5 | |

2106909050 | Aromen in Zubereitungen | 8 | 5 | |

2106909060 | Eichelmehl | 8 | 5 | |

2106909070 | Zubereitungen auf der Grundlage von Aloe | 8 | 5 | |

2106909080 | Zubereitungen (ausgenommen solche auf der Basis von Riechstoffen) der zum Herstellen von Getränken verwendeten Art mit einem Alkoholgehalt von mehr als 0,5 % vol. | 30 | 5 | |

2106909091 | Zubereitungen aus Gelée royale und Honig | 8 | 10 | |

2106909099 | andere | 8 | 3 | |

2201100000 | Mineralwasser und kohlensäurehaltiges Wasser | 8 | 5 | |

2201901000 | Eis und Schnee | 8 | 10 | |

2201909000 | andere | 8 | 0 | |

2202101000 | gefärbt | 8 | 0 | |

2202109000 | andere | 8 | 0 | |

2202901000 | Getränke auf der Grundlage von Ginseng | 8 | 5 | |

2202902000 | Getränke aus Fruchtsaft | 9 | 0 | |

+++++ TIFF +++++

2202903000 | Sikye | 8 | 10 | |

2202909000 | andere | 8 | 5 | |

2203000000 | Bier aus Malz | 30 | 7 | |

2204100000 | Schaumwein | 15 | 0 | |

2204211000 | Rotwein | 15 | 0 | |

2204212000 | Weißwein | 15 | 0 | |

2204219000 | andere | 15 | 0 | |

2204291000 | Rotwein | 15 | 0 | |

2204292000 | Weißwein | 15 | 0 | |

2204299000 | andere | 15 | 0 | |

2204300000 | anderer Traubenmost | 30 | 0 | |

2205100000 | in Behältnissen von nicht mehr als 2 l | 15 | 10 | |

2205900000 | andere | 15 | 10 | |

2206001010 | Apfelwein | 15 | 0 | |

2206001020 | Birnenwein | 15 | 0 | |

2206001090 | andere | 15 | 0 | |

+++++ TIFF +++++

2206002010 | Cheongju | 15 | 0 | |

+++++ TIFF +++++

2206002020 | Yakju | 15 | 0 | |

+++++ TIFF +++++

2206002030 | Takju | 15 | 0 | |

2206002090 | andere | 15 | 0 | |

2206009010 | Bowle (unter Zusatz von Erzeugnissen der Position 2009 oder 2202, einschließlich aus Trauben hergestellt) | 15 | 0 | |

2206009090 | andere | 15 | 0 | |

2207101000 | Rohbrand für Getränke | 10 | 15 | |

2207109010 | vergorener Alkohol für die Herstellung von Spirituosen | 270 | 15 | Siehe Anhang 3 |

2207109090 | andere | 30 | 5 | |

2207200000 | Ethylalkohol und Branntwein mit beliebigem Alkoholgehalt, vergällt | 8 | 0 | |

2208201000 | Cognac | 15 | 5 | |

2208209000 | andere | 15 | 5 | |

2208301000 | "Scotch"-Whisky | 20 | 3 | |

2208302000 | "Bourbon"-Whisky | 20 | 3 | |

2208303000 | "Rye"-Whisky | 20 | 5 | |

2208309000 | andere | 20 | | |

–Irish Whisky | 20 | 3 | |

–andere | 20 | 5 | |

2208400000 | Rum und anderer Branntwein, gewonnen durch Destillieren vergorener Zuckerrohrerzeugnisse | 20 | 5 | |

2208500000 | Gin und Genever | 20 | 5 | |

2208600000 | Wodka | 20 | 5 | |

2208701000 | Ginsengwein | 20 | 0 | |

+++++ TIFF +++++

2208702000 | Ogarpi-Wein | 20 | 10 | |

2208709000 | andere | 20 | 5 | |

2208901000 | Branntweine, ausgenommen solche der Unterposition 2208 20 | 20 | 10 | |

+++++ TIFF +++++

2208904000 | Soju | 30 | 0 | |

2208906000 | Kaoliang-Wein | 30 | 5 | |

2208907000 | Tequila | 20 | 5 | |

2208909000 | andere | 30 | 5 | |

2209001000 | Bieressig | 8 | 5 | |

2209009000 | andere | 8 | 5 | |

2301101000 | Mehl und Pellets von Fleisch oder von Schlachtnebenerzeugnissen | 9 | 7 | |

2301102000 | Grieben/Grammeln | 5 | 0 | |

2301201000 | Mehl und Pellets von Fischen | 5 | 5 | |

2301209000 | andere | 5 | 3 | |

2302100000 | von Mais | 5 | 0 | |

2302300000 | von Weizen | 2 | 0 | |

2302401000 | von Reis | 5 | 0 | |

2302409000 | andere | 5 | 0 | |

2302500000 | von Hülsenfrüchten | 5 | 0 | |

2303100000 | Rückstände aus der Stärkegewinnung und ähnliche Rückstände | 0 | 0 | |

2303200000 | Ausgelaugte Rübenschnitzel, Bagasse und andere Abfälle aus der Zuckergewinnung | 5 | 0 | |

2303300000 | Treber, Schlempen und Abfälle aus Brauereien oder Brennereien | 5 | 0 | |

2304000000 | Ölkuchen und andere feste Rückstände aus der Gewinnung von Sojaöl, auch gemahlen oder in Form von Pellets | 1,8 | 0 | |

2305000000 | Ölkuchen und andere feste Rückstände aus der Gewinnung von Erdnussöl, auch gemahlen oder in Form von Pellets | 5 | 0 | |

2306100000 | aus Baumwollsamen | 2 | 0 | |

2306200000 | aus Leinsamen | 5 | 0 | |

2306300000 | aus Sonnenblumenkernen | 5 | 0 | |

2306410000 | aus erucasäurearmen Raps- oder Rübsensamen | 0 | 0 | |

2306490000 | andere | 0 | 0 | |

2306500000 | aus Kokosnüssen (Kopra) | 2 | 0 | |

2306600000 | aus Palmnüssen oder Palmkernen | 2 | 0 | |

2306901000 | aus Sesamsamen | 63 % oder 72 Won/kg, je nachdem, welcher Betrag höher ist | 10 | |

2306902000 | aus Perillasamen | 5 | 0 | |

2306903000 | aus Maiskeimen | 5 | 0 | |

2306909000 | andere | 5 | 0 | |

2307000000 | Weintrub/Weingeläger; Weinstein, roh | 5 | 0 | |

2308001000 | Eicheln | 5 | 10 | |

2308002000 | Rosskastanien | 5 | 10 | |

2308003000 | Baumwollsamenschalen | 5 | 0 | |

2308009000 | andere | 46,4 | 10 | |

2309100000 | Hunde- und Katzenfutter, in Aufmachungen für den Einzelverkauf | 5 | 0 | |

2309901010 | für Schweine | 4,2 | 0 | |

2309901020 | für Hühner | 4,2 | 0 | |

2309901030 | für Fische | 5 | 0 | |

2309901040 | für Rinder | 4,2 | 0 | |

2309901091 | aus Milchaustauscher | 71 | 10 | |

2309901099 | andere | 5 | 0 | |

2309902010 | vorwiegend auf der Grundlage anorganischer Stoffe oder Mineralien (ausgenommen Stoffe vorwiegend auf der Grundlage von Mikromineralien) | 50,6 | Siehe Anlage 2-A-1 Absatz 14 | |

2309902020 | vorwiegend auf der Grundlage von Aromastoffen | 50,6 | Siehe Anlage 2-A-1 Absatz 14 | |

2309902091 | Importerzeugnisse mit automatischer Genehmigung seit 31. Dezember 1994: 1.Peckmor, sessalom, calfnectar und pignectar von FCA Feed flavor starter (conc.)2.FCA Feed nectars (conc.)3.FCA Feed protanox4.FCA Encila (conc.)5.FCA Sugar mate6.Poultry, fish, mineral, calf, hy sugar and cheese von FFI Ade (conc.)7.Pig, hog, cattle, dairy, beef and kanine von FFI Krave (conc.)8.Pig and fresh von FFI Arome (conc., 2X)9.Pecuaroma-poultry | 5 | 0 | |

2309902099 | andere | 50,6 | Siehe Anlage 2-A-1 Absatz 14 | |

2309903010 | vorwiegend auf der Grundlage von Antibiotika | 5 | 0 | |

2309903020 | vorwiegend auf der Grundlage von Vitaminen | 5 | 0 | |

2309903030 | vorwiegend auf der Grundlage von Mikromineralien | 5 | 0 | |

2309903090 | andere | 5 | 0 | |

2309909000 | andere | 50,6 | Siehe Anlage 2-A-1 Absatz 14 | |

2401101000 | "flue-cured" | 20 | 10 | |

2401102000 | Burley | 20 | 10 | |

2401103000 | Orienttabak | 20 | 10 | |

2401109000 | andere | 20 | 10 | |

2401201000 | "flue-cured" | 20 | 10 | |

2401202000 | Burley | 20 | 10 | |

2401203000 | Orienttabak | 20 | 10 | |

2401209000 | andere | 20 | 10 | |

2401301000 | Stängel | 20 | 10 | |

2401302000 | Abfälle | 20 | 10 | |

2401309000 | andere | 20 | 10 | |

2402101000 | Zigarren | 40 | 10 | |

2402102000 | Stumpen | 40 | 10 | |

2402103000 | Zigarillos | 40 | 10 | |

2402201000 | Filterzigaretten | 40 | 15 | |

2402209000 | andere | 40 | 15 | |

2402900000 | andere | 40 | 10 | |

2403101000 | Pfeifentabak | 40 | 10 | |

2403109000 | andere | 40 | 10 | |

2403911000 | Tabakblätter | 32,8 | 10 | |

2403919000 | andere | 40 | 10 | |

2403991000 | Kautabak | 40 | 10 | |

2403992000 | Schnupftabak | 40 | 10 | |

2403993000 | Tabakauszüge und Tabaksoßen | 40 | 10 | |

2403999000 | andere | 40 | 10 | |

2501001010 | Steinsalz | 1 | 0 | |

2501001020 | Meersalz, durch Sonnenwärme erzeugt | 1 | 0 | |

2501009010 | Speisesalz | 8 | 0 | |

2501009020 | reines Natriumchlorid | 8 | 3 | |

2501009090 | andere | 8 | 3 | |

2502000000 | Schwefelkies, nicht geröstet | 2 | 0 | |

2503000000 | Schwefel aller Art, ausgenommen sublimierter Schwefel, gefällter Schwefel und kolloider Schwefel | 2 | 0 | |

2504101000 | natürlicher Grafit, kristallin | 3 | 0 | |

2504102000 | natürlicher Grafit, amorph | 3 | 0 | |

2504109000 | andere | 3 | 0 | |

2504901000 | natürlicher Grafit, kristallin | 3 | 0 | |

2504902000 | natürlicher Grafit, amorph | 3 | 0 | |

2504909000 | andere | 3 | 0 | |

2505100000 | kieselsaure Sande und Quarzsande | 3 | 0 | |

2505901010 | tonhaltiger Sand | 3 | 0 | |

2505901020 | feldspathaltiger Sand | 3 | 0 | |

2505901090 | andere | 3 | 0 | |

2505909000 | andere | 3 | 0 | |

2506101000 | weniger als 0,06 % Verunreinigungen enthaltend | 3 | 0 | |

2506102000 | nicht weniger als 0,06 % und nicht mehr als 0,1 % Verunreinigungen enthaltend | 3 | 0 | |

2506103000 | mehr als 0,1 % Verunreinigungen enthaltend | 3 | 0 | |

2506201000 | roh oder grob behauen | 3 | 0 | |

2506209000 | andere | 3 | 0 | |

2507001010 | nicht gebrannt | 3 | 0 | |

2507001090 | andere | 3 | 0 | |

2507002010 | Gairome-Ton | 3 | 0 | |

2507002020 | Kibushi-Ton | 3 | 0 | |

2507002090 | andere | 3 | 0 | |

2507009000 | andere | 3 | 0 | |

2508100000 | Bentonit | 3 | 0 | |

2508300000 | feuerfester Ton und Lehm | 3 | 0 | |

2508401000 | saurer Ton | 3 | 0 | |

2508402000 | Bleicherde und Fullererde | 3 | 0 | |

2508409000 | andere | 3 | 0 | |

2508501000 | Andalusit | 3 | 0 | |

2508502000 | Cyanit | 3 | 0 | |

2508503000 | Sillimanit | 3 | 0 | |

2508600000 | Mullit | 3 | 0 | |

2508701000 | Schamotte-Körnungen | 3 | 0 | |

2508702000 | Ton-Dinasmassen | 3 | 0 | |

2509000000 | Kreide | 3 | 0 | |

2510101000 | natürliche Calciumphosphate | 0 | 0 | |

2510102000 | natürliche Aluminiumcalciumphosphate | 1 | 0 | |

2510109000 | andere | 1 | 0 | |

2510201000 | natürliche Calciumphosphate | 3 | 0 | |

2510202000 | natürliche Aluminiumcalciumphosphate | 3 | 0 | |

2510209000 | andere | 3 | 0 | |

2511100000 | natürliches Bariumsulfat (Baryt) | 3 | 0 | |

2511200000 | natürliches Bariumcarbonat (Witherit), auch gebrannt | 3 | 0 | |

2512000000 | kieselsäurehaltige Fossilienmehle (z. B. Kieselgur, Tripel und Diatomit) und ähnliche kieselsäurehaltige Erden, auch gebrannt, mit einem Schüttgewicht von 1 oder weniger | 3 | 0 | |

2513101000 | roh oder in unregelmäßigen Stücken, einschließlich gebrochener Bimsstein (Bimskies) | 3 | 0 | |

2513109000 | andere | 3 | 0 | |

2513201010 | Schmirgel | 3 | 0 | |

2513201020 | natürlicher Korund | 3 | 0 | |

2513201030 | natürlicher Granat | 3 | 0 | |

2513201090 | andere | 3 | 0 | |

2513202010 | Schmirgel | 3 | 0 | |

2513202020 | natürlicher Korund | 3 | 0 | |

2513202030 | natürlicher Granat | 3 | 0 | |

2513202090 | andere | 3 | 0 | |

2514001000 | roh oder grob behauen | 3 | 3 | |

2514009000 | andere | 3 | 3 | |

2515111000 | Marmor | 3 | 0 | |

2515112000 | Travertin | 3 | 0 | |

2515121000 | Marmor | 3 | 0 | |

2515122000 | Travertin | 3 | 0 | |

2515200000 | Ecaussine und andere Werksteine aus Kalkstein; Alabaster | 3 | 0 | |

2516110000 | roh oder grob behauen | 3 | 3 | |

2516120000 | durch Sägen oder auf andere Weise lediglich zerteilt, in Blöcken oder in quadratischen oder rechteckigen Platten | 3 | 3 | |

2516201000 | roh oder grob behauen | 3 | 3 | |

2516209000 | durch Sägen oder auf andere Weise lediglich zerteilt, in Blöcken oder in quadratischen oder rechteckigen Platten | 3 | 3 | |

2516901000 | roh oder grob behauen | 3 | 3 | |

2516909000 | andere | 3 | 3 | |

2517101000 | Kies | 3 | 0 | |

2517102000 | zerkleinerte Steine | 3 | 0 | |

2517109000 | andere | 3 | 0 | |

2517200000 | Makadam aus Schlacken und ähnlichen Industrieabfällen, auch mit den in der Unterposition 2517 10 aufgeführten Stoffen vermischt | 3 | 0 | |

2517300000 | Teermakadam | 3 | 0 | |

2517410000 | aus Marmor | 3 | 0 | |

2517491000 | aus Basalt | 3 | 3 | |

2517492000 | aus Granit | 3 | 3 | |

2517499000 | andere | 3 | 3 | |

2518100000 | Dolomit, weder gebrannt noch gesintert | 3 | 0 | |

2518200000 | Dolomit, gebrannt oder gesintert | 3 | 0 | |

2518300000 | Dolomitstampfmasse | 3 | 0 | |

2519100000 | natürliches Magnesiumcarbonat (Magnesit) | 3 | 0 | |

2519901000 | geschmolzene Magnesia und totgebrannte (gesinterte) Magnesia | 3 | 0 | |

2519902000 | natürliches Magnesiumoxid | 3 | 0 | |

2519909000 | andere | 3 | 0 | |

2520101000 | Gipsstein | 5 | 0 | |

2520102000 | Anhydrit | 5 | 0 | |

2520201000 | besonders gebrannt oder fein gemahlen, von der in der Zahnheilkunde verwendeten Art | 5 | 0 | |

2520209000 | andere | 5 | 0 | |

2521001000 | Kalkstein | 3 | 0 | |

2521009000 | andere | 3 | 0 | |

2522100000 | Luftkalk, ungelöscht | 3 | 0 | |

2522200000 | Luftkalk, gelöscht | 3 | 0 | |

2522300000 | hydraulischer Kalk | 3 | 0 | |

2523100000 | Zementklinker | 5 | 0 | |

2523210000 | weißer Zement, auch künstlich gefärbt | 5 | 0 | |

2523290000 | andere | 5 | 5 | |

2523300000 | Tonerdezement | 8 | 5 | |

2523901000 | Hochofenzement | 5 | 0 | |

2523909000 | andere | 5 | 5 | |

2524100000 | Krokydolith | 5 | 0 | |

2524901000 | Amosit | 5 | 0 | |

2524902000 | Chrysotil | 5 | 0 | |

2524909000 | andere | 5 | 0 | |

2525100000 | Glimmer, roh oder in ungleichmäßige Blätter oder Scheiben gespalten | 3 | 0 | |

2525200000 | Glimmerpulver | 3 | 0 | |

2525300000 | Glimmerabfall | 3 | 0 | |

2526101000 | natürlicher Speckstein und Talk, auch grob behauen oder durch Sägen oder auf andere Weise lediglich zerteilt, in Blöcken oder quadratischen oder rechteckigen Platten | 3 | 0 | |

2526109000 | andere | 3 | 0 | |

2526200000 | gemahlen oder sonst zerkleinert | 5 | 0 | |

2528100000 | natürliche Natriumborate und ihre Konzentrate (auch calciniert) | 3 | 0 | |

2528901000 | Calciumborate | 3 | 0 | |

2528902000 | Magnesiumchlorborat | 3 | 0 | |

2528903000 | natürliche Borsäure | 3 | 0 | |

2528909000 | andere | 3 | 0 | |

2529100000 | Feldspat | 3 | 0 | |

2529211000 | Pulver | 2 | 0 | |

2529219000 | andere | 2 | 0 | |

2529221000 | Pulver | 2 | 0 | |

2529229000 | andere | 2 | 0 | |

2529301000 | Leuzit | 2 | 0 | |

2529302000 | Nephelin | 2 | 0 | |

2529303000 | Nephelinsyenit | 2 | 0 | |

2530101000 | Vermiculit | 3 | 0 | |

2530102000 | Perlit und Chlorite | 3 | 0 | |

2530200000 | Kieserit und Epsomit (natürliche Magnesiumsulfate) | 3 | 0 | |

2530901000 | natürliche Arsensulfide | 3 | 0 | |

2530902000 | Pyrolusit (Manganerz), zur Herstellung von Trockenbatterien | 3 | 0 | |

2530903000 | Strontianit | 3 | 0 | |

2530904000 | Zinnober | 3 | 0 | |

2530905000 | Pyrophyllit | 3 | 0 | |

2530906000 | Zeolithe | 3 | 0 | |

2530907000 | Alunite | 3 | 0 | |

2530908000 | Wollastonite | 3 | 0 | |

2530909010 | Keramikstein | 3 | 0 | |

2530909020 | Sericite | 3 | 0 | |

2530909030 | Farberden | 8 | 0 | |

2530909040 | natürlicher Eisenglimmer | 8 | 0 | |

2530909050 | natürlicher Kryolith und natürlicher Chiolith | 3 | 0 | |

2530909091 | natürliches Calciumcarbonat | 3 | 0 | |

2530909099 | andere | 3 | 0 | |

2601111000 | roter Hämatit | 0 | 0 | |

2601112000 | Magnetit | 0 | 0 | |

2601119000 | andere | 0 | 0 | |

2601121000 | roter Hämatit | 0 | 0 | |

2601122000 | Magnetit | 0 | 0 | |

2601129000 | andere | 0 | 0 | |

2601200000 | Schwefelkiesabbrände | 1 | 0 | |

2602000000 | Manganerze und ihre Konzentrate, einschließlich eisenhaltige Manganerze und ihre Konzentrate, mit einem Gehalt an Mangan von 20 GHT oder mehr, bezogen auf die Trockenmasse | 0 | 0 | |

2603000000 | Kupfererze und ihre Konzentrate | 0 | 0 | |

2604000000 | Nickelerze und ihre Konzentrate | 0 | 0 | |

2605000000 | Cobalterze und ihre Konzentrate | 0 | 0 | |

2606000000 | Aluminiumerze und ihre Konzentrate | 0 | 0 | |

2607000000 | Bleierze und ihre Konzentrate | 0 | 0 | |

2608000000 | Zinkerze und ihre Konzentrate | 0 | 0 | |

2609000000 | Zinnerze und ihre Konzentrate | 0 | 0 | |

2610000000 | Chromerze und ihre Konzentrate | 0 | 0 | |

2611001000 | Wolframit | 0 | 0 | |

2611002000 | Scheelit | 0 | 0 | |

2611009000 | andere | 0 | 0 | |

2612100000 | Uranerze und ihre Konzentrate | 0 | 0 | |

2612200000 | Thoriumerze und ihre Konzentrate | 0 | 0 | |

2613100000 | geröstet | 0 | 0 | |

2613900000 | andere | 0 | 0 | |

2614001000 | Rutil | 0 | 0 | |

2614002000 | Anatas | 0 | 0 | |

2614009000 | andere | 0 | 0 | |

2615100000 | Zirkonerze und ihre Konzentrate | 0 | 0 | |

2615901000 | Niobiumerze und ihre Konzentrate | 0 | 0 | |

2615902000 | Tantalerze und ihre Konzentrate | 0 | 0 | |

2615903000 | Vanadiumerze und ihre Konzentrate | 0 | 0 | |

2616100000 | Silbererze und ihre Konzentrate | 0 | 0 | |

2616901000 | Golderze und ihre Konzentrate | 0 | 0 | |

2616902000 | Platinerze und ihre Konzentrate (einschließlich Erze und Konzentrate der Platingruppe) | 0 | 0 | |

2617100000 | Antimonerze und ihre Konzentrate | 0 | 0 | |

2617901000 | Quecksilbererze und ihre Konzentrate | 0 | 0 | |

2617902000 | Germaniumerze und ihre Konzentrate | 0 | 0 | |

2617903000 | Berylliumerze und ihre Konzentrate | 0 | 0 | |

2617904000 | Wismuterze und ihre Konzentrate | 0 | 0 | |

2617909000 | andere | 0 | 0 | |

2618000000 | granulierte Schlacke (Schlackensand) aus der Eisen- und Stahlherstellung | 2 | 0 | |

2619001010 | Hochofenschlacke | 2 | 0 | |

2619001090 | andere | 2 | 0 | |

2619002000 | Schlacken | 2 | 0 | |

2619003000 | Zunder | 2 | 0 | |

2619009000 | andere | 2 | 0 | |

2620110000 | Hartzinkabfälle | 2 | 0 | |

2620190000 | andere | 2 | 0 | |

2620210000 | Schlämme von bleihaltigem Benzin und Schlämme von bleihaltigen Antiklopfmitteln | 2 | 0 | |

2620290000 | andere | 2 | 0 | |

2620300000 | überwiegend Kupfer enthaltend | 2 | 0 | |

2620400000 | überwiegend Aluminium enthaltend | 2 | 0 | |

2620600000 | Arsen, Quecksilber, Thallium oder deren Mischungen enthaltend, wie sie zum Gewinnen von Arsen, der genannten Metalle oder zum Herstellen von chemischen Verbindungen daraus verwendet werden | 2 | 0 | |

2620910000 | Antimon, Beryllium, Cadmium, Chrom oder deren Mischungen enthaltend | 2 | 0 | |

2620990000 | andere | 2 | 0 | |

2621100000 | Aschen und Rückstände vom Verbrennen von Siedlungsabfällen | 2 | 0 | |

2621900000 | andere | 2 | 0 | |

2701110000 | Anthrazit | 0 | 0 | |

2701121000 | Kokskohle, schwer | 0 | 0 | |

2701122000 | andere Kokskohle | 0 | 0 | |

2701129010 | mit einem Gehalt an flüchtigen Bestandteilen von weniger als 22 RHT (bezogen auf die trockene, mineralstofffreie Substanz) | 0 | 0 | |

2701129090 | andere | 0 | 0 | |

2701190000 | andere Steinkohle | 0 | 0 | |

2701201000 | Steinkohlenbriketts | 1 | 0 | |

2701202000 | Eierbriketts | 1 | 0 | |

2701209000 | andere | 1 | 0 | |

2702100000 | Braunkohle, auch in Pulverform, jedoch nicht agglomeriert | 1 | 0 | |

2702200000 | Braunkohle, agglomeriert | 1 | 0 | |

2703001000 | nicht agglomeriert | 1 | 0 | |

2703002000 | agglomeriert | 1 | 0 | |

2704001010 | aus Steinkohle | 3 | 3 | |

2704001090 | andere | 3 | 3 | |

2704002000 | Schwelkoks | 3 | 0 | |

2704003000 | Retortenkohle | 3 | 0 | |

2705000000 | Steinkohlengas, Wassergas, Generatorgas und ähnliche Gase, ausgenommen Erdgas und andere gasförmige Kohlenwasserstoffe | 5 | 0 | |

2706001000 | Teer aus Steinkohle | 5 | 3 | |

2706002000 | Teer aus Braunkohle oder Torf | 5 | 0 | |

2706009000 | andere | 5 | 0 | |

2707100000 | Benzole | 3 | 0 | |

2707200000 | Toluole | 3 | 0 | |

2707300000 | Xylole | 3 | 0 | |

2707400000 | Naphthalin | 5 | 0 | |

2707500000 | andere Mischungen aromatischer Kohlenwasserstoffe, bei deren Destillation nach ASTM D 86 bis 250 °C einschließlich der Destillationsverluste mindestens 65 RHT übergehen | 5 | 0 | |

2707910000 | Kreosotöle | 5 | 0 | |

2707991000 | Solvent Naphtha (Lösungsbenzol) | 5 | 0 | |

2707992000 | Anthracen | 5 | 0 | |

2707993000 | Phenole | 8 | 0 | |

2707999000 | andere | 5 | 0 | |

2708100000 | Pech | 5 | 0 | |

2708200000 | Pechkoks | 5 | 0 | |

2709001010 | mit einem spezifischen Gewicht von mehr als 0,796, jedoch nicht mehr als 0,841 bei 15 °C | 3 | 0 | |

2709001020 | mit einem spezifischen Gewicht von mehr als 0,841, jedoch nicht mehr als 0,847 bei 15 °C | 3 | 0 | |

2709001030 | mit einem spezifischen Gewicht von mehr als 0,847, jedoch nicht mehr als 0,855 bei 15 °C | 3 | 0 | |

2709001040 | mit einem spezifischen Gewicht von mehr als 0,855, jedoch nicht mehr als 0,869 bei 15 °C | 3 | 0 | |

2709001050 | mit einem spezifischen Gewicht von mehr als 0,869, jedoch nicht mehr als 0,885 bei 15 °C | 3 | 0 | |

2709001060 | mit einem spezifischen Gewicht von mehr als 0,885, jedoch nicht mehr als 0,899 bei 15 °C | 3 | 0 | |

2709001070 | mit einem spezifischen Gewicht von mehr als 0,899, jedoch nicht mehr als 0,904 bei 15 °C | 3 | 0 | |

2709001080 | mit einem spezifischen Gewicht von mehr als 0,904, jedoch nicht mehr als 0,966 bei 15 °C | 3 | 0 | |

2709001090 | andere | 3 | 0 | |

2709002000 | Öl aus bituminösen Mineralien, roh | 3 | 0 | |

2710111000 | Motorenbenzin | 5 | 0 | |

2710112000 | Flugbenzin | 5 | 0 | |

2710113000 | Propylen, Tetramer | 5 | 0 | |

2710114000 | Naphtha | 0 | 0 | |

2710115000 | Flüssigerdgas | 0 | 0 | |

2710119000 | andere | 5 | 0 | |

2710191010 | Flugturbinenkraftstoff | 5 | 0 | |

2710191090 | andere | 5 | 0 | |

2710192010 | Leuchtöl (Kerosin) | 5 | 0 | |

2710192020 | Flugturbinenkraftstoff | 5 | 0 | |

2710192030 | n-Paraffin | 5 | 0 | |

2710192090 | andere | 5 | 0 | |

2710193000 | Gasöl | 5 | 0 | |

2710194010 | leichtes Heizöl (Bunker A) | 5 | 0 | |

2710194020 | Heizöl (Bunker B) | 5 | 0 | |

2710194030 | Schweröl (Bunker C) | 5 | 0 | |

2710194090 | andere | 5 | 0 | |

2710195010 | Rohöle | 7 | 0 | |

2710195020 | Basisschmieröl | 7 | 0 | |

2710196000 | Streckungsöl | 8 | 0 | |

2710197110 | Flugmotorenöl | 7 | 0 | |

2710197120 | Motorenöl für den Kraftfahrzeugbereich | 7 | 5 | |

2710197130 | Motorenöl für den Schifffahrtsbereich | 7 | 5 | |

2710197210 | Zylinderöl | 7 | 0 | |

2710197220 | Spindelöl | 7 | 0 | |

2710197230 | Getriebeöl | 7 | 0 | |

2710197240 | Turbinenöl | 7 | 0 | |

2710197250 | Kältemaschinenöl | 7 | 0 | |

2710197310 | Compoundöl | 7 | 0 | |

2710197320 | Paraffinum liquidum | 7 | 0 | |

2710197330 | Automatikgetriebeflüssigkeit | 7 | 5 | |

2710197410 | Korrosionsschutzöl | 7 | 5 | |

2710197420 | Schneidöl | 7 | 5 | |

2710197430 | Spülöl | 7 | 0 | |

2710197440 | Formöl | 7 | 0 | |

2710197450 | Öl für hydraulische Bremsen | 7 | 0 | |

2710197510 | Weichmacheröl | 7 | 0 | |

2710197520 | Isolieröl | 7 | 0 | |

2710197530 | Härteöl | 7 | 0 | |

2710197540 | Wärmeträgeröl | 7 | 0 | |

2710197900 | andere | 7 | 0 | |

2710198010 | Aluminium als Zusatz enthaltend | 8 | 0 | |

2710198020 | Calcium als Zusatz enthaltend | 8 | 0 | |

2710198030 | Natrium als Zusatz enthaltend | 8 | 0 | |

2710198040 | Lithium als Zusatz enthaltend | 8 | 0 | |

2710198090 | andere | 8 | 0 | |

2710199000 | andere | 8 | 0 | |

2710911010 | von Motorenbenzin, Flugbenzin und Flugturbinenkraftstoff | 5 | 0 | |

2710911020 | von Naphtha und Flüssigerdgas | 0 | 0 | |

2710911090 | andere | 5 | 0 | |

2710912010 | von Leuchtöl und Flugturbinenkraftstoff | 5 | 0 | |

2710912090 | andere | 5 | 0 | |

2710913000 | von Gasölen | 5 | 0 | |

2710914010 | von leichtem Heizöl (Bunker A), Heizöl (Bunker B) und Schweröl (Bunker C) | 5 | 0 | |

2710914090 | andere | 5 | 0 | |

2710915000 | von Rohölen, Schmieröl (ausgenommen Streckungsöl) und Basisschmieröl | 7 | 0 | |

2710919000 | andere | 8 | 0 | |

2710991010 | von Motorenbenzin, Flugbenzin und Flugturbinenkraftstoff | 5 | 0 | |

2710991020 | von Naphtha und Flüssigerdgas | 0 | 0 | |

2710991090 | andere | 5 | 0 | |

2710992010 | von Leuchtöl und Flugturbinenkraftstoff | 5 | 0 | |

2710992090 | andere | 5 | 0 | |

2710993000 | von Gasölen | 5 | 0 | |

2710994010 | von leichtem Heizöl (Bunker A), Heizöl (Bunker B) und Schweröl (Bunker C) | 5 | 0 | |

2710994090 | andere | 5 | 0 | |

2710995000 | von Rohölen, Schmieröl (ausgenommen Streckungsöl) und Basisschmieröl | 7 | 0 | |

2710999000 | andere | 8 | 0 | |

2711110000 | Erdgas | 3 | 0 | |

2711120000 | Propan | 3 | 0 | |

2711130000 | Butane | 3 | 0 | |

2711141000 | Ethylen | 5 | 0 | |

2711142000 | Propylen | 5 | 0 | |

2711143000 | Butylen | 5 | 0 | |

2711144000 | Butadien | 5 | 0 | |

2711190000 | andere | 5 | 0 | |

2711210000 | Erdgas | 3 | 0 | |

2711290000 | andere | 5 | 0 | |

2712101000 | Vaselin | 8 | 0 | |

2712109000 | andere | 8 | 0 | |

2712200000 | Paraffin mit einem Gehalt an Öl von weniger als 0,75 GHT | 8 | 0 | |

2712901010 | paraffinische Rückstände ("slack wax", "scale wax") | 8 | 0 | |

2712901020 | mikrokristallines Wachs | 8 | 0 | |

2712901090 | andere | 8 | 0 | |

2712909010 | Montanwachs | 8 | 0 | |

2712909020 | Torfwachs | 8 | 0 | |

2712909030 | Ceresin-Wachs | 8 | 0 | |

2712909040 | synthetisches Paraffin | 8 | 0 | |

2712909090 | andere | 8 | 0 | |

2713110000 | nicht calciniert | 5 | 0 | |

2713120000 | calciniert | 5 | 0 | |

2713200000 | Bitumen aus Erdöl | 5 | 0 | |

2713900000 | andere Rückstände aus Erdöl oder Öl aus bituminösen Mineralien | 5 | 0 | |

2714100000 | bituminöse oder ölhaltige Schiefer und Sande | 5 | 0 | |

2714901000 | Naturbitumen und Naturasphalt | 5 | 0 | |

2714902000 | Asphaltite | 5 | 0 | |

2714903000 | Asphaltgestein | 5 | 0 | |

2715001000 | Verschnittbitumen | 5 | 0 | |

2715002000 | Emulsionen oder stabile Suspensionen aus Asphalt, Bitumen, Pech oder Teer | 5 | 0 | |

2715003000 | Mastix | 5 | 0 | |

2715009000 | andere | 5 | 0 | |

2716000000 | elektrische Energie | 5 | 0 | |

2801100000 | Chlor | 5,5 | 0 | |

2801200000 | Jod | 5,5 | 0 | |

2801301000 | Fluor | 5,5 | 0 | |

2801302000 | Brom | 5,5 | 0 | |

2802001000 | Schwefel, sublimiert | 5 | 0 | |

2802002000 | Schwefel, gefällt | 5 | 0 | |

2802003000 | kolloider Schwefel | 5 | 0 | |

2803001000 | Acetylenruß | 5,5 | 0 | |

2803009010 | Ruß (Kohlenstoff) | 5,5 | 0 | |

2803009090 | andere | 5,5 | 0 | |

2804100000 | Wasserstoff | 5,5 | 0 | |

2804210000 | Argon | 5,5 | 0 | |

2804291000 | Helium | 5,5 | 0 | |

2804292000 | Neon | 5,5 | 0 | |

2804293000 | Krypton | 5,5 | 0 | |

2804294000 | Xenon | 5,5 | 0 | |

2804299000 | andere | 5,5 | 0 | |

2804300000 | Stickstoff | 5,5 | 0 | |

2804400000 | Sauerstoff | 5,5 | 0 | |

2804501000 | Bor | 5,5 | 0 | |

2804502000 | Tellur | 5,5 | 0 | |

2804610000 | mit einem Gehalt an Silicium von 99,99 GHT oder mehr | 3 | 0 | |

2804690000 | andere | 5,5 | 0 | |

2804701000 | gelber Phosphor | 5 | 0 | |

2804709000 | andere | 5,5 | 0 | |

2804800000 | Arsen | 5,5 | 0 | |

2804900000 | Selen | 5,5 | 0 | |

2805110000 | Natrium | 5,5 | 0 | |

2805120000 | Calcium | 5,5 | 0 | |

2805190000 | andere | 5,5 | 0 | |

2805301000 | Cerium-Gruppe | 5,5 | 0 | |

2805302000 | Terbium-Gruppe | 5,5 | 0 | |

2805303000 | Erbium-Gruppe | 5,5 | 0 | |

2805304000 | Yttrium | 5,5 | 0 | |

2805305000 | Scandium | 5,5 | 0 | |

2805309000 | andere | 5,5 | 0 | |

2805400000 | Quecksilber | 5,5 | 0 | |

2806100000 | Chlorwasserstoff (Salzsäure) | 5,5 | 0 | |

2806200000 | Chloroschwefelsäure | 5,5 | 0 | |

2807001010 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2807001090 | andere | 5,5 | 0 | |

2807002000 | Oleum | 5,5 | 0 | |

2808001010 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2808001090 | andere | 5,5 | 0 | |

2808002000 | Nitriersäuren | 5,5 | 0 | |

2809100000 | Diphosphorpentaoxid | 5,5 | 0 | |

2809201010 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2809201090 | andere | 5,5 | 0 | |

2809202010 | Metaphosphorsäure | 5,5 | 0 | |

2809202020 | Pyrophosphorsäure | 5,5 | 0 | |

2809202090 | andere | 5,5 | 0 | |

2810001010 | Dibortrioxid | 5,5 | 0 | |

2810001090 | andere | 5,5 | 0 | |

2810002000 | Orthoborsäure | 5,5 | 0 | |

2810003000 | Metaborsäure | 5,5 | 0 | |

2810009000 | andere | 5,5 | 0 | |

2811111000 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2811119000 | andere | 5,5 | 0 | |

2811191000 | Hydrogensulfid | 5,5 | 0 | |

2811192000 | Bromwasserstoffsäure | 5,5 | 0 | |

2811193000 | Sulfaminsäure | 5,5 | 0 | |

2811194000 | Perchlorsäure | 5,5 | 0 | |

2811195000 | Chlorsäure | 5,5 | 0 | |

2811196000 | hypophosphorige Säure | 5,5 | 0 | |

2811197000 | phosphorige Säure | 5,5 | 0 | |

2811198000 | Arsensäure | 5,5 | 0 | |

2811199010 | Hydrogencyanid | 5,5 | 0 | |

2811199090 | andere | 5,5 | 0 | |

2811210000 | Kohlendioxid | 5,5 | 0 | |

2811221000 | weißer Kohlenstoff | 5,5 | 3 | |

2811229010 | Kieselgel | 5,5 | 0 | |

2811229090 | andere | 5,5 | 0 | |

2811291000 | Kohlenmonoxid | 5,5 | 0 | |

2811292000 | Distickstoffmonoxid | 5,5 | 0 | |

2811293000 | Stickstoffdioxid | 5,5 | 0 | |

2811294000 | Arsentrioxid | 5,5 | 0 | |

2811295000 | Diarsenpentaoxid | 5,5 | 0 | |

2811299000 | andere | 5,5 | 0 | |

2812101010 | Jodtrichlorid | 5 | 0 | |

2812101020 | Phosphortrichlorid | 5 | 0 | |

2812101030 | Phosphorpentachlorid | 5 | 3 | |

2812101040 | Arsentrichlorid | 5 | 0 | |

2812101050 | Schwefelmonochlorid | 5 | 0 | |

2812101060 | Schwefeldichlorid | 5 | 0 | |

2812101090 | andere | 5 | 0 | |

2812102010 | Thionyldichlorid | 5 | 0 | |

2812102020 | Carbonyldichlorid (Phosgen) | 5 | 0 | |

2812102030 | Phosphoroxychlorid | 5 | 0 | |

2812102090 | andere | 5 | 0 | |

2812901000 | Bortrifluorid | 5,5 | 0 | |

2812902000 | Schwefelhexafluorid | 5,5 | 0 | |

2812909000 | andere | 5,5 | 0 | |

2813100000 | Kohlenstoffdisulfid | 5,5 | 0 | |

2813901020 | Phosphorpentasulfid | 5,5 | 0 | |

2813901090 | andere | 5,5 | 0 | |

2813902010 | Diarsenpentasulfid | 5,5 | 0 | |

2813902090 | andere | 5,5 | 0 | |

2813903000 | Siliciumdisulfid | 5,5 | 0 | |

2813909000 | andere | 5,5 | 0 | |

2814100000 | Ammoniak, wasserfrei | 1 | 0 | |

2814200000 | Ammoniak in wässriger Lösung | 2 | 0 | |

2815110000 | fest | 5,5 | 5 | |

2815120000 | in wässriger Lösung (Natronlauge) | 8 | 7 | |

2815200000 | Kaliumhydroxid (Ätzkali) | 5,5 | 0 | |

2815301000 | Natriumperoxid | 5,5 | 0 | |

2815302000 | Kaliumperoxid | 5,5 | 0 | |

2816101000 | Magnesiumhydroxid | 5,5 | 0 | |

2816102000 | Magnesiumperoxid | 5,5 | 0 | |

2816400000 | Oxide, Hydroxide und Peroxide des Strontiums oder des Bariums | 5,5 | 0 | |

2817001000 | Zinkoxid | 5,5 | 0 | |

2817002000 | Zinkperoxid | 5,5 | 0 | |

2818101000 | Körner bestimmter Größe | 3 | 0 | |

2818109000 | andere | 3 | 0 | |

2818200000 | anderes Aluminiumoxid als künstlicher Korund | 1 | 0 | |

2818301000 | Alumogel | 5,5 | 0 | |

2818309000 | andere | 5,5 | 0 | |

2819100000 | Chromtrioxid | 5,5 | 0 | |

2819901010 | Chrom(III)-oxide | 5,5 | 0 | |

2819901090 | andere | 5,5 | 0 | |

2819902000 | Chromhydroxide | 5,5 | 0 | |

2820100000 | Mangandioxid | 5,5 | 0 | |

2820901000 | Manganoxid | 5,5 | 0 | |

2820902000 | Mangan(III)-oxid | 5,5 | 0 | |

2820909000 | andere | 5,5 | 0 | |

2821101000 | Eisenoxide | 5,5 | 0 | |

2821102000 | Eisenhydroxide | 5,5 | 0 | |

2821200000 | Farberden | 5,5 | 0 | |

2822001010 | Cobalt(III)-oxid | 5,5 | 0 | |

2822001091 | zur Herstellung von Sekundärbatterien | 4 | 0 | |

2822001099 | andere | 5,5 | 0 | |

2822002010 | Cobalthydroxid | 5,5 | 0 | |

2822002090 | andere | 5,5 | 0 | |

2823001000 | der Art Anatas | 5,5 | 0 | |

2823009000 | andere | 5,5 | 0 | |

2824100000 | Bleimonoxid (Lithargyrum, Massicot) | 5,5 | 0 | |

2824901000 | Mennige und Orangemennige | 5,5 | 0 | |

2824909000 | andere | 5,5 | 0 | |

2825101000 | Hydrazinhydrat | 5,5 | 0 | |

2825109010 | Hydrazin | 5,5 | 0 | |

2825109020 | anorganische Salze des Hydrazins | 5,5 | 0 | |

2825109030 | Hydroxylamin | 5,5 | 3 | |

2825109041 | Hydroxylammoniumchlorid (Hydroxylaminhydrochlorid) | 5,5 | 0 | |

2825109049 | andere | 5,5 | 0 | |

2825201000 | Lithiumoxid | 5,5 | 0 | |

2825202000 | Lithiumhydroxid | 5,5 | 0 | |

2825301000 | Vanadiumpentoxid | 2 | 0 | |

2825309000 | andere | 3 | 0 | |

2825401000 | Nickeloxide | 5,5 | 0 | |

2825402000 | Nickelhydroxide | 5,5 | 0 | |

2825501000 | Kupferoxide | 5,5 | 0 | |

2825502010 | Stoffe zur Herstellung chemischer Produkte für die Landwirtschaft (gemäß dem Gesetz zur Verwendung von chemischen Stoffen in der Landwirtschaft (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2825502090 | andere | 5,5 | 0 | |

2825601000 | Germaniumoxide | 5,5 | 0 | |

2825602000 | Zirconiumdioxid | 5,5 | 0 | |

2825701000 | Molybdänoxide | 3 | 0 | |

2825702000 | Molybdänhydroxid | 5,5 | 0 | |

2825800000 | Antimonoxide | 5,5 | 0 | |

2825901010 | Calciumoxid | 5,5 | 0 | |

2825901020 | Wolframoxide | 1 | 0 | |

2825901030 | Zinnoxide | 5,5 | 0 | |

2825901090 | andere | 5,5 | 0 | |

2825902010 | Calciumhydroxid | 5,5 | 0 | |

2825902020 | Manganhydroxide | 5,5 | 0 | |

2825902030 | Wolframhydroxide | 5,5 | 0 | |

2825902040 | Zinnhydroxide | 5,5 | 0 | |

2825902090 | andere | 5,5 | 0 | |

2825903010 | Nickelperoxide | 5,5 | 0 | |

2825903090 | andere | 5,5 | 0 | |

2825909000 | andere | 5,5 | 0 | |

2826120000 | des Aluminiums | 5,5 | 0 | |

2826191000 | Calciumfluorid | 5,5 | 0 | |

2826193010 | Kaliumhydrogenfluorid | 5,5 | 0 | |

2826193090 | andere | 5,5 | 0 | |

2826194000 | Ammonium- oder Natriumfluorid | 5,5 | 0 | |

2826199000 | andere | 5,5 | 0 | |

2826300000 | Natriumhexafluoroaluminat (synthetischer Kryolith) | 5,5 | 0 | |

2826901000 | künstlicher Chiolith | 5,5 | 0 | |

2826902000 | Calciumfluorosilicat | 5,5 | 0 | |

2826903000 | Fluoroborate | 5,5 | 0 | |

2826904000 | Fluorophosphate | 5,5 | 0 | |

2826905000 | Fluorosulfate | 5,5 | 0 | |

2826906000 | Fluorosilicate des Natriums oder des Kaliums | 5,5 | 0 | |

2826909000 | andere | 5,5 | 0 | |

2827100000 | Ammoniumchlorid | 5,5 | 0 | |

2827200000 | Calciumchlorid | 5,5 | 0 | |

2827310000 | des Magnesiums | 5,5 | 0 | |

2827320000 | des Aluminiums | 5,5 | 0 | |

2827350000 | des Nickels | 5,5 | 0 | |

2827391000 | des Kupfers | 5,5 | 0 | |

2827399000 | andere | 5,5 | 0 | |

2827411000 | Kupferchloridoxide | 5,5 | 0 | |

2827412010 | Stoffe zur Herstellung chemischer Produkte für die Landwirtschaft (gemäß dem Gesetz zur Verwendung von chemischen Stoffen in der Landwirtschaft (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2827412090 | andere | 5,5 | 0 | |

2827491000 | Chloridoxide | 5,5 | 0 | |

2827492000 | Chloridhydroxide | 5,5 | 0 | |

2827511000 | Natriumbromid | 5,5 | 0 | |

2827512000 | Kaliumbromid | 5,5 | 0 | |

2827591000 | Calciumbromid | 5,5 | 0 | |

2827599000 | andere | 5,5 | 0 | |

2827601000 | Iodidoxide | 5,5 | 0 | |

2827609010 | Kaliumiodid | 5,5 | 0 | |

2827609090 | andere | 5,5 | 0 | |

2828100000 | handelsübliches Calciumhypochlorit und andere Calciumhypochlorite | 5,5 | 0 | |

2828901010 | Natriumhypochlorit | 5,5 | 0 | |

2828901020 | Kaliumhypochlorit | 5,5 | 0 | |

2828901090 | andere | 5,5 | 0 | |

2828902010 | Natriumchlorit | 5,5 | 0 | |

2828902020 | Aluminiumchlorit | 5,5 | 0 | |

2828902090 | andere | 5,5 | 0 | |

2828903000 | Hypobromite | 5,5 | 0 | |

2829110000 | des Natriums | 5,5 | 0 | |

2829191000 | Kaliumchlorat | 5,5 | 0 | |

2829192000 | Bariumchlorat | 5,5 | 0 | |

2829199000 | andere | 5,5 | 0 | |

2829901010 | Natriumperchlorat | 5,5 | 0 | |

2829901020 | Ammoniumperchlorat | 5,5 | 0 | |

2829901090 | andere | 5,5 | 0 | |

2829902010 | Bromate | 5,5 | 0 | |

2829902020 | Perbromate | 5,5 | 0 | |

2829902030 | Iodate | 5,5 | 0 | |

2829902040 | Periodate | 5,5 | 0 | |

2830101000 | Natriumhydrogensulfid | 5,5 | 0 | |

2830109000 | andere | 5,5 | 0 | |

2830901000 | Sulfide | 5,5 | 0 | |

2830902000 | Polysulfide | 5,5 | 0 | |

2831101000 | Natriumdithionit | 5,5 | 0 | |

2831102000 | Natriumsulfoxylat (Natriumformaldehydsulfoxylat) | 5,5 | 0 | |

2831901000 | Dithionite | 5,5 | 0 | |

2831902000 | Sulfoxylate | 5,5 | 0 | |

2832101000 | Natriumbisulfit | 5,5 | 0 | |

2832109000 | andere | 5,5 | 0 | |

2832201000 | Ammoniumsulfit | 5,5 | 0 | |

2832202000 | Kaliumsulfite | 5,5 | 0 | |

2832203000 | Calciumsulfite | 5,5 | 0 | |

2832209000 | andere | 5,5 | 0 | |

2832301000 | Ammoniumthiosulfat | 5,5 | 0 | |

2832302000 | Natriumthiosulfat | 5,5 | 0 | |

2832303000 | Kaliumthiosulfat | 5,5 | 0 | |

2832309000 | andere | 5,5 | 0 | |

2833110000 | Dinatriumsulfat | 5,5 | 0 | |

2833191000 | Natriumhydrogensulfat | 5,5 | 0 | |

2833192000 | Dinatriumdisulfat | 5,5 | 0 | |

2833199000 | andere | 5,5 | 0 | |

2833210000 | des Magnesiums | 5,5 | 0 | |

2833220000 | des Aluminiums | 5,5 | 0 | |

2833240000 | des Nickels | 5,5 | 0 | |

2833251000 | Stoffe zur Herstellung chemischer Produkte für die Landwirtschaft (gemäß dem Gesetz zur Verwendung von chemischen Stoffen in der Landwirtschaft (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2833259000 | andere | 5,5 | 0 | |

2833270000 | des Bariums | 8 | 0 | |

2833291000 | Eisensulfate | 5,5 | 0 | |

2833299000 | andere | 5,5 | 0 | |

2833300000 | Alaune | 5,5 | 0 | |

2833401000 | Diammoniumperoxodisulfat | 5,5 | 0 | |

2833402000 | Dinatriumperoxodisulfat | 5,5 | 0 | |

2833403000 | Calciumperoxodisulfat | 5,5 | 0 | |

2833409000 | andere | 5,5 | 0 | |

2834101000 | Natriumnitrit | 5,5 | 0 | |

2834109000 | andere | 5,5 | 0 | |

2834210000 | des Kaliums | 5,5 | 0 | |

2834291000 | Bariumnitrat | 5,5 | 0 | |

2834299000 | andere | 5,5 | 0 | |

2835101010 | Natriumhypophosphit | 5,5 | 0 | |

2835101020 | Calciumhypophosphit | 5,5 | 0 | |

2835101090 | andere | 5,5 | 0 | |

2835102000 | Phosphite | 5,5 | 0 | |

2835221000 | des Mononatriums | 5,5 | 0 | |

2835222000 | des Dinatriums | 5,5 | 0 | |

2835240000 | des Kaliums | 5,5 | 0 | |

2835250000 | Calciumhydrogenorthophosphat (Dicalciumphosphat) | 5,5 | 0 | |

2835260000 | andere Calciumphosphate | 5,5 | 0 | |

2835291000 | Aluminiumphosphat | 5,5 | 0 | |

2835299000 | andere Polyphosphate | 5,5 | 0 | |

2835310000 | Natriumtriphosphat (Natriumtripolyphosphat) | 5,5 | 0 | |

2835391000 | Natriummetaphosphat | 5,5 | 0 | |

2835392000 | Natriumpyrophosphat | 5,5 | 0 | |

2835399000 | andere | 5,5 | 0 | |

2836200000 | Dinatriumcarbonat (Soda) | 4 | 0 | |

2836300000 | Natriumhydrogencarbonat (Natriumbicarbonat) | 5,5 | 0 | |

2836400000 | Kaliumcarbonate | 5,5 | 0 | |

2836500000 | Calciumcarbonat | 5,5 | 0 | |

2836600000 | Bariumcarbonat | 5,5 | 0 | |

2836910000 | Lithiumcarbonate | 5,5 | 0 | |

2836920000 | Strontiumcarbonat | 5,5 | 0 | |

2836991010 | Magnesiumcarbonat | 5,5 | 0 | |

2836991020 | Ammoniumcarbonate (einschließlich handelsübliches Ammoniumcarbonat) | 5,5 | 0 | |

2836991090 | andere | 5,5 | 0 | |

2836992000 | Peroxocarbonate (Percarbonate) | 5,5 | 0 | |

2837111000 | Natriumcyanide | 5,5 | 0 | |

2837112000 | Natriumcyanidoxide | 5,5 | 0 | |

2837191010 | Kaliumcyanid | 5,5 | 0 | |

2837191020 | Kupfercyanide | 5,5 | 0 | |

2837191030 | Zinkcyanid | 5,5 | 0 | |

2837191090 | andere | 5,5 | 0 | |

2837192000 | Cyanidoxide | 5,5 | 0 | |

2837201000 | Ferrocyanide | 5,5 | 0 | |

2837202000 | Ferricyanide | 5,5 | 0 | |

2837209000 | andere | 5,5 | 0 | |

2839110000 | Natriummetasilicate | 8 | 0 | |

2839190000 | andere | 8 | 0 | |

2839901000 | Zirconiumsilicate | 8 | 0 | |

2839902000 | Bariumsilicate | 8 | 0 | |

2839909000 | andere | 8 | 0 | |

2840110000 | wasserfrei | 5 | 0 | |

2840190000 | andere | 5 | 0 | |

2840200000 | andere Borate | 5 | 0 | |

2840300000 | Peroxoborate (Perborate) | 5 | 0 | |

2841300000 | Natriumdichromat | 8 | 0 | |

2841501000 | Kaliumchromat | 5,5 | 0 | |

2841509000 | andere | 5,5 | 0 | |

2841610000 | Kaliumpermanganat | 5,5 | 0 | |

2841691000 | Manganite | 5,5 | 0 | |

2841692000 | Manganate | 5,5 | 0 | |

2841693000 | Permanganate | 5,5 | 0 | |

2841700000 | Molybdate | 5,5 | 0 | |

2841800000 | Wolframate | 5 | 0 | |

2841901000 | Stannate | 5,5 | 0 | |

2841902010 | Bariumtitanat | 5,5 | 0 | |

2841902020 | Strontiumtitanat | 5,5 | 0 | |

2841902030 | Bleititanat | 5,5 | 0 | |

2841902090 | andere | 5,5 | 0 | |

2841903000 | Antimonate | 5,5 | 0 | |

2841904000 | Ferrate und Ferrite | 5,5 | 0 | |

2841905000 | Vanadate | 5,5 | 0 | |

2841906000 | Bismutate | 5,5 | 0 | |

2841909000 | andere | 5,5 | 0 | |

2842101000 | Aluminosilicate | 6,5 | 0 | |

2842109000 | andere | 5,5 | 0 | |

2842901000 | Salze der Säuren des Selens | 5,5 | 0 | |

2842903000 | Doppel- oder Komplexsalze, die Schwefel enthalten | 5,5 | 0 | |

2842905000 | Doppel- oder Komplexsalze des Selens | 5,5 | 0 | |

2842909000 | andere | 5,5 | 0 | |

2843101000 | kolloidales Silber | 5,5 | 0 | |

2843102000 | kolloidales Gold | 5,5 | 0 | |

2843103000 | kolloidales Platin | 5,5 | 0 | |

2843109000 | andere | 5,5 | 0 | |

2843211000 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2843219000 | andere | 5,5 | 0 | |

2843291000 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2843299000 | andere | 5,5 | 0 | |

2843301000 | Kaliumgoldcyanid zur Herstellung von Halbleitern | 5,5 | 0 | |

2843309000 | andere | 5,5 | 0 | |

2843901000 | Amalgame | 5,5 | 0 | |

2843909010 | Platinverbindungen | 5,5 | 0 | |

2843909090 | andere | 5,5 | 0 | |

2844101000 | natürliches Uran | 0 | 0 | |

2844102000 | Dispersionen (die natürliches Uran oder Verbindungen von natürlichem Uran enthalten) | 0 | 0 | |

2844109000 | andere | 0 | 0 | |

2844201000 | an U 235 angereichertes Uran | 0 | 0 | |

2844202000 | Dispersionen (die an U 235 angereichertes Uran, Plutonium oder Verbindungen dieser Erzeugnisse enthalten) | 0 | 0 | |

2844209000 | andere | 0 | 0 | |

2844301000 | Dispersionen (die an U 235 abgereichertes Uran, Thorium oder Verbindungen dieser Erzeugnisse enthalten) | 0 | 0 | |

2844309000 | andere | 0 | 0 | |

2844401000 | radioaktive Elemente | 0 | 0 | |

2844402000 | radioaktive Isotope | 0 | 0 | |

2844403000 | Dispersionen (die radioaktive Elemente, Isotope oder Verbindungen enthalten) | 0 | 0 | |

2844409000 | andere | 0 | 0 | |

2844500000 | verbrauchte (bestrahlte) Brennstoffelemente (Stäbe, Kartuschen) von Kernreaktoren | 0 | 0 | |

2845100000 | schweres Wasser (Deuteriumoxid) | 0 | 0 | |

2845901000 | schwerer Wasserstoff (Deuterium) | 0 | 0 | |

2845902000 | Kohlenstoffisotope | 0 | 0 | |

2845909000 | andere | 0 | 0 | |

2846100000 | Cerverbindungen | 5 | 0 | |

2846901000 | Yttriumoxid | 5 | 0 | |

2846909000 | andere | 5 | 0 | |

2847002000 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2847009000 | andere | 5,5 | 0 | |

2848001000 | von Kupfer (Kupferphosphide) mit einem Gehalt an Phosphor von mehr als 15 GHT | 5,5 | 0 | |

2848002000 | Aluminiumphosphid | 5,5 | 0 | |

2848009000 | andere | 5,5 | 0 | |

2849100000 | des Calciums | 5,5 | 0 | |

2849200000 | des Siliciums | 5 | 0 | |

2849901000 | komplexe Carbide | 5,5 | 0 | |

2849909010 | Wolframcarbide | 5,5 | 0 | |

2849909090 | andere | 5,5 | 0 | |

2850001000 | Hydride | 5,5 | 0 | |

2850002000 | Nitride | 5,5 | 0 | |

2850003000 | Azide | 5,5 | 0 | |

2850004000 | Silicide | 5,5 | 0 | |

2850005000 | Boride | 5,5 | 0 | |

2852001000 | der Unterposition 2825 90, 2827 39, 2827 49, 2827 60, 2830 90, 2833 29, 2834 29, 2835 39, 2837 19, 2837 20, 2841 50, 2842 10, 2842 90, 2843 90, 2848 00, 2849 90, 2850 00 oder 2853 00 | 5,5 | 0 | |

2852002000 | der Unterposition 2918 11, 2931 00, 2932 99, 2934 99 9090, 3201 90 2000, 3201 90 4000, 3206 50, 3707 90, 3822 00 1091 oder 3822 00 2091 | 6,5 | 0 | |

2852003000 | der Unterposition 2934 99 2000, 3822 00 1092 oder 3822 00 2092 | 8 | 0 | |

2852004000 | der Unterposition 3502 90 oder 3504 00 | 8 | 0 | |

2852005000 | der Unterposition 3822 00 101, 3822 00 102, 3822 00 1093, 3822 00 201, 3822 00 202 oder 3822 00 2093 | 0 | 0 | |

2852006000 | der Unterposition 3822 00 1099 oder 3822 00 2099 | 8 | | |

–der Unterposition 3822 00 1099 (andere) | | 0 | |

–der Unterposition 3822 00 2099 (andere) | | 3 | |

2853001000 | destilliertes Wasser, Leitfähigkeitswasser oder Wasser von gleicher Reinheit | 5,5 | 0 | |

2853002000 | Pressluft | 5,5 | 0 | |

2853003000 | Amalgam | 5,5 | 0 | |

2853004000 | Cyanogen und Halogenverbindungen des Cyanogen | 5,5 | 0 | |

2853005000 | Alkaliamide | 5,5 | 0 | |

2853009000 | andere | 5,5 | 0 | |

2901101000 | Butane | 0 | 0 | |

2901102000 | Hexane | 0 | 0 | |

2901103000 | Heptane | 0 | 0 | |

2901109000 | andere | 0 | 0 | |

2901210000 | Ethylen | 0 | 0 | |

2901220000 | Propen (Propylen) | 0 | 0 | |

2901230000 | Buten (Butylen) und seine Isomeren | 0 | 0 | |

2901241000 | Buta-1,3-dien | 0 | 0 | |

2901242000 | Isopren | 0 | 0 | |

2901291000 | Hexen | 0 | 0 | |

2901292000 | Octen | 0 | 0 | |

2901299000 | andere | 0 | 0 | |

2902110000 | Cyclohexan | 5 | 0 | |

2902190000 | andere | 5 | 0 | |

2902200000 | Benzol | 3 | 0 | |

2902300000 | Toluol | 3 | 0 | |

2902410000 | o-Xylol | 5 | 0 | |

2902420000 | m-Xylol | 5 | 0 | |

2902430000 | p-Xylol | 3 | 0 | |

2902440000 | Xylol-Isomerengemische | 3 | 0 | |

2902500000 | Styrol | 0 | 0 | |

2902600000 | Ethylbenzol | 5 | 0 | |

2902700000 | Cumol | 3 | 0 | |

2902901000 | Naphthalin | 0 | 0 | |

2902902000 | Methylnaphtalin | 0 | 0 | |

2902903000 | Methylstyrol | 0 | 0 | |

2902909000 | andere | 0 | 0 | |

2903111000 | Chlormethan (Methylchlorid) | 5,5 | 0 | |

2903112000 | Chlorethan (Ethylchlorid) | 5,5 | 0 | |

2903120000 | Dichlormethan (Methylenchlorid) | 5,5 | 0 | |

2903130000 | Chloroform (Trichlormethan) | 5,5 | 0 | |

2903140000 | Kohlenstofftetrachlorid (Tetrachlorkohlenstoff) | 5,5 | 0 | |

2903150000 | Ethylendichlorid (ISO) (1,2-Dichlorethan) | 5 | 5 | |

2903191000 | 1,1,1-Trichlorethan (Methylchloroform) | 5,5 | 0 | |

2903199000 | andere | 5,5 | 0 | |

2903210000 | Vinylchlorid (Chlorethylen) | 5,5 | 5 | |

2903220000 | Trichlorethylen | 5,5 | 0 | |

2903230000 | Tetrachlorethylen (Perchlorethylen) | 5,5 | 0 | |

2903290000 | andere | 5,5 | 0 | |

2903310000 | Ethylendibromid (ISO) (1,2-Dibromethan) | 5,5 | 0 | |

2903391000 | Brommethan | 5,5 | 0 | |

2903392000 | Bromethan, ausgenommen 1,2-Dibromethan | 5,5 | 0 | |

2903393000 | Iodmethan | 5,5 | 0 | |

2903394000 | Hexafluorethan (CFK-116) | 5,5 | 0 | |

2903395000 | 1,1-Difluorethan (HFKW-152a) | 5,5 | 0 | |

2903396000 | 1,1,1,2-Tetrafluorethan (HFKW-134a) | 5,5 | 0 | |

2903397000 | 1,1,3,3,3-Pentafluor-2-(trifluormethyl)1-propen | 5,5 | 0 | |

2903399000 | andere | 5,5 | 5 | |

2903410000 | Trichlorfluormethan | 5,5 | 0 | |

2903420000 | Dichlordifluormethan | 5,5 | 0 | |

2903430000 | Trichlortrifluorethan | 5,5 | 0 | |

2903441000 | Dichlortetrafluorethan (CFK-114) | 5,5 | 0 | |

2903442000 | Chlorpentafluorethan (CFK-115) | 5,5 | 0 | |

2903451010 | Chlortrifluormethan (CFK-13) | 5,5 | 0 | |

2903451090 | andere | 5,5 | 0 | |

2903452010 | Pentachlorfluorethan (CFK-111) | 5,5 | 0 | |

2903452020 | Tetrachlordifluorethan (CFK-112) | 5,5 | 0 | |

2903452090 | andere | 5,5 | 0 | |

2903453010 | Heptachlorfluorpropan (CFK-211) | 5,5 | 0 | |

2903453020 | Hexachlordifluorpropan (CFK-212) | 5,5 | 0 | |

2903453030 | Pentachlortrifluorpropan (CFK-213) | 5,5 | 0 | |

2903453040 | Tetrachlortetrafluorpropan (CFK-214) | 5,5 | 0 | |

2903453050 | Tetrachlorpentafluorpropan (CFK-215) | 5,5 | 0 | |

2903453060 | Dichlorhexafluorpropan (CFK-216) | 5,5 | 0 | |

2903453070 | Chlorheptafluorpropan (CFK-217) | 5,5 | 0 | |

2903453090 | andere | 5,5 | 0 | |

2903461000 | Bromchlordifluormethan (Halon-1211) | 5,5 | 0 | |

2903462000 | Bromtrifluormethan (Halon-1301) | 5,5 | 0 | |

2903463000 | Dibromtetrafluorethan (Halon-2402) | 5,5 | 0 | |

2903471000 | teilhalogenierter Bromfluorkohlenwasserstoff | 5,5 | 0 | |

2903479000 | andere | 5,5 | 0 | |

2903491110 | Dichlorfluormethan (HFCKW-21) | 5,5 | 0 | |

2903491120 | Chlordifluormethan (HFCKW-22) | 5,5 | 0 | |

2903491130 | Chlorfluormethan (HFCKW-31) | 5,5 | 0 | |

2903491190 | andere | 5,5 | 0 | |

2903491210 | Dichlortrifluorethan (HFCKW-123) | 5,5 | 0 | |

2903491220 | Chlortetrafluorethan (HFCKW-124) | 5,5 | 0 | |

2903491230 | Dichlorfluorethan (HFCKW-141) | 5,5 | 0 | |

2903491240 | Chlordifluorethan (HFCKW-142) | 5,5 | 0 | |

2903491290 | andere | 5,5 | 0 | |

2903491310 | Dichlorpentafluorpropan (HFCKW-225) | 5,5 | 0 | |

2903491390 | andere | 5,5 | 0 | |

2903492000 | nur mit Fluor und Brom halogenierte Derivate des Methans, Ethans oder Propans | 5,5 | 0 | |

2903499000 | andere | 5,5 | 0 | |

2903510000 | 1,2,3,4,5,6-Hexachlorcyclohexan (HCH (ISO)), einschließlich Lindan (ISO, INN) | 5,5 | 0 | |

2903520000 | Aldrin (ISO), Chlordan (ISO) und Heptachlor (ISO) | 5,5 | 0 | |

2903590000 | andere | 5,5 | 0 | |

2903611000 | Chlorbenzol | 5,5 | 0 | |

2903619000 | andere | 5,5 | 0 | |

2903621000 | Hexachlorbenzol (ISO) | 5,5 | 0 | |

2903622000 | DDT (ISO) (Clofenotan (INN), 1,1,1-Trichlor-2,2-bis(4-chlorphenyl)ethan) | 5,5 | 0 | |

2903691000 | Benzylchlorid | 5,5 | 0 | |

2903692010 | 1,2,4-Trichlorbenzol | 5,5 | 0 | |

2903692090 | andere | 5,5 | 0 | |

2903693000 | Benzotrichlorid | 5,5 | 0 | |

2903699000 | andere | 5,5 | 0 | |

2904101000 | Benzolsulfonsäure | 5,5 | 0 | |

2904109000 | andere | 5,5 | 0 | |

2904201000 | Nitrotoluol | 5,5 | 0 | |

2904209010 | Nitrobenzol | 5,5 | 0 | |

2904209020 | 4-Nitrobiphenyl und seine Salze | 5,5 | 0 | |

2904209090 | andere | 5,5 | 0 | |

2904901000 | 2,4-Dinitrochlorbenzol | 5,5 | 0 | |

2904902000 | p-Nitrochlorbenzol | 5,5 | 0 | |

2904903000 | Trichlornitromethan (Chlorpikrin) | 5,5 | 0 | |

2904909000 | andere | 5,5 | 0 | |

2905110000 | Methanol (Methylalkohol) | 2 | 0 | |

2905121000 | Propan-1-ol (Propylalkohol) | 5,5 | 0 | |

2905122010 | zur Herstellung von Halbleitern | 5,5 | 5 | |

2905122090 | andere | 5,5 | 5 | |

2905130000 | Butan-1-ol (n-Butylalkohol) | 5 | 0 | |

2905140000 | andere Butanole | 5,5 | 0 | |

2905161000 | 2-Ethylhexylalkohol | 5,5 | 5 | |

2905169000 | andere | 5,5 | 5 | |

2905171000 | Dodecan-1-ol (Laurylalkohol) | 5,5 | 0 | |

2905172000 | Hexadecan-1-ol (Cetylalkohol) | 5,5 | 0 | |

2905173000 | Octadecan-1-ol (Stearylalkohol) | 5,5 | 0 | |

2905191000 | Heptylalkohole | 5,5 | 0 | |

2905192000 | Nonylalkohol | 5,5 | 0 | |

2905193000 | Isononylalkohol | 3 | 0 | |

2905194000 | Pentanol (Amylalkohol) und seine Isomere | 5,5 | 0 | |

2905199010 | 3,3-Dimethylbutan-2-ol (Pinakolylalkohol) | 5 | 0 | |

2905199020 | 2-Propylheptanol | 5 | 0 | |

2905199030 | Isodecylalkohol | 3 | 0 | |

2905199090 | andere | 5 | 0 | |

2905221000 | Geraniol, Citronellol, Linalol, Rhodinol und Nerol | 5 | 0 | |

2905229000 | andere | 5 | 0 | |

2905290000 | andere | 5 | 0 | |

2905310000 | Ethylenglykol (Ethandiol) | 3 | 0 | |

2905320000 | Propylenglykol (Propan-1,2-diol) | 5,5 | 5 | |

2905391000 | 1,4-Butandiol | 5,5 | 0 | |

2905392000 | Neopentylglykol | 5,5 | 5 | |

2905399000 | andere | 5,5 | 0 | |

2905410000 | 2-Ethyl-2-(hydroxymethyl)propan-1,3-diol (Trimethylolpropan) | 5,5 | 0 | |

2905420000 | Pentaerythritol | 5,5 | 0 | |

2905430000 | Mannitol | 8 | 0 | |

2905440000 | D-Glucitol (Sorbit) | 8 | 0 | |

2905450000 | Glycerin | 8 | 3 | |

2905490000 | andere | 5,5 | 3 | |

2905510000 | Ethchlorvynol (INN) | 5,5 | 0 | |

2905590000 | andere | 5,5 | 0 | |

2906110000 | Menthol | 8 | 0 | |

2906120000 | Cyclohexanol, Methylcyclohexanole und Dimethylcyclohexanole | 5,5 | 0 | |

2906131000 | Sterine | 5,5 | 0 | |

2906132000 | Inosite | 5,5 | 0 | |

2906191000 | Borneol | 5,5 | 0 | |

2906192000 | Terpineole | 5,5 | 0 | |

2906199000 | andere | 5,5 | 0 | |

2906210000 | Benzylalkohol | 5,5 | 0 | |

2906291000 | Phenylethylalkohol | 5,5 | 0 | |

2906292000 | Phenylpropylalkohol | 5,5 | 0 | |

2906293000 | Cinnamylalkohol | 5,5 | 0 | |

2906299000 | andere | 5,5 | 0 | |

2907111000 | Phenol | 5,5 | 5 | |

2907112000 | Salze des Phenols | 5,5 | 0 | |

2907121000 | Kresole | 5,5 | 0 | |

2907122000 | Salze der Kresole | 5,5 | 0 | |

2907131000 | Octylphenol | 5,5 | 0 | |

2907132000 | Nonylphenol | 5 | 0 | |

2907139000 | andere | 5,5 | 0 | |

2907151000 | Naphthole | 5,5 | 0 | |

2907152000 | Salze der Naphthole | 5,5 | 0 | |

2907191000 | Thymol | 5,5 | 0 | |

2907192000 | Xylenole und ihre Salze | 5,5 | 0 | |

2907199000 | andere | 5,5 | 0 | |

2907211000 | Resorcin | 5,5 | 0 | |

2907212000 | Salze des Resorcins | 5,5 | 0 | |

2907221000 | Hydrochinon | 5,5 | 0 | |

2907222000 | Salz des Hydrochinons | 5,5 | 0 | |

2907231000 | 4,4′-Isopropylidendiphenol (Bisphenol A) | 5,5 | 5 | |

2907232000 | Salze des 4,4′-Isopropylidendiphenols (Bisphenol A) | 5,5 | 5 | |

2907291000 | Brenzcatechin | 5,5 | 0 | |

2907299000 | andere | 5,5 | 0 | |

2908110000 | Pentachlorphenol (ISO) | 5 | 0 | |

2908191000 | Chlorphenole, ausgenommen Pentachlorphenol | 5 | 0 | |

2908192000 | Tetrabrombisphenol A | 5 | 0 | |

2908193000 | Tribromphenol | 5 | 0 | |

2908199000 | andere | 5 | 0 | |

2908910000 | Dinoseb (ISO) und seine Salze | 5,5 | 0 | |

2908991000 | Naphtholsulfonsäuren und ihre Salze | 5,5 | 0 | |

2908992000 | Phenolsulfonsäuren | 5,5 | 0 | |

2908993000 | Nitroderivate und ihre Salze | 5,5 | 0 | |

2908994000 | Nitrosoderivate und ihre Salze | 5,5 | 0 | |

2908999000 | andere | 5,5 | 0 | |

2909110000 | Diethylether | 5,5 | 0 | |

2909191000 | Bis(chlormethyl)ether | 5,5 | 0 | |

2909192000 | tertiärer Methylbutylether | 5,5 | 0 | |

2909199000 | andere | 5,5 | 0 | |

2909201000 | Cineol | 5,5 | 0 | |

2909209000 | andere | 5,5 | 0 | |

2909301000 | Anisol | 5,5 | 0 | |

2909302000 | Anethol | 5,5 | 0 | |

2909303000 | Diphenylether | 5,5 | 0 | |

2909304000 | Ambrettemoschus | 5,5 | 0 | |

2909305000 | Decabromdiphenyloxid | 5,5 | 0 | |

2909309010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2909309090 | andere | 5,5 | 0 | |

2909410000 | 2,2′-Oxydiethanol (Diethylenglykol, Digol) | 5,5 | 0 | |

2909430000 | Monobutylether des Ethylenglykols oder des Diethylenglykols | 5,5 | 0 | |

2909441000 | Monomethylether des Ethylenglykols oder des Diethylenglykols | 5,5 | 0 | |

2909449000 | andere | 5,5 | 0 | |

2909491000 | Triethylenglykol | 5,5 | 0 | |

2909499000 | andere | 5,5 | 0 | |

2909501000 | Eugenol | 5,5 | 0 | |

2909502000 | Isoeugenol | 5,5 | 0 | |

2909503000 | Etheralkoholphenole | 5,5 | 0 | |

2909509000 | andere | 5,5 | 0 | |

2909601000 | Alkoholperoxide | 5,5 | 0 | |

2909602000 | Dicumylperoxid | 5,5 | 0 | |

2909603000 | Methylethylketonperoxid | 5,5 | 0 | |

2909609000 | andere | 5,5 | 0 | |

2910100000 | Oxiran (Ethylenoxid) | 5 | 0 | |

2910200000 | Methyloxiran (Propylenoxid) | 5,5 | 5 | |

2910300000 | 1-Chlor-2,3-epoxypropan (Epichlorhydrin) | 5,5 | 5 | |

2910400000 | Dieldrin (ISO, INN) | 5,5 | 0 | |

2910900000 | andere | 5,5 | 0 | |

2911001010 | Acetale | 5,5 | 0 | |

2911001020 | Halbacetale | 5,5 | 0 | |

2911009000 | andere | 5,5 | 0 | |

2912110000 | Methanal (Formaldehyd) | 5,5 | 0 | |

2912120000 | Ethanal (Acetaldehyd) | 5,5 | 0 | |

2912191000 | Citronellal | 5,5 | 0 | |

2912192000 | Citral | 5,5 | 0 | |

2912193000 | Butanal (Butyraldehyd, normales Isomer) | 5,5 | 0 | |

2912199000 | andere | 5,5 | 0 | |

2912210000 | Benzaldehyd | 5,5 | 0 | |

2912292000 | Phenylacetaldehyd | 5,5 | 0 | |

2912293000 | Zimtaldehyd | 5,5 | 0 | |

2912294000 | Alpha-Amylzimtaldehyd | 5,5 | 0 | |

2912295000 | Cyclamenaldehyd | 5,5 | 0 | |

2912299000 | andere | 5,5 | 0 | |

2912301000 | Hydroxycitronellal | 5,5 | 0 | |

2912309000 | andere | 5,5 | 0 | |

2912410000 | Vanillin (4-Hydroxy-3-methoxybenzaldehyd) | 5 | 0 | |

2912420000 | Ethylvanillin (3-Ethoxy-4-hydroxybenzaldehyd) | 5,5 | 0 | |

2912491000 | 3,4,5-Trimethoxybenzaldehyd | 5,5 | 0 | |

2912499000 | andere | 5,5 | 0 | |

2912501000 | Trioxan | 5,5 | 0 | |

2912502000 | Paraldehyd | 5,5 | 0 | |

2912503000 | Metaldehyd | 5,5 | 0 | |

2912509000 | andere | 5,5 | 0 | |

2912600000 | Paraformaldehyd | 5,5 | 0 | |

2913000000 | Halogen-, Sulfo-, Nitro- oder Nitrosoderivate der Erzeugnisse der Position 2912 | 5,5 | 0 | |

2914110000 | Aceton | 5,5 | 5 | |

2914120000 | Butanon (Methylethylketon) | 3 | 0 | |

2914130000 | 4-Methylpentan-2-on (Methylisobutylketon) | 5,5 | 0 | |

2914191000 | 3,3-Dimethyl-2-butanon (Pinakolon) | 5,5 | 0 | |

2914199000 | andere | 5,5 | 0 | |

2914210000 | Campher | 5 | 0 | |

2914221000 | Cyclohexanon | 5 | 0 | |

2914222000 | Methylcyclohexanone | 5 | 0 | |

2914231000 | Jonone | 5 | 0 | |

2914232000 | Methyljonone | 5 | 0 | |

2914291000 | Jasmon | 5 | 0 | |

2914299000 | andere | 5 | 0 | |

2914310000 | Phenylaceton (Phenylpropan-2-on) | 5,5 | 0 | |

2914390000 | andere | 5,5 | 0 | |

2914401000 | Diacetonalkohol (4-Hydroxy-4-methylpentan-2-on) | 5,5 | 0 | |

2914409000 | andere | 5,5 | 0 | |

2914501000 | Ketonphenole | 5,5 | 0 | |

2914509000 | andere | 5,5 | 0 | |

2914610000 | Anthrachinon | 5,5 | 0 | |

2914691000 | Derivate des Anthrachinons | 5,5 | 0 | |

2914699010 | Chinonalkohole, Chinonphenole und Chinonaldehyde | 5,5 | 0 | |

2914699090 | andere | 5,5 | 0 | |

2914701000 | Ketonmoschus | 5 | 0 | |

2914709010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2914709090 | andere | 5 | 0 | |

2915110000 | Ameisensäure | 5,5 | 0 | |

2915121000 | Calciumformiat | 5,5 | 0 | |

2915122000 | Ammoniumformiat | 5,5 | 0 | |

2915129000 | andere | 5,5 | 0 | |

2915131000 | Methylformiat | 5,5 | 0 | |

2915132000 | 2-Ethylhexylchlorformiat | 5,5 | 0 | |

2915139000 | andere | 5,5 | 0 | |

2915210000 | Essigsäure | 5,5 | 0 | |

2915240000 | Essigsäureanhydrid | 5,5 | 0 | |

2915291000 | Calciumacetat | 5,5 | 0 | |

2915292000 | Natriumacetat | 5,5 | 0 | |

2915293000 | Cobaltacetat | 5,5 | 0 | |

2915299000 | andere | 5,5 | 0 | |

2915310000 | Ethylacetat | 5,5 | 0 | |

2915320000 | Vinylacetat | 5,5 | 0 | |

2915331000 | zur Herstellung von Halbleitern | 5,5 | 0 | |

2915339000 | andere | 5,5 | 0 | |

2915360000 | Dinosebacetat (ISO) | 5,5 | 0 | |

2915391000 | Amylacetat | 5,5 | 0 | |

2915392000 | Isoamylacetat | 5,5 | 0 | |

2915393000 | Methylacetat | 5,5 | 0 | |

2915394000 | Isobutylacetat | 5,5 | 0 | |

2915395000 | 2-Ethoxyethylacetat | 5,5 | 0 | |

2915399000 | andere | 5,5 | 0 | |

2915401000 | Monochloressigsäure | 5,5 | 0 | |

2915409000 | andere | 5,5 | 0 | |

2915500000 | Propionsäure, ihre Salze und Ester | 5,5 | 0 | |

2915600000 | Butansäuren, Pentansäuren, ihre Salze und Ester | 5,5 | 0 | |

2915701000 | Palmitinsäure, ihre Salze und Ester | 5,5 | 0 | |

2915702010 | Stearinsäure | 5,5 | 0 | |

2915702020 | Magnesiumstearat | 5,5 | 0 | |

2915702030 | Bleistearat | 5,5 | 0 | |

2915702040 | Zinkstearat | 5,5 | 0 | |

2915702050 | Bariumstearat | 5,5 | 0 | |

2915702060 | Cadmiumstearat | 5,5 | 0 | |

2915702070 | Calciumstearat | 5,5 | 0 | |

2915702080 | Butylstearat | 5,5 | 0 | |

2915702090 | andere | 5,5 | 0 | |

2915901000 | Neodecanoylchlorid und Pivaloylchlorid | 5,5 | 0 | |

2915909010 | 2-Ethylhexansäure | 5,5 | 0 | |

2915909090 | andere | 5,5 | 3 | |

2916111000 | Acrylsäure | 6,5 | 0 | |

2916119000 | andere | 6,5 | 0 | |

2916121000 | Ethylacrylat | 6,5 | 0 | |

2916122000 | Methylacrylat | 6,5 | 0 | |

2916123000 | Butylacrylat | 6,5 | 0 | |

2916124000 | 2-Ethylhexylacrylat | 6,5 | 0 | |

2916129000 | andere | 6,5 | 0 | |

2916131000 | Methacrylsäure | 6,5 | 5 | |

2916139000 | andere | 6,5 | 5 | |

2916141000 | Methylmethacrylat | 6,5 | 5 | |

2916149000 | andere | 6,5 | 5 | |

2916151000 | Ölsäure, ihre Salze und Ester | 6,5 | 0 | |

2916152000 | Linolsäure, ihre Salze und Ester | 6,5 | 0 | |

2916153000 | Linolensäure, ihre Salze und Ester | 6,5 | 0 | |

2916190000 | andere | 6,5 | 0 | |

2916201000 | Cyclohexancarbonsäure | 6,5 | 0 | |

2916202000 | Cyclopentenylessigsäure | 6,5 | 0 | |

2916209010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2916209090 | andere | 6,5 | 0 | |

2916311000 | Benzoesäure | 6,5 | 0 | |

2916312000 | Natriumbenzoat | 6,5 | 0 | |

2916313000 | Benzylbenzoate | 6,5 | 0 | |

2916319010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2916319090 | andere | 6,5 | 0 | |

2916321000 | Benzoylperoxid | 6,5 | 0 | |

2916322000 | Benzoylchlorid | 6,5 | 3 | |

2916341000 | Phenylessigsäure | 6,5 | 0 | |

2916342000 | Salze der Phenylessigsäure | 6,5 | 0 | |

2916351000 | Ethylphenylacetat | 6,5 | 0 | |

2916352000 | Isobutylphenylacetat | 6,5 | 0 | |

2916359000 | andere | 6,5 | 0 | |

2916360000 | Binapacryl (ISO) | 6,5 | 0 | |

2916391000 | Zimtsäure | 6,5 | 0 | |

2916399010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2916399090 | andere | 6,5 | 0 | |

2917111000 | Oxalsäure | 6,5 | 0 | |

2917112000 | Salze der Oxalsäure | 6,5 | 0 | |

2917113000 | Ester der Oxalsäure | 6,5 | 0 | |

2917121000 | Adipinsäure | 6,5 | 5 | |

2917122000 | Salze der Adipinsäure | 6,5 | 0 | |

2917123010 | Dioctyladipat | 6,5 | 3 | |

2917123090 | andere | 6,5 | 3 | |

2917131000 | Azelainsäure, ihre Salze und Ester | 6,5 | 0 | |

2917132000 | Sebacinsäure, ihre Salze und Ester | 6,5 | 0 | |

2917140000 | Maleinsäureanhydrid | 6,5 | 0 | |

2917191000 | Maleinsäure | 6,5 | 0 | |

2917192000 | Bernsteinsäure | 6,5 | 0 | |

2917193000 | Natriumsuccinat | 6,5 | 0 | |

2917194000 | Diethylmalonat | 6,5 | 0 | |

2917195000 | Diisopropylmalonat | 6,5 | 0 | |

2917199000 | andere | 6,5 | 0 | |

2917200000 | alicyclische mehrbasische Carbonsäuren, ihre Anhydride, Halogenide, Peroxide, Peroxysäuren und ihre Derivate | 6,5 | 0 | |

2917321000 | Di-2-ethylhexylorthophthalat | 6,5 | 5 | |

2917329000 | andere | 6,5 | 3 | |

2917331000 | Dinonylorthophthalat | 6,5 | 0 | |

2917332000 | Didecylorthophthalate | 6,5 | 0 | |

2917341000 | Diheptylorthophthalat | 6,5 | 0 | |

2917342000 | Diisodecylorthophthalat | 6,5 | 3 | |

2917343000 | Dibutylorthophthalate | 8 | 0 | |

2917349000 | andere | 6,5 | 5 | |

2917350000 | Phthalsäureanhydrid | 6,5 | 0 | |

2917361000 | Terephthalsäure | 3 | 0 | |

2917369000 | andere | 6,5 | 0 | |

2917370000 | Dimethylterephthalat | 6,5 | 0 | |

2917391000 | Isophthalsäure | 6,5 | 3 | |

2917392000 | Trioctyltrimellitat (TOTM) | 6,5 | 0 | |

2917393000 | Trimellithsäureanhydrid | 6,5 | 0 | |

2917399000 | andere | 6,5 | 0 | |

2918111000 | Milchsäure | 6,5 | 0 | |

2918112000 | Salze der Milchsäure | 6,5 | 0 | |

2918113000 | Ester der Milchsäure | 6,5 | 0 | |

2918120000 | Weinsäure | 6,5 | 0 | |

2918131000 | Salze der Weinsäure | 6,5 | 0 | |

2918132000 | Ester der Weinsäure | 6,5 | 0 | |

2918140000 | Citronensäure | 8 | 0 | |

2918151010 | Calciumcitrat | 6,5 | 0 | |

2918151090 | andere | 6,5 | 0 | |

2918152000 | Ester der Citronensäure | 6,5 | 0 | |

2918161000 | Gluconsäure | 6,5 | 0 | |

2918162000 | Salze der Gluconsäure | 6,5 | 0 | |

2918163000 | Ester der Gluconsäure | 6,5 | 0 | |

2918180000 | Chlorbenzilat (ISO) | 6,5 | 0 | |

2918191010 | Äpfelsäure | 6,5 | 0 | |

2918191090 | andere | 6,5 | 0 | |

2918192010 | Salze der Apfelsäure | 6,5 | 0 | |

2918192090 | andere | 6,5 | 0 | |

2918193010 | Ester der Apfelsäure | 6,5 | 0 | |

2918193020 | Methylbenzilat | 6,5 | 0 | |

2918193090 | andere | 6,5 | 0 | |

2918194000 | Hydroxydiphenylessigsäure (Benzilsäure) | 6,5 | 0 | |

2918199000 | andere | 6,5 | 0 | |

2918211000 | Salicylsäure | 6,5 | 0 | |

2918212010 | Natriumsalicylat | 6,5 | 0 | |

2918212090 | andere | 6,5 | 0 | |

2918221000 | o-Acetylsalicylsäure | 6,5 | 0 | |

2918222000 | Salze der o-Acetylsalicylsäure | 6,5 | 0 | |

2918223000 | Ester der o-Acetylsalicylsäure | 6,5 | 0 | |

2918231010 | Methylsalicylat | 6,5 | 0 | |

2918231020 | Ethylsalicylat | 6,5 | 0 | |

2918231090 | andere | 6,5 | 0 | |

2918232000 | Salze anderer Ester der Salicylsäure | 6,5 | 0 | |

2918291000 | β-Oxynaphthoesäure und ihre Salze | 6,5 | 0 | |

2918299010 | Gallussäure | 6,5 | 0 | |

2918299020 | Parahydroxynaphthoesäure | 6,5 | 0 | |

2918299030 | Parahydroxybenzoesäure | 6,5 | 0 | |

2918299040 | Salze und Ester der Gallussäure | 6,5 | 0 | |

2918299090 | andere | 6,5 | 0 | |

2918301000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2918309000 | andere | 6,5 | 0 | |

2918910000 | 2,4,5-T (ISO) (2,4,5-Trichlorphenoxyessigsäure), ihre Salze und Ester | 6,5 | 0 | |

2918991000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2918999000 | andere | 6,5 | 0 | |

2919100000 | Tris(2,3-dibrompropyl)phosphat | 6,5 | 0 | |

2919901011 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2919901019 | andere | 6,5 | 0 | |

2919901020 | Glycerophosphatsäure | 6,5 | 0 | |

2919901090 | andere | 6,5 | 0 | |

2919902000 | Salze der Ester der Phosphorsäuren | 6,5 | 0 | |

2919909000 | andere | 6,5 | 0 | |

2920111000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2920119000 | andere | 6,5 | 0 | |

2920191000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2920199010 | 0,0-Dimethyl-0-(3-methyl-4-nitrophenyl)thiophosphat | 6,5 | 0 | |

2920199090 | andere | 6,5 | 0 | |

2920901010 | Dimethylsulfat | 6,5 | 0 | |

2920901020 | Diethylsulfat | 6,5 | 0 | |

2920901090 | andere | 6,5 | 0 | |

2920902000 | der Ester der salpetrigen Säure und der Salpetersäure | 6,5 | 0 | |

2920903000 | der Ester der Kohlensäure | 6,5 | 0 | |

2920904010 | Dimethylphosphit | 6,5 | 0 | |

2920904020 | Diethylphosphit | 6,5 | 0 | |

2920904030 | Trimethylphosphit | 6,5 | 0 | |

2920904040 | Triethylphosphit | 6,5 | 0 | |

2920909010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2920909090 | andere | 6,5 | 0 | |

2921111010 | Methylamin | 6,5 | 0 | |

2921111020 | Salze des Methylamins | 6,5 | 0 | |

2921112010 | Dimethylamin | 6,5 | 0 | |

2921112020 | Salze des Dimethylamins | 6,5 | 0 | |

2921113010 | Trimethylamin | 6,5 | 0 | |

2921113020 | Salze des Trimethylamins | 6,5 | 0 | |

2921191000 | Hydrochlorid des Dimethylaminoethylchlorids | 6,5 | 0 | |

2921192000 | Diethylamin und seine Salze | 6,5 | 0 | |

2921199010 | Dimethyllaurylamin | 6,5 | 0 | |

2921199020 | Chlormethin (Bis-(2-chlorethyl)methylamin) | 6,5 | 0 | |

2921199030 | Bis-(2-chlorethyl)ethylamin | 6,5 | 0 | |

2921199040 | Trichlormethin (Tris-(2-chlorethyl)amin) | 6,5 | 0 | |

2921199050 | Diisopropylamin | 6,5 | 0 | |

2921199060 | N,N-Diisopropyl-(beta)-aminoethylchlorid | 6,5 | 0 | |

2921199070 | N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)2-chlorethylamine und ihre protonierten Salze | 6,5 | 0 | |

2921199090 | andere | 6,5 | 0 | |

2921211000 | Ethylendiamin | 6,5 | 0 | |

2921212000 | Salze des Ethylendiamins | 6,5 | 0 | |

2921221000 | Hexamethylendiamin | 6,5 | 0 | |

2921222000 | Hexamethylendiaminadipat | 6,5 | 0 | |

2921229000 | andere | 6,5 | 0 | |

2921291000 | Diethylentriamin | 5 | 0 | |

2921292000 | Triethylentetramin | 5 | 0 | |

2921299000 | andere | 5 | 0 | |

2921301000 | Cyclohexylamin | 6,5 | 0 | |

2921309000 | andere | 6,5 | 0 | |

2921411000 | Anilin | 6,5 | 0 | |

2921412000 | Salze des Anilins | 6,5 | 0 | |

2921421000 | Nitrohalogenderivate des Anilins | 6,5 | 0 | |

2921422000 | 2,4,5-Trichloranilin | 6,5 | 0 | |

2921429010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2921429090 | andere | 6,5 | 0 | |

2921431000 | Paratoluidin-m-sulfonsäure und ihre Salze | 6,5 | 0 | |

2921432000 | 2-Chlorparatoluidin-5-sulfonsäure und ihre Salze | 6,5 | 0 | |

2921433000 | 3-Amino-6-chlortoluol-4-sulfonsäure und ihre Salze | 6,5 | 0 | |

2921439010 | Toluidine | 6,5 | 0 | |

2921439091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2921439099 | andere | 6,5 | 0 | |

2921441000 | Diphenylamin | 6,5 | 0 | |

2921449000 | andere | 6,5 | 0 | |

2921451000 | 1-Naphthylamin-4-sulfonsäure und ihre Salze | 6,5 | 0 | |

2921459010 | 1-Naphthylamin (Alphanaphthylamin) und seine Salze | 6,5 | 0 | |

2921459020 | 2-Naphthylamin (Betanaphthylamin) und seine Salze | 6,5 | 0 | |

2921459030 | 2-Naphthylamin-3,6,8-trisulfonsäure und ihre Salze | 5 | 0 | |

2921459090 | andere | 6,5 | 0 | |

2921460000 | Amfetamin (INN), Benzfetamin (INN), Dexamfetamin (INN), Etilamfetamin (INN), Fencamfamin (INN), Lefetamin (lNN), Levamfetamin (INN), Mefenorex (INN) und Phentermin (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2921491000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2921499000 | andere | 6,5 | 0 | |

2921511000 | N-Phenyl-N′-isopropyl-paraphenylendiamin | 6,5 | 0 | |

2921512000 | N-(1,3-Dimethylbutyl)-N′-phenyl-paraphenylendiamin | 6,5 | 0 | |

2921519010 | o-Phenylendiamin | 6,5 | 0 | |

2921519020 | m-Phenylendiamin | 6,5 | 0 | |

2921519030 | p-Phenylendiamin | 6,5 | 0 | |

2921519040 | Diaminotoluole | 6,5 | 0 | |

2921519090 | andere | 6,5 | 0 | |

2921591000 | Salze der 3,3-Dichlorbenzidinsulfonsäure | 6,5 | 0 | |

2921599010 | Benzidin | 6,5 | 0 | |

2921599020 | Benzidindihydrochlorid | 6,5 | 0 | |

2921599030 | 4,4′-Diaminostilben-2,2′-disulfonsäure und ihre Salze | 6,5 | 0 | |

2921599040 | Salze des Benzidins, ausgenommen Benzidindihydrochlorid | 6,5 | 0 | |

2921599050 | o-Tolidin und seine Salze | 6,5 | 0 | |

2921599090 | andere | 6,5 | 0 | |

2922111000 | Monoethanolamin | 6,5 | 0 | |

2922112000 | Salze des Monoethanolamins | 6,5 | 0 | |

2922121000 | Diethanolamin | 6,5 | 0 | |

2922122000 | Salze des Diethanolamins | 6,5 | 0 | |

2922131000 | Triethanolamin | 3 | 0 | |

2922132000 | Salze des Triethanolamins | 6,5 | 0 | |

2922140000 | Dextropropoxyphen (INN) und seine Salze | 6,5 | 0 | |

2922191000 | Arylethanolamine | 6,5 | 0 | |

2922193010 | N,N-Dimethyl-2-aminoethanol und seine protonierten Salze | 6,5 | 0 | |

2922193020 | N,N-Diethyl-2-aminoethanol und seine protonierten Salze | 6,5 | 0 | |

2922193090 | andere | 6,5 | 0 | |

2922194000 | Ethyldiethanolamin | 6,5 | 0 | |

2922195000 | Methyldiethanolamin | 6,5 | 0 | |

2922196000 | Diethylaminoethanol | 6,5 | 0 | |

2922199000 | andere | 6,5 | 0 | |

2922211000 | 7-Amino-1-naphthol-3-sulfonsäure (Gammasäure) und ihre Salze | 6,5 | 0 | |

2922212000 | 8-Amino-1-naphthol-3,6-disulfonsäure (H-Säure) und ihre Salze | 3 | 0 | |

2922213000 | 2-Amino-5-naphthol-7-disulfonsäure (J-Säure) und ihre Salze | 6,5 | 0 | |

2922219000 | andere | 6,5 | 0 | |

2922291000 | Paraaminophenol | 6,5 | 0 | |

2922299010 | Metaaminophenol | 6,5 | 0 | |

2922299020 | Orthoaminophenol | 6,5 | 0 | |

2922299030 | Aminokresole | 6,5 | 0 | |

2922299040 | Phenetidin und seine Salze | 6,5 | 0 | |

2922299090 | andere | 6,5 | 0 | |

2922310000 | Amfepramon (INN), Methadon (INN) und Normethadon (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2922392000 | Aminoanthrachinone und ihre Salze | 6,5 | 0 | |

2922393000 | Derivate der Aminoanthrachinone | 6,5 | 0 | |

2922399000 | andere | 6,5 | 0 | |

2922411000 | Lysin | 6,5 | 0 | |

2922412000 | Erster des Lysins | 6,5 | 0 | |

2922413000 | Salze des Lysins und seiner Ester | 6,5 | 0 | |

2922421000 | Glutaminsäure | 5 | 0 | |

2922422000 | Natriumglutamat | 8 | 0 | |

2922423000 | andere Salze der Glutaminsäure | 6,5 | 0 | |

2922431000 | Anthranilsäure | 6,5 | 0 | |

2922439000 | Salze der Anthranilsäure | 6,5 | 0 | |

2922440000 | Tilidin (INN) und seine Salze | 6,5 | 0 | |

2922491000 | Glycin | 6,5 | 0 | |

2922492000 | Alanin | 6,5 | 0 | |

2922493000 | Leucin | 6,5 | 0 | |

2922494000 | Valin | 6,5 | 0 | |

2922495000 | Asparaginsäure | 6,5 | 0 | |

2922496000 | Phenylglycin | 6,5 | 0 | |

2922497000 | Ethylparaaminobenzoat | 6,5 | 0 | |

2922499000 | andere | 6,5 | 0 | |

2922501000 | Serin | 6,5 | 0 | |

2922502000 | Paraaminosalicylsäure und ihre Salze | 6,5 | 0 | |

2922503000 | 1-p-Nitrophenol-2-amino-1,3-propandiol | 6,5 | 0 | |

2922504000 | Di-alpha-Hydroxyphenylglycin | 6,5 | 0 | |

2922509010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

2922509090 | andere | 6,5 | 3 | |

2923101000 | Cholin | 6,5 | 0 | |

2923102000 | Salze des Cholins | 6,5 | 0 | |

2923201000 | Lecithine | 6,5 | 0 | |

2923202000 | andere Phosphoaminolipide | 6,5 | 0 | |

2923900000 | andere | 6,5 | 3 | |

2924110000 | Meprobamat (INN) | 6,5 | 0 | |

2924121000 | Fluoracetamid (ISO) | 6,5 | 0 | |

2924122000 | Monocrotophos (ISO) | 6,5 | 0 | |

2924123000 | Phosphamidon (ISO) | 6,5 | 0 | |

2924191000 | Dimethylformamid | 6,5 | 0 | |

2924192000 | Dimethylacetamid | 6,5 | 0 | |

2924199010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2924199090 | andere | 6,5 | 0 | |

2924211000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2924219000 | andere | 6,5 | 0 | |

2924230000 | 2-Acetamidobenzoesäure (N-Acetylanthranilsäure) und ihre Salze | 6,5 | 0 | |

2924240000 | Ethinamat (INN) | 6,5 | 0 | |

2924291010 | Aminoacetanilid und seine Derivate | 6,5 | 0 | |

2924291020 | Acetaminophen | 6,5 | 0 | |

2924291090 | andere | 6,5 | 0 | |

2924292000 | Acetoacetanilid und seine Derivate | 5 | 0 | |

2924299010 | Lidocainhydrochlorid | 6,5 | 0 | |

2924299091 | Iopromid, Iopamidol und Iomeprol | 0 | 0 | |

2924299092 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2924299099 | andere | 6,5 | 0 | |

2925111000 | Saccharin | 6,5 | 0 | |

2925112000 | Salze des Saccharins | 6,5 | 0 | |

2925120000 | Glutethimid (INN) | 6,5 | 0 | |

2925191000 | Phthalimid | 6,5 | 0 | |

2925199010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2925199090 | andere | 6,5 | 0 | |

2925210000 | Chlordimeform (ISO) | 6,5 | 5 | |

2925291000 | Diphenylguanidin | 6,5 | 0 | |

2925299010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 5 | |

2925299090 | andere | 6,5 | | |

–Guanidin | | 0 | |

–andere | | 5 | |

2926100000 | Acrylnitril | 6,5 | 0 | |

2926200000 | 1-Cyanoguanidin (Dicyandiamid) | 6,5 | 0 | |

2926300000 | Fenproporex (INN) und seine Salze; Methadon (INN)-Zwischenerzeugnis (4-Cyano-2-dimethylamino-4,4-diphenylbutan) | 6,5 | 0 | |

2926901000 | Acetonitril | 6,5 | 0 | |

2926902000 | 1,4-Diamino-2,3-dicyanoanthrachinon | 6,5 | 0 | |

2926909010 | Malononitril | 6,5 | 0 | |

2926909091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2926909099 | andere | 6,5 | 0 | |

2927001100 | 6-Nitro-1-diazo-2-naphthol-4-sulfonsäure | 6,5 | 0 | |

2927001900 | andere | 6,5 | 0 | |

2927002100 | Azodicarbonamid | 8 | 0 | |

2927002910 | Azoisobutyronitril | 8 | 0 | |

2927002990 | andere | 8 | 0 | |

2927003000 | Azoxyverbindungen | 6,5 | 0 | |

2928001000 | Phenylhydrazin | 6,5 | 0 | |

2928009010 | Perillartin | 6,5 | 0 | |

2928009020 | Methylethylketoxim | 6,5 | 0 | |

2928009091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2928009099 | andere | 6,5 | 0 | |

2929101000 | Toluoldiisocyanat | 6,5 | 0 | |

2929102000 | Diphenylmethandiisocyanat | 6,5 | 0 | |

2929109000 | andere | 6,5 | 0 | |

2929901000 | Isocyanide | 6,5 | 0 | |

2929903000 | Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)N,N-Dialkyl(Methyl-, Ethyl, n-Propyl- oder Isopropyl) phosphoramidate | 6,5 | 0 | |

2929904000 | Diethyl-N,N-dimethylphosphoramidate | 6,5 | 0 | |

2929905000 | O-Ethyl-2-diisopropylaminoethylmethylphosphonit | 6,5 | 0 | |

2929906000 | N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl)phosphoraminodihalogenide | 6,5 | 0 | |

2929909000 | andere | 6,5 | 0 | |

2930201010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2930201090 | andere | 6,5 | 0 | |

2930202010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2930202090 | andere | 6,5 | 0 | |

2930301000 | Thiurammonosulfide | 6,5 | 0 | |

2930302000 | Thiuramdisulfide | 6,5 | 0 | |

2930303000 | Thiuramtetrasulfide | 6,5 | 0 | |

2930400000 | Methionin | 6,5 | 0 | |

2930501000 | Captafol (ISO) | 6,5 | 0 | |

2930502000 | Methamidophos (ISO) | 6,5 | 0 | |

2930901000 | Natrium-2-amino-4-methylthiobutylat | 6,5 | 0 | |

2930902010 | Thioharnstoff | 6,5 | 0 | |

2930902020 | Thiocarbanilid | 6,5 | 0 | |

2930902091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2930902099 | andere | 6,5 | 0 | |

2930903010 | Thioalkohole | 6,5 | 0 | |

2930903020 | Thiophenole | 6,5 | 0 | |

2930903030 | N,N-Diisopropyl-β-aminoethanthiol | 6,5 | 0 | |

2930903040 | N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)aminoethan-2-thiole und ihre protonierten Salze | 6,5 | 0 | |

2930904010 | Thiodiglycol(bis(2-hydroxyethyl)sulfid) | 6,5 | 0 | |

2930904020 | Thioanilin | 6,5 | 0 | |

2930904090 | andere | 6,5 | 0 | |

2930905010 | 2-Chlorethylchlormethylsulfid | 6,5 | 0 | |

2930905020 | Bis(2-chlorethyl)sulfid | 6,5 | 0 | |

2930905030 | Bis(2-chlorethylthio)methan | 6,5 | 0 | |

2930905040 | 1,2-Bis(2-chlorethylthio)ethan | 6,5 | 0 | |

2930905050 | 1,3-Bis(2-chlorethylthio)-n-propan | 6,5 | 0 | |

2930905060 | 1,4-Bis(2-chlorethylthio)-n-butan | 6,5 | 0 | |

2930905070 | 1,5-Bis(2-chlorethylthio)-n-pentan | 6,5 | 0 | |

2930905081 | Bis(2-chlorethylthiomethyl)ether | 6,5 | 0 | |

2930905082 | Bis(2-chlorethylthioethyl)ether | 6,5 | 0 | |

2930905090 | andere | 6,5 | 0 | |

2930906000 | [S-2-(Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)amino)ethyl] Wasserstoffalkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonothioate und ihre O-Alkyl-(≤ C10, einschließlich Cycloalkyl)ester; alkylierte oder protonierte Salze dieser Erzeugnisse | 6,5 | 0 | |

2930907000 | O,O-Diethyl-S-[2-(diethylamino)ethyl] phosphorthioat und seine alkylierten oder protonierten Salze | 6,5 | 0 | |

2930908000 | O-Ethyl-S-phenyl-ethyldithiophosphonat (Fonofos) | 6,5 | 0 | |

2930909010 | Thiosäuren | 6,5 | 0 | |

2930909020 | Isothiocyanate | 6,5 | 0 | |

2930909030 | Cystein | 6,5 | 0 | |

2930909040 | Cystin | 6,5 | 0 | |

2930909050 | Glutathion | 6,5 | 0 | |

2930909060 | 8-Chlor-6-tosylsäureethylester | 6,5 | 0 | |

2930909070 | ein Phosphoratom enthaltend, an das eine Methyl-, Ethyl-, n-Propyl- oder Isopropyl-Gruppe, jedoch keine weiteren Kohlenstoffatome gebunden sind | 6,5 | 0 | |

2930909080 | Dithiocarbonate (Xanthate) | 6,5 | 0 | |

2930909091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2930909099 | andere | 6,5 | 0 | |

2931002010 | 2-Chlorvinyldichlorarsin | 6,5 | 0 | |

2931002020 | Bis(2-chlorvinyl)chlorarsin | 6,5 | 0 | |

2931002030 | Tris(2-chlorvinyl)arsin | 6,5 | 0 | |

2931002091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2931002099 | andere | 6,5 | 0 | |

2931003100 | [O-2-(Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)amino)ethyl] Wasserstoffalkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonite und ihre O-Alkyl(≤ C10, einschließlich Cycloalkyl)ester; alkylierte oder protonierte Salze dieser Erzeugnisse | 6,5 | 0 | |

2931003300 | O-Isopropylmethylphosphonchloridat | 6,5 | 0 | |

2931003400 | O-Pinacolylmethylphosphonchloridat | 6,5 | 0 | |

2931003500 | O-Alkyl(≤ C10, einschließlich Cycloalkyl) Alkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonofluoridate | 6,5 | 0 | |

2931003700 | O-Alkyl(< C10, einschließlich Cycloalkyl) N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphoramidocyanidate | 6,5 | 0 | |

2931003911 | Dimethylmethylphosphonat | 6,5 | 0 | |

2931003912 | Diethylethylphosphonat | 6,5 | 0 | |

2931003913 | Diethylmethylphosphonat | 6,5 | 0 | |

2931003914 | Dimethylethylphosphonat | 6,5 | 0 | |

2931003915 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2931003919 | andere | 6,5 | 0 | |

2931004010 | Alkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonsäuredifluoride | 6,5 | 0 | |

2931004090 | andere | 6,5 | 0 | |

2931005010 | Methylphosphonsäuredichlorid | 6,5 | 0 | |

2931005020 | Methylphosphonigsäuredichlorid | 6,5 | 0 | |

2931005030 | Ethylphosphonsäuredichlorid | 6,5 | 0 | |

2931005040 | Ethylphosphonigsäuredichlorid | 6,5 | 0 | |

2931005090 | andere | 6,5 | 0 | |

2931009010 | Dibutylzinnoxid | 6,5 | 0 | |

2931009020 | Diethylaluminiumchlorid | 6,5 | 0 | |

2931009091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2931009099 | andere | 6,5 | 0 | |

2932110000 | Tetrahydrofuran | 6,5 | 0 | |

2932120000 | 2-Furaldehyd (Furfural) | 6,5 | 0 | |

2932131000 | Furfurylalkohol | 6,5 | 0 | |

2932132000 | Tetrahydrofurfurylalkohol | 6,5 | 0 | |

2932191000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2932199000 | andere | 6,5 | 0 | |

2932211000 | Cumarin | 5 | 0 | |

2932212000 | Methylcumarine | 5 | 0 | |

2932213000 | Ethylcumarine | 5 | 0 | |

2932291000 | Nonalacton | 5 | 0 | |

2932292000 | Undecalacton | 5 | 0 | |

2932293000 | Butyrolacton | 5 | 0 | |

2932294000 | Santonin | 5 | 0 | |

2932295000 | Phenolphthalein | 5 | 0 | |

2932296000 | Glucuronolacton | 5 | 0 | |

2932297000 | Dehydracetsäure und ihre Salze | 5 | 0 | |

2932298000 | Acetylketen (Diketen) | 5 | 0 | |

2932299010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2932299090 | andere | 5 | 0 | |

2932910000 | Isosafrol | 6,5 | 0 | |

2932920000 | 1-(1,3-Benzodioxol-5-yl)propan-2-on | 6,5 | 0 | |

2932930000 | Piperonal | 6,5 | 0 | |

2932940000 | Safrol | 6,5 | 0 | |

2932950000 | Tetrahydrocannabinole (alle Isomere) | 6,5 | 0 | |

2932991000 | Dioxane | 6,5 | 0 | |

2932992000 | Benzofuran (Cumaron) | 6,5 | 0 | |

2932999010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2932999090 | andere | 6,5 | 0 | |

2933111000 | Methylen-bis(1-phenyl-2,3-dimethyl-4-methylaminopyrazolon-5) | 6,5 | 0 | |

2933119010 | Phenazon (Antipyrin) | 6,5 | 0 | |

2933119030 | Sulpyrin | 6,5 | 0 | |

2933119040 | Isopropylantipyrin | 6,5 | 0 | |

2933119091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2933119099 | andere | 6,5 | 0 | |

2933191000 | Pyrazolon und seine Derivate | 6,5 | 0 | |

2933199010 | Phenylbutazon | 6,5 | 0 | |

2933199020 | Pyrazolat | 6,5 | 0 | |

2933199091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2933199099 | andere | 6,5 | 0 | |

2933211000 | Hydantoin | 6,5 | 0 | |

2933212000 | Derivate des Hydantoins | 6,5 | 0 | |

2933291000 | Lysidin | 6,5 | 0 | |

2933299010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

2933299090 | andere | 6,5 | 3 | |

2933311000 | Pyridin | 6,5 | 0 | |

2933312000 | Salze des Pyridins | 6,5 | 0 | |

2933321000 | Piperidin | 6,5 | 0 | |

2933329000 | Salze des Piperidins | 6,5 | 0 | |

2933330000 | Alfentanil (INN), Anileridin (INN), Bezitramid (INN), Bromazepam (INN), Difenoxin (INN), Diphenoxylat (INN), Dipipanon (INN), Fentanyl (INN), Ketobemidon (INN), Methylphenidat (INN), Pentazocin (INN), Pethidin (INN), Pethidin (INN)-Zwischenerzeugnis A, Phencyclidin (INN) (PCP), Phenoperidin (INN), Pipradrol (INN), Piritramid (INN), Propiram (INN) und Trimeperidin (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2933391000 | Isonicotinsäurehydrazid | 6,5 | 0 | |

2933393000 | 3-Hydroxy-1-methylpiperidin | 6,5 | 0 | |

2933394000 | 3-Chinuclidinylbenzilat | 6,5 | 0 | |

2933395000 | Chinuclidin-3-ol | 6,5 | 0 | |

2933399010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

2933399090 | andere | 6,5 | 3 | |

2933410000 | Levorphanol (INN) und seine Salze | 6,5 | 0 | |

2933491000 | Pyrviniumpamoat | 6,5 | 0 | |

2933499010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2933499090 | andere | 6,5 | 0 | |

2933520000 | Malonylharnstoff (Barbitursäure) und seine Salze | 6,5 | 0 | |

2933530000 | Allobarbital (INN), Amobarbital (INN), Barbital (INN), Butalbital (INN), Butobarbital, Cyclobarbital (INN), Methylphenobarbital (INN), Pentobarbital (INN), Phenobarbital (INN), Secbutabarbital (INN), Secobarbital (INN) und Vinylbital (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2933540000 | andere Derivate von Malonylharnstoff (Barbitursäure); Salze dieser Erzeugnisse | 6,5 | 0 | |

2933550000 | Loprazolam (INN), Mecloqualon (INN), Methaqualon (INN) und Zipeprol (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2933591100 | 5-Fluorouracil | 6,5 | 0 | |

2933591910 | Pyrimidin | 6,5 | 0 | |

2933591991 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2933591999 | andere | 6,5 | 0 | |

2933592010 | Piperazin | 6,5 | 0 | |

2933592020 | Piperazincitrat | 6,5 | 0 | |

2933592030 | Piperazinadipat | 6,5 | 0 | |

2933592040 | 1-Amino-4-methylpiperazin | 6,5 | 0 | |

2933592090 | andere | 6,5 | 0 | |

2933599000 | andere | 6,5 | 0 | |

2933610000 | Melamin | 6,5 | 0 | |

2933691000 | Cyanurchlorid | 3 | 0 | |

2933692000 | Hexamethylentetramin | 6,5 | 0 | |

2933699010 | Trimethylentrinitramin | 6,5 | 0 | |

2933699091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2933699099 | andere | 6,5 | 0 | |

2933710000 | 6-Hexanlactam (epsilon-Caprolactam) | 3 | 3 | |

2933720000 | Clobazam (INN) und Methyprylon (INN) | 6,5 | 0 | |

2933791000 | Isatin | 6,5 | 0 | |

2933792000 | 2-Hydroxychinolin | 6,5 | 0 | |

2933793000 | 1-Vinyl-2-pyrrolidon | 6,5 | 0 | |

2933799000 | andere | 6,5 | 0 | |

2933910000 | Alprazolam (INN), Camazepam (INN), Chlordiazepoxid (INN), Clonazepam (INN), Clorazepat, Delorazepam (INN), Diazepam (lNN), Estazolam (INN), Ethylloflazepat (INN), Fludiazepam (INN), Flunitrazepam (INN), Flurazepam (INN), Halazepam (INN), Lorazepam (INN), Lormetazepam (INN), Mazindol (INN), Medazepam (INN), Midazolam (INN), Nimetazepam (INN), Nitrazepam (INN), Nordazepam (INN), Oxazepam (INN), Pinazepam (INN), Prazepam (INN), Pyrovaleron (INN), Temazepam (INN), Tetrazepam (INN) und Triazolam (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2933991000 | Indol und seine Derivate | 6,5 | 0 | |

2933999010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

2933999090 | andere | 6,5 | 3 | |

2934101000 | Aminothiazol und seine Derivate | 6,5 | 0 | |

2934109010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2934109090 | andere | 6,5 | 0 | |

2934201000 | Benzothiazol | 6,5 | 0 | |

2934202000 | Mercaptobenzothiazol | 6,5 | 0 | |

2934203000 | Dibenzothiazolyldisulfid | 6,5 | 0 | |

2934209010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2934209090 | andere | 6,5 | 0 | |

2934301000 | Phenothiazin (Thiodiphenylamin) | 6,5 | 0 | |

2934309000 | andere | 6,5 | 0 | |

2934910000 | Aminorex (INN), Brotizolam (INN), Clotiazepam (lNN), Cloxazolam (INN), Dextromoramid (INN), Haloxazolam (INN), Ketazolam (INN), Mesocarb (INN), Oxazolam (INN), Pemolin (INN), Phendimetrazin (INN), Phenmetrazin (INN) und Sufentanil (INN); Salze dieser Erzeugnisse | 6,5 | 0 | |

2934991000 | Morpholin | 6,5 | 0 | |

2934992000 | Nucleinsäuren, ihre Salze und Derivate | 8 | 0 | |

2934993000 | 7-Aminocephalosporansäure | 6,5 | 5 | |

2934999010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 5 | |

2934999090 | andere | 6,5 | 5 | |

2935002000 | 5-Amino-2-methyl-N-phenylbenzensulfonamid | 6,5 | 0 | |

2935003000 | Paratoluidin-3-sulfonanilid | 6,5 | 0 | |

2935004000 | 2-Amino-N-ethylbenzensulfonanilid | 6,5 | 0 | |

2935006000 | Sulfamethoxazol | 6,5 | 0 | |

2935007000 | Sulfamethoxin | 6,5 | 0 | |

2935008010 | Sulfamin | 6,5 | 0 | |

2935008020 | Sulfapyridin | 6,5 | 0 | |

2935008030 | Sulfadiazin | 6,5 | 0 | |

2935008040 | Sulfamerazin | 6,5 | 0 | |

2935008050 | Sulfathiazol | 6,5 | 0 | |

2935008090 | andere | 6,5 | 0 | |

2935009020 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2935009090 | andere | 6,5 | 0 | |

2936210000 | Vitamine A und ihre Derivate, ungemischt | 6,5 | 0 | |

2936220000 | Vitamin B1 und seine Derivate | 6,5 | 0 | |

2936230000 | Vitamin B2 und seine Derivate | 6,5 | 0 | |

2936240000 | D- oder DL-Pantothensäure (Vitamin B3 oder B5) und ihre Derivate | 6,5 | 0 | |

2936250000 | Vitamin B6 und seine Derivate | 6,5 | 0 | |

2936260000 | Vitamin B12 und seine Derivate | 6,5 | 0 | |

2936271000 | Ascorbinsäure | 6,5 | 0 | |

2936272000 | Natriumascorbat | 6,5 | 3 | |

2936273000 | Calciumascorbat | 6,5 | 0 | |

2936279000 | andere | 6,5 | 3 | |

2936281000 | Alpha-Tocopherolacetat | 6,5 | 0 | |

2936289000 | andere | 6,5 | 0 | |

2936291010 | Vitamin B9 | 6,5 | 0 | |

2936291090 | andere | 6,5 | 0 | |

2936292000 | Vitamine D und ihre Derivate | 6,5 | 0 | |

2936293000 | Vitamin H und seine Derivate | 6,5 | 0 | |

2936294000 | Vitamine K und ihre Derivate | 6,5 | 0 | |

2936295000 | Nicotinamid und seine Derivate | 6,5 | 0 | |

2936299000 | andere | 6,5 | 0 | |

2936901000 | Provitamine, ungemischt | 6,5 | 0 | |

2936909000 | andere | 6,5 | 0 | |

2937111000 | der Unterposition 2933 9 oder 2934 9 | 6,5 | 0 | |

2937119000 | andere | 0 | 0 | |

2937120000 | Insulin und seine Salze | 0 | 0 | |

2937191000 | der Unterposition 2933 9 oder 2934 9 | 6,5 | 0 | |

2937199000 | andere | 0 | 0 | |

2937211000 | Cortison | 0 | 0 | |

2937212000 | Hydrocortison | 0 | 0 | |

2937213000 | Prednison | 0 | 0 | |

2937214000 | Prednisolon | 0 | 0 | |

2937220000 | Halogenderivate und halogenierte Derivate der Corticosteroide (Hormone der Nebennierenrinde) | 0 | 0 | |

2937230000 | Östrogene und Gestagene | 0 | 0 | |

2937292000 | der Unterposition 2914 50 | 5,5 | 0 | |

2937299000 | andere | 0 | 0 | |

2937310000 | Epinephrin | 0 | 0 | |

2937391000 | der Unterposition 2922 50 | 6,5 | 0 | |

2937399000 | andere | 0 | 0 | |

2937400000 | Aminosäure-Derivate | 0 | 0 | |

2937501000 | der Unterposition 2918 19 oder 2918 9 | 6,5 | 0 | |

2937502000 | der Unterposition 2934 9 | 6,5 | 0 | |

2937509000 | andere | 0 | 0 | |

2937901000 | der Unterposition 2933 9 oder 2934 9 | 6,5 | 0 | |

2937909000 | andere | 0 | 0 | |

2938101000 | Rutosid (Rutin) | 6,5 | 0 | |

2938102000 | Derivate des Rutosids | 6,5 | 0 | |

2938901000 | Digitalis-Glykoside | 6,5 | 0 | |

2938902000 | Glycyrrhizin und Glycyrrhizate | 6,5 | 0 | |

2938903000 | Saponine | 6,5 | 0 | |

2938904000 | Steviosid | 6,5 | 0 | |

2938909000 | andere | 6,5 | 0 | |

2939111000 | Morphin | 0 | 0 | |

2939112000 | Ethylmorphin | 0 | 0 | |

2939113000 | Codein | 0 | 0 | |

2939114000 | Mohnstrohkonzentrate mit einem Gehalt an Alkaloiden von 50 GHT oder mehr | 8 | 0 | |

2939119000 | andere | 0 | 0 | |

2939190000 | andere | 0 | 0 | |

2939200000 | Chinaalkaloide und ihre Derivate; Salze dieser Erzeugnisse | 0 | 0 | |

2939300000 | Coffein und seine Salze | 0 | 0 | |

2939411000 | Ephedrine | 0 | 0 | |

2939419000 | Salze der Ephedrine | 0 | 0 | |

2939421000 | Pseudoephedrin (INN) | 0 | 0 | |

2939429000 | Salze des Pseudoephedrins | 0 | 0 | |

2939430000 | Cathin (INN) und seine Salze | 0 | 0 | |

2939491000 | Norephedrin | 0 | 0 | |

2939499000 | andere | 0 | 0 | |

2939510000 | Fenetyllin (INN) und seine Salze | 0 | 0 | |

2939590000 | andere | 0 | 0 | |

2939611000 | Ergometrin (INN) | 0 | 0 | |

2939619000 | Salze des Ergometrins (INN) | 0 | 0 | |

2939621000 | Ergotamin (INN) | 0 | 0 | |

2939629000 | Salze des Ergotamins (INN) | 0 | 0 | |

2939631000 | Lysergsäure | 0 | 0 | |

2939639000 | Salze der Lysergsäure | 0 | 0 | |

2939690000 | andere | 0 | 0 | |

2939910000 | Cocain, Ecgonin, Levometamfetamin, Metamfetamin (INN), Metamfetamin-Racemat; ihre Salze, Ester und anderen Derivate | 0 | 0 | |

2939991000 | Atropin und Homatropin | 0 | 0 | |

2939992000 | Arecolin | 0 | 0 | |

2939993000 | Piperin | 0 | 0 | |

2939994000 | Nicotin und seine Salze | 0 | 0 | |

2939999000 | andere | 0 | 0 | |

2940001010 | Galactose | 8 | 0 | |

2940001020 | Sorbose | 8 | 0 | |

2940001030 | Xylose | 8 | 0 | |

2940001090 | andere | 8 | 0 | |

2940002010 | Hydroxypropylsaccharose | 8 | 0 | |

2940002090 | andere | 8 | 0 | |

2941101000 | Penicillin G-Kalium | 6,5 | 0 | |

2941109010 | Penicillin G-Natrium | 6,5 | 0 | |

2941109020 | Penicillin V | 6,5 | 0 | |

2941109090 | andere | 6,5 | 0 | |

2941201000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

2941209000 | andere | 6,5 | 0 | |

2941301000 | Chlortetracyclin | 6,5 | 0 | |

2941302000 | Oxytetracyclinhydrochlorid | 6,5 | 0 | |

2941303000 | Chlortetracyclinhydrochlorid | 6,5 | 0 | |

2941309000 | andere | 6,5 | 0 | |

2941400000 | Chloramphenicol und seine Derivate; Salze dieser Erzeugnisse | 6,5 | 0 | |

2941501000 | Erythromycinthiocyanat | 6,5 | 0 | |

2941509000 | andere | 6,5 | 0 | |

2941902000 | 11-Alpha-chlor-6-deoxy-6-demethyl-6-methylen-5-oxytetracyclin-paratoluolsulfonat | 6,5 | 0 | |

2941909010 | Kanamycinsulfat | 6,5 | 0 | |

2941909020 | Ledermycin | 6,5 | 0 | |

2941909030 | Gentamycinsulfat | 6,5 | 0 | |

2941909040 | Leucomycin | 6,5 | 0 | |

2941909091 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

2941909099 | andere | 6,5 | 3 | |

2942001000 | Ketene | 6,5 | 0 | |

2942009010 | Kupferacetoarsenit | 6,5 | 0 | |

2942009090 | andere | 6,5 | 0 | |

3001201000 | Auszüge aus Drüsen | 0 | 0 | |

3001202000 | Leberextrakte | 0 | 0 | |

3001203000 | Gallenblasenextrakte | 0 | 0 | |

3001204000 | Pankreasextrakte | 0 | 0 | |

3001205000 | Magenextrakte | 0 | 0 | |

3001209000 | andere | 0 | 0 | |

3001901010 | von Menschen | 0 | 0 | |

3001901090 | andere | 0 | 0 | |

3001902010 | Bärengalle | 0 | 0 | |

3001902090 | andere | 0 | 0 | |

3001909010 | Heparin und seine Salze | 0 | 0 | |

3001909020 | von Menschen | 0 | 0 | |

3001909090 | andere | 0 | 0 | |

3002101000 | Zubereitungen aus Blutfraktionen, in Aufmachungen für Arzneiwaren | 0 | 0 | |

3002102010 | Hämoglobin | 0 | 0 | |

3002102020 | Globuline | 0 | 0 | |

3002103000 | Thrombin und Prothrombinase | 0 | 0 | |

3002109010 | Antiseren | 0 | 0 | |

3002109020 | Seren und Blutplasma (ausgenommen synthetisch hergestellte) | 0 | 0 | |

3002109090 | andere | 0 | 0 | |

3002200000 | Vaccine für die Humanmedizin | 0 | 0 | |

3002301000 | Vaccine gegen Maul- und Klauenseuche | 0 | 0 | |

3002309000 | andere | 0 | 0 | |

3002901000 | menschliches Blut | 0 | 0 | |

3002902000 | tierisches Blut, zu therapeutischen, prophylaktischen oder diagnostischen Zwecken zubereitet | 0 | 0 | |

3002903010 | Saxitoxin | 6,5 | 0 | |

3002903020 | Ricin | 8 | 0 | |

3002903090 | andere | 0 | 0 | |

3002904000 | Mikrobenkultur | 0 | 0 | |

3002905000 | Viren und Antiviren | 0 | 0 | |

3002906000 | Bakteriophagen | 0 | 0 | |

3002909000 | andere | 0 | 0 | |

3003101000 | Penicilline oder ihre Derivate (mit Penicillansäuregerüst) enthaltend | 8 | 0 | |

3003102000 | Streptomycine oder ihre Derivate enthaltend | 8 | 0 | |

3003201000 | antituberkulöse und antikanzerogene Zubereitungen | 8 | 3 | |

3003209010 | Chloramphenicol enthaltende Zubereitungen | 8 | 0 | |

3003209090 | andere | 8 | 0 | |

3003310000 | Insulin enthaltend | 8 | 0 | |

3003391010 | Hypophysenvorderlappenhormone enthaltende Zubereitungen | 8 | 0 | |

3003391020 | Hypophysenhinterlappenhormone enthaltende Zubereitungen | 8 | 0 | |

3003392000 | Speicheldrüsenhormone enthaltende Zubereitungen | 8 | 0 | |

3003393000 | Schilddrüsen- und Nebenschilddrüsenhormone enthaltende Zubereitungen | 8 | 0 | |

3003394000 | anabolische Steroide enthaltende Zubereitungen | 8 | 0 | |

3003395000 | Hormone der Nebennierenrinde enthaltende Zubereitungen | 8 | 0 | |

3003396000 | Hormone des Nebennierenmarks enthaltende Zubereitungen | 8 | 0 | |

3003397000 | männliche Sexualhormone enthaltende Zubereitungen | 8 | 3 | |

3003398000 | Östrogene, Gestagene und Progestine enthaltende Zubereitungen | 8 | 0 | |

3003399000 | andere | 8 | 0 | |

3003401000 | antikanzerogene Zubereitungen | 8 | 0 | |

3003409110 | Morphin enthaltende Zubereitungen | 8 | 0 | |

3003409120 | Chinin enthaltende Zubereitungen | 8 | 0 | |

3003409130 | Theobromin enthaltende Zubereitungen | 8 | 0 | |

3003409210 | Coffein enthaltende Zubereitungen | 8 | 0 | |

3003409220 | Strychnin enthaltende Zubereitungen | 8 | 0 | |

3003409230 | Ephedrin enthaltende Zubereitungen | 8 | 0 | |

3003409310 | Cocain enthaltende Zubereitungen | 8 | 0 | |

3003409320 | Mutterkornalkaloide enthaltende Zubereitungen | 8 | 0 | |

3003409330 | Nicotin enthaltende Zubereitungen | 8 | 0 | |

3003409400 | Atropin und Homatropin enthaltende Zubereitungen | 8 | 0 | |

3003409500 | Arecolin enthaltende Zubereitungen | 8 | 0 | |

3003409600 | Piperin enthaltende Zubereitungen | 8 | 0 | |

3003409900 | andere | 8 | 0 | |

3003901000 | antituberkulöse, anthelmintische und antikanzerogene Zubereitungen | 8 | 0 | |

3003909100 | Aspirin enthaltende Zubereitungen | 8 | 0 | |

3003909200 | antiallergische Stoffe enthaltende Zubereitungen | 8 | 3 | |

3003909300 | Vitamine enthaltende Zubereitungen | 8 | 0 | |

3003909400 | Geweihe enthaltende Zubereitungen | 8 | 0 | |

3003909500 | Ginseng enthaltende Zubereitungen | 8 | 0 | |

3003909600 | Gelée royale enthaltende Zubereitungen | 8 | 0 | |

3003909900 | andere | 8 | 3 | |

3004101000 | Penicilline oder ihre Derivate (mit Penicillansäuregerüst) enthaltend | 8 | 0 | |

3004102000 | Streptomycine oder ihre Derivate enthaltend | 8 | 3 | |

3004201000 | antituberkulöse, anthelmintische und antikanzerogene Zubereitungen | 8 | 0 | |

3004209100 | Chloramphenicol enthaltende Zubereitungen | 8 | 0 | |

3004209200 | Erythromycin enthaltende Zubereitungen | 8 | 3 | |

3004209300 | Oxytetracyclin enthaltende Zubereitungen | 8 | 0 | |

3004209400 | Kanamycin enthaltende Zubereitungen | 8 | 0 | |

3004209900 | andere | 8 | 3 | |

3004310000 | Insulin enthaltend | 8 | 3 | |

3004320000 | Corticosteroidhormone, deren Derivate oder deren strukturverwandte Verbindungen enthaltend | 8 | 3 | |

3004391010 | Hypophysenvorderlappenhormone enthaltende Zubereitungen | 8 | 3 | |

3004391020 | Hypophysenhinterlappenhormone enthaltende Zubereitungen | 8 | 0 | |

3004392000 | Speicheldrüsenhormone enthaltende Zubereitungen | 8 | 0 | |

3004393000 | Schilddrüsen- und Nebenschilddrüsenhormone enthaltende Zubereitungen | 8 | 0 | |

3004394000 | anabolische Steroide enthaltende Zubereitungen | 8 | 0 | |

3004395000 | Hormone des Nebennierenmarks enthaltende Zubereitungen | 8 | 0 | |

3004396000 | männliche Sexualhormone enthaltende Zubereitungen | 8 | 0 | |

3004397000 | Östrogene, Gestagene und Progestine enthaltende Zubereitungen | 8 | 3 | |

3004399000 | andere | 8 | 3 | |

3004401000 | antikanzerogene Zubereitungen | 8 | 3 | |

3004409110 | Morphin enthaltende Zubereitungen | 8 | 0 | |

3004409120 | Chinin enthaltende Zubereitungen | 8 | 0 | |

3004409130 | Theobromin enthaltende Zubereitungen | 8 | 0 | |

3004409210 | Coffein enthaltende Zubereitungen | 8 | 0 | |

3004409220 | Strychnin enthaltende Zubereitungen | 8 | 0 | |

3004409230 | Ephedrin enthaltende Zubereitungen | 8 | 0 | |

3004409310 | Cocain enthaltende Zubereitungen | 8 | 0 | |

3004409320 | Mutterkornalkaloide enthaltende Zubereitungen | 8 | 0 | |

3004409330 | Nicotin enthaltende Zubereitungen | 8 | 3 | |

3004409400 | Atropin und Homatropin enthaltende Zubereitungen | 8 | 0 | |

3004409500 | Arecolin enthaltende Zubereitungen | 8 | 0 | |

3004409600 | Piperin enthaltende Zubereitungen | 8 | 0 | |

3004409900 | andere | 8 | 3 | |

3004501000 | Vitamin A enthaltende Zubereitungen | 8 | 0 | |

3004502010 | Vitamin B1 enthaltende Zubereitungen | 8 | 0 | |

3004502090 | andere | 8 | 3 | |

3004503000 | Vitamin C enthaltende Zubereitungen | 8 | 3 | |

3004504000 | Vitamin D enthaltende Zubereitungen | 8 | 0 | |

3004505000 | Vitamin E enthaltende Zubereitungen | 8 | 0 | |

3004506000 | Vitamin H enthaltende Zubereitungen | 8 | 0 | |

3004507000 | Vitamin K enthaltende Zubereitungen | 8 | 0 | |

3004509000 | andere | 8 | 3 | |

3004901000 | antituberkulöse, anthelmintische und antikanzerogene Zubereitungen | 8 | 3 | |

3004909100 | Aspirin enthaltende Zubereitungen | 8 | 0 | |

3004909200 | antiallergische Stoffe enthaltende Zubereitungen | 8 | 0 | |

3004909300 | Geweihe enthaltende Zubereitungen | 8 | 0 | |

3004909400 | Ginseng enthaltende Zubereitungen | 8 | 0 | |

3004909500 | Gelée royale enthaltende Zubereitungen | 8 | 0 | |

3004909900 | andere | 8 | 3 | |

3005101000 | Pflaster zum Heilgebrauch | 0 | 0 | |

3005109000 | andere | 0 | 0 | |

3005901000 | Watte | 0 | 0 | |

3005902000 | Gaze | 0 | 0 | |

3005903000 | Binden | 0 | 0 | |

3005904000 | zubereitetes Verbandzeug und Senfpflaster | 0 | 0 | |

3005909000 | andere | 0 | 0 | |

3006101010 | steriles chirurgisches Catgut | 0 | 0 | |

3006101020 | steriles Nahtmaterial (einschließlich sterile resorbierbare Garne zu chirurgischen oder zahnärztlichen Zwecken) | 0 | 0 | |

3006102000 | sterile Klebstoffe für organische Gewebe, die in der Chirurgie zum Schließen von Wunden verwendet werden | 0 | 0 | |

3006103000 | sterile Laminariastifte und -tampons | 0 | 0 | |

3006104000 | sterile resorbierbare Blut stillende Einlagen zu chirurgischen Zwecken | 0 | 0 | |

3006105010 | aus Kunststoff | 6,5 | 0 | |

3006105020 | aus Gewirken und Gestricken | 8 | 0 | |

3006105090 | andere | 0 | 0 | |

3006200000 | Reagenzien zum Bestimmen der Blutgruppen oder Blutfaktoren | 0 | 0 | |

3006301000 | Röntgenkontrastmittel | 0 | 0 | |

3006302000 | diagnostische Reagenzien zur Verwendung am Patienten | 0 | 0 | |

3006401000 | Zahnzement | 0 | 0 | |

3006402000 | Zahnfüllstoffe | 0 | 0 | |

3006403000 | Zement zum Wiederherstellen von Knochen | 0 | 0 | |

3006500000 | Taschen und andere Behältnisse mit Apothekenausstattung für erste Hilfe | 0 | 0 | |

3006600000 | empfängnisverhütende chemische Zubereitungen auf der Grundlage von Hormonen, von anderen Erzeugnissen der Position 2937 oder von Spermiziden | 0 | 0 | |

3006700000 | Zubereitungen in Form von Gelen, die in der Human- oder Veterinärmedizin als Gleitmittel für Körperteile bei chirurgischen Operationen oder medizinischen Untersuchungen oder als Kontaktmittel zwischen dem Körper und den medizinischen Geräten verwendet werden | 6,5 | 0 | |

3006910000 | Vorrichtungen erkennbar zur Verwendung für Stomata | 8 | 3 | |

3006921010 | Haut- und Knochentransplantate | 0 | 0 | |

3006921090 | andere | 0 | 0 | |

3006922010 | Zubereitungen aus Blutfraktionen, in Aufmachungen für Arzneiwaren | 0 | 0 | |

3006922020 | Hämoglobin und Globuline | 0 | 0 | |

3006922031 | Saxitoxin | 6,5 | 0 | |

3006922032 | Ricin | 8 | 0 | |

3006922090 | andere | 0 | 0 | |

3006923000 | der Position 3003 oder 3004 | 8 | 0 | |

3006924000 | der Position 3005 oder 3006 | 0 | 0 | |

3006925000 | der Unterposition 3824 90 | 6,5 | 0 | |

3101001010 | Guano | 6,5 | 0 | |

3101001090 | andere | 6,5 | 0 | |

3101002000 | pflanzliche Düngemittel | 6,5 | 0 | |

3101003000 | durch Mischen oder chemische Behandlung von tierischen oder pflanzlichen Erzeugnissen gewonnene Düngemittel | 6,5 | 0 | |

3102101000 | landwirtschaftliche Düngemittel oder für die Herstellung landwirtschaftlicher Düngemittel | 2 | 3 | |

3102109000 | andere | 6,5 | 3 | |

3102210000 | Ammoniumsulfat | 6,5 | 0 | |

3102291000 | Doppelsalze von Ammoniumsulfat und Ammoniumnitrat (Ammonsalpeter) | 6,5 | 0 | |

3102292000 | Mischungen von Ammoniumsulfat und Ammoniumnitrat (Ammonsalpeter) | 6,5 | 0 | |

3102300000 | Ammoniumnitrat (Ammonsalpeter), auch in wässriger Lösung | 6,5 | 0 | |

3102400000 | Mischungen von Ammoniumnitrat (Ammonsalpeter) und Calciumcarbonat oder anderen nicht düngenden anorganischen Stoffen | 6,5 | 0 | |

3102501000 | natürlich | 6,5 | 0 | |

3102509000 | andere | 6,5 | 0 | |

3102600000 | Doppelsalze und Mischungen von Calciumnitrat (Kalksalpeter) und Ammoniumnitrat (Ammonsalpeter) | 6,5 | 0 | |

3102800000 | Mischungen von Harnstoff und Ammoniumnitrat (Ammonsalpeter) in wässriger oder ammoniakalischer Lösung | 6,5 | 0 | |

3102901000 | Doppelsalze von Calciumnitrat (Kalksalpeter) und Magnesiumnitrat (Magnesiumsalpeter) | 6,5 | 0 | |

3102909000 | andere | 6,5 | 0 | |

3103100000 | Superphosphate | 6,5 | 0 | |

3103901000 | durch Glühen aufgeschlossene Calciumphosphate | 6,5 | 0 | |

3103902000 | Calciumhydrogenorthophosphat mit einem Gehalt an Fluor von 0,2 GHT oder mehr | 6,5 | 0 | |

3103903000 | anderes Calciumphosphat | 6,5 | 0 | |

3103904000 | Mischungen von Phosphatdüngemitteln | 6,5 | 0 | |

3103909000 | andere | 6,5 | 0 | |

3104200000 | Kaliumchlorid | 0 | 0 | |

3104301000 | nicht mehr als 52 GHT von K2O | 1 | 0 | |

3104309000 | andere | 6,5 | 0 | |

3104901010 | nicht mehr als 30 GHT von K2O | 1 | 0 | |

3104901090 | andere | 6,5 | 0 | |

3104909000 | andere | 1 | 0 | |

3105100000 | Erzeugnisse dieses Kapitels in Tabletten oder ähnlichen Formen oder in Packungen mit einem Rohgewicht von 10 kg oder weniger | 6,5 | 0 | |

3105200000 | mineralische oder chemische Düngemittel, die drei düngenden Stoffe Stickstoff, Phosphor und Kalium enthaltend | 6,5 | 0 | |

3105300000 | Diammoniumhydrogenorthophosphat (Diammoniumphosphat) | 6,5 | 0 | |

3105400000 | Ammoniumdihydrogenorthophosphat (Monoammoniumphosphat), auch mit Diammoniumhydrogenorthophosphat (Diammoniumphosphat) gemischt | 6,5 | 0 | |

3105510000 | Nitrate und Phosphate enthaltend | 6,5 | 0 | |

3105590000 | andere | 6,5 | 0 | |

3105600000 | mineralische oder chemische Düngemittel, die beiden düngenden Stoffe Phosphor und Kalium enthaltend | 6,5 | 0 | |

3105901000 | Düngemittel, Stickstoff und Kalium enthaltend | 6,5 | 0 | |

3105909000 | andere | 6,5 | 0 | |

3201100000 | Quebrachoauszug | 8 | 0 | |

3201200000 | Mimosaauszug | 8 | 0 | |

3201901010 | Mangrovenauszüge | 8 | 0 | |

3201901020 | Myrobalanauszüge | 8 | 0 | |

3201901030 | Sumachauszüge | 8 | 0 | |

3201901040 | Gambirauszüge | 8 | 0 | |

3201901090 | andere | 8 | 0 | |

3201902000 | Tannine (Gerbsäuren) und ihre Salze | 6,5 | 0 | |

3201903000 | Ether oder Ester von Tanninen | 6,5 | 0 | |

3201904000 | andere Derivate von Tanninen | 6,5 | 0 | |

3202101000 | aromatische synthetische Gerbstoffe | 6,5 | 0 | |

3202102000 | Alkylsulfonylchloride | 6,5 | 0 | |

3202103000 | Harzgerbstoffe | 6,5 | 0 | |

3202109000 | andere | 6,5 | 0 | |

3202901000 | anorganische Gerbstoffe | 6,5 | 0 | |

3202902000 | künstliche Beizen | 6,5 | 3 | |

3202909000 | andere | 6,5 | 0 | |

3203001100 | natürlicher Indigo | 6,5 | 0 | |

3203001910 | Blauholz | 6,5 | 0 | |

3203001920 | Sandelholz | 6,5 | 0 | |

3203001930 | Chlorophyll | 6,5 | 0 | |

3203001990 | andere | 6,5 | 0 | |

3203002010 | Cochenille | 6,5 | 0 | |

3203002020 | Kermes | 6,5 | 0 | |

3203002030 | Sepia | 6,5 | 0 | |

3203002090 | andere | 6,5 | 0 | |

3203003000 | Zubereitungen auf der Grundlage pflanzlicher oder tierischer Farbmittel | 6,5 | 0 | |

3204111000 | Zubereitungen auf der Grundlage von Dispersionsfarbstoffen (Presskuchen) | 4 | 0 | |

3204119000 | andere | 8 | 0 | |

3204121000 | Säurefarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204122000 | Beizenfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204130000 | basische Farbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204140000 | Direktfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204150000 | Küpenfarbstoffe (einschließlich der in diesem Zustand als Pigmente verwendbaren) und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204160000 | Reaktivfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204170000 | Pigmente (organische) und Zubereitungen auf der Grundlage dieser Farbmittel | 8 | 0 | |

3204191000 | Lösungsmittelfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204192000 | Rapidechtfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204193000 | Sulfidfarbstoffe und Sulfidküpenfarbstoffe und Zubereitungen auf der Grundlage dieser Farbstoffe | 8 | 0 | |

3204199000 | andere | 8 | 0 | |

3204200000 | synthetische organische Erzeugnisse von der als fluoreszierende Aufheller verwendeten Art | 6,5 | 0 | |

3204901000 | synthetische organische Erzeugnisse von der als Luminophore verwendeten Art | 6,5 | 0 | |

3204909000 | andere | 6,5 | 0 | |

3205001000 | Kunststoffpigmentfarbgrundstoffe | 6,5 | 0 | |

3205009000 | andere | 6,5 | 0 | |

3206110000 | mit einem Gehalt an Titandioxid von 80 GHT oder mehr, bezogen auf die Trockensubstanz | 6,5 | 0 | |

3206190000 | andere | 6,5 | 0 | |

3206200000 | Pigmente und Zubereitungen auf der Grundlage von Chromverbindungen | 6,5 | 0 | |

3206411000 | Ultramarin | 6,5 | 0 | |

3206419000 | andere | 6,5 | 0 | |

3206421000 | Lithopone | 6,5 | 0 | |

3206429000 | andere | 6,5 | 0 | |

3206491000 | Zinkgrau | 6,5 | 0 | |

3206492000 | Mineralschwarz | 6,5 | 0 | |

3206493000 | Farberden | 6,5 | 0 | |

3206494000 | lösliches Van-Dyck-Braun | 6,5 | 0 | |

3206495000 | Pigmente auf der Grundlage von Cobaltverbindungen | 6,5 | 0 | |

3206496000 | Pigmente und Zubereitungen auf der Grundlage von Cadmiumverbindungen | 6,5 | 0 | |

3206499000 | andere | 6,5 | 0 | |

3206500000 | anorganische Erzeugnisse von der als Luminophore verwendeten Art | 6,5 | 0 | |

3207100000 | zubereitete Pigmente, zubereitete Trübungsmittel, zubereitete Farben und ähnliche Zubereitungen | 6,5 | 0 | |

3207201000 | Schmelzglasuren und andere verglasbare Massen | 6,5 | 0 | |

3207202000 | Engoben | 6,5 | 0 | |

3207209000 | andere | 6,5 | 0 | |

3207301000 | aus Gold | 6,5 | 0 | |

3207302000 | aus Platin | 6,5 | 0 | |

3207303000 | aus Palladium | 6,5 | 0 | |

3207304000 | aus Silber | 6,5 | 0 | |

3207309000 | andere | 6,5 | 0 | |

3207400000 | Glasfritte und anderes Glas in Form von Pulver, Granalien, Schuppen oder Flocken | 6,5 | 5 | |

3208101010 | Emaillacke | 6,5 | 0 | |

3208101090 | andere | 8 | 0 | |

3208102000 | Lacke | 6,5 | 0 | |

3208103000 | Lösungen im Sinne der Anmerkung 4 zu diesem Kapitel | 6,5 | 0 | |

3208201011 | Emaillacke | 6,5 | 0 | |

3208201019 | andere | 8 | 0 | |

3208201020 | Lacke | 6,5 | 0 | |

3208201030 | Lösungen im Sinne der Anmerkung 4 zu diesem Kapitel | 6,5 | 0 | |

3208202011 | Emaillacke | 6,5 | 0 | |

3208202019 | andere | 8 | 0 | |

3208202020 | Lacke | 6,5 | 0 | |

3208202030 | Lösungen im Sinne der Anmerkung 4 zu diesem Kapitel | 6,5 | 0 | |

3208901011 | Emaillacke | 6,5 | 0 | |

3208901019 | andere | 8 | 0 | |

3208901020 | Lacke | 6,5 | 0 | |

3208901030 | Lösungen im Sinne der Anmerkung 4 zu diesem Kapitel | 6,5 | 0 | |

3208909011 | Emaillacke | 6,5 | 0 | |

3208909019 | andere | 8 | 0 | |

3208909020 | Lacke | 6,5 | 0 | |

3208909030 | Lösungen im Sinne der Anmerkung 4 zu diesem Kapitel | 6,5 | 0 | |

3209101011 | Emaillacke | 6,5 | 0 | |

3209101019 | andere | 8 | 0 | |

3209101020 | Lacke | 6,5 | 0 | |

3209102010 | Anstrichfarben (einschließlich Emaillacke) | 6,5 | 0 | |

3209102020 | Lacke | 6,5 | 0 | |

3209901011 | Emaillacke | 6,5 | 0 | |

3209901019 | andere | 8 | 0 | |

3209901020 | Lacke | 6,5 | 0 | |

3209909011 | Emaillacke | 6,5 | 0 | |

3209909019 | andere | 8 | 0 | |

3209909020 | Lacke | 6,5 | 0 | |

3210001011 | Emaillacke | 6,5 | 0 | |

3210001019 | andere | 8 | 0 | |

3210001091 | Emaillacke | 6,5 | 0 | |

3210001099 | andere | 8 | 0 | |

3210002010 | Lacke auf der Grundlage von trocknenden Ölen | 6,5 | 0 | |

3210002020 | Lacke auf der Grundlage von Schellack, natürlichen Gummen oder Harzen | 6,5 | 0 | |

3210002030 | Lacke auf der Grundlage von Bitumen, Pech oder ähnlichen Erzeugnissen | 6,5 | 0 | |

3210002040 | flüssige Lacke, keine Lösungsmittel enthaltend | 6,5 | 0 | |

3210003010 | Leimfarben | 6,5 | 0 | |

3210003090 | andere | 6,5 | 0 | |

3211000000 | zubereitete Sikkative | 6,5 | 0 | |

3212100000 | Prägefolien | 6,5 | 0 | |

3212901000 | Färbemittel und andere Farbmittel, in Formen oder Packungen für den Einzelverkauf | 6,5 | 0 | |

3212909000 | andere | 6,5 | 0 | |

3213101000 | Ölfarben | 8 | 0 | |

3213102000 | Wasserfarben | 8 | 0 | |

3213109000 | andere | 8 | 0 | |

3213901000 | Ölfarben | 8 | 0 | |

3213902000 | Wasserfarben | 8 | 0 | |

3213909000 | andere | 8 | 0 | |

3214101060 | auf der Grundlage von Kautschuk | 6,5 | 0 | |

3214101080 | Harzkitte und Harzzement | 6,5 | 0 | |

3214101090 | andere | 8 | 0 | |

3214102000 | Spachtelmassen für Anstreicherarbeiten | 6,5 | 0 | |

3214109000 | andere | 6,5 | 0 | |

3214900000 | andere | 6,5 | 0 | |

3215110000 | schwarz | 6,5 | 0 | |

3215190000 | andere | 6,5 | 0 | |

3215901000 | Tinte und Tusche zum Schreiben | 6,5 | 0 | |

3215902000 | Tinte und Tusche zum Zeichnen | 6,5 | 0 | |

3215903000 | Kopiertinte | 6,5 | 0 | |

3215904010 | aus Öl | 6,5 | 0 | |

3215904020 | aus Wasser | 6,5 | 0 | |

3215904030 | aus Öl und Wasser | 6,5 | 0 | |

3215905000 | Metallbronzefarbe | 6,5 | 0 | |

3215906010 | aus Öl | 6,5 | 0 | |

3215906020 | aus Wasser | 6,5 | 0 | |

3215906030 | aus Öl und Wasser | 6,5 | 0 | |

3215909000 | andere | 6,5 | 0 | |

3301120000 | Süß- und Bitterorangenöl | 5 | 0 | |

3301130000 | Citronenöl | 5 | 0 | |

3301190000 | andere | 5 | 0 | |

3301240000 | Pfefferminzöl (Mentha piperita) | 5 | 0 | |

3301250000 | andere Minzenöle | 5 | 0 | |

3301291000 | Vanilleöl | 5 | 0 | |

3301292000 | Citronellöl | 5 | 0 | |

3301293000 | Zimtrindenöl | 5 | 0 | |

3301294000 | Zimtblätteröl | 5 | 0 | |

3301299000 | andere | 5 | 0 | |

3301300000 | Resinoide | 8 | 0 | |

3301901000 | terpenhaltige Nebenerzeugnisse aus ätherischen Ölen | 8 | 0 | |

3301902000 | Konzentrate ätherischer Öle | 8 | 0 | |

3301903000 | destillierte aromatische Wässer und wässrige Lösungen ätherischer Öle | 8 | 0 | |

3301904100 | von Opium | 8 | 0 | |

3301904200 | von Süßholzwurzeln | 8 | 0 | |

3301904300 | von Hopfen | 30 | 0 | |

3301904400 | von Pyrethrum und rotenonhaltigen Wurzeln | 8 | 0 | |

3301904510 | von weißem Ginseng | 20 | 13 | |

3301904520 | von rotem Ginseng | 754,3 | 10 | |

3301904530 | von anderem Ginseng | 20 | 10 | |

3301904600 | von Cashewnussschalenflüssigkeit | 8 | 0 | |

3301904700 | von Japanlack | 8 | 0 | |

3301904800 | andere | 8 | 0 | |

3302101000 | von der in der Lebensmittelindustrie verwendeten Art | 8 | 0 | |

3302102011 | zusammengesetzte alkoholhaltige Zubereitungen | 30 | 0 | |

3302102019 | andere | 8 | 0 | |

3302102090 | andere | 8 | 0 | |

3302900000 | andere | 8 | 3 | |

3303001000 | Duftstoffe (Parfüms) | 8 | 3 | |

3303002000 | Duftwässer (Toilettewässer) | 8 | 0 | |

3304101000 | Lippenstifte | 8 | 3 | |

3304109000 | andere | 8 | 3 | |

3304201000 | Lidschatten | 8 | 3 | |

3304209000 | andere | 8 | 3 | |

3304301000 | Nagellacke | 8 | 3 | |

3304309000 | andere | 8 | 0 | |

3304911000 | Gesichtspuder | 8 | 5 | |

3304912000 | Säuglingspuder (einschließlich Talkumpuder) | 8 | 0 | |

3304919000 | andere | 8 | 0 | |

3304991000 | Hautpflegemittel | 8 | 5 | |

3304992000 | Schminkmittel (Make-up) | 8 | 3 | |

3304993000 | Säuglingspflegemittel | 8 | 0 | |

3304999000 | andere | 8 | 3 | |

3305100000 | Haarwaschmittel (Shampoo) | 8 | 3 | |

3305200000 | Dauerwellmittel und Entkrausungsmittel (Zubereitungen zur Haardauerverformung) | 8 | 3 | |

3305300000 | Haarlacke | 8 | 0 | |

3305901000 | Haarspülungen | 8 | 5 | |

3305902000 | Haarcremes | 8 | 3 | |

3305909000 | andere | 8 | 3 | |

3306100000 | Zahnputzmittel | 8 | 0 | |

3306201011 | nicht mehr als 70 dtex | 8 | 0 | |

3306201019 | andere | 8 | 0 | |

3306201020 | mit einem Titer der einfachen Garne von mehr als 50 tex | 8 | 0 | |

3306209000 | andere | 8 | 3 | |

3306901000 | zubereitete Mundpflegemittel | 8 | 0 | |

3306902000 | zubereitete Zahnpflegemittel | 8 | 0 | |

3307101000 | Rasiermittel, Nachbehandlungsmittel | 8 | 0 | |

3307109000 | andere | 8 | 0 | |

3307200000 | Körperdesodorierungs- und Antitranspirationsmittel | 8 | 0 | |

3307301000 | parfümierte Badesalze | 8 | 0 | |

3307302000 | andere zubereitete Badezusätze | 8 | 0 | |

3307410000 | "Agarbatti" und andere duftende zubereitete Räuchermittel | 8 | 0 | |

3307490000 | andere | 8 | 0 | |

3307901000 | Enthaarungsmittel | 8 | 0 | |

3307902000 | kleine Säckchen mit Teilen von Aromapflanzen | 8 | 0 | |

3307903000 | Lösungen für Kontaktlinsen oder künstliche Augen | 6,5 | 0 | |

3307909000 | andere | 6,5 | 0 | |

3401111000 | Medizinalseifen | 6,5 | 0 | |

3401119000 | andere | 8 | 5 | |

3401191010 | Wäscheseifen | 6,5 | 0 | |

3401191090 | andere | 6,5 | 3 | |

3401192000 | Papier, Watte, Filz und Vliesstoffe, mit Seife oder Reinigungsmitteln getränkt oder überzogen | 6,5 | 0 | |

3401200000 | Seifen in anderen Formen | 6,5 | 0 | |

3401300000 | organische grenzflächenaktive Erzeugnisse und Zubereitungen zum Waschen der Haut, in Form einer Flüssigkeit oder Creme, in Aufmachungen für den Einzelverkauf, auch ohne Gehalt an Seife | 6,5 | 0 | |

3402110000 | anionisch wirkend | 8 | 5 | |

3402120000 | kationisch wirkend | 8 | 5 | |

3402131000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 7 | |

3402139000 | andere | 8 | 7 | |

3402190000 | andere | 8 | 5 | |

3402201000 | zubereitete Waschmittel | 6,5 | 3 | |

3402202000 | zubereitete Reinigungsmittel | 6,5 | 3 | |

3402209000 | andere | 6,5 | 3 | |

3402901000 | grenzflächenaktive Zubereitungen | 6,5 | 5 | |

3402902000 | zubereitete Waschmittel | 6,5 | 5 | |

3402903000 | zubereitete Reinigungsmittel | 6,5 | 5 | |

3403111000 | Zubereitungen zum Behandeln von Spinnstoffen | 6,5 | 0 | |

3403112000 | Zubereitungen zum Behandeln von Leder oder Pelzfellen | 6,5 | 0 | |

3403119000 | andere | 6,5 | 0 | |

3403191000 | zubereitete Schneidöle | 6,5 | 0 | |

3403192000 | Zubereitungen zum Lösen von Schrauben oder Bolzen | 6,5 | 0 | |

3403193000 | zubereitete Rostschutzmittel oder Korrosionsschutzmittel | 6,5 | 5 | |

3403194000 | zubereitete Form- und Trennöle | 6,5 | 0 | |

3403195000 | beim Drahtziehen verwendete zubereitete Schmiermittel | 6,5 | 0 | |

3403199000 | andere | 6,5 | 0 | |

3403911000 | Zubereitungen zum Behandeln von Spinnstoffen | 6,5 | 0 | |

3403912000 | Zubereitungen zum Behandeln von Leder oder Pelzfellen | 6,5 | 5 | |

3403919000 | andere | 6,5 | 0 | |

3403991000 | zubereitete Schneidöle | 6,5 | 0 | |

3403992000 | beim Drahtziehen verwendete zubereitete Schmiermittel | 6,5 | 0 | |

3403999000 | andere | 6,5 | 0 | |

3404200000 | Poly(oxyethylen)-Wachs (Polyethylenglycolwachs) | 6,5 | 0 | |

3404901010 | aus Chlorparaffinen | 6,5 | 0 | |

3404901020 | aus Opalen | 6,5 | 0 | |

3404901030 | aus Polyalkylenen | 6,5 | 0 | |

3404901040 | aus chemisch modifiziertem Lignit | 6,5 | 0 | |

3404901090 | andere | 6,5 | 0 | |

3404902000 | zubereitete Wachse | 8 | 0 | |

3405100000 | Schuhcreme und ähnliche Schuh- oder Lederpflegemittel | 6,5 | 3 | |

3405200000 | Möbel- und Bohnerwachs und ähnliche Zubereitungen | 6,5 | 0 | |

3405300000 | Poliermittel für Karosserien und ähnliche Autopflegemittel, ausgenommen Poliermittel für Metall | 6,5 | 3 | |

3405400000 | Scheuerpasten und -pulver und ähnliche Zubereitungen | 6,5 | 3 | |

3405901010 | auf der Grundlage von Kreide | 6,5 | 0 | |

3405901020 | auf der Grundlage von Kieselgur | 6,5 | 0 | |

3405901030 | auf der Grundlage von Diamantpulver oder -staub | 6,5 | 0 | |

3405901090 | andere | 6,5 | 0 | |

3405909000 | andere | 6,5 | 3 | |

3406000000 | Kerzen (Lichte) aller Art und dergleichen | 8 | 0 | |

3407001000 | Modelliermassen | 6,5 | 0 | |

3407002000 | zubereitetes "Dentalwachs" oder "Zahnabdruckmassen" | 6,5 | 0 | |

3407003000 | andere Zubereitungen für zahnärztliche Zwecke auf der Grundlage von Gips | 6,5 | 0 | |

3501101000 | zur Herstellung von Kaffeeweißer | 8 | 5 | |

3501109000 | andere | 20 | 5 | |

3501901110 | zur Herstellung von Kaffeeweißer | 8 | 5 | |

3501901190 | andere | 20 | 5 | |

3501901200 | andere Caseinderivate | 20 | 5 | |

3501902000 | Caseinleime | 20 | 5 | |

3502110000 | getrocknet | 8 | 5 | |

3502190000 | andere | 8 | 5 | |

3502200000 | Molkenproteine (Lactalbumin), einschließlich Konzentrate aus zwei oder mehr Molkenproteinen | 8 | 5 | |

3502901000 | Albuminate und andere Albuminderivate | 8 | 0 | |

3502909000 | andere | 8 | 0 | |

3503001010 | Gelatine | 8 | 3 | |

3503001020 | Gelatinederivate | 8 | 0 | |

3503002000 | Hausenblase | 8 | 0 | |

3503003000 | andere Leime tierischen Ursprungs | 8 | 0 | |

3504001010 | Peptone | 8 | 0 | |

3504001020 | Derivate der Peptone | 8 | 0 | |

3504002010 | Keratine | 8 | 0 | |

3504002020 | Nucleoproteide | 8 | 0 | |

3504002030 | Proteinisolate | 8 | 0 | |

3504002090 | andere | 8 | 0 | |

3504003000 | Hautpulver | 8 | 0 | |

3505101000 | Dextrine | 8 | 0 | |

3505102000 | lösliche Stärke (Amylogen) | 8 | 10 | |

3505103000 | geröstete Stärken | 385,7 | 10 | |

3505104010 | für Nahrungszwecke | 385,7 | Siehe Anlage 2-A-1 Absatz 15 | Siehe Anhang 3 |

3505104090 | andere | 385,7 | Siehe Anlage 2-A-1 Absatz 15 | Siehe Anhang 3 |

3505105010 | für Nahrungszwecke | 385,7 | Siehe Anlage 2-A-1 Absatz 15 | Siehe Anhang 3 |

3505105090 | andere | 385,7 | Siehe Anlage 2-A-1 Absatz 15 | Siehe Anhang 3 |

3505109010 | für Nahrungszwecke | 385,7 | 10 | |

3505109090 | andere | 385,7 | 10 | |

3505201000 | Leime auf der Grundlage von Stärken | 201,2 | 10 | |

3505202000 | Leime auf der Grundlage von Dextrinen | 201,2 | 10 | |

3505209000 | andere | 201,2 | 10 | |

3506101000 | auf der Grundlage von Kautschuk | 6,5 | 5 | |

3506102000 | auf der Grundlage von Kunststoff (einschließlich Kunstharze) | 6,5 | 5 | |

3506109000 | andere | 6,5 | 5 | |

3506910000 | Klebstoffe auf der Grundlage von Polymeren der Positionen 3901 bis 3913 oder von Kautschuk | 6,5 | 5 | |

3506991000 | Wiener Leim | 6,5 | 0 | |

3506992000 | durch die chemische Behandlung von natürlichen Gummen erhaltene Leime | 6,5 | 0 | |

3506993000 | Leime auf der Grundlage von Silicaten | 6,5 | 0 | |

3506999000 | andere | 6,5 | 5 | |

3507100000 | Lab und seine Konzentrate | 6,5 | 0 | |

3507901010 | Trypsin | 6,5 | 0 | |

3507901020 | Chymotrypsin | 6,5 | 0 | |

3507901030 | Alpha-Amylase | 6,5 | 0 | |

3507901040 | Lipase | 6,5 | 0 | |

3507901090 | andere | 6,5 | 0 | |

3507902000 | Pepsin | 6,5 | 0 | |

3507903000 | Malzenzyme | 6,5 | 0 | |

3507904010 | Papain | 6,5 | 0 | |

3507904020 | Bromelain | 6,5 | 0 | |

3507904030 | Ficin | 6,5 | 0 | |

3507906010 | Amylase | 6,5 | 0 | |

3507906020 | Protease | 6,5 | 0 | |

3507907000 | pektolytische Enzyme | 6,5 | 0 | |

3507908000 | Cytochrom C | 6,5 | 0 | |

3507909000 | andere | 6,5 | 5 | |

3601001000 | Schwarzpulver | 6,5 | 0 | |

3601002000 | rauchlose Pulver | 6,5 | 0 | |

3602000000 | zubereitete Sprengstoffe, ausgenommen Schießpulver | 6,5 | 0 | |

3603001000 | Sicherheitszündschnüre | 6,5 | 0 | |

3603002000 | Sprengzündschnüre | 6,5 | 0 | |

3603003000 | Zündhütchen, Sprengkapseln | 6,5 | 0 | |

3603004000 | Zünder | 6,5 | 0 | |

3603005000 | elektrische Sprengzünder | 6,5 | 0 | |

3604100000 | Feuerwerkskörper | 8 | 0 | |

3604901000 | Signalraketen | 8 | 0 | |

3604909000 | andere | 8 | 0 | |

3605001000 | gelbe Phosphorzündhölzer | 8 | 0 | |

3605009000 | andere | 8 | 0 | |

3606100000 | flüssige Brennstoffe und brennbare Flüssiggase, in Behältnissen von der zum Auffüllen oder Wiederauffüllen von Feuerzeugen oder Anzündern verwendeten Art mit einem Fassungsvermögen von 300 cm3 oder weniger | 8 | 0 | |

3606901010 | Metaldehyd | 8 | 0 | |

3606901020 | Hexamin | 8 | 0 | |

3606901030 | Hartspiritus | 8 | 0 | |

3606901090 | andere | 8 | 0 | |

3606902010 | Zündsteine | 8 | 0 | |

3606902090 | andere | 8 | 0 | |

3606909010 | Zündsteine | 8 | 0 | |

3606909090 | andere | 8 | 0 | |

3701100000 | für Röntgenaufnahmen | 6,5 | 3 | |

3701200000 | Sofortbild-Planfilme | 8 | 3 | |

3701301000 | zur Herstellung von Halbleitern | 6,5 | 0 | |

3701309100 | für grafische Zwecke | 6,5 | 0 | |

3701309200 | für gedruckte Schaltungen | 6,5 | 0 | |

3701309910 | für die Astronomie | 8 | 0 | |

3701309920 | für die Luftbildfotografie | 8 | 0 | |

3701309991 | für Flachbildschirme (leere Maske) | 3 | 3 | |

3701309999 | andere | 8 | 3 | |

3701911000 | zur Herstellung von Halbleitern | 6,5 | 0 | |

3701919100 | für grafische Zwecke | 6,5 | 0 | |

3701919200 | für gedruckte Schaltungen | 6,5 | 0 | |

3701919910 | für die Astronomie | 8 | 0 | |

3701919920 | für die Luftbildfotografie | 8 | 0 | |

3701919990 | andere | 8 | 0 | |

3701991000 | zur Herstellung von Halbleitern | 3 | 3 | |

3701999100 | für grafische Zwecke | 6,5 | 0 | |

3701999200 | für gedruckte Schaltungen | 6,5 | 0 | |

3701999910 | für die Astronomie | 8 | 0 | |

3701999920 | für die Luftbildfotografie | 8 | 0 | |

3701999990 | andere | 8 | 3 | |

3702100000 | für Röntgenaufnahmen | 6,5 | 0 | |

3702311110 | Negative | 6,5 | 0 | |

3702311120 | Positive | 6,5 | 0 | |

3702311210 | Negative | 6,5 | 3 | |

3702311220 | Positive | 6,5 | 0 | |

3702311910 | Negative | 6,5 | 0 | |

3702311920 | Positive | 6,5 | 0 | |

3702312000 | für grafische Zwecke | 6,5 | 0 | |

3702313000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702319010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702319020 | für die Luftbildfotografie | 8 | 0 | |

3702319090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702321110 | Negative | 6,5 | 0 | |

3702321120 | Positive | 6,5 | 0 | |

3702321210 | Negative | 6,5 | 0 | |

3702321220 | Positive | 6,5 | 0 | |

3702321910 | Negative | 6,5 | 0 | |

3702321920 | Positive | 6,5 | 0 | |

3702322000 | für grafische Zwecke | 6,5 | 0 | |

3702323000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702329010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702329020 | für die Luftbildfotografie | 8 | 0 | |

3702329030 | Sofortbild-Planfilme | 8 | 3 | |

3702329090 | andere | 8 | 0 | |

3702391110 | Negative | 6,5 | 0 | |

3702391120 | Positive | 6,5 | 0 | |

3702391210 | Negative | 6,5 | 0 | |

3702391220 | Positive | 6,5 | 0 | |

3702391910 | Negative | 6,5 | 0 | |

3702391920 | Positive | 6,5 | 0 | |

3702392000 | für grafische Zwecke | 6,5 | 0 | |

3702393000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702399010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702399020 | für die Luftbildfotografie | 8 | 0 | |

3702399090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702411010 | Negative | 6,5 | 0 | |

3702411020 | Positive | 6,5 | 0 | |

3702412000 | für grafische Zwecke | 6,5 | 0 | |

3702413000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702419010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702419020 | für die Luftbildfotografie | 8 | 0 | |

3702419090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702421010 | Negative | 6,5 | 0 | |

3702421020 | Positive | 6,5 | 0 | |

3702422000 | für grafische Zwecke | 6,5 | 0 | |

3702423000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702429010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702429020 | für die Luftbildfotografie | 8 | 0 | |

3702429090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702431010 | Negative | 6,5 | 0 | |

3702431020 | Positive | 6,5 | 0 | |

3702432000 | für grafische Zwecke | 6,5 | 0 | |

3702433000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702439010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702439020 | für die Luftbildfotografie | 8 | 0 | |

3702439090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702441010 | Negative | 6,5 | 0 | |

3702441020 | Positive | 6,5 | 0 | |

3702442000 | für grafische Zwecke | 6,5 | 0 | |

3702443000 | für gedruckte Schaltungen | 6,5 | 3 | |

3702449010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702449020 | für die Luftbildfotografie | 8 | 0 | |

3702449090 | andere | 8 | | |

–Sofortbild-Planfilme | | 3 | |

–andere | | 0 | |

3702511010 | Negative | 6,5 | 0 | |

3702511020 | Positive | 6,5 | 0 | |

3702512000 | für grafische Zwecke | 6,5 | 0 | |

3702513000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702519010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702519020 | für die Luftbildfotografie | 8 | 0 | |

3702519090 | andere | 8 | 0 | |

3702521010 | Negative | 6,5 | 0 | |

3702521020 | Positive | 6,5 | 0 | |

3702522000 | für grafische Zwecke | 6,5 | 0 | |

3702523000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702529010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702529020 | für die Luftbildfotografie | 8 | 0 | |

3702529090 | andere | 8 | 0 | |

3702530000 | mit einer Breite von mehr als 16 mm bis 35 mm und einer Länge von 30 m oder weniger, für Diapositive | 8 | 0 | |

3702541010 | Negative | 6,5 | 0 | |

3702541020 | Positive | 6,5 | 0 | |

3702542000 | für grafische Zwecke | 6,5 | 0 | |

3702543000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702549010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702549020 | für die Luftbildfotografie | 8 | 0 | |

3702549090 | andere | 8 | 0 | |

3702551010 | Negative | 6,5 | 3 | |

3702551020 | Positive | 6,5 | 0 | |

3702552000 | für grafische Zwecke | 6,5 | 0 | |

3702553000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702559010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702559020 | für die Luftbildfotografie | 8 | 0 | |

3702559090 | andere | 8 | 0 | |

3702561010 | Negative | 6,5 | 0 | |

3702561020 | Positive | 6,5 | 0 | |

3702562000 | für grafische Zwecke | 6,5 | 3 | |

3702563000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702569010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702569020 | für die Luftbildfotografie | 8 | 0 | |

3702569090 | andere | 8 | 0 | |

3702911010 | Negative | 6,5 | 0 | |

3702911020 | Positive | 6,5 | 0 | |

3702912000 | für grafische Zwecke | 6,5 | 0 | |

3702913000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702919010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702919020 | für die Luftbildfotografie | 8 | 0 | |

3702919090 | andere | 8 | 0 | |

3702931010 | Negative | 6,5 | 0 | |

3702931020 | Positive | 6,5 | 0 | |

3702932000 | für grafische Zwecke | 6,5 | 0 | |

3702933000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702939010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702939020 | für die Luftbildfotografie | 8 | 0 | |

3702939090 | andere | 8 | 0 | |

3702941010 | Negative | 6,5 | 0 | |

3702941020 | Positive | 6,5 | 0 | |

3702942000 | für grafische Zwecke | 6,5 | 0 | |

3702943000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702949010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702949020 | für die Luftbildfotografie | 8 | 0 | |

3702949090 | andere | 8 | 0 | |

3702951010 | Negative | 6,5 | 0 | |

3702951020 | Positive | 6,5 | 0 | |

3702952000 | für grafische Zwecke | 6,5 | 0 | |

3702953000 | für gedruckte Schaltungen | 6,5 | 0 | |

3702959010 | für die Tonaufnahme auf fotoelektrischem Wege | 8 | 0 | |

3702959020 | für die Luftbildfotografie | 8 | 0 | |

3702959090 | andere | 8 | 0 | |

3703101010 | für Röntgenaufnahmen | 8 | 0 | |

3703101020 | für Elektrokardiografen | 8 | 0 | |

3703101030 | zum Fotokopieren | 8 | 0 | |

3703101040 | für die Aufzeichnung | 8 | 0 | |

3703101090 | andere | 8 | 3 | |

3703109010 | für Röntgenaufnahmen | 8 | 0 | |

3703109020 | für Elektrokardiografen | 8 | 0 | |

3703109030 | zum Fotokopieren | 8 | 0 | |

3703109040 | für die Aufzeichnung | 8 | 0 | |

3703109090 | andere | 8 | 0 | |

3703201000 | für Röntgenaufnahmen | 8 | 0 | |

3703202000 | für Elektrokardiografen | 8 | 0 | |

3703203000 | zum Fotokopieren | 8 | 0 | |

3703204000 | für die Aufzeichnung | 8 | 0 | |

3703209000 | andere | 8 | 3 | |

3703901000 | für Röntgenaufnahmen | 8 | 0 | |

3703902000 | für Elektrokardiografen | 8 | 0 | |

3703903000 | zum Fotokopieren | 8 | 0 | |

3703904000 | für die Aufzeichnung | 8 | 0 | |

3703909000 | andere | 8 | 0 | |

3704001110 | für Nachrichten | 0 | 0 | |

3704001120 | kinematografische Filme, in Übersee belichtet während der Arbeit an einem Film eines Produzenten der Republik Korea (in dem nur Schauspieler der Republik Korea mitwirken) | 0 | 0 | |

3704001190 | andere | 0 | 0 | |

3704001200 | für Offsetreproduktionen zur Herstellung von Postkarten, illustrierten Postkarten, Karten und Kalendern | 4 | 0 | |

3704001300 | zur Herstellung von Halbleitern | 4 | 0 | |

3704001900 | andere | 0 | 0 | |

3704002000 | fotografische Papiere, Pappen und Spinnstoffwaren | 8 | 0 | |

3705101000 | zur Herstellung von Postkarten, illustrierten Postkarten, Karten und Kalendern | 8 | 0 | |

3705109000 | andere | 0 | 0 | |

3705901000 | zur Herstellung von Halbleitern | 3 | 0 | |

3705902010 | Röntgenaufnahmen | 0 | 0 | |

3705902020 | Buchkopien | 0 | 0 | |

3705902030 | Dokumentkopien | 0 | 0 | |

3705903000 | Mikrofilme | 0 | 0 | |

3705909010 | für die wissenschaftliche Forschung | 0 | 0 | |

3705909020 | für die Astronomie | 0 | 0 | |

3705909030 | für die Luftbildfotografie | 0 | 0 | |

3705909090 | andere | 0 | 0 | |

3706101000 | nur mit Tonaufnahme | 6,5 % oder 195 Won/Meter | 0 | |

3706102000 | für Nachrichten | 6,5 % oder 4 Won/Meter | 0 | |

3706103010 | Werkkopien | 6,5 % oder 26 Won/Meter | 0 | |

3706103020 | andere Negative gemeinsam produzierter kinematografischer Filme | 6,5 % oder 468 Won/Meter | 0 | |

3706103030 | andere Positive gemeinsam produzierter kinematografischer Filme | 6,5 % oder 78 Won/Meter | 0 | |

3706104000 | kinematografische Filme, in Übersee belichtet während der Arbeit an einem Film eines Produzenten der Republik Korea (in dem nur überseeische Drehorte dargestellt werden oder nur Schauspieler der Republik Korea mitwirken) und von einem koreanischen Produzenten in Korea hergestellte kinematografische Filme | 6,5 % oder 26 Won/Meter | 0 | |

3706105010 | Negative | 6,5 % oder 1092 Won/Meter | 0 | |

3706105020 | Positive | 6,5 % oder 182 Won/Meter | 3 | |

3706106010 | Negative | 6,5 % oder 1560 Won/Meter | 0 | |

3706106020 | Positive | 6,5 % oder 260 Won/Meter | 0 | |

3706901000 | nur mit Tonaufnahme | 6,5 % oder 9 Won/Meter | 0 | |

3706902000 | für Nachrichten | 6,5 % oder 5 Won/Meter | 0 | |

3706903010 | Werkkopien | 6,5 % oder 26 Won/Meter | 0 | |

3706903020 | andere Negative gemeinsam produzierter kinematografischer Filme | 6,5 % oder 468 Won/Meter | 0 | |

3706903030 | andere Positive gemeinsam produzierter kinematografischer Filme | 6,5 % oder 78 Won/Meter | 0 | |

3706904000 | kinematografische Filme, in Übersee belichtet während der Arbeit an einem Film eines Produzenten der Republik Korea (in dem nur überseeische Drehorte dargestellt werden oder nur Schauspieler der Republik Korea mitwirken) und von einem koreanischen Produzenten in Korea hergestellte kinematografische Filme | 6,5 % oder 26 Won/Meter | 0 | |

3706905010 | Negative | 6,5 % oder 25 Won/Meter | 0 | |

3706905020 | Positive | 6,5 % oder 8 Won/Meter | 0 | |

3706906010 | Negative | 6,5 % oder 1092 Won/Meter | 0 | |

3706906020 | Positive | 6,5 % oder 182 Won/Meter | 0 | |

3707100000 | Emulsionen zum Sensibilisieren von Oberflächen | 6,5 | 0 | |

3707901010 | zur Herstellung von Halbleitern | 6,5 | 3 | |

3707901090 | andere | 6,5 | 0 | |

3707902100 | für mehrfarbige Aufnahmen | 6,5 | 0 | |

3707902910 | für Röntgenaufnahmen | 6,5 | 0 | |

3707902920 | für grafische Zwecke | 6,5 | 0 | |

3707902990 | andere | 6,5 | 0 | |

3707903100 | für mehrfarbige Aufnahmen | 6,5 | 0 | |

3707903910 | für Röntgenaufnahmen | 6,5 | 3 | |

3707903920 | für grafische Zwecke | 6,5 | 0 | |

3707903990 | andere | 6,5 | 0 | |

3707909100 | Verstärker und Abschwächer | 6,5 | 0 | |

3707909200 | Toner | 6,5 | 0 | |

3707909300 | Wässerungshilfen | 6,5 | 0 | |

3707909400 | Blitzmaterialien | 6,5 | 0 | |

3707909900 | andere | 6,5 | 0 | |

3801101000 | zur Herstellung von Sekundärbatterien | 4 | 0 | |

3801109000 | andere | 6,5 | 0 | |

3801200000 | kolloider und halbkolloider Grafit | 6,5 | 0 | |

3801300000 | kohlenstoffhaltige Pasten für Elektroden und ähnliche Pasten für die Innenauskleidung von Öfen | 6,5 | 0 | |

3801900000 | andere | 6,5 | 0 | |

3802100000 | Aktivkohle | 6,5 | 5 | |

3802901010 | aktivierte Kieselgur | 6,5 | 0 | |

3802901020 | aktivierte Tone und aktivierte Erden | 6,5 | 0 | |

3802901090 | andere | 6,5 | 0 | |

3802902000 | Tierisches Schwarz (auch ausgebraucht) | 6,5 | 0 | |

3803000000 | Tallöl, auch raffiniert | 5 | 0 | |

3804001000 | flüssig | 6,5 | 0 | |

3804009000 | andere | 6,5 | 0 | |

3805101000 | Balsamterpentinöl | 6,5 | 0 | |

3805102000 | Holzterpentinöl | 6,5 | 0 | |

3805103000 | Sulfatterpentinöl | 6,5 | 0 | |

3805900000 | andere | 6,5 | 0 | |

3806101000 | Kolofonium | 6,5 | 5 | |

3806102000 | Harzsäuren | 6,5 | 0 | |

3806201000 | Salze des Kolofoniums | 6,5 | 0 | |

3806202000 | Salze der Harzsäuren | 6,5 | 0 | |

3806209000 | andere | 6,5 | 0 | |

3806300000 | Harzester | 6,5 | 0 | |

3806902000 | Schmelzharz | 6,5 | 0 | |

3806903000 | leichte und schwere Harzöle | 6,5 | 0 | |

3806909000 | andere | 6,5 | 0 | |

3807001000 | Holzteere, Holzteeröle und Holzkreosot | 6,5 | 0 | |

3807002000 | Holzgeist | 6,5 | 0 | |

3807003000 | pflanzliches Pech | 6,5 | 0 | |

3807009010 | pyrolignose Flüssigkeit | 6,5 | 5 | |

3807009090 | andere | 6,5 | 0 | |

3808501000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | | |

–Insektizide | | 3 | |

–Fungizide | | 3 | |

–Herbizide | | 0 | |

–Keimungshemmer | | 0 | |

–Pflanzenwuchsregulatoren | | 0 | |

–Desinfektionsmittel | | 0 | |

–Rodentizide | | 0 | |

–andere | | 0 | |

3808509000 | andere | 6,5 | | |

–Insektizide | | 3 | |

–Fungizide | | 3 | |

–Herbizide | | 0 | |

–Keimungshemmer | | 0 | |

–Pflanzenwuchsregulatoren | | 0 | |

–Desinfektionsmittel | | 0 | |

–Rodentizide | | 0 | |

–andere | | 0 | |

3808911000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

3808919000 | andere | 6,5 | 3 | |

3808921000 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

3808929000 | andere | 6,5 | 3 | |

3808931000 | Herbizide | 6,5 | 0 | |

3808932000 | Keimungshemmer | 6,5 | 0 | |

3808933000 | Pflanzenwuchsregulatoren | 6,5 | 0 | |

3808940000 | Desinfektionsmittel | 6,5 | 0 | |

3808991000 | Rodentizide | 6,5 | 0 | |

3808999000 | andere | 6,5 | 0 | |

3809100000 | auf der Grundlage von Stärke oder Stärkederivaten | 8 | 0 | |

3809910000 | von der in der Textilindustrie oder ähnlichen Industrien verwendeten Art | 6,5 | 3 | |

3809920000 | von der in der Papierindustrie oder ähnlichen Industrien verwendeten Art | 6,5 | 0 | |

3809930000 | von der in der Lederindustrie oder ähnlichen Industrien verwendeten Art | 6,5 | 3 | |

3810101000 | Zubereitungen zum Abbeizen von Metallen | 6,5 | 0 | |

3810109000 | andere | 6,5 | 0 | |

3810901000 | Flussmittel und andere Hilfsmittel zum Schweißen oder Löten von Metallen | 6,5 | 0 | |

3810909000 | andere | 6,5 | 0 | |

3811110000 | auf der Grundlage von Bleiverbindungen | 6,5 | 0 | |

3811190000 | andere | 6,5 | 0 | |

3811210000 | Erdöl oder Öl aus bituminösen Mineralien enthaltend | 5 | 0 | |

3811290000 | andere | 5 | 0 | |

3811900000 | andere | 6,5 | 5 | |

3812101000 | auf der Grundlage von Diphenylguanidin | 6,5 | 0 | |

3812102000 | auf der Grundlage von Dithiocarbamaten | 6,5 | 0 | |

3812103000 | auf der Grundlage von Thiuramsulfiden | 6,5 | 0 | |

3812104000 | auf der Grundlage von Hexamethylentetramin | 6,5 | 0 | |

3812105000 | auf der Grundlage von Mercaptobenzothiazol | 6,5 | 0 | |

3812106000 | auf der Grundlage von Dibenzothiazyldisulfid | 6,5 | 0 | |

3812109000 | andere | 6,5 | 0 | |

3812200000 | zusammengesetzte Weichmacher für Kautschuk oder Kunststoffe | 6,5 | 3 | |

3812301000 | zubereitete Antioxidationsmittel | 6,5 | 5 | |

3812302000 | andere zusammengesetzte Stabilisatoren | 6,5 | 5 | |

3813001000 | Gemische für Feuerlöschgeräte | 6,5 | 0 | |

3813002000 | Ladungen für Feuerlöschgeräte | 6,5 | 0 | |

3813003000 | Feuerlöschgranaten und Feuerlöschbomben | 6,5 | 0 | |

3814001010 | Mischungen von Acetonen, Methylacetat und Methanol | 6,5 | 0 | |

3814001020 | Mischungen von Ethylacetat, Butylalkohol und Toluol | 6,5 | 0 | |

3814001090 | andere | 6,5 | 0 | |

3814002110 | zur Herstellung von Halbleitern | 6,5 | 0 | |

3814002190 | andere | 6,5 | 0 | |

3814002900 | andere | 6,5 | 0 | |

3815110000 | mit Nickel oder einer Nickelverbindung als aktiver Substanz | 6,5 | 3 | |

3815121000 | mit Platinmetall oder einer Platinverbindung | 6,5 | 3 | |

3815122000 | von Palladium oder einer Palladiumverbindung | 6,5 | 0 | |

3815129000 | andere | 6,5 | 3 | |

3815191000 | mit Eisen oder einer Eisenverbindung als aktiver Substanz | 6,5 | 0 | |

3815192000 | von Titan oder einer Titanverbindung | 6,5 | 3 | |

3815199000 | andere | 6,5 | 0 | |

3815901000 | Reaktionsauslöser | 6,5 | 0 | |

3815909000 | andere | 6,5 | 3 | |

3816001000 | feuerfeste Zemente | 6,5 | 0 | |

3816002000 | feuerfeste Mörtel | 6,5 | 0 | |

3816003000 | feuerfester Beton | 6,5 | 0 | |

3816009000 | andere | 6,5 | 0 | |

3817000000 | Alkylbenzol-Gemische und Alkylnaphthalin-Gemische, ausgenommen Waren der Position 2707 oder 2902 | 6,5 | 0 | |

3818001000 | chemische Elemente, zur Verwendung in der Elektronik dotiert | 0 | 0 | |

3818002000 | chemische Verbindungen, zur Verwendung in der Elektronik dotiert | 0 | 0 | |

3819001000 | Flüssigkeiten für hydraulische Bremsen | 6,5 | 0 | |

3819002000 | andere zubereitete Flüssigkeiten für hydraulische Kraftübertragung | 6,5 | 0 | |

3820001000 | zubereitete Gefrierschutzmittel | 6,5 | 0 | |

3820002000 | zubereitete Flüssigkeiten zum Enteisen | 6,5 | 0 | |

3821000000 | zubereitete Nährsubstrate zum Züchten und Erhalten von Mikroorganismen (einschließlich Viren und dergleichen) oder pflanzlichen, menschlichen oder tierischen Zellen | 6,5 | 0 | |

3822001011 | andere Tafeln, Platten, Folien, Filme, Bänder und Streifen, aus Kunststoffen | 0 | 0 | |

3822001012 | andere Waren aus Kunststoffen | 0 | 0 | |

3822001013 | Papiere, Pappen, Zellstoffwatte und Vliese aus Zellstofffasern, in Rollen oder Bogen gemäß Anmerkung 8 zu Kapitel 48 | 0 | 0 | |

3822001014 | Lackmusteststreifen und andere ähnliche Teststreifen | 0 | 0 | |

3822001019 | andere | 0 | 0 | |

3822001020 | zubereitet, nicht auf einem Träger | 0 | 0 | |

3822001091 | andere Tafeln, Platten, Folien, Filme, Bänder und Streifen, aus Kunststoffen | 6,5 | 0 | |

3822001092 | andere Waren aus Kunststoffen | 8 | 0 | |

3822001093 | Papiere, Pappen, Zellstoffwatte und Vliese aus Zellstofffasern, in Rollen oder Bogen gemäß Anmerkung 8 zu Kapitel 48 | 0 | 0 | |

3822001099 | andere | 8 | 0 | |

3822002011 | andere Tafeln, Platten, Folien, Filme, Bänder und Streifen, aus Kunststoffen | 0 | 0 | |

3822002012 | andere Waren aus Kunststoffen | 0 | 0 | |

3822002013 | Papiere, Pappen, Zellstoffwatte und Vliese aus Zellstofffasern, in Rollen oder Bogen gemäß Anmerkung 8 zu Kapitel 48 | 0 | 0 | |

3822002014 | Lackmusteststreifen und andere ähnliche Teststreifen | 0 | 0 | |

3822002019 | andere | 0 | 0 | |

3822002020 | zubereitet, nicht auf einem Träger | 0 | 0 | |

3822002091 | andere Tafeln, Platten, Folien, Filme, Bänder und Streifen, aus Kunststoffen | 6,5 | 0 | |

3822002092 | andere Waren aus Kunststoffen | 8 | 0 | |

3822002093 | Papiere, Pappen, Zellstoffwatte und Vliese aus Zellstofffasern, in Rollen oder Bogen gemäß Anmerkung 8 zu Kapitel 48 | 0 | 0 | |

3822002099 | andere | 8 | 3 | |

3822003041 | des Satzes von 0 % im Zolltarif | 0 | 0 | |

3822003042 | des Satzes von 1 % im Zolltarif | 1 | 0 | |

3822003043 | des Satzes von 2 % im Zolltarif | 2 | 0 | |

3822003044 | des Satzes von 3 % im Zolltarif | 3 | 0 | |

3822003045 | des Satzes von 4 % im Zolltarif | 4 | 0 | |

3822003046 | des Satzes von 5 % im Zolltarif | 5 | 0 | |

3822003047 | des Satzes von 5,4 % im Zolltarif | 5,4 | 0 | |

3822003048 | des Satzes von 6,5 % im Zolltarif | 6,5 | 0 | |

3822003049 | des Satzes von 7 % im Zolltarif | 7 | 0 | |

3822003050 | des Satzes von 8 % im Zolltarif | 8 | 0 | |

3822003051 | des Satzes von 10 % im Zolltarif | 10 | 0 | |

3822003052 | des Satzes von 20 % im Zolltarif | 20 | 0 | |

3822003053 | des Satzes von 27 % im Zolltarif | 27 | 0 | |

3822003054 | des Satzes von 30 % im Zolltarif | 30 | 0 | |

3822003055 | des Satzes von 36 % im Zolltarif | 36 | 0 | |

3822003056 | des Satzes von 40 % im Zolltarif | 40 | 0 | |

3822003057 | des Satzes von 50 % im Zolltarif | 50 | 0 | |

3822003058 | der Unterpositionen 3706 10 1000, 3706 10 5020 und 3706 90 6020 | 6,5 % oder 182 Won/Meter | 0 | |

3822003059 | der Unterpositionen 3706 10 2000 und 3706 90 2000 | 6,5 % oder 4 Won/Meter | 0 | |

3822003060 | der Unterpositionen 3706 10 3010, 3706 10 4000, 3706 90 3010 und 3706 90 4000 | 6,5 % oder 26 Won/Meter | 0 | |

3822003061 | der Unterpositionen 3706 10 3020 und 3706 90 3020 | 6,5 % oder 468 Won/Meter | 0 | |

3822003062 | der Unterpositionen 3706 10 3030 und 3706 90 3030 | 6,5 % oder 78 Won/Meter | 0 | |

3822003063 | der Unterpositionen 3706 10 5010 und 3706 90 6010 | 6,5 % oder 1092 Won/ Meter | 0 | |

3822003064 | der Unterposition 3706 10 6010 | 6,5 % oder 1560 Won/ Meter | 0 | |

3822003065 | der Unterposition 3706 10 6020 | 6,5 % oder 260 Won/Meter | 0 | |

3822003066 | der Unterpositionen 3706 90 1000 und 3706 90 5020 | 6,5 % oder 8 Won/Meter | 0 | |

3822003067 | der Unterposition 3706 90 5010 | 6,5 % oder 25 Won/Meter | 0 | |

3823110000 | Stearinsäure | 8 | 0 | |

3823120000 | Ölsäure | 8 | 0 | |

3823130000 | Tallölfettsäuren | 8 | 0 | |

3823191000 | Palmitinsäuren | 8 | 0 | |

3823192000 | saure Öle aus der Raffination | 8 | 0 | |

3823199000 | andere | 8 | 0 | |

3823701000 | Cetylalkohol | 5 | 3 | |

3823702000 | Stearylalkohol | 5 | 3 | |

3823703000 | Oleylalkohol | 5 | 0 | |

3823704000 | Laurylalkohol | 5 | 0 | |

3823709010 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 0 | |

3823709090 | andere | 5 | 0 | |

3824100000 | zubereitete Bindemittel für Gießereiformen oder -kerne | 6,5 | 0 | |

3824300000 | nicht gesinterte Metallcarbide, untereinander oder mit metallischen Bindemitteln gemischt | 6,5 | 0 | |

3824400000 | zubereitete Additive für Zement, Mörtel oder Beton | 6,5 | 0 | |

3824500000 | Mörtel und Beton, nicht feuerfest | 6,5 | 0 | |

3824600000 | Sorbit, ausgenommen Waren der Unterposition 2905 44 | 8 | 5 | |

3824711000 | Reinigungsmittel auf der Grundlage von Trichlortrifluorethan | 6,5 | 0 | |

3824719000 | andere | 6,5 | 0 | |

3824720000 | Bromchlordifluormethan, Bromtrifluormethan oder Dibromtetrafluorethan enthaltend | 6,5 | 0 | |

3824730000 | teilhalogenierte Bromfluorkohlenwasserstoffe (HBFKW) enthaltend | 6,5 | 0 | |

3824740000 | teilhalogenierte Chlorfluorkohlenwasserstoffe (HCFKW) enthaltend, auch perfluorierte Kohlenwasserstoffe (FKW) oder teilfluorierte Kohlenwasserstoffe (HFKW), jedoch keine perhalogenierten Chlorfluorkohlenwasserstoffe (CFK) enthaltend | 6,5 | 0 | |

3824750000 | Tetrachlorkohlenstoff enthaltend | 6,5 | 0 | |

3824760000 | 1,1,1-Trichlorethan (Methylchloroform) enthaltend | 6,5 | 0 | |

3824770000 | Brommethan (Methylbromid) oder Bromchlormethan enthaltend | 6,5 | 0 | |

3824780000 | perfluorierte Kohlenwasserstoffe (FKW) oder teilfluorierte Kohlenwasserstoffe (HFKW) enthaltend, jedoch keine perhalogenierten Chlorfluorkohlenstoffe (CFK) oder teilhalogenierten Chlorfluorkohlenwasserstoffe (HCFKW) enthaltend | 6,5 | 0 | |

3824790000 | andere | 6,5 | 0 | |

3824810000 | Oxiran (Ethylenoxid) enthaltend | 6,5 | 0 | |

3824820000 | polychlorierte Biphenyle (PCB), polychlorierte Terphenyle (PCT) oder polybromierte Biphenyle (PBB) enthaltend | 6,5 | 0 | |

3824830000 | Tris(2,3-dibrompropyl)phosphat enthaltend | 6,5 | 0 | |

3824901000 | geröstetes Chromit | 5 | 0 | |

3824902100 | Absorbentien zum Vervollständigen des Vakuums in elektrischen Röhren | 6,5 | 0 | |

3824902200 | Zubereitungen für Kohlewiderstände oder Keramikfestwiderstände | 6,5 | 0 | |

3824902410 | Stoffe zur Herstellung agrochemischer Erzeugnisse (gemäß dem Verwaltungsgesetz für agrochemische Erzeugnisse (Agricultural Chemicals Management Act) eingetragene Stoffe) | 2 | 3 | |

3824902490 | andere | 6,5 | 3 | |

3824903100 | Mischungen, die vorwiegend aus O-Alkyl(≤ C10, einschließlich Cycloalkyl) Alkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonofluoridaten bestehen | 6,5 | 0 | |

3824903200 | Mischungen, die vorwiegend aus O-Alkyl(≤ C10, einschließlich Cycloalkyl) N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphoramidocyanidaten bestehen | 6,5 | 0 | |

3824903300 | Mischungen, die vorwiegend aus [S-2-(Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)amino)ethyl] Wasserstoffalkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonthioaten und ihren O-Alkyl(≤ C10, einschließlich Cycloalkyl)estern bestehen; Mischungen, die vorwiegend aus alkylierten oder protonierten Salzen dieser Erzeugnisse bestehen | 6,5 | 0 | |

3824903400 | Mischungen, die vorwiegend aus Alkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphonsäuredifluoriden bestehen | 6,5 | 0 | |

3824903500 | Mischungen, die vorwiegend aus [O-2-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)aminoethyl] Wasserstoffalkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphoniten und ihren O-Alkyl(≤ C10, einschließlich Cycloalkyl)estern bestehen; Mischungen, die vorwiegend aus alkylierten oder protonierten Salzen dieser Erzeugnisse bestehen | 6,5 | 0 | |

3824903600 | Mischungen, die vorwiegend aus N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphoraminodihalogeniden bestehen | 6,5 | 0 | |

3824903700 | Mischungen, die vorwiegend aus Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-) N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)phosphoramidaten bestehen | 6,5 | 0 | |

3824903800 | Mischungen, die vorwiegend aus N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)2-chlorethylaminen oder ihren protonierten Salzen bestehen | 6,5 | 0 | |

3824903911 | Mischungen, die vorwiegend aus N,N-Dimethyl-2-aminoethanol oder N,N-Diethyl-2-aminoethanol oder ihren protonierten Salzen bestehen | 6,5 | 0 | |

3824903919 | andere | 6,5 | 0 | |

3824903920 | Mischungen, die vorwiegend aus N,N-Dialkyl(Methyl-, Ethyl-, n-Propyl- oder Isopropyl-)aminoethan-2-thiolen oder ihren protonierten Salzen bestehen | 6,5 | 0 | |

3824903930 | andere Mischungen, die vorwiegend aus Chemikalien bestehen, die ein Phosphoratom enthalten, an das eine Methyl-, Ethyl-, n-Propyl- oder Isopropyl-Gruppe gebunden ist, jedoch keine weiteren Kohlenstoffatome | 6,5 | 0 | |

3824903990 | andere | 6,5 | 0 | |

3824904100 | Polyethylenglycol-Gemische | 6,5 | 0 | |

3824904200 | Ionenaustauscher | 6,5 | 0 | |

3824904300 | Kesselsteinentfernungsmittel | 6,5 | 0 | |

3824904400 | Additive zur Härtung von Lacken und Leimen | 6,5 | 0 | |

3824905100 | Tintenentferner | 6,5 | 0 | |

3824905200 | Korrekturlacke | 6,5 | 0 | |

3824905300 | Korrekturflüssigkeiten | 6,5 | 0 | |

3824906100 | zusammengesetzte Füllstoffe für Anstrichfarben | 6,5 | 0 | |

3824906200 | Zubereitungen zur Herstellung bestimmter keramischer Waren (künstliche Zähne usw.) | 6,5 | 0 | |

3824906300 | Natronkalk | 6,5 | 0 | |

3824906400 | Blaugel | 6,5 | 0 | |

3824906500 | zubereitete Rostschutzmittel | 6,5 | 0 | |

3824906600 | Zubereitungen zur Herstellung von keramischen Kondensatoren und Ferritkernen | 6,5 | 0 | |

3824907100 | Zubereitungen für die Metallplattierung | 6,5 | 0 | |

3824907200 | Chlorparaffin | 6,5 | 0 | |

3824907300 | Schaumverhüter | 6,5 | 0 | |

3824907400 | Schaumbildner | 6,5 | 0 | |

3824907500 | zubereitetes Calciumcarbonat | 6,5 | 0 | |

3824907600 | Flüssigkristallzubereitungen | 6,5 | 3 | |

3824907700 | Ammoniakwässer | 6,5 | 0 | |

3824908010 | auf der Grundlage von Methylethylketonperoxiden | 6,5 | 0 | |

3824908090 | andere | 6,5 | 0 | |

3824909010 | Spurenelementdüngemittel (ausgenommen Erzeugnisse des Kapitels 31) | 6,5 | 0 | |

3824909020 | Polydiphenylmethan-Polydiisocyanat (Roh-MDI) | 6,5 | 3 | |

3824909030 | Kaugummigrundmasse | 8 | 0 | |

3824909050 | Naphthensäuren, ihre wasserunlöslichen Salze und ihre Ester | 6,5 | 0 | |

3824909090 | andere | 6,5 | | |

–acyclische Kohlenwasserstoffe enthaltend, die nur mit Fluor oder Chlor perhalogeniert sind | | 0 | |

–Mischungen, die perhalogenierte Derivate von acyclischen Kohlenwasserstoffen enthalten, die aus zwei oder mehr verschiedenen Halogenen bestehen (ausgenommen acyclische Kohlenwasserstoffe enthaltend, die nur mit Fluor oder Chlor perhalogeniert sind) | | 0 | |

–3824 90 9090 (andere) | | 3 | |

3825100000 | Siedlungsabfälle | 6,5 | 0 | |

3825200000 | Klärschlamm | 6,5 | 0 | |

3825301000 | der Position 3005 | 0 | 0 | |

3825302000 | der Unterposition 3824 90 | 6,5 | 0 | |

3825303000 | der Unterposition 4015 11 | 8 | 0 | |

3825304000 | der Unterposition 9018 3 | 8 | 0 | |

3825410000 | halogeniert | 6,5 | 0 | |

3825490000 | andere | 6,5 | 0 | |

3825500000 | Abfälle von flüssigen Abbeizmitteln für Metalle, Hydraulikflüssigkeiten, Bremsflüssigkeiten und Gefrierschutzflüssigkeiten | 6,5 | 0 | |

3825610000 | überwiegend organische Bestandteile enthaltend | 6,5 | 0 | |

3825690000 | andere | 6,5 | 0 | |

3825900000 | andere | 6,5 | 0 | |

3901101000 | lineares Polyethylen mit geringer Dichte | 6,5 | 5 | |

3901109000 | andere | 6,5 | 5 | |

3901201000 | aus Pulpe | 6,5 | 0 | |

3901209000 | andere | 6,5 | 0 | |

3901300000 | Ethylen-Vinylacetat-Copolymere | 6,5 | 5 | |

3901900000 | andere | 6,5 | 0 | |

3902100000 | Polypropylen | 6,5 | 0 | |

3902200000 | Polyisobutylen | 6,5 | 0 | |

3902300000 | Propylen-Copolymere | 6,5 | 0 | |

3902900000 | andere | 6,5 | 3 | |

3903110000 | expandierbar | 6,5 | 0 | |

3903190000 | andere | 6,5 | 0 | |

3903200000 | Styrol-Acrylnitril-Copolymere (SAN) | 6,5 | 0 | |

3903300000 | Acrylnitril-Butadien-Styrol-Copolymere (ABS) | 6,5 | 0 | |

3903901000 | Styrol-Butadien-Copolymere | 6,5 | 0 | |

3903909000 | andere | 6,5 | 0 | |

3904100000 | Poly(vinylchlorid), nicht mit anderen Stoffen gemischt | 6,5 | 5 | |

3904210000 | nicht weich gemacht | 6,5 | 0 | |

3904220000 | weich gemacht | 6,5 | 0 | |

3904300000 | Vinylchlorid-Vinylacetat-Copolymere | 6,5 | 5 | |

3904400000 | andere Copolymere des Vinylchlorids | 6,5 | 0 | |

3904500000 | Polymere des Vinylidenchlorids | 6,5 | 0 | |

3904610000 | Polytetrafluorethylen | 6,5 | 0 | |

3904690000 | andere | 6,5 | 0 | |

3904900000 | andere | 6,5 | 0 | |

3905120000 | in wässriger Dispersion | 6,5 | 0 | |

3905190000 | andere | 6,5 | 0 | |

3905210000 | in wässriger Dispersion | 6,5 | 0 | |

3905290000 | andere | 6,5 | 3 | |

3905300000 | Poly(vinylalkohol), auch nicht hydrolisierte Acetatgruppen enthaltend | 8 | 0 | |

3905910000 | Copolymere | 6,5 | 0 | |

3905990000 | andere | 6,5 | 0 | |

3906100000 | Poly(methylmethacrylat) | 6,5 | 3 | |

3906901000 | Polyacrylamid | 8 | 0 | |

3906909000 | andere | 8 | 0 | |

3907100000 | Polyacetale | 6,5 | 0 | |

3907201000 | Polyoxyethylen (Polyethylenglycol) | 6,5 | 0 | |

3907202000 | Polyoxypropylen (Polypropylenglycol) | 6,5 | 0 | |

3907203000 | Polyphenylenoxid | 6,5 | 0 | |

3907209000 | andere | 6,5 | 0 | |

3907301000 | zur Herstellung von Halbleitern | 6,5 | 0 | |

3907309000 | andere | 6,5 | 0 | |

3907400000 | Polycarbonate | 6,5 | 3 | |

3907500000 | Alkydharze | 6,5 | 0 | |

3907600000 | Poly(ethylenterephthalat) | 6,5 | 0 | |

3907700000 | Poly(milchsäure) | 6,5 | 0 | |

3907910000 | ungesättigt | 6,5 | 0 | |

3907991000 | Polybutylenterephthalat | 6,5 | 0 | |

3907999000 | andere | 6,5 | 0 | |

3908101000 | Polyamid-6 | 6,5 | 0 | |

3908102000 | Polyamid-6,6 | 6,5 | 0 | |

3908103000 | Polyamid-11, -12, -6,9, -6,10, -6,12 | 6,5 | 0 | |

3908900000 | andere | 6,5 | 0 | |

3909101000 | Harnstoffharze | 6,5 | 0 | |

3909102000 | Thioharnstoffharze | 6,5 | 0 | |

3909200000 | Melaminharze | 6,5 | 0 | |

3909300000 | andere Aminoharze | 6,5 | 0 | |

3909400000 | Phenolharze | 6,5 | 0 | |

3909500000 | Polyurethane | 6,5 | 0 | |

3910001000 | zur Herstellung von Halbleitern | 6,5 | 0 | |

3910009010 | Siliconöl | 6,5 | 3 | |

3910009020 | Siliconkautschuk | 6,5 | 3 | |

3910009090 | andere | 6,5 | 3 | |

3911101000 | Petroleumharze | 8 | 5 | |

3911102000 | Cumaron-, Inden- oder Cumaron-Inden-Harze | 8 | 0 | |

3911103000 | Polyterpene | 8 | 0 | |

3911901000 | Polysulfide | 6,5 | 0 | |

3911902000 | Polysulfone | 6,5 | 3 | |

3911903000 | Furanharz | 6,5 | 0 | |

3911909000 | andere | 6,5 | 3 | |

3912110000 | nicht weich gemacht | 5 | 0 | |

3912120000 | weich gemacht | 5 | 0 | |

3912200000 | Cellulosenitrate (einschließlich Collodium) | 6,5 | 3 | |

3912311000 | Natriumcarboxymethylcellulose | 6,5 | 3 | |

3912319000 | andere | 6,5 | 0 | |

3912391000 | Methylcellulose | 6,5 | 3 | |

3912399000 | andere | 6,5 | 0 | |

3912901000 | regenerierte Cellulose | 6,5 | 0 | |

3912909000 | andere | 6,5 | 0 | |

3913101000 | Natriumalginat | 6,5 | 0 | |

3913102000 | Propylenglycolalginat | 6,5 | 0 | |

3913109000 | andere | 6,5 | 0 | |

3913901000 | gehärtete Eiweißstoffe | 6,5 | 0 | |

3913902010 | Chlorkautschuk | 6,5 | 3 | |

3913902020 | Kautschukhydrochlorid | 6,5 | 0 | |

3913902030 | oxidierter Kautschuk | 6,5 | 0 | |

3913902040 | cyclischer Kautschuk | 6,5 | 0 | |

3913902090 | andere | 6,5 | 0 | |

3913909010 | Dextran | 8 | 0 | |

3913909090 | andere | 6,5 | 5 | |

3914001000 | kationisch | 6,5 | 0 | |

3914009000 | andere | 6,5 | 0 | |

3915100000 | von Polymeren des Ethylens | 6,5 | 0 | |

3915200000 | von Polymeren des Styrols | 6,5 | 0 | |

3915300000 | von Polymeren des Vinylchlorids | 6,5 | 0 | |

3915901000 | von Polymeren des Propylens | 6,5 | 0 | |

3915902000 | von Acrylpolymeren | 6,5 | 0 | |

3915903000 | von Polyacetalen | 6,5 | 0 | |

3915904000 | von Polycarbonaten | 6,5 | 0 | |

3915905000 | von Polyamiden | 6,5 | 0 | |

3915909000 | andere | 6,5 | 0 | |

3916100000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3916200000 | aus Polymeren des Vinylchlorids | 6,5 | 5 | |

3916901000 | aus Polymeren des Styrols | 6,5 | 0 | |

3916902000 | aus Polymeren des Propylens | 6,5 | 0 | |

3916903000 | aus Acrylpolymeren | 6,5 | 0 | |

3916904000 | aus Polyamiden | 6,5 | 0 | |

3916909000 | andere | 6,5 | 3 | |

3917101000 | aus gehärteten Eiweißstoffen | 6,5 | 3 | |

3917102000 | aus Cellulosekunststoffen | 6,5 | 3 | |

3917210000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3917220000 | aus Polymeren des Propylens | 6,5 | 3 | |

3917230000 | aus Polymeren des Vinylchlorids | 6,5 | 0 | |

3917291000 | aus Polymeren des Styrols | 6,5 | 0 | |

3917292000 | aus Polyamiden | 6,5 | 0 | |

3917299000 | andere | 6,5 | 3 | |

3917311000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3917312000 | aus Polymeren des Vinylchlorids | 6,5 | 0 | |

3917319000 | andere | 6,5 | 0 | |

3917321000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3917322000 | aus Polymeren des Vinylchlorids | 6,5 | 0 | |

3917329000 | andere | 6,5 | 0 | |

3917331000 | aus Polymeren des Ethylens | 8 | 0 | |

3917332000 | aus Polymeren des Vinylchlorids | 8 | 0 | |

3917339000 | andere | 8 | 0 | |

3917391000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3917392000 | aus Polymeren des Vinylchlorids | 6,5 | 0 | |

3917399000 | andere | 6,5 | 0 | |

3917400000 | Formstücke, Verschlussstücke oder Verbindungsstücke | 8 | 3 | |

3918101000 | aus Polyvinylchlorid | 6,5 | 5 | |

3918102000 | aus Copolymeren des Vinylchlorids und Vinylacetats | 6,5 | 3 | |

3918109000 | andere | 6,5 | 5 | |

3918900000 | aus anderen Kunststoffen | 6,5 | 0 | |

3919100000 | in Rollen mit einer Breite von 20 cm oder weniger | 6,5 | 0 | |

3919900000 | andere | 6,5 | 0 | |

3920100000 | aus Polymeren des Ethylens | 6,5 | 3 | |

3920200000 | aus Polymeren des Propylens | 6,5 | 0 | |

3920300000 | aus Polymeren des Styrols | 6,5 | 0 | |

3920430000 | mit einem Gehalt an Weichmachern von 6 GHT oder mehr | 6,5 | 0 | |

3920490000 | andere | 6,5 | 0 | |

3920510000 | aus Poly(methylmethacrylat) | 6,5 | 0 | |

3920590000 | andere | 6,5 | 5 | |

3920610000 | aus Polycarbonaten | 6,5 | 5 | |

3920620000 | aus Poly(ethylenterephthalat) | 6,5 | 0 | |

3920630000 | aus ungesättigten Polyestern | 6,5 | 0 | |

3920690000 | aus anderen Polyestern | 6,5 | 0 | |

3920710000 | aus regenerierter Cellulose | 6,5 | 0 | |

3920730000 | aus Celluloseacetat | 6,5 | 0 | |

3920791000 | aus Vulkanfiber | 6,5 | 0 | |

3920799000 | andere | 6,5 | 0 | |

3920910000 | aus Poly(vinylchlorid) | 6,5 | 0 | |

3920920000 | aus Polyamiden | 6,5 | 0 | |

3920930000 | aus Aminoharzen | 6,5 | 0 | |

3920940000 | aus Phenolharzen | 6,5 | 0 | |

3920991000 | für Luftfahrzeuge | 6,5 | 0 | |

3920999010 | Polyimidfolien, zur Herstellung gedruckter Schaltungen in der Funktion als Anschlussrahmen (Leadframe) | 4 | 0 | |

3920999090 | andere | 6,5 | 0 | |

3921110000 | aus Polymeren des Styrols | 6,5 | 0 | |

3921120000 | aus Polymeren des Vinylchlorids | 6,5 | 0 | |

3921130000 | aus Polyurethanen | 6,5 | 5 | |

3921140000 | aus regenerierter Cellulose | 6,5 | 0 | |

3921191010 | Separator, zur Herstellung von Sekundärbatterien | 4 | 0 | |

3921191090 | andere | 6,5 | 0 | |

3921192010 | Separator, zur Herstellung von Sekundärbatterien | 4 | 0 | |

3921192090 | andere | 6,5 | 0 | |

3921193010 | aus Polymethylmethacrylat | 6,5 | 0 | |

3921193090 | andere | 6,5 | 0 | |

3921194010 | aus Polycarbonaten | 6,5 | 0 | |

3921194020 | aus Polyethylenterephthalat | 6,5 | 0 | |

3921194030 | aus ungesättigten Polyestern | 6,5 | 0 | |

3921194090 | andere | 6,5 | 0 | |

3921195010 | aus Vulkanfiber | 6,5 | 0 | |

3921195020 | aus Celluloseacetat | 6,5 | 0 | |

3921195090 | andere | 6,5 | 0 | |

3921199010 | aus Polyvinylbutyral | 6,5 | 0 | |

3921199020 | aus Polyamiden | 6,5 | 0 | |

3921199030 | aus Aminoharzen | 6,5 | 0 | |

3921199040 | aus Phenolharzen | 6,5 | 0 | |

3921199090 | andere | 6,5 | 0 | |

3921901000 | aus Polymeren des Ethylens | 6,5 | 0 | |

3921902000 | aus Polymeren des Propylens | 6,5 | 0 | |

3921903000 | aus Polymeren des Styrols | 6,5 | 0 | |

3921904010 | starr | 6,5 | 0 | |

3921904020 | flexibel | 6,5 | 0 | |

3921905010 | aus Polymethylmethacrylat | 6,5 | 0 | |

3921905090 | andere | 6,5 | 0 | |

3921906010 | aus Polycarbonaten | 6,5 | 0 | |

3921906020 | aus Polyethylenterephthalat | 6,5 | 0 | |

3921906030 | aus ungesättigten Polyestern | 6,5 | 0 | |

3921906090 | andere | 6,5 | 0 | |

3921907010 | aus regenerierter Cellulose | 6,5 | 0 | |

3921907020 | aus Vulkanfiber | 6,5 | 0 | |

3921907030 | aus Celluloseacetat | 6,5 | 0 | |

3921907090 | andere | 6,5 | 0 | |

3921909010 | aus Polyvinylbutyral | 6,5 | 0 | |

3921909020 | aus Polyamiden | 6,5 | 0 | |

3921909030 | aus Aminoharzen | 6,5 | 0 | |

3921909040 | aus Phenolharzen | 6,5 | 0 | |

3921909050 | aus Polyurethanen | 6,5 | 0 | |

3921909090 | andere | 6,5 | 0 | |

3922101000 | Badewannen und Duschen | 8 | 0 | |

3922102000 | Waschbecken | 8 | 0 | |

3922103000 | Spülbecken | 8 | 0 | |

3922200000 | Klosettsitze und -deckel | 8 | 0 | |

3922901000 | Bidets | 8 | 0 | |

3922909000 | andere | 8 | 0 | |

3923100000 | Schachteln (einschließlich Dosen), Kisten, Verschläge und ähnliche Waren | 8 | 0 | |

3923210000 | aus Polymeren des Ethylens | 8 | 0 | |

3923290000 | aus anderen Kunststoffen | 8 | 0 | |

3923300000 | Ballons, Flaschen, Flakons und ähnliche Waren | 8 | 0 | |

3923400000 | Spulen, Spindeln, Hülsen und ähnliche Warenträger | 6,5 | 3 | |

3923500000 | Stöpsel, Deckel, Kapseln und andere Verschlüsse | 8 | 5 | |

3923900000 | andere | 8 | 3 | |

3924100000 | Geschirr und andere Artikel für den Tisch- oder Küchengebrauch | 8 | 0 | |

3924901000 | Seifenschalen und Seifenbehälter | 8 | 0 | |

3924902000 | Tischdecken und andere ähnliche Waren | 8 | 0 | |

3924909000 | andere | 8 | 0 | |

3925100000 | Sammelbehälter, Tanks, Bottiche und ähnliche Behälter, mit einem Fassungsvermögen von mehr als 300 l | 8 | 0 | |

3925200000 | Türen, Fenster, und deren Rahmen, Verkleidungen und Schwellen | 8 | 0 | |

3925300000 | Fensterläden, Jalousien (einschließlich Jalousetten) und ähnliche Waren, und Teile davon | 8 | 0 | |

3925900000 | andere | 8 | 3 | |

3926101000 | Federmäppchen und Radiergummi | 8 | 0 | |

3926102000 | Hefter und Alben | 8 | 0 | |

3926109000 | andere | 8 | 0 | |

3926200000 | Kleidung und Bekleidungszubehör (einschließlich Fingerhandschuhe, Handschuhe ohne Fingerspitzen und Fausthandschuhe) | 8 | 0 | |

3926300000 | Beschläge für Möbel, Karosserien und dergleichen | 8 | 0 | |

3926400000 | Statuetten und andere Ziergegenstände | 8 | 0 | |

3926901000 | Teile für die Verwendung in Maschinen, Apparaten und mechanischen Geräten | 8 | 3 | |

3926902000 | Fächer und Handschilder, nicht mechanisch, Rahmen und Griffe dafür sowie Teile dieser Rahmen und Griffe | 8 | 0 | |

3926903000 | Etiketten und Schildchen | 8 | 0 | |

3926904000 | Klebestreifen mit Behälter | 8 | 0 | |

3926905000 | Rahmen für Gemälde, Fotografien, Spiegel und dergleichen | 8 | 0 | |

3926909000 | andere | 8 | 3 | |

4001100000 | Latex von Naturkautschuk, auch vorvulkanisiert | 0 | 0 | |

4001211000 | RSS-1X | 0 | 0 | |

4001212000 | RSS-1 | 0 | 0 | |

4001213000 | RSS-2 | 0 | 0 | |

4001214000 | RSS-3 | 0 | 0 | |

4001215000 | RSS-4 | 0 | 0 | |

4001216000 | RSS-5 | 0 | 0 | |

4001220000 | technisch spezifizierter Naturkautschuk (TSNR) | 0 | 0 | |

4001290000 | andere | 0 | 0 | |

4001301000 | Chicle-Kautschuk | 2 | 0 | |

4001309000 | andere | 2 | 0 | |

4002110000 | Latex | 8 | 0 | |

4002190000 | andere | 8 | 5 | |

4002201000 | Latex | 8 | 0 | |

4002209000 | andere | 8 | 5 | |

4002311000 | Latex | 5 | 0 | |

4002319000 | andere | 5 | 0 | |

4002391000 | Latex | 5 | 0 | |

4002399010 | aus Chlorbutylkautschuk (CIIR) | 5 | 0 | |

4002399020 | aus Brombutylkautschuk (BIIR) | 5 | 0 | |

4002410000 | Latex | 8 | 0 | |

4002490000 | andere | 8 | 0 | |

4002510000 | Latex | 8 | 3 | |

4002590000 | andere | 8 | 5 | |

4002601000 | Latex | 8 | 0 | |

4002609000 | andere | 8 | 0 | |

4002701000 | Latex | 8 | 5 | |

4002709000 | andere | 8 | 7 | |

4002801000 | Latex | 8 | 0 | |

4002809000 | andere | 8 | 0 | |

4002910000 | Latex | 8 | 0 | |

4002991000 | aus carboxyliertem Acrylnitril-Butadien-Kautschuk (XNBR) | 8 | 0 | |

4002992000 | aus Acrylnitril-Isopren-Kautschuk (NIR) | 8 | 0 | |

4002993000 | Thioplaste (TM) | 8 | 0 | |

4002999000 | andere | 8 | 0 | |

4003000000 | regenerierter Kautschuk in Primärformen oder in Platten, Blättern oder Streifen | 8 | 0 | |

4004000000 | Abfälle, Bruch und Schnitzel von Weichkautschuk, auch zu Pulver oder Granulat zerkleinert | 3 | 0 | |

4005101000 | Platten, Blätter und Streifen | 8 | 0 | |

4005109000 | andere | 8 | 3 | |

4005200000 | Lösungen; Dispersionen, ausgenommen solche der Unterposition 4005 10 | 8 | 0 | |

4005910000 | Platten, Blätter und Streifen | 8 | 0 | |

4005991000 | Latex von Kautschukmischungen | 8 | 0 | |

4005999000 | andere | 8 | 3 | |

4006100000 | Rohlaufprofile | 8 | 0 | |

4006901000 | Stangen aus Kautschuk | 8 | 0 | |

4006902000 | Rohre aus Kautschuk | 8 | 0 | |

4006903000 | Profile aus Kautschuk | 8 | 0 | |

4006904000 | Scheiben, Ringe und Unterlegscheiben aus Kautschuk | 8 | 0 | |

4006905000 | Fäden aus Kautschuk | 8 | 0 | |

4006909000 | andere | 8 | 0 | |

4007001000 | Fäden aus Kautschuk | 8 | 0 | |

4007002000 | Schnüre aus Kautschuk | 8 | 0 | |

4008111000 | in Verbindung mit Geweben, die zur Verstärkung dienen | 8 | 3 | |

4008119000 | andere | 8 | 3 | |

4008191000 | in Verbindung mit Geweben, die zur Verstärkung dienen | 8 | 0 | |

4008199000 | andere | 8 | 3 | |

4008211000 | in Verbindung mit Geweben, die zur Verstärkung dienen | 8 | 0 | |

4008219000 | andere | 8 | 0 | |

4008291000 | in Verbindung mit Geweben, die zur Verstärkung dienen | 8 | 3 | |

4008299000 | andere | 8 | 5 | |

4009110000 | ohne Formstücke, Verschlussstücke oder Verbindungsstücke | 8 | 0 | |

4009120000 | mit Formstücken, Verschlussstücken oder Verbindungsstücken | 8 | 0 | |

4009210000 | ohne Formstücke, Verschlussstücke oder Verbindungsstücke | 8 | 5 | |

4009220000 | mit Formstücken, Verschlussstücken oder Verbindungsstücken | 8 | 3 | |

4009310000 | ohne Formstücke, Verschlussstücke oder Verbindungsstücke | 8 | 0 | |

4009320000 | mit Formstücken, Verschlussstücken oder Verbindungsstücken | 8 | 0 | |

4009410000 | ohne Formstücke, Verschlussstücke oder Verbindungsstücke | 8 | 0 | |

4009420000 | mit Formstücken, Verschlussstücken oder Verbindungsstücken | 8 | 5 | |

4010110000 | nur mit Metall verstärkt | 8 | 0 | |

4010120000 | nur mit textilen Spinnstoffen verstärkt | 8 | 0 | |

4010191000 | nur mit Kunststoffen verstärkt | 8 | 3 | |

4010199000 | andere | 8 | 0 | |

4010310000 | endlose Treibriemen mit trapezförmigem Querschnitt (Keilriemen), v-artig gerippt, mit einem äußeren Umfang von mehr als 60 cm bis 180 cm | 8 | 0 | |

4010320000 | endlose Treibriemen mit trapezförmigem Querschnitt (Keilriemen), andere als v-artig gerippt, mit einem äußeren Umfang von mehr als 60 cm bis 180 cm | 8 | 0 | |

4010330000 | endlose Treibriemen mit trapezförmigem Querschnitt (Keilriemen), v-artig gerippt, mit einem äußeren Umfang von mehr als 180 cm bis 240 cm | 8 | 0 | |

4010340000 | endlose Treibriemen mit trapezförmigem Querschnitt (Keilriemen), andere als v-artig gerippt, mit einem äußeren Umfang von mehr als 180 cm bis 240 cm | 8 | 0 | |

4010350000 | endlose Synchrontreibriemen (Zahnriemen) mit einem äußeren Umfang von mehr als 60 cm bis 150 cm | 8 | 0 | |

4010360000 | endlose Synchrontreibriemen (Zahnriemen) mit einem äußeren Umfang von mehr als 150 cm bis 198 cm | 8 | 0 | |

4010390000 | andere | 8 | 5 | |

4011101000 | von der für Radialkarkassen verwendeten Art | 8 | 0 | |

4011102000 | von der für Diagonalkarkassen verwendeten Art | 8 | 0 | |

4011109000 | andere | 8 | 0 | |

4011201010 | für die Verwendung auf Felgen mit einem Durchmesser von weniger als 49,53 cm | 8 | 0 | |

4011201090 | andere | 8 | 0 | |

4011202010 | für die Verwendung auf Felgen mit einem Durchmesser von weniger als 49,53 cm | 8 | 0 | |

4011202090 | andere | 8 | 0 | |

4011209000 | andere | 8 | 0 | |

4011300000 | von der für Luftfahrzeuge verwendeten Art | 5 | 0 | |

4011400000 | von der für Motorräder und Motorroller verwendeten Art | 8 | 0 | |

4011500000 | von der für Fahrräder verwendeten Art | 8 | 0 | |

4011610000 | von der für Maschinen und Fahrzeuge in der Land- und Forstwirtschaft verwendeten Art | 8 | 0 | |

4011620000 | von der für Maschinen und Fahrzeuge im Hoch- und Tiefbau verwendeten Art, mit einem Felgendurchmesser von 61 cm oder weniger | 8 | 3 | |

4011630000 | von der für Maschinen und Fahrzeuge im Hoch- und Tiefbau verwendeten Art, mit einem Felgendurchmesser von mehr als 61 cm | 8 | 0 | |

4011690000 | andere | 8 | 0 | |

4011920000 | von der für Maschinen und Fahrzeuge in der Land- und Forstwirtschaft verwendeten Art | 8 | 0 | |

4011930000 | von der für Maschinen und Fahrzeuge im Hoch- und Tiefbau verwendeten Art, mit einem Felgendurchmesser von 61 cm oder weniger | 8 | 0 | |

4011940000 | von der für Maschinen und Fahrzeuge im Hoch- und Tiefbau verwendeten Art, mit einem Felgendurchmesser von mehr als 61 cm | 8 | 0 | |

4011990000 | andere | 8 | 0 | |

4012110000 | von der für Personenkraftwagen (einschließlich Kombinationskraftwagen und Rennwagen) verwendeten Art | 8 | 0 | |

4012120000 | von der für Omnibusse und Lastkraftwagen verwendeten Art | 8 | 0 | |

4012130000 | von der für Luftfahrzeuge verwendeten Art: | 5 | 0 | |

4012190000 | andere | 8 | 0 | |

4012201000 | von der für Luftfahrzeuge verwendeten Art | 5 | 0 | |

4012209010 | von der für Personenkraftwagen (einschließlich Kombinationskraftwagen und Rennwagen) verwendeten Art | 8 | 0 | |

4012209020 | von der für Omnibusse und Lastkraftwagen verwendeten Art | 8 | 0 | |

4012209090 | andere | 8 | 0 | |

4012901010 | Vollreifen | 5 | 0 | |

4012901020 | Hohlkammerreifen | 5 | 0 | |

4012901030 | Überreifen | 5 | 0 | |

4012901040 | Felgenbänder | 5 | 0 | |

4012909010 | Vollreifen | 8 | 0 | |

4012909020 | Hohlkammerreifen | 8 | 0 | |

4012909030 | Überreifen | 8 | 0 | |

4012909040 | Felgenbänder | 8 | 0 | |

4012909090 | andere | 8 | 0 | |

4013101000 | von der für Personenkraftwagen (einschließlich Kombinationskraftwagen und Rennwagen) verwendeten Art | 8 | 0 | |

4013102000 | von der für Omnibusse und Lastkraftwagen verwendeten Art | 8 | 0 | |

4013200000 | von der für Fahrräder verwendeten Art | 8 | 0 | |

4013901000 | von der für Luftfahrzeuge verwendeten Art | 5 | 0 | |

4013909010 | von der für Motorräder und Motorroller verwendeten Art | 8 | 0 | |

4013909020 | von der der für Maschinen und Fahrzeuge im Hoch- und Tiefbau und in der Landwirtschaft verwendeten Art | 8 | 0 | |

4013909090 | andere | 8 | 0 | |

4014100000 | Präservative | 8 | 0 | |

4014901000 | Sauger | 8 | 0 | |

4014909000 | andere | 8 | 0 | |

4015110000 | für chirurgische Zwecke | 8 | 0 | |

4015190000 | andere | 8 | 0 | |

4015901000 | Schutzkleidung für diverse Zwecke | 8 | 0 | |

4015902000 | Schutzkleidung für Radiologen | 8 | 0 | |

4015909000 | andere | 8 | 0 | |

4016100000 | aus Zellkautschuk | 8 | 0 | |

4016910000 | Bodenbeläge und Fußmatten | 8 | 3 | |

4016920000 | Radiergummi | 8 | 0 | |

4016930000 | Dichtungen | 8 | 3 | |

4016940000 | Fender, auch aufblasbar | 8 | 0 | |

4016951000 | Luftmatratzen | 8 | 0 | |

4016952000 | aufblasbare Kopfkissen | 8 | 0 | |

4016953000 | aufblasbare Kissen | 8 | 0 | |

4016959000 | andere | 8 | 3 | |

4016991010 | Teile von Ballonen, Luftschiffen, Flugmaschinen, Segelflugzeugen, Drachen und rotierenden Fallschirmen | 0 | 0 | |

4016991090 | andere | 8 | 3 | |

4016992000 | Bänder aus Kautschuk | 8 | 0 | |

4016993000 | Stöpsel und Ringe für Flaschen | 8 | 3 | |

4016999000 | andere | 8 | 3 | |

4017001000 | Hartkautschuk | 8 | 0 | |

4017002000 | Waren aus Hartkautschuk | 8 | 0 | |

4101201000 | Häute und Felle, nicht gegerbt | 1 | 0 | |

4101202000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4101501011 | Häute von Kühen | 1 | 0 | |

4101501012 | Häute von Jungbullen | 1 | 0 | |

4101501013 | Häute von Ochsen | 1 | 10 | |

4101501014 | Häute von Bullen | 1 | 0 | |

4101501019 | andere | 1 | 0 | |

4101501021 | Häute von Kühen | 1 | 0 | |

4101501022 | Häute von Jungbullen | 1 | 0 | |

4101501023 | Häute von Ochsen | 1 | 0 | |

4101501024 | Häute von Bullen | 1 | 0 | |

4101501029 | andere | 1 | 0 | |

4101501090 | andere | 1 | 0 | |

4101502000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4101901011 | von Kälberfellen | 1 | 0 | |

4101901019 | andere | 1 | 0 | |

4101901091 | von Kälberfellen | 1 | 0 | |

4101901099 | andere | 1 | 0 | |

4101902000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4102100000 | nicht enthaart | 1 | 0 | |

4102211000 | Häute und Felle, nicht gegerbt | 1 | 0 | |

4102212000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4102291000 | Häute und Felle, nicht gegerbt | 1 | 0 | |

4102292000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4103201010 | von Schlangen | 1 | 0 | |

4103201020 | von Echsen | 1 | 0 | |

4103201030 | von Krokodilen | 1 | 0 | |

4103201090 | andere | 1 | 0 | |

4103202000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4103301000 | Häute und Felle, nicht gegerbt | 1 | 0 | |

4103302000 | Häute und Felle, die einem reversiblen Gerbprozess (einschließlich Vorgerbungsprozess) unterzogen wurden | 5 | 0 | |

4103901010 | von Aalen | 1 | 0 | |

4103901020 | von Kängurus | 1 | 0 | |

4103901030 | von Kamelen (einschließlich Dromedaren) | 1 | 0 | |

4103901090 | andere | 1 | 0 | |

4103902010 | von Kamelen (einschließlich Dromedaren) | 3 | 0 | |

4103902090 | andere | 5 | 0 | |

4104110000 | Vollleder, ungespalten; Narbenspalt | 5 | 0 | |

4104190000 | andere | 5 | 0 | |

4104410000 | Vollleder, ungespalten; Narbenspalt | 5 | 0 | |

4104490000 | andere | 5 | 0 | |

4105100000 | in nassem Zustand (einschließlich wet-blue) | 5 | 0 | |

4105300000 | in getrocknetem Zustand (crust) | 5 | 0 | |

4106210000 | in nassem Zustand (einschließlich wet-blue) | 5 | 0 | |

4106220000 | in getrocknetem Zustand (crust) | 5 | 0 | |

4106310000 | in nassem Zustand (einschließlich wet-blue) | 5 | 0 | |

4106320000 | in getrocknetem Zustand (crust) | 5 | 0 | |

4106400000 | von Kriechtieren | 5 | 0 | |

4106910000 | in nassem Zustand (einschließlich wet-blue) | 5 | 0 | |

4106920000 | in getrocknetem Zustand (crust) | 5 | 0 | |

4107110000 | Vollleder, ungespalten | 5 | 0 | |

4107120000 | Narbenspalt | 5 | 0 | |

4107190000 | andere | 5 | 0 | |

4107910000 | Vollleder, ungespalten | 5 | 0 | |

4107920000 | Narbenspalt | 5 | 0 | |

4107990000 | andere | 5 | 0 | |

4112000000 | nach dem Gerben oder Trocknen zugerichtetes Leder, einschließlich Pergament- oder Rohhautleder, von Schafen oder Lämmern, enthaart, auch gespalten, ausgenommen Leder der Position 4114 | 5 | 0 | |

4113100000 | von Ziegen oder Zickeln | 5 | 0 | |

4113200000 | von Schweinen | 5 | 0 | |

4113300000 | von Kriechtieren | 5 | 0 | |

4113900000 | andere | 5 | 0 | |

4114100000 | Sämischleder (einschließlich Neusämischleder) | 5 | 0 | |

4114201000 | Lackleder | 5 | 0 | |

4114202000 | folienkaschierte Lackleder | 5 | 0 | |

4114203000 | metallisierte Leder | 5 | 0 | |

4115100000 | rekonstituiertes Leder auf der Grundlage von Leder oder Lederfasern hergestellt, in Platten, Blättern oder Streifen, auch in Rollen | 8 | 0 | |

4115200000 | Schnitzel und andere Abfälle von Leder, Pergament- oder Rohhautleder oder rekonstituiertem Leder, nicht zur Herstellung von Waren aus Leder verwendbar; Lederspäne, Lederpulver und Ledermehl | 3 | 0 | |

4201001000 | aus Leder von Kriechtieren | 8 | 0 | |

4201009010 | Sättel und Satteldecken | 8 | 3 | |

4201009020 | Zugtaue | 8 | 0 | |

4201009030 | Leinen | 8 | 0 | |

4201009040 | Maulkörbe | 8 | 0 | |

4201009090 | andere | 8 | 0 | |

4202111010 | von Schlangen | 8 | 0 | |

4202111020 | von Echsen | 8 | 0 | |

4202111030 | von Krokodilen | 8 | 0 | |

4202111040 | von Aalen | 8 | 0 | |

4202111050 | von Kängurus | 8 | 0 | |

4202111090 | andere | 8 | 3 | |

4202112000 | aus rekonstituiertem Leder | 8 | 3 | |

4202113000 | aus Lackleder | 8 | 0 | |

4202121010 | aus Polyvinylchlorid | 8 | 0 | |

4202121020 | aus Polyurethan | 8 | 0 | |

4202121090 | andere | 8 | 0 | |

4202122000 | aus Spinnstoffen | 8 | 3 | |

4202191000 | aus Pappe | 8 | 3 | |

4202199000 | andere | 8 | 3 | |

4202211010 | von Schlangen | 8 | 3 | |

4202211020 | von Echsen | 8 | 3 | |

4202211030 | von Krokodilen | 8 | 3 | |

4202211040 | von Aalen | 8 | 0 | |

4202211050 | von Kängurus | 8 | 0 | |

4202211090 | andere | 8 | 0 | |

4202212000 | aus rekonstituiertem Leder | 8 | 0 | |

4202213000 | aus Lackleder | 8 | 0 | |

4202221010 | aus Polyvinylchlorid | 8 | 3 | |

4202221020 | aus Polyurethan | 8 | 0 | |

4202221090 | andere | 8 | 3 | |

4202222000 | aus Spinnstoffen | 8 | 0 | |

4202291000 | aus Pappe | 8 | 0 | |

4202299000 | andere | 8 | 3 | |

4202311010 | von Schlangen | 8 | 3 | |

4202311020 | von Echsen | 8 | 3 | |

4202311030 | von Krokodilen | 8 | 3 | |

4202311040 | von Aalen | 8 | 0 | |

4202311050 | von Kängurus | 8 | 0 | |

4202311090 | andere | 8 | 3 | |

4202312000 | aus rekonstituiertem Leder | 8 | 0 | |

4202313000 | aus Lackleder | 8 | 0 | |

4202321010 | aus Polyvinylchlorid | 8 | 3 | |

4202321020 | aus Polyurethan | 8 | 0 | |

4202321090 | andere | 8 | 3 | |

4202322000 | aus Spinnstoffen | 8 | 3 | |

4202391000 | aus Pappe | 8 | 0 | |

4202399000 | andere | 8 | 3 | |

4202911010 | von Schlangen | 8 | 0 | |

4202911020 | von Echsen | 8 | 0 | |

4202911030 | von Krokodilen | 8 | 0 | |

4202911040 | von Aalen | 8 | 0 | |

4202911050 | von Kängurus | 8 | 0 | |

4202911090 | andere | 8 | 0 | |

4202912000 | aus rekonstituiertem Leder | 8 | 0 | |

4202913000 | aus Lackleder | 8 | 0 | |

4202921010 | aus Polyvinylchlorid | 8 | 0 | |

4202921020 | aus Polyurethan | 8 | 0 | |

4202921090 | andere | 8 | 0 | |

4202922000 | aus Spinnstoffen | 8 | 0 | |

4202991000 | aus Pappe | 8 | 0 | |

4202999000 | andere | 8 | 0 | |

4203101010 | Mäntel | 13 | 0 | |

4203101020 | Jacken, Blazer und Jumper | 13 | 0 | |

4203101050 | Westen | 13 | 0 | |

4203101060 | Hosen | 13 | 0 | |

4203101070 | Röcke | 13 | 0 | |

4203101080 | Overalls | 13 | 0 | |

4203101090 | andere | 13 | 0 | |

4203102010 | Mäntel | 13 | 0 | |

4203102020 | Jacken, Blazer und Jumper | 13 | 0 | |

4203102050 | Westen | 13 | 0 | |

4203102060 | Hosen | 13 | 0 | |

4203102070 | Röcke | 13 | 0 | |

4203102080 | Overalls | 13 | 0 | |

4203102090 | andere | 13 | 0 | |

4203103010 | Mäntel | 13 | 0 | |

4203103020 | Jacken, Blazer und Jumper | 13 | 0 | |

4203103050 | Westen | 13 | 0 | |

4203103060 | Hosen | 13 | 0 | |

4203103070 | Röcke | 13 | 0 | |

4203103080 | Overalls | 13 | 0 | |

4203103090 | andere | 13 | 0 | |

4203109010 | Mäntel | 13 | 0 | |

4203109020 | Jacken, Blazer und Jumper | 13 | 0 | |

4203109050 | Westen | 13 | 0 | |

4203109060 | Hosen | 13 | 0 | |

4203109070 | Röcke | 13 | 0 | |

4203109080 | Overalls | 13 | 0 | |

4203109090 | andere | 13 | 0 | |

4203211000 | Baseball-Handschuhe | 13 | 0 | |

4203212000 | Golfhandschuhe | 13 | 0 | |

4203213000 | Skihandschuhe | 13 | 0 | |

4203214000 | Motorradhandschuhe | 13 | 0 | |

4203215000 | Schlägerhandschuhe | 13 | 0 | |

4203216000 | Tennishandschuhe | 13 | 0 | |

4203217000 | Eishockey-Handschuhe | 13 | 0 | |

4203219000 | andere | 13 | 0 | |

4203291000 | Arbeitshandschuhe | 13 | 0 | |

4203292000 | Handschuhe (Bekleidung) | 13 | 0 | |

4203293000 | Fahrerhandschuhe | 13 | 0 | |

4203299000 | andere | 13 | 3 | |

4203301010 | von Schlangen | 13 | 0 | |

4203301020 | von Echsen | 13 | 3 | |

4203301030 | von Krokodilen | 13 | 3 | |

4203301040 | von Aalen | 13 | 0 | |

4203301090 | andere | 13 | 3 | |

4203309000 | andere | 13 | 3 | |

4203400000 | anderes Bekleidungszubehör | 13 | 3 | |

4205001110 | Riemen | 8 | | |

–für Förderer | | 3 | |

–für Motoren | | 0 | |

–andere | | 3 | |

4205001190 | andere | 8 | | |

–Picker | | 0 | |

–andere | | 3 | |

4205001900 | andere Waren aus Leder | 8 | 0 | |

4205002110 | Riemen | 8 | | |

–für Förderer | | 3 | |

–für Motoren | | 0 | |

–andere | | 3 | |

4205002190 | andere | 8 | | |

–Picker | | 0 | |

–andere | | 3 | |

4205002900 | andere Waren aus rekonstituiertem Leder | 8 | 0 | |

4206001000 | Catgut | 8 | 0 | |

4206009000 | andere | 8 | 0 | |

4301100000 | von Nerzen, ganz, auch ohne Kopf, Schwanz oder Klauen | 3 | 0 | |

4301300000 | von Astrachan-, Karakul-, Persianer-, Breitschwanz- oder ähnlichen Lämmern, von indischen, chinesischen, mongolischen oder tibetanischen Lämmern, ganz, auch ohne Kopf, Schwanz oder Klauen | 3 | 0 | |

4301600000 | von Füchsen, ganz, auch ohne Kopf, Schwanz oder Klauen | 3 | 0 | |

4301801000 | von Chinchillas | 3 | 0 | |

4301802000 | von Opossums | 3 | 0 | |

4301803000 | von Waschbären | 3 | 0 | |

4301804000 | von Kojoten | 3 | 0 | |

4301805000 | von Kaninchen oder Hasen | 3 | 0 | |

4301806000 | von Bisamratten | 3 | 0 | |

4301809000 | andere | 3 | 0 | |

4301900000 | Köpfe, Schwänze, Klauen und andere zu Kürschnerzwecken verwendbare Teile | 3 | 0 | |

4302110000 | von Nerzen | 5 | 0 | |

4302191000 | von Bibern | 5 | 0 | |

4302192000 | von Bisamratten | 5 | 0 | |

4302193000 | von Füchsen | 5 | 0 | |

4302195000 | von Chinchillas | 5 | 0 | |

4302196000 | von Opossums | 5 | 0 | |

4302197000 | von Waschbären | 5 | 0 | |

4302198000 | von Kojoten | 5 | 0 | |

4302199010 | von Schafen | 5 | 0 | |

4302199020 | von Astrachan-, Breitschwanz-, Karakul-, Persianer- oder ähnlichen Lämmern, von indischen, chinesischen, mongolischen oder tibetanischen Lämmern | 5 | 0 | |

4302199090 | andere | 5 | 0 | |

4302201000 | von Nerzen | 5 | 0 | |

4302202000 | von Kaninchen oder Hasen | 5 | 0 | |

4302203000 | von Bibern | 5 | 0 | |

4302204000 | von Bisamratten | 5 | 0 | |

4302205000 | von Füchsen | 5 | 0 | |

4302207000 | von Chinchillas | 5 | 0 | |

4302209010 | von Opossums | 5 | 0 | |

4302209020 | von Waschbären | 5 | 0 | |

4302209030 | von Kojoten | 5 | 0 | |

4302209090 | andere | 5 | 0 | |

4302300000 | ganze Pelzfelle, Teile und Überreste davon, zusammengesetzt | 5 | 0 | |

4303101100 | von Nerzen | 16 | 0 | |

4303101200 | von Kaninchen oder Hasen | 16 | 0 | |

4303101300 | von Lämmern | 16 | 0 | |

4303101400 | von Bibern | 16 | 0 | |

4303101500 | von Bisamratten | 16 | 0 | |

4303101600 | von Füchsen | 16 | 0 | |

4303101800 | von Chinchillas | 16 | 0 | |

4303101910 | von Opossums | 16 | 0 | |

4303101920 | von Waschbären | 16 | 0 | |

4303101930 | von Kojoten | 16 | 0 | |

4303101990 | andere | 16 | 0 | |

4303102100 | von Nerzen | 16 | 0 | |

4303102200 | von Kaninchen oder Hasen | 16 | 0 | |

4303102300 | von Lämmern | 16 | 0 | |

4303102400 | von Bibern | 16 | 0 | |

4303102500 | von Bisamratten | 16 | 0 | |

4303102600 | von Füchsen | 16 | 0 | |

4303102800 | von Chinchillas | 16 | 0 | |

4303102910 | von Opossums | 16 | 0 | |

4303102920 | von Waschbären | 16 | 0 | |

4303102930 | von Kojoten | 16 | 0 | |

4303102990 | andere | 16 | 0 | |

4303900000 | andere | 16 | 0 | |

4304001000 | künstliches Pelzwerk | 8 | 0 | |

4304002000 | Waren aus künstlichem Pelzwerk | 8 | 0 | |

4401100000 | Brennholz in Form von Rundlingen, Scheiten, Zweigen, Reisigbündeln oder ähnlichen Formen | 2 | 0 | |

4401210000 | Nadelholz | 2 | 0 | |

4401221000 | zur Herstellung von Halbstoffen | 0 | 0 | |

4401229000 | andere | 2 | 0 | |

4401300000 | Sägespäne, Holzabfälle und Holzausschuss, auch zu Pellets, Briketts, Scheiten oder ähnlichen Formen zusammengepresst | 2 | 3 | |

4402101000 | Holzkohle, zusammengepresst | 2 | 3 | |

4402109000 | andere | 2 | 3 | |

4402901000 | Holzkohle, zusammengepresst | 2 | 3 | |

4402909000 | andere | 2 | 3 | |

4403101000 | tropische Hölzer | 0 | 0 | |

4403102000 | anderes Holz | 0 | 0 | |

4403109000 | Nadelholz | 0 | 0 | |

4403201000 | Zedernholz | 0 | 0 | |

4403202010 | Douglasienholz | 0 | 0 | |

4403202020 | Hemlocktannenholz | 0 | 0 | |

4403203000 | Rotkiefernholz | 0 | 0 | |

4403204000 | Holz von Whitewood oder Grautanne | 0 | 0 | |

4403205000 | Lärchenholz | 0 | 0 | |

4403207000 | Fichtenholz | 0 | 0 | |

4403208000 | Holz der Radiata-Kiefer | 0 | 0 | |

4403209000 | andere | 0 | 0 | |

4403410000 | Dark Red Meranti, Light Red Meranti und Meranti Bakau | 0 | 0 | |

4403491000 | White Lauan, White Meranti, White Seraya, Yellow Meranti und Alan | 0 | 0 | |

4403492010 | Teak | 0 | 0 | |

4403492020 | Keruing | 0 | 0 | |

4403492030 | Kapur | 0 | 0 | |

4403492040 | Jelutong | 0 | 0 | |

4403492090 | andere | 0 | 0 | |

4403493000 | Okoumé, Obéché, Sapelli, Sipo, Acajou d'Afrique, Makoré und Iroko | 0 | 0 | |

4403494000 | Tiama, Mansonia, Ilomba, Dibtou, Limba und Azobé | 0 | 0 | |

4403495000 | Mahogany und Balsa | 0 | 0 | |

4403499000 | andere | 0 | 0 | |

4403910000 | Eichenholz (Quercus spp.) | 0 | 0 | |

4403920000 | Buchenholz (Fagus spp.) | 0 | 0 | |

4403991010 | Rosenholz | 0 | 0 | |

4403991020 | Ebenholz | 0 | 0 | |

4403991040 | Eschenholz | 0 | 0 | |

4403991050 | Walnussbaumholz | 0 | 0 | |

4403991090 | andere | 0 | 0 | |

4403992000 | Guajakholz | 0 | 0 | |

4403993010 | Espenholz | 0 | 0 | |

4403993020 | Pappelholz | 0 | 0 | |

4403993030 | Ahornholz | 0 | 0 | |

4403993040 | Ulmenholz | 0 | 0 | |

4403993050 | Birkenholz | 0 | 0 | |

4403993060 | Lindenholz | 0 | 0 | |

4403994000 | Paulownienholz | 0 | 0 | |

4403999011 | Malasholz | 0 | 0 | |

4403999012 | Taunholz | 0 | 0 | |

4403999019 | andere | 0 | 0 | |

4403999090 | andere | 0 | 0 | |

4404102000 | Holzstäbe | 5 | 5 | |

4404109000 | andere | 5 | 5 | |

4404202000 | Holzstäbe | 5 | 5 | |

4404209000 | andere | 5 | 5 | |

4405000000 | Holzwolle; Holzmehl | 5 | 5 | |

4406100000 | nicht imprägniert | 5 | 5 | |

4406900000 | andere | 5 | 5 | |

4407101000 | Zedernholz | 5 | 3 | |

4407102000 | Douglasienholz | 5 | 3 | |

4407103000 | Rotkiefernholz | 5 | 5 | |

4407104000 | Holz von Whitewood oder Grautanne | 5 | 3 | |

4407105000 | Lärchenholz | 5 | 3 | |

4407107000 | Fichtenholz | 5 | 5 | |

4407108000 | Holz der Radiata-Kiefer | 5 | 3 | |

4407109000 | andere | 5 | 3 | |

4407210000 | Mahogany (Swietenia spp.) | 5 | 5 | |

4407220000 | Virola, Imbuia und Balsa | 5 | 5 | |

4407250000 | Dark Red Meranti, Light Red Meranti und Meranti Bakau | 5 | 5 | |

4407260000 | White Lauan, White Meranti, White Seraya, Yellow Meranti und Alan | 5 | 5 | |

4407270000 | Sapelli | 5 | 5 | |

4407280000 | Iroko | 5 | 5 | |

4407291000 | Keruing, Ramin, Kapur, Jonkong, Merbau, Jelutong und Kempas | 5 | 5 | |

4407292000 | Teak | 5 | 5 | |

4407293000 | Okoumé, Obéché, Sipo, Acajou, d'Afrique, Makoré, Tiama, Mansonia, Ilomba, Dibétou, Limba und Azobé | 5 | 5 | |

4407299000 | andere | 5 | 5 | |

4407910000 | Eichenholz (Quercus spp.) | 5 | 3 | |

4407920000 | Buchenholz (Fagus spp.) | 5 | 5 | |

4407930000 | Ahornholz (Acer spp.) | 5 | 3 | |

4407940000 | Kirschbaumholz (Prunus spp.) | 5 | 3 | |

4407950000 | Eschenholz (Fraxinus spp.) | 5 | 3 | |

4407991010 | Rosenholz | 5 | 3 | |

4407991020 | Ebenholz | 5 | 5 | |

4407991040 | Walnussbaumholz | 5 | 3 | |

4407991090 | andere | 5 | 5 | |

4407992000 | Guajakholz | 5 | 3 | |

4407993010 | Espenholz | 5 | 3 | |

4407993020 | Pappelholz | 5 | 3 | |

4407993040 | Ulmenholz | 5 | 5 | |

4407993050 | Birkenholz | 5 | 3 | |

4407993060 | Lindenholz | 5 | 3 | |

4407994000 | Paulownienholz | 5 | 3 | |

4407999010 | tropische Hölzer, in den vorhergehenden Unterpositionen nicht genannt | 5 | 3 | |

4407999090 | andere | 5 | 3 | |

4408106000 | für Furniere, durch Messern von Lagenholz gewonnen, oder für ähnliches Lagenholz | 8 | 5 | |

4408109100 | zur Herstellung von Sperrholz | 3 | 5 | |

4408109200 | ornamentiertes Furnier | 3 | 5 | |

4408109910 | Zedernholz | 5 | 5 | |

4408109920 | Douglasienholz | 5 | 5 | |

4408109930 | Rotkiefernholz | 5 | 5 | |

4408109940 | Holz von Whitewood oder Grautanne | 5 | 5 | |

4408109950 | Lärchenholz | 5 | 5 | |

4408109960 | Fichtenholz | 5 | 5 | |

4408109970 | Holz der Radiata-Kiefer | 5 | 5 | |

4408109990 | andere | 5 | 5 | |

4408313000 | für Furniere, durch Messern von Lagenholz gewonnen, oder für ähnliches Lagenholz | 8 | 5 | |

4408319011 | zur Herstellung von Sperrholz | 3 | 5 | |

4408319012 | ornamentiertes Furnier | 3 | 5 | |

4408319019 | andere | 5 | 5 | |

4408319021 | zur Herstellung von Sperrholz | 3 | 5 | |

4408319022 | ornamentiertes Furnier | 3 | 5 | |

4408319029 | andere | 5 | 5 | |

4408396000 | für Furniere, durch Messern von Lagenholz gewonnen, oder für ähnliches Lagenholz | 8 | 5 | |

4408399011 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399012 | ornamentiertes Furnier | 3 | 5 | |

4408399019 | andere | 5 | 5 | |

4408399021 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399022 | ornamentiertes Furnier | 3 | 5 | |

4408399029 | andere | 5 | 5 | |

4408399031 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399032 | ornamentiertes Furnier | 3 | 5 | |

4408399039 | andere | 5 | 5 | |

4408399041 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399042 | ornamentiertes Furnier | 3 | 5 | |

4408399049 | andere | 5 | 5 | |

4408399051 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399052 | ornamentiertes Furnier | 3 | 5 | |

4408399059 | andere | 5 | 5 | |

4408399091 | zur Herstellung von Sperrholz | 3 | 5 | |

4408399092 | ornamentiertes Furnier | 3 | 5 | |

4408399099 | andere | 5 | 5 | |

4408901000 | für Furniere, durch Messern von Lagenholz gewonnen, oder für ähnliches Lagenholz | 8 | 5 | |

4408909150 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909160 | ornamentiertes Furnier | 3 | 5 | |

4408909191 | Rosenholz | 5 | 5 | |

4408909192 | Ebenholz | 5 | 5 | |

4408909193 | Eschenholz | 5 | 5 | |

4408909194 | Walnussbaumholz | 5 | 5 | |

4408909199 | andere | 5 | 5 | |

4408909210 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909220 | ornamentiertes Furnier | 3 | 5 | |

4408909290 | andere | 5 | 5 | |

4408909370 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909380 | ornamentiertes Furnier | 3 | 5 | |

4408909391 | Espenholz | 5 | 5 | |

4408909392 | Pappelholz | 5 | 5 | |

4408909393 | Ahornholz | 5 | 5 | |

4408909394 | Ulmenholz | 5 | 5 | |

4408909395 | Birkenholz | 5 | 5 | |

4408909396 | Lindenholz | 5 | 5 | |

4408909410 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909420 | ornamentiertes Furnier | 3 | 5 | |

4408909490 | andere | 5 | 5 | |

4408909912 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909913 | ornamentiertes Furnier | 3 | 5 | |

4408909914 | Baboen | 5 | 5 | |

4408909919 | andere | 5 | 5 | |

4408909991 | zur Herstellung von Sperrholz | 3 | 5 | |

4408909992 | ornamentiertes Furnier | 3 | 5 | |

4408909999 | andere | 5 | 5 | |

4409100000 | Nadelholz | 8 | 5 | |

4409210000 | Bambus | 8 | 5 | |

4409290000 | andere | 8 | 5 | |

4410111000 | roh oder nur geschliffen | 8 | 7 | |

4410112000 | auf der Oberfläche mit Melamin imprägniertem Papier beschichtet | 8 | 7 | |

4410113000 | auf der Oberfläche mit Dekorplatten oder Dekorfolie aus Kunststoff beschichtet | 8 | 5 | |

4410119000 | andere | 8 | 5 | |

4410121000 | roh oder nur geschliffen | 8 | 7 | |

4410129000 | andere | 8 | 5 | |

4410191010 | roh oder nur geschliffen | 8 | 7 | |

4410191090 | andere | 8 | 5 | |

4410199010 | roh oder nur geschliffen | 8 | 7 | |

4410199020 | auf der Oberfläche mit Melamin imprägniertem Papier beschichtet | 8 | 7 | |

4410199030 | auf der Oberfläche mit Dekorplatten oder Dekorfolie aus Kunststoff beschichtet | 8 | 5 | |

4410199090 | andere | 8 | 5 | |

4410900000 | andere | 8 | 5 | |

4411121000 | weder mechanisch bearbeitet noch oberflächenbeschichtet | 8 | 7 | |

4411122000 | mechanisch bearbeitet oder oberflächenbeschichtet | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411129000 | andere | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411131000 | weder mechanisch bearbeitet noch oberflächenbeschichtet | 8 | 7 | |

4411132000 | mechanisch bearbeitet oder oberflächenbeschichtet | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411139000 | andere | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8 g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411141000 | weder mechanisch bearbeitet noch oberflächenbeschichtet | 8 | 7 | |

4411142010 | Fußbodenbretter | 8 | 7 | |

4411142090 | andere | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3, ausgenommen Fußbodenbretter | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411149000 | andere | 8 | | |

–Faserplatten mit einer Dichte von mehr als 0,8 g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,5 g/cm3 bis 0,8 g/cm3 | | 7 | |

–Faserplatten mit einer Dichte von mehr als 0,35 g/cm3 bis 0,5 g/cm3, ausgenommen Fußbodenbretter | | 5 | |

4411921000 | weder mechanisch bearbeitet noch oberflächenbeschichtet | 8 | 7 | |

4411922010 | Fußbodenbretter | 8 | 7 | |

4411922090 | andere | 8 | 7 | |

4411929000 | andere | 8 | 7 | |

4411931000 | weder mechanisch bearbeitet noch oberflächenbeschichtet | 8 | 7 | |

4411932010 | Fußbodenbretter | 8 | 7 | |

4411932090 | andere | 8 | 7 | |

4411939000 | andere | 8 | 7 | |

4411941000 | weder mechanisch bearbeitet noch oberflächenbeschichtet: | 8 | 7 | |

4411949000 | andere | 8 | 5 | |

4412101010 | mit einer Dicke von weniger als 6 mm | 8 | | |

1.ausschließlich aus Furnieren mit einer Dicke von 6 mm oder wenigera.mit mindestens einer äußeren Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern– mit einer Dicke von weniger als 3,2 mm | | 7 | |

–mit einer Dicke von weniger als 4 mm, jedoch nicht weniger als 3,2 mm | | 7 | |

–mit einer Dicke von nicht mehr als 6 mm, jedoch nicht weniger als 4 mm | | 5 | |

b.andere, mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– mit einer Dicke von weniger als 3,2 mm | | 7 | |

–mit einer Dicke von weniger als 4 mm, jedoch nicht weniger als 3,2 mm | | 5 | |

–mit einer Dicke von nicht mehr als 6 mm, jedoch nicht weniger als 4 mm | | 5 | |

c.andere, außer solchen mit beiden äußeren Lagen aus Nadelholz– mit einer Dicke von weniger als 6 mm | | 5 | |

2.andere, mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend– – Sperrholz | | 5 | |

3.aus anderen (andere)– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend, wobei die beiden äußeren Lagen aus Nadelholz sind | | 5 | |

4412101020 | mit einer Dicke von nicht weniger als 6 mm | 8 | | |

1.ausschließlich aus Furnieren mit einer Dicke von 6 mm oder wenigera.mit mindestens einer äußeren Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern– mit einer Dicke von weniger als 12 mm, jedoch nicht weniger als 6 mm | | 5 | |

–mit einer Dicke von weniger als 15 mm, jedoch nicht weniger als 12 mm | | 5 | |

–mit einer Dicke von nicht weniger als 15 mm | | 5 | |

b.andere, mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– mit einer Dicke von weniger als 12 mm, jedoch nicht weniger als 6 mm | | 7 | |

–mit einer Dicke von weniger als 15 mm, jedoch nicht weniger als 12 mm | | 7 | |

–mit einer Dicke von nicht weniger als 15 mm | | 5 | |

c.andere, außer solchen mit beiden äußeren Lagen aus Nadelholz | | 5 | |

2.andere, mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend– – Sperrholz | | 5 | |

3.aus anderen (andere)– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend, wobei die beiden äußeren Lagen aus Nadelholz sind | | 5 | |

4412102000 | Fußbodenbretter | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend | | 5 | |

2.andere– außer solchen mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern und mindestens eine Spanplatte enthaltend | | 7 | |

4412109010 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– furniertes Holz und ähnliches Lagenholz– – mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

– –andere, mindestens eine Spanplatte enthaltend | | 7 | |

– –andere (andere) | | 5 | |

2.aus anderen (andere)– furniertes Holz und ähnliches Lagenholz– – mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

– –andere, mindestens eine Spanplatte enthaltend | | 5 | |

– –andere (andere) | | 5 | |

4412109090 | andere | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholz– furniertes Holz und ähnliches Lagenholz– – mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

– –andere, mindestens eine Spanplatte enthaltend | | 7 | |

– –andere (andere) | | 5 | |

2.aus anderen (andere)– furniertes Holz und ähnliches Lagenholz– – mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

– –andere, mindestens eine Spanplatte enthaltend | | 5 | |

– –andere (andere) | | 5 | |

4412311000 | mit einer Dicke von weniger als 3,2 mm | 8 | 7 | |

4412312000 | mit einer Dicke von weniger als 4 mm, jedoch nicht weniger als 3,2 mm | 8 | 7 | |

4412313000 | mit einer Dicke von weniger als 6 mm, jedoch nicht weniger als 4 mm | 8 | 5 | |

4412314000 | mit einer Dicke von weniger als 10 mm, jedoch nicht weniger als 6 mm | 11 | 5 | |

4412315000 | mit einer Dicke von weniger als 12 mm, jedoch nicht weniger als 10 mm | 11 | 5 | |

4412316000 | mit einer Dicke von weniger als 15 mm, jedoch nicht weniger als 12 mm | 11 | 5 | |

4412317000 | mit einer Dicke von nicht weniger als 15 mm | 11 | 5 | |

4412321000 | mit einer Dicke von weniger als 3,2 mm | 8 | 7 | |

4412322000 | mit einer Dicke von weniger als 4 mm, jedoch nicht weniger als 3,2 mm | 8 | 5 | |

4412323000 | mit einer Dicke von weniger als 6 mm, jedoch nicht weniger als 4 mm | 8 | 5 | |

4412324000 | mit einer Dicke von weniger als 10 mm, jedoch nicht weniger als 6 mm | 11 | 7 | |

4412325000 | mit einer Dicke von weniger als 12 mm, jedoch nicht weniger als 10 mm | 11 | 7 | |

4412326000 | mit einer Dicke von weniger als 15 mm, jedoch nicht weniger als 12 mm | 11 | 7 | |

4412327000 | mit einer Dicke von nicht weniger als 15 mm | 11 | 5 | |

4412391010 | mit einer Dicke von weniger als 6 mm | 8 | 7 | |

4412391090 | andere | 11 | 7 | |

4412399010 | mit einer Dicke von weniger als 6 mm | 8 | 5 | |

4412399090 | andere | 11 | 5 | |

4412941000 | mit Blockholzmittellage | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholza.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

b.andere, außer solchen, die mindestens eine Spanplatte enthalten– Sperrholz | | 5 | |

–Fußbodenbretter | | 5 | |

–andere, furniertes Holz und ähnliches Lagenholz | | 5 | |

2.aus anderen (andere)a.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

b.andere, außer solchen, die mindestens eine Spanplatte enthalten– Sperrholz, mit beiden äußeren Lagen aus Nadelholz | | 7 | |

–Sperrholz (andere) | | 5 | |

–Fußbodenbretter | | 7 | |

–andere (furniertes Holz und ähnliches Lagenholz) | | 5 | |

4412942000 | mit Stäbchenholzmittellage | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholza.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

b.andere, außer solchen, die mindestens eine Spanplatte enthalten– Sperrholz | | 5 | |

–Fußbodenbretter | | 5 | |

–andere, furniertes Holz und ähnliches Lagenholz | | 5 | |

2.aus anderen (andere)a.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern: | | 7 | |

b.andere, mindestens eine Spanplatte enthaltend– Sperrholz, mit beiden äußeren Lagen aus Nadelholz | | 7 | |

–Sperrholz (andere) | | 5 | |

–Fußbodenbretter | | 7 | |

–andere (furniertes Holz und ähnliches Lagenholz) | | 5 | |

4412943000 | mit Streifenholzmittellage | 8 | | |

1.mit mindestens einer äußeren Lage aus anderem Holz als Nadelholza.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

b.andere, außer solchen, die mindestens eine Spanplatte enthalten– Sperrholz | | 5 | |

–Fußbodenbretter | | 5 | |

–andere, furniertes Holz und ähnliches Lagenholz | | 5 | |

2.aus anderen (andere)a.mit mindestens einer Lage aus den in der Unterpositions-Anmerkung 1 zu diesem Kapitel genannten tropischen Hölzern | | 7 | |

b.andere, außer solchen, die mindestens eine Spanplatte enthalten– Sperrholz, mit beiden äußeren Lagen aus Nadelholz | | 7 | |

–Sperrholz (andere) | | 5 | |

–Fußbodenbretter | | 7 | |

–andere (furniertes Holz und ähnliches Lagenholz) | | 5 | |

4412991011 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 7 | |

4412991019 | andere | 8 | 7 | |

4412991021 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 7 | |

4412991029 | andere | 8 | 7 | |

4412991031 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412991039 | andere | 8 | 5 | |

4412991041 | Fußbodenbretter, mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412991042 | Fußbodenbretter, andere | 8 | 5 | |

4412991043 | andere, mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412991049 | andere | 8 | 5 | |

4412992010 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 7 | |

4412992090 | andere | 8 | 7 | |

4412993010 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412993090 | andere | 8 | 5 | |

4412999111 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 7 | |

4412999119 | andere | 8 | 7 | |

4412999191 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412999199 | andere | 8 | 5 | |

4412999211 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 7 | |

4412999219 | andere | 8 | 7 | |

4412999291 | mit einer Gesamtdicke von nicht weniger als 6 mm, wobei jede Lage nicht dicker als 6 mm ist | 11 | 5 | |

4412999299 | andere | 8 | 5 | |

4413000000 | verdichtetes Holz in Blöcken, Platten, Brettern oder Profilen | 8 | 5 | |

4414000000 | Holzrahmen für Bilder, Fotografien, Spiegel oder dergleichen | 8 | 5 | |

4415100000 | Kisten, Kistchen, Verschläge, Trommeln und ähnliche Verpackungsmittel; Kabeltrommeln | 8 | 5 | |

4415200000 | Flachpaletten, Boxpaletten oder andere Ladungsträger; Palettenaufsatzwände | 8 | 5 | |

4416000000 | Fässer, Tröge, Bottiche, Kübel und andere Böttcherwaren und Teile davon, aus Holz, einschließlich Fassstäbe | 8 | 5 | |

4417000000 | Werkzeuge, Werkzeugfassungen, Werkzeuggriffe und Werkzeugstiele, Fassungen, Stiele und Griffe für Besen, Bürsten und Pinsel, aus Holz; Schuhformen, Schuhleisten und Schuhspanner, aus Holz | 8 | 5 | |

4418100000 | Fenster, Fenstertüren, Rahmen und Verkleidungen dafür | 8 | 5 | |

4418200000 | Türen und Rahmen dafür, Türverkleidungen und -schwellen | 8 | 5 | |

4418400000 | Verschalungen für Betonarbeiten | 8 | 5 | |

4418500000 | Schindeln ("shingles" und "shakes") | 8 | 5 | |

4418600000 | Pfosten und Balken | 8 | 5 | |

4418711000 | Parketttafeln | 8 | 5 | |

4418719000 | andere | 8 | 5 | |

4418721000 | Parketttafeln | 8 | 5 | |

4418729000 | andere | 8 | 5 | |

4418791000 | Parketttafeln | 8 | 5 | |

4418799000 | andere | 8 | 5 | |

4418901000 | Verbundplatten mit Hohlraum-Mittellagen | 8 | 5 | |

4418909000 | andere | 8 | 5 | |

4419001000 | Schalen | 8 | 5 | |

4419002010 | aus Bambus | 8 | 5 | |

4419002090 | andere | 8 | 5 | |

4419009000 | andere | 8 | 5 | |

4420101000 | Statuetten | 8 | 5 | |

4420109000 | andere | 8 | 5 | |

4420901000 | Hölzer mit Einlegearbeit (Intarsien oder Marketerie) | 8 | 5 | |

4420902010 | Zigarettenetuis oder Zigarettenkisten | 8 | 5 | |

4420902020 | Schmuckkassetten oder Schmuckkästen | 8 | 5 | |

4420902030 | andere Innenausstattungsgegenstände, ausgenommen Waren des Kapitels 94 | 8 | 5 | |

4420902090 | andere | 8 | 5 | |

4420909010 | Zigarettenetuis, Zigarettenkisten, Schmuckkassetten oder Schmuckkästen | 8 | 5 | |

4420909020 | andere Innenausstattungsgegenstände, ausgenommen Waren des Kapitels 94 | 8 | 5 | |

4420909090 | andere | 8 | 5 | |

4421100000 | Kleiderbügel | 8 | 5 | |

4421901010 | Spulen | 8 | 5 | |

4421901090 | andere | 8 | 5 | |

4421902000 | Holz für Zündhölzer, vorgerichtet; Holznägel für Schuhe | 8 | 5 | |

4421903000 | Zahnstocher | 8 | 5 | |

4421904000 | Holzpflasterblöcke | 8 | 5 | |

4421905000 | Fächer und Handschilder, nicht mechanisch, Rahmen und Griffe dafür sowie Teile dieser Rahmen und Griffe | 8 | 5 | |

4421909000 | andere | 8 | 5 | |

4501100000 | Naturkork, unbearbeitet oder nur zugerichtet | 8 | 3 | |

4501900000 | andere | 8 | 3 | |

4502000000 | Naturkork, entrindet, zwei- oder vierseitig grob zugerichtet oder in Würfeln, Platten, Blättern oder Streifen von quadratischer oder rechteckiger Form (einschließlich scharfkantige Rohlinge zum Herstellen von Stopfen) | 8 | 3 | |

4503100000 | Stopfen | 8 | 3 | |

4503900000 | andere | 8 | 3 | |

4504100000 | Würfel, Quader, Platten, Blätter und Streifen; Fliesen in beliebiger Form; massive Zylinder, einschließlich Scheiben | 8 | 3 | |

4504900000 | andere | 8 | 3 | |

4601211000 | Matten und Strohmatten | 8 | 0 | |

4601212000 | Gittergeflechte | 8 | 0 | |

4601221000 | Matten und Strohmatten | 8 | 0 | |

4601222000 | Gittergeflechte | 8 | 0 | |

4601291000 | Matten und Strohmatten | 8 | 0 | |

4601292000 | Gittergeflechte | 8 | 0 | |

4601921000 | Eunjukbaljang (mit einer Breite von weniger als 35 cm) | 8 | 0 | |

4601929000 | andere | 8 | 0 | |

4601930000 | aus Rattan | 8 | 0 | |

4601941000 | Eunjukbaljang (mit einer Breite von weniger als 35 cm) | 8 | 0 | |

4601949000 | andere | 8 | 0 | |

4601991000 | Waren in Flächenform, mit Kunststoffen verflochten | 8 | 0 | |

4601999000 | andere | 8 | 0 | |

4602111000 | Körbe | 8 | 5 | |

4602112000 | Tabletts, Schüsseln und ähnliche Haushalts- oder Tischwaren | 8 | 5 | |

4602119000 | andere | 8 | 5 | |

4602120000 | aus Rattan | 8 | 5 | |

4602191000 | Waren aus Binsen | 8 | 0 | |

4602199000 | andere | 8 | 5 | |

4602900000 | andere | 8 | 0 | |

4701001000 | ungebleicht | 0 | 0 | |

4701002000 | halbgebleicht oder gebleicht | 0 | 0 | |

4702000000 | chemische Halbstoffe aus Holz, zum Auflösen | 0 | 0 | |

4703110000 | aus Nadelholz | 0 | 0 | |

4703190000 | aus anderem Holz | 0 | 0 | |

4703211000 | halbgebleicht | 0 | 0 | |

4703212000 | gebleicht | 0 | 0 | |

4703291000 | halbgebleicht | 0 | 0 | |

4703292000 | gebleicht | 0 | 0 | |

4704110000 | aus Nadelholz | 0 | 0 | |

4704190000 | aus anderem Holz | 0 | 0 | |

4704210000 | aus Nadelholz | 0 | 0 | |

4704290000 | aus anderem Holz | 0 | 0 | |

4705000000 | Halbstoffe aus Holz, durch Kombination aus mechanischem und chemischem Aufbereitungsverfahren hergestellt | 0 | 0 | |

4706100000 | aus Baumwoll-Linters | 0 | 0 | |

4706200000 | Halbstoffe aus der Aufbereitung von Abfällen und Ausschuss von Papier oder Pappe | 0 | 0 | |

4706301000 | mechanisch aufbereitet | 0 | 0 | |

4706302000 | chemisch aufbereitet | 0 | 0 | |

4706303000 | halbchemisch aufbereitet | 0 | 0 | |

4706911000 | ungebleicht | 0 | 0 | |

4706912000 | halbgebleicht oder gebleicht | 0 | 0 | |

4706921000 | ungebleicht | 0 | 0 | |

4706922000 | halbgebleicht oder gebleicht | 0 | 0 | |

4706931000 | ungebleicht | 0 | 0 | |

4706932000 | halbgebleicht oder gebleicht | 0 | 0 | |

4707100000 | ungebleichte Kraftpapiere oder Kraftpappen oder Wellpapiere oder Wellpappen | 0 | 0 | |

4707200000 | Papier oder Pappe, hauptsächlich aus gebleichten, nicht in der Masse gefärbten chemischen Halbstoffen hergestellt | 0 | 0 | |

4707300000 | Papier oder Pappe, hauptsächlich aus mechanischen Halbstoffen hergestellt (z. B. Zeitungen, Zeitschriften und ähnliche Drucke) | 0 | 0 | |

4707900000 | andere (einschließlich Abfälle und Ausschuss, unsortiert) | 0 | 0 | |

4801000000 | Zeitungsdruckpapier, in Rollen oder Bogen | 0 | 0 | |

4802100000 | Büttenpapier und Büttenpappe (handgeschöpft) | 0 | 0 | |

4802200000 | Rohpapier und Rohpappe für lichtempfindliche, wärmeempfindliche oder elektroempfindliche Papiere und Pappen | 0 | 0 | |

4802400000 | Tapetenrohpapier | 0 | 0 | |

4802541010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802541090 | andere | 0 | 0 | |

4802549010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802549090 | andere | 0 | 0 | |

4802551010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802551090 | andere | 0 | 0 | |

4802559010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802559090 | andere | 0 | 0 | |

4802561010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802561090 | andere | 0 | 0 | |

4802569010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802569090 | andere | 0 | 0 | |

4802571010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802571090 | andere | 0 | 0 | |

4802579010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802579090 | andere | 0 | 0 | |

4802581010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802581090 | andere | 0 | 0 | |

4802582010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802582090 | andere | 0 | 0 | |

4802589010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802589090 | andere | 0 | 0 | |

4802611010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802611090 | andere | 0 | 0 | |

4802619010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802619090 | andere | 0 | 0 | |

4802621010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802621090 | andere | 0 | 0 | |

4802629010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802629090 | andere | 0 | 0 | |

4802691010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802691090 | andere | 0 | 0 | |

4802699010 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4802699090 | andere | 0 | 0 | |

4803001000 | Papiere von der Art, wie sie für die Herstellung von Toilettenpapier oder Abschminktüchern zur Verwendung im Haushalt, zu hygienischen Zwecken oder für die Körperpflege benutzt werden | 0 | 0 | |

4803002000 | Zellstoffwatte und Vliese aus Zellstofffasern | 0 | 0 | |

4803009000 | andere | 0 | 0 | |

4804110000 | ungebleicht | 0 | 0 | |

4804190000 | andere | 0 | 0 | |

4804210000 | ungebleicht | 0 | 0 | |

4804290000 | andere | 0 | 0 | |

4804311000 | Elektroisolierpapier und -pappe | 0 | 0 | |

4804312000 | Kondensatorpapier und -pappe | 0 | 0 | |

4804313000 | Packpapier und -pappe | 0 | 0 | |

4804319000 | andere | 0 | 0 | |

4804391000 | Elektroisolierpapier und -pappe | 0 | 0 | |

4804392000 | Kondensatorpapier und -pappe | 0 | 0 | |

4804393000 | Packpapier und -pappe | 0 | 0 | |

4804399000 | andere | 0 | 0 | |

4804411010 | mit einem Quadratmetergewicht von weniger als 200 g | 0 | 0 | |

4804411090 | andere | 0 | 0 | |

4804419010 | mit einem Quadratmetergewicht von weniger als 200 g | 0 | 0 | |

4804419090 | andere | 0 | 0 | |

4804421000 | mit einem Quadratmetergewicht von weniger als 200 g | 0 | 0 | |

4804429000 | andere | 0 | 0 | |

4804491000 | mit einem Quadratmetergewicht von weniger als 200 g | 0 | 0 | |

4804499000 | andere | 0 | 0 | |

4804510000 | ungebleicht | 0 | 0 | |

4804520000 | in der Masse einheitlich gebleicht, mit einem Gehalt an chemisch aufbereiteten Fasern aus Holz von mehr als 95 GHT, bezogen auf die Gesamtfasermenge | 0 | 0 | |

4804590000 | andere | 0 | 0 | |

4805110000 | Halbzellstoffpapier für die Welle der Wellpappe (sog. "fluting") | 0 | 0 | |

4805120000 | Strohpapier für die Welle der Wellpappe | 0 | 0 | |

4805190000 | andere | 0 | 0 | |

4805241000 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4805249000 | andere | 0 | 0 | |

4805251000 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4805259000 | andere | 0 | 0 | |

4805300000 | Sulfitpackpapier | 0 | 0 | |

4805400000 | Filterpapier und Filterpappe | 0 | 0 | |

4805500000 | Filzpapier und Filzpappe | 0 | 0 | |

4805911000 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4805919010 | Kondensatorpapier und -pappe | 0 | 0 | |

4805919090 | andere | 0 | 0 | |

4805921000 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4805929000 | andere | 0 | 0 | |

4805931000 | Multiplexpapiere und -pappen, jede Lage gebleicht | 0 | 0 | |

4805939000 | andere | 0 | 0 | |

4806100000 | Pergamentpapier und -pappe | 0 | 0 | |

4806200000 | Pergamentersatzpapier | 0 | 0 | |

4806300000 | Naturpauspapier | 0 | 0 | |

4806401000 | Pergaminpapier | 0 | 0 | |

4806409000 | andere | 0 | 0 | |

4807000000 | Papier und Pappe, zusammengeklebt, auf der Oberfläche weder gestrichen noch überzogen oder getränkt, auch mit Innenverstärkung, in Rollen und Bogen | 0 | 0 | |

4808100000 | Wellpapier oder Wellpappe, auch perforiert | 0 | 0 | |

4808200000 | Kraftsackpapier, gekreppt oder gefältelt, auch durch Pressen oder Prägen gemustert oder perforiert | 0 | 0 | |

4808300000 | anderes Kraftpapier, gekreppt oder gefältelt, auch durch Pressen oder Prägen gemustert oder perforiert | 0 | 0 | |

4808900000 | andere | 0 | 0 | |

4809201000 | einlagig | 0 | 0 | |

4809202000 | Multiplex | 0 | 0 | |

4809901000 | Umdruckpapier | 0 | 0 | |

4809902000 | wärmeempfindliches Aufzeichnungspapier | 0 | 0 | |

4809903000 | Grafikpapier | 0 | 0 | |

4809904000 | Kohlepapier oder ähnliches Vervielfältigungspapier | 0 | 0 | |

4809909000 | andere | 0 | 0 | |

4810131000 | Druckpapiere und -pappen oder Schreibpapiere und -pappen | 0 | 0 | |

4810139000 | andere | 0 | 0 | |

4810141000 | Druckpapiere und -pappen oder Schreibpapiere und -pappen | 0 | 0 | |

4810149000 | andere | 0 | 0 | |

4810191000 | Druckpapiere und -pappen oder Schreibpapiere und -pappen | 0 | 0 | |

4810199000 | andere | 0 | 0 | |

4810220000 | leichtgewichtiges gestrichenes Papier | 0 | 0 | |

4810290000 | andere | 0 | 0 | |

4810310000 | in der Masse einheitlich gebleicht, mit einem Gehalt an chemisch aufbereiteten Fasern aus Holz von mehr als 95 GHT, bezogen auf die Gesamtfasermenge, mit einem Quadratmetergewicht von 150 g oder weniger | 0 | 0 | |

4810320000 | in der Masse einheitlich gebleicht, mit einem Gehalt an chemisch aufbereiteten Fasern aus Holz von mehr als 95 GHT, bezogen auf die Gesamtfasermenge, mit einem Quadratmetergewicht von mehr als 150 g | 0 | 0 | |

4810390000 | andere | 0 | 0 | |

4810920000 | Multiplex | 0 | 0 | |

4810991000 | Matrixpapier | 0 | 0 | |

4810992000 | Filterpapier | 0 | 0 | |

4810999000 | andere | 0 | 0 | |

4811101000 | Dachpappe | 0 | 0 | |

4811109000 | andere | 0 | 0 | |

4811410000 | selbstklebend | 0 | 0 | |

4811490000 | andere | 0 | 0 | |

4811511000 | mit einem Quadratmetergewicht von mehr als 150 g bis 265 g | 0 | 0 | |

4811519011 | Erzeugnisse mit Papier- oder Pappunterlage, die sich als Fußbodenbelag eignen | 0 | 0 | |

4811519019 | andere | 0 | 0 | |

4811519090 | andere | 0 | 0 | |

4811590000 | andere | 0 | 0 | |

4811600000 | Papiere und Pappen, mit Wachs, Paraffin, Stearin, Öl oder Glycerin überzogen oder getränkt | 0 | 0 | |

4811901010 | liniert oder kariert | 0 | 0 | |

4811901090 | andere | 0 | 0 | |

4811902010 | Zellstoffwatte | 0 | 0 | |

4811902090 | andere | 0 | 0 | |

4812000000 | Filterblöcke und Filterplatten, aus Papierhalbstoff | 0 | 0 | |

4813100000 | in Form von Heftchen oder Hülsen | 0 | 0 | |

4813200000 | in Rollen mit einer Breite von 5 cm oder weniger | 0 | 0 | |

4813900000 | andere | 0 | 0 | |

4814100000 | Raufaserpapier, sog. "Ingrainpapier" | 0 | 0 | |

4814201000 | Tapeten | 0 | 0 | |

4814202000 | Linkrusta | 0 | 0 | |

4814209000 | andere | 0 | 0 | |

4814901010 | aus Fasern der Kopoubohne (Kohemp-Fasern) | 0 | 0 | |

4814901090 | andere | 0 | 0 | |

4814909000 | andere | 0 | 0 | |

4816201000 | einlagig | 0 | 0 | |

4816202000 | Multiplex | 0 | 0 | |

4816901000 | Umdruckpapier | 0 | 0 | |

4816902000 | wärmeempfindliches Aufzeichnungspapier | 0 | 0 | |

4816903000 | Grafikpapier | 0 | 0 | |

4816904000 | Kohlepapier oder ähnliches Vervielfältigungspapier | 0 | 0 | |

4816905000 | Dauerschablonen | 0 | 0 | |

4816909000 | andere | 0 | 0 | |

4817100000 | Briefumschläge | 0 | 0 | |

4817200000 | Kartenbriefe, Postkarten (ohne Bilder) und Korrespondenzkarten | 0 | 0 | |

4817300000 | Zusammenstellungen von Schreibwaren aus Papier, in Schachteln, Taschen und ähnlichen Behältnissen, aus Papier oder Pappe | 0 | 0 | |

4818100000 | Toilettenpapier | 0 | 0 | |

4818200000 | Taschentücher, Abschminktücher und Handtücher | 0 | 0 | |

4818300000 | Tischtücher und Servietten | 0 | 0 | |

4818401000 | Windeln für Kleinkinder | 0 | 0 | |

4818409000 | andere | 0 | 0 | |

4818500000 | Bekleidung und Bekleidungszubehör | 0 | 0 | |

4818900000 | andere | 0 | 0 | |

4819100000 | Schachteln und Kartons aus Wellpapier oder Wellpappe | 0 | 0 | |

4819200000 | Faltschachteln und -kartons aus nicht gewelltem Papier oder nicht gewellter Pappe | 0 | 0 | |

4819300000 | Säcke und Beutel mit einer Bodenbreite von 40 cm oder mehr | 0 | 0 | |

4819400000 | andere Säcke, Beutel oder Tüten (ausgenommen Schallplattenhüllen) | 0 | 0 | |

4819501000 | für die Verpackung von Flüssigkeiten geeignet | 0 | 0 | |

4819509000 | andere | 0 | 0 | |

4819600000 | Pappwaren von der in Büros, Geschäften und dergleichen verwendeten Art | 0 | 0 | |

4820100000 | Register, Bücher für die kaufmännische Buchführung, Merkbücher, Auftragsbücher, Quittungsbücher, Notiz- und Tagebücher, auch mit Kalendarium, Notizblöcke, Briefpapierblöcke und dergleichen | 0 | 0 | |

4820200000 | Hefte | 0 | 0 | |

4820300000 | Ordner, Schnellhefter, Einbände (andere als Buchhüllen) und Aktendeckel | 0 | 0 | |

4820400000 | Durchschreibesätze und -hefte, auch mit eingelegtem Kohlepapier | 0 | 0 | |

4820500000 | Alben für Muster oder für Sammlungen | 0 | 0 | |

4820900000 | andere | 0 | 0 | |

4821100000 | bedruckt | 0 | 0 | |

4821900000 | andere | 0 | 0 | |

4822100000 | zum Aufwickeln von Spinnstoffgarnen | 0 | 0 | |

4822900000 | andere | 0 | 0 | |

4823200000 | Filterpapier und Filterpappe | 0 | 0 | |

4823400000 | Diagrammpapier für Registriergeräte, in Rollen, Bogen oder Scheiben | 0 | 0 | |

4823610000 | aus Bambus | 0 | 0 | |

4823690000 | andere | 0 | 0 | |

4823700000 | formgepresste oder gepresste Waren aus Papierhalbstoff | 0 | 0 | |

4823901010 | Lochkarten | 0 | 0 | |

4823901090 | andere | 0 | 0 | |

4823902000 | Elektroisolierpapier | 0 | 0 | |

4823903011 | Erzeugnisse mit Papier- oder Pappunterlage, die sich als Fußbodenbelag eignen | 0 | 0 | |

4823903019 | andere | 0 | 0 | |

4823903021 | Erzeugnisse mit Papier- oder Pappunterlage, die sich als Fußbodenbelag eignen | 0 | 0 | |

4823903029 | andere | 0 | 0 | |

4823903090 | andere | 0 | 0 | |

4823905000 | perforierte Papiere für Jacquardvorrichtungen | 0 | 0 | |

4823909011 | Erzeugnisse mit Papier- oder Pappunterlage, die sich als Fußbodenbelag eignen | 0 | 0 | |

4823909019 | andere | 0 | 0 | |

4823909090 | andere | 0 | 0 | |

4901101000 | in koreanischer Sprache gedruckt | 0 | 0 | |

4901109000 | andere | 0 | 0 | |

4901911000 | in koreanischer Sprache gedruckt | 0 | 0 | |

4901919000 | andere | 0 | 0 | |

4901991000 | in koreanischer Sprache gedruckt | 0 | 0 | |

4901999000 | andere | 0 | 0 | |

4902101010 | Zeitungen | 0 | 0 | |

4902101090 | andere | 0 | 0 | |

4902109000 | andere | 0 | 0 | |

4902901010 | Zeitschriften | 0 | 0 | |

4902901090 | andere | 0 | 0 | |

4902909010 | Zeitschriften | 0 | 0 | |

4902909090 | andere | 0 | 0 | |

4903000000 | Bilderalben, Bilderbücher und Zeichen- oder Malbücher, für Kinder | 0 | 0 | |

4904000000 | Noten, handgeschrieben oder gedruckt, auch mit Bildern, auch gebunden | 0 | 0 | |

4905100000 | Globen | 0 | 0 | |

4905911000 | kartografische Erzeugnisse | 0 | 0 | |

4905919000 | andere | 0 | 0 | |

4905990000 | andere | 0 | 0 | |

4906001000 | Pläne | 0 | 0 | |

4906002000 | Zeichnungen | 0 | 0 | |

4906009000 | andere | 0 | 0 | |

4907001000 | nicht entwertete Briefmarken | 0 | 0 | |

4907002000 | Luftfrachtbrief | 0 | 0 | |

4907009000 | andere | 0 | 0 | |

4908100000 | Abziehbilder, verglasbar | 3,3 | 0 | |

4908901000 | Abziehbilder für Laminatfußbodenplatten | 3,3 | 0 | |

4908909000 | andere | 3,3 | 0 | |

4909000000 | bedruckte oder illustrierte Postkarten; Glückwunschkarten und bedruckte Karten mit persönlichen Mitteilungen, auch illustriert, auch mit Umschlägen oder Verzierungen aller Art | 4 | 0 | |

4910001000 | aus Papier oder Pappe | 4,7 | 0 | |

4910009000 | andere | 4,7 | 0 | |

4911100000 | Werbedrucke und Werbeschriften, Verkaufskataloge und dergleichen | 0 | 0 | |

4911911000 | gedruckte Pläne und Zeichnungen | 0 | 0 | |

4911919000 | andere | 0 | 0 | |

4911990000 | andere | 0 | 0 | |

5001000000 | Seidenraupenkokons, zum Abhaspeln geeignet | 51 % oder 5276 Won/kg, je nachdem welcher Betrag höher ist | 0 | |

5002001010 | nicht mehr als 20 dtex | 3 | 0 | |

5002001020 | mehr als 20 dtex, jedoch nicht mehr als 25,56 dtex | 51,7 % oder 17215 Won/kg, je nachdem, welcher Betrag höher ist | 0 | |

5002001030 | mehr als 25,56 dtex, jedoch nicht mehr als 28,89 dtex | 51,7 % oder 17215 Won/kg, je nachdem, welcher Betrag höher ist | 0 | |

5002001040 | mehr als 28,89 dtex, jedoch nicht mehr als 36,67 dtex | 51,7 % oder 17215 Won/kg, je nachdem, welcher Betrag höher ist | 0 | |

5002001050 | mehr als 36,67 dtex | 51,7 % oder 17215 Won/kg, je nachdem, welcher Betrag höher ist | 0 | |

5002002000 | Dupionseide | 3 | 0 | |

5002009000 | andere | 8 | 0 | |

5003001100 | Abfälle von Kokons | 2 | 0 | |

5003001200 | Flockseide | 2 | 0 | |

5003001300 | Bisu | 2 | 0 | |

5003001400 | Frison | 2 | 0 | |

5003001900 | andere | 2 | 0 | |

5003009100 | Pegine | 2 | 0 | |

5003009200 | Bourretteseide | 2 | 0 | |

5003009900 | andere | 2 | 0 | |

5004000000 | Seidengarne (andere als Schappeseidengarne oder Bourretteseidengarne), nicht in Aufmachungen für den Einzelverkauf | 8 | 0 | |

5005001000 | handgesponnene Garne | 8 | 0 | |

5005002000 | Schappeseidengarne | 8 | 0 | |

5005003000 | Bourretteseidengarne | 8 | 0 | |

5006001000 | Seidengarne | 8 | 0 | |

5006002000 | handgesponnene Garne | 8 | 0 | |

5006003000 | Schappeseidengarne | 8 | 0 | |

5006004000 | Bourretteseidengarne | 8 | 0 | |

5006005000 | Messinahaar | 8 | 0 | |

5007100000 | Gewebe aus Bourretteseide | 13 | 0 | |

5007201000 | Seidengewebe, grau | 13 | 0 | |

5007202010 | Shibori | 13 | 0 | |

5007202020 | Satin | 13 | 0 | |

5007202030 | Crêpe de chine | 13 | 0 | |

5007202090 | andere | 13 | 0 | |

5007209000 | andere | 13 | 0 | |

5007901000 | Seidengewebe, grau | 13 | 0 | |

5007902000 | Seidengewebe, gemischt mit Acetatfäden | 13 | 0 | |

5007903000 | Seidengewebe, gemischt mit synthetischen Fasern | 13 | 0 | |

5007904000 | Seidengewebe, gemischt mit Wolle | 13 | 0 | |

5007909000 | andere | 13 | 0 | |

5101110000 | Schurwolle | 0 | 0 | |

5101190000 | andere | 0 | 0 | |

5101210000 | Schurwolle | 0 | 0 | |

5101290000 | andere | 0 | 0 | |

5101300000 | carbonisiert | 0 | 0 | |

5102110000 | Kaschmirziegenhaare (Cashmere) | 0 | 0 | |

5102190000 | andere | 0 | 0 | |

5102200000 | grobe Tierhaare | 0 | 0 | |

5103100000 | Kämmlinge von Wolle oder feinen Tierhaaren | 0 | 0 | |

5103200000 | andere Abfälle von Wolle oder feinen Tierhaaren | 0 | 0 | |

5103300000 | Abfälle von groben Tierhaaren | 0 | 0 | |

5104000000 | Reißspinnstoff aus Wolle oder feinen oder groben Tierhaaren | 0 | 0 | |

5105100000 | gekrempelte Wolle | 0 | 0 | |

5105210000 | gekämmte Wolle in loser Form ("open tops") | 0 | 0 | |

5105291000 | gekämmte Wolle, reine Wolle | 0 | 0 | |

5105292000 | gekämmte Wolle, Wollgemisch | 0 | 0 | |

5105293000 | Vorgarn | 0 | 0 | |

5105299000 | andere | 0 | 0 | |

5105310000 | Kaschmirziegenhaare (cashmere) | 0 | 0 | |

5105390000 | andere | 0 | 0 | |

5105400000 | grobe Tierhaare, gekrempelt oder gekämmt | 0 | 0 | |

5106101000 | reine Wolle | 8 | 0 | |

5106109000 | andere | 8 | 0 | |

5106201000 | mit Polyesterfasern gemischt | 8 | 0 | |

5106202000 | mit Polyamidfasern gemischt | 8 | 0 | |

5106203000 | mit Polyacrylfasern gemischt | 8 | 0 | |

5106204000 | mit anderen synthetischen Fasern gemischt | 8 | 0 | |

5106209000 | andere | 8 | 0 | |

5107101000 | reine Wolle | 8 | 7 | |

5107102000 | mit synthetischen Fasern gemischt | 8 | 0 | |

5107109000 | mit anderen Fasern gemischt | 8 | 0 | |

5107201000 | mit Polyesterfasern gemischt | 8 | 0 | |

5107202000 | mit Polyamidfasern gemischt | 8 | 0 | |

5107203000 | mit Polyacrylfasern gemischt | 8 | 0 | |

5107204000 | mit anderen synthetischen Fasern gemischt | 8 | 0 | |

5107209000 | mit anderen Fasern gemischt | 8 | 0 | |

5108100000 | gekrempelt | 8 | 0 | |

5108200000 | gekämmt | 8 | 0 | |

5109101000 | Garne aus Wolle | 8 | 0 | |

5109109000 | Garne aus feinen Tierhaaren | 8 | 0 | |

5109901000 | Garne aus Wolle | 8 | 0 | |

5109909000 | Garne aus feinen Tierhaaren | 8 | 0 | |

5110000000 | Garne aus groben Tierhaaren oder aus Rosshaar (einschließlich umsponnene Garne aus Rosshaar), auch in Aufmachungen für den Einzelverkauf | 8 | 0 | |

5111111000 | aus Wolle | 13 | 0 | |

5111112000 | aus feinen Tierhaaren | 13 | 0 | |

5111191000 | aus Wolle | 13 | 0 | |

5111192000 | aus feinen Tierhaaren | 13 | 0 | |

5111200000 | andere, hauptsächlich oder ausschließlich mit synthetischen oder künstlichen Filamenten gemischt | 13 | 0 | |

5111300000 | andere, hauptsächlich oder ausschließlich mit synthetischen oder künstlichen Spinnfasern gemischt | 13 | 0 | |

5111900000 | andere | 13 | 0 | |

5112111000 | aus Wolle | 13 | 7 | |

5112112000 | aus feinen Tierhaaren | 13 | 0 | |

5112191000 | aus Wolle | 13 | 7 | |

5112192000 | aus feinen Tierhaaren | 13 | 7 | |

5112200000 | andere, hauptsächlich oder ausschließlich mit synthetischen oder künstlichen Filamenten gemischt | 13 | 0 | |

5112300000 | andere, hauptsächlich oder ausschließlich mit synthetischen oder künstlichen Spinnfasern gemischt | 13 | 0 | |

5112900000 | andere | 13 | 7 | |

5113000000 | Gewebe aus groben Tierhaaren oder aus Rosshaar | 13 | 0 | |

5201001000 | Baumwollfaser | 0 | 0 | |

5201009010 | mit einer Faserlänge von weniger als 23,2 mm (7/8 Inch) | 0 | 0 | |

5201009020 | mit einer Faserlänge von nicht weniger als 23,2 mm (7/8 Inch), jedoch weniger als 25,4 mm (1 Inch) | 0 | 0 | |

5201009030 | mit einer Faserlänge von nicht weniger als 25,4 mm (1 Inch), jedoch weniger als 28,5 mm (1 1/8 Inch) | 0 | 0 | |

5201009050 | mit einer Faserlänge von nicht weniger als 28,5 mm (11/8 Inch), jedoch weniger als 34,9 mm (1 3/8 Inch) | 0 | 0 | |

5201009060 | mit einer Faserlänge von nicht weniger als 34,9 mm (1 3/8 Inch) | 0 | 0 | |

5202100000 | Garnabfälle | 0 | 0 | |

5202910000 | Reißspinnstoff | 0 | 0 | |

5202990000 | andere | 0 | 0 | |

5203000000 | Baumwolle, kardiert oder gekämmt | 0 | 0 | |

5204110000 | mit einem Anteil an Baumwolle von 85 GHT oder mehr | 8 | 0 | |

5204190000 | andere | 8 | 0 | |

5204200000 | in Aufmachungen für den Einzelverkauf | 8 | 0 | |

5205111000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205119000 | andere | 8 | 0 | |

5205121010 | mit einem Titer von nicht mehr als 370,37 dtex, jedoch nicht weniger als 232,56 dtex (nicht weniger als Nm 27 bis Nm 43), ausgenommen Open-End-Garn | 4 | 0 | |

5205121090 | andere | 8 | 0 | |

5205129000 | andere | 8 | 0 | |

5205131000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205139000 | andere | 8 | 0 | |

5205141000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205149000 | andere | 8 | 0 | |

5205151000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205159000 | andere | 8 | 0 | |

5205211000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205219000 | andere | 8 | 0 | |

5205221000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205229000 | andere | 8 | 0 | |

5205231000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205239000 | andere | 8 | 0 | |

5205241000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205249000 | andere | 8 | 0 | |

5205261000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205269000 | andere | 8 | 0 | |

5205271000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205279000 | andere | 8 | 0 | |

5205281000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205289000 | andere | 8 | 0 | |

5205311000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205319000 | andere | 8 | 0 | |

5205321010 | mit einem Titer von nicht mehr als 370,37 dtex, jedoch nicht weniger als 232,56 dtex (nicht weniger als Nm 27 bis Nm 43), ausgenommen Open-End-Garn | 4 | 0 | |

5205321090 | andere | 8 | 0 | |

5205329000 | andere | 8 | 0 | |

5205331000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205339000 | andere | 8 | 0 | |

5205341000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205349000 | andere | 8 | 0 | |

5205351000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205359000 | andere | 8 | 0 | |

5205411000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205419000 | andere | 8 | 0 | |

5205421000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205429000 | andere | 8 | 0 | |

5205431000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205439000 | andere | 8 | 0 | |

5205441000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205449000 | andere | 8 | 0 | |

5205461000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205469000 | andere | 8 | 0 | |

5205471000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205479000 | andere | 8 | 0 | |

5205481000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5205489000 | andere | 8 | 0 | |

5206111000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206119000 | andere | 8 | 0 | |

5206121000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206129000 | andere | 8 | 0 | |

5206131000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206139000 | andere | 8 | 0 | |

5206141000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206149000 | andere | 8 | 0 | |

5206151000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206159000 | andere | 8 | 0 | |

5206211000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206219000 | andere | 8 | 0 | |

5206221000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206229000 | andere | 8 | 0 | |

5206231000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206239000 | andere | 8 | 0 | |

5206241000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206249000 | andere | 8 | 0 | |

5206251000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206259000 | andere | 8 | 0 | |

5206311000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206319000 | andere | 8 | 0 | |

5206321000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206329000 | andere | 8 | 0 | |

5206331000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206339000 | andere | 8 | 0 | |

5206341000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206349000 | andere | 8 | 0 | |

5206351000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206359000 | andere | 8 | 0 | |

5206411000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206419000 | andere | 8 | 0 | |

5206421000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206429000 | andere | 8 | 0 | |

5206431000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206439000 | andere | 8 | 0 | |

5206441000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206449000 | andere | 8 | 0 | |

5206451000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5206459000 | andere | 8 | 0 | |

5207101000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5207109000 | andere | 8 | 0 | |

5207901000 | ungebleicht oder nicht merzerisiert | 8 | 0 | |

5207909000 | andere | 8 | 0 | |

5208110000 | in Leinwandbindung, mit einem Quadratmetergewicht von 100 g oder weniger | 10 | 0 | |

5208120000 | in Leinwandbindung, mit einem Quadratmetergewicht von mehr als 100 g | 10 | 0 | |

5208130000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5208190000 | andere Gewebe | 10 | 0 | |

5208210000 | in Leinwandbindung, mit einem Quadratmetergewicht von 100 g oder weniger | 10 | 0 | |

5208220000 | in Leinwandbindung, mit einem Quadratmetergewicht von mehr als 100 g | 10 | 0 | |

5208230000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5208290000 | andere Gewebe | 10 | 0 | |

5208310000 | in Leinwandbindung, mit einem Quadratmetergewicht von 100 g oder weniger | 10 | 0 | |

5208320000 | in Leinwandbindung, mit einem Quadratmetergewicht von mehr als 100 g | 10 | 0 | |

5208330000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5208390000 | andere Gewebe | 10 | 0 | |

5208410000 | in Leinwandbindung, mit einem Quadratmetergewicht von 100 g oder weniger | 10 | 0 | |

5208420000 | in Leinwandbindung, mit einem Quadratmetergewicht von mehr als 100 g | 10 | 0 | |

5208430000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5208490000 | andere Gewebe | 10 | 0 | |

5208510000 | in Leinwandbindung, mit einem Quadratmetergewicht von 100 g oder weniger | 10 | 0 | |

5208520000 | in Leinwandbindung, mit einem Quadratmetergewicht von mehr als 100 g | 10 | 0 | |

5208591000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5208599000 | andere | 10 | 0 | |

5209110000 | in Leinwandbindung | 10 | 0 | |

5209120000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5209190000 | andere Gewebe | 10 | 0 | |

5209210000 | in Leinwandbindung | 10 | 0 | |

5209220000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5209290000 | andere Gewebe | 10 | 0 | |

5209310000 | in Leinwandbindung | 10 | 0 | |

5209320000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5209390000 | andere Gewebe | 10 | 0 | |

5209410000 | in Leinwandbindung | 10 | 0 | |

5209420000 | Denim | 10 | 0 | |

5209430000 | andere Gewebe in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5209490000 | andere Gewebe | 10 | 0 | |

5209510000 | in Leinwandbindung | 10 | 0 | |

5209520000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5209590000 | andere Gewebe | 10 | 0 | |

5210110000 | in Leinwandbindung | 10 | 0 | |

5210191000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5210199000 | andere | 10 | 0 | |

5210210000 | in Leinwandbindung | 10 | 0 | |

5210291000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5210299000 | andere | 10 | 0 | |

5210310000 | in Leinwandbindung | 10 | 0 | |

5210320000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5210390000 | andere Gewebe | 10 | 0 | |

5210410000 | in Leinwandbindung | 10 | 0 | |

5210491000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5210499000 | andere | 10 | 0 | |

5210510000 | in Leinwandbindung | 10 | 0 | |

5210590000 | andere Gewebe | 10 | 0 | |

5211110000 | in Leinwandbindung | 10 | 0 | |

5211120000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5211190000 | andere Gewebe | 10 | 0 | |

5211200000 | gebleicht | 10 | 0 | |

5211310000 | in Leinwandbindung | 10 | 0 | |

5211320000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5211390000 | andere Gewebe | 10 | 0 | |

5211410000 | in Leinwandbindung | 10 | 0 | |

5211420000 | Denim | 10 | 0 | |

5211430000 | andere Gewebe in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5211490000 | andere Gewebe | 10 | 0 | |

5211510000 | in Leinwandbindung | 10 | 0 | |

5211520000 | in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5211590000 | andere Gewebe | 10 | 0 | |

5212110000 | roh | 10 | 0 | |

5212120000 | gebleicht | 10 | 0 | |

5212130000 | gefärbt | 10 | 0 | |

5212140000 | buntgewebt | 10 | 0 | |

5212150000 | bedruckt | 10 | 0 | |

5212210000 | roh | 10 | 0 | |

5212220000 | gebleicht | 10 | 0 | |

5212230000 | gefärbt | 10 | 0 | |

5212240000 | buntgewebt | 10 | 0 | |

5212250000 | bedruckt | 10 | 0 | |

5301100000 | Flachs (Leinen), roh oder geröstet | 2 | 0 | |

5301210000 | gebrochen oder geschwungen | 2 | 0 | |

5301290000 | andere | 2 | 0 | |

5301301000 | Flachswerg | 2 | 0 | |

5301302000 | Abfälle von Flachs (Leinen) | 2 | 0 | |

5302100000 | Hanf, roh oder geröstet | 2 | 0 | |

5302901000 | Hanf, gebrochen, geschwungen, gehechelt oder anders bearbeitet, jedoch nicht versponnen | 2 | 0 | |

5302902010 | Werg von Hanf | 2 | 0 | |

5302902020 | Abfälle von Hanf | 2 | 0 | |

5303101000 | Jute | 2 | 0 | |

5303102000 | andere textile Bastfasern | 2 | 0 | |

5303901010 | Jute | 2 | 0 | |

5303901090 | andere textile Bastfasern | 2 | 0 | |

5303909010 | Werg und Abfälle von Jute | 2 | 0 | |

5303909090 | Werg und Abfälle anderer textiler Bastfasern | 2 | 0 | |

5305001010 | roh | 2 | 0 | |

5305001090 | andere | 2 | 0 | |

5305002010 | roh | 2 | 0 | |

5305002090 | andere | 2 | 0 | |

5305003010 | roh | 2 | 0 | |

5305003090 | andere | 2 | 0 | |

5305009010 | roh | 2 | 0 | |

5305009090 | andere | 2 | 0 | |

5306101000 | aus reinem Flachs | 8 | 0 | |

5306102000 | gemischt | 8 | 0 | |

5306201000 | aus reinem Flachs | 8 | 0 | |

5306202000 | gemischt | 8 | 0 | |

5307101000 | aus Jute | 8 | 0 | |

5307109000 | andere | 8 | 0 | |

5307201000 | aus Jute | 8 | 0 | |

5307209000 | andere | 8 | 0 | |

5308100000 | Kokosgarne | 8 | 0 | |

5308200000 | Hanfgarne | 8 | 0 | |

5308901000 | Ramiegarne | 8 | 0 | |

5308909000 | andere | 8 | 0 | |

5309110000 | roh oder gebleicht | 2 | 0 | |

5309190000 | andere | 2 | 0 | |

5309210000 | roh oder gebleicht | 2 | 0 | |

5309290000 | andere | 2 | 0 | |

5310101000 | Gewebe aus Jute | 8 | 0 | |

5310109000 | andere | 8 | 0 | |

5310901000 | Gewebe aus Jute | 8 | 0 | |

5310909000 | andere | 8 | 0 | |

5311001000 | Gewebe aus Ramie | 8 | 0 | |

5311002000 | Gewebe aus Hanf | 8 | 0 | |

5311003000 | Gewebe aus Papiergarnen | 8 | 0 | |

5311009000 | andere | 8 | 0 | |

5401101000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5401102000 | aus Polyestern | 8 | 0 | |

5401103000 | aus Acrylpolymeren | 8 | 0 | |

5401109000 | andere | 8 | 0 | |

5401201000 | aus Viskose | 8 | 0 | |

5401202000 | aus Celluloseacetat | 8 | 0 | |

5401209000 | andere | 8 | 0 | |

5402110000 | aus Aramid | 8 | 0 | |

5402190000 | andere | 8 | 0 | |

5402200000 | hochfeste Garne aus Polyestern | 8 | 0 | |

5402310000 | aus Nylon oder anderen Polyamiden, mit einem Titer der einfachen Garne von 50 tex oder weniger | 8 | 0 | |

5402320000 | aus Nylon oder anderen Polyamiden, mit einem Titer der einfachen Garne von mehr als 50 tex | 8 | 0 | |

5402330000 | aus Polyestern | 8 | 0 | |

5402340000 | aus Polypropylen | 8 | 0 | |

5402390000 | andere | 8 | 0 | |

5402440000 | aus Elastomeren | 8 | 0 | |

5402450000 | andere, aus Nylon oder anderen Polyamiden | 8 | 0 | |

5402460000 | andere, aus Polyestern, teilverstreckt | 8 | 0 | |

5402470000 | andere, aus Polyestern | 8 | 0 | |

5402480000 | andere, aus Polypropylen | 8 | 0 | |

5402491000 | aus Acrylpolymeren | 8 | 0 | |

5402499000 | andere | 8 | 0 | |

5402510000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5402520000 | aus Polyestern | 8 | 0 | |

5402591000 | aus Acrylpolymeren | 8 | 0 | |

5402599000 | andere | 8 | 0 | |

5402610000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5402620000 | aus Polyestern | 8 | 0 | |

5402691000 | aus Acrylpolymeren | 8 | 0 | |

5402692000 | aus Polyvinylalkohol | 8 | 0 | |

5402699000 | andere | 8 | 0 | |

5403100000 | hochfeste Garne aus Viskose | 2 | 0 | |

5403311000 | texturierte Garne | 2 | 0 | |

5403319000 | andere | 2 | 0 | |

5403321000 | texturierte Garne | 2 | 0 | |

5403329000 | andere | 2 | 0 | |

5403331000 | texturierte Garne | 8 | 0 | |

5403339000 | andere | 8 | 0 | |

5403391000 | texturierte Garne | 8 | 0 | |

5403399000 | andere | 8 | 0 | |

5403411000 | texturierte Garne | 2 | 0 | |

5403419000 | andere | 2 | 0 | |

5403421000 | texturierte Garne | 8 | 0 | |

5403429000 | andere | 8 | 0 | |

5403491000 | texturierte Garne | 8 | 0 | |

5403499000 | andere | 8 | 0 | |

5404110000 | aus Elastomeren | 8 | 0 | |

5404120000 | andere, aus Polypropylen | 8 | 0 | |

5404191000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5404192000 | aus Polyurethan | 8 | 0 | |

5404193000 | aus Polyvinylalkohol | 8 | 0 | |

5404199000 | andere | 8 | 0 | |

5404901000 | aus Streifen | 8 | 0 | |

5404909000 | andere | 8 | 0 | |

5405001000 | Monofile | 8 | 0 | |

5405009000 | andere | 8 | 0 | |

5406001000 | Garne aus synthetischen Filamenten | 8 | 0 | |

5406002000 | Garne aus künstlichen Filamenten | 8 | 0 | |

5407101000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407102000 | aus Polyestern | 8 | 0 | |

5407200000 | Gewebe aus Streifen oder dergleichen | 8 | 0 | |

5407300000 | Gewebe im Sinne der Anmerkung 9 zu Abschnitt XI | 8 | 0 | |

5407410000 | roh oder gebleicht | 8 | 0 | |

5407420000 | gefärbt | 8 | 0 | |

5407430000 | buntgewebt | 8 | 0 | |

5407440000 | bedruckt | 8 | 0 | |

5407510000 | roh oder gebleicht | 8 | 0 | |

5407520000 | gefärbt | 8 | 0 | |

5407530000 | buntgewebt | 8 | 0 | |

5407540000 | bedruckt | 8 | 0 | |

5407611000 | roh oder gebleicht | 8 | 0 | |

5407612000 | gefärbt | 8 | 0 | |

5407613000 | buntgewebt | 8 | 0 | |

5407614000 | bedruckt | 8 | 0 | |

5407691000 | roh oder gebleicht | 8 | 0 | |

5407692000 | gefärbt | 8 | 0 | |

5407693000 | buntgewebt | 8 | 0 | |

5407694000 | bedruckt | 8 | 0 | |

5407711000 | aus Acrylpolymeren | 8 | 0 | |

5407719000 | andere | 8 | 0 | |

5407721000 | aus Acrylpolymeren | 8 | 0 | |

5407729000 | andere | 8 | 0 | |

5407731000 | aus Acrylpolymeren | 8 | 0 | |

5407739000 | andere | 8 | 0 | |

5407741000 | aus Acrylpolymeren | 8 | 0 | |

5407749000 | andere | 8 | 0 | |

5407811000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407812000 | aus Polyestern | 8 | 0 | |

5407813000 | aus Acrylpolymeren | 8 | 0 | |

5407819000 | andere | 8 | 0 | |

5407821000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407822000 | aus Polyestern | 8 | 0 | |

5407823000 | aus Acrylpolymeren | 8 | 0 | |

5407829000 | andere | 8 | 0 | |

5407831000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407832000 | aus Polyestern | 8 | 0 | |

5407833000 | aus Acrylpolymeren | 8 | 0 | |

5407839000 | andere | 8 | 0 | |

5407841000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407842000 | aus Polyestern | 8 | 0 | |

5407843000 | aus Acrylpolymeren | 8 | 0 | |

5407849000 | andere | 8 | 0 | |

5407911000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407912000 | aus Polyestern | 8 | 0 | |

5407913000 | aus Acrylpolymeren | 8 | 0 | |

5407919000 | andere | 8 | 0 | |

5407921000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407922000 | aus Polyestern | 8 | 0 | |

5407923000 | aus Acrylpolymeren | 8 | 0 | |

5407929000 | andere | 8 | 0 | |

5407931000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407932000 | aus Polyestern | 8 | 0 | |

5407933000 | aus Acrylpolymeren | 8 | 0 | |

5407939000 | andere | 8 | 0 | |

5407941000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5407942000 | aus Polyestern | 8 | 0 | |

5407943000 | aus Acrylpolymeren | 8 | 0 | |

5407949000 | andere | 8 | 0 | |

5408100000 | Gewebe aus hochfesten Viskose-Garnen | 8 | 0 | |

5408210000 | roh oder gebleicht | 8 | 0 | |

5408220000 | gefärbt | 8 | 0 | |

5408230000 | buntgewebt | 8 | 0 | |

5408240000 | bedruckt | 8 | 0 | |

5408310000 | roh oder gebleicht | 8 | 0 | |

5408320000 | gefärbt | 8 | 0 | |

5408330000 | buntgewebt | 8 | 0 | |

5408340000 | bedruckt | 8 | 0 | |

5501100000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5501200000 | aus Polyestern | 8 | 0 | |

5501301000 | aus Polyacryl | 8 | 0 | |

5501302000 | aus Modacryl | 8 | 0 | |

5501400000 | aus Polypropylen | 8 | 0 | |

5501900000 | andere | 8 | 0 | |

5502001000 | aus Viskose | 7,5 | 0 | |

5502002010 | weniger als 44000 dtex | 7,5 | 0 | |

5502002020 | nicht weniger als 44000 dtex | 7,5 | 0 | |

5502009000 | andere | 7,5 | 0 | |

5503111000 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5503119000 | andere | 8 | 0 | |

5503191000 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5503199000 | andere | 8 | 0 | |

5503201000 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5503209000 | andere | 8 | 0 | |

5503301010 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5503301020 | mit einer Oberseite mit konjugiertem Profil | 8 | 0 | |

5503301090 | andere | 8 | 0 | |

5503302010 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5503302020 | mit einer Oberseite mit konjugiertem Profil | 8 | 0 | |

5503302090 | andere | 8 | 0 | |

5503400000 | aus Polypropylen | 8 | 0 | |

5503900000 | andere | 8 | 0 | |

5504101000 | mit einer Oberseite mit speziellem Profil | 2 | 0 | |

5504102000 | mit einer Oberseite mit polynosischem Profil | 2 | 0 | |

5504109000 | andere | 2 | 0 | |

5504901000 | aus Celluloseacetat | 8 | 0 | |

5504902000 | aus Lyocell | 4 | 0 | |

5504909000 | andere | 8 | 0 | |

5505100000 | aus synthetischen Chemiefasern | 2 | 0 | |

5505200000 | aus künstlichen Chemiefasern | 2 | 0 | |

5506101000 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5506109000 | andere | 8 | 0 | |

5506201000 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5506209000 | andere | 8 | 0 | |

5506301010 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5506301020 | mit einer Oberseite mit konjugiertem Profil | 8 | 0 | |

5506301090 | andere | 8 | 0 | |

5506302010 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5506302020 | mit einer Oberseite mit konjugiertem Profil | 8 | 0 | |

5506302090 | andere | 8 | 0 | |

5506900000 | andere | 8 | 0 | |

5507001010 | mit einer Oberseite mit speziellem Profil | 8 | 0 | |

5507001020 | mit einer Oberseite mit polynosischem Profil | 8 | 0 | |

5507001090 | andere | 8 | 0 | |

5507002000 | aus Celluloseacetat | 8 | 0 | |

5507009000 | andere | 8 | 0 | |

5508101000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5508102000 | aus Polyestern | 8 | 0 | |

5508103000 | aus Polyacryl oder Modacryl | 8 | 0 | |

5508109000 | andere | 8 | 0 | |

5508201000 | aus Viskose | 8 | 0 | |

5508202000 | aus Celluloseacetat | 8 | 0 | |

5508209000 | andere | 8 | 0 | |

5509111000 | hochfeste Garne | 8 | 0 | |

5509119000 | andere | 8 | 0 | |

5509121000 | hochfeste Garne | 8 | 0 | |

5509129000 | andere | 8 | 0 | |

5509211000 | hochfeste Garne | 8 | 0 | |

5509219000 | andere | 8 | 0 | |

5509221000 | hochfeste Garne | 8 | 0 | |

5509229000 | andere | 8 | 0 | |

5509311000 | aus Polyacryl | 8 | 0 | |

5509312000 | aus Modacryl | 8 | 0 | |

5509321000 | aus Polyacryl | 8 | 0 | |

5509322000 | aus Modacryl | 8 | 0 | |

5509410000 | ungezwirnt | 8 | 0 | |

5509420000 | gezwirnt | 8 | 0 | |

5509510000 | hauptsächlich oder ausschließlich mit künstlichen Spinnfasern gemischt | 8 | 0 | |

5509520000 | hauptsächlich oder ausschließlich mit Wolle oder feinen Tierhaaren gemischt | 8 | 0 | |

5509530000 | hauptsächlich oder ausschließlich mit Baumwolle gemischt | 8 | 0 | |

5509590000 | andere | 8 | 0 | |

5509611000 | aus Polyacryl | 8 | 0 | |

5509612000 | aus Modacryl | 8 | 0 | |

5509621000 | aus Polyacryl | 8 | 0 | |

5509622000 | aus Modacryl | 8 | 0 | |

5509691010 | aus Polyacryl | 8 | 0 | |

5509691020 | Modacryl | 8 | 0 | |

5509692010 | aus Polyacryl | 8 | 0 | |

5509692020 | aus Modacryl | 8 | 0 | |

5509911000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5509919000 | andere | 8 | 0 | |

5509921000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5509929000 | andere | 8 | 0 | |

5509990000 | andere | 8 | 0 | |

5510111000 | aus Viskose | 8 | 0 | |

5510112000 | aus Celluloseacetat | 8 | 0 | |

5510119000 | andere | 8 | 0 | |

5510121000 | aus Viskose | 8 | 0 | |

5510122000 | aus Celluloseacetat | 8 | 0 | |

5510129000 | andere | 8 | 0 | |

5510201000 | aus Viskose | 8 | 0 | |

5510202000 | aus Celluloseacetat | 8 | 0 | |

5510209000 | andere | 8 | 0 | |

5510301000 | aus Viskose | 8 | 0 | |

5510302000 | aus Celluloseacetat | 8 | 0 | |

5510309000 | andere | 8 | 0 | |

5510901000 | aus Viskose | 8 | 0 | |

5510902000 | aus Celluloseacetat | 8 | 0 | |

5510909000 | andere | 8 | 0 | |

5511101000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5511102000 | aus Polyestern | 8 | 0 | |

5511103000 | aus Polyacryl oder Modacryl | 8 | 0 | |

5511109000 | andere | 8 | 0 | |

5511201000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5511202000 | aus Polyestern | 8 | 0 | |

5511203000 | aus Polyacryl oder Modacryl | 8 | 0 | |

5511209000 | andere | 8 | 0 | |

5511301000 | aus Viskose | 8 | 0 | |

5511302000 | aus Celluloseacetat | 8 | 0 | |

5511309000 | andere | 8 | 0 | |

5512110000 | roh oder gebleicht | 10 | 0 | |

5512191000 | gefärbt | 10 | 0 | |

5512192000 | buntgewebt | 10 | 0 | |

5512193000 | bedruckt | 10 | 0 | |

5512211000 | aus Polyacryl | 10 | 0 | |

5512212000 | aus Modacryl | 10 | 0 | |

5512290000 | andere | 10 | 0 | |

5512911000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5512919000 | andere | 10 | 0 | |

5512991000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5512999000 | andere | 10 | 0 | |

5513110000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5513120000 | aus Polyester-Spinnfasern, in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5513130000 | andere Gewebe aus Polyester-Spinnfasern | 10 | 0 | |

5513191000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5513192010 | aus Polyacryl | 10 | 0 | |

5513192020 | aus Modacryl | 10 | 0 | |

5513199000 | andere | 10 | 0 | |

5513210000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5513231000 | aus Polyester-Spinnfasern, in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5513239000 | andere | 10 | 0 | |

5513291000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5513292010 | aus Polyacryl | 10 | 0 | |

5513292020 | aus Modacryl | 10 | 0 | |

5513299000 | andere | 10 | 0 | |

5513310000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5513391000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5513392010 | aus Polyacryl | 10 | 0 | |

5513392020 | aus Modacryl | 10 | 0 | |

5513399000 | andere | 10 | 0 | |

5513410000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5513491000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5513492010 | aus Polyacryl | 10 | 0 | |

5513492020 | aus Modacryl | 10 | 0 | |

5513499000 | andere | 10 | 0 | |

5514110000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5514120000 | aus Polyester-Spinnfasern, in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5514191000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5514192010 | aus Polyacryl | 10 | 0 | |

5514192020 | aus Modacryl | 10 | 0 | |

5514193000 | andere Gewebe aus Polyester-Spinnfasern | 10 | 0 | |

5514199000 | andere | 10 | 0 | |

5514210000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5514220000 | aus Polyester-Spinnfasern, in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5514230000 | andere Gewebe aus Polyester-Spinnfasern | 10 | 0 | |

5514291000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5514292010 | aus Polyacryl | 10 | 0 | |

5514292020 | aus Modacryl | 10 | 0 | |

5514299000 | andere | 10 | 0 | |

5514300000 | buntgewebt | 10 | 0 | |

5514410000 | aus Polyester-Spinnfasern, in Leinwandbindung | 10 | 0 | |

5514420000 | aus Polyester-Spinnfasern, in 3- oder 4-bindigem Köper, einschließlich Doppelköper | 10 | 0 | |

5514430000 | andere Gewebe aus Polyester-Spinnfasern | 10 | 0 | |

5514491000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5514492010 | aus Polyacryl | 10 | 0 | |

5514492020 | aus Modacryl | 10 | 0 | |

5514499000 | andere | 10 | 0 | |

5515111000 | roh oder gebleicht | 10 | 0 | |

5515119000 | andere | 10 | 0 | |

5515121000 | roh oder gebleicht | 10 | 0 | |

5515129000 | andere | 10 | 0 | |

5515131000 | roh oder gebleicht | 10 | 0 | |

5515139000 | andere | 10 | 0 | |

5515191000 | roh oder gebleicht | 10 | 0 | |

5515199000 | andere | 10 | 0 | |

5515211000 | roh oder gebleicht | 10 | 0 | |

5515219000 | andere | 10 | 0 | |

5515221000 | roh oder gebleicht | 10 | 0 | |

5515229000 | andere | 10 | 0 | |

5515291000 | roh oder gebleicht | 10 | 0 | |

5515299000 | andere | 10 | 0 | |

5515911000 | roh oder gebleicht | 10 | 0 | |

5515919000 | andere | 10 | 0 | |

5515991000 | roh oder gebleicht | 10 | 0 | |

5515999000 | andere | 10 | 0 | |

5516111000 | aus Viskose | 10 | 0 | |

5516112000 | aus Celluloseacetat | 10 | 0 | |

5516119000 | andere | 10 | 0 | |

5516121000 | aus Viskose | 10 | 0 | |

5516122000 | aus Celluloseacetat | 10 | 0 | |

5516129000 | andere | 10 | 0 | |

5516131000 | aus Viskose | 10 | 0 | |

5516132000 | aus Celluloseacetat | 10 | 0 | |

5516139000 | andere | 10 | 0 | |

5516141000 | aus Viskose | 10 | 0 | |

5516142000 | aus Celluloseacetat | 10 | 0 | |

5516149000 | andere | 10 | 0 | |

5516211000 | aus Viskose | 10 | 0 | |

5516212000 | aus Celluloseacetat | 10 | 0 | |

5516219000 | andere | 10 | 0 | |

5516221000 | aus Viskose | 10 | 0 | |

5516222000 | aus Celluloseacetat | 10 | 0 | |

5516229000 | andere | 10 | 0 | |

5516231000 | aus Viskose | 10 | 0 | |

5516232000 | aus Celluloseacetat | 10 | 0 | |

5516239000 | andere | 10 | 0 | |

5516241000 | aus Viskose | 10 | 0 | |

5516242000 | aus Celluloseacetat | 10 | 0 | |

5516249000 | andere | 10 | 0 | |

5516311000 | aus Viskose | 10 | 0 | |

5516312000 | aus Celluloseacetat | 10 | 0 | |

5516319000 | andere | 10 | 0 | |

5516321000 | aus Viskose | 10 | 0 | |

5516322000 | aus Celluloseacetat | 10 | 0 | |

5516329000 | andere | 10 | 0 | |

5516331000 | aus Viskose | 10 | 0 | |

5516332000 | aus Celluloseacetat | 10 | 0 | |

5516339000 | andere | 10 | 0 | |

5516341000 | aus Viskose | 10 | 0 | |

5516342000 | aus Celluloseacetat | 10 | 0 | |

5516349000 | andere | 10 | 0 | |

5516411000 | aus Viskose | 10 | 0 | |

5516412000 | aus Celluloseacetat | 10 | 0 | |

5516419000 | andere | 10 | 0 | |

5516421000 | aus Viskose | 10 | 0 | |

5516422000 | aus Celluloseacetat | 10 | 0 | |

5516429000 | andere | 10 | 0 | |

5516431000 | aus Viskose | 10 | 0 | |

5516432000 | aus Celluloseacetat | 10 | 0 | |

5516439000 | andere | 10 | 0 | |

5516441000 | aus Viskose | 10 | 0 | |

5516442000 | aus Celluloseacetat | 10 | 0 | |

5516449000 | andere | 10 | 0 | |

5516911000 | aus Viskose | 10 | 0 | |

5516912000 | aus Celluloseacetat | 10 | 0 | |

5516919000 | andere | 10 | 0 | |

5516921000 | aus Viskose | 10 | 0 | |

5516922000 | aus Celluloseacetat | 10 | 0 | |

5516929000 | andere | 10 | 0 | |

5516931000 | aus Viskose | 10 | 0 | |

5516932000 | aus Celluloseacetat | 10 | 0 | |

5516939000 | andere | 10 | 0 | |

5516941000 | aus Viskose | 10 | 0 | |

5516942000 | aus Celluloseacetat | 10 | 0 | |

5516949000 | andere | 10 | 0 | |

5601100000 | hygienische Binden und Tampons, Windeln für Kleinkinder und ähnliche hygienischeWaren, aus Watte | 8 | 0 | |

5601210000 | aus Baumwolle | 8 | 0 | |

5601220000 | aus Chemiefasern | 8 | 0 | |

5601290000 | andere | 8 | 0 | |

5601301000 | Scherstaub | 8 | 0 | |

5601309000 | andere | 8 | 0 | |

5602101000 | Nadelfilze | 8 | 0 | |

5602102000 | nähgewirkte Flächenerzeugnisse | 8 | 0 | |

5602211000 | Klavierfilz | 8 | 0 | |

5602219000 | andere | 8 | 0 | |

5602290000 | aus anderen Spinnstoffen | 8 | 0 | |

5602900000 | andere | 8 | 0 | |

5603111000 | getränkt, bestrichen, überzogen oder mit Lagen versehen | 8 | 0 | |

5603119000 | andere | 8 | 0 | |

5603121000 | getränkt, bestrichen, überzogen oder mit Lagen versehen | 8 | 0 | |

5603129000 | andere | 8 | 0 | |

5603131000 | getränkt, bestrichen, überzogen oder mit Lagen versehen | 8 | 0 | |

5603139000 | andere | 8 | 0 | |

5603141000 | getränkt, bestrichen, überzogen oder mit Lagen versehen | 8 | 0 | |

5603149000 | andere | 8 | 0 | |

5603910000 | mit einem Quadratmetergewicht von 25 g oder weniger | 8 | 0 | |

5603920000 | mit einem Quadratmetergewicht von mehr als 25 g bis 70 g | 8 | 0 | |

5603930000 | mit einem Quadratmetergewicht von mehr als 70 g bis 150 g | 8 | 0 | |

5603940000 | mit einem Quadratmetergewicht von mehr als 150 g | 8 | 0 | |

5604100000 | Fäden und Schnüre aus Kautschuk, mit einem Überzug aus Spinnstoffen | 8 | 0 | |

5604901000 | Catgutnachahmungen, aus Spinnstoffgarnen bestehend | 8 | 0 | |

5604902000 | hochfeste Garne aus Polyester, Nylon oder anderen Polyamiden oder aus Viskose, getränkt oder bestrichen | 8 | 0 | |

5604909000 | andere | 8 | 0 | |

5605000000 | Metallgarne und metallisierte Garne, auch umsponnen, bestehend aus Streifen und dergleichen der Position 5404 oder 5405 oder aus Garnen aus Spinnstoffen, in Verbindung mit Metall in Form von Fäden, Streifen oder Pulver oder mit Metall überzogen | 8 | 0 | |

5606001000 | Gimpen | 8 | 0 | |

5606002000 | Chenillegarne | 8 | 0 | |

5606003000 | "Maschengarne" | 8 | 0 | |

5606009000 | andere | 8 | 0 | |

5607210000 | Bindegarne oder Pressengarne | 10 | 0 | |

5607290000 | andere | 10 | 0 | |

5607410000 | Bindegarne oder Pressengarne | 10 | 0 | |

5607490000 | andere | 10 | 0 | |

5607500000 | aus anderen synthetischen Chemiefasern | 10 | 0 | |

5607901000 | aus Jute oder anderen textilen Bastfasern der Position 5303 | 10 | 0 | |

5607909000 | andere | 10 | 0 | |

5608111000 | aus synthetischen Chemiefasern | 10 | 0 | |

5608119000 | andere | 10 | 0 | |

5608191000 | aus synthetischen Chemiefasern | 10 | 0 | |

5608199000 | andere | 10 | 0 | |

5608901000 | aus Baumwolle | 10 | 0 | |

5608909000 | andere | 10 | 0 | |

5609001000 | aus Baumwolle | 8 | 0 | |

5609002000 | aus pflanzlichen Fasern, ausgenommen Baumwolle | 8 | 0 | |

5609003000 | aus Chemiefasern | 8 | 0 | |

5609009000 | andere | 8 | 0 | |

5701100000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

5701900000 | aus anderen Spinnstoffen | 10 | 0 | |

5702100000 | Kelim, Sumak, Karamanie und ähnliche handgewebte Teppiche | 10 | 0 | |

5702200000 | Fußbodenbeläge aus Kokosfasern | 10 | 0 | |

5702310000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

5702320000 | aus synthetischen oder künstlichen Spinnstoffen | 10 | 0 | |

5702390000 | aus anderen Spinnstoffen | 10 | 0 | |

5702410000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

5702420000 | aus synthetischen oder künstlichen Spinnstoffen | 10 | 0 | |

5702490000 | aus anderen Spinnstoffen | 10 | 0 | |

5702500000 | andere, ohne Flor, nicht konfektioniert | 10 | 0 | |

5702910000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

5702920000 | aus synthetischen oder künstlichen Spinnstoffen | 10 | 0 | |

5702990000 | aus anderen Spinnstoffen | 10 | 0 | |

5703100000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

5703200000 | aus Nylon oder anderen Polyamiden | 10 | 0 | |

5703300000 | aus anderen synthetischen oder künstlichen Spinnstoffen | 10 | 0 | |

5703900000 | aus anderen Spinnstoffen | 10 | 0 | |

5704100000 | Fliesen mit einer Oberfläche von 0,3 m2 oder weniger | 10 | 0 | |

5704900000 | andere | 10 | 0 | |

5705000000 | andere Teppiche und andere Fußbodenbeläge, aus Spinnstoffen, auch konfektioniert | 10 | 0 | |

5801101000 | Samt und Plüsch | 13 | 0 | |

5801102000 | Chenillegewebe | 13 | 0 | |

5801210000 | Schusssamt und Schussplüsch, nicht aufgeschnitten | 13 | 0 | |

5801220000 | Rippenschusssamt und Rippenschussplüsch, aufgeschnitten | 13 | 0 | |

5801230000 | anderer Schusssamt und Schussplüsch | 13 | 0 | |

5801240000 | Kettsamt und Kettplüsch, nicht aufgeschnitten (Epinglé) | 13 | 0 | |

5801250000 | Kettsamt und Kettplüsch, aufgeschnitten | 13 | 0 | |

5801260000 | Chenillegewebe | 13 | 0 | |

5801310000 | Schusssamt und Schussplüsch, nicht aufgeschnitten | 13 | 0 | |

5801320000 | Rippenschusssamt und Rippenschussplüsch, aufgeschnitten | 13 | 0 | |

5801330000 | anderer Schusssamt und Schussplüsch | 13 | 0 | |

5801340000 | Kettsamt und Kettplüsch, nicht aufgeschnitten (Epinglé) | 13 | 0 | |

5801350000 | Kettsamt und Kettplüsch, aufgeschnitten | 13 | 0 | |

5801360000 | Chenillegewebe | 13 | 0 | |

5801900000 | aus anderen Spinnstoffen | 13 | 0 | |

5802110000 | roh | 8 | 0 | |

5802190000 | andere | 8 | 0 | |

5802200000 | Schlingengewebe nach Art der Frottiergewebe, aus anderen Spinnstoffen | 8 | 0 | |

5802300000 | getuftete Spinnstofferzeugnisse | 8 | 0 | |

5803000000 | Drehergewebe, ausgenommen Waren der Position 5806 | 8 | 0 | |

5804101000 | aus Seide | 13 | 0 | |

5804102000 | aus Baumwolle | 13 | 0 | |

5804103000 | aus Chemiefasern | 13 | 0 | |

5804109000 | andere | 13 | 0 | |

5804210000 | aus Chemiefasern | 13 | 0 | |

5804291000 | aus Seide | 13 | 0 | |

5804292000 | aus Baumwolle | 13 | 0 | |

5804299000 | andere | 13 | 0 | |

5804300000 | handgefertigte Spitzen | 13 | 0 | |

5805001010 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

5805001090 | andere | 8 | 0 | |

5805002000 | Tapisserien als Nadelarbeit | 8 | 0 | |

5806101000 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

5806102000 | aus Baumwolle | 8 | 0 | |

5806103000 | aus Chemiefasern | 8 | 0 | |

5806109000 | andere | 8 | 0 | |

5806200000 | andere Bänder, mit einem Anteil an Elastomergarnen oder Kautschukfäden von 5 GHT oder mehr | 8 | 0 | |

5806310000 | aus Baumwolle | 8 | 0 | |

5806320000 | aus Chemiefasern | 8 | 0 | |

5806391000 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

5806392000 | aus pflanzlichen Fasern, ausgenommen Baumwolle | 8 | 0 | |

5806399000 | andere | 8 | 0 | |

5806400000 | schusslose Bänder aus parallel gelegten und geklebten Garnen oder Fasern (Bolducs) | 8 | 0 | |

5807101000 | Etiketten | 8 | 0 | |

5807109000 | andere | 8 | 0 | |

5807901000 | Etiketten | 8 | 0 | |

5807909000 | andere | 8 | 0 | |

5808100000 | Geflechte als Meterware | 8 | 0 | |

5808901000 | Posamentierwaren und ähnliche Zierwaren | 8 | 0 | |

5808909000 | andere | 8 | 0 | |

5809000000 | Gewebe aus Metallfäden und Gewebe aus Metallgarnen oder aus metallisierten Garnen der Position 5605, von der zur Bekleidung, Innenausstattung oder zu ähnlichen Zwecken verwendeten Art, anderweit weder genannt noch inbegriffen | 8 | 0 | |

5810100000 | Ätzstickereien und Stickereien mit herausgeschnittenem Grund | 13 | 0 | |

5810910000 | aus Baumwolle | 13 | 0 | |

5810920000 | aus Chemiefasern | 13 | 0 | |

5810990000 | aus anderen Spinnstoffen | 13 | 0 | |

5811001000 | aus Seide | 8 | 0 | |

5811002000 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

5811003000 | aus Baumwolle | 8 | 0 | |

5811004000 | aus Chemiefasern | 8 | 0 | |

5811009000 | andere | 8 | 0 | |

5901100000 | Gewebe, mit Leim oder stärkehaltigen Stoffen bestrichen, von der zum Einbinden von Büchern, zum Herstellen von Futteralen, Kartonagen oder zu ähnlichen Zwecken verwendeten Art | 8 | 0 | |

5901901000 | Pausleinwand | 8 | 0 | |

5901902000 | präparierte Malleinwand | 8 | 0 | |

5901903000 | Bougram und ähnliche steife Gewebe | 8 | 0 | |

5902100000 | aus Nylon oder anderen Polyamiden | 8 | 0 | |

5902200000 | aus Polyestern | 8 | 0 | |

5902900000 | andere | 8 | 0 | |

5903100000 | mit Poly(vinylchlorid) | 10 | 0 | |

5903200000 | mit Polyurethan | 10 | 0 | |

5903900000 | andere | 10 | 0 | |

5904100000 | Linoleum | 8 | 0 | |

5904900000 | andere | 8 | 0 | |

5905000000 | Wandverkleidungen aus Spinnstoffen | 8 | 0 | |

5906100000 | Klebebänder, mit einer Breite von 20 cm oder weniger | 8 | 0 | |

5906910000 | aus Gewirken oder Gestricken | 8 | 0 | |

5906990000 | andere | 8 | 0 | |

5907001000 | Gewebe, getränkt oder bestrichen mit Öl oder mit einem Überzug auf der Grundlage von Öl | 8 | 0 | |

5907002000 | bemalte Gewebe für Theaterdekorationen, Atelierhintergründe oder dergleichen | 8 | 0 | |

5907009000 | andere | 8 | 0 | |

5908001000 | Dochte | 8 | 0 | |

5908009000 | andere | 8 | 0 | |

5909000000 | Pumpenschläuche und ähnliche Schläuche, aus Spinnstoffen, auch mit Armaturen oder Zubehör aus anderen Stoffen | 8 | 0 | |

5910000000 | Förderbänder und Treibriemen, aus Spinnstoffen, auch mit Kunststoff getränkt, bestrichen, überzogen oder mit Lagen aus Kunststoff versehen oder mit Metall oder anderen Stoffen verstärkt | 8 | 0 | |

5911101000 | aus Bändern | 8 | 0 | |

5911109000 | andere | 8 | 0 | |

5911200000 | Müllergaze, auch konfektioniert | 8 | 0 | |

5911310000 | mit einem Quadratmetergewicht von weniger als 650 g | 8 | 0 | |

5911320000 | mit einem Quadratmetergewicht von 650 g oder mehr | 8 | 0 | |

5911400000 | Filtertücher, von der zum Pressen von Öl oder zu ähnlichen technischen Zwecken verwendeten Art, auch aus Menschenhaaren | 8 | 0 | |

5911900000 | andere | 8 | 0 | |

6001101000 | aus Baumwolle | 10 | 0 | |

6001102000 | aus Chemiefasern | 10 | 0 | |

6001109000 | andere | 10 | 0 | |

6001210000 | aus Baumwolle | 10 | 0 | |

6001220000 | aus Chemiefasern | 10 | 0 | |

6001290000 | aus anderen Spinnstoffen | 10 | 0 | |

6001910000 | aus Baumwolle | 10 | 0 | |

6001920000 | aus Chemiefasern | 10 | 0 | |

6001990000 | aus anderen Spinnstoffen | 10 | 0 | |

6002400000 | mit einem Anteil an Elastomergarnen von 5 GHT oder mehr, jedoch keine Kautschukfäden enthaltend | 10 | 0 | |

6002900000 | andere | 10 | 0 | |

6003100000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

6003200000 | aus Baumwolle | 10 | 0 | |

6003300000 | aus synthetischen Chemiefasern | 10 | 0 | |

6003400000 | aus künstlichen Chemiefasern | 10 | 0 | |

6003900000 | andere | 10 | 0 | |

6004100000 | mit einem Anteil an Elastomergarnen von 5 GHT oder mehr, jedoch keine Kautschukfäden enthaltend | 10 | 0 | |

6004900000 | andere | 10 | 0 | |

6005210000 | roh oder gebleicht | 10 | 0 | |

6005220000 | gefärbt | 10 | 0 | |

6005230000 | buntgewebt | 10 | 0 | |

6005240000 | bedruckt | 10 | 0 | |

6005310000 | roh oder gebleicht | 10 | 0 | |

6005320000 | gefärbt | 10 | 0 | |

6005330000 | buntgewebt | 10 | 0 | |

6005340000 | bedruckt | 10 | 0 | |

6005410000 | roh oder gebleicht | 10 | 0 | |

6005420000 | gefärbt | 10 | 0 | |

6005430000 | buntgewebt | 10 | 0 | |

6005440000 | bedruckt | 10 | 0 | |

6005900000 | andere | 10 | 0 | |

6006100000 | aus Wolle oder feinen Tierhaaren | 10 | 0 | |

6006210000 | roh oder gebleicht | 10 | 0 | |

6006220000 | gefärbt | 10 | 0 | |

6006230000 | buntgewebt | 10 | 0 | |

6006240000 | bedruckt | 10 | 0 | |

6006310000 | roh oder gebleicht | 10 | 0 | |

6006320000 | gefärbt | 10 | 0 | |

6006330000 | buntgewebt | 10 | 0 | |

6006340000 | bedruckt | 10 | 0 | |

6006410000 | roh oder gebleicht | 10 | 0 | |

6006420000 | gefärbt | 10 | 0 | |

6006430000 | buntgewebt | 10 | 0 | |

6006440000 | bedruckt | 10 | 0 | |

6006900000 | andere | 10 | 0 | |

6101200000 | aus Baumwolle | 13 | 0 | |

6101301000 | aus synthetischen Chemiefasern | 13 | 0 | |

6101302000 | aus künstlichen Chemiefasern | 13 | 0 | |

6101900000 | aus anderen Spinnstoffen | 13 | 0 | |

6102100000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6102200000 | aus Baumwolle | 13 | 0 | |

6102301000 | aus synthetischen Chemiefasern | 13 | 0 | |

6102302000 | aus künstlichen Chemiefasern | 13 | 0 | |

6102900000 | aus anderen Spinnstoffen | 13 | 0 | |

6103101000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6103102000 | aus synthetischen Chemiefasern | 13 | 0 | |

6103109000 | aus anderen Spinnstoffen | 13 | 0 | |

6103220000 | aus Baumwolle | 13 | 0 | |

6103230000 | aus synthetischen Chemiefasern | 13 | 0 | |

6103290000 | aus anderen Spinnstoffen | 13 | 0 | |

6103310000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6103320000 | aus Baumwolle | 13 | 0 | |

6103330000 | aus synthetischen Chemiefasern | 13 | 0 | |

6103390000 | aus anderen Spinnstoffen | 13 | 0 | |

6103410000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6103420000 | aus Baumwolle | 13 | 0 | |

6103430000 | aus synthetischen Chemiefasern | 13 | 0 | |

6103490000 | aus anderen Spinnstoffen | 13 | 0 | |

6104130000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104191000 | aus Baumwolle | 13 | 0 | |

6104199000 | andere | 13 | 0 | |

6104220000 | aus Baumwolle | 13 | 0 | |

6104230000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104290000 | aus anderen Spinnstoffen | 13 | 0 | |

6104310000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6104320000 | aus Baumwolle | 13 | 0 | |

6104330000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104390000 | aus anderen Spinnstoffen | 13 | 0 | |

6104410000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6104420000 | aus Baumwolle | 13 | 0 | |

6104430000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104440000 | aus künstlichen Chemiefasern | 13 | 0 | |

6104491000 | aus Seide | 13 | 0 | |

6104499000 | andere | 13 | 0 | |

6104510000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6104520000 | aus Baumwolle | 13 | 0 | |

6104530000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104590000 | aus anderen Spinnstoffen | 13 | 0 | |

6104610000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6104620000 | aus Baumwolle | 13 | 0 | |

6104630000 | aus synthetischen Chemiefasern | 13 | 0 | |

6104690000 | aus anderen Spinnstoffen | 13 | 0 | |

6105100000 | aus Baumwolle | 13 | 0 | |

6105201000 | aus synthetischen Chemiefasern | 13 | 0 | |

6105202000 | aus künstlichen Chemiefasern | 13 | 0 | |

6105901000 | aus Seide | 13 | 0 | |

6105902000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6105909000 | andere | 13 | 0 | |

6106100000 | aus Baumwolle | 13 | 0 | |

6106201000 | aus synthetischen Chemiefasern | 13 | 0 | |

6106202000 | aus künstlichen Chemiefasern | 13 | 0 | |

6106901000 | aus Seide | 13 | 0 | |

6106902000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6106909000 | andere | 13 | 0 | |

6107110000 | aus Baumwolle | 13 | 0 | |

6107121000 | aus synthetischen Chemiefasern | 13 | 0 | |

6107122000 | aus künstlichen Chemiefasern | 13 | 0 | |

6107190000 | aus anderen Spinnstoffen | 13 | 0 | |

6107210000 | aus Baumwolle | 13 | 0 | |

6107221000 | aus synthetischen Chemiefasern | 13 | 0 | |

6107222000 | aus künstlichen Chemiefasern | 13 | 0 | |

6107290000 | aus anderen Spinnstoffen | 13 | 0 | |

6107910000 | aus Baumwolle | 13 | 0 | |

6107991000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6107999000 | andere | 13 | 0 | |

6108111000 | aus synthetischen Chemiefasern | 13 | 0 | |

6108112000 | aus künstlichen Chemiefasern | 13 | 0 | |

6108191000 | aus Baumwolle | 13 | 0 | |

6108199000 | andere | 13 | 0 | |

6108210000 | aus Baumwolle | 13 | 0 | |

6108221000 | aus synthetischen Chemiefasern | 13 | 0 | |

6108222000 | aus künstlichen Chemiefasern | 13 | 0 | |

6108290000 | aus anderen Spinnstoffen | 13 | 0 | |

6108310000 | aus Baumwolle | 13 | 0 | |

6108321000 | aus synthetischen Chemiefasern | 13 | 0 | |

6108322000 | aus künstlichen Chemiefasern | 13 | 0 | |

6108390000 | aus anderen Spinnstoffen | 13 | 0 | |

6108910000 | aus Baumwolle | 13 | 0 | |

6108921000 | aus synthetischen Chemiefasern | 13 | 0 | |

6108922000 | aus künstlichen Chemiefasern | 13 | 0 | |

6108991000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6108999000 | andere | 13 | 0 | |

6109101000 | T-Shirts | 13 | 0 | |

6109109000 | andere | 13 | 0 | |

6109901010 | T-Shirts | 13 | 0 | |

6109901090 | andere | 13 | 0 | |

6109902010 | T-Shirts | 13 | 0 | |

6109902090 | andere | 13 | 0 | |

6109903010 | T-Shirts | 13 | 0 | |

6109903090 | andere | 13 | 0 | |

6109909010 | T-Shirts | 13 | 0 | |

6109909090 | andere | 13 | 0 | |

6110110000 | aus Wolle | 13 | 0 | |

6110120000 | aus Kaschmirziegenhaaren (Cashmere) | 13 | 0 | |

6110190000 | andere | 13 | 0 | |

6110200000 | aus Baumwolle | 13 | 0 | |

6110301000 | aus synthetischen Chemiefasern | 13 | 0 | |

6110302000 | aus künstlichen Chemiefasern | 13 | 0 | |

6110901000 | aus Seide | 13 | 0 | |

6110909000 | andere | 13 | 0 | |

6111201000 | Kleidung | 13 | 0 | |

6111202000 | Bekleidungszubehör | 13 | 0 | |

6111301000 | Kleidung | 13 | 0 | |

6111302000 | Bekleidungszubehör | 13 | 0 | |

6111901000 | Kleidung | 13 | 0 | |

6111902000 | Bekleidungszubehör | 13 | 0 | |

6112110000 | aus Baumwolle | 13 | 0 | |

6112120000 | aus synthetischen Chemiefasern | 13 | 0 | |

6112190000 | aus anderen Spinnstoffen | 13 | 0 | |

6112201000 | aus Chemiefasern | 13 | 0 | |

6112209000 | andere | 13 | 0 | |

6112310000 | aus synthetischen Chemiefasern | 13 | 0 | |

6112390000 | aus anderen Spinnstoffen | 13 | 0 | |

6112410000 | aus synthetischen Chemiefasern | 13 | 0 | |

6112490000 | aus anderen Spinnstoffen | 13 | 0 | |

6113001000 | der Position 5903 | 13 | 0 | |

6113002000 | der Position 5906 | 13 | 0 | |

6113003000 | der Position 5907 | 13 | 0 | |

6114200000 | aus Baumwolle | 13 | 0 | |

6114301000 | aus synthetischen Chemiefasern | 13 | 0 | |

6114302000 | aus künstlichen Chemiefasern | 13 | 0 | |

6114901000 | aus Seide | 13 | 0 | |

6114909000 | andere | 13 | 0 | |

6115100000 | Strumpfhosen, Strümpfe und Kniestrümpfe mit degressiver Kompression (z. B. Krampfaderstrümpfe) | 13 | 0 | |

6115210000 | aus synthetischen Chemiefasern, mit einem Titer der einfachen Garne von weniger als 67 dtex | 13 | 0 | |

6115220000 | aus synthetischen Chemiefasern, mit einem Titer der einfachen Garne von 67 dtex oder mehr | 13 | 0 | |

6115290000 | aus anderen Spinnstoffen | 13 | 0 | |

6115301000 | aus Chemiefasern | 13 | 0 | |

6115309000 | andere | 13 | 0 | |

6115940000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6115950000 | aus Baumwolle | 13 | 0 | |

6115960000 | aus synthetischen Chemiefasern | 13 | 0 | |

6115990000 | aus anderen Stoffen | 13 | 0 | |

6116100000 | mit Kunststoff oder Kautschuk getränkt, bestrichen oder überzogen | 8 | 0 | |

6116910000 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

6116921000 | Arbeitshandschuhe | 8 | 0 | |

6116929000 | andere | 8 | 0 | |

6116930000 | aus synthetischen Chemiefasern | 8 | 0 | |

6116990000 | aus anderen Spinnstoffen | 8 | 0 | |

6117101000 | aus Seide | 13 | 0 | |

6117102000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6117103000 | aus Baumwolle | 13 | 0 | |

6117104000 | aus Chemiefasern | 13 | 0 | |

6117109000 | andere | 13 | 0 | |

6117801000 | Krawatten, Schleifen (z. B. Querbinder) und Krawattenschals | 13 | 0 | |

6117809000 | andere | 13 | 0 | |

6117900000 | Teile | 13 | 0 | |

6201110000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6201120000 | aus Baumwolle | 13 | 0 | |

6201131000 | aus synthetischen Chemiefasern | 13 | 0 | |

6201132000 | aus künstlichen Chemiefasern | 13 | 0 | |

6201190000 | aus anderen Spinnstoffen | 13 | 0 | |

6201910000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6201920000 | aus Baumwolle | 13 | 0 | |

6201931000 | aus synthetischen Chemiefasern | 13 | 0 | |

6201932000 | aus künstlichen Chemiefasern | 13 | 0 | |

6201990000 | aus anderen Spinnstoffen | 13 | 0 | |

6202110000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6202120000 | aus Baumwolle | 13 | 0 | |

6202131000 | aus synthetischen Chemiefasern | 13 | 0 | |

6202132000 | aus künstlichen Chemiefasern | 13 | 0 | |

6202190000 | aus anderen Spinnstoffen | 13 | 0 | |

6202910000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6202920000 | aus Baumwolle | 13 | 0 | |

6202931000 | aus synthetischen Chemiefasern | 13 | 0 | |

6202932000 | aus künstlichen Chemiefasern | 13 | 0 | |

6202990000 | aus anderen Spinnstoffen | 13 | 0 | |

6203110000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6203120000 | aus synthetischen Chemiefasern | 13 | 0 | |

6203190000 | aus anderen Spinnstoffen | 13 | 0 | |

6203220000 | aus Baumwolle | 13 | 0 | |

6203230000 | aus synthetischen Chemiefasern | 13 | 0 | |

6203291000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6203299000 | andere | 13 | 0 | |

6203310000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6203320000 | aus Baumwolle | 13 | 0 | |

6203330000 | aus synthetischen Chemiefasern | 13 | 0 | |

6203390000 | aus anderen Spinnstoffen | 13 | 0 | |

6203410000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6203421000 | aus Denim, einschließlich Bluejeans | 13 | 0 | |

6203429000 | andere | 13 | 0 | |

6203430000 | aus synthetischen Chemiefasern | 13 | 0 | |

6203490000 | aus anderen Spinnstoffen | 13 | 0 | |

6204110000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204120000 | aus Baumwolle | 13 | 0 | |

6204130000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204191000 | aus Seide | 13 | 0 | |

6204199000 | andere | 13 | 0 | |

6204210000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204220000 | aus Baumwolle | 13 | 0 | |

6204230000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204291000 | aus Seide | 13 | 0 | |

6204299000 | andere | 13 | 0 | |

6204310000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204320000 | aus Baumwolle | 13 | 0 | |

6204330000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204391000 | aus Seide | 13 | 0 | |

6204399000 | andere | 13 | 0 | |

6204410000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204420000 | aus Baumwolle | 13 | 0 | |

6204430000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204440000 | aus künstlichen Chemiefasern | 13 | 0 | |

6204491000 | aus Seide | 13 | 0 | |

6204499000 | andere | 13 | 0 | |

6204510000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204520000 | aus Baumwolle | 13 | 0 | |

6204530000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204591000 | aus Seide | 13 | 0 | |

6204599000 | andere | 13 | 0 | |

6204610000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6204621000 | aus Denim, einschließlich Bluejeans | 13 | 0 | |

6204629000 | andere | 13 | 0 | |

6204630000 | aus synthetischen Chemiefasern | 13 | 0 | |

6204691000 | aus Seide | 13 | 0 | |

6204699000 | andere | 13 | 0 | |

6205200000 | aus Baumwolle | 13 | 0 | |

6205301000 | aus synthetischen Chemiefasern | 13 | 0 | |

6205302000 | aus künstlichen Chemiefasern | 13 | 0 | |

6205901000 | aus Seide | 13 | 0 | |

6205902000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6205909000 | andere | 13 | 0 | |

6206100000 | aus Seide, Schappeseide oder Bourretteseide | 13 | 0 | |

6206200000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6206300000 | aus Baumwolle | 13 | 0 | |

6206401000 | aus synthetischen Chemiefasern | 13 | 0 | |

6206402000 | aus künstlichen Chemiefasern | 13 | 0 | |

6206900000 | aus anderen Spinnstoffen | 13 | 0 | |

6207110000 | aus Baumwolle | 13 | 0 | |

6207191000 | aus Chemiefasern | 13 | 0 | |

6207199000 | andere | 13 | 0 | |

6207210000 | aus Baumwolle | 13 | 0 | |

6207221000 | aus synthetischen Chemiefasern | 13 | 0 | |

6207222000 | aus künstlichen Chemiefasern | 13 | 0 | |

6207290000 | aus anderen Spinnstoffen | 13 | 0 | |

6207910000 | aus Baumwolle | 13 | 0 | |

6207991000 | aus Seide | 13 | 0 | |

6207992000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6207993010 | aus synthetischen Chemiefasern | 13 | 0 | |

6207993020 | aus künstlichen Chemiefasern | 13 | 0 | |

6207999000 | andere | 13 | 0 | |

6208111000 | aus synthetischen Chemiefasern | 13 | 0 | |

6208112000 | aus künstlichen Chemiefasern | 13 | 0 | |

6208191000 | aus Seide | 13 | 0 | |

6208192000 | aus Baumwolle | 13 | 0 | |

6208199000 | andere | 13 | 0 | |

6208210000 | aus Baumwolle | 13 | 0 | |

6208221000 | aus synthetischen Chemiefasern | 13 | 0 | |

6208222000 | aus künstlichen Chemiefasern | 13 | 0 | |

6208290000 | aus anderen Spinnstoffen | 13 | 0 | |

6208910000 | aus Baumwolle | 13 | 0 | |

6208921000 | aus synthetischen Chemiefasern | 13 | 0 | |

6208922000 | aus künstlichen Chemiefasern | 13 | 0 | |

6208991000 | aus Seide | 13 | 0 | |

6208992000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6208999000 | andere | 13 | 0 | |

6209201000 | Kleidung | 13 | 0 | |

6209202000 | Bekleidungszubehör | 13 | 0 | |

6209301000 | Kleidung | 13 | 0 | |

6209302000 | Bekleidungszubehör | 13 | 0 | |

6209901010 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6209901090 | andere | 13 | 0 | |

6209902000 | Bekleidungszubehör | 13 | 0 | |

6210101000 | aus Erzeugnissen der Position 5602 | 13 | 0 | |

6210102000 | aus Erzeugnissen der Position 5603 | 13 | 0 | |

6210201000 | aus Erzeugnissen der Position 5903 | 13 | 0 | |

6210202000 | aus Erzeugnissen der Position 5906 | 13 | 0 | |

6210203000 | aus Erzeugnissen der Position 5907 | 13 | 0 | |

6210301000 | aus Erzeugnissen der Position 5903 | 13 | 0 | |

6210302000 | aus Erzeugnissen der Position 5906 | 13 | 0 | |

6210303000 | aus Erzeugnissen der Position 5907 | 13 | 0 | |

6210401000 | aus Erzeugnissen der Position 5903 | 13 | 0 | |

6210402000 | aus Erzeugnissen der Position 5906 | 13 | 0 | |

6210403000 | aus Erzeugnissen der Position 5907 | 13 | 0 | |

6210501000 | aus Erzeugnissen der Position 5903 | 13 | 0 | |

6210502000 | aus Erzeugnissen der Position 5906 | 13 | 0 | |

6210503000 | aus Erzeugnissen der Position 5907 | 13 | 0 | |

6211111000 | aus Chemiefasern | 13 | 0 | |

6211119000 | andere | 13 | 0 | |

6211121000 | aus Chemiefasern | 13 | 0 | |

6211129000 | andere | 13 | 0 | |

6211201000 | aus Chemiefasern | 13 | 0 | |

6211209000 | andere | 13 | 0 | |

6211321000 | Judoanzüge, Taekwondo-Anzüge und Anzüge für andere östliche Kampfsportarten | 13 | 0 | |

6211329000 | andere | 13 | 0 | |

6211331000 | aus synthetischen Chemiefasern | 13 | 0 | |

6211332000 | aus künstlichen Chemiefasern | 13 | 0 | |

6211391000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6211399000 | andere | 13 | 0 | |

6211410000 | aus Wolle oder feinen Tierhaaren | 13 | 0 | |

6211421000 | Judoanzüge, Taekwondo-Anzüge und Anzüge für andere östliche Kampfsportarten | 13 | 0 | |

6211429000 | andere | 13 | 0 | |

6211431000 | aus synthetischen Chemiefasern | 13 | 0 | |

6211432000 | aus künstlichen Chemiefasern | 13 | 0 | |

6211490000 | aus anderen Spinnstoffen | 13 | 0 | |

6212101000 | aus Baumwolle | 13 | 0 | |

6212102000 | aus Chemiefasern | 13 | 0 | |

6212109000 | andere | 13 | 0 | |

6212201000 | aus Baumwolle | 13 | 0 | |

6212202000 | aus Chemiefasern | 13 | 0 | |

6212209000 | andere | 13 | 0 | |

6212300000 | Korseletts | 13 | 0 | |

6212900000 | andere | 13 | 0 | |

6213200000 | aus Baumwolle | 8 | 0 | |

6213900000 | aus anderen Spinnstoffen | 8 | 0 | |

6214100000 | aus Seide, Schappeseide oder Bourretteseide | 8 | 0 | |

6214200000 | aus Wolle oder feinen Tierhaaren | 8 | 0 | |

6214300000 | aus synthetischen Chemiefasern | 8 | 0 | |

6214400000 | aus künstlichen Chemiefasern | 8 | 0 | |

6214900000 | aus anderen Spinnstoffen | 8 | 0 | |

6215100000 | aus Seide, Schappeseide oder Bourretteseide | 8 | 0 | |

6215200000 | aus Chemiefasern | 8 | 0 | |

6215900000 | aus anderen Spinnstoffen | 8 | 0 | |

6216001000 | mit Kunststoff oder Kautschuk getränkt, bestrichen oder überzogen | 8 | 0 | |

6216009000 | andere | 8 | 0 | |

6217100000 | Bekleidungszubehör | 13 | 0 | |

6217900000 | Teile | 13 | 0 | |

6301100000 | Decken mit elektrischer Heizvorrichtung | 10 | 0 | |

6301200000 | Decken (ausgenommen Decken mit elektrischer Heizvorrichtung) aus Wolle oder feinen Tierhaaren | 10 | 0 | |

6301300000 | Decken (ausgenommen Decken mit elektrischer Heizvorrichtung) aus Baumwolle | 10 | 0 | |

6301400000 | Decken (ausgenommen Decken mit elektrischer Heizvorrichtung) aus synthetischen Chemiefasern | 10 | 0 | |

6301900000 | andere Decken | 10 | 0 | |

6302101000 | aus Baumwolle | 13 | 0 | |

6302109000 | andere | 13 | 0 | |

6302210000 | aus Baumwolle | 13 | 0 | |

6302220000 | aus Chemiefasern | 13 | 0 | |

6302290000 | aus anderen Spinnstoffen | 13 | 0 | |

6302310000 | aus Baumwolle | 13 | 0 | |

6302320000 | aus Chemiefasern | 13 | 0 | |

6302390000 | aus anderen Spinnstoffen | 13 | 0 | |

6302400000 | Tischwäsche aus Gewirken oder Gestricken | 13 | 0 | |

6302510000 | aus Baumwolle | 13 | 0 | |

6302530000 | aus Chemiefasern | 13 | 0 | |

6302590000 | aus anderen Spinnstoffen | 13 | 0 | |

6302600000 | Wäsche zur Körperpflege und Küchenwäsche, aus Frottierware aus Baumwolle | 13 | 0 | |

6302910000 | aus Baumwolle | 13 | 0 | |

6302930000 | aus Chemiefasern | 13 | 0 | |

6302990000 | aus anderen Spinnstoffen | 13 | 0 | |

6303120000 | aus synthetischen Chemiefasern | 13 | 0 | |

6303191000 | aus Baumwolle | 13 | 0 | |

6303199000 | andere | 13 | 0 | |

6303910000 | aus Baumwolle | 13 | 0 | |

6303920000 | aus synthetischen Chemiefasern | 13 | 0 | |

6303990000 | aus anderen Spinnstoffen | 13 | 0 | |

6304110000 | aus Gewirken oder Gestricken | 13 | 0 | |

6304190000 | andere | 13 | 0 | |

6304910000 | aus Gewirken oder Gestricken | 13 | 0 | |

6304920000 | aus Baumwolle (ausgenommen aus Gewirken oder Gestricken) | 13 | 0 | |

6304930000 | aus synthetischen Chemiefasern (ausgenommen aus Gewirken oder Gestricken) | 13 | 0 | |

6304990000 | aus anderen Spinnstoffen (ausgenommen aus Gewirken oder Gestricken) | 13 | 0 | |

6305100000 | aus Jute oder anderen textilen Bastfasern der Position 5303 | 8 | 0 | |

6305200000 | aus Baumwolle | 8 | 0 | |

6305320000 | flexible Schüttgutbehälter | 8 | 0 | |

6305330000 | andere, aus Streifen oder dergleichen, aus Polyethylen oder Polypropylen | 8 | 0 | |

6305390000 | andere | 8 | 0 | |

6305900000 | aus anderen Spinnstoffen | 8 | 0 | |

6306120000 | aus synthetischen Chemiefasern | 13 | 0 | |

6306190000 | aus anderen Spinnstoffen | 13 | 0 | |

6306220000 | aus synthetischen Chemiefasern | 13 | 0 | |

6306290000 | aus anderen Spinnstoffen | 13 | 0 | |

6306300000 | Segel | 13 | 0 | |

6306401000 | aus Baumwolle | 13 | 0 | |

6306409000 | aus anderen Spinnstoffen | 13 | 0 | |

6306910000 | aus Baumwolle | 13 | 0 | |

6306991000 | aus synthetischen Chemiefasern | 13 | 0 | |

6306999000 | andere | 13 | 0 | |

6307100000 | Scheuertücher, Wischtücher, Spültücher, Staubtücher und ähnliche Reinigungstücher | 10 | 0 | |

6307200000 | Schwimmwesten und Rettungsgürtel | 10 | 0 | |

6307901000 | Schnürsenkel | 10 | 0 | |

6307902000 | Stoffeinbände | 10 | 0 | |

6307903000 | Schnittmuster zum Herstellen von Kleidung | 10 | 0 | |

6307909000 | andere | 10 | 0 | |

6308000000 | Warenzusammenstellungen, aus Geweben und Garn, auch mit Zubehör, für die Herstellung von Teppichen, Tapisserien, bestickten Tischdecken oder Servietten oder ähnlichen Spinnstoffwaren, in Aufmachungen für den Einzelverkauf | 13 | 0 | |

6309000000 | Altwaren | 8 | 0 | |

6310100000 | sortiert | 8 | 0 | |

6310900000 | andere | 8 | 0 | |

6401100000 | Schuhe, mit einem Metallschutz in der Vorderkappe | 8 | 0 | |

6401921000 | Skistiefel | 8 | 0 | |

6401929010 | aus Kautschuk | 8 | 0 | |

6401929090 | andere | 8 | 0 | |

6401991010 | aus Kautschuk | 8 | 0 | |

6401991090 | andere | 8 | 0 | |

6401999000 | andere | 8 | 0 | |

6402120000 | Skistiefel, Skilanglaufschuhe und Snowboardschuhe | 13 | 0 | |

6402190000 | andere | 13 | 0 | |

6402200000 | Schuhe mit Oberteil aus Bändern oder Riemen, mit der Sohle durch Zapfen zusammengesteckt | 13 | 0 | |

6402911000 | Schuhe, die Schutz gegen Kälte bieten | 13 | 0 | |

6402912000 | Tennisschuhe, Basketballschuhe, Turnschuhe, Trainingsschuhe und ähnliche Schuhe | 13 | 0 | |

6402919000 | andere | 13 | 0 | |

6402991000 | Sandalen oder ähnliche Schuhe, durch Formen in einem Stück hergestellt | 13 | 0 | |

6402992000 | Tennisschuhe, Basketballschuhe, Turnschuhe, Trainingsschuhe und ähnliche Schuhe | 13 | 0 | |

6402999000 | andere | 13 | 0 | |

6403120000 | Skistiefel, Skilanglaufschuhe und Snowboardschuhe | 13 | 0 | |

6403190000 | andere | 13 | 0 | |

6403200000 | Schuhe mit Laufsohlen aus Leder und Oberteil aus Lederriemen, die über den Spann und um die große Zehe führen | 13 | 0 | |

6403400000 | andere Schuhe, mit einem Metallschutz in der Vorderkappe | 13 | 0 | |

6403511000 | elegantes Schuhwerk | 13 | 0 | |

6403519000 | andere | 13 | 0 | |

6403591000 | elegantes Schuhwerk | 13 | 0 | |

6403599000 | andere | 13 | 0 | |

6403911000 | elegantes Schuhwerk | 13 | 0 | |

6403912000 | Bergsteigerschuhe | 13 | 0 | |

6403913000 | Schnürstiefel | 13 | 0 | |

6403914000 | Tennisschuhe, Basketballschuhe, Turnschuhe, Trainingsschuhe und ähnliche Schuhe | 13 | 0 | |

6403919000 | andere | 13 | 0 | |

6403991000 | elegantes Schuhwerk | 13 | 0 | |

6403992000 | Bergsteigerschuhe | 13 | 0 | |

6403993000 | Schnürstiefel | 13 | 0 | |

6403994000 | Tennisschuhe, Basketballschuhe, Turnschuhe, Trainingsschuhe und ähnliche Schuhe | 13 | 0 | |

6403999000 | andere | 13 | 0 | |

6404110000 | Sportschuhe; Tennisschuhe, Basketballschuhe, Turnschuhe, Trainingsschuhe und ähnliche Schuhe | 13 | 0 | |

6404191000 | Pantoffeln | 13 | 0 | |

6404199000 | andere | 13 | 0 | |

6404201000 | Pantoffeln | 13 | 0 | |

6404209000 | andere | 13 | 0 | |

6405100000 | mit Oberteil aus Leder oder rekonstituiertem Leder | 13 | 3 | |

6405200000 | mit Oberteil aus Spinnstoffen | 13 | 0 | |

6405900000 | andere | 13 | 5 | |

6406101000 | Schuhoberteile | 8 | 0 | |

6406102000 | Teile | 8 | 0 | |

6406201000 | Laufsohlen | 8 | 0 | |

6406202000 | Absätze | 8 | 0 | |

6406910000 | aus Holz | 8 | 0 | |

6406991000 | Einlegesohlen | 8 | 0 | |

6406992000 | Fersenstücke | 8 | 0 | |

6406993000 | Gamaschen | 8 | 0 | |

6406994000 | ähnliche Waren wie Gamaschen | 8 | 0 | |

6406999000 | andere | 8 | 0 | |

6501000000 | Hutstumpen, weder geformt noch randgeformt, aus Filz; Hutplatten, Bandeaux (auch aufgeschnitten), aus Filz, zum Herstellen von Hüten | 8 | 0 | |

6502000000 | Hutstumpen oder Hutrohlinge, geflochten oder durch Verbindung von Streifen aus Stoffen aller Art hergestellt, weder geformt noch randgeformt noch ausgestattet | 8 | 0 | |

6504000000 | Hüte und andere Kopfbedeckungen, geflochten oder durch Verbindung von Streifen aus Stoffen aller Art hergestellt, auch ausgestattet | 8 | 0 | |

6505100000 | Haarnetze | 8 | 0 | |

6505901010 | aus synthetischen Chemiefasern | 8 | 0 | |

6505901090 | aus anderen Fasern | 8 | 0 | |

6505902010 | Sportkappen | 8 | 0 | |

6505902020 | Baskenmützen | 8 | 0 | |

6505902090 | andere | 8 | 0 | |

6505909000 | andere | 8 | 0 | |

6506100000 | Sicherheitskopfbedeckungen | 8 | 0 | |

6506910000 | aus Kautschuk oder Kunststoff | 8 | 0 | |

6506991000 | aus Leder | 8 | 0 | |

6506992000 | aus Metall | 8 | 0 | |

6506999000 | andere | 8 | 0 | |

6507000000 | Bänder zur Innenausrüstung, Innenfutter, Bezüge, Gestelle, Schirme und Kinnbänder, für Kopfbedeckungen | 8 | 0 | |

6601100000 | Gartenschirme und ähnliche Waren | 13 | 0 | |

6601910000 | Taschenschirme | 13 | 0 | |

6601991000 | Stockschirme | 13 | 0 | |

6601992000 | Sonnenschirme | 13 | 0 | |

6601999000 | andere | 13 | 0 | |

6602001000 | Gehstöcke | 8 | 0 | |

6602002000 | Sitzstöcke | 8 | 0 | |

6602003000 | Peitschen, Reitpeitschen | 8 | 0 | |

6602009000 | andere | 8 | 0 | |

6603200000 | Schirmgestelle, zusammengesetzt, auch mit Unterstock oder Griffstock | 13 | 0 | |

6603900000 | andere | 13 | 0 | |

6701000000 | Vogelbälge und andere Vogelteile mit ihren Federn oder Daunen, Federn, Teile von Federn, Daunen und Waren daraus (ausgenommen Waren der Position 0505 und bearbeitete Federspulen und -kiele) | 8 | 0 | |

6702100000 | aus Kunststoff | 8 | 0 | |

6702901000 | aus Webwaren | 8 | 0 | |

6702902000 | aus Papier | 8 | 0 | |

6702909000 | andere | 8 | 0 | |

6703001010 | gewaschen, gleichgerichtet, gedünnt | 8 | 0 | |

6703001090 | andere | 8 | 0 | |

6703009000 | andere | 8 | 0 | |

6704110000 | vollständige Perücken | 8 | 0 | |

6704191000 | Teilperücken | 8 | 0 | |

6704192000 | falsche Bärte | 8 | 0 | |

6704193000 | falsche Augenbrauen | 8 | 0 | |

6704194000 | falsche Wimpern | 8 | 0 | |

6704199000 | andere | 8 | 0 | |

6704201000 | vollständige Perücken | 8 | 0 | |

6704202000 | Teilperücken | 8 | 0 | |

6704203000 | falsche Bärte | 8 | 0 | |

6704204000 | falsche Augenbrauen | 8 | 0 | |

6704205000 | falsche Wimpern | 8 | 0 | |

6704209000 | andere | 8 | 0 | |

6704900000 | aus anderen Stoffen | 8 | 0 | |

6801000000 | Pflastersteine, Randsteine und Pflasterplatten, aus Naturstein (ausgenommen Schiefer) | 8 | 0 | |

6802100000 | Fliesen, Würfel und dergleichen, auch in anderer als quadratischer oder rechteckiger Form, deren größte Fläche in ein Quadrat mit einer Seitenlänge von weniger als 7 cm eingeschlossen werden kann; Körnungen, Splitter und Mehl, künstlich gefärbt | 8 | 3 | |

6802211000 | Marmor | 8 | 5 | |

6802212000 | Travertin | 8 | 0 | |

6802213000 | Alabaster | 8 | 0 | |

6802230000 | Granit | 8 | 5 | |

6802291000 | andere Kalksteine | 8 | 0 | |

6802299000 | andere | 8 | 5 | |

6802911000 | Marmor | 8 | 5 | |

6802912000 | Travertin | 8 | 0 | |

6802913000 | Alabaster | 8 | 0 | |

6802920000 | andere Kalksteine | 8 | 0 | |

6802930000 | Granit | 8 | 5 | |

6802990000 | andere Steine | 8 | 5 | |

6803001000 | Tuschereibstein | 8 | 5 | |

6803009000 | andere | 8 | 5 | |

6804100000 | Mühlsteine und Steine zum Mahlen, Zerfasern oder Brechen | 8 | 0 | |

6804210000 | aus agglomerierten synthetischen oder natürlichen Diamanten | 8 | 0 | |

6804220000 | aus anderen agglomerierten Schleifstoffen oder keramisch hergestellt | 8 | 3 | |

6804230000 | aus Naturstein | 8 | 0 | |

6804300000 | Wetz- oder Poliersteine zum Handgebrauch | 8 | 0 | |

6805100000 | nur auf einer Unterlage aus Gewebe aus Spinnstoffen | 8 | 0 | |

6805200000 | nur auf einer Unterlage aus Papier oder Pappe | 8 | 0 | |

6805300000 | auf einer Unterlage aus anderen Stoffen | 8 | 0 | |

6806101000 | Hüttenwolle/Schlackenwolle | 8 | 0 | |

6806102000 | Steinwolle | 8 | 3 | |

6806103000 | Keramikfaser | 8 | 0 | |

6806109000 | andere | 8 | 0 | |

6806201000 | geblähter Vermiculit | 8 | 5 | |

6806202000 | geblähter Ton | 8 | 0 | |

6806204000 | geblähter Perlit | 8 | 0 | |

6806209000 | andere | 8 | 0 | |

6806901000 | feuerfestes Material | 8 | 0 | |

6806909000 | andere | 8 | 3 | |

6807100000 | in Rollen | 8 | 0 | |

6807900000 | andere | 8 | 0 | |

6808000000 | Platten, Dielen, Fliesen, Blöcke und dergleichen, aus Pflanzenfasern, Stroh oder aus Holzspänen, -schnitzeln, -fasern, Sägemehl oder anderen Holzabfällen, mit Zement, Gips oder anderen mineralischen Bindemitteln hergestellt | 8 | 0 | |

6809110000 | nur mit Papier oder Pappe überzogen oder verstärkt | 8 | 0 | |

6809190000 | andere | 8 | 0 | |

6809900000 | andere | 8 | 0 | |

6810111000 | Blöcke | 8 | 0 | |

6810112000 | Mauersteine | 8 | 0 | |

6810191000 | Fliesen | 8 | 0 | |

6810192000 | Platten | 8 | 0 | |

6810193000 | Dachsteine | 8 | 0 | |

6810199000 | andere | 8 | 0 | |

6810910000 | vorgefertigte Bauelemente | 8 | 0 | |

6810991000 | Balken und Träger | 8 | 0 | |

6810992000 | Pfähle | 8 | 0 | |

6810993000 | Oberleitungsmasten | 8 | 0 | |

6810994000 | Eisenbahnschwellen | 8 | 0 | |

6810995000 | Rohre | 8 | 0 | |

6810999000 | andere | 8 | 0 | |

6811401010 | für Dächer, Decken, Wände oder Fußböden | 8 | 0 | |

6811401090 | andere | 8 | 0 | |

6811402010 | für Dächer, Decken, Wände oder Fußböden | 8 | 0 | |

6811402090 | andere | 8 | 0 | |

6811403000 | Rohre, Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

6811409010 | für Dächer, Decken, Wände oder Fußböden | 8 | 0 | |

6811409090 | andere | 8 | 0 | |

6811810000 | Wellplatten | 8 | 0 | |

6811820000 | andere Platten, Tafeln, Fliesen, Ziegel und dergleichen | 8 | 0 | |

6811830000 | Rohre, Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

6811890000 | andere | 8 | 0 | |

6812801000 | Kleidung, Bekleidungszubehör, Schuhe und Kopfbedeckungen | 8 | 0 | |

6812802000 | Papier, Pappe und Filz | 8 | 0 | |

6812803000 | Dichtungsmaterial aus zusammengepressten Asbestfasern und Elastomeren, in Platten oder Rollen | 8 | 0 | |

6812809000 | andere | 8 | 0 | |

6812910000 | Kleidung, Bekleidungszubehör, Schuhe und Kopfbedeckungen | 8 | 0 | |

6812920000 | Papier, Pappe und Filz | 8 | 0 | |

6812930000 | Dichtungsmaterial aus zusammengepressten Asbestfasern und Elastomeren, in Platten oder Rollen | 8 | 0 | |

6812990000 | andere | 8 | 0 | |

6813201010 | für Kraftfahrzeuge | 8 | 0 | |

6813201090 | andere | 8 | 0 | |

6813202010 | für Kraftfahrzeuge | 8 | 0 | |

6813202090 | andere | 8 | 0 | |

6813209010 | für Kraftfahrzeuge | 8 | 3 | |

6813209090 | andere | 8 | 3 | |

6813810000 | Bremsbeläge und Bremsklötze | 8 | 0 | |

6813891000 | Kupplungsbeläge | 8 | 0 | |

6813899000 | andere | 8 | 3 | |

6814100000 | Platten, Blätter oder Streifen aus agglomeriertem oder rekonstituiertem Glimmer, auch auf Unterlagen | 8 | 0 | |

6814900000 | andere | 8 | 0 | |

6815101000 | Waren aus Grafit, nicht für elektrotechnische Zwecke | 8 | 0 | |

6815102000 | Kohlenstofffasern | 8 | 0 | |

6815109000 | andere | 8 | 0 | |

6815200000 | Waren aus Torf | 8 | 0 | |

6815910000 | Magnesit, Dolomit oder Chromit enthaltend | 8 | 0 | |

6815990000 | andere | 8 | 5 | |

6901001000 | Steine | 8 | 0 | |

6901002000 | Blöcke | 8 | 0 | |

6901003000 | Fliesen | 8 | 0 | |

6901009010 | Platten und Tafeln | 8 | 0 | |

6901009090 | andere | 8 | 0 | |

6902100000 | mit einem Gehalt der Elemente Mg, Ca oder Cr, berechnet als MgO, CaO oder Cr2O3, einzeln oder gemeinsam, von mehr als 50 GHT | 8 | 5 | |

6902200000 | mit einem Gehalt an Tonerde (Al2O3), an Kieselsäure (SiO2) oder einer Mischung oder Verbindung dieser Erzeugnisse von mehr als 50 GHT | 8 | 5 | |

6902901000 | auf der Grundlage von Siliciumcarbid oder Zirkon | 8 | 0 | |

6902909000 | andere | 8 | 5 | |

6903101000 | Retorten | 8 | 0 | |

6903102010 | für Öfen zur Herstellung von Halbleiterscheiben (wafers) | 3 | 0 | |

6903102090 | andere | 8 | 0 | |

6903103000 | Reaktionsgefäße | 8 | 0 | |

6903104000 | Muffeln | 8 | 0 | |

6903105000 | Ausgüsse | 8 | 0 | |

6903106000 | Stopfen | 8 | 0 | |

6903107000 | Rohre | 8 | 0 | |

6903108000 | Stangen und Stäbe | 8 | 0 | |

6903109000 | andere | 8 | 3 | |

6903201000 | Retorten | 8 | 0 | |

6903202000 | Schmelztiegel | 8 | 0 | |

6903203000 | Reaktorsgefäße | 8 | 0 | |

6903204000 | Muffeln | 8 | 0 | |

6903205000 | Ausgüsse | 8 | 0 | |

6903206000 | Stopfen | 8 | 0 | |

6903207000 | Rohre | 8 | 0 | |

6903208000 | Stangen und Stäbe | 8 | 0 | |

6903209000 | andere | 8 | 0 | |

6903901000 | auf der Grundlage von Siliciumcarbid oder Zirkon | 8 | 0 | |

6903909010 | Retorten | 8 | 0 | |

6903909020 | Schmelztiegel | 8 | 0 | |

6903909030 | Reaktionsgefäße | 8 | 0 | |

6903909040 | Muffeln | 8 | 0 | |

6903909050 | Ausgüsse | 8 | 0 | |

6903909060 | Stopfen | 8 | 0 | |

6903909070 | Rohre | 8 | 0 | |

6903909080 | Stangen und Stäbe | 8 | 0 | |

6903909090 | andere | 8 | 5 | |

6904100000 | Mauerziegel | 8 | 0 | |

6904900000 | andere | 8 | 0 | |

6905100000 | Dachziegel | 8 | 0 | |

6905901000 | Schornsteinteile, Elemente für Rauchfänge und Rauchleitungen | 8 | 0 | |

6905902000 | Bauzierrate | 8 | 0 | |

6905909000 | andere | 8 | 0 | |

6906001000 | Rohre, Rohrleitungen und Rinnen | 8 | 0 | |

6906002000 | Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

6907101000 | aus Porzellan | 8 | 0 | |

6907109000 | andere | 8 | 0 | |

6907901000 | aus Porzellan | 8 | 0 | |

6907909000 | andere | 8 | 0 | |

6908101000 | aus Porzellan | 8 | 0 | |

6908109000 | andere | 8 | 3 | |

6908901000 | aus Porzellan | 8 | 5 | |

6908909000 | andere | 8 | 5 | |

6909110000 | aus Porzellan | 8 | 0 | |

6909120000 | Waren mit einer Mohsschen Härte von 9 oder mehr | 8 | 0 | |

6909190000 | andere | 8 | 0 | |

6909900000 | andere | 8 | 0 | |

6910101000 | Waschbecken | 8 | 0 | |

6910102000 | Badewannen | 8 | 0 | |

6910103000 | Klosettbecken | 8 | 0 | |

6910104000 | Urinierbecken | 8 | 0 | |

6910109000 | andere | 8 | 3 | |

6910900000 | andere | 8 | 3 | |

6911101000 | Kaffee- oder Teeservice | 8 | 5 | |

6911102000 | Schalen und Schüsseln | 8 | 3 | |

6911109000 | andere | 8 | 0 | |

6911901000 | Haushalts- oder Hauswirtschaftsartikel | 8 | 0 | |

6911902000 | Hygiene- oder Toilettengegenstände | 8 | 0 | |

6911909000 | andere | 8 | 0 | |

6912001010 | Kaffee- oder Teeservice | 8 | 3 | |

6912001020 | Schalen und Schüsseln | 8 | 3 | |

6912001090 | andere | 8 | 5 | |

6912002000 | Haushalts- oder Hauswirtschaftsartikel | 8 | 0 | |

6912003000 | Hygiene- oder Toilettengegenstände | 8 | 0 | |

6912009000 | andere | 8 | 0 | |

6913101000 | Statuen, Statuetten und Büsten | 8 | 0 | |

6913109020 | Ziergegenstände | 8 | 0 | |

6913109090 | andere | 8 | 0 | |

6913901000 | Statuen, Statuetten und Büsten | 8 | 0 | |

6913909020 | Ziergegenstände | 8 | 0 | |

6913909090 | andere | 8 | 3 | |

6914101000 | Blumentöpfe | 8 | 0 | |

6914109000 | andere | 8 | 0 | |

6914901000 | Blumentöpfe | 8 | 0 | |

6914909000 | andere | 8 | 0 | |

7001001000 | Glasmasse | 5 | 0 | |

7001002000 | Abfälle und Scherben von Glas, Bruchglas | 3 | 0 | |

7002100000 | Kugeln | 8 | 0 | |

7002201000 | zur Herstellung von Quarzgut für Halbleiter | 3 | 0 | |

7002209000 | andere | 8 | 0 | |

7002311000 | zur Herstellung von Quarzgut für Halbleiter | 3 | 3 | |

7002319000 | andere | 8 | 3 | |

7002320000 | aus anderem Glas, mit einem linearen Ausdehnungskoeffizienten von 5 × 10-6 oder weniger je Kelvin in einem Temperaturbereich von 0 °C bis 300 °C | 8 | 0 | |

7002390000 | andere | 8 | 0 | |

7003121000 | mit einer Dicke von 2 mm oder weniger | 8 | 0 | |

7003122000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7003123000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7003124000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7003125000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7003126000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7003127000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7003191000 | mit einer Dicke von 2 mm oder weniger | 8 | 0 | |

7003192000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7003193000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7003194000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7003195000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7003196000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7003197000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7003200000 | Platten oder Tafeln, mit Drahteinlagen oder dergleichen verstärkt | 8 | 0 | |

7003300000 | Profile | 8 | 0 | |

7004201000 | mit einer Dicke von 2 mm oder weniger | 8 | 0 | |

7004202000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7004203000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7004204000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7004205000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7004206000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7004207000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7004901000 | mit einer Dicke von 2 mm oder weniger | 8 | 0 | |

7004902000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7004903000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7004904000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7004905000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7004906000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7004907000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7005101000 | mit einer Dicke von 2 mm oder weniger | 8 | 3 | |

7005102000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7005103000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7005104000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7005105000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7005106000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7005107000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7005211000 | mit einer Dicke von 2 mm oder weniger | 8 | 0 | |

7005212000 | mit einer Dicke von mehr als 2 mm bis 3 mm | 8 | 0 | |

7005213000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 0 | |

7005214000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 0 | |

7005215000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 0 | |

7005216000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7005217000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7005291010 | für Plasmaanzeigen (PDP) | 4 | 0 | |

7005291020 | für leere Masken, die zur Herstellung von Halbleitern oder von Flachbildschirmen (FPD) verwendet werden | 3 | 0 | |

7005291030 | für organische Leuchtdioden (OLED) | 4 | 0 | |

7005291090 | andere | 8 | 0 | |

7005292010 | für Plasmaanzeigen (PDP) | 4 | 0 | |

7005292020 | für leere Masken, die zur Herstellung von Halbleitern oder von Flachbildschirmen (FPD) verwendet werden | 3 | 0 | |

7005292030 | für organische Leuchtdioden (OLED) | 4 | 0 | |

7005292090 | andere | 8 | 0 | |

7005293000 | mit einer Dicke von mehr als 3 mm bis 4 mm | 8 | 3 | |

7005294000 | mit einer Dicke von mehr als 4 mm bis 5 mm | 8 | 3 | |

7005295000 | mit einer Dicke von mehr als 5 mm bis 6 mm | 8 | 3 | |

7005296000 | mit einer Dicke von mehr als 6 mm bis 8 mm | 8 | 0 | |

7005297000 | mit einer Dicke von mehr als 8 mm | 8 | 0 | |

7005300000 | mit Drahteinlagen oder dergleichen verstärkt | 8 | 0 | |

7006001000 | für Plasmaanzeigen (PDP) | 4 | 5 | |

7006002000 | für leere Masken, die zur Herstellung von Halbleitern oder von Flachbildschirmen (FPD) verwendet werden | 3 | 5 | |

7006003000 | für organische Leuchtdioden (OLED) | 4 | 5 | |

7006009000 | andere | 8 | 5 | |

7007110000 | in Abmessungen und Formen von der in Kraftfahrzeugen, Luftfahrzeugen, Wasserfahrzeugen oder anderen Fahrzeugen verwendeten Art | 8 | 0 | |

7007190000 | andere | 8 | 0 | |

7007210000 | in Abmessungen und Formen von der in Kraftfahrzeugen, Luftfahrzeugen, Wasserfahrzeugen oder anderen Fahrzeugen verwendeten Art | 8 | 0 | |

7007290000 | andere | 8 | 0 | |

7008000000 | mehrschichtige Isolierverglasungen | 8 | 0 | |

7009100000 | Rückspiegel für Fahrzeuge | 8 | 0 | |

7009910000 | nicht gerahmt | 8 | 0 | |

7009920000 | gerahmt | 8 | 0 | |

7010100000 | Ampullen | 8 | 0 | |

7010200000 | Stopfen, Deckel und andere Verschlüsse | 8 | 0 | |

7010900000 | andere | 8 | 0 | |

7011100000 | für elektrische Beleuchtung | 8 | 0 | |

7011201000 | farbig | 8 | 0 | |

7011209000 | andere | 8 | 0 | |

7011900000 | andere | 8 | 0 | |

7013100000 | aus Glaskeramik | 8 | 0 | |

7013220000 | aus Bleikristall | 8 | 0 | |

7013280000 | andere | 8 | 5 | |

7013330000 | aus Bleikristall | 8 | 0 | |

7013370000 | andere | 8 | 5 | |

7013410000 | aus Bleikristall | 8 | 0 | |

7013420000 | aus anderem Glas, mit einem linearen Ausdehnungskoeffizienten von 5 × 10-6 oder weniger je Kelvin in einem Temperaturbereich von 0 °C bis 300 °C | 8 | 0 | |

7013490000 | andere | 8 | 5 | |

7013910000 | aus Bleikristall | 8 | 0 | |

7013990000 | andere | 8 | 0 | |

7014001000 | für innenverspiegelte Scheinwerferlampen | 8 | 0 | |

7014009010 | Glaswaren für Signalvorrichtungen | 8 | 0 | |

7014009020 | optische Elemente aus Glas | 8 | 5 | |

7015100000 | Gläser für medizinische Brillen | 8 | 0 | |

7015901000 | für Sonnenbrillen | 8 | 0 | |

7015902000 | Gläser für Uhren und ähnliche Gläser | 8 | 0 | |

7015909000 | andere | 8 | 0 | |

7016100000 | Glaswürfel und andere Glaskurzwaren, auch auf Unterlagen, für Mosaike oder zu ähnlichen Zierzwecken | 8 | 0 | |

7016901000 | Bausteine, Platten, Fliesen, Dachziegel und andere Waren, aus gepresstem oder geformtem Glas, auch mit Drahteinlagen oder dergleichen verstärkt, zu Bauzwecken | 8 | 0 | |

7016909010 | Kunstverglasungen | 8 | 0 | |

7016909020 | Buntglas | 8 | 0 | |

7016909090 | andere | 8 | 0 | |

7017100000 | aus geschmolzenem Quarz oder anderem geschmolzenen Siliciumdioxid | 8 | 0 | |

7017200000 | aus anderem Glas, mit einem linearen Ausdehnungskoeffizienten von 5 × 10-6 oder weniger je Kelvin in einem Temperaturbereich von 0 °C bis 300 °C | 8 | 0 | |

7017900000 | andere | 8 | 0 | |

7018101000 | Perlen | 8 | 0 | |

7018102000 | Nachahmungen von Perlen | 8 | 0 | |

7018103000 | Nachahmungen von Edelsteinen und Schmucksteinen | 8 | 0 | |

7018104000 | Nachahmungen von Korallen | 8 | 0 | |

7018109000 | andere | 8 | 0 | |

7018200000 | Mikrokugeln aus Glas, mit einem Durchmesser von 1 mm oder weniger | 8 | 0 | |

7018901000 | Glasaugen, ausgenommen Prothesen | 8 | 0 | |

7018909000 | andere | 8 | 0 | |

7019110000 | Stapelfasern mit einer Länge von 50 mm oder weniger (chopped strands) | 8 | 0 | |

7019120000 | Glasseidenstränge (Rovings) | 8 | 0 | |

7019190000 | andere | 8 | 3 | |

7019310000 | Matten | 8 | 0 | |

7019320000 | Vliese | 8 | 0 | |

7019390000 | andere | 8 | 0 | |

7019400000 | Gewebe aus Glasseidensträngen (Rovings) | 8 | 0 | |

7019510000 | mit einer Breite von 30 cm oder weniger | 8 | 3 | |

7019520000 | mit einer Breite von mehr als 30 cm, in Leinwandbindung, mit einem Quadratmetergewicht von weniger als 250 g, aus Filamenten mit einem Titer des einfachen Garns von 136 tex oder weniger | 8 | 0 | |

7019590000 | andere | 8 | 3 | |

7019901000 | Glaswolle | 8 | 3 | |

7019909000 | andere | 8 | 0 | |

7020001011 | Reagenzröhren und Halterungen aus Quarz zur Verwendung in Diffusions- und Oxidationsöfen bei der Herstellung von Halbleiterscheiben (wafers) | 0 | 0 | |

7020001012 | Quarzschmelztiegel zur Herstellung von Halbleiterscheiben (wafers) | 3 | 0 | |

7020001013 | zur Herstellung von Quarzgut für Halbleiter | 3 | 0 | |

7020001019 | andere | 8 | 0 | |

7020001090 | andere | 8 | 0 | |

7020009000 | andere | 8 | 0 | |

7101101000 | roh | 8 | 0 | |

7101102000 | bearbeitet | 8 | 0 | |

7101210000 | roh | 8 | 0 | |

7101220000 | bearbeitet | 8 | 0 | |

7102100000 | nicht sortiert | 1 | 0 | |

7102210000 | roh oder nur gesägt, gespalten oder rau geschliffen | 1 | 0 | |

7102290000 | andere | 5 | 0 | |

7102310000 | roh oder nur gesägt, gespalten oder rau geschliffen | 1 | 0 | |

7102390000 | andere | 5 | 0 | |

7103100000 | roh oder nur gesägt oder grob geformt | 1 | 0 | |

7103911000 | Industrieedelsteine | 5 | 0 | |

7103919010 | Rubine | 5 | 0 | |

7103919020 | Saphire | 5 | 0 | |

7103919030 | Smaragde | 5 | 0 | |

7103991000 | Industrieedelsteine | 5 | 0 | |

7103999010 | Opal | 5 | 0 | |

7103999020 | Jade | 5 | 0 | |

7103999030 | Chalzedon | 5 | 0 | |

7103999040 | Bergkristall | 5 | 0 | |

7103999090 | andere | 5 | 0 | |

7104100000 | piezoelektrischer Quarz | 5 | 0 | |

7104201000 | Diamanten | 5 | 0 | |

7104209000 | andere | 5 | 0 | |

7104901010 | Diamanten | 5 | 0 | |

7104901020 | synthetischer Quarz | 5 | 0 | |

7104901090 | andere | 5 | 0 | |

7104909010 | Diamanten | 5 | 0 | |

7104909090 | andere | 5 | 0 | |

7105101000 | natürliche | 5 | 0 | |

7105102000 | synthetische | 5 | 0 | |

7105901000 | von Granat | 5 | 0 | |

7105909000 | andere | 5 | 0 | |

7106100000 | Pulver | 3 | 0 | |

7106911000 | 99,99 GHT oder mehr Silber enthaltend | 3 | 0 | |

7106919000 | andere | 3 | 0 | |

7106921000 | Stäbe und Profile | 3 | 0 | |

7106922000 | Bleche und Bänder | 3 | 0 | |

7106923000 | Drähte | 3 | 0 | |

7106929000 | andere | 3 | 0 | |

7107001000 | Stäbe und Profile | 3 | 0 | |

7107002000 | Bleche und Bänder | 3 | 0 | |

7107003000 | Drähte | 3 | 0 | |

7107004000 | Rohre und Hohlstäbe | 3 | 0 | |

7107009000 | andere | 3 | 0 | |

7108110000 | Pulver | 3 | 0 | |

7108121000 | Klumpen, Knüppel und Körner | 3 | 0 | |

7108129000 | andere | 3 | 0 | |

7108131010 | zur Verwendung bei der Herstellung von Halbleitern | 3 | 0 | |

7108131090 | andere | 3 | 0 | |

7108139010 | Stäbe und Profile | 3 | 0 | |

7108139020 | Bleche und Bänder | 3 | 0 | |

7108139090 | andere | 3 | 0 | |

7108200000 | zu monetären Zwecken | 0 | 0 | |

7109000000 | Goldplattierungen auf unedlen Metallen oder auf Silber, in Rohform oder als Halbzeug | 3 | 0 | |

7110110000 | in Rohform oder als Pulver | 3 | 0 | |

7110190000 | andere | 3 | 0 | |

7110210000 | in Rohform oder als Pulver | 3 | 0 | |

7110290000 | andere | 3 | 0 | |

7110310000 | in Rohform oder als Pulver | 3 | 0 | |

7110390000 | andere | 3 | 0 | |

7110410000 | in Rohform oder als Pulver | 3 | 0 | |

7110490000 | andere | 3 | 0 | |

7111000000 | Platinplattierungen auf unedlen Metallen, auf Silber oder auf Gold, in Rohform oder als Halbzeug | 3 | 0 | |

7112300000 | Aschen, Edelmetalle oder Edelmetallverbindungen enthaltend | 2 | 0 | |

7112911000 | von Rückständen | 2 | 0 | |

7112919000 | andere | 3 | 0 | |

7112921000 | von Rückständen | 2 | 0 | |

7112929000 | andere | 3 | 0 | |

7112991000 | von Rückständen | 2 | 0 | |

7112992000 | von Abfällen, Schnitzeln und Bruch von Kunststoffen | 6,5 | 0 | |

7112999000 | andere | 3 | 0 | |

7113110000 | aus Silber, auch mit anderen Edelmetallen überzogen oder plattiert | 8 | 5 | |

7113191000 | aus Platin | 8 | 3 | |

7113192000 | aus Gold | 8 | 5 | |

7113199000 | andere | 8 | 5 | |

7113201000 | Platinplattierung | 8 | 0 | |

7113202000 | Goldplattierung | 8 | 3 | |

7113203000 | Silberplattierung | 8 | 3 | |

7113209000 | andere | 8 | 0 | |

7114111000 | zur Verwendung bei Tisch | 8 | 0 | |

7114112000 | zur Verwendung bei der Toilette | 8 | 0 | |

7114113000 | zur Verwendung im Büro oder auf dem Schreibtisch | 8 | 0 | |

7114114000 | zur Verwendung durch Raucher | 8 | 0 | |

7114119000 | andere | 8 | 0 | |

7114191000 | zur Verwendung bei Tisch | 8 | 0 | |

7114192000 | zur Verwendung bei der Toilette | 8 | 0 | |

7114193000 | zur Verwendung im Büro oder auf dem Schreibtisch | 8 | 0 | |

7114194000 | zur Verwendung durch Raucher | 8 | 0 | |

7114199000 | andere | 8 | 0 | |

7114201000 | zur Verwendung bei Tisch | 8 | 0 | |

7114202000 | zur Verwendung bei der Toilette | 8 | 0 | |

7114203000 | zur Verwendung im Büro oder auf dem Schreibtisch | 8 | 0 | |

7114204000 | zur Verwendung durch Raucher | 8 | 0 | |

7114209000 | andere | 8 | 0 | |

7115100000 | Katalysatoren in Form von Geweben oder Gittern, aus Platin | 8 | 0 | |

7115901010 | Platintiegel | 8 | 0 | |

7115901090 | andere | 8 | 0 | |

7115909010 | aus Gold, einschließlich mit Gold plattierte Metalle | 8 | 0 | |

7115909020 | aus Silber, einschließlich mit Silber plattierte Metalle | 8 | 0 | |

7115909090 | andere | 8 | 0 | |

7116101000 | aus echten Perlen | 8 | 0 | |

7116102000 | aus Zuchtperlen | 8 | 0 | |

7116201000 | Industrieedelsteine | 8 | 0 | |

7116209010 | als Schmuck dienend | 8 | 0 | |

7116209090 | andere | 8 | 0 | |

7117110000 | Manschettenknöpfe und ähnliche Knöpfe | 8 | 0 | |

7117191000 | Halsketten | 8 | 0 | |

7117192000 | Armbänder | 8 | 0 | |

7117193000 | Ohrringe | 8 | 0 | |

7117194000 | Broschen | 8 | 0 | |

7117195000 | Ringe | 8 | 0 | |

7117196000 | Ketten, als Schmuck dienend | 8 | 0 | |

7117199000 | andere | 8 | 0 | |

7117900000 | andere | 8 | 0 | |

7118100000 | Münzen (ausgenommen Goldmünzen), ausgenommen gesetzliche Zahlungsmittel | 0 | 0 | |

7118901000 | Goldmünzen | 0 | 0 | |

7118902000 | Silbermünzen | 0 | 0 | |

7118909000 | andere | 0 | 0 | |

7201101000 | zum Gießen | 0 | 0 | |

7201102000 | zur Herstellung von Stahl | 0 | 0 | |

7201109000 | andere | 0 | 0 | |

7201200000 | Roheisen, nicht legiert, mit einem Phosphorgehalt von mehr als 0,5 GHT | 0 | 0 | |

7201501000 | Roheisen, legiert | 2 | 0 | |

7201502000 | Spiegeleisen | 2 | 0 | |

7202110000 | mit einem Kohlenstoffgehalt von mehr als 2 GHT | 5 | 0 | |

7202190000 | andere | 5 | 0 | |

7202210000 | mit einem Siliciumgehalt von mehr als 55 GHT | 3 | 0 | |

7202291000 | mit einem Magnesiumgehalt von 2 GHT oder mehr | 3 | 0 | |

7202299000 | andere | 3 | 0 | |

7202300000 | Ferrosiliciummangan | 5 | 0 | |

7202410000 | mit einem Kohlenstoffgehalt von mehr als 4 GHT | 3 | 0 | |

7202490000 | andere | 3 | 0 | |

7202500000 | Ferrosiliciumchrom | 3 | 0 | |

7202600000 | Ferronickel | 3 | 0 | |

7202700000 | Ferromolybdän | 3 | 0 | |

7202800000 | Ferrowolfram und Ferrosiliciumwolfram | 3 | 0 | |

7202910000 | Ferrotitan und Ferrosiliciumtitan | 3 | 0 | |

7202920000 | Ferrovanadium | 3 | 0 | |

7202930000 | Ferroniob | 3 | 0 | |

7202991000 | Ferrophosphor (Eisenphosphid) mit einem Phosphorgehalt von 15 GHT oder mehr | 3 | 0 | |

7202999000 | andere | 3 | 0 | |

7203100000 | durch Direktreduktion aus Eisenerzen hergestellte Eisenerzeugnisse | 0 | 0 | |

7203900000 | andere | 1 | 0 | |

7204100000 | Abfälle und Schrott, aus Gusseisen | 0 | 0 | |

7204210000 | aus nicht rostendem Stahl | 0 | 0 | |

7204290000 | andere | 0 | 0 | |

7204300000 | Abfälle und Schrott aus verzinntem Eisen oder Stahl | 0 | 0 | |

7204410000 | Drehspäne, Frässpäne, Hobelspäne, Schleifspäne, Sägespäne, Feilspäne und Stanz- oder Schneidabfälle, auch paketiert | 0 | 0 | |

7204490000 | andere | 0 | 0 | |

7204500000 | Abfallblöcke | 0 | 0 | |

7205101000 | Schrot | 5 | 0 | |

7205102000 | Gries | 5 | 0 | |

7205109000 | andere | 5 | 0 | |

7205210000 | aus legiertem Stahl | 5 | 0 | |

7205290000 | andere | 5 | 0 | |

7206100000 | Rohblöcke (Ingots) | 0 | 0 | |

7206900000 | andere | 0 | 0 | |

7207111000 | Vorblöcke | 0 | 0 | |

7207112000 | Knüppel | 0 | 0 | |

7207121000 | Brammen | 0 | 0 | |

7207122000 | Platinen | 0 | 0 | |

7207190000 | andere | 0 | 0 | |

7207201000 | Vorblöcke | 0 | 0 | |

7207202000 | Knüppel | 0 | 0 | |

7207203000 | Brammen | 0 | 0 | |

7207204000 | Platinen | 0 | 0 | |

7207209000 | andere | 0 | 0 | |

7208101000 | mit einer Dicke von 4,75 mm oder mehr | 0 | 0 | |

7208109000 | mit einer Dicke von weniger als 4,75 mm | 0 | 0 | |

7208251000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208259000 | andere | 0 | 0 | |

7208261000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208269000 | andere | 0 | 0 | |

7208271000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208279000 | andere | 0 | 0 | |

7208361000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208369000 | andere | 0 | 0 | |

7208371000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208379000 | andere | 0 | 0 | |

7208381000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208389000 | andere | 0 | 0 | |

7208391000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208399000 | andere | 0 | 0 | |

7208400000 | nicht in Rollen (Coils), nur warmgewalzt, mit Oberflächenmuster | 0 | 0 | |

7208511000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208519000 | andere | 0 | 0 | |

7208521000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208529000 | andere | 0 | 0 | |

7208531000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208539000 | andere | 0 | 0 | |

7208541000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7208549000 | andere | 0 | 0 | |

7208900000 | andere | 0 | 0 | |

7209151000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209159000 | andere | 0 | 0 | |

7209161000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209169000 | andere | 0 | 0 | |

7209171000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209179000 | andere | 0 | 0 | |

7209181000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209189000 | andere | 0 | 0 | |

7209251000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209259000 | andere | 0 | 0 | |

7209261000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209269000 | andere | 0 | 0 | |

7209271000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209279000 | andere | 0 | 0 | |

7209281000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7209289000 | andere | 0 | 0 | |

7209900000 | andere | 0 | 0 | |

7210110000 | mit einer Dicke von 0,5 mm oder mehr | 0 | 0 | |

7210120000 | mit einer Dicke von weniger als 0,5 mm | 0 | 0 | |

7210200000 | verbleit, einschließlich Terneblech oder -band | 0 | 0 | |

7210301000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7210309000 | andere | 0 | 0 | |

7210410000 | gewellt | 0 | 0 | |

7210491010 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7210491090 | andere | 0 | 0 | |

7210499010 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7210499090 | andere | 0 | 0 | |

7210500000 | mit Chromoxiden oder mit Chrom und Chromoxiden überzogen | 0 | 0 | |

7210610000 | mit Aluminium-Zink-Legierungen überzogen | 0 | 0 | |

7210690000 | andere | 0 | 0 | |

7210700000 | mit Farbe versehen, lackiert oder mit Kunststoff überzogen | 0 | 0 | |

7210901000 | vernickelt | 0 | 0 | |

7210902000 | verkupfert | 0 | 0 | |

7210909000 | andere | 0 | 0 | |

7211130000 | auf vier Flächen oder in geschlossenen Kalibern gewalzt, mit einer Breite von mehr als 150 mm und einer Dicke von 4 mm oder mehr, nicht in Rollen (Coils), ohne Oberflächenmuster | 0 | 0 | |

7211141000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7211149000 | andere | 0 | 0 | |

7211191000 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7211199000 | andere | 0 | 0 | |

7211231000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7211239000 | andere | 0 | 0 | |

7211291000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7211299000 | andere | 0 | 0 | |

7211901000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7211909000 | andere | 0 | 0 | |

7212101000 | mit einer Dicke von 0,5 mm oder mehr | 0 | 0 | |

7212102000 | mit einer Dicke von weniger als 0,5 mm | 0 | 0 | |

7212201000 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7212209000 | andere | 0 | 0 | |

7212301010 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7212301090 | andere | 0 | 0 | |

7212309010 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7212309090 | andere | 0 | 0 | |

7212400000 | mit Farbe versehen, lackiert oder mit Kunststoff überzogen | 0 | 0 | |

7212501000 | vernickelt | 0 | 0 | |

7212502000 | verkupfert | 0 | 0 | |

7212509000 | andere | 0 | 0 | |

7212600000 | plattiert | 0 | 0 | |

7213100000 | mit vom Walzen herrührenden Einschnitten, Rippen (Wülsten), Vertiefungen oder Erhöhungen | 0 | 0 | |

7213200000 | anderer, aus Automatenstahl | 0 | 0 | |

7213911010 | mit einem Kohlenstoffgehalt von 0,25 GHT oder mehr | 0 | 0 | |

7213911090 | andere | 0 | 0 | |

7213919000 | andere | 0 | 0 | |

7213991010 | mit einem Kohlenstoffgehalt von mehr als 0,25 GHT | 0 | 0 | |

7213991090 | andere | 0 | 0 | |

7213999000 | andere | 0 | 0 | |

7214100000 | geschmiedet | 0 | 0 | |

7214201000 | Betonstahl | 0 | 0 | |

7214209000 | andere | 0 | 0 | |

7214300000 | anderer, aus Automatenstahl | 0 | 0 | |

7214910000 | mit rechteckigem (nicht quadratischem) Querschnitt | 0 | 0 | |

7214991000 | mit einem Kohlenstoffgehalt von weniger als 0,6 GHT | 0 | 0 | |

7214999000 | andere | 0 | 0 | |

7215100000 | aus Automatenstahl, nur kalthergestellt oder nur kaltfertiggestellt | 0 | 0 | |

7215500000 | anderer, nur kalthergestellt oder nur kaltfertiggestellt | 0 | 0 | |

7215900000 | andere | 0 | 0 | |

7216101000 | U-Profile | 0 | 0 | |

7216102000 | I-Profile | 0 | 0 | |

7216103000 | H-Profile | 0 | 0 | |

7216210000 | L-Profile | 0 | 0 | |

7216220000 | T-Profile | 0 | 0 | |

7216310000 | U-Profile | 0 | 0 | |

7216320000 | I-Profile | 0 | 0 | |

7216333000 | mit einer Höhe von weniger als 300 mm | 0 | 0 | |

7216334000 | mit einer Höhe von 300 mm und mehr bis 600 mm | 0 | 0 | |

7216335000 | mit einer Höhe von mehr als 600 mm | 0 | 0 | |

7216401000 | L-Profile | 0 | 0 | |

7216402000 | T-Profile | 0 | 0 | |

7216500000 | andere Profile, nur warmgewalzt, nur warmgezogen oder nur warmstranggepresst | 0 | 0 | |

7216610000 | aus flachgewalzten Erzeugnissen hergestellt | 0 | 0 | |

7216690000 | andere | 0 | 0 | |

7216910000 | aus flachgewalzten Erzeugnissen kalthergestellt oder kaltfertiggestellt | 0 | 0 | |

7216990000 | andere | 0 | 0 | |

7217100000 | nicht überzogen, auch poliert | 0 | 0 | |

7217200000 | verzinkt | 0 | 0 | |

7217301000 | verkupfert | 0 | 0 | |

7217309000 | andere | 0 | 0 | |

7217900000 | andere | 0 | 0 | |

7218101000 | Rohblöcke (Ingots) | 0 | 0 | |

7218109000 | andere | 0 | 0 | |

7218911000 | Brammen | 0 | 0 | |

7218912000 | Platinen | 0 | 0 | |

7218919000 | andere | 0 | 0 | |

7218991000 | Vorblöcke | 0 | 0 | |

7218992000 | Knüppel | 0 | 0 | |

7218999000 | andere | 0 | 0 | |

7219111000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219119000 | andere | 0 | 0 | |

7219121000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219129000 | andere | 0 | 0 | |

7219131000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219139000 | andere | 0 | 0 | |

7219141000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219149000 | andere | 0 | 0 | |

7219211000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219219000 | andere | 0 | 0 | |

7219221000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219229000 | andere | 0 | 0 | |

7219231000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219239000 | andere | 0 | 0 | |

7219241000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219249000 | andere | 0 | 0 | |

7219310000 | mit einer Dicke von 4,75 mm oder mehr | 0 | 0 | |

7219321000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219329000 | andere | 0 | 0 | |

7219331000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219339000 | andere | 0 | 0 | |

7219341000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219349000 | andere | 0 | 0 | |

7219351000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7219359000 | andere | 0 | 0 | |

7219900000 | andere | 0 | 0 | |

7220111000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7220119000 | andere | 0 | 0 | |

7220121000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7220129000 | andere | 0 | 0 | |

7220201000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7220209000 | andere | 0 | 0 | |

7220901000 | der Nickel-Reihe, Nickel enthaltend, auch andere Elemente enthaltend | 0 | 0 | |

7220909000 | andere | 0 | 0 | |

7221000000 | Walzdraht aus nicht rostendem Stahl | 0 | 0 | |

7222110000 | mit kreisförmigem Querschnitt | 0 | 0 | |

7222190000 | andere | 0 | 0 | |

7222200000 | Stabstahl, nur kalthergestellt oder nur kaltfertiggestellt | 0 | 0 | |

7222300000 | anderer Stabstahl | 0 | 0 | |

7222400000 | Profile | 0 | 0 | |

7223000000 | Draht aus nicht rostendem Stahl | 0 | 0 | |

7224101000 | Rohblöcke (Ingots) | 0 | 0 | |

7224109000 | andere | 0 | 0 | |

7224901000 | Vorblöcke | 0 | 0 | |

7224902000 | Knüppel | 0 | 0 | |

7224903000 | Brammen | 0 | 0 | |

7224904000 | Platinen | 0 | 0 | |

7224909000 | andere | 0 | 0 | |

7225110000 | kornorientiert | 0 | 0 | |

7225190000 | andere | 0 | 0 | |

7225301000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225309010 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7225309090 | andere | 0 | 0 | |

7225401000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225409010 | mit einer Zugfestigkeit von 490 MPa oder mehr | 0 | 0 | |

7225409090 | andere | 0 | 0 | |

7225501000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225509000 | andere | 0 | 0 | |

7225911000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225919010 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7225919090 | andere | 0 | 0 | |

7225921000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225929011 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7225929019 | andere | 0 | 0 | |

7225929091 | mit einer Zugfestigkeit von 340 MPa oder mehr | 0 | 0 | |

7225929099 | andere | 0 | 0 | |

7225991000 | aus Schnellarbeitsstahl | 0 | 0 | |

7225999000 | andere | 0 | 0 | |

7226110000 | kornorientiert | 0 | 0 | |

7226190000 | andere | 0 | 0 | |

7226200000 | aus Schnellarbeitsstahl | 0 | 0 | |

7226910000 | nur warmgewalzt | 0 | 0 | |

7226920000 | nur kaltgewalzt | 0 | 0 | |

7226991000 | Stahl mit amorpher Legierung, Feinblech mit einer Dicke von weniger als 100 μm | 0 | 0 | |

7226992000 | elektrolytisch verzinkt | 0 | 0 | |

7226993000 | anders verzinkt | 0 | 0 | |

7226999000 | andere | 0 | 0 | |

7227100000 | aus Schnellarbeitsstahl | 0 | 0 | |

7227200000 | aus Mangan-Silicium-Stahl | 0 | 0 | |

7227901000 | aus hitzebeständigem Stahl | 0 | 0 | |

7227909000 | andere | 0 | 0 | |

7228100000 | Stabstahl aus Schnellarbeitsstahl | 0 | 0 | |

7228200000 | Stabstahl aus Mangan-Silicium-Stahl | 0 | 0 | |

7228300000 | anderer Stabstahl, nur warmgewalzt, nur warmgezogen oder nur warmstranggepresst | 0 | 0 | |

7228400000 | anderer Stabstahl, nur geschmiedet | 0 | 0 | |

7228500000 | anderer Stabstahl, nur kalthergestellt oder nur kaltfertiggestellt | 0 | 0 | |

7228600000 | anderer Stabstahl | 0 | 0 | |

7228700000 | Profile | 0 | 0 | |

7228800000 | Hohlbohrerstäbe | 0 | 0 | |

7229200000 | aus Mangan-Silicium-Stahl | 0 | 0 | |

7229901010 | aus Schnellarbeitsstahl | 0 | 0 | |

7229901090 | andere | 0 | 0 | |

7229902010 | aus Schnellarbeitsstahl | 0 | 0 | |

7229902090 | andere | 0 | 0 | |

7229909010 | aus Schnellarbeitsstahl | 0 | 0 | |

7229909090 | andere | 0 | 0 | |

7301101000 | U-förmig | 0 | 0 | |

7301109000 | andere | 0 | 0 | |

7301201000 | U-Profile | 0 | 0 | |

7301202000 | H-Profile | 0 | 0 | |

7301203000 | I-Profile | 0 | 0 | |

7301209000 | andere | 0 | 0 | |

7302101010 | vergütet | 0 | 0 | |

7302101090 | andere | 0 | 0 | |

7302102010 | vergütet | 0 | 0 | |

7302102090 | andere | 0 | 0 | |

7302103010 | vergütet | 0 | 0 | |

7302103090 | andere | 0 | 0 | |

7302104010 | vergütet | 0 | 0 | |

7302104090 | andere | 0 | 0 | |

7302300000 | Weichenzungen, Herzstücke, Zungenverbindungsstangen und anderes Material für Kreuzungen oder Weichen | 8 | 0 | |

7302400000 | Laschen und Unterlagsplatten | 0 | 0 | |

7302900000 | andere | 0 | 0 | |

7303001010 | aus Gusseisen mit Kugelgrafit | 8 | 0 | |

7303001090 | andere | 8 | 0 | |

7303002000 | Hohlprofile | 8 | 0 | |

7304110000 | aus nicht rostendem Stahl | 0 | 0 | |

7304190000 | andere | 0 | 0 | |

7304220000 | Bohrgestänge (drill pipe), aus nicht rostendem Stahl | 0 | 0 | |

7304230000 | andere Bohrgestänge (drill pipe) | 0 | 0 | |

7304240000 | andere, aus nichtrostendem Stahl | 0 | 0 | |

7304290000 | andere | 0 | 0 | |

7304310000 | kaltgezogen oder kaltgewalzt | 0 | 0 | |

7304390000 | andere | 0 | 0 | |

7304410000 | kaltgezogen oder kaltgewalzt | 0 | 0 | |

7304490000 | andere | 0 | 0 | |

7304510000 | kaltgezogen oder kaltgewalzt | 0 | 0 | |

7304590000 | andere | 0 | 0 | |

7304900000 | andere | 0 | 0 | |

7305111000 | mit einem äußeren Durchmesser von mehr als 406,4 mm bis 1422,4 mm | 0 | 0 | |

7305112000 | mit einem äußeren Durchmesser von mehr als 1422,4 mm | 0 | 0 | |

7305120000 | anders längsnahtgeschweißt | 0 | 0 | |

7305190000 | andere | 0 | 0 | |

7305200000 | Futterrohre von der für das Fördern von Öl oder Gas verwendeten Art (casing) | 0 | 0 | |

7305311000 | mit verdecktem Lichtbogen geschweißt | 0 | 0 | |

7305312000 | widerstandsgeschweißt | 0 | 0 | |

7305319000 | andere | 0 | 0 | |

7305390000 | andere | 0 | 0 | |

7305900000 | andere | 0 | 0 | |

7306110000 | geschweißt, aus nicht rostendem Stahl | 0 | 0 | |

7306190000 | andere | 0 | 0 | |

7306211000 | Futterrohre (casing) | 0 | 0 | |

7306212000 | Steigrohre (tubing) | 0 | 0 | |

7306291000 | Futterrohre (casing) | 0 | 0 | |

7306292000 | Steigrohre (tubing) | 0 | 0 | |

7306301010 | elektrolytisch verzinkt | 0 | 0 | |

7306301020 | mit einem anderen Metall als Zink überzogen oder plattiert | 0 | 0 | |

7306301030 | mit nichtmetallischem Überzug | 0 | 0 | |

7306301090 | andere | 0 | 0 | |

7306302010 | elektrolytisch verzinkt | 0 | 0 | |

7306302020 | mit einem anderen Metall als Zink überzogen oder plattiert | 0 | 0 | |

7306302030 | mit nichtmetallischem Überzug | 0 | 0 | |

7306302090 | andere | 0 | 0 | |

7306401000 | mit einem äußeren Durchmesser von mehr als 114,3 mm | 0 | 0 | |

7306402000 | mit einem äußeren Durchmesser von nicht mehr als 114,3 mm | 0 | 0 | |

7306500000 | andere, geschweißt, mit kreisförmigem Querschnitt, aus anderem legierten Stahl | 0 | 0 | |

7306611010 | elektrolytisch verzinkt | 0 | 0 | |

7306611090 | andere | 0 | 0 | |

7306612000 | aus nicht rostendem Stahl | 0 | 0 | |

7306613000 | aus anderem legierten Stahl | 0 | 0 | |

7306691010 | elektrolytisch verzinkt | 0 | 0 | |

7306691090 | andere | 0 | 0 | |

7306692000 | aus nicht rostendem Stahl | 0 | 0 | |

7306693000 | aus anderem legierten Stahl | 0 | 0 | |

7306901000 | doppelwandige Stahlrohre | 0 | 0 | |

7306909000 | andere | 0 | 0 | |

7307110000 | aus nicht verformbarem Gusseisen | 8 | 0 | |

7307190000 | andere | 8 | 0 | |

7307210000 | Flansche | 8 | 0 | |

7307221000 | Muffen mit Gewinde, aus nicht rostendem Stahl | 0 | 0 | |

7307229000 | andere | 8 | 0 | |

7307230000 | Formstücke, Verschlussstücke und Verbindungsstücke, zum Stumpfschweißen | 8 | 0 | |

7307290000 | andere | 8 | 0 | |

7307910000 | Flansche | 8 | 0 | |

7307921000 | Muffen mit Gewinde, aus Eisen oder Stahl | 0 | 0 | |

7307929000 | andere | 8 | 0 | |

7307930000 | Formstücke, Verschlussstücke und Verbindungsstücke, zum Stumpfschweißen | 8 | 0 | |

7307991000 | mit Gewinde, auch plattiert | 8 | 3 | |

7307999000 | andere | 8 | 3 | |

7308100000 | Brücken und Brückenelemente | 0 | 0 | |

7308200000 | Türme und Gittermaste | 8 | 0 | |

7308300000 | Tore, Türen, Fenster und deren Rahmen und Verkleidungen, Tor- und Türschwellen | 8 | 0 | |

7308400000 | Gerüst-, Schalungs- oder Stützmaterial | 8 | 0 | |

7308901000 | Schleusentore | 0 | 0 | |

7308909000 | andere | 0 | 0 | |

7309000000 | Sammelbehälter, Fässer, Bottiche und ähnliche Behälter, aus Eisen oder Stahl, für Stoffe aller Art (ausgenommen verdichtete oder verflüssigte Gase), mit einem Fassungsvermögen von mehr als 300 l, ohne mechanische oder wärmetechnische Einrichtungen, auch mit Innenauskleidung oder Wärmeschutzverkleidung | 8 | 0 | |

7310100000 | mit einem Fassungsvermögen von 50 l oder mehr | 8 | 0 | |

7310210000 | Dosen, die durch Schweißen, Löten oder Falzen verschlossen werden | 8 | 0 | |

7310290000 | andere | 8 | 0 | |

7311001000 | mit einem Fassungsvermögen von nicht mehr als 30 l | 8 | 0 | |

7311002000 | mit einem Fassungsvermögen von mehr als 30 l bis 100 l | 8 | 0 | |

7311003000 | mit einem Fassungsvermögen von 100 l oder mehr | 8 | 0 | |

7312101011 | ausgerüstet oder gebrauchsfertig | 0 | 0 | |

7312101019 | andere | 0 | 0 | |

7312101091 | ausgerüstet oder gebrauchsfertig | 0 | 0 | |

7312101092 | Reifenstahlcord | 0 | 0 | |

7312101099 | andere | 0 | 0 | |

7312102011 | ausgerüstet oder gebrauchsfertig | 0 | 0 | |

7312102019 | andere | 0 | 0 | |

7312102091 | ausgerüstet oder gebrauchsfertig | 0 | 0 | |

7312102092 | Reifenstahlcord | 0 | 0 | |

7312102099 | andere | 0 | 0 | |

7312900000 | andere | 0 | 0 | |

7313001000 | Stacheldraht aus Eisen oder Stahl | 0 | 0 | |

7313009000 | andere | 0 | 0 | |

7314120000 | endlose Gewebe für Maschinen, aus nicht rostendem Stahl | 0 | 0 | |

7314140000 | andere Gewebe, aus nicht rostendem Stahl | 0 | 0 | |

7314190000 | andere | 0 | 0 | |

7314200000 | Gitter und Geflechte, an den Kreuzungsstellen verschweißt, mit einer Maschengröße von 100 cm2 oder mehr, aus Draht mit einer größten Querschnittsabmessung von 3 mm oder mehr | 0 | 0 | |

7314310000 | verzinkt | 0 | 0 | |

7314390000 | andere | 0 | 0 | |

7314410000 | verzinkt | 0 | 0 | |

7314420000 | mit Kunststoff überzogen | 0 | 0 | |

7314490000 | andere | 0 | 0 | |

7314500000 | Streckbleche und -bänder | 0 | 0 | |

7315110000 | Rollenketten | 8 | 0 | |

7315120000 | andere Ketten | 8 | 0 | |

7315190000 | Teile | 8 | 0 | |

7315200000 | Gleitschutzketten | 8 | 0 | |

7315810000 | Stegketten | 8 | 0 | |

7315820000 | andere Ketten, mit geschweißten Gliedern | 8 | 0 | |

7315890000 | andere | 8 | 0 | |

7315900000 | andere Teile | 8 | 0 | |

7316001000 | Schiffsanker und Draggen | 8 | 0 | |

7316002000 | Teile | 8 | 0 | |

7317001011 | überzogen oder mit Farbe versehen | 0 | 0 | |

7317001019 | andere | 0 | 0 | |

7317001021 | überzogen oder mit Farbe versehen | 0 | 0 | |

7317001029 | andere | 0 | 0 | |

7317002000 | Stifte | 0 | 0 | |

7317003000 | Reißnägel oder Stifte für den Bürogebrauch | 0 | 0 | |

7317004000 | Krampen | 0 | 0 | |

7317005000 | gewellte oder abgeschrägte Klammern | 0 | 0 | |

7317009000 | andere | 0 | 0 | |

7318110000 | Schwellenschrauben | 8 | 0 | |

7318120000 | andere Holzschrauben | 8 | 0 | |

7318130000 | Schraubhaken, Ring- und Ösenschrauben | 8 | 0 | |

7318140000 | gewindeformende Schrauben | 8 | 0 | |

7318151000 | Maschinenschrauben | 8 | 0 | |

7318152000 | Bolzen | 8 | 0 | |

7318153000 | Bolzen und Muttern (als Satz) | 8 | 0 | |

7318159000 | andere | 8 | 0 | |

7318160000 | Muttern | 8 | 0 | |

7318190000 | andere | 8 | 0 | |

7318210000 | Federringe und -scheiben und andere Sicherungsringe und -scheiben | 8 | 0 | |

7318220000 | andere Unterlegscheiben | 8 | 0 | |

7318230000 | Niete | 8 | 0 | |

7318240000 | Splinte und Keile | 8 | 0 | |

7318290000 | andere | 8 | 0 | |

7319200000 | Sicherheitsnadeln | 8 | 0 | |

7319300000 | Stecknadeln und ähnliche Nadeln | 8 | 0 | |

7319901010 | Nähnadeln | 8 | 0 | |

7319901020 | Stopfnadeln | 8 | 0 | |

7319901090 | andere | 8 | 0 | |

7319909000 | andere | 8 | 0 | |

7320101000 | Blattfedern für Kraftfahrzeuge | 8 | 0 | |

7320102000 | Blattfedern für Lokomotiven und Schienenfahrzeuge | 8 | 0 | |

7320109000 | andere | 8 | 0 | |

7320201000 | für Kraftfahrzeuge | 8 | 3 | |

7320202000 | für Stoßdämpfer | 8 | 0 | |

7320203000 | für Puffer für Kupplungen von Schienenfahrzeugen | 8 | 0 | |

7320204000 | für Polsterungen | 8 | 0 | |

7320209000 | andere | 8 | 0 | |

7320901000 | Spiralflachfedern | 8 | 0 | |

7320909000 | andere Federn | 8 | 0 | |

7321110000 | für Feuerung mit gasförmigen Brennstoffen oder mit Gas und anderen Brennstoffen | 8 | 0 | |

7321120000 | für Feuerung mit flüssigen Brennstoffen | 8 | 0 | |

7321190000 | andere, einschließlich Geräte für Festbrennstoffe | 8 | 0 | |

7321810000 | für Feuerung mit gasförmigen Brennstoffen oder mit Gas und anderen Brennstoffen | 8 | 0 | |

7321820000 | für Feuerung mit flüssigen Brennstoffen | 8 | 0 | |

7321890000 | andere, einschließlich Geräte für Festbrennstoffe | 8 | 0 | |

7321900000 | Teile | 8 | 0 | |

7322111000 | Heizkörper | 8 | 0 | |

7322112000 | Teile | 8 | 0 | |

7322191000 | Heizkörper | 8 | 0 | |

7322192000 | Teile | 8 | 0 | |

7322901000 | Solarkollektoren und Teile davon | 8 | 0 | |

7322909010 | Heißlufterzeuger | 8 | 0 | |

7322909020 | Heißluftverteiler | 8 | 0 | |

7322909030 | Teile | 8 | 0 | |

7323100000 | Eisen- oder Stahlwolle; Schwämme, Putzlappen, Handschuhe und ähnliche Waren, zum Scheuern, Polieren oder dergleichen | 8 | 0 | |

7323910000 | aus Gusseisen, nicht emailliert | 8 | 0 | |

7323920000 | aus Gusseisen, emailliert | 8 | 3 | |

7323930000 | aus nicht rostendem Stahl | 8 | 0 | |

7323940000 | aus Eisen (ausgenommen Gusseisen) oder Stahl, emailliert | 8 | 3 | |

7323990000 | andere | 8 | 0 | |

7324101000 | Spülbecken | 8 | 0 | |

7324102000 | Waschbecken | 8 | 0 | |

7324210000 | aus Gusseisen, auch emailliert | 8 | 0 | |

7324291000 | aus nicht rostendem Stahl | 8 | 0 | |

7324299000 | andere | 8 | 0 | |

7324901000 | Toilettengarnituren | 8 | 0 | |

7324908000 | andere | 8 | 0 | |

7324909000 | Teile | 8 | 0 | |

7325100000 | aus nicht verformbarem Gusseisen | 8 | 0 | |

7325910000 | Mahlkugeln und ähnliche Mahlkörper | 8 | 0 | |

7325991000 | aus Gusseisen | 8 | 0 | |

7325992000 | aus Stahlguss | 8 | 0 | |

7325993000 | aus legiertem Stahl | 8 | 0 | |

7325999000 | andere | 8 | 0 | |

7326110000 | Mahlkugeln und ähnliche Mahlkörper | 8 | 0 | |

7326190000 | andere | 8 | 0 | |

7326200000 | Waren aus Eisen- oder Stahldraht | 8 | 0 | |

7326901000 | Spulen für Textilmaschinen | 8 | 0 | |

7326909000 | andere | 8 | 0 | |

7401001000 | Kupfermatte | 0 | 0 | |

7401002000 | Zementkupfer (gefälltes Kupfer) | 0 | 0 | |

7402001000 | nicht raffiniertes Kupfer | 0 | 0 | |

7402002000 | Kupferanoden zum elektrolytischen Raffinieren | 0 | 0 | |

7403110000 | Kathoden und Kathodenabschnitte | 3 | 0 | |

7403120000 | Drahtbarren | 5 | 0 | |

7403130000 | Knüppel | 5 | 0 | |

7403191000 | Brammen | 5 | 0 | |

7403192000 | Rohblöcke (Ingots) | 5 | 0 | |

7403199000 | andere | 5 | 0 | |

7403210000 | Kupfer-Zink-Legierungen (Messing) | 5 | 0 | |

7403220000 | Kupfer-Zinn-Legierungen (Bronze) | 5 | 0 | |

7403291010 | Kupfer-Nickel-Legierungen (Kupfernickel) | 5 | 0 | |

7403291020 | Kupfer-Nickel-Zink-Legierungen (Neusilber) | 5 | 0 | |

7403299000 | andere | 5 | 0 | |

7404000000 | Abfälle und Schrott aus Kupfer | 0 | 0 | |

7405000000 | Kupfervorlegierungen | 5 | 0 | |

7406100000 | Pulver ohne Lamellenstruktur | 8 | 5 | |

7406201000 | Pulver mit Lamellenstruktur | 8 | 5 | |

7406202000 | Flitter | 8 | 0 | |

7407100000 | aus raffiniertem Kupfer | 8 | 0 | |

7407210000 | aus Kupfer-Zink-Legierungen (Messing) | 8 | 0 | |

7407291000 | aus Kupfer-Zinn-Legierungen (Bronze) | 8 | 0 | |

7407292010 | aus Kupfer-Nickel-Legierungen (Kupfernickel) | 8 | 0 | |

7407292020 | aus Kupfer-Nickel-Zink-Legierungen (Neusilber) | 8 | 0 | |

7407299000 | andere | 8 | 0 | |

7408110000 | mit einer größten Querschnittsabmessung von mehr als 6 mm | 8 | 5 | |

7408190000 | andere | 8 | 3 | |

7408210000 | aus Kupfer-Zink-Legierungen (Messing) | 8 | 0 | |

7408221000 | aus Kupfer-Nickel-Legierungen (Kupfernickel) | 8 | 5 | |

7408222000 | aus Kupfer-Nickel-Zink-Legierungen (Neusilber) | 8 | 3 | |

7408291000 | aus Kupfer-Zinn-Legierungen (Bronze) | 8 | 0 | |

7408299000 | andere | 8 | 0 | |

7409111000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 5 | |

7409119000 | andere | 8 | 5 | |

7409191000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 5 | |

7409199000 | andere | 8 | 3 | |

7409211000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 0 | |

7409219000 | andere | 8 | 0 | |

7409291000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 5 | |

7409299000 | andere | 8 | 7 | |

7409311000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 0 | |

7409319000 | andere | 8 | 5 | |

7409391000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 0 | |

7409399000 | andere | 8 | 0 | |

7409401010 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 0 | |

7409401090 | andere | 8 | 5 | |

7409402010 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 0 | |

7409402090 | andere | 8 | 0 | |

7409901000 | zur Verwendung bei der Herstellung von Halbleitern | 5 | 5 | |

7409909000 | andere | 8 | 0 | |

7410110000 | aus raffiniertem Kupfer | 8 | 5 | |

7410120000 | aus Kupferlegierungen | 8 | 5 | |

7410211000 | zur Herstellung gedruckter Schaltungen geeignet | 8 | 0 | |

7410219000 | andere | 8 | 0 | |

7410221000 | zur Herstellung gedruckter Schaltungen geeignet | 8 | 0 | |

7410229000 | andere | 8 | 0 | |

7411100000 | aus raffiniertem Kupfer | 8 | 3 | |

7411210000 | aus Kupfer-Zink-Legierungen (Messing) | 8 | 0 | |

7411221000 | aus Kupfer-Nickel-Legierungen (Kupfernickel) | 8 | 5 | |

7411222000 | aus Kupfer-Nickel-Zink-Legierungen (Neusilber) | 8 | 3 | |

7411291000 | aus Kupfer-Zinn-Legierungen (Bronze) | 8 | 0 | |

7411299000 | andere | 8 | 0 | |

7412100000 | aus raffiniertem Kupfer | 3 | 0 | |

7412200000 | aus Kupferlegierungen | 3 | 0 | |

7413000000 | Litzen, Kabel, Seile und ähnliche Waren, aus Kupfer, ausgenommen isolierte Erzeugnisse für die Elektrotechnik | 3 | 0 | |

7415101000 | plattiert, gewalzt oder mit Edelmetallen überzogen | 8 | 0 | |

7415109000 | andere | 8 | 0 | |

7415210000 | Unterlegscheiben (einschließlich Federringe und -scheiben) | 8 | 0 | |

7415290000 | andere | 8 | 0 | |

7415330000 | Schrauben; Bolzen und Muttern | 8 | 0 | |

7415390000 | andere | 8 | 0 | |

7418110000 | Schwämme, Putzlappen, Handschuhe und ähnliche Waren, zum Scheuern, Polieren oder dergleichen | 8 | 0 | |

7418191000 | Haushaltsartikel | 8 | 0 | |

7418192010 | Solarkollektoren von der für Haushaltszwecke verwendeten Art, nicht elektrisch | 5 | 0 | |

7418192090 | andere | 8 | 0 | |

7418199010 | Solarkollektoren von der für Haushaltszwecke verwendeten Art, nicht elektrisch | 5 | 0 | |

7418199090 | andere | 8 | 0 | |

7418201000 | Sanitär-, Hygiene- oder Toilettenartikel | 8 | 0 | |

7418202000 | Teile | 8 | 0 | |

7419101000 | Ketten | 8 | 0 | |

7419102000 | Teile | 8 | 0 | |

7419910000 | gegossen oder geschmiedet, jedoch nicht weiter bearbeitet | 0 | 0 | |

7419991010 | Gewebe | 8 | 0 | |

7419991090 | andere | 8 | 0 | |

7419992000 | Federn aus Kupfer | 8 | 0 | |

7419999000 | andere | 8 | 0 | |

7501100000 | Nickelmatten | 0 | 0 | |

7501201010 | mit einem Nickelgehalt von 88 GHT oder mehr | 2 | 0 | |

7501201090 | andere | 0 | 0 | |

7501209010 | mit einem Nickelgehalt von 88 GHT oder mehr | 2 | 0 | |

7501209090 | andere | 0 | 0 | |

7502101000 | Kathoden | 3 | 0 | |

7502109000 | andere | 3 | 0 | |

7502200000 | Nickellegierungen | 3 | 0 | |

7503000000 | Abfälle und Schrott, aus Nickel | 0 | 0 | |

7504001000 | Pulver | 5 | 0 | |

7504002000 | Flitter | 5 | 0 | |

7505110000 | aus nicht legiertem Nickel | 5 | 0 | |

7505120000 | aus Nickellegierungen | 5 | 0 | |

7505210000 | aus nicht legiertem Nickel | 5 | 0 | |

7505220000 | aus Nickellegierungen | 5 | 0 | |

7506101000 | Bleche und Bänder | 5 | 0 | |

7506102000 | Folien | 5 | 0 | |

7506201000 | Bleche und Bänder | 5 | 0 | |

7506202000 | Folien | 5 | 0 | |

7507110000 | aus nicht legiertem Nickel | 8 | 0 | |

7507120000 | aus Nickellegierungen | 8 | 0 | |

7507200000 | Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

7508100000 | Gewebe, Gitter und Geflechte, aus Nickeldraht | 8 | 0 | |

7508901000 | Anoden für die Elektroplattierung | 8 | 0 | |

7508909000 | andere | 8 | 0 | |

7601100000 | nicht legiertes Aluminium | 1 | 0 | |

7601201000 | Gusslegierung | 1 | 0 | |

7601202000 | Knüppel | 3 | 0 | |

7601209000 | andere | 1 | 0 | |

7602000000 | Abfälle und Schrott, aus Aluminium | 0 | 0 | |

7603100000 | Pulver mit Lamellenstruktur | 8 | 5 | |

7603201000 | Pulver | 8 | 3 | |

7603202000 | Flitter | 8 | 0 | |

7604101000 | Stangen (Stäbe) | 8 | 3 | |

7604102010 | Hohlprofile | 8 | 0 | |

7604102090 | andere | 8 | 3 | |

7604210000 | Hohlprofile | 8 | 0 | |

7604291000 | Stangen (Stäbe) | 8 | 3 | |

7604299000 | andere Profile | 8 | 0 | |

7605110000 | mit einer größten Querschnittsabmessung von mehr als 7 mm | 8 | 0 | |

7605190000 | andere | 8 | 0 | |

7605210000 | mit einer größten Querschnittsabmessung von mehr als 7 mm | 8 | 3 | |

7605290000 | andere | 8 | 0 | |

7606111000 | mit einem Aluminiumgehalt von nicht weniger als 99,99 GHT | 8 | 3 | |

7606119000 | andere | 8 | 3 | |

7606120000 | aus Aluminiumlegierungen | 8 | 3 | |

7606911000 | mit einem Aluminiumgehalt von nicht weniger als 99,99 GHT | 8 | 0 | |

7606919000 | andere | 8 | 0 | |

7606920000 | aus Aluminiumlegierungen | 8 | 3 | |

7607111000 | mit einem Aluminiumgehalt von nicht weniger als 99,99 GHT | 8 | 0 | |

7607119000 | andere | 8 | 0 | |

7607191000 | mit einem Aluminiumgehalt von nicht weniger als 99,99 GHT | 8 | 0 | |

7607199000 | andere | 8 | 0 | |

7607201000 | mit einem Aluminiumgehalt von nicht weniger als 99,99 GHT | 8 | 0 | |

7607209000 | andere | 8 | 0 | |

7608100000 | aus nicht legiertem Aluminium | 8 | 0 | |

7608200000 | aus Aluminiumlegierungen | 8 | 3 | |

7609000000 | Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke (z. B. Bogen, Muffen), aus Aluminium | 8 | 3 | |

7610100000 | Tore, Türen, Fenster, und deren Rahmen und Verkleidungen, Tor- und Türschwellen | 8 | 0 | |

7610901000 | Konstruktionen | 8 | 0 | |

7610908000 | andere | 8 | 3 | |

7610909000 | Teile | 8 | 5 | |

7611000000 | Sammelbehälter, Fässer, Bottiche und ähnliche Behälter, aus Aluminium, für Stoffe aller Art (ausgenommen verdichtete oder verflüssigte Gase), mit einem Fassungsvermögen von mehr als 300 l, ohne mechanische oder wärmetechnische Einrichtungen, auch mit Innenauskleidung oder Wärmeschutzverkleidung | 8 | 0 | |

7612100000 | Tuben | 8 | 0 | |

7612901000 | Verpackungsröhrchen | 8 | 0 | |

7612909010 | mit einem Fassungsvermögen von weniger als 1 l | 8 | 0 | |

7612909020 | mit einem Fassungsvermögen von nicht weniger als 1 l, jedoch weniger als 20 l | 8 | 3 | |

7612909030 | mit einem Fassungsvermögen von 20 l oder mehr | 8 | 0 | |

7613001000 | für verdichtete Gase | 8 | 0 | |

7613002000 | für verflüssigte Gase | 8 | 0 | |

7614100000 | mit Stahlseele | 8 | 0 | |

7614900000 | andere | 8 | 0 | |

7615110000 | Schwämme, Putzlappen, Handschuhe und ähnliche Waren, zum Scheuern, Polieren oder dergleichen | 8 | 0 | |

7615191000 | Solarkollektoren und Teile davon | 5 | 3 | |

7615192000 | Haushaltsartikel | 8 | 0 | |

7615193000 | andere Hauswirtschaftsartikel | 8 | 0 | |

7615199000 | Teile | 8 | 0 | |

7615201000 | Sanitär-, Hygiene- oder Toilettenartikel | 8 | 0 | |

7615202000 | Teile | 8 | 0 | |

7616100000 | Stifte, Nägel, Krampen, Klammern (ausgenommen Klammern der Position 8305), Schrauben, Bolzen, Muttern, Schraubhaken, Niete, Splinte, Keile, Unterlegscheiben und ähnliche Waren | 8 | 0 | |

7616910000 | Gewebe, Gitter und Geflechte, aus Aluminiumdraht | 8 | 0 | |

7616991000 | Spulen | 8 | 0 | |

7616999010 | Aluminiumbeutel | 8 | 0 | |

7616999020 | Aluminiumknöpfe | 8 | 0 | |

7616999090 | andere | 8 | 0 | |

7801101000 | mit einem Bleigehalt von 99,99 GHT oder mehr | 3 | 0 | |

7801109000 | andere | 3 | 0 | |

7801910000 | Antimon als gewichtsmäßig vorherrschendes anderes Element enthaltend | 3 | 0 | |

7801991000 | Blei in Rohform | 1 | 0 | |

7801992010 | Blei-Zinn-Legierungen | 3 | 0 | |

7801992090 | andere | 3 | 0 | |

7802000000 | Abfälle und Schrott, aus Blei | 0 | 0 | |

7804111000 | Bleche und Bänder | 8 | 0 | |

7804112000 | Folien | 8 | 0 | |

7804190000 | andere | 8 | 0 | |

7804201000 | Pulver | 8 | 0 | |

7804202000 | Flitter | 8 | 0 | |

7806001000 | Verpackungsmittel aus Blei | 8 | 0 | |

7806002000 | Anoden für die Elektroplattierung | 8 | 0 | |

7806003010 | Stangen (Stäbe) | 8 | 0 | |

7806003020 | Profile | 8 | 0 | |

7806003030 | Draht | 8 | 0 | |

7806004010 | Rohre | 8 | 0 | |

7806004020 | Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

7806009000 | andere | 8 | 0 | |

7901110000 | mit einem Zinkgehalt von 99,99 GHT oder mehr | 3 | 0 | |

7901120000 | mit einem Zinkgehalt von weniger als 99,99 GHT | 3 | 0 | |

7901201000 | Zink-Aluminium-Legierung | 3 | 0 | |

7901202000 | Zink-Kupfer-Legierung | 3 | 0 | |

7901209000 | andere | 3 | 0 | |

7902000000 | Abfälle und Schrott, aus Zink | 0 | 0 | |

7903100000 | Zinkstaub | 8 | 0 | |

7903901000 | Pulver | 8 | 0 | |

7903902000 | Flitter | 8 | 0 | |

7904001000 | Stangen (Stäbe) | 8 | 0 | |

7904002000 | Profile | 8 | 0 | |

7904003000 | Draht | 8 | 0 | |

7905001000 | Bleche und Bänder | 8 | 0 | |

7905002000 | Folien | 8 | 0 | |

7907001000 | Dachrinnen, Firstbleche, Oberlichtklappen und andere vorgefertigte Bauelemente | 8 | 0 | |

7907002010 | Rohre | 8 | 0 | |

7907002020 | Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke | 8 | 0 | |

7907009010 | Anoden für die Elektroplattierung | 8 | 0 | |

7907009090 | andere | 8 | 0 | |

8001100000 | nicht legiertes Zinn | 3 | 0 | |

8001200000 | Zinnlegierungen | 3 | 0 | |

8002000000 | Abfälle und Schrott, aus Zinn | 0 | 0 | |

8003001010 | nicht legiert | 8 | 0 | |

8003001090 | andere | 8 | 0 | |

8003002010 | nicht legiert | 8 | 0 | |

8003002090 | andere | 8 | 0 | |

8007001000 | Anoden für die Elektroplattierung | 8 | 0 | |

8007002000 | Bleche und Bänder, mit einer Dicke von mehr als 0,2 mm | 8 | 0 | |

8007003010 | Folien | 8 | 0 | |

8007003021 | Pulver | 8 | 0 | |

8007003022 | Flitter | 8 | 0 | |

8007004000 | Rohre, Rohrformstücke, Rohrverschlussstücke und Rohrverbindungsstücke (z. B. Bogen, Muffen) | 8 | 0 | |

8007009000 | andere | 8 | 0 | |

8101100000 | Pulver | 3 | 0 | |

8101940000 | Wolfram in Rohform, einschließlich nur gesinterte Stangen (Stäbe) | 3 | 0 | |

8101961000 | Glühwendel für elektrische oder elektronische Glühlampen | 8 | 0 | |

8101969000 | andere | 8 | 0 | |

8101970000 | Abfälle und Schrott | 0 | 0 | |

8101991010 | Stangen (Stäbe) | 8 | 0 | |

8101991020 | Profile | 8 | 0 | |

8101991030 | Bleche und Bänder | 8 | 0 | |

8101991040 | Folien | 8 | 0 | |

8101999000 | andere | 8 | 0 | |

8102100000 | Pulver | 3 | 0 | |

8102940000 | Molybdän in Rohform, einschließlich nur gesinterte Stangen (Stäbe) | 3 | 0 | |

8102951000 | Stangen (Stäbe) | 8 | 0 | |

8102952000 | Profile | 8 | 0 | |

8102953000 | Bleche und Bänder | 8 | 0 | |

8102954000 | Folien | 8 | 0 | |

8102961000 | Glühwendel für elektrische oder elektronische Glühlampen | 8 | 0 | |

8102969000 | andere | 8 | 0 | |

8102970000 | Abfälle und Schrott | 0 | 0 | |

8102990000 | andere | 8 | 0 | |

8103201000 | in Rohform | 3 | 0 | |

8103202000 | Pulver | 3 | 0 | |

8103300000 | Abfälle und Schrott | 0 | 0 | |

8103900000 | andere | 8 | 0 | |

8104110000 | mit einem Magnesiumgehalt von 99,8 GHT oder mehr | 3 | 0 | |

8104190000 | andere | 3 | 0 | |

8104200000 | Abfälle und Schrott | 0 | 0 | |

8104301000 | Drehspäne und Körner | 8 | 0 | |

8104302000 | Pulver | 8 | 0 | |

8104901000 | Stangen (Stäbe) | 8 | 0 | |

8104909000 | andere | 8 | 0 | |

8105201000 | Cobalt in Rohform | 3 | 0 | |

8105202000 | Cobaltmatte und andere Zwischenerzeugnisse der Cobaltmetallurgie | 3 | 0 | |

8105203000 | Pulver | 3 | 0 | |

8105300000 | Abfälle und Schrott | 3 | 0 | |

8105900000 | andere | 3 | 0 | |

8106001010 | Bismut in Rohform | 3 | 0 | |

8106001020 | Abfälle und Schrott | 3 | 0 | |

8106001030 | Pulver | 3 | 0 | |

8106009000 | andere | 3 | 0 | |

8107201000 | Cadmium in Rohform | 3 | 0 | |

8107202000 | Pulver | 3 | 0 | |

8107300000 | Abfälle und Schrott | 3 | 0 | |

8107900000 | andere | 3 | 0 | |

8108201000 | in Rohform | 3 | 0 | |

8108202000 | Pulver | 3 | 0 | |

8108300000 | Abfälle und Schrott | 3 | 0 | |

8108901000 | Bleche und Bänder | 8 | 0 | |

8108902000 | Rohre | 8 | 0 | |

8108909000 | andere | 8 | 0 | |

8109201000 | in Rohform | 3 | 0 | |

8109202000 | Pulver | 3 | 0 | |

8109300000 | Abfälle und Schrott | 3 | 0 | |

8109901010 | Rohre | 0 | 0 | |

8109901020 | Bleche und Bänder | 0 | 0 | |

8109901030 | Stangen | 0 | 0 | |

8109901090 | andere | 0 | 0 | |

8109909000 | andere | 3 | 0 | |

8110100000 | Antimon in Rohform; Pulver | 3 | 0 | |

8110200000 | Abfälle und Schrott | 3 | 0 | |

8110900000 | andere | 3 | 0 | |

8111000000 | Mangan und Waren daraus, einschließlich Abfälle und Schrott | 3 | 0 | |

8112120000 | in Rohform; Pulver | 3 | 0 | |

8112130000 | Abfälle und Schrott | 3 | 0 | |

8112190000 | andere | 3 | 0 | |

8112210000 | in Rohform; Pulver | 3 | 0 | |

8112220000 | Abfälle und Schrott | 3 | 0 | |

8112290000 | andere | 3 | 0 | |

8112510000 | in Rohform; Pulver | 3 | 0 | |

8112520000 | Abfälle und Schrott | 3 | 0 | |

8112590000 | andere | 3 | 0 | |

8112921000 | Germanium | 3 | 0 | |

8112922000 | Vanadium | 3 | 0 | |

8112929000 | andere | 3 | 0 | |

8112991000 | Germanium | 3 | 0 | |

8112992000 | Vanadium | 3 | 0 | |

8112999000 | andere | 3 | 0 | |

8113000000 | Cermets und Waren daraus, einschließlich Abfälle und Schrott | 3 | 0 | |

8201100000 | Spaten und Schaufeln | 8 | 0 | |

8201200000 | Gabeln | 8 | 0 | |

8201300000 | Spitzhacken, Hacken aller Art, Rechen und Schaber | 8 | 0 | |

8201400000 | Äxte, Beile, Haumesser und ähnliche Werkzeuge zum Hauen oder Spalten | 8 | 0 | |

8201500000 | Gartenscheren, Rosenscheren und ähnliche mit einer Hand zu betätigende Scheren (einschließlich Geflügelscheren) | 8 | 0 | |

8201600000 | Heckenscheren, Baumscheren und ähnliche mit zwei Händen zu betätigende Scheren | 8 | 0 | |

8201901000 | Sensen und Sicheln | 8 | 0 | |

8201902000 | Heu- und Strohmesser | 8 | 0 | |

8201903000 | Keile | 8 | 0 | |

8201909000 | andere | 8 | 0 | |

8202101000 | für Holz | 8 | 0 | |

8202102000 | für Metall | 8 | 0 | |

8202109000 | andere | 8 | 0 | |

8202200000 | Bandsägeblätter | 8 | 0 | |

8202310000 | mit arbeitendem Teil aus Stahl | 8 | 3 | |

8202391000 | mit arbeitendem Teil aus Wolframcarbid | 8 | 0 | |

8202392000 | mit arbeitendem Teil aus Diamant | 8 | 0 | |

8202393000 | mit arbeitendem Teil aus anderen Stoffen | 8 | 0 | |

8202399000 | Teile | 8 | 0 | |

8202400000 | Sägeketten | 8 | 0 | |

8202911000 | Bügelsägeblätter | 8 | 0 | |

8202919000 | andere | 8 | 0 | |

8202990000 | andere | 8 | 0 | |

8203101000 | für Sägeblätter | 8 | 0 | |

8203109000 | andere | 8 | 0 | |

8203201000 | Zangen (auch zum Schneiden) | 8 | 0 | |

8203202000 | Kneifzangen/Beißzangen | 8 | 0 | |

8203203000 | Pinzetten | 8 | 0 | |

8203204000 | Nagelzieher | 8 | 0 | |

8203209000 | andere | 8 | 0 | |

8203300000 | Scheren zum Schneiden von Metallen und ähnliche Werkzeuge | 8 | 0 | |

8203401000 | Rohrschneider | 8 | 0 | |

8203402000 | Bolzenschneider | 8 | 0 | |

8203403000 | Locheisen und Lochzangen | 8 | 0 | |

8203409000 | andere | 8 | 3 | |

8204110000 | mit nicht verstellbarer Spannweite | 8 | 0 | |

8204120000 | mit verstellbarer Spannweite | 8 | 0 | |

8204200000 | auswechselbare Steckschlüsseleinsätze, auch mit Griff | 8 | 0 | |

8205101000 | Bohrwerkzeuge | 8 | 0 | |

8205102000 | Gewindeschneidwerkzeuge | 8 | 0 | |

8205103000 | Gewindebohrwerkzeuge | 8 | 0 | |

8205109000 | andere | 8 | 0 | |

8205200000 | Hämmer und Fäustel | 8 | 0 | |

8205300000 | Hobel, Stechbeitel, Hohlbeitel und ähnliche schneidende Werkzeuge für die Holzbearbeitung | 8 | 0 | |

8205400000 | Schraubenzieher (Schraubendreher) | 8 | 0 | |

8205510000 | Haushaltswerkzeuge | 8 | 0 | |

8205591000 | Glasschneidediamanten | 8 | 0 | |

8205592000 | Lötkolben | 8 | 0 | |

8205593000 | Fettpressen | 8 | 0 | |

8205595000 | Werkzeuge für den Bergbau und Werkzeuge für den Hoch- und Tiefbau | 8 | 0 | |

8205596000 | Werkzeuge für Zementarbeiter und Maler | 8 | 0 | |

8205597000 | Uhrmacherwerkzeuge | 8 | 0 | |

8205599000 | andere | 8 | 3 | |

8205600000 | Lötlampen und dergleichen | 8 | 0 | |

8205701000 | Schraubstöcke | 8 | 0 | |

8205702000 | Schraubzwingen | 8 | 0 | |

8205709000 | andere | 8 | 0 | |

8205801000 | Ambosse | 8 | 0 | |

8205802000 | tragbare Feldschmieden | 8 | 0 | |

8205803000 | Schleifapparate zum Hand- oder Fußbetrieb | 8 | 0 | |

8205809000 | andere | 8 | 0 | |

8205900000 | Zusammenstellungen von Waren aus zwei oder mehr der vorstehenden Unterpositionen | 8 | 0 | |

8206000000 | Zusammenstellungen von Werkzeugen aus zwei oder mehr der Positionen 8202 bis 8205, in Aufmachungen für den Einzelverkauf | 8 | 0 | |

8207130000 | mit arbeitendem Teil aus Cermets | 8 | 0 | |

8207191000 | mit arbeitendem Teil aus anderen Stoffen | 8 | 0 | |

8207199000 | Teile | 8 | 0 | |

8207201000 | Ziehwerkzeuge und Pressmatrizen zum Ziehen | 8 | 0 | |

8207202000 | Strang- und Fließpressen | 8 | 0 | |

8207301000 | Presswerkzeuge | 8 | 0 | |

8207302000 | Präge-, Tiefzieh- und Gesenkschmiedewerkzeuge | 8 | 0 | |

8207303000 | Stanz- und Lochwerkzeuge | 8 | 0 | |

8207309000 | andere | 8 | 0 | |

8207401000 | Werkzeuge zum Herstellen von Innengewinden | 8 | 0 | |

8207402000 | Werkzeuge zum Herstellen von Außengewinden | 8 | 0 | |

8207409000 | andere | 8 | 0 | |

8207501010 | aus Schnellarbeitsstahl | 8 | 0 | |

8207501090 | andere | 8 | 5 | |

8207502000 | Bohrer für Bohrwinden | 8 | 0 | |

8207509000 | andere | 8 | 5 | |

8207601000 | Reibahlen | 8 | 0 | |

8207602000 | Läppwerkzeuge | 8 | 0 | |

8207603000 | Räumwerkzeuge | 8 | 0 | |

8207609000 | andere | 8 | 3 | |

8207701000 | Zahnformfräser | 8 | 0 | |

8207702000 | Fräswerkzeuge | 8 | 0 | |

8207703000 | Messerfräser | 8 | 0 | |

8207704000 | Rotationsfeilen | 8 | 0 | |

8207709000 | andere | 8 | 0 | |

8207801000 | Werkzeuge für Drehmaschinen | 8 | 0 | |

8207809000 | andere | 8 | 0 | |

8207901000 | Diamantwerkzeuge | 8 | 0 | |

8207909000 | andere | 8 | 3 | |

8208100000 | für die Metallbearbeitung | 8 | 0 | |

8208200000 | für die Holzbearbeitung | 8 | 0 | |

8208300000 | für Küchenmaschinen oder Maschinen für die Nahrungsmittelindustrie | 8 | 0 | |

8208400000 | für Maschinen für die Landwirtschaft, den Gartenbau oder die Forstwirtschaft | 8 | 0 | |

8208900000 | andere | 8 | 0 | |

8209001010 | aus Wolframcarbid, mit Gamma-Phase-Beschichtung | 8 | 5 | |

8209001040 | aus Cerments | 8 | 0 | |

8209001090 | andere | 8 | 0 | |

8209002010 | aus Wolframcarbid | 8 | 3 | |

8209002040 | aus Cerments | 8 | 0 | |

8209002090 | andere | 8 | 3 | |

8210001000 | Mühlen und Zerkleinerungsgeräte | 8 | 0 | |

8210002000 | Saftpressen und Pressen | 8 | 0 | |

8210003000 | Rührwerke und Mischgeräte | 8 | 0 | |

8210004000 | Schnitzel- und Schneidgeräte | 8 | 0 | |

8210005000 | Geräte zum Öffnen, Verkorken und Versiegeln | 8 | 0 | |

8210008000 | andere Haushaltsgeräte zur Verarbeitung von Nahrungsmitteln | 8 | 0 | |

8210009000 | Teile | 8 | 0 | |

8211100000 | Zusammenstellungen | 8 | 0 | |

8211910000 | Tischmesser mit feststehender Klinge | 8 | 0 | |

8211920000 | andere Messer mit feststehender Klinge | 8 | 0 | |

8211930000 | Messer mit nicht feststehender Klinge, einschließlich Klappmesser für den Gartenbau | 8 | 0 | |

8211940000 | Klingen | 8 | 0 | |

8211950000 | Griffe aus unedlen Metallen | 8 | 0 | |

8212100000 | Rasiermesser und Rasierapparate | 8 | 0 | |

8212200000 | Rasierklingen, einschließlich Rasierklingenrohlinge im Band | 8 | 3 | |

8212900000 | andere Teile | 8 | 0 | |

8213001000 | Scheren | 8 | 0 | |

8213002010 | Schneiderscheren | 8 | 0 | |

8213002020 | Friseurscheren | 8 | 0 | |

8213002090 | andere | 8 | 0 | |

8213003000 | Nagelscheren | 8 | 0 | |

8213004000 | Scherenblätter | 8 | 0 | |

8213009000 | andere | 8 | 0 | |

8214101000 | Bleistiftspitzer | 8 | 0 | |

8214109000 | andere | 8 | 0 | |

8214200000 | Instrumente und Zusammenstellungen, für die Hand- oder Fußpflege (einschließlich Nagelfeilen) | 8 | 0 | |

8214901000 | Haarschneide- und -scherapparate | 8 | 0 | |

8214902000 | Spaltmesser, Hackmesser, Wiegemesser für Metzger/Fleischhauer oder für den Küchengebrauch | 8 | 0 | |

8214909000 | andere | 8 | 0 | |

8215100000 | Zusammenstellungen, die mindestens einen versilberten, vergoldeten oder platinierten Bestandteil enthalten | 8 | 0 | |

8215200000 | andere Zusammenstellungen | 8 | 0 | |

8215911000 | Löffel | 8 | 0 | |

8215912000 | Gabeln | 8 | 0 | |

8215913000 | Schöpflöffel und Schaumlöffel | 8 | 0 | |

8215914000 | Fischmesser und Buttermesser | 8 | 0 | |

8215915000 | Zangen aller Art | 8 | 0 | |

8215919000 | andere | 8 | 0 | |

8215991000 | Löffel | 8 | 0 | |

8215992000 | Gabeln | 8 | 0 | |

8215993000 | Schöpflöffel und Schaumlöffel | 8 | 0 | |

8215994000 | Fischmesser und Buttermesser | 8 | 0 | |

8215995000 | Zangen aller Art | 8 | 0 | |

8215999000 | andere | 8 | 0 | |

8301100000 | Vorhängeschlösser | 8 | 0 | |

8301200000 | Schlösser von der für Kraftfahrzeuge verwendeten Art | 8 | 0 | |

8301300000 | Schlösser von der für Möbel verwendeten Art | 8 | 0 | |

8301401000 | Türschlösser | 8 | 0 | |

8301409000 | andere | 8 | 0 | |

8301500000 | Verschlüsse und Verschlussbügel, mit Schloss | 8 | 0 | |

8301600000 | Teile | 8 | 0 | |

8301700000 | Schlüssel, gesondert gestellt | 8 | 0 | |

8302100000 | Scharniere | 8 | 0 | |

8302200000 | Laufrädchen oder -rollen | 8 | 0 | |

8302300000 | andere Beschläge und ähnliche Waren, für Kraftfahrzeuge | 8 | 0 | |

8302411000 | für Türen und Fenster | 8 | 0 | |

8302419000 | andere | 8 | 0 | |

8302420000 | andere, für Möbel | 8 | 0 | |

8302491000 | für Reisekisten, Koffer oder ähnliche Reiseartikel | 8 | 0 | |

8302499000 | andere | 8 | 0 | |

8302500000 | Kleiderhaken, Huthalter, Konsolen, Stützen und ähnliche Waren | 8 | 0 | |

8302600000 | automatische Türschließer | 8 | 0 | |

8303001000 | Geldschränke | 8 | 0 | |

8303009000 | andere | 8 | 0 | |

8304000000 | Sortierkästen, Ablegekästen, Karteikästen, Manuskriptständer, Federschalen, Stempelhalter und ähnliche Ausstattungsgegenstände für Büros, aus unedlen Metallen, ausgenommen Büromöbel der Position 9403 | 8 | 0 | |

8305100000 | Mechaniken für Schnellhefter oder Aktenordner | 8 | 0 | |

8305200000 | Heftklammern, zusammenhängend in Streifen | 8 | 0 | |

8305900000 | andere, einschließlich Teile | 8 | 0 | |

8306100000 | Glocken, Klingeln, Gongs und ähnliche Waren | 8 | 0 | |

8306210000 | versilbert, vergoldet oder platiniert | 8 | 0 | |

8306290000 | andere | 8 | 0 | |

8306301000 | Rahmen für Fotografien, Bilder oder dergleichen | 8 | 0 | |

8306302000 | Spiegel aus unedlen Metallen | 8 | 0 | |

8307100000 | aus Eisen oder Stahl | 8 | 0 | |

8307900000 | aus anderen unedlen Metallen | 8 | 0 | |

8308101000 | Klammern | 8 | 0 | |

8308102000 | Haken und Ösen | 8 | 0 | |

8308200000 | Hohlniete und Zweispitzniete | 8 | 0 | |

8308901000 | Verschlüsse und Verschlussbügel | 8 | 0 | |

8308902000 | Schnallen und Spangen | 8 | 0 | |

8308903000 | Perlen | 8 | 0 | |

8308904000 | zugeschnittener Flitter | 8 | 0 | |

8308909000 | andere | 8 | 0 | |

8309100000 | Kronenverschlüsse | 8 | 0 | |

8309901000 | handelsübliche Deckel von Dosen (Easy Open End) | 8 | 0 | |

8309909000 | andere | 8 | 0 | |

8310000000 | Aushängeschilder, Hinweisschilder, Namensschilder und ähnliche Schilder, Zahlen, Buchstaben und andere Zeichen, aus unedlen Metallen, ausgenommen Schilder und Zeichen der Position 9405 | 8 | 0 | |

8311101000 | zur Verwendung bei der Herstellung von Halbleitern | 8 | 0 | |

8311109000 | andere | 8 | 0 | |

8311201000 | zur Verwendung bei der Herstellung von Halbleitern | 8 | 0 | |

8311209000 | andere | 8 | 0 | |

8311301000 | zur Verwendung bei der Herstellung von Halbleitern | 8 | 0 | |

8311309010 | Lötmittel aus Blei-Zinn-Legierungen | 8 | 0 | |

8311309090 | andere | 8 | 0 | |

8311901000 | zur Verwendung bei der Herstellung von Halbleitern | 8 | 0 | |

8311909000 | andere | 8 | 0 | |

8401100000 | Kernreaktoren | 0 | 0 | |

8401200000 | Maschinen und Apparate für die Isotopentrennung sowie Teile davon | 0 | 0 | |

8401300000 | nicht bestrahlte Brennstoffelemente für Kernreaktoren | 0 | 0 | |

8401400000 | Teile von Kernreaktoren | 0 | 0 | |

8402110000 | Wasserrohrkessel mit einer Dampfleistung von mehr als 45 t/h | 8 | 3 | |

8402120000 | Wasserrohrkessel mit einer Dampfleistung von 45 t/h oder weniger | 8 | 0 | |

8402191000 | Heizkessel mit wärmeabgebendem Medium | 8 | 0 | |

8402199000 | andere | 8 | 0 | |

8402200000 | Kessel zum Erzeugen von überhitztem Wasser | 8 | 0 | |

8402901000 | Dampfkessel | 8 | 0 | |

8402902000 | Kessel zum Erzeugen von überhitztem Wasser | 8 | 0 | |

8403101000 | Zentralheizungskessel, mit Heizöl betrieben | 8 | 0 | |

8403102000 | Zentralheizungskessel, mit Kohle oder Koks betrieben | 8 | 0 | |

8403103000 | Zentralheizungskessel, mit Gas betrieben | 8 | 0 | |

8403109000 | andere | 8 | 0 | |

8403900000 | Teile | 8 | 0 | |

8404101000 | Vorwärmer | 8 | 0 | |

8404102000 | Überhitzer | 8 | 0 | |

8404103000 | Rußbläser | 8 | 0 | |

8404104000 | Rauchgasrückführungen | 8 | 0 | |

8404109000 | andere | 8 | 0 | |

8404200000 | Kondensatoren für Dampfkraftmaschinen | 8 | 0 | |

8404901000 | von Kondensatoren für Dampfkessel | 8 | 0 | |

8404902000 | von Kondensatoren für Dampfkraftmaschinen | 8 | 0 | |

8404909000 | andere | 8 | 0 | |

8405101000 | Generatorgaserzeuger | 8 | 0 | |

8405102000 | Wassergaserzeuger | 8 | 0 | |

8405103000 | Acetylenentwickler | 8 | 0 | |

8405104000 | Sauerstofferzeuger | 8 | 0 | |

8405109000 | andere | 8 | 0 | |

8405901000 | von Generatorgaserzeugern | 8 | 0 | |

8405902000 | von Wassergaserzeugern | 8 | 0 | |

8405903000 | von Acetylenentwicklern | 8 | 0 | |

8405904000 | von Sauerstofferzeugern | 8 | 0 | |

8405909000 | andere | 8 | 0 | |

8406103000 | mit einer Leistung von mehr als 2 MW | 5 | 0 | |

8406109000 | andere | 5 | 0 | |

8406811000 | mit einer Leistung von mehr als 40 MW bis 100 MW | 5 | 0 | |

8406812000 | mit einer Leistung von mehr als 100 MW bis 300 MW | 5 | 5 | |

8406813000 | mit einer Leistung von mehr als 300 MW | 5 | 5 | |

8406820000 | mit einer Leistung von 40 MW oder weniger | 5 | 0 | |

8406901000 | von Dampfturbinen für den Antrieb von Wasserfahrzeugen | 8 | 3 | |

8406909000 | andere | 8 | 3 | |

8407100000 | Motoren für Luftfahrzeuge | 0 | 0 | |

8407210000 | Außenbordmotoren | 8 | 0 | |

8407290000 | andere | 8 | 0 | |

8407311000 | für Krafträder | 8 | 0 | |

8407319000 | andere | 8 | 0 | |

8407321000 | für Krafträder | 8 | 0 | |

8407329000 | andere | 8 | 0 | |

8407331000 | für Krafträder | 8 | 0 | |

8407339000 | andere | 8 | 0 | |

8407341000 | für Krafträder | 8 | 0 | |

8407349000 | andere | 8 | 0 | |

8407901000 | für Lokomotiven | 0 | 0 | |

8407909000 | andere | 8 | 0 | |

8408101000 | mit einer Nennleistung von 300 kW oder weniger | 8 | 3 | |

8408102000 | mit einer Nennleistung von mehr als 300 kW bis 2000 kW | 8 | 3 | |

8408103000 | mit einer Nennleistung von mehr als 2000 kW | 8 | 0 | |

8408201000 | mit einem Hubraum von 1000 cm3 oder weniger | 8 | 0 | |

8408202000 | mit einem Hubraum von mehr als 1000 cm3 bis 2000 cm3 | 8 | 0 | |

8408203000 | mit einem Hubraum von mehr als 2000 cm3 bis 4000 cm3 | 8 | 0 | |

8408204000 | mit einem Hubraum von mehr als 4000 cm3 bis 10000 cm3 | 8 | 5 | |

8408205000 | mit einem Hubraum von mehr als 10000 cm3 | 8 | 5 | |

8408901010 | Verbrennungsmotoren für Lokomotiven | 0 | 0 | |

8408901090 | andere | 5 | 0 | |

8408909010 | Verbrennungsmotoren für Schiffe | 8 | 3 | |

8408909021 | zur Erzeugung einer Leistung von mindestens 400 kW (mit 1500 oder 1800 U/min) | 4 | 0 | |

8408909029 | andere | 8 | 0 | |

8408909030 | Verbrennungsmotoren für Maschinen der Unterposition 8429 | 8 | 0 | |

8408909090 | andere | 8 | 0 | |

8409100000 | von Motoren für Luftfahrzeuge | 5 | 0 | |

8409911000 | für Fahrzeuge des Kapitels 87 | 8 | 0 | |

8409912000 | für Außenbordmotoren | 8 | 0 | |

8409919000 | andere | 8 | 0 | |

8409991000 | für Lokomotiven und Schienenfahrzeuge | 5 | 0 | |

8409992000 | für Fahrzeuge des Kapitels 87 | 8 | 0 | |

8409993010 | von Verbrennungsmotoren mit einer Nennleistung von 300 kW oder weniger | 8 | 0 | |

8409993020 | von Verbrennungsmotoren mit einer Nennleistung von mehr als 300 kW bis 2000 kW | 8 | 3 | |

8409993030 | von Verbrennungsmotoren mit einer Nennleistung von 2000 kW oder mehr | 8 | 3 | |

8409999010 | für Generatoren | 8 | 3 | |

8409999090 | andere | 8 | 3 | |

8410111000 | Wasserturbinen | 0 | 0 | |

8410119000 | andere | 8 | 0 | |

8410120000 | mit einer Leistung von mehr als 1000 kW bis 10000 kW | 0 | 0 | |

8410130000 | mit einer Leistung von mehr als 10000 kW | 0 | 0 | |

8410901010 | für Wasserturbinen | 0 | 0 | |

8410901090 | andere | 8 | 0 | |

8410909010 | für Wasserturbinen | 0 | 0 | |

8410909090 | andere | 8 | 0 | |

8411111000 | für Luftfahrzeuge | 3 | 0 | |

8411119010 | für Wasserfahrzeuge | 8 | 0 | |

8411119090 | andere | 8 | 0 | |

8411121000 | für Luftfahrzeuge | 3 | 0 | |

8411129010 | für Wasserfahrzeuge | 8 | 0 | |

8411129090 | andere | 8 | 0 | |

8411211000 | für Luftfahrzeuge | 3 | 0 | |

8411219010 | für Wasserfahrzeuge | 8 | 0 | |

8411219090 | andere | 8 | 0 | |

8411221000 | für Luftfahrzeuge | 3 | 0 | |

8411229010 | für Wasserfahrzeuge | 8 | 3 | |

8411229090 | andere | 8 | 0 | |

8411811000 | für Luftfahrzeuge | 3 | 0 | |

8411819010 | für Wasserfahrzeuge | 8 | 3 | |

8411819090 | andere | 8 | 0 | |

8411821000 | für Luftfahrzeuge | 3 | 0 | |

8411829010 | für Wasserfahrzeuge | 8 | 3 | |

8411829090 | andere | 8 | 3 | |

8411911000 | für Luftfahrzeuge | 3 | 0 | |

8411919000 | andere | 8 | 0 | |

8411991000 | für Luftfahrzeuge | 3 | 0 | |

8411999000 | andere | 8 | 0 | |

8412101010 | Staustrahltriebwerke oder Pulsostrahltriebwerke | 5 | 0 | |

8412101090 | andere | 5 | 0 | |

8412109000 | andere | 8 | 0 | |

8412211000 | Hydrozylinder | 8 | 3 | |

8412219000 | andere | 8 | 0 | |

8412290000 | andere | 8 | 0 | |

8412310000 | linear arbeitend (Zylinder) | 8 | 0 | |

8412390000 | andere | 8 | 0 | |

8412800000 | andere | 8 | 0 | |

8412901010 | Staustrahltriebwerke oder Pulsostrahltriebwerke | 5 | 0 | |

8412901090 | andere | 5 | 0 | |

8412902000 | von Wassermotoren | 0 | 0 | |

8412909000 | andere | 8 | 0 | |

8413110000 | Ausgabepumpen für Kraftstoffe oder Schmiermittel, von der in Tankstellen oder Kraftfahrzeugwerkstätten verwendeten Art | 8 | 0 | |

8413190000 | andere | 8 | 5 | |

8413200000 | Handpumpen, ausgenommen solche der Unterposition 8413 11 oder 8413 19 | 8 | 0 | |

8413301000 | für Luftfahrzeuge | 8 | 0 | |

8413302000 | für Lokomotiven | 8 | 3 | |

8413303000 | für Wasserfahrzeuge | 8 | 5 | |

8413304000 | für Fahrzeuge des Kapitels 87 | 8 | 3 | |

8413309000 | andere | 8 | 5 | |

8413400000 | Betonpumpen | 8 | 0 | |

8413504000 | in Schwimmbecken verwendete Pumpen | 8 | 0 | |

8413509010 | Tauchkolbenpumpen | 8 | 0 | |

8413509020 | Kolbenpumpen | 8 | 5 | |

8413509030 | Membranpumpen | 8 | 0 | |

8413509090 | andere | 8 | 5 | |

8413604000 | in Schwimmbecken verwendete Pumpen | 8 | 0 | |

8413609010 | Zahnradpumpen | 8 | 0 | |

8413609020 | Flügelzellenpumpen | 8 | 0 | |

8413609030 | Schraubenspindelpumpen | 8 | 0 | |

8413609090 | andere | 8 | 5 | |

8413703000 | in Schwimmbecken verwendete Pumpen | 8 | 0 | |

8413709010 | Turbinenpumpen | 8 | 0 | |

8413709020 | Spiralpumpen | 8 | 0 | |

8413709090 | andere | 8 | 5 | |

8413811000 | in Schwimmbecken verwendete Pumpen | 8 | 0 | |

8413819000 | andere | 8 | 3 | |

8413820000 | Hebewerke für Flüssigkeiten | 8 | 0 | |

8413911000 | von Ausgabepumpen für Kraftstoffe oder Schmiermittel | 8 | 0 | |

8413912000 | von Verbrennungsmotoren | 8 | 0 | |

8413913000 | von Kolbenhubpumpen | 8 | 0 | |

8413914000 | von Kreiselpumpen | 8 | 3 | |

8413915000 | von Rotationspumpen | 8 | 0 | |

8413919000 | andere | 8 | 3 | |

8413920000 | von Hebewerken für Flüssigkeiten | 8 | 0 | |

8414101000 | für Luftfahrzeuge | 8 | 0 | |

8414109010 | für Maschinen und mechanische Apparate zur Herstellung von Halbleiterbauelementen (ausgenommen solche mit einem Endvakuum von nicht mehr als 9 × 10-3 Torr) | 3 | 0 | |

8414109090 | andere | 8 | 3 | |

8414200000 | hand- oder fußbetriebene Luftpumpen | 8 | 0 | |

8414301000 | mit einem Leistungsbedarf von weniger als 11 kW | 8 | 0 | |

8414302000 | mit einem Leistungsbedarf von nicht weniger als 11 kW | 8 | 3 | |

8414400000 | Luftkompressoren, auf Anhängerfahrgestell montiert | 8 | 0 | |

8414511000 | für Luftfahrzeuge | 8 | 0 | |

8414519000 | andere | 8 | 0 | |

8414591000 | für Luftfahrzeuge | 8 | 0 | |

8414599000 | andere | 8 | 3 | |

8414601000 | für Luftfahrzeuge | 8 | 0 | |

8414609000 | andere | 8 | 0 | |

8414801000 | Abzugshauben mit einer größten horizontalen Seitenlänge von mehr als 120 cm | 8 | 0 | |

8414809110 | für Luftfahrzeuge | 8 | 0 | |

8414809190 | andere | 8 | 3 | |

8414809210 | mit einem Leistungsbedarf von weniger als 74,6 kW | 8 | 5 | |

8414809220 | mit einem Leistungsbedarf von nicht weniger als 74,6 kW, jedoch weniger als 373 kW | 8 | 3 | |

8414809230 | mit einer Leistung von nicht weniger als 373 kW | 8 | 3 | |

8414809900 | andere | 8 | 3 | |

8414901000 | von Ventilatoren und Abzugshauben | 8 | 0 | |

8414909010 | von Kompressoren von der für Kältemaschinen verwendeten Art | 8 | 0 | |

8414909020 | von Luft- oder Gaskompressoren (ausgenommen solche für Kältemaschinen) | 8 | 0 | |

8414909090 | andere | 8 | 5 | |

8415101011 | mit einer Leistung von weniger als 11 kW | 8 | 0 | |

8415101012 | mit einer Leistung von nicht weniger als 11 kW | 8 | 0 | |

8415101021 | mit einer Leistung von weniger als 11 kW | 8 | 0 | |

8415101022 | mit einer Leistung von nicht weniger als 11 kW | 8 | 0 | |

8415102010 | mit einer Leistung von weniger als 11 kW | 8 | 0 | |

8415102020 | mit einer Leistung von nicht weniger als 11 kW | 8 | 0 | |

8415200000 | von der zum Komfort von Personen in Kraftfahrzeugen verwendeten Art | 8 | 0 | |

8415810000 | mit Kälteerzeugungsvorrichtung und einem Ventil zum Umkehren des Kühl-Heizkreislaufs (Umkehrwärmepumpen) | 8 | 0 | |

8415820000 | andere, mit Kälteerzeugungsvorrichtung | 8 | 0 | |

8415830000 | ohne Kälteerzeugungsvorrichtung | 8 | 0 | |

8415900000 | Teile | 8 | 0 | |

8416101000 | mit einem maximalen Brennstoffverbrauch von nicht mehr als 200 l pro Stunde | 8 | 0 | |

8416102000 | mit einem maximalen Brennstoffverbrauch von mehr als 200 l, jedoch weniger als 1500 l pro Stunde | 8 | 0 | |

8416103000 | mit einem maximalen Brennstoffverbrauch von nicht weniger als 1500 l pro Stunde | 8 | 0 | |

8416201000 | Brenner für Feuerungen, die mit pulverisiertem festem Brennstoff betrieben werden | 8 | 0 | |

8416202000 | Brenner für Feuerungen, die mit Gas betrieben werden | 8 | 0 | |

8416209000 | andere | 8 | 0 | |

8416300000 | automatische Feuerungen, einschließlich ihrer mechanischen Beschicker, mechanischen Roste, mechanischen Entascher und ähnlichen Vorrichtungen | 8 | 0 | |

8416901000 | von Brennern für Feuerungen | 8 | 0 | |

8416909000 | andere | 8 | 0 | |

8417101010 | für Eisenerze | 8 | 0 | |

8417101090 | andere | 8 | 0 | |

8417102010 | für Eisen oder Stahl | 8 | 0 | |

8417102090 | andere | 8 | 3 | |

8417200000 | Backöfen | 8 | 0 | |

8417801010 | für Zement | 8 | 0 | |

8417801020 | für Glas | 8 | 0 | |

8417801030 | für Keramik | 8 | 0 | |

8417801090 | andere | 8 | 0 | |

8417802000 | von der in Laboratorien verwendeten Art | 8 | 3 | |

8417809000 | andere | 8 | 0 | |

8417900000 | Teile | 8 | 0 | |

8418101010 | mit einem Inhalt von 200 l oder weniger | 8 | 0 | |

8418101020 | mit einem Inhalt von mehr als 200 l bis 400 l | 8 | 0 | |

8418101030 | mit einem Inhalt von mehr als 400 l | 8 | 0 | |

8418109000 | andere | 8 | 0 | |

8418211000 | mit einem Inhalt von weniger als 200 l | 8 | 0 | |

8418212000 | mit einem Inhalt von nicht weniger als 200 l, jedoch weniger als 400 l | 8 | 0 | |

8418213000 | mit einem Inhalt von nicht weniger als 400 l | 8 | 0 | |

8418291000 | elektrische Absorberkühlschränke | 8 | 0 | |

8418299000 | andere | 8 | 0 | |

8418300000 | Gefrier- und Tiefkühltruhen mit einem Inhalt von 800 l oder weniger | 8 | 0 | |

8418400000 | Gefrier- und Tiefkühlschränke mit einem Inhalt von 900 l oder weniger | 8 | 0 | |

8418501000 | Theken | 8 | 0 | |

8418509000 | andere | 8 | 0 | |

8418610000 | Wärmepumpen, andere als Klimageräte der Position 8415 | 8 | 0 | |

8418691000 | Kühlgeräte zur Lagerung von Blut | 8 | 0 | |

8418692010 | Eismaschinen (für Speiseeis) | 8 | 0 | |

8418692020 | Eiswürfelmaschinen | 8 | 0 | |

8418692030 | Wasserkühler | 8 | 0 | |

8418692090 | andere | 8 | 0 | |

8418693000 | Wärmepumpen | 8 | 0 | |

8418910000 | Möbel, ihrer Beschaffenheit nach zur Aufnahme einer Kälteerzeugungseinrichtung bestimmt | 8 | 0 | |

8418991000 | für Haushaltskühlschränke | 8 | 0 | |

8418999000 | andere | 8 | 0 | |

8419110000 | Gasdurchlauferhitzer | 8 | 0 | |

8419190000 | andere | 8 | 0 | |

8419200000 | Sterilisierapparate für medizinische oder chirurgische Zwecke oder für Laboratorien | 0 | 0 | |

8419310000 | für landwirtschaftliche Erzeugnisse | 8 | 0 | |

8419320000 | für Holz, Papierhalbstoff, Papier oder Pappe | 8 | 0 | |

8419391000 | Zentrifugaltrockner für Maschinen und mechanische Apparate zur Herstellung von Halbleiterbauelementen | 3 | 0 | |

8419399000 | andere | 8 | 0 | |

8419400000 | Destillier- und Rektifizierapparate | 8 | 0 | |

8419501000 | für Luftfahrzeuge | 8 | 0 | |

8419509000 | andere | 8 | 3 | |

8419600000 | Apparate und Vorrichtungen für die Luft- oder andere Gasverflüssigung | 8 | 0 | |

8419810000 | zum Zubereiten heißer Getränke oder zum Kochen oder Wärmen von Speisen | 8 | 0 | |

8419891000 | Polymerisationsautoklaven zur Herstellung synthetischer Spinnstoffe | 8 | 0 | |

8419899010 | Heizanlagen | 8 | 0 | |

8419899020 | Kühlanlagen | 8 | 0 | |

8419899030 | Verdampfungsanlagen | 8 | 0 | |

8419899040 | Kondensationsanlagen | 8 | 0 | |

8419899050 | Solarkollektoren und deren Ausrüstungen | 8 | 0 | |

8419899060 | Kammern mit konstanter hoher oder niedriger Temperatur | 8 | 0 | |

8419899070 | Kammern mit konstanter Temperatur und Feuchtigkeit | 8 | 0 | |

8419899080 | Klimageräte | 8 | 0 | |

8419899090 | andere | 8 | 0 | |

8419901000 | von Polymerisationsautoklaven zur Herstellung synthetischer Spinnstoffe | 8 | 0 | |

8419909010 | von Durchlauferhitzern und Heißwasserspeichern | 8 | 0 | |

8419909020 | von Apparaten und Vorrichtungen zum Zubereiten heißer Getränke oder zum Kochen oder Wärmen von Speisen | 8 | 0 | |

8419909030 | von Klimaanlagen- und -geräten | 8 | 0 | |

8419909040 | von Sterilisierapparaten für medizinische oder chirurgische Zwecke oder für Laboratorien | 0 | 0 | |

8419909090 | andere | 8 | 0 | |

8420101000 | für die Papierindustrie | 8 | 0 | |

8420102000 | für die Textilindustrie | 8 | 0 | |

8420103000 | für die Lederindustrie | 8 | 0 | |

8420104000 | für die Kautschuk- oder Kunststoffindustrie | 8 | 3 | |

8420109000 | andere | 8 | 0 | |

8420910000 | Walzen | 8 | 0 | |

8420990000 | andere | 8 | 0 | |

8421110000 | Milchentrahmer | 8 | 0 | |

8421120000 | Wäscheschleudern | 8 | 0 | |

8421191000 | für medizinische und chirurgische Zwecke oder für Laboratorien | 8 | 0 | |

8421192000 | für die Nahrungsmittelindustrie | 8 | 0 | |

8421193000 | für die Petrochemie | 8 | 0 | |

8421199000 | andere | 8 | 0 | |

8421211000 | von der im Haushalt verwendeten Art | 8 | 0 | |

8421219010 | Apparate zum Filtrieren oder Reinigen, in Schwimmbecken verwendet | 8 | 0 | |

8421219020 | Apparate zum Filtrieren oder Reinigen, zur Herstellung von Halbleiterbauelementen | 3 | 0 | |

8421219090 | andere | 8 | 0 | |

8421220000 | zum Filtrieren oder Reinigen von Getränken, ausgenommen Wasser | 8 | 0 | |

8421231000 | für Verbrennungsmotoren für Fahrzeuge des Kapitels 87 | 8 | 3 | |

8421232000 | für Luftfahrzeuge | 8 | 0 | |

8421239000 | andere | 8 | 0 | |

8421291000 | für die Milchindustrie | 8 | 0 | |

8421292000 | zur Behandlung schädlicher Abwässer | 8 | 3 | |

8421293000 | zur Verwendung bei der Herstellung von Halbleitern | 0 | 0 | |

8421294000 | für Luftfahrzeuge | 8 | 0 | |

8421299000 | andere | 8 | 0 | |

8421311000 | für Verbrennungsmotoren für Fahrzeuge des Kapitels 87 | 8 | 0 | |

8421312000 | für Luftfahrzeuge | 8 | 0 | |

8421319000 | andere | 8 | 0 | |

8421391000 | für die im Haushalt verwendeten Art | 8 | 0 | |

8421392000 | zur Reinigung von Abgasen für Fahrzeuge des Kapitels 87 | 8 | 0 | |

8421399010 | zur Behandlung schädlicher Abgase | 8 | 0 | |

8421399020 | zur Verwendung bei der Herstellung von Halbleitern | 0 | 0 | |

8421399030 | für Luftfahrzeuge | 8 | 0 | |

8421399090 | andere | 8 | 3 | |

8421910000 | von Zentrifugen, einschließlich Zentrifugaltrockner | 8 | 3 | |

8421991000 | zur Reinigung von Abgasen für Fahrzeuge des Kapitels 87 | 8 | 0 | |

8421999010 | von Apparaten zum Filtrieren oder Reinigen, für Kolbenverbrennungsmotoren | 8 | 0 | |

8421999020 | Filter für Apparate zum Reinigen | 8 | 0 | |

8421999030 | zur Verwendung bei der Herstellung von Halbleitern | 0 | 0 | |

8421999090 | andere | 8 | 3 | |

8422110000 | Haushaltsgeschirrspülmaschinen | 8 | 0 | |

8422190000 | andere | 8 | 0 | |

8422200000 | Maschinen und Apparate zum Reinigen oder Trocknen von Flaschen oder anderen Behältnissen | 8 | 0 | |

8422301000 | Maschinen und Apparate zum Füllen von Flaschen oder anderen Behältnissen | 8 | 0 | |

8422302000 | Maschinen und Apparate zum Verschließen oder Versiegeln von Flaschen oder anderen Behältnissen | 8 | 0 | |

8422303000 | Maschinen und Apparate zum Verkapseln oder Etikettieren von Flaschen oder anderen Behältnissen | 8 | 0 | |

8422304000 | Maschinen und Apparate zum Versetzen von Getränken mit Kohlensäure | 8 | 0 | |

8422309000 | andere | 8 | 0 | |

8422404000 | Schrumpffolienverpackungsmaschinen | 8 | 0 | |

8422409010 | automatische Maschinen und Apparate zum Umhüllen von Waren, einschließlich Binde- und Verschnürmaschinen | 8 | 0 | |

8422409020 | automatische Bündelpackmaschinen | 8 | 0 | |

8422409030 | Vakuumverpackungsmaschinen | 8 | 0 | |

8422409090 | andere | 8 | 0 | |

8422901000 | von Geschirrspülmaschinen | 8 | 0 | |

8422902000 | von anderen Maschinen und Apparaten zum Verpacken und Umhüllen von Waren | 8 | 3 | |

8422909000 | andere | 8 | 0 | |

8423100000 | Personenwaagen, einschließlich Säuglingswaagen; Haushaltswaagen | 8 | 0 | |

8423201000 | Waagen für Stetigförderer | 8 | 0 | |

8423202000 | Dosierwaagen und Schüttgutdosierer | 8 | 0 | |

8423209000 | andere | 8 | 0 | |

8423300000 | Absackwaagen, Abfüllwaagen, Dosierwaagen und andere Waagen zur Verwiegung konstanter Gewichtsmengen | 8 | 0 | |

8423810000 | für eine Höchstlast von 30 kg oder weniger | 8 | 0 | |

8423820000 | für eine Höchstlast von mehr als 30 kg bis 5000 kg | 8 | 0 | |

8423891000 | Brückenwaagen | 8 | 0 | |

8423899000 | andere | 8 | 0 | |

8423901010 | Gewichte für Waagen von Genauigkeitsklassen | 8 | 0 | |

8423901090 | andere | 8 | 0 | |

8423909000 | Teile von Waagen | 8 | 0 | |

8424100000 | Feuerlöscher, auch mit Füllung | 8 | 3 | |

8424201000 | Spritzpistolen | 8 | 0 | |

8424202010 | Roboter | 8 | 0 | |

8424202090 | andere | 8 | 3 | |

8424209000 | andere | 8 | 3 | |

8424301000 | Dampfstrahlapparate oder Sandstrahlmaschinen | 8 | 0 | |

8424302000 | Hochdruckdampfstrahlreiniger | 8 | 0 | |

8424309000 | andere | 8 | 0 | |

8424811000 | Spritz- und Sprühgeräte, selbstfahrend | 8 | 0 | |

8424812000 | andere Spritz- und Sprühgeräte | 8 | 0 | |

8424819000 | andere | 8 | 0 | |

8424891000 | zur Verwendung bei der Herstellung von Halbleitern | 0 | 0 | |

8424899000 | andere | 8 | 5 | |

8424901000 | von Feuerlöschern | 8 | 3 | |

8424902000 | von Spritzpistolen | 8 | 0 | |

8424903000 | von Spritz- und Sprühgeräten | 8 | 0 | |

8424909010 | zur Verwendung bei der Herstellung von Halbleitern | 0 | 0 | |

8424909090 | andere | 8 | 5 | |

8425111010 | Flaschenzüge | 0 | 0 | |

8425111090 | andere | 0 | 0 | |

8425112010 | Flaschenzüge | 0 | 0 | |

8425112090 | andere | 0 | 0 | |

8425190000 | andere | 0 | 0 | |

8425311000 | Fördermaschinen für Bergwerke, zum Hochziehen und Herablassen der Förderkörbe oder Skips; Spezialzugwinden für den Untertagebergbau | 0 | 0 | |

8425319000 | andere | 0 | 0 | |

8425391000 | Fördermaschinen für Bergwerke, zum Hochziehen und Herablassen der Förderkörbe oder Skips; Spezialzugwinden für den Untertagebergbau | 0 | 0 | |

8425399000 | andere | 0 | 0 | |

8425410000 | ortsfeste Hebebühnen von der in Kraftfahrzeugwerkstätten verwendeten Art | 0 | 0 | |

8425421000 | mit einer Tragfähigkeit von 10 Tonnen oder weniger | 0 | 0 | |

8425422000 | mit einer Tragfähigkeit von mehr als 10 Tonnen | 0 | 0 | |

8425491000 | mit einer Tragfähigkeit von 10 Tonnen oder weniger | 0 | 0 | |

8425492000 | mit einer Tragfähigkeit von mehr als 10 Tonnen | 0 | 0 | |

8426110000 | Konsol- oder Wandlaufkrane | 0 | 0 | |

8426121000 | auf luftbereiften Rädern fahrende Hubportale | 0 | 0 | |

8426122000 | Portalhubkraftkarren | 0 | 0 | |

8426190000 | andere | 0 | 0 | |

8426200000 | Turmdrehkrane | 0 | 0 | |

8426301000 | Portaldrehkrane | 0 | 0 | |

8426302000 | Bockdrehkrane | 0 | 0 | |

8426410000 | mit luftbereiften Rädern | 0 | 0 | |

8426491000 | mit Teleskopausleger | 0 | 0 | |

8426492000 | mit Gittermastausleger | 0 | 0 | |

8426499000 | andere | 0 | 0 | |

8426910000 | ihrer Beschaffenheit nach zum Aufbau auf Straßenfahrzeuge bestimmt | 0 | 0 | |

8426991000 | Derrickkrane | 0 | 0 | |

8426999000 | andere | 0 | 0 | |

8427101000 | Gegengewichtsstapler | 8 | 7 | |

8427102000 | andere Stapler, ausgenommen Gegengewichtsstapler | 8 | 3 | |

8427109000 | andere | 8 | 3 | |

8427201010 | mit einer Hublast von 3 Tonnen oder weniger | 8 | 5 | |

8427201020 | mit einer Hublast von mehr als 3 Tonnen | 8 | 5 | |

8427209000 | andere | 8 | 3 | |

8427901000 | Handgabelhubwagen | 8 | 3 | |

8427909000 | andere | 8 | 3 | |

8428101000 | Personenaufzüge | 0 | 0 | |

8428102000 | Lastenaufzüge | 0 | 0 | |

8428201000 | pneumatische Stetigförderer (Senkrechtförderer) | 0 | 0 | |

8428202000 | pneumatische Stetigförderer | 0 | 0 | |

8428310000 | ihrer Beschaffenheit nach für Arbeiten unter Tage bestimmt | 0 | 0 | |

8428320000 | andere, mit Kübeln | 0 | 0 | |

8428331010 | mit einer Hubgeschwindigkeit von weniger als 240 m pro Minute | 0 | 0 | |

8428331020 | mit einer Hubgeschwindigkeit von nicht weniger als 240 m pro Minute | 0 | 0 | |

8428332000 | Stetigförderer | 0 | 0 | |

8428390000 | andere | 0 | 0 | |

8428401000 | Rolltreppen | 0 | 0 | |

8428402000 | Rollsteige | 0 | 0 | |

8428600000 | Seilschwebebahnen, Sessellifte und Schlepplifte; Zugmechanismen für Standseilbahnen | 0 | 0 | |

8428901000 | Aufschieber, Vorzieher, Umgleiser (Schiebebühnen), Kipper und ähnliche Vorrichtungen zum Bewegen oder Handhaben von Lokomotiven, Wagons, Grubenwagen oder anderen Schienenfahrzeugen | 0 | 0 | |

8428909000 | andere | 0 | 0 | |

8429111000 | Planiermaschinen (Bulldozer) | 0 | 0 | |

8429112000 | Planiermaschinen (Angledozer) | 0 | 0 | |

8429190000 | andere | 0 | 0 | |

8429200000 | Erd- oder Straßenhobel (Grader) | 0 | 0 | |

8429300000 | Schürfwagen (Scraper) | 0 | 0 | |

8429401000 | Bodenverdichter | 0 | 0 | |

8429402000 | Straßenwalzen | 0 | 0 | |

8429511010 | Lader | 0 | 0 | |

8429511020 | Baggerlader | 0 | 0 | |

8429511030 | Kompaktbagger | 0 | 0 | |

8429511090 | andere | 0 | 0 | |

8429519000 | andere | 0 | 0 | |

8429521010 | auf Rädern | 0 | 0 | |

8429521020 | auf Gleisketten | 0 | 0 | |

8429521090 | andere | 0 | 0 | |

8429529000 | andere | 0 | 0 | |

8429591000 | Schaufellader | 0 | 0 | |

8429599000 | andere | 0 | 0 | |

8430100000 | Rammen und Pfahlzieher | 0 | 0 | |

8430200000 | Schneeräumer | 0 | 0 | |

8430310000 | selbstfahrend | 0 | 0 | |

8430390000 | andere | 0 | 0 | |

8430411000 | Bohrmaschinen | 0 | 0 | |

8430412000 | Tiefbohrgeräte | 0 | 0 | |

8430491000 | Maschinen für Testbohrungen | 0 | 0 | |

8430499000 | andere | 0 | 0 | |

8430500000 | andere selbstfahrende Maschinen, Apparate und Geräte | 0 | 0 | |

8430610000 | Maschinen, Apparate und Geräte zum Feststampfen oder Verdichten des Bodens | 0 | 0 | |

8430690000 | andere | 0 | 0 | |

8431100000 | von Maschinen, Apparaten und Geräten der Position 8425 | 0 | 0 | |

8431200000 | von Maschinen, Apparaten und Geräten der Position 8427 | 8 | 3 | |

8431310000 | von Personenaufzügen, Lastenaufzügen oder Rolltreppen | 0 | 0 | |

8431390000 | andere | 0 | 0 | |

8431411000 | von Baggern | 0 | 0 | |

8431419000 | andere | 0 | 0 | |

8431420000 | Planierschilde für Planiermaschinen (Bulldozer oder Angledozer) | 0 | 0 | |

8431430000 | Teile von Bohrmaschinen oder Tiefbohrgeräten der Unterposition 8430 41 oder 8430 49 | 0 | 0 | |

8431491000 | hydraulische Brecher | 0 | 0 | |

8431492000 | Crusher | 0 | 0 | |

8431499000 | andere | 0 | 0 | |

8432100000 | Pflüge | 0 | 0 | |

8432210000 | Scheibeneggen | 0 | 0 | |

8432291000 | Vertikutierer | 0 | 0 | |

8432292000 | Jätmaschinen | 0 | 0 | |

8432299000 | andere | 0 | 0 | |

8432301000 | Sämaschinen | 0 | 0 | |

8432302000 | Pflanzmaschinen | 0 | 0 | |

8432303000 | Setzmaschinen | 0 | 0 | |

8432309000 | andere | 0 | 0 | |

8432401000 | Stallmiststreuer | 0 | 0 | |

8432402000 | Düngerstreuer | 0 | 0 | |

8432800000 | andere Maschinen, Apparate und Geräte | 0 | 0 | |

8432901000 | von Pflügen | 0 | 0 | |

8432902000 | von automatischen Kultivatoren | 0 | 0 | |

8432909000 | andere | 0 | 0 | |

8433110000 | mit Motor und horizontal rotierendem Schneidwerk | 0 | 0 | |

8433190000 | andere | 0 | 0 | |

8433200000 | andere Mähmaschinen, einschließlich Mähbalken für Schlepperanbau | 0 | 0 | |

8433300000 | andere Heuernte-(Heuwerbungs-)maschinen, -apparate und -geräte | 0 | 0 | |

8433400000 | Stroh- und Futterpressen, einschließlich Aufnahmepressen | 0 | 0 | |

8433510000 | Mähdrescher | 0 | 0 | |

8433520000 | andere Dreschmaschinen und -geräte | 0 | 0 | |

8433530000 | Maschinen zum Ernten von Wurzeln oder Knollenfrüchten | 0 | 0 | |

8433590000 | andere | 0 | 0 | |

8433601000 | Maschinen zum Sortieren von Eiern | 0 | 0 | |

8433609010 | Maschinen zum Sortieren von landwirtschaftlichen Erzeugnissen | 0 | 0 | |

8433609090 | andere | 0 | 0 | |

8