This document is an excerpt from the EUR-Lex website
Document 32018R0669
Commission Regulation (EU) 2018/669 of 16 April 2018 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixturesText with EEA relevance.
Kommissionens forordning (EU) 2018/669 af 16. april 2018 om ændring med henblik på tilpasning til den tekniske og videnskabelige udvikling af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandingerEØS-relevant tekst.
Kommissionens forordning (EU) 2018/669 af 16. april 2018 om ændring med henblik på tilpasning til den tekniske og videnskabelige udvikling af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandingerEØS-relevant tekst.
C/2018/2154
EUT L 115 af 4.5.2018, p. 1–755
(BG, ES, CS, DA, DE, ET, EL, EN, FR, HR, IT, LV, LT, HU, MT, NL, PL, PT, RO, SK, SL, FI, SV)
In force
- Date of document:
- 16/04/2018; Vedtagelsesdato
- Date of effect:
- 24/05/2018; ikrafttrædelse off.gørelsesdato +20 se art 2
- Date of effect:
- 01/12/2019; Anvendelse se art 2
- Date of end of validity:
- No end date
- Author:
- Europa-Kommissionen, Generaldirektoratet for Miljø
- Responsible body:
- ENV
- Form:
- Forordning
- Additional information:
- interesse for EØS
- Treaty:
- Traktat om Den Europæiske Unions funktionsmåde
- Legal basis:
-
- 32008R1272 - A53P1
- Link
- Link
- Link
- Select all documents mentioning this document No data available in the table
- Modifies:
-
Relation Act Comment Subdivision concerned From To Modifies 32008R1272 erstatning bilag VI tekst 01/12/2019
No data available in the table
- Modified by:
-
Relation Act Comment Subdivision concerned From To Corrected by 32018R0669R(01) (FR) Corrected by 32018R0669R(02) (DE) - Instruments cited:
- Link
- EUROVOC descriptor:
- Subject matter:
- Directory code:
|
4.5.2018 |
DA |
Den Europæiske Unions Tidende |
L 115/1 |
KOMMISSIONENS FORORDNING (EU) 2018/669
af 16. april 2018
om ændring med henblik på tilpasning til den tekniske og videnskabelige udvikling af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandinger
(EØS-relevant tekst)
EUROPA-KOMMISSIONEN HAR —
under henvisning til traktaten om Den Europæiske Unions funktionsmåde,
under henvisning til Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 af 16. december 2008 om klassificering, mærkning og emballering af stoffer og blandinger og om ændring og ophævelse af direktiv 67/548/EØF og 1999/45/EF og om ændring af forordning (EF) nr. 1907/2006 (1), særlig artikel 53, stk. 1, og
ud fra følgende betragtninger:
|
(1) |
Tabel 3.1 og 3.2 i bilag VI til forordning (EF) nr. 1272/2008 indeholder listen over harmoniseret klassificering og mærkning af farlige stoffer, men kun på engelsk hvad angår alle forordningens sprogudgaver. |
|
(2) |
Den 2. december 2008 (2) forpligtede Kommissionen sig til at sikre, at de kemiske navne, der svarer til den internationale kemiske identifikation i tabel 3.1 og 3.2 i bilag VI til forordning (EF) nr. 1272/2008, offentliggøres på samme sprog som de sprogudgaver, på hvilke forordningen er offentliggjort. |
|
(3) |
Tabel 3.1 i bilag VI til forordning (EF) nr. 1272/2008 er blevet ændret flere gange for at afspejle den tekniske og videnskabelige udvikling ved at tilføje, slette og ændre stoffer eller deres klassificering. For at tage hensyn til disse forandringer og for at sikre, at alle kemiske navne i tabel 3.1 i bilag VI til forordning (EF) nr. 1272/2008 angives på det sprog, på hvilket forordningen er offentliggjort, vil tabel 3.1 til dels blive erstattet. |
|
(4) |
I henhold til undtagelsen (3), der gælder for oversættelsen til irsk af retsakter, der ikke er vedtaget af Europa-Parlamentet og Rådet i fællesskab, bør de kemiske navne i tabel 3.1 i bilag VI ikke oversættes til irsk. |
|
(5) |
Tabel 3.2 indeholder en liste over harmoniseret klassificering og mærkning af farlige stoffer baseret på de kriterier, der er anført i bilag VI til Rådets direktiv 67/548/EØF (4), der er ophævet med virkning fra 1. juni 2015. Som følge heraf vil tabel 3.2 udgå i henhold til artikel 1, stk. 2, i Kommissionens forordning (EU) 2016/1179 (5) med virkning fra 1. juni 2017. Den tabel bør derfor ikke ændres. Som følge deraf er tabel 3.1 blevet omdøbt til tabel 3 i overensstemmelse med artikel 2, stk. 2, i Kommissionens forordning (EU) 2017/776 (6) med virkning fra 1. juni 2017. |
|
(6) |
Leverandører bør gives tilstrækkelig tid til at tilpasse mærkningen og emballeringen af stoffer og blandinger til de nye bestemmelser vedrørende oversættelse og til at sælge eksisterende lagre. |
|
(7) |
Leverandører bør have mulighed for at anvende forordningen inden dens anvendelsesdato for at sikre et højt beskyttelsesniveau for menneskers sundhed og for miljøet og for derigennem at tilvejebringe tilstrækkelig fleksibilitet for leverandører. |
|
(8) |
Foranstaltningerne i denne forordning er i overensstemmelse med udtalelsen fra det udvalg, der er nedsat ved artikel 133 i Europa-Parlamentets og Rådets forordning (EF) nr. 1907/2006 (7) — |
VEDTAGET DENNE FORORDNING:
Artikel 1
De indgange, der er fastsat i bilag VI til forordning (EF) nr. 1272/2008 og svarer til de indgange, der er fastsat i bilaget til nærværende forordning, erstattes af de indgange, der er fastsat i bilaget til nærværende forordning.
Artikel 2
Denne forordning træder i kraft på tyvendedagen efter offentliggørelsen i Den Europæiske Unions Tidende.
Den anvendes fra den 1. december 2019
Uanset andet afsnit må stoffer og blandinger klassificeres, mærkes og emballeres i overensstemmelse med forordning (EF) nr. 1272/2008, som ændret ved nærværende forordning, før den 1. december 2019.
Denne forordning er bindende i alle enkeltheder og gælder umiddelbart i hver medlemsstat.
Udfærdiget i Bruxelles, den 16. april 2018.
På Kommissionens vegne
Jean-Claude JUNCKER
Formand
(1) EUT L 353 af 31.12.2008, s. 1.
(2) Berigtigelse af Europa-Parlamentets holdning, der blev fastlagt ved førstebehandlingen den 3. september 2008, med henblik på vedtagelse af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandinger og om ændring og ophævelse af direktiv 67/548/EØF og 1999/45/EF og om ændring af forordning (EF) nr. 1907/2006 — P6_TA(2008)0392 (KOM(2007)0355 — C6-0197/2007 — 2007/0121 (COD)).
(3) Rådets forordning (EU) nr. 1257/2010 af 20. december 2010 om forlængelse af de midlertidige undtagelsesforanstaltninger fra forordning nr. 1 af 15. april 1958 om den ordning, der skal gælde for Det Europæiske Økonomiske Fællesskab på det sproglige område, og fra forordning nr. 1 af 15. april 1958 om den ordning, der skal gælde for Det Europæiske Atomenergifællesskab på det sproglige område, der er indført ved forordning (EF) nr. 920/2005 (EUT L 343 af 29.12.2010, s. 5).
(4) Rådets direktiv 67/548/EØF af 27. juni 1967 om tilnærmelse af love og administrative bestemmelser om klassificering, emballering og etikettering af farlige stoffer (EFT 196 af 16.8.1967, s. 1).
(5) Kommissionens forordning (EU) 2016/1179 af 19. juli 2016 om ændring, med henblik på tilpasning til den tekniske og videnskabelige udvikling, af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandinger (EUT L 195 af 20.7.2016, s. 11).
(6) Kommissionens forordning (EU) 2017/776 af 4. maj 2017 om ændring, med henblik på tilpasning til den tekniske og videnskabelige udvikling, af Europa-Parlamentets og Rådets forordning (EF) nr. 1272/2008 om klassificering, mærkning og emballering af stoffer og blandinger (EUT L 116 af 5.5.2017, s. 1).
(7) Europa-Parlamentets og Rådets forordning (EF) nr. 1907/2006 af 18. december 2006 om registrering, vurdering, godkendelse af samt begrænsninger for kemikalier (REACH), om oprettelse af et europæisk kemikalieagentur og om ændring af direktiv 1999/45/EF og ophævelse af Rådets forordning (EØF) nr. 793/93 og Kommissionens forordning (EF) nr. 1488/94 samt Rådets direktiv 76/769/EØF og Kommissionens direktiv 91/155/EØF, 93/67/EØF, 93/105/EF og 2000/21/EF (EUT L 396 af 30.12.2006, s. 1).
BILAG
|
Indeksnr. |
International kemisk identifikation |
EF nr. |
CAS nr. |
Klassificering |
Mærkning |
Specifikke koncentrationsgrænser, M-faktorer |
Noter |
|||
|
Fareklasse og kategorikode(r) |
Fare-sætnings-kode(r) |
Piktogram-, signalordskode(r) |
Faresætningskode(r) |
Suppl. faresætningskode(r) |
||||||
|
(1) |
(2) |
(3) |
(4) |
(5) |
(6) |
(7) |
(8) |
(9) |
(10) |
(11) |
|
001-001-00-9 |
hydrogen (brint) |
215-605-7 |
1333-74-0 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
001-002-00-4 |
aluminiumlithiumhydrid |
240-877-9 |
16853-85-3 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
|
|
|
|
001-003-00-X |
natriumhydrid |
231-587-3 |
7646-69-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
001-004-00-5 |
calciumhydrid |
232-189-2 |
7789-78-8 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
003-001-00-4 |
lithium |
231-102-5 |
7439-93-2 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
003-002-00-X |
n-hexyllithium |
404-950-0 |
21369-64-2 |
Water-react. 1 Pyr. Sol. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
003-003-00-5 |
(2-methylpropyl)lithium; isobutyllithium |
440-620-2 |
920-36-5 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H314 H336 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014 |
|
|
|
004-001-00-7 |
beryllium |
231-150-7 |
7440-41-7 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
004-002-00-2 |
berylliumforbindelser med undtagelse af aluminiumberylliumsillicater samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
|
|
A |
|
004-003-00-8 |
berylliumoxid |
215-133-1 |
1304-56-9 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
005-001-00-X |
bortrifluorid |
231-569-5 |
7637-07-2 |
Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014 |
|
U |
|
005-002-00-5 |
bortriclorid |
233-658-4 |
10294-34-5 |
Press. Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
U |
|
005-003-00-0 |
bortribromid |
233-657-9 |
10294-33-4 |
Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
|
|
005-004-00-6 |
trialkylboraner, fast |
— |
— |
Pyr. Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-004-01-3 |
trialkylboraner, flydende |
— |
— |
Pyr. Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-005-00-1 |
trimethylborat |
204-468-9 |
121-43-7 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
|
|
|
|
005-006-00-7 |
dibutyltinhydrogenborat |
401-040-5 |
75113-37-0 |
Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H341 H372 H312 H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H360FD H341 H372 ** H312 H302 H318 H317 H410 |
|
|
|
|
005-007-00-2 |
borsyre; [1] borsyre; [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD: C ≥ 5,5 % |
|
|
005-008-00-8 |
dibortrioxid; boroxid |
215-125-8 |
1303-86-2 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD:C ≥ 3,1 % |
|
|
005-009-00-3 |
tetrabutylammonium butyltriphenylborat |
418-080-4 |
120307-06-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
005-010-00-9 |
N, N-dimethylanilinium-tetrakis(pentafluorphenyl)borat |
422-050-6 |
118612-00-3 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
|
|
|
|
005-011-00-4 |
dinatriumtetraborat, vandfrit; borsyredinatriumsalt; [1] tetrabordinatriumheptaoxid, hydrat; [2] orthoborsyre, natriumsalt [3] |
215-540-4 [1] 235-541-3 [2] 237-560-2 [3] |
1330-43-4 [1] 12267-73-1 [2] 13840-56-7 [3] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 4,5 % |
|
|
005-011-01-1 |
dinatriumtetraborat decahydrat; borax decahydrat |
215-540-4 |
1303-96-4 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD: C ≥ 8,5 % |
|
|
005-011-02-9 |
dinatriumtetraborat pentahydrat; borax pentahydrat |
215-540-4 |
12179-04-3 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr.1B; H360FD: C ≥ 6,5 % |
|
|
005-012-00-X |
diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienyliden]cyclohexa-2,5-dienyliden}ammonium butyltriphenylborat(1-) |
418-070-1 |
141714-54-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
005-013-00-5 |
diethylmethoxyboran |
425-380-9 |
7397-46-8 |
Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373 ** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373 ** H314 H317 H413 |
|
|
|
|
005-014-00-0 |
4-formylphenylboronsyre |
438-670-5 |
87199-17-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
005-015-00-6 |
1-chlormethyl-4-fluor-1,4-diazoniabicyclo[2.2.2]octanbis(tetrafluorborat) |
414-380-4 |
140681-55-6 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
005-016-00-1 |
tetrabutylammonium-butyl-tris-(4-tert-butylphenyl)borat |
431-370-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
005-017-00-7 |
natriumperborat; [1] natriumperoxometaborat; [2] natriumperoxoborat; [indeholdende < 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr.1B; H360Df: C ≥ 9 % Repr.1B; H360 D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-017-01-4 |
natriumperborat; [1] natriumperoxometaborat; [2] natriumperoxoborat; [indeholdende ≥ 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-018-00-2 |
perborsyre, (H3BO2(O2)), mononatriumsalt trihydrat; [1] perborsyre, natriumsalt, tetrahydrat; [2] perborsyre (HBO(O2)), natriumsalt, tetrahydrat [3] natriumperoxoborat hexahydrat; [indeholdende < 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H335 H318 |
|
Repr. 1B; H360Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-018-01-X |
perborsyre (H3BO2(O2)), mononatriumsalt trihydrat; [1] perborsyre, natriumsalt, tetrahydrat; [2] perborsyre (HBO(O2)), natriumsalt, tetrahydrat; [3] natriumperoxoborat hexahydrat; [indeholdende ≥ 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
|
Repr. 1B; H360 Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-019-00-8 |
perborsyre, natriumsalt; [1] perborsyre, natriumsalt, monohydrat; [2] perborsyre (HBO(O2)), natriumsalt, monohydrat; [3] natriumperoxoborat; [indeholdende < 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-019-01-5 |
perborsyre, natriumsalt; [1] perborsyre, natriumsalt, monohydrat; [2] perborsyre (HBO(O2)), natriumsalt, monohydrat; [3] natriumperoxoborat; [indeholdende ≥ 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
006-001-00-2 |
carbonmonoxid |
211-128-3 |
630-08-0 |
Flam. Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
|
|
U |
|
006-002-00-8 |
phosgen; carbonylchlorid |
200-870-3 |
75-44-5 |
Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
|
|
U |
|
006-003-00-3 |
carbondisulfid |
200-843-6 |
75-15-0 |
Flam. Liq. 2 Repr. 2 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H361fd H372 ** H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
|
Repr. 2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
006-004-00-9 |
calciumcarbid |
200-848-3 |
75-20-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
T |
|
006-005-00-4 |
thiram (ISO); tetramethylthiuramdisulfid |
205-286-2 |
137-26-8 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
|
M = 10 |
|
|
006-006-00-X |
hydrogencyanid; blåsyre |
200-821-6 |
74-90-8 |
Flam. Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
|
|
|
|
006-006-01-7 |
hydrogencyanid … %; blåsyre … % |
200-821-6 |
74-90-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
B |
|
006-007-00-5 |
salte af hydrogencyanid med undtagelse af komplekse salte som cyanoferrat (II) og-(III) og kviksølv(II)oxidcyanid samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032 |
|
A |
|
006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourinstof |
201-706-3 |
86-88-4 |
Acute Tox. 2 * Carc. 2 |
H300 H351 |
GHS06 GHS08 Dgr |
H300 H351 |
|
|
|
|
006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yldimethylcarbamat; isolan |
204-318-2 |
119-38-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyldimethylcarbamat; 5,5-dimethyldihydroresorcinoldimethylcarbamat; dimetan |
204-525-8 |
122-15-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
006-011-00-7 |
carbaryl (ISO); 1-naphthylmethylcarbamat |
200-555-0 |
63-25-2 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
|
M = 100 |
|
|
006-012-00-2 |
ziram (ISO); zink-bis(N, N-dimethyldithiocarbamat) |
205-288-3 |
137-30-4 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H373 ** H335 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
|
M = 100 |
|
|
006-013-00-8 |
metam-natrium (ISO); natrium-N-methyldithiocarbamat |
205-293-0 |
137-42-8 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031 |
|
|
|
006-014-00-3 |
nabam (ISO); dinatriumethylenbisdithiocarbamat |
205-547-0 |
142-59-6 |
Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
|
|
|
|
006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorphenyl)-1,1-dimethylurinstof |
206-354-4 |
330-54-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H373 ** H410 |
|
M = 10 |
|
|
006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenylmethylcarbamat; 2-isopropoxyphenylmethylcarbamat |
204-043-8 |
114-26-1 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propionaldehyd-O-(methylcarbamoyl)oxim |
204-123-2 |
116-06-3 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
|
|
|
006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolylmethylcarbamat |
217-990-7 |
2032-59-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
006-019-00-0 |
di-allat (ISO); S-2,3-dichlorallyldiisopropylthiocarbamat |
218-961-1 |
2303-16-4 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl-3-chlorphenylcarbamat |
202-930-4 |
101-27-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorphenyl)-1-methoxy-1-methylurinstof |
206-356-5 |
330-55-2 |
Repr. 1B Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
|
|
|
|
006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methyl-7-benzofuranyl-methylcarbamat |
— |
1563-67-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 4-methylthio-3,5-xylylmethylcarbamat methiocarb |
217-991-2 |
2032-65-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-024-00-8 |
proxan-Na (ISO); natrium-isopropyl-xanthogenat |
205-443-5 |
140-93-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3RS)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat; [1] S-bioallethrin; [2] (S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat; [3] esbiothrin; (RS)-3-allyl-2-methyl-4- oxocyclopent-2-enyl(1R,3R)- 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat |
209-542-4 [1] 249-013-5 [2]-[3] |
584-79-2 [1] 28434-00-6 [2] 84030-86-4 [3] |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
C |
|
006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-ylmethylcarbamat |
216-353-0 |
1563-66-2 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
|
006-028-00-X |
dinobuton (ISO); 2-sec-butyl-4,6-dinitrophenylisopropylcarbonat |
213-546-1 |
973-21-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenylmethylcarbamat |
230-253-4 |
6988-21-2 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
006-030-00-0 |
EPTC (ISO); S-ethyldipropylthiocarbamat |
212-073-8 |
759-94-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-031-00-6 |
formetanat (ISO); 3-[(EZ)-dimethylaminomethylenamino]phenylmethylcarbamat |
244-879-0 |
22259-30-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
006-032-00-1 |
monolinuron (ISO); 3-(4-dichlorphenyl)-1-methoxy-1-methylurinstof |
217-129-5 |
1746-81-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
006-033-00-7 |
metoxuron (ISO); N'-(3-chlor-4-methoxyphenyl)-N, N-dimethylurinstof |
243-433-2 |
19937-59-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
006-034-00-2 |
pebulat (ISO); S-propylbutyl (ethyl) thiocarbamat |
214-215-4 |
1114-71-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurinstof |
217-685-9 |
1929-88-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-037-00-9 |
promecarb (ISO); 5-isopropyl-3-tolylmethylcarbamat |
220-113-0 |
2631-37-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-038-00-4 |
sulfallat (ISO); 2-chlorallyldiethyldithiocarbamat |
202-388-9 |
95-06-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
006-039-00-X |
tri-allat (ISO); S-2,3,3-trichlorallyldiisopropylthiocarbamat |
218-962-7 |
2303-17-5 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
006-040-00-5 |
(3-methyl-1H-pyrazol-5-yl)-N, N-dimethylcarbamat; |
— |
2532-43-6 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
006-041-00-0 |
dimethylcarbamoylchlorid |
201-208-6 |
79-44-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H331 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
|
Carc. 1B; H350: C ≥ 0.001 % |
|
|
006-042-00-6 |
monuron (ISO); 3-(4-dichlorphenyl)-1,1-dimethylurinstof |
205-766-1 |
150-68-5 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
006-043-00-1 |
3-(4-chlorphenyl)-1,1-dimethyluroniumtrichloracetat; monuron-TCA |
— |
140-41-0 |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
|
|
|
|
006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurinstof |
251-835-4 |
34123-59-6 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 10 |
|
|
006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylidenamino-N-methylcarbamat |
240-815-0 |
16752-77-5 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
|
M = 100 |
|
|
006-047-00-3 |
bufencarb (ISO); blanding af 3-(1-methylbutyl) phenylmethylcarbamat og 3-(1-ethylpropyl) phenylmethylcarbamat (3:1) |
— |
8065-36-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
006-048-00-9 |
ethiofencarb (ISO); 2-ethylthiomethylphenylmethylcarbamat |
249-981-9 |
29973-13-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-049-00-4 |
dixanthogen; O,O-diethyldithiobis(thioformiat) |
207-944-4 |
502-55-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-050-00-X |
1,1-dimethylphenyluroniumtrichloracetat; fenuron-TCA |
— |
4482-55-7 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
006-051-00-5 |
ferbam (ISO); jerntris(dimethyldithiocarbamat) |
238-484-2 |
14484-64-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
006-052-00-0 |
formetanathydrochlorid; 3-(N, N-dimethylaminomethylenamino)phenyl-N-methylcarbamat |
245-656-0 |
23422-53-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
006-053-00-6 |
isoprocarb (ISO); O-cumenylmethylcarbamat |
220-114-6 |
2631-40-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-054-00-1 |
mexacarbat (ISO); 4-dimethylamino-3,5-xylylmethylcarbamat |
206-249-3 |
315-18-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamat; 3,4-xylylmethylcarbamat; MPMC |
219-364-9 |
2425-10-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-056-00-2 |
metolcarb (ISO); m-tolylmethylcarbamat; MTMC |
214-446-0 |
1129-41-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-057-00-8 |
nitrapyrin (ISO); 2-chlor-6-trichlormethylpyridin |
217-682-2 |
1929-82-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urinstof |
— |
2163-79-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamin-N-methylcarbamat |
245-445-3 |
23135-22-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
|
|
|
|
006-060-00-4 |
oxycarboxin (ISO); 5,6-dihydro-2-methyl-1,4-oxathiin-3-carboxanilid-4,4-dioxid |
226-066-2 |
5259-88-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
006-061-00-X |
S-ethyl-N-(dimethylaminopropyl)thiocarbamathydrochlorid; prothiocarb hydrochlorid |
243-193-9 |
19622-19-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-062-00-5 |
methyl-3,4-dichlorphenylcarbanilat SWEP |
— |
1918-18-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-063-00-0 |
thiobencarb (ISO); S-4-chlorbenzyldiethylthiocarbamat |
248-924-5 |
28249-77-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanon-O-(N-methylcarbamoyl)oxim |
254-346-4 |
39196-18-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
006-065-00-1 |
3-chlor-6-cyanobicyclo(2,2,1)heptan-2-on-O-(N-methylcarbamoyl)oxim; triamid |
— |
15271-41-7 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
|
|
|
|
006-066-00-7 |
vernolat (ISO); S-propyldipropylthiocarbamat |
217-681-7 |
1929-77-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-067-00-2 |
3,5-xylylmethylcarbamat; XMC |
— |
2655-14-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-068-00-8 |
diazomethan |
206-382-7 |
334-88-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
006-069-00-3 |
thiophanatmethyl (ISO); 1,2-di-(3-methoxycarbonyl-2-thioureido)benzen |
245-740-7 |
23564-05-8 |
Muta. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H317 H410 |
|
|
|
|
006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamid |
262-302-0 |
60568-05-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
006-071-00-4 |
cyclooct-4-en-1-ylmethylcarbonat |
401-620-8 |
87731-18-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
006-072-00-X |
prosulfocarb (ISO); S-benzyl-N, N-dipropylthiocarbamat |
401-730-6 |
52888-80-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
006-073-00-5 |
3-(dimethylamino)propylurinstof |
401-950-2 |
31506-43-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-ylisocyanat |
402-440-2 |
2094-99-7 |
Acute Tox. 2 * Skin Corr. 1B STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H314 H373 ** H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
|
|
|
|
006-076-00-1 |
mancozeb (ISO); manganethylenbis(dithiocarbamat) (polymer), kompleks med zinksalt |
— |
8018-01-7 |
Repr. 2 Skin Sens. 1 Aquatic Acute 1 |
H361d *** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H361d *** H317 H400 |
|
M = 10 |
|
|
006-077-00-7 |
maneb (ISO); manganethylenbis(dithiocarbamat) (polymer) |
235-654-8 |
12427-38-2 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d *** H332 H319 H317 H410 |
|
M = 10 |
|
|
006-078-00-2 |
zineb (ISO); zinkethylenbis(dithiocarbamat) (polymer) |
235-180-1 |
12122-67-7 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
|
|
|
006-079-00-8 |
disulfiram; tetraethylthiuramdisulfid |
202-607-8 |
97-77-8 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
006-080-00-3 |
tetramethylthiurammonosulfid |
202-605-7 |
97-74-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
006-081-00-9 |
zinkbis(dibutyldithiocarbamat) |
205-232-8 |
136-23-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
006-082-00-4 |
zinkbis(diethyldithiocarbamat) |
238-270-9 |
14324-55-1 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
|
|
|
|
006-083-00-X |
butocarboxim (ISO; 3-(methylthio)-2-butanon O-[(methylamino)carbonyl]oxim |
252-139-3 |
34681-10-2 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
|
|
|
|
006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamat |
259-565-9 |
55285-14-8 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
|
|
|
|
006-085-00-0 |
fenobucarb (ISO); 2-butylphenylmethylcarbamat |
223-188-8 |
3766-81-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-086-00-6 |
fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy)ethyl]carbamat |
276-696-7 |
72490-01-8 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 000 |
|
|
006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl-2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoat |
265-974-3 |
65907-30-4 |
Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373 ** H319 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H301 H373 ** H319 H315 H317 H410 |
|
M = 100 |
|
|
006-088-00-7 |
benfuracarb (ISO); ethyl-N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl-β-alaninat |
— |
82560-54-1 |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f *** H331 H302 H410 |
|
|
|
|
006-090-00-8 |
2-(3-iodprop-2-yn-1-yloxy)ethylphenylcarbamat |
408-010-0 |
88558-41-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
|
|
|
|
006-091-00-3 |
propineb (ISO) polymert zink-propylenbis(dithiocarbamat) |
— |
9016-72-2 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373 ** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373 ** H317 H400 |
|
|
|
|
006-092-00-9 |
tert-butyl-(1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamat |
425-420-5 |
98737-29-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
006-093-00-4 |
2,2'-dithio-di(ethylammonium)bis(dibenzyldithiocarbamat) |
427-180-7 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-094-00-X |
O-isobutyl-N-ethoxycarbonylthiocarbamat |
434-350-4 |
103122-66-3 |
Flam. Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373 ** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373 ** H317 H411 |
|
|
|
|
006-095-00-5 |
fosetyl-aluminium (ISO); aluminiumtriethyltriphosphonat |
254-320-2 |
39148-24-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
006-096-00-0 |
chlorpropham (ISO); isopropyl-3-chlorcarbanilat |
202-925-7 |
101-21-3 |
Carc. 2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373 ** H411 |
GHS08 GHS09 Wng |
H351 H373 ** H411 |
|
|
|
|
006-097-00-6 |
1-phenyl-3-(p-toluensulfonyl)urinstof |
424-620-1 |
13909-63-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
006-098-00-1 |
tert-butyl-(1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamat |
429-170-8 |
134575-17-0 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 |
|
|
|
|
006-099-00-7 |
N-(p-toluensulfonyl)-N'-(3-(p-toluensulfonyloxy)phenyl)urinstof; 3-({[(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl 4-methylbenzensulfonat |
520-2 |
232938-43-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
006-101-00-6 |
blanding af N, N''-(methylendi-4,1-phenylen)bis[N'-phenylurinstof]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurinstof; N, N''-(methylendi-4,1-phenylen)bis[N'-cyclohexylurinstof] |
423-070-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamat |
432-750-3 |
— |
Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373 ** H317 H411 |
|
|
|
|
006-103-00-7 |
N,N″-(methylendi-4,1-phenylen)bis[N′-octyl]urinstof |
445-760-8 |
— |
Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
|
M = 100 |
|
|
007-001-00-5 |
ammoniak, vandfri |
231-635-3 |
7664-41-7 |
Flam. Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
|
|
U |
|
007-001-01-2 |
ammoniak ....% |
215-647-6 |
1336-21-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
B |
|
007-002-00-0 |
nitrogendioxid; [1] dinitrogentetraoxid [2] |
233-272-6 [1] 234-126-4 [2] |
10102-44-0 [1] 10544-72-6 [2] |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
* STOT SE 3; H335: C ≥ 0,5 % |
5 |
|
007-003-00-6 |
chlormequatchlorid (ISO); 2-chlorethyltrimethylammoniumchlorid |
213-666-4 |
999-81-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
007-006-00-2 |
ethylnitrit |
203-722-6 |
109-95-5 |
Flam. Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
|
|
U |
|
007-007-00-8 |
ethylnitrat |
210-903-3 |
625-58-1 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
007-008-00-3 |
hydrazin |
206-114-9 |
302-01-2 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
|
007-009-00-9 |
dicyclohexylammoniumnitrit |
221-515-9 |
3129-91-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
|
007-010-00-4 |
natriumnitrit |
231-555-9 |
7632-00-0 |
Ox. Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
007-011-00-X |
kaliumnitrit |
231-832-4 |
7758-09-0 |
Ox. Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
007-012-00-5 |
N, N-dimethylhydrazin |
200-316-0 |
57-14-7 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
|
|
|
|
007-013-00-0 |
1,2-dimethylhydrazin |
— |
540-73-8 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
007-014-00-6 |
salte af hydrazin |
— |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
A |
|
007-015-00-1 |
O-ethylhydroxylamin |
402-030-3 |
624-86-2 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
|
|
|
|
007-016-00-7 |
butylnitrit |
208-862-1 |
544-16-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
|
|
|
|
007-017-00-2 |
isobutylnitrit |
208-819-7 |
542-56-3 |
Flam. Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
|
|
|
|
007-018-00-8 |
sec-butylnitrit |
213-104-8 |
924-43-6 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-019-00-3 |
tert-butylnitrit |
208-757-0 |
540-80-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-020-00-9 |
pentylnitrit; [1] amylnitrit, blanding af isomerer [2] |
207-332-7 [1] 203-770-8 [2] |
463-04-7 [1] 110-46-3 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-021-00-4 |
hydrazobenzen; 1,2-diphenylhydrazin |
204-563-5 |
122-66-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
007-022-00-X |
hydrazinbis(3-carboxy-4-hydroxybenzensulfonat) |
405-030-1 |
— |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
|
|
|
|
007-023-00-5 |
natrium-3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzensulfonat |
405-510-0 |
— |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
007-024-00-0 |
2-(decylthio)ethylammoniumchlorid |
405-640-8 |
36362-09-1 |
STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H315 H318 H410 |
|
|
|
|
007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethansulfonamidhydrochlorid |
406-090-1 |
81880-96-8 |
Muta. 2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
|
|
|
|
007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazid |
413-230-5 |
122035-71-6 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexan |
420-190-2 |
771478-66-1 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
|
|
|
|
007-028-00-2 |
hydroxylammoniumnitrat |
236-691-2 |
13465-08-2 |
Expl. 1,1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373 ** H319 H315 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373 ** H319 H315 H317 H400 |
|
|
|
|
007-029-00-8 |
diethyldimethylammoniumhydroxid |
419-400-5 |
95500-19-9 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
008-001-00-8 |
ilt |
231-956-9 |
7782-44-7 |
Ox. Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
|
|
U |
|
008-003-00-9 |
hydrogenperoxidopløsning … % |
231-765-0 |
7722-84-1 |
Ox. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
|
Ox. Liq. 1; H271: C ≥ 70 % **** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C< 8 % STOT SE 3; H335; C ≥ 35 % |
B |
|
009-001-00-0 |
fluor |
231-954-8 |
7782-41-4 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
|
|
|
009-002-00-6 |
hydrogenfluorid |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
009-003-00-1 |
hydrogenfluorid, opløsning … % |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
Skin Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C < 7 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
B |
|
009-004-00-7 |
natriumfluorid |
231-667-8 |
7681-49-4 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
EUH032 |
|
|
|
009-005-00-2 |
kaliumfluorid |
232-151-5 |
7789-23-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
009-006-00-8 |
ammoniumfluorid |
235-185-9 |
12125-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
009-007-00-3 |
natriumbifluorid; natriumhydrogenfluorid |
215-608-3 |
1333-83-1 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 * |
|
Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 7 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-008-00-9 |
kaliumbiflourid; kaliumhydrogenfluorid |
232-156-2 |
7789-29-9 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-009-00-4 |
ammoniumbiflourid; ammoniumhydrogenfluorid |
215-676-4 |
1341-49-7 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit.2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-010-00-X |
flourborsyre … % |
240-898-3 |
16872-11-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
009-011-00-5 |
hydrogensilicimhexafluorid … %, fluskiselsyre … % % |
241-034-8 |
16961-83-4 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
B |
|
009-012-00-0 |
ammonium- og alkalihexafluorosilicater(Na); [1] ammonium- og alkalihexafluorosilicater(K); [2] ammonium- og alkalihexafluorosilicater(NH4) [3] |
240-934-8 [1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9 [1] 16871-90-2 [2] 16919-19-0 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
* |
A |
|
009-013-00-6 |
hexafluorosilicater, undtagen de andetsteds i dette bilag nævnte |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
* |
A |
|
009-014-00-1 |
blyhexafluorosilicat |
247-278-1 |
25808-74-6 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
009-015-00-7 |
sulfuryldifluorid |
220-281-5 |
2699-79-8 |
Press. Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
|
|
U |
|
009-016-00-2 |
trinatriumhexafluoraluminat [1] trinatriumhexafluoraluminat(cryolite) [2] |
237-410-6 [1] 239-148-8 [2] |
13775-53-6 [1] 15096-52-3 [2] |
STOT RE 1 Acute Tox. 4 Aquatic Chronic 2 |
H372 H332 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
|
|
|
|
009-017-00-8 |
kalium-mu-fluor-bis(triethylaluminium) |
400-040-2 |
12091-08-6 |
Flam. Sol. 1 Water-react. 1 Skin Corr. 1A Acute Tox. 4 * |
H228 H270 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H228 H270 H314 H332 |
EUH014 |
|
T |
|
009-018-00-3 |
magnesiumhexafluorosilicat |
241-022-2 |
16949-65-8 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
* |
|
|
011-001-00-0 |
natrium |
231-132-9 |
7440-23-5 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
011-002-00-6 |
natriumhydroxid; kaustisk soda |
215-185-5 |
1310-73-2 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit.2; H319: 0,5 % ≤ C < 2 % |
|
|
011-003-00-1 |
natriumperoxid |
215-209-4 |
1313-60-6 |
Ox. Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
|
|
|
011-004-00-7 |
natriumazid |
247-852-1 |
26628-22-8 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032 |
|
|
|
011-005-00-2 |
natriumcarbonat |
207-838-8 |
497-19-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
011-006-00-8 |
natriumcyanat |
213-030-6 |
917-61-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
011-007-00-3 |
natriumpropoxycarbazon |
— |
181274-15-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
012-001-00-3 |
magnesiumpulver (ustabiliseret) |
231-104-6 |
7439-95-4 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
012-002-00-9 |
magnesiumpulver (stabiliseret) og -spåner |
231-104-6 |
— |
Flam. Sol. 1 Water-react. 2 Self-heat. 1 |
H228 H261 H252 |
GHS02 Dgr |
H228 H261 H252 |
|
|
T |
|
012-003-00-4 |
magnesiumalkyler |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
012-004-00-X |
aluminium-magnesium-carbonat-hydroxid-perchlorat-hydrat |
422-150-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
013-001-00-6 |
aluminiumpulver (ustabiliseret) |
231-072-3 |
7429-90-5 |
Water-react. 2 Pyr. Sol. 1 |
H261 H250 |
GHS02 Dgr |
H261 H250 |
|
|
T |
|
013-002-00-1 |
aluminiumpulver (stabiliseret) |
231-072-3 |
7429-90-5 |
Water-react. 2 Flam. Sol. 1 |
H261 H228 |
GHS02 Dgr |
H261 H228 |
|
|
T |
|
013-003-00-7 |
aluminiumchlorid, vandfrit |
231-208-1 |
7446-70-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
013-004-00-2 |
aluminiumalkyler |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
013-005-00-8 |
diethyl(ethyldimethylsilanolato)aluminium |
401-160-8 |
55426-95-4 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxy-2-propanolato)aluminium(III), dimeriseret |
402-370-2 |
— |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
403-430-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
013-008-00-4 |
di-n-octylaluminiumiodid |
408-190-0 |
7585-14-0 |
Pyr. Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014 |
|
|
|
013-009-00-X |
natrium((n-butyl)x(ethyl)y-1,5-dihydro)aluminat) x = 0,5 y = 1,5 |
418-720-2 |
— |
Flam. Sol. 1 Water-react. 1 Pyr. Sol. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H250 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014 |
|
T |
|
013-010-00-5 |
hydroxy-aluminium-bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxid) |
430-650-4 |
151841-65-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-001-00-9 |
trichlorsilan |
233-042-5 |
10025-78-2 |
Flam. Liq. 1 Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H224 H250 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H250 H332 H302 H314 |
EUH014 EUH029 |
* STOT SE 3; H335: C ≥ 1 % |
T |
|
014-002-00-4 |
Siliciumtetrafluorid |
233-054-0 |
10026-04-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
EUH014 |
|
|
|
014-003-00-X |
dichlordimethylsilan |
200-901-0 |
75-78-5 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
014-004-00-5 |
trichlor(methyl)silan; methyltrichlorsilan |
200-902-6 |
75-79-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014 |
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
014-005-00-0 |
tetraethylsilicat; ethylsilicat |
201-083-8 |
78-10-4 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
|
|
|
|
014-006-00-6 |
bis(4-fluorphenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silanhydrochlorid |
401-380-4 |
— |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
014-007-00-1 |
triethoxyisobutylsilan |
402-810-3 |
17980-47-1 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
014-008-00-7 |
(chlormethyl)bis(4-fluorphenyl)methylsilan |
401-200-4 |
85491-26-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-009-00-2 |
isobutylisopropyldimethoxysilan |
402-580-4 |
111439-76-0 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
|
|
|
|
014-010-00-8 |
dinatriummetasilicat |
229-912-9 |
6834-92-0 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
014-011-00-3 |
cyclohexyldimethoxymethylsilan |
402-140-1 |
17865-32-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amin |
403-480-3 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxan) |
404-920-7 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
|
|
|
|
014-014-00-X |
etacelasil (ISO); 6-(2-chlorethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecan |
253-704-7 |
37894-46-5 |
Repr. 1B Acute Tox. 4 * STOT RE 2 * |
H360D *** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D *** H302 H373 ** |
|
|
|
|
014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilandiyl]-co-oxy (dimethylsilan)) |
406-420-4 |
69430-40-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
014-016-00-0 |
blanding af 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxan; 1,3-dihexen-1-yl-1,1,3,3-tetramethyldisiloxan |
406-490-6 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-017-00-6 |
flusilazol (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silan |
— |
85509-19-9 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-018-00-1 |
octamethylcyclotetrasiloxan |
209-136-7 |
556-67-2 |
Repr. 2 Aquatic Chronic 4 |
H361f *** H413 |
GHS08 Wng |
H361f *** H413 |
|
|
|
|
014-019-00-7 |
blanding af 4-[[bis-(4-fluorphenyl)methylsilyl]methyl]-4H-1,2,4-triazol; 1-[[bis-(4-fluorphenyl)methylsilyl]methyl]-1H-1,2,4-triazol |
403-250-2 |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-020-00-2 |
bis(1,1-dimetil-2-propinilossi)dimetilsilano |
414-960-7 |
53863-99-3 |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
014-021-00-8 |
tris(isopropenyloxy)phenylsilan |
411-340-8 |
52301-18-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
|
|
|
|
014-022-00-3 |
reaktionsproduktet af (2-hydroxy-4-(3-propenoxy)benzophenon og triethoxysilan med (hydrolyseproduktet af silica og methyltrimethoxy-silan) |
401-530-9 |
— |
Flam. Sol. 1 STOT SE 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H228 H370 ** H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
|
|
T |
|
014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxan) |
408-160-7 |
125613-45-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-024-00-4 |
1-((3-(3-chlor-4-fluorphenyl)propyl)dimethylsilanyl)-4-ethoxybenzen |
412-620-2 |
121626-74-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidin |
411-400-3 |
102089-33-8 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
|
|
|
|
014-026-00-5 |
dichlor-(3-(3-chlor-4-fluorphenyl)propyl)methylsilan |
407-180-3 |
770722-36-6 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
014-027-00-0 |
chlor(3-(3-chlor-4-fluorphenyl)propyl)dimethylsilan |
410-270-5 |
770722-46-8 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyloxy-ω-[3-(1-oxoprop-2-enyl-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxan) |
415-290-8 |
193159-06-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
014-029-00-1 |
O, O'-(ethenylmethylsilylen)di[(4-methylpentan-2-on)oxim] |
421-870-1 |
156145-66-3 |
Repr. 2 Acute Tox. 4 * STOT RE 2 * |
H361f *** H302 H373 ** |
GHS08 GHS07 Wng |
H361f *** H302 H373 ** |
|
|
|
|
014-030-00-7 |
[(dimethylsilylen)bis((1,2,3,3a,7a-η)-1H-inden-1-yliden)dimethyl]hafnium |
422-060-0 |
137390-08-0 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilan |
421-540-7 |
18230-61-0 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
|
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilan |
404-370-8 |
126990-35-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoat, hydrolyseprodukt med silica |
419-030-4 |
125804-20-8 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
014-034-00-9 |
3-hexylheptamethyltrisiloxan |
428-700-5 |
1873-90-1 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silan |
425-050-4 |
10217-34-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluor-3-phenoxyphenyl)propyl)dimethylsilan |
405-020-7 |
105024-66-6 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F *** H400 H410 |
GHS08 GHS09 Dgr |
H360F *** H410 |
|
M = 1 000 |
|
|
014-037-00-5 |
2-butanon-O, O',O''-(phenylsilylidyn)trioxim |
433-360-6 |
34036-80-1 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H317 H412 |
GHS08 GHS07 Wng |
H373 ** H317 H412 |
|
|
|
|
014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanthioat |
436-690-9 |
220727-26-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilan |
439-360-2 |
142877-45-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
014-041-00-7 |
N, N-bis(trimethylsilyl)aminopropylmethyldiethoxysilan |
445-890-5 |
201290-01-9 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
014-042-00-2 |
blanding af O, O',O'',O'''-silantetrayl-tetrakis(4-methyl-2-pentanonoxim) (3 stereoisomerer) |
423-010-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
014-043-00-8 |
reaktionsprodukt mellem amorf silica (50-85 %), butyl(1-methylpropyl)magnesium (3-15 %), tetraethylorthosilicat (5-15 %) og titantetrachlorid (5-20 %) |
432-200-2 |
— |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H412 |
|
|
|
|
014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilan |
433-050-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-045-00-9 |
magnesiumnatriumfluoridsilicat |
442-650-1 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
015-001-00-1 |
phosphor, hvid og gul |
231-768-7 |
12185-10-3 |
Pyr. Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
|
|
|
|
015-002-00-7 |
phosphor, rød |
231-768-7 |
7723-14-0 |
Flam. Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
|
|
|
|
015-004-00-8 |
aluminiumphosphid |
244-088-0 |
20859-73-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
015-005-00-3 |
magnesiumphosphid; trimagnesiumdiphosphid |
235-023-7 |
12057-74-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
015-006-00-9 |
trizinkdiphosphid; zincphosphid |
215-244-5 |
1314-84-7 |
Water-react. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032 |
M = 100 |
T |
|
015-007-00-4 |
phosphortrichlorid |
231-749-3 |
7719-12-2 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029 |
|
|
|
015-008-00-X |
phosphorpentachlorid |
233-060-3 |
10026-13-8 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029 |
|
|
|
015-009-00-5 |
phosphoryltrichlorid |
233-046-7 |
10025-87-3 |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1A |
H330 H372 ** H302 H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029 |
|
|
|
015-010-00-0 |
phosphorpentaoxid |
215-236-1 |
1314-56-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
015-011-00-6 |
phosphorsyre …% orthophosphorsyre … % |
231-633-2 |
7664-38-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
015-012-00-1 |
tetraphosphortrisulfid; phosphorsesquisulfid |
215-245-0 |
1314-85-8 |
Flam. Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
|
|
T |
|
015-013-00-7 |
triethylphosphat |
201-114-5 |
78-40-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-014-00-2 |
tributylphosphat |
204-800-2 |
126-73-8 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
|
|
|
|
015-015-00-8 |
tricresylphosphater (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolylphosphater (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) |
201-103-5 |
78-30-8 |
STOT SE 1 Aquatic Chronic 2 |
H370 ** H411 |
GHS08 GHS09 Dgr |
H370 ** H411 |
|
STOT SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C |
|
015-016-00-3 |
tricresylphosphater (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolylphosphater (m-m-m-, m-m-p-, m-p-p-, p-p-p-) |
201-105-6 |
78-32-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
* |
C |
|
015-019-00-X |
dichlorvos (ISO); 2,2-dichlorvinyldimethylphosphat |
200-547-7 |
62-73-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
|
M = 1 000 |
|
|
015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyldimethylphosphat |
232-095-1 |
7786-34-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 000 |
|
|
015-021-00-0 |
trichlorfon (ISO); dimethyl-2,2,2-trichlor-1-hydroxyethylphosphonat |
200-149-3 |
52-68-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
|
M = 1 000 |
|
|
015-022-00-6 |
phosphamidon (ISO); (2-chlor-3-diethylamino-1-methyl-3-oxo-prop-1-en-yl)-dimethylphosphat |
236-116-5 |
13171-21-6 |
Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
|
|
|
|
015-023-00-1 |
pyrazoxon; O, O-diethyl-O-(3-methyl-1H-pyrazol-5-yl)-phosphat |
— |
108-34-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N, N,N',N'-tetramethylphosphondiamid |
— |
1031-47-6 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-025-00-2 |
TEPP (ISO); tetraethylpyrophosphat |
203-495-3 |
107-49-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramid |
205-801-0 |
152-16-9 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-027-00-3 |
sulfotep (ISO); O, O,O, O-tetraethyldithiopyrophosphat |
222-995-2 |
3689-24-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1 000 |
|
|
015-028-00-9 |
demeton-O (ISO); O, O-diethyl-O-2-ethylthioethylthiophosphat |
206-053-8 |
298-03-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethylthiophosphat |
204-801-8 |
126-75-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl-O, O-dimethylthiophosphat |
212-758-1 |
867-27-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyldimethylthiophosphat |
213-052-6 |
919-86-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
|
|
|
|
015-032-00-0 |
prothoat (ISO); O, O-diethylisopropylcarbamoylmethyldithiophosphat |
218-893-2 |
2275-18-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
|
|
|
|
015-033-00-6 |
phorat (ISO); O, O-diethylethylthiomethyldithiophosphat |
206-052-2 |
298-02-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1 000 |
|
|
015-034-00-1 |
parathion (ISO); O, O-diethyl-O-4-nitrophenylthiophosphat |
200-271-7 |
56-38-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
|
M = 100 |
|
|
015-035-00-7 |
parathion — methyl (ISO); O, O-dimethyl-O-4-nitrophenylthiophosphat |
206-050-1 |
298-00-0 |
Flam. Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
|
M = 100 |
|
|
015-036-00-2 |
O-ethyl-O-4-nitrophenylphenylthiophosphonat; EPN |
218-276-8 |
2104-64-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-037-00-8 |
phencapton (ISO); O, O-diethyl-S-(2,5-dichlorphenylthiomethyl)-dithiophosphat |
218-892-7 |
2275-14-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
015-038-00-3 |
coumaphos (ISO); O-3-chlor-4-methylcumarin-7-yl-O, O-diethylthiophosphat |
200-285-3 |
56-72-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
015-039-00-9 |
azinphos-methyl (ISO); O, O-dimethyl-4-oxobenzotriazin-3-ylmethyldithiophosphat |
201-676-1 |
86-50-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
|
|
|
|
015-040-00-4 |
diazinon (ISO); O, O-diethyl-O-2-isopropyl-6-methylpyrimidin-4-ylthiophosphat |
206-373-8 |
333-41-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl-O, O-dimethylphosphordithioat [indeholdende ≤ 0,03 % isomalathion] |
204-497-7 |
121-75-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M = 1 000 |
|
|
015-042-00-5 |
chlorthion; O-(3-chlor-4-nitrophenyl)-O, O-dimethylthiophosphat |
207-902-5 |
500-28-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 100 |
|
|
015-043-00-0 |
phosnichlor (ISO); O-(4-chlor-3-nitrophenyl)-O, O-dimethylthiophosphat |
— |
5826-76-6 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
015-044-00-6 |
carbophenothion (ISO); 4-chlorphenylthiomethyl-O, O-diethyldithiophosphat |
212-324-1 |
786-19-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl-O, O-diethyldithiophosphat |
219-993-9 |
2595-54-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
|
|
|
|
015-046-00-7 |
oxydemeton-methyl; O, O-dimethyl-S-2-(ethylsulfinyl)-ethyl)-thiophosphat |
206-110-7 |
301-12-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
|
|
|
|
015-047-00-2 |
ethion (ISO); O, O,O',O'-tetraethyl-S, S'-methylendi (dithiophosphat); diethion |
209-242-3 |
563-12-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 10 000 |
|
|
015-048-00-8 |
fenthion (ISO); O, O-dimethyl-O-(4-methylthion-m-tolyl) phosphorthioat |
200-231-9 |
55-38-9 |
Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372 ** H410 |
|
M = 100 |
|
|
015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyldimethylthiophosphat |
220-472-3 |
2778-04-3 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl-O, O-dimethyldithiophosphat |
211-362-6 |
640-15-3 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
015-051-00-4 |
dimethoat (ISO); O, O-dimethylmethylcarbamoylmethyldithiophosphat |
200-480-3 |
60-51-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-052-00-X |
fenchlorphos (ISO); O, O-dimethyl-O-2,4,5-trichlorphenylthiophosphat |
206-082-6 |
299-84-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O, O-dimethyldithiophosphat |
201-123-4 |
78-57-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
015-054-00-0 |
fenitrothion (ISO); O, O-dimethyl-O-4-nitro-m-tolylthiophosphat |
204-524-2 |
122-14-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-055-00-6 |
naled (ISO); 1,2-dibrom-2,2-dichlorethyldimethylphosphat |
206-098-3 |
300-76-5 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H312 H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
|
M = 1 000 |
|
|
015-056-00-1 |
azinphos-ethyl (ISO); O, O-diethyl-4-oxobenzotriazin-3-ylmethyldithiophosphat |
220-147-6 |
2642-71-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 100 |
|
|
015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl-O, O-dimethyldithiophosphat |
219-818-6 |
2540-82-1 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-058-00-2 |
morphothion (ISO); O, O-dimethyl-S-(morpholinocarbonylmethyl)-dithiophosphat |
205-628-0 |
144-41-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
015-059-00-8 |
vamidothion (ISO); dimethyl-S-2-(1-methylcarbamoylethylthio) ethylthiophospat |
218-894-8 |
2275-23-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
015-060-00-3 |
disulfoton (ISO); O, O-diethyl-2-ethylthioethyldithiophosphat |
206-054-3 |
298-04-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-061-00-9 |
dimefox (ISO); tetramethylphosphorsyrediamidfluorid |
204-076-8 |
115-26-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-062-00-4 |
mipafox (ISO); N, N'-diisopropylphosphorsyrediamidfluorid |
206-742-3 |
371-86-8 |
STOT SE 1 |
H370 ** |
GHS08 Dgr |
H370 ** |
|
|
|
|
015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O, O,O',O'-tetraethyldi (dithiophosphat) |
201-107-7 |
78-34-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
M = 1 000 |
|
|
015-064-00-5 |
bromophos-ethyl (ISO); O-4-brom-2,5-dichlorphenyl-O, O-diethylthiophosphat |
225-399-0 |
4824-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
015-065-00-0 |
S-2-ethylsulfinyl-ethyl-O, O-dimethyl-dithiophosphat |
— |
2703-37-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
|
|
015-066-00-6 |
omethoat (ISO); O, O-dimethyl-S-methylcarbamoylmethylthiophosphat |
214-197-8 |
1113-02-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
015-067-00-1 |
phosalon (ISO); S-(6-chlor-2-oxo-benzoxazolin-3-ylmethyl)-O, O-diethyl-phosphordithioat |
218-996-2 |
2310-17-0 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
|
M = 1 000 |
|
|
015-068-00-7 |
dichlofenthion (ISO); O-2,4-dichlorphenyl-O, O-diethylthiophosphat |
202-564-5 |
97-17-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O, O-dimethyldithiophosphat |
213-449-4 |
950-37-8 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
015-070-00-8 |
cyanthoat (ISO); S-(N-(1-cyano-1-methylethyl) carbamoylmethyl)-O, O-diethylthiophosphat |
223-099-4 |
3734-95-0 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-071-00-3 |
chlorfenvinphos (ISO); 2-chlor-1-(2,4-dichlorphenyl) vinyldiethylphosphat |
207-432-0 |
470-90-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinylphosphat |
230-042-7 |
6923-22-4 |
Muta. 2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
|
|
|
|
015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyldimethylphosphat |
205-494-3 |
141-66-2 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-074-00-X |
crufomat (ISO); 4-tert-butyl-2-chlorphenylmethylmethylphosphoramidat |
206-083-1 |
299-86-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-075-00-5 |
S-2-ethylsulfinyl-isopropyl-O, O-dimethyl-thiophosphat |
— |
2635-50-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
015-076-00-0 |
potasan; O, O-diethyl-O-(4-methyl-7-coumarinyl)-thiophosphat |
— |
299-45-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 1 000 |
|
|
015-077-00-6 |
O-(2,2-dichlorovinyl)-O-methyl-O-(2-ethylsulfinyl-ethyl)-phosphat |
— |
7076-53-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
015-078-00-1 |
demeton-S-methylsulfon (ISO); S-2-ethylsulfonylethyldimethylthiophosphat |
241-109-5 |
17040-19-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
|
|
|
|
015-079-00-7 |
acephat (ISO); O, S-dimethylacetylthiophosphoramidat |
250-241-2 |
30560-19-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl-O, O-dimethyldithiophosphat |
— |
919-76-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-081-00-8 |
O, O,O',O'-tetrapropyldithiopyrophosphat |
221-817-0 |
3244-90-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-082-00-3 |
azothoat (ISO); O-4-(4-chlor-phenylazo)-phenyl-O, O-dimethyl-thiophosphat |
227-419-3 |
5834-96-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
015-083-00-9 |
bensulid (ISO); O, O-diisopropyl-2-phenylsulfonylaminoethyldithiophosphat |
212-010-4 |
741-58-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-084-00-4 |
chlorpyrifos (ISO); O, O-diethyl-O-3,5,6-trichlor-2-pyridylthiophosphat |
220-864-4 |
2921-88-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
|
M = 10 000 |
|
|
015-085-00-X |
chlorphoniumchlorid (ISO); tributyl (2,4-dichlorbenzyl) phosphoniumchlorid |
204-105-4 |
115-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H312 H319 H315 |
GHS06 Dgr |
H301 H312 H319 H315 |
|
|
|
|
015-086-00-5 |
coumithoat (ISO); O, O-diethyl-O-7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-ylthiophosphat |
— |
572-48-5 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl-O, O-dimethylthiophosphat |
220-130-3 |
2636-26-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-088-00-6 |
dialisfos (ISO); 2-chlor-1-phthalimidoethyl-O, O-diethyldithiophosphat |
233-689-3 |
10311-84-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
|
|
|
|
015-089-00-1 |
ethoat-methyl (ISO); ethylcarbamoylmethyl-O, O-dimethyldithiophosphat |
204-121-1 |
116-01-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-090-00-7 |
fensulfothion (ISO); O, O-diethyl-O-4-methylsulfinylphenylthiophosphat |
204-114-3 |
115-90-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-091-00-2 |
fonofos (ISO); O-ethylphenylethyldithiophosphonat |
213-408-0 |
944-22-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-092-00-8 |
phosacetim (ISO); O, O-bis(4-chlorphenyl)-N-acetimidoylthiophosphoramidat |
223-874-7 |
4104-14-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-093-00-3 |
leptophos (ISO); O-4-brom-2,5-dichlorphenyl-O-methylphenylthiophosphonat |
244-472-8 |
21609-90-5 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H370 ** H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
|
|
|
|
015-094-00-9 |
mephosfolan (ISO); diethyl-4-methyl-1,3-dithiolan-2-ylidenphosphoramidat |
213-447-3 |
950-10-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
|
|
|
|
015-095-00-4 |
methamidophos (ISO); O, S-dimethylthiophosphoramidat |
233-606-0 |
10265-92-6 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
|
|
|
|
015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl-S-2-ethylsulfinyl-ethyl-dithiophosphat |
219-679-1 |
2497-07-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 10 |
|
|
015-097-00-5 |
phenthoat (ISO); ethyl-2-(dimethoxythiophosphinoylthio)-2-phenylacetat |
219-997-0 |
2597-03-7 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
015-098-00-0 |
trichloronat (ISO); O-ethyl-O-2,4,5-trichlorphenylethylthiophosphonat |
206-326-1 |
327-98-0 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-099-00-6 |
pirimiphos-ethyl (ISO); O, O-diethyl-O-2-diethylamino-6-methylpyrimidin-4-ylthiophosphat |
245-704-0 |
23505-41-1 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino)phenylacetonitril |
238-887-3 |
14816-18-3 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H302 H317 H410 |
|
M = 1 000 |
|
|
015-101-00-5 |
phosmet (ISO); O, O-dimethylphthalimidomethyldithiophosphat |
211-987-4 |
732-11-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
015-102-00-0 |
tris(2-chlorethyl)phosphat |
204-118-5 |
115-96-8 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F *** H302 H411 |
|
|
|
|
015-103-00-6 |
phosphortribromid |
232-178-2 |
7789-60-8 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
015-104-00-1 |
diphosphorpentasulfid; phosphorpentasulfid |
215-242-4 |
1314-80-3 |
Flam. Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029 |
|
T |
|
015-105-00-7 |
triphenylphosphit |
202-908-4 |
101-02-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
|
|
015-106-00-2 |
hexamethylphosphortriamid; hexamethylphosphoramid |
211-653-8 |
680-31-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
015-107-00-8 |
ethoprophos (ISO); ethyl-S, S-dipropyldithiophosphat |
236-152-1 |
13194-48-4 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
|
|
|
|
015-108-00-3 |
bromophos (ISO); O-4-brom-2,5-dichlorphenyl-O, O-dimethylthiophosphat |
218-277-3 |
2104-96-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl-3-(dimethoxyphosphinyloxy) isocrotonat |
231-720-5 |
7700-17-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 10 |
|
|
015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl-O-ethylphenylthiophosphonat |
— |
13067-93-1 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H301 H370 ** H312 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
|
|
|
|
015-111-00-X |
phosfolan (ISO); diethyl-1,3-dithiolan-2-ylidenphosphoramidat |
213-423-2 |
947-02-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-112-00-5 |
thionazin (ISO); O, O-diethyl-O-pyrazin-2-ylthiophosphat |
206-049-6 |
297-97-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-113-00-0 |
tolclofos-methyl (ISO); O-(2,6-dichlor-p-tolyl)-O, O-dimethylthiophosphat |
260-515-3 |
57018-04-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-114-00-6 |
chlormephos (ISO); S-chlormethyl-O, O-diethylphosphordithioat |
246-538-1 |
24934-91-6 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 |
|
|
015-115-00-1 |
chlorthiophos (ISO); [isomer blanding, hvori O-2,5-dichlorphenyl-4-methylthiophenyl-O, O-diethylthiophosphat er fremherskende] |
244-663-6 |
21923-23-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 1 000 |
|
|
015-116-00-7 |
demephion-O (ISO): O, O-dimethyl-O-2-methylthioethylthiophosphat |
211-666-9 |
682-80-4 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-117-00-2 |
demephion-S (ISO); dimethyl-S-2-methylthioethylthiophosphat |
219-971-9 |
2587-90-8 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-118-00-8 |
demeton |
— |
8065-48-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-119-00-3 |
dimethyl-4-(methylthio)phenylphosphat |
— |
3254-63-5 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-120-00-9 |
ditalimfos (ISO); O, O-diethylphthalimidophosphonothionat |
225-875-8 |
5131-24-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
015-121-00-4 |
edifenphos (ISO); ethyl-S, S-diphenyldithiophosphat |
241-178-1 |
17109-49-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
|
|
|
|
015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl-O, O-dimethylthiophosphat |
253-855-9 |
38260-54-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl-N-isopropylphosphoramidat |
244-848-1 |
22224-92-6 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H310 H330 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
|
M = 100 M = 100 |
|
|
015-124-00-0 |
fosthietan (ISO); diethyl-1,3-dithietan-2-ylidenphosphoramidat |
244-437-7 |
21548-32-3 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-125-00-6 |
glyphosin (ISO); N, N-bis(phosphonomethyl)glycin |
219-468-4 |
2439-99-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
015-126-00-1 |
heptenophos (ISO); 7-chlorbicyclo(3.2.0)hepta-2,6-dien-6-yldimethylphosphat |
245-737-0 |
23560-59-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
015-127-00-7 |
iprobenfos (ISO); S-benzyldiisopropylthiophosphat |
247-449-0 |
26087-47-8 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
015-128-00-2 |
IPSP; S-ethylsulfinylmethyl-O, O-diisopropyldithiophosphat |
— |
5827-05-4 |
Acute Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
|
M = 100 |
|
|
015-129-00-8 |
isofenphos (ISO); O-ethyl-O-2-isopropoxycarbonylphenyl-N-isopropylthiophosphoramidat |
246-814-1 |
25311-71-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 100 |
|
|
015-130-00-3 |
isothioat (ISO); S-2-isopropylthioethyl-O, O-dimethyldithiophosphat |
— |
36614-38-7 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
015-131-00-9 |
isoxathion (ISO); O, O-diethyl-O-5-phenylisoxazol-3-ylthiophosphat |
242-624-8 |
18854-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
015-132-00-4 |
S-(chlorphenylthiomethyl)-O, O-dimethyldithiophosphat; methylcarbophenothion |
— |
953-17-3 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 1 000 |
|
|
015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O, O-dipropyldithiophosphat |
— |
24151-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
015-134-00-5 |
pirimiphos-methyl (ISO); O-(2-diethylamino-6-methylpyrimidin-4-yl)-O, O-dimethylthiophosphat |
249-528-5 |
29232-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-135-00-0 |
profenofos (ISO); O-(4-brom-2-chlorphenyl)-O-ethyl-S-propylthiophosphat |
255-255-2 |
41198-08-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1 000 |
|
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyphosphinothioyl]oxy]crotonat; isopropyl-3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonat; propetamphos (ISO) |
250-517-2 |
31218-83-4 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
015-137-00-1 |
pyrazophos (ISO); O, O-diethyl-O-(6-ethoxycarbonyl-5-methylpyrazolo(2,3-a)pyrimidin-2-yl) thiophosphat |
236-656-1 |
13457-18-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
|
|
015-138-00-7 |
quinalphos (ISO); O, O-diethyl-O-quinoxalin-2-ylthiophosphat |
237-031-6 |
13593-03-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 1 000 |
|
|
015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl-O, O-diethyldithiophosphat |
235-963-8 |
13071-79-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1 000 |
|
|
015-140-00-8 |
triazophos (ISO); O, O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-ylthiophosphat |
245-986-5 |
24017-47-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
M = 100 |
|
|
015-141-00-3 |
ethylendiammonium-O, O-bis(octyl)dithiophosphat, blanding af isomerer |
400-520-1 |
— |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
|
015-142-00-9 |
butyl(dialkyloxy(dibutoxyphosphoryloxy)titan)phosphat |
401-100-0 |
— |
Flam. Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
|
|
T |
|
015-143-00-4 |
blanding af 2-chlorethyl-chlorpropyl-2-chlorethylphosphonat, blanding af isomerer og 2-chlorethyl-chlorpropyl-2-chlorpropylphosphonat, blanding af isomerer |
401-740-0 |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-144-00-X |
blanding af pentylmethylphosphinat og 2-methylbutylmethylphosphinat |
402-090-0 |
87025-52-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
015-145-00-5 |
blanding af kobber(I)-O, O-diisopropyldithiophosphat og kobber(I)-O-isopropyl-O-(4-methylpent-2-yl)dithiophosphat og kobber(I)-O, O-bis(4-methylpent-2-yl)dithiophosphat |
401-520-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-146-00-0 |
S-(tricyclo(5.2.1.02,6)deca-3-en-8(eller 9)-yl-O-(isopropyl eller isobutyl eller 2-ethylhexyl)-O-(isopropyl eller isobutyl eller 2-ethylhexyl)dithiophosphat |
401-850-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-147-00-6 |
blanding af C12-14-tert-alkylammoniumdiphenylthiophosphat og dinonylsulfid (eller -disulfid) |
400-930-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
015-148-00-1 |
2-(diphosphonomethyl)ravsyre |
403-070-4 |
51395-42-7 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
015-149-00-7 |
blanding af hexyldioctylphosphinoxid; dihexyloctylphosphinoxid; trioctylphosphinoxid |
403-470-9 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphoniumbromid |
404-940-6 |
86608-70-0 |
Acute Tox. 4 * Eye Dam. 1 STOT RE 2 * Aquatic Chronic 3 |
H302 H318 H373 ** H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
|
|
|
|
015-151-00-8 |
tris(isopropyl/tert-butylphenyl)phosphat |
405-010-2 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin-2-sulfid |
223-292-3 |
3811-49-2 |
Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
|
|
|
|
015-153-00-9 |
isazofos (ISO); O-(5-chlor-1-isopropyl-1,2,4-triazol-3-yl)-O, O-diethylthiophosphat |
255-863-8 |
42509-80-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
|
|
|
|
015-154-00-4 |
ethephon; 2-chlorethylphosphonsyre |
240-718-3 |
16672-87-0 |
Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H332 H302 H314 H411 |
EUH071 |
|
|
|
015-155-00-X |
glufosinat ammonium (ISO); ammonium-2-amino-4-(hydroxymethylphosphinyl)butyrat |
278-636-5 |
77182-82-2 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373 ** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373 ** |
|
|
|
|
015-156-00-5 |
methyl-3-[(dimethoxyphosphinothioyl)oxy]methacrylat; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylat [2] |
250-366-9 [1]-[2] |
30864-28-9 [1] 62610-77-9 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
015-157-00-0 |
trihydroxophosphor; [1] phosponsyre [2] |
237-066-7 [1] 233-663-1 [2] |
13598-36-2 [1] 10294-56-1 [2] |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
015-158-00-6 |
(η-ciclopentadienyl)(η-cumenyl)jern(1+)hexafluorphosphat(1-) |
402-340-9 |
32760-80-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
015-159-00-1 |
hydroxyphosphonoeddikesyre |
405-710-8 |
23783-26-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
|
|
|
|
015-160-00-7 |
vanadylpyrophosphat |
406-260-5 |
58834-75-6 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-161-00-2 |
divanadylpyrophosphat |
407-130-0 |
65232-89-5 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
015-162-00-8 |
vanadium(IV)oxidhydrogenphosphathemihydrat, lithium, zink, molybden, jern og chlor dopet |
407-350-7 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
|
|
|
|
015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxid |
412-010-6 |
145052-34-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-164-00-9 |
calcium-P, P'-(1-hydroxyethyliden)bis(hydrogenphosphonat)dihydrat |
400-480-5 |
36669-85-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
015-165-00-4 |
blanding af thiobis(4,1-phenylen)-S, S,S',S'-tetraphenyldisulfoniumbishexafluorphosphat; diphenyl(4-phenylthiophenyl)sulfoniumhexafluorphosphat |
404-986-7 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan |
410-290-4 |
80693-00-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
015-167-00-5 |
3-(hydroxyphenylphosphinoyl)propansyre |
411-200-6 |
14657-64-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
015-168-00-0 |
fosthiazat (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylthiophosphonat |
— |
98886-44-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070 |
|
|
|
015-169-00-6 |
tributyltetradecylphosphonium tetrafluorborat |
413-520-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
|
015-170-00-1 |
blanding af di-(1-octan-N, N,N-trimethylammonium)-octylphosphat: 1-octan-N, N,N-trimethylammonium di-octylphosphat; 1-octan-N, N,N-trimethylammonium-octylphosphat |
407-490-9 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
015-171-00-7 |
O, O,O-tris(2(eller 4)-C9-10-isoalkylphenyl) thiophosphat |
406-940-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-172-00-2 |
blanding af bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphat; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphat |
406-240-6 |
— |
Flam. Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
|
|
|
|
015-173-00-8 |
methyl-[2-(1,1-dimethylethyl)-6-methoxypirimidin-4-yl]ethylthiophosphat |
414-080-3 |
117291-73-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-174-00-3 |
1-chlor-N, N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramin |
411-370-1 |
82857-68-9 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
|
|
|
|
015-175-00-9 |
tert-butyl-(triphenylphosphoranyliden)acetat |
412-880-7 |
35000-38-5 |
Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
|
|
|
|
015-176-00-4 |
P, P,P',P'-tetrakis-(o-methoxyphenyl)propan-1,3-diphosphin |
413-430-2 |
116163-96-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)eddikesyre |
412-170-7 |
83623-61-4 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS08 GHS05 Dgr |
H373 ** H318 H317 |
|
|
|
|
015-178-00-5 |
(R)-α-phenylethylammonium-(-)-(1R, 2S)-(1,2-epoxypropyl)phosphonatmonohydrat |
418-570-8 |
25383-07-7 |
Repr. 2 Aquatic Chronic 2 |
H361f *** H411 |
GHS08 GHS09 Wng |
H361f *** H411 |
|
|
|
|
015-179-00-0 |
UVCB kondensationsprodukt af tetrakis-hydroxymethylphosphoniumchlorid, urinstof og destilleret hydrogeneret C16-18-talg-alkylamin |
422-720-8 |
166242-53-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
|
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] eddikesyre, (-)-cinchonidin (1:1) salt |
415-820-8 |
137590-32-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
015-181-00-1 |
phosphin |
232-260-8 |
7803-51-2 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
|
|
U |
|
015-182-00-7 |
tetraisopropyldichlormethylenbisphosphonat |
430-630-5 |
10596-22-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
015-183-00-2 |
(1-hydroxydodecyliden)diphosphonsyre |
425-230-2 |
16610-63-2 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-184-00-8 |
glyphosat, salte heraf, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
A |
|
015-186-00-9 |
chlorpyrifos-methyl (ISO); O, O-dimethyl O-3,5,6-trichlor-2-pyridylthiophosphat |
227-011-5 |
5598-13-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10 000 |
|
|
015-187-00-4 |
blanding af tetranatrium(((2-hydroxyethyl)imino)bis(methylen))bisphosphonat, N-oxid; trinatrium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonat, N-oxid, P-oxid |
417-540-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphinoxid |
423-340-5 |
162881-26-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
015-190-00-0 |
bis(2,4-dicumylphenyl)neopentyldiphosphit; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan |
421-920-2 |
154862-43-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
015-191-00-6 |
dodecyldiphenylphosphat |
431-760-5 |
27460-02-2 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
015-192-00-1 |
tetrakis(2,6-dimethylphenyl)-m-phenylenbiphosphat |
432-770-2 |
139189-30-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluor-N-methyl-1-butansulfonamid (1:1) |
442-960-7 |
332350-93-3 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
|
|
|
|
015-194-00-2 |
tetrabutylphosphonium-nonafluorbutan-1-sulfonat |
444-440-5 |
220689-12-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
015-195-00-8 |
blanding af kalium-o-toluenphosphonat; kalium-m-toluenphosphonat; kalium-p-toluenphosphonat |
433-860-4 |
— |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-196-00-3 |
blanding af dimethyl-(2-(hydroxymethylcarbamoyl)ethyl)phosphonat; diethyl-(2-(hydroxymethylcarbamoyl)ethyl)phosphonat; methylethyl-(2-(hydroxymethylcarbamoyl)ethyl)phosphonat |
435-960-3 |
— |
Carc. 1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
|
|
|
|
015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonsyre |
420-160-9 |
107667-02-7 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
|
|
|
|
015-198-00-4 |
(4-phenylbutyl)phosphinsyre |
420-450-5 |
86552-32-1 |
Carc. 2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
|
|
|
|
015-199-00-X |
tris[2-chlor-1-chlormethyl)ethyl] phosphat |
237-159-2 |
13674-87-8 |
Carc. 2 |
H351 |
GSH08 Wng |
H351 |
|
|
|
|
015-200-00-3 |
indiumphosphid |
244-959-5 |
22398-80-7 |
Carc. Repr. 2 STOT RE 1 |
H350 H361f H372 (lunger) |
GHS08 Dgr |
H350 H361f H372 (lunger) |
|
STOT RE 1; H372: C ≥ 0,1 % Carc 1B; H350: C ≥ 0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
|
015-201-00-9 |
trixylylphosphat |
246-677-8 |
25155-23-1 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
015-202-00-4 |
tris(nonylphenyl)phosphit |
247-759-6 |
26523-78-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-203-00-X |
diphenyl(2,4,6-trimethylbenzoyl)phosphinoxid |
278-355-8 |
75980-60-8 |
Repr. 2 |
H361f (forårsager svækkelse af testiklerne) |
GHS08 Wng |
H361f (forårsager svækkelse af testiklerne) |
|
|
|
|
016-001-00-4 |
hydrogensulfid |
231-977-3 |
7783-06-4 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H330 H400 |
|
|
U |
|
016-002-00-X |
bariumsulfid |
244-214-4 |
21109-95-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031 |
|
|
|
016-003-00-5 |
bariumpolysulfider |
256-814-3 |
50864-67-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
016-004-00-0 |
calciumsulfid |
243-873-5 |
20548-54-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
016-005-00-6 |
calciumpolysulfider |
215-709-2 |
1344-81-6 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
016-006-00-1 |
dikaliumsulfid; kaliumsulfid |
215-197-0 |
1312-73-8 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
016-007-00-7 |
kaliumpolysulfider |
253-390-1 |
37199-66-9 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
016-008-00-2 |
ammoniumpolysulfider |
232-989-1 |
9080-17-5 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥ 1 % |
|
|
016-009-00-8 |
dinatriumsulfid; natriumsulfid |
215-211-5 |
1313-82-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
|
|
|
|
016-010-00-3 |
natriumpolysulfider |
215-686-9 |
1344-08-7 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031 |
|
|
|
016-011-00-9 |
svovldioxid |
231-195-2 |
7446-09-5 |
Press. Gas Acute Tox. 3 * Skin Corr. 1B |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
* |
U5 |
|
016-012-00-4 |
disvovldichlorid; svovlmonochlorid |
233-036-2 |
10025-67-9 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
016-013-00-X |
svovldichlorid |
234-129-0 |
10545-99-0 |
Skin Corr. 1B STOT SE 3 Aquatic Acute 1 |
H314 H335 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
016-014-00-5 |
svovltetrachlorid |
— |
13451-08-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
016-015-00-0 |
thionyldichlorid; thionylchlorid |
231-748-8 |
7719-09-7 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
016-016-00-6 |
sulfurylchlorid |
232-245-6 |
7791-25-5 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
016-017-00-1 |
chlorsulfonsyre |
232-234-6 |
7790-94-5 |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
016-018-00-7 |
fluorsulfonsyre |
232-149-4 |
7789-21-1 |
Acute Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
|
|
|
|
016-019-00-2 |
oleum … % SO3 |
— |
— |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
B |
|
016-020-00-8 |
svovlsyre … % |
231-639-5 |
7664-93-9 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B |
|
016-021-00-3 |
methanthiol; methylmercaptan |
200-822-1 |
74-93-1 |
Flam. Gas. 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U |
|
016-022-00-9 |
ethanethiol; ethylmercaptan |
200-837-3 |
75-08-1 |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
|
|
|
|
016-023-00-4 |
dimethylsulfat |
201-058-1 |
77-78-1 |
Carc. 1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
|
Carc. 1B; H350: C ≥ 0,01 % Muta. 2; H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
|
|
016-024-00-X |
dimexano (ISO); bis(methoxy-thiocarbonyl)-disulfid |
215-993-8 |
1468-37-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
016-025-00-5 |
disul (ISO); 2-(2,4-dichlorphenoxy)-ethylhydrogensulfat; 2,4-DES |
205-259-5 |
149-26-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
|
016-026-00-0 |
sulfamidsyre; sulfaminsyre |
226-218-8 |
5329-14-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
016-027-00-6 |
diethylsulfat |
200-589-6 |
64-67-5 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
|
|
|
|
016-028-00-1 |
natriumdithionit; natriumhydrosulfit |
231-890-0 |
7775-14-6 |
Self-heat. 1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
|
|
|
016-029-00-7 |
p-toluensulfonsyre, indeholdende mere end 5 % H2SO4 |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
016-030-00-2 |
p-toluensulfonsyre (indeholdende højst 5 % H2SO4) |
203-180-0 |
104-15-4 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 20 % |
|
|
016-031-00-8 |
tetrahydrothiophen-1,1-dioxid; sulfolan |
204-783-1 |
126-33-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
016-032-00-3 |
1,3-propansulton; 1,2-oxathiolan 2,2-dioxid |
214-317-9 |
1120-71-4 |
Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
016-033-00-9 |
dimethylsulfamoylchlorid |
236-412-4 |
13360-57-1 |
Carc. 1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
|
|
|
|
016-034-00-4 |
tetranatrium-3,3'-(piperazin-1,4-diylbis((6-chlor-1,3,5-triazin-4,2-diyl)imino(2-acetamido)-4,1-phenylenazo))bis(naphthalen-1,5-disulfonat) |
400-010-9 |
81898-60-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-035-00-X |
pentanatrium-5-anilino-3-(4-(4-(6-chlor-4-(3-sulfonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulfonatophenylazo)-4-hydroxynaphthalen-2,7-disulfonat |
400-120-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-036-00-5 |
tetranatrium-5-(4,6-dichlor-5-cyanpyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalen-1,2,5,7-disulfonat |
400-130-1 |
— |
Resp. Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
|
|
|
|
016-037-00-0 |
dinatrium-1-amino-4-(4-benzensulfonamido-3-sulfonatoanilino)anthraquinon-2-sulfonat |
400-350-8 |
85153-93-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-038-00-6 |
dinatrium-6-((4-chlor-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulfonatophenylazo)naphthalen-3-sulfonat |
400-380-1 |
86393-35-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-039-00-1 |
tetranatrium-2-(6-chlor-4-(4-(2,5-dimethyl-4-(2,5-disulfonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzen-1,4-disulfonat |
400-430-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-040-00-7 |
blanding af dinatrium-6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalen-2-sulfonat og dinatrium-6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalen-2-sulfonat og trinatrium-6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulfonato-2-naphthylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalen-2-sulfonat |
400-570-4 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-041-00-2 |
calcium-2,5-dichlor-4-(4-((5-chlor-4-methyl-2-sulfonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzensulfonat |
400-710-4 |
— |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
016-042-00-8 |
tetranatrium-5-benzamido-3-(5-(4-fluor-6-(1-sulfonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalen-2,7-disulfonat |
400-790-0 |
85665-97-0 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
016-043-00-3 |
dilithium-6-acetamido-4-hydroxy-3-(4-((2-sulfonatooxy)ethylsulfonyl)phenylazo)naphthalen-2-sulfonat |
401-010-1 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-044-00-9 |
dinatrium-S, S-hexan-1,6-diyldi(thiosulfat)dihydrat |
401-320-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
016-045-00-4 |
lithiumnatriumhydrogen-4-amino-6-(5-(5-chlor-2,6-difluorpyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalen-2,7-disulfonat |
401-560-2 |
108624-00-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-046-00-X |
natriumhydrogensulfat |
231-665-7 |
7681-38-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
016-047-00-5 |
hexanatrium-7-(4-(4-(4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulfonatonaphthylazo)naphthalen-1,3,5- trisulfonat |
401-650-1 |
85665-96-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-048-00-0 |
natrium-3,5-dichlor-2-(5-cyan-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzensulfonat |
401-870-8 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-049-00-6 |
calciumoctadecylxylensulfonat |
402-040-8 |
— |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
016-050-00-1 |
kaliumnatrium-5-(4-chlor-6-(N-(4-(4-chlor-6-(5-hydroxy-2,7-disulfonato-6-(2-sulfonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino)phenyl- N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulfonatophenylazo)naphthalen-2,7-disulfonat |
402-150-6 |
— |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
016-051-00-7 |
trinatrium-7-(4-(6-fluor-4-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalen-1,3,6- trisulfonat |
402-170-5 |
106359-91-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-052-00-2 |
benzyltributylammonium-4-hydroxynaphthalen-1-sulfonat |
402-240-5 |
102561-46-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
016-053-00-8 |
(C16 eller C18-n-alkyl)(C16 eller C18-n-alkyl)ammonium-2-((C16 eller C18-n-alkyl)(C16 eller C18-n-alkyl)carbamoyl)benzensulfonat |
402-460-1 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
016-054-00-3 |
natrium-4-(2,4,4-trimethylpentylcarbonyloxy)benzensulfonat |
400-030-8 |
— |
Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Sens. 1 |
H331 H372 ** H302 H319 H335 H317 |
GHS06 GHS08 Dgr |
H331 H372 ** H302 H319 H335 H317 |
|
|
|
|
016-055-00-9 |
tetranatrium-4-amino-3,6-bis(5-(6-chlor-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalen-2,7-sulfonat (der indeholder > 35 % natriumchlorid og natriumacetat) |
400-510-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
016-056-00-4 |
kaliumhydrogensulfat |
231-594-1 |
7646-93-7 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
016-057-00-X |
styren-4-sulfonylchlorid |
404-770-2 |
2633-67-2 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
016-058-00-5 |
thionylchlorid, reaktionsprodukter med 1,3,4-thiadiazol-2,5-dithiol, tert-nonanthiol og C12-14-tert-alkylamin |
404-820-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
016-059-00-0 |
N, N,N',N'-tetramethyldithiobis(ethylen)diamindihydrochlorid |
405-300-9 |
17339-60-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
|
|
|
|
016-060-00-6 |
diammoniumperoxodisulfat; ammoniumpersulfat |
231-786-5 |
7727-54-0 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
016-061-00-1 |
dikaliumperoxodisulfat; kaliumpersulfat |
231-781-8 |
7727-21-1 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
016-062-00-7 |
bensultap (ISO); di-S-benzensulfonyl-2-(dimethylamino)propan-1,3-dithiol |
— |
17606-31-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
016-063-00-2 |
natriummetabisulfit |
231-673-0 |
7681-57-4 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
EUH031 |
|
|
|
016-064-00-8 |
natriumhydrogensulfit … %; natriumdisulfit . . . % |
231-548-0 |
7631-90-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
EUH031 |
|
B |
|
016-065-00-3 |
natrium-1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthrachinon-2-sulfonat |
400-100-8 |
84057-97-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
016-066-00-9 |
tetranatrium-[5-((4-amino-6-chlor-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2-sulfonatobenzylidenhydrazino)benzoat]kobber(II) |
404-070-7 |
116912-62-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
016-067-00-4 |
(4-methylphenyl)mesitylen-sulfonat |
407-530-5 |
67811-06-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
016-068-00-X |
natrium-3,5-bis(tetradecyloxycarbonyl)benzensulfinat |
407-720-8 |
155160-86-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
016-069-00-5 |
3,5-bis(tetradecyloxycarbonyl)benzensulfinsyre |
407-990-7 |
141915-64-2 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
016-070-00-0 |
4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfon |
408-220-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
016-071-00-6 |
trinatrium-3-amino-6,13-dichlor-10-((3-((4-chlor-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazindisulfonat |
410-130-3 |
136248-03-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-072-00-1 |
3-amino-4-hydroxy-N-(2-methoxyethyl)-benzensulfonamid |
411-520-6 |
112195-27-4 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
016-073-00-7 |
tetrakis(phenylmethyl)thioperoxydi(carbothioamid) |
404-310-0 |
10591-85-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
016-074-00-2 |
6-fluor-2-methyl-3-(4-methylthiobenzyl)inden |
405-410-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
016-075-00-8 |
2,2'-diallyl-4,4'-sulfonyldiphenol |
411-570-9 |
41481-66-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
016-076-00-3 |
2,3-bis((2-mercapto-ethyl)thio)-1-propanthiol |
411-290-7 |
131538-00-6 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
016-077-00-9 |
2-chlor-p-toluensulfochlorid |
412-890-1 |
42413-03-6 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H314 H317 H412 |
GHS05 GHS07 Dgr |
H314 H317 H412 |
|
|
|
|
016-078-00-4 |
4-methyl-N, N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)-benzensulfonamid |
413-300-5 |
56187-04-3 |
Aquatic Chronic 4 |
H413 |
— |
|
|
|
|
|
016-079-00-X |
N, N-bis(2-(p-toluensulfonyloxy)ethyl)-p-toluensulfonamid |
412-920-3 |
16695-22-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
016-080-00-5 |
natrium-2-anilin-5-(2-nitro-4-(N-phenylsulfamoyl))anilinbenzensulfonat |
412-320-1 |
31361-99-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-081-00-0 |
hexahydrocyclopenta[c]pyrrol-1-(1H)-ammonium-N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanid |
418-350-1 |
— |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H302 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H319 H317 H411 |
|
|
|
|
016-082-00-6 |
ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urinstof |
— |
126801-58-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
016-083-00-1 |
acibenzolar-S-methyl; benzo[1,2,3]thiadiazol-7-carbothiosyre S-methylester |
420-050-0 |
135158-54-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
016-084-00-7 |
prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluorpropyl)phenylsulfonyl]urinstof |
— |
94125-34-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
016-085-00-2 |
flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urinstof |
— |
104040-78-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
016-086-00-8 |
tetranatrium-10-amino-6,13-dichlor-3-(3-(4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacen-4,11-disulfonat |
402-590-9 |
109125-56-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
016-087-00-3 |
blanding af thiobis(4,1-phenylen)-S, S,S',S'-tetraphenyldisulfoniumbishexafluorphosphat; diphenyl(4-phenylthiophenyl)sulfoniumhexafluorphosphat; propylencarbonat |
403-490-8 |
104558-95-4 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H317 H410 |
|
|
|
|
016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzen-1,2-dimethansulfonsyre |
407-280-7 |
71297-11-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
016-089-00-4 |
blanding af estere af 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan og 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalen |
413-840-1 |
— |
Self-react. C **** Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
|
|
|
|
016-090-00-X |
4-methyl-N-(methylsulfonyl)benzensulfonamid |
415-040-8 |
14653-91-9 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
|
|
|
016-091-00-5 |
C12-14-tert-alkylammonium-1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonat |
414-110-5 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
016-092-00-0 |
blanding af 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol og 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol |
427-050-1 |
— |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f H315 H317 H410 |
|
|
|
|
016-093-00-6 |
blanding af (2:1)(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonat) og 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonat) |
414-770-4 |
140698-96-0 |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
016-094-00-1 |
svovl |
231-722-6 |
7704-34-9 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
016-095-00-7 |
blanding af reaktionsprodukt af 4,4'-methylenbis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] og 6-diazo-5,6-dihydro-5-oxo-naphthalensulfonat (1:2) og reaktionsprodukt af 4,4'-methylenbis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] og 6-diazo-5,6-dihydro-5-oxo-naphthalensulfonat (1:3) |
417-980-4 |
— |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
016-096-00-2 |
thifensulfuron-methyl (ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophen-2-carboxylat |
— |
79277-27-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
016-097-00-8 |
1-amino-2-methyl-2-propanthiolhydrochlorid |
434-480-1 |
32047-53-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
|
|
|
|
017-001-00-7 |
chlor |
231-959-5 |
7782-50-5 |
Ox. Gas 1 Press. Gas Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H270 H331 H319 H335 H315 H400 |
GHS03 GHS04 GHS06 GHS09 Dgr |
H270 H331 H319 H335 H315 H400 |
|
M = 100 |
U |
|
017-002-00-2 |
hydrogenchlorid |
231-595-7 |
7647-01-0 |
Press. Gas Acute Tox. 3 * Skin Corr. 1A |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
|
U5 |
|
017-002-01-X |
saltsyre … % |
231-595-7 |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
017-003-00-8 |
bariumchlorat |
236-760-7 |
13477-00-4 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
|
017-004-00-3 |
kaliumchlorat |
223-289-7 |
3811-04-9 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
|
017-005-00-9 |
natriumchlorat |
231-887-4 |
7775-09-9 |
Ox. Sol. 1 Acute Tox. 4 * Aquatic Chronic 2 |
H271 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H302 H411 |
|
|
|
|
017-006-00-4 |
perchlorsyre … % |
231-512-4 |
7601-90-3 |
Ox. Liq. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
Skin Corr. 1A; H314: C ≥ 50 % Skin Corr. 1B; H314: 10 % ≤ C < 50 % Skin Irrit. 2; H315: 1 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 10 % Ox. Liq. 1; H271: C > 50 %: Ox. Liq. 2; H272: C ≤ 50 %: |
B |
|
017-007-00-X |
bariumperchlorat |
236-710-4 |
13465-95-7 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * |
H271 H332 H302 |
GHS03 GHS07 Dgr |
H271 H332 H302 |
|
|
|
|
017-008-00-5 |
kaliumperchlorat |
231-912-9 |
7778-74-7 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
017-009-00-0 |
ammoniumperchlorat |
232-235-1 |
7790-98-9 |
Expl. 1,1 Ox. Sol. 1 |
H201 H271 |
GHS01 Dgr |
H201 H271 |
|
|
T |
|
017-010-00-6 |
natriumperchlorat |
231-511-9 |
7601-89-0 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
017-011-00-1 |
natriumhypochloritopløsning … % aktiv chlor |
231-668-3 |
7681-52-9 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥ 5 % |
B |
|
017-012-00-7 |
calciumhypochlorit |
231-908-7 |
7778-54-3 |
Ox. Sol. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H272 H302 H314 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H400 |
EUH031 |
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 3 % M = 10 |
T |
|
017-013-00-2 |
calciumchlorid |
233-140-8 |
10043-52-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
017-014-00-8 |
ammoniumchlorid |
235-186-4 |
12125-02-9 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchlorid hydrochlorid |
417-410-4 |
61807-67-8 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
017-016-00-9 |
methyltriphenylphosphoniumchlorid |
418-400-2 |
1031-15-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
|
|
|
|
017-017-00-4 |
(Z)-13-docosenyl-N, N-bis(2-hydroxyethyl)-N-methylammoniumchlorid |
426-210-6 |
120086-58-0 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
017-018-00-X |
N, N,N-trimethyl-2,3-bis(stearoyloxy)propylammoniumchlorid |
405-660-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
017-019-00-5 |
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisochinolinhydrochlorid |
415-110-8 |
54417-53-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
017-020-00-0 |
ethylpropoxyaluminiumchlorid |
421-790-7 |
13014-29-4 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
017-021-00-6 |
behenamidopropyl-dimethyl-(dihydroxypropyl) ammoniumchlorid |
423-420-1 |
136920-10-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
017-023-00-7 |
[phosphinyldyntris(oxy)]-tris[3-aminopropyl-2-hydroxy-N, N-dimethyl-N-(C6-18)-alkyl]-trichlorider |
425-520-9 |
197179-61-6 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
017-026-00-3 |
chlordioxid |
233-162-8 |
10049-04-4 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H270 H330 H314 H400 |
GHS04 GHS03 GHS06 GHS05 GHS09 Dgr |
H270 H330 H314 H400 |
|
M = 10 |
5 |
|
017-026-01-0 |
chlordioxid … % |
233-162-8 |
10049-04-4 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,3 % ≤ C < 3 % STOT SE 3; H335: C ≥ 3 % M = 10 |
B |
|
019-001-00-2 |
kalium |
231-119-8 |
7440-09-7 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
019-002-00-8 |
kaliumhydroxid; kaustisk potaske |
215-181-3 |
1310-58-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
|
020-001-00-X |
calcium |
231-179-5 |
7440-70-2 |
Water-react. 2 |
H261 |
GHS02 Dgr |
H261 |
|
|
|
|
020-002-00-5 |
calciumcyanid |
209-740-0 |
592-01-8 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
EUH032 |
|
|
|
020-003-00-0 |
blanding af dicalcium (bis(2-hydroxy-5-tetrapropenylphenylmethyl)methylamin)dihydroxid; tricalcium (tris(2-hydroxy-5-tetrapropenylphenylmethyl)methylamin)trihydroxid; poly[calcium ((2-hydroxy-5-tetrapropenyl-phenylmethyl)methylamin)hydroxid] |
420-470-4 |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
022-001-00-5 |
titantetrachlorid |
231-441-9 |
7550-45-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
EUH014 |
|
|
|
022-002-00-0 |
titan(4+)oxalat |
403-260-7 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
022-003-00-6 |
bis(η5-cyclopentadienyl)-bis[2,6-difluor-3-(pyrrol-1-yl)-phenyl]titan |
412-000-1 |
125051-32-3 |
Flam. Sol. 1 Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H228 H361f *** H373 ** H411 |
GHS02 GHS08 GHS09 Dgr |
H228 H361f *** H373 ** H411 |
|
|
T |
|
022-004-00-1 |
kaliumtitanoxid (K2Ti6O13) |
432-240-0 |
12056-51-8 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
022-005-00-7 |
[N-(1,1-dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][1,2,3,4-η)-1,3-pentadien]-titan |
419-840-8 |
169104-71-6 |
Flam. Sol. 1**** Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H228 H314 H317 H413 |
GHS02 GHS05 GHS07 Dgr |
H228 H314 H317 H413 |
|
|
|
|
023-001-00-8 |
divanadiumpentaoxid; vanadiumpentaoxid |
215-239-8 |
1314-62-1 |
Muta. 2 Repr. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Aquatic Chronic 2 |
H341 H361d *** H372 ** H332 H302 H335 H411 |
GHS08 GHS07 GHS09 Dgr |
H341 H361d *** H372 ** H332 H302 H335 H411 |
|
|
|
|
024-001-00-0 |
chromtrioxid |
215-607-8 |
1333-82-0 |
Ox. Sol. 1 Carc. 1A Muta. 1B Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
024-002-00-6 |
kaliumdichromat |
231-906-6 |
7778-50-9 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
3 |
|
024-003-00-1 |
ammoniumdichromat |
232-143-1 |
7789-09-5 |
Ox. Sol. 2 **** Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % Resp. Sens.; H334: C ≥ 0,2 % Skin Sens.; H317:C ≥ 0,2 % |
G3 |
|
024-004-00-7 |
natriumdichromat |
234-190-3 |
10588-01-9 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS05 GHS08 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H312 H372 ** H314 H334 H317 H410 |
|
Resp. Sens. 1; H334: C ≥ 0,2 % Skin Sens. 1; H317:C ≥ 0,2 % STOT SE 3; H335: C ≥ 5 % |
3 |
|
024-005-00-2 |
chromyldichlorid |
239-056-8 |
14977-61-8 |
Ox. Liq. 1 Carc. 1B Muta. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350i H340 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350i H340 H314 H317 H410 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 5 % ≤ C < 10 % Skin Irrit. 2; H315: 0,5 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: 0,5 % ≤ C < 5 % Skin Sens. 1; H317: C ≥ 0,5 % |
T3 |
|
024-006-00-8 |
kaliumchromat |
232-140-5 |
7789-00-6 |
Carc. 1B Muta. 1B Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H340 H319 H335 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H340 H319 H335 H315 H317 H410 |
|
Skin Sens. 1; H317:C ≥ 0,5 % |
3 |
|
024-007-00-3 |
zinkchromater, herunder zinkkaliumchromat |
— |
— |
Carc. 1A Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
|
|
A |
|
024-008-00-9 |
calciumchromat |
237-366-8 |
13765-19-0 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
024-009-00-4 |
strontiumchromat |
232-142-6 |
7789-06-2 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H400 H410 |
|
|
|
|
024-010-00-X |
dichromtris(chromat); chrom III chromat; chromchromat |
246-356-2 |
24613-89-6 |
Ox. Sol. 1 Carc. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350 H314 H317 H410 |
|
|
T |
|
024-011-00-5 |
ammoniumbis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromat(1-) |
400-110-2 |
109125-51-1 |
Self-react. C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
|
|
|
|
024-012-00-0 |
trinatriumbis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)chromat(1-) |
400-810-8 |
— |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
024-013-00-6 |
trinatrium-(6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)(4-sulfonato-1,1'-azodi-2,2'naphtholato)chromat(1-) |
402-500-8 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
024-014-00-1 |
trinatriumbis(2-(5-chlor-4-nitro-2-oxidophenylazo)-5-sulfonato-1-naphtholato)chromat(1-) |
402-870-0 |
93952-24-0 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
024-015-00-7 |
dinatrium(3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromat(1-) |
404-930-1 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H318 H411 |
|
|
|
|
024-016-00-2 |
tetradecylammoniumbis(1-(5-chlor-2-oxidophenylazo)-2-naphtholato)chromat(1-) |
405-110-6 |
88377-66-6 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
024-017-00-8 |
chrom(VI)forbindelser, med undtagelse af bariumchromat samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H317 H410 |
|
|
A |
|
024-018-00-3 |
natriumchromat |
231-889-5 |
7775-11-3 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
Resp. Sens.; H334: C ≥ 0,2 % Skin Sens.; H317:C ≥ 0,2 % |
3 |
|
024-019-00-9 |
hovedkomponent: acetoeddikesyre/3-amino-1-hydroxybenzen (ATAN-MAP): trinatrium {6-[(2 eller 3 eller 4)-amino-(4 eller 5 eller 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato}-{6''-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfamoyl)-3''-sulfonatonaphthalen-2''-azobenzen-1'',2'''-diolato}chromat (III); biprodukt 1: acetoeddikesyreanilid / acetoeddikesyreanilid (ATAN-ATAN): trinatrium bis{6-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfonyl)-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato}chromat (III); biprodukt 2: 3-amino-1-hydroxybenzen/3-amino-1-hydroxybenzen (MAP-MAP): trinatrium bis{6-[(2 eller 3 eller 4)-amino-(4 eller 5 eller 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato} chromat (III) |
419-230-1 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-020-00-4 |
trinatrium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzen-2',4-diolato)]chromat(III) |
418-220-4 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-021-00-X |
kaliumtetranatrium-bis[(N, N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzenazo-1'-prop-1'-en-2,2'-diolato]chromat(III) |
425-830-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
025-001-00-3 |
mangandioxid |
215-202-6 |
1313-13-9 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
025-002-00-9 |
kaliumpermanganat |
231-760-3 |
7722-64-7 |
Ox. Sol. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H410 |
|
|
|
|
025-003-00-4 |
mangansulfat |
232-089-9 |
7785-87-7 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
025-004-00-X |
bis(N, N',N''-trimethyl-1,4,7-triazacyclononan)-trioxo-dimangan (IV) di(hexafluorphosphat)monohydrat |
411-760-1 |
116633-53-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
025-005-00-5 |
blanding af tri-natrium [29H, 31H-phthalocyanin-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganat (3-); tetranatrium [29H,31H-phthalocyanin-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganat (3-); pentanatrium [29H,31H-phthalocyanin-C,C,C,C,C-pentasulfonato (6-)-N29,N30,N31,N32] manganat (3-) |
417-660-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
026-001-00-6 |
(η-cumen)-(η-cyclopentadienyl)jern(II)-hexafluorantimonat |
407-840-0 |
100011-37-8 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
026-002-00-1 |
(η-cumen)-(η-cyclopentadienyl)jern(II)-trifluormethan-sulfonat |
407-880-9 |
117549-13-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
026-003-00-7 |
jern(II)sulfat |
231-753-5 |
7720-78-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
026-003-01-4 |
jern(II)sulfat (1:1) heptahydrat; svovlsyre, jern(II)-salt (1:1), heptahydrat; ferrosulfat heptahydrat |
231-753-5 |
7782-63-0 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
Skin Irrit.2; H315: C ≥ 25 % |
|
|
026-004-00-2 |
kaliumferrit |
430-010-4 |
12160-44-0 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
027-001-00-9 |
cobalt |
231-158-0 |
7440-48-4 |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H334 H317 H413 |
GHS08 Dgr |
H334 H317 H413 |
|
|
|
|
027-002-00-4 |
cobaltoxid |
215-154-6 |
1307-96-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M = 10 |
|
|
027-003-00-X |
cobaltsulfid |
215-273-3 |
1317-42-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10 |
|
|
027-004-00-5 |
cobaltdichlorid |
231-589-4 |
7646-79-9 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360f *** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360f *** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
027-005-00-0 |
cobaltsulfat |
233-334-2 |
10124-43-3 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360f *** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360f *** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
027-006-00-6 |
cobaltdi(acetat) |
200-755-8 |
71-48-7 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360f *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360f *** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
027-007-00-1 |
zinkhexacyanocobaltat(III), tert-butylalkohol/polypropylenglycolkompleks |
425-240-7 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
027-008-00-7 |
kompleks af cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamid), hydrat (n H2O, 2<n<3) |
427-390-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
027-009-00-2 |
cobaltdinitrat |
233-402-1 |
10141-05-6 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360f *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360f *** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
027-010-00-8 |
cobaltcarbonat |
208-169-4 |
513-79-1 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360f *** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360f *** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
028-001-00-1 |
tetracarbonylnikkel; nikkeltetracarbonyl |
236-669-2 |
13463-39-3 |
Flam. Liq. 2 Carc. 2 Repr. 1B Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H351 H360D *** H330 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H351 H360D *** H330 H410 |
|
|
|
|
028-002-00-7 |
nikkel |
231-111-4 |
7440-02-0 |
Carc. 2 STOT RE 1 Skin Sens. 1 |
H351 H372 ** H317 |
GHS08 GHS07 Dgr |
H351 H372 ** H317 |
|
|
S7 |
|
028-002-01-4 |
nikkelpulver; [partikeldiameter < 1 mm] |
231-111-4 |
7440-02-0 |
Carc. 2 STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H372 ** H317 H412 |
GHS08 GHS07 Dgr |
H351 H372 ** H317 H412 |
|
|
|
|
028-003-00-2 |
nikkelmonoxid; [1] nikkeloxid; [2] bunsenit [3] |
215-215-7 [1] 234-323-5 [2]-[3] |
1313-99-1 [1] 11099-02-8 [2] 34492-97-2 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
|
|
|
|
028-004-00-8 |
nikkeldioxid |
234-823-3 |
12035-36-8 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
|
|
|
|
028-005-00-3 |
dinikkeltrioxid |
215-217-8 |
1314-06-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372 ** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 H413 |
|
|
|
|
028-006-00-9 |
nikkel(II)sulfid; [1] nikkelsulfid; [2] millerit [3] |
240-841-2 [1] 234-349-7 [2]-[3] |
16812-54-7 [1] 11113-75-0 [2] 1314-04-1 [3] |
Carc. 1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372 ** H317 H410 |
|
|
|
|
028-007-00-4 |
trinikkeldisulfid; nikkelsubsulfid; [1] heazlewoodit [2] |
234-829-6 [1] - [2] |
12035-72-2 [1] 12035-71-1 [2] |
Carc. 1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372 ** H317 H410 |
|
|
|
|
028-008-00-X |
nikkeldihydroxid; [1] nikkelhydroxid [2] |
235-008-5 [1] 234-348-1 [2] |
12054-48-7 [1] 11113-74-9 [2] |
Carc. 1A Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360D *** H341 H372 ** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360D *** H341 H372 ** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-009-00-5 |
nikkelsulfat |
232-104-9 |
7786-81-4 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-010-00-0 |
nikkelcarbonat; basisk nikkelcarbonat; kulsyre, nikkel(2+)-salt; [1]; kulsyre, nikkelsalt; [2] [μ-[carbonato(2-)-O:O']]-dihydroxytrinikkel; [3] [carbonato(2-)]tetrahydroxytrinikkel [4] |
222-068-2 [1] 240-408-8 [2] 265-748-4 [3] 235-715-9 [4] |
3333-67-3 [1] 16337-84-1 [2] 65405-96-1 [3] 12607-70-4 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-011-00-6 |
nikkeldichlorid |
231-743-0 |
7718-54-9 |
Carc. 1A Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H331 H301 H372 ** H315 H334 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H341 H360D *** H331 H301 H372 ** H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-012-00-1 |
nikkeldinitrat; [1] salpetersyre, nikkelsalt [2] |
236-068-5 [1] 238-076-4 [2] |
13138-45-9 [1] 14216-75-2 [2] |
Ox. Sol. 2 Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350i H341 H360D *** H372 ** H332 H302 H315 H318 H334 H317 H400 H410 |
GHS03 GHS05 GHS08 GHS07 GHS09 Dgr |
H272 H350i H341 H360D *** H372 ** H332 H302 H315 H318 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317 C ≥ 0,01 % M = 1 |
|
|
028-013-00-7 |
nikkelsten |
273-749-6 |
69012-50-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i *** H372 ** H317 H410 |
|
|
|
|
028-014-00-2 |
mudder og slam, kobberraffineringselektrolyse-, renset for kobber, nikkelsulfat |
295-859-3 |
92129-57-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-015-00-8 |
mudder og slam, kobberraffineringselektrolyse-, renset for kobber |
305-433-1 |
94551-87-8 |
Carc. 1A Muta. 2 Repr. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
|
|
|
028-016-00-3 |
nikkeldiperchlorat; perchlorsyre, nikkel(II)salt |
237-124-1 |
13637-71-3 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H314 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-017-00-9 |
nikkeldikaliumbis(sulfat); [1] diammoniumnikkelbis(sulfat) [2] |
237-563-9 [1] 239-793-2 [2] |
13842-46-1 [1] 15699-18-0 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-018-00-4 |
nikkelbis(sulfamidat); nikkelsulfamat |
237-396-1 |
13770-89-3 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-019-00-X |
nikkelbis(tetrafluorborat) |
238-753-4 |
14708-14-6 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-021-00-0 |
nikkeldiformat; [1] myresyre, nikkelsalt; [2] myresyre, kobbernikkkelsalt [3] |
222-101-0 [1] 239-946-6 [2] 268-755-0 [3] |
3349-06-2 [1] 15843-02-4 [2] 68134-59-8 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-022-00-6 |
nikkeldi(acetat); [1] nikkelacetat [2] |
206-761-7 [1] 239-086-1 [2] |
373-02-4 [1] 14998-37-9 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D *** H372 ** H332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-024-00-7 |
nikkeldibenzoat |
209-046-8 |
553-71-9 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-025-00-2 |
nikkelbis(4-cyclohexylbutyrat) |
223-463-2 |
3906-55-6 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-026-00-8 |
nikkel(II)stearat; nikkel(II) octadecanoat |
218-744-1 |
2223-95-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-027-00-3 |
nikkeldilactat |
— |
16039-61-5 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-028-00-9 |
nikkel(II)octanoat |
225-656-7 |
4995-91-9 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H314 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-029-00-4 |
nikkeldifluorid; [1] nikkeldibromid; [2] nikkeldiiodid; [3] nikkelkaliumfluorid [4] |
233-071-3 [1] 236-665-0 [2] 236-666-6 [3] - [4] |
10028-18-9 [1] 13462-88-9 [2] 13462-90-3 [3] 11132-10-8 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-030-00-X |
nikkelhexafluorsilicat |
247-430-7 |
26043-11-8 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-031-00-5 |
nikkelselenat |
239-125-2 |
15060-62-5 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-032-00-0 |
nikkelhydrogenphosphat; [1] nikkelbis(dihydrogenphosphat); [2] trinikkelbis(orthophosphat); [3] dinikkeldiphosphat; [4] nikkelbis(phosphinat); [5] nikkelphosphinat; [6] phosphorsyre, calciumnikkelsalt; [7] diphosphorsyyre, nikkel(II)salt [8] |
238-278-2 [1] 242-522-3 [2] 233-844-5 [3] 238-426-6 [4] 238-511-8 [5] 252-840-4 [6] - [7] - [8] |
14332-34-4 [1] 18718-11-1 [2] 10381-36-9 [3] 14448-18-1 [4] 14507-36-9 [5] 36026-88-7 [6] 17169-61-8 [7] 19372-20-4 [8] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
|
|
|
|
028-033-00-6 |
diammoniumnikkelhexacyanoferrat |
— |
74195-78-1 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
|
|
|
|
028-034-00-1 |
nikkeldicyanid |
209-160-8 |
557-19-7 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
EUH032 |
|
|
|
028-035-00-7 |
nikkelchromat |
238-766-5 |
14721-18-7 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
|
|
|
|
028-036-00-2 |
nikkel(II)silicat; [1] dinikkelorthosilicat; [2] nikkelsilicat (3:4); [3] kiselsyre, nikkelsalt; [4] trihydrogenhydroxybis[orthosilicato(4-)]trinikkelat(3-) [5] |
244-578-4 [1] 237-411-1 [2] 250-788-7 [3] 253-461-7 [4] 235-688-3 [5] |
21784-78-1 [1] 13775-54-7 [2] 31748-25-1 [3] 37321-15-6 [4] 12519-85-6 [5] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-037-00-8 |
dinikkelhexacyanoferrat |
238-946-3 |
14874-78-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-038-00-3 |
trinikkel bis(arsenat); nikkel(II)arsenat |
236-771-7 |
13477-70-8 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H372 ** H317 H410 |
|
|
|
|
028-039-00-9 |
nikkeloxalat; [1] oxalsyre, nikkelsalt [2] |
208-933-7 [1] 243-867-2 [2] |
547-67-1 [1] 20543-06-0 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-040-00-4 |
nikkeltellurid |
235-260-6 |
12142-88-0 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-041-00-X |
trinikkeltetrasulfid |
— |
12137-12-1 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-042-00-5 |
trinikkelbis(arsenit) |
— |
74646-29-0 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-043-00-0 |
cobaltnikkelgrå periclas; C.I. Pigment Black 25; C.I. 77332; [1] cobaltnikkeldioxid; [2] cobaltnikkeloxid [3] |
269-051-6 [1] 261-346-8 [2] - [3] |
68186-89-0 [1] 58591-45-0 [2] 12737-30-3 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
|
|
|
|
028-044-00-6 |
nikkeltintrioxid; nikkelstannat |
234-824-9 |
12035-38-0 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i *** H372 ** H317 |
|
|
|
|
028-045-00-1 |
nikkeltriurandecaoxid |
239-876-6 |
15780-33-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i *** H372 ** H317 |
|
|
|
|
028-046-00-7 |
nikkeldithiocyanat |
237-205-1 |
13689-92-4 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
EUH032 |
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-047-00-2 |
nikkeldichromat |
239-646-5 |
15586-38-6 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M = 1 |
|
|
028-048-00-8 |
nikkel(II)selenit |
233-263-7 |
10101-96-9 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i *** H372 ** H334 H317 H410 |
|
|
|
|
028-049-00-3 |
nikkelselenid |
215-216-2 |
1314-05-2 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i *** H372 ** H317 H410 |
|
|
|
|
028-050-00-9 |
kiselsyre, blynikkelsalt |
— |
68130-19-8 |
Carc. 1A Repr. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360Df H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360Df H372 ** H317 H410 |
|
|
|
|
028-051-00-4 |
nikkeldiarsenid; [1] nikkelarsenid [2] |
235-103-1 [1] 248-169-1 [2] |
12068-61-0 [1] 27016-75-7 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i *** H372 ** H317 H410 |
|
|
|
|
028-052-00-X |
nikkelbariumtitanprimulagul priderit; C.I. Pigment Yellow 157; C.I. 77900 |
271-853-6 |
68610-24-2 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i *** H372 ** H317 |
|
|
|
|
028-053-00-5 |
nikkeldichlorat; [1] nikkeldibromat; [2] ethylhydrogensulfat, nikkel(II)salt [3] |
267-897-0 [1] 238-596-1 [2] 275-897-7 [3] |
67952-43-6 [1] 14550-87-9 [2] 71720-48-4 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < % Skin Sens. 1; H317:C ≥ 0,01 % 1 M = 1 |
|
|
028-054-00-0 |
nikkel(II)trifluoracetat; [1] nikkel(II)propionat; [2] nikkelbis(benzensulfonat); [3] nikkel(II)hydrogencitrat; [4] citronsyre, ammoniumnikkelsalt; [5] citronsyre, nikkelsalt; [6] nikkelbis(2-ethylhexanoat); [7] 2-ethylhexansyre, nikkelsalt; [8] dimethylhexansyre, nikkelsalt; [9] nikkel(II)isooctanoat; [10] nikkelisooctanoat; [11] nikkelbis(isononanoat); [12] nikkel(II)neononanoat; [13] nikkel(II)isodecanoat; [14] nikkel(II)neodecanoat; [15] neodecansyre, nikkelsalt;[16] nikkel(II)neoundecanoat; [17] bis(D-gluconato-O1,O2)nikkel; [18] nikkel-3,5-bis(tert-butyl)-4-hydroxybenzoat (1:2); [19] nikkel(II)palmitat; [20] (2-ethylhexanoato-O)(isononanoato-O)nikkel; [21] (isononanoato-O)(isooctanoato-O)nikkel; [22] (isooctanoato-O)(neodecanoato-O)nikkel; [23] (2-ethylhexanoato-O)(isodecanoato-O)nikkel; [24] (2-ethylhexanoato-O)(neodecanoato-O)nikkel; [25] (isodecanoato-O)(isooctanoato-O)nikkel; [26] (isodecanoato-O)(isononanoato-O)nikkel; [27] (isononanoato-O)(neodecanoato-O)nikkel; [28] fedtsyrer, C6-19-forgrenede, nikkelsalte; [29] fedtsyrer, C8-18 og C18-umættede, nikkelsalte; [30] 2,7-naphthalendisulfonsyre, nikkel(II)salt; [31] |
240-235-8 [1] 222-102-6 [2] 254-642-3 [3] 242-533-3 [4] 242-161-1 [5] 245-119-0 [6] 224-699-9 [7] 231-480-1 [8] 301-323-2 [9] 249-555-2 [10] 248-585-3 [11] 284-349-6 [12] 300-094-6 [13] 287-468-1 [14] 287-469-7 [15] 257-447-1 [16] 300-093-0 [17] 276-205-6 [18] 258-051-1 [19] 294-302-1 [29] 283-972-0 [30] - [31] 237-138-8 [20] 287-470-2 [21] 287-471-8 [22] 284-347-5 [23] 284-351-7 [24] 285-698-7 [25] 285-909-2 [26] 284-348-0 [27] 287-592-6 [28] |
16083-14-0 [1] 3349-08-4 [2] 39819-65-3 [3] 18721-51-2 [4] 18283-82-4 [5] 22605-92-1 [6] 4454-16-4 [7] 7580-31-6 [8] 93983-68-7 [9] 29317-63-3 [10] 27637-46-3 [11] 84852-37-9 [12] 93920-10-6 [13] 85508-43-6 [14] 85508-44-7 [15] 51818-56-5 [16] 93920-09-3 [17] 71957-07-8 [18] 52625-25-9 [19] 13654-40-5 [20] 85508-45-8 [21] 85508-46-9 [22] 84852-35-7 [23] 84852-39-1 [24] 85135-77-9 [25] 85166-19-4 [26] 84852-36-8 [27] 85551-28-6 [28] 91697-41-5 [29] 84776-45-4 [30] 72319-19-8 [31] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D *** H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D *** H372 ** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
028-055-00-6 |
nikkel(II)sulfit; [1] nikkeltellurtrioxid; [2] nikkeltellurtetraoxid; [3] molybdennikkelhydroxidoxidphosphat [4] |
231-827-7 [1] 239-967-0 [2] 239-974-9 [3] 268-585-7 [4] |
7757-95-1 [1] 15851-52-2 [2] 15852-21-8 [3] 68130-36-9 [4] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372 ** H334 H317 H410 |
|
|
|
|
028-056-00-1 |
nikkelborid (NiB); [1] dinikkelborid; [2] trinikkelborid; [3] nikkelborid; [4] dinikkelsilicid; [5] nikkeldisilicid; [6] dinikkelphosphid; [7] nikkelborphosphid [8] |
234-493-0 [1] 234-494-6 [2] 234-495-1 [3] 235-723-2 [4] 235-033-1 [5] 235-379-3 [6] 234-828-0 [7] - [8] |
12007-00-0 [1] 12007-01-1 [2] 12007-02-2 [3] 12619-90-8 [4] 12059-14-2 [5] 12201-89-7 [6] 12035-64-2 [7] 65229-23-4 [8] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372 ** H317 H410 |
|
|
|
|
028-057-00-7 |
dialuminiumnikkeltetraoxid; [1] nikkeltitantrioxid;[2] nikkeltitanoxid; [3] nikkeldivanadiumhexaoxid; [4] cobaltdimolybdennikkeloctaoxid; [5] nikkelzirkoniumtrioxid; [6] molybdennikkeltetraoxid; [7] nikkelwolframtetraoxid; [8] olivin, nikkelgrøn; [9] lithiumnikkeldioxid; [10] molybdennikkeloxid; [11] |
234-454-8 [1] 234-825-4 [2] 235-752-0 [3] 257-970-5 [4] 268-169-5 [5] 274-755-1 [6] 238-034-5 [7] 238-032-4 [8] 271-112-7 [9] - [10] - [11] |
12004-35-2 [1] 12035-39-1 [2] 12653-76-8 [3] 52502-12-2 [4] 68016-03-5 [5] 70692-93-2 [6] 14177-55-0 [7] 14177-51-6 [8] 68515-84-4 [9] 12031-65-1 [10] 12673-58-4 [11] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372 ** H317 |
GHS08 GHS07 Dgr |
H350i H372 ** H317 |
|
|
|
|
028-058-00-2 |
cobaltlithiumnikkeloxid |
442-750-5 |
— |
Carc. 1A Acute Tox. 2 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H330 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H372 ** H317 H410 |
|
|
|
|
029-001-00-4 |
kobberchlorid; kobber(I)chlorid |
231-842-9 |
7758-89-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
029-003-00-5 |
naphthensyrer, kobbersalte; kobber napthenat |
215-657-0 |
1338-02-9 |
Flam. Liq. 3 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H410 |
|
|
|
|
029-004-00-0 |
kobbersulfat |
231-847-6 |
7758-98-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
029-005-00-6 |
(tris(chlormethyl)phthalocyaninato)kobber(II), reaktionsprodukter med N-methylpiperazin og methoxyeddikesyre |
401-260-1 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
029-006-00-1 |
tris(octadec-9-enylammonium)-(trisulfonatophthalocyaninato)kobber(II) |
403-210-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
029-007-00-7 |
(trinatrium-(2-((3-(6-(2-chlor-5-sulfonato)anilino-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)kobber(3-))hydroxid |
404-670-9 |
89797-01-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
G |
|
029-008-00-2 |
kobber(II)methansulfonat |
405-400-2 |
54253-62-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
029-009-00-8 |
phthalocyanin-N-[3-(diethylamino)propyl]sulfonamid kobberkomplex |
413-650-9 |
93971-95-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
029-010-00-3 |
blanding af forbindelser fra (dodecakis(p-tolylthio)phthalocyaninato)kobber(II) til (hexadecakis(p-tolylthio)phthalocyaninato)kobber(II) |
407-700-9 |
101408-30-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
029-011-00-9 |
natrium-[29H,31H-phtalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonat, kobberkomplex |
412-730-0 |
150522-10-4 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
029-012-00-4 |
natrium-((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)kobber(II) |
407-340-2 |
124719-24-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
029-013-00-X |
trinatrium-(2-(α-(3-(4-chlor-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenhydrazino)-4-sulfonatobenzoato)kobber(II) |
407-580-8 |
130201-51-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
029-014-00-5 |
en blanding af 2,2'-[[cis-1,2-cyclohexandiylbis(nitrilomethyliden)]bis[phenolat]](2-)-N, N',O, O'-kobberkompleks og 2,2'-[[trans-1,2-cyclohexandiylbis(nitrilomethylidyn)]bis[phenolat]](2-)-N, N',O, O'-kobberkompleks |
419-610-7 |
171866-24-3 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
030-001-00-1 |
zinkpulver — zinkstøv (ustabiliseret) |
231-175-3 |
7440-66-6 |
Water-react. 1 Pyr. Sol. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H400 H410 |
GHS02 GHS09 Dgr |
H260 H250 H410 |
|
|
T |
|
030-001-01-9 |
zinkpulver — zinkstøv (stabiliseret) |
231-175-3 |
7440-66-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
030-003-00-2 |
zinkchlorid |
231-592-0 |
7646-85-7 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
030-004-00-8 |
dimethylzink; [1] diethylzink [2] |
208-884-1 [1] 209-161-3 [2] |
544-97-8 [1] 557-20-0 [2] |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H260 H314 H410 |
EUH014 |
|
|
|
030-005-00-3 |
diamindiisocyanoatozink |
401-610-3 |
— |
Acute Tox. 4 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H318 H334 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H318 H334 H317 H400 |
|
|
|
|
030-006-00-9 |
zinksulfat (vandholdig) (mono-, hexa- og heptahydrat); [1] zinksulfat (vandfri) [2] |
231-793-3 [1] 231-793-3 [2] |
7446-19-7 [1] 7733-02-0 [2] |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
030-007-00-4 |
bis(3,5-di-tert-butylsalicylato-O1,O2)zink |
403-360-0 |
42405-40-3 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
030-008-00-X |
hydroxo(2-(benzensulfonamido)benzoato)zink(II) |
403-750-0 |
113036-91-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
030-009-00-5 |
zink-bis(4-(n-octyloxycarbonylamino)salicylat) dihydrat |
417-130-2 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
030-010-00-0 |
2-dodec-1-enylbutandisyre, 4-methylester, zinksalt |
430-740-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
030-011-00-6 |
trizinkbis(orthophosphat) |
231-944-3 |
7779-90-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
030-012-00-1 |
aluminium-magnesium-zink-carbonat-hydroxid |
423-570-6 |
169314-88-9 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
030-013-00-7 |
zinkoxid |
215-222-5 |
1314-13-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
030-015-00-8 |
tetrazink(2+)-bis(hexacyanocobalt(3+))diacetat |
440-060-9 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
033-001-00-X |
arsen |
231-148-6 |
7440-38-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
033-002-00-5 |
arsenforbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
* |
A1 |
|
033-003-00-0 |
diarsentrioxid; arsentrioxid |
215-481-4 |
1327-53-3 |
Carc. 1A Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H300 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H300 H314 H410 |
|
|
|
|
033-004-00-6 |
diarsenpentaoxid; arsenpentaoxid; arsenoxid |
215-116-9 |
1303-28-2 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
033-005-00-1 |
arsensyre og dets salte undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
A |
|
033-006-00-7 |
arsin |
232-066-3 |
7784-42-1 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H330 H373 ** H400 H410 |
GHS02 GHS04 GHS06 GHS08 GHS09 Dgr |
H220 H330 H373 ** H410 |
|
|
U |
|
033-007-00-2 |
tert-butylarsin |
423-320-6 |
4262-43-5 |
Pyr. Liq. 1 Acute Tox. 2 * |
H250 H330 |
GHS02 GHS06 Dgr |
H250 H330 |
|
|
|
|
034-001-00-2 |
selen |
231-957-4 |
7782-49-2 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 4 |
H331 H301 H373 ** H413 |
GHS06 GHS08 Dgr |
H331 H301 H373 ** H413 |
|
|
|
|
034-002-00-8 |
selenforbindelser med undtagelse af cadmiumsulfoselenid undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H373 ** H410 |
|
|
A |
|
034-003-00-3 |
natriumselenit |
233-267-9 |
10102-18-8 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 2 |
H300 H331 H317 H411 |
GHS06 GHS09 Dgr |
H300 H331 H317 H411 |
EUH031 |
|
|
|
035-001-00-5 |
brom |
231-778-1 |
7726-95-6 |
Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H330 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H314 H400 |
|
|
|
|
035-002-00-0 |
hydrogenbromid |
233-113-0 |
10035-10-6 |
Press. Gas Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS04 GHS05 GHS07 Dgr |
H314 H335 |
|
|
U |
|
035-002-01-8 |
hydrogenbromid … % |
— |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 40 % Skin Irrit. 2; H315: 10 % ≤ C < 40 % Eye Irrit. 2; H319: 10 % ≤ C < 40 % STOT RE 3; H335: C ≥ 10 % |
B |
|
035-003-00-6 |
kaliumbromat |
231-829-8 |
7758-01-2 |
Ox. Sol. 1 Carc. 1B Acute Tox. 3 * |
H271 H350 H301 |
GHS03 GHS06 GHS08 Dgr |
H271 H350 H301 |
|
|
|
|
035-004-00-1 |
2-hydroxyethylammoniumperbromid |
407-440-6 |
— |
Ox. Sol. 2 **** Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H272 H302 H314 H317 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H317 H400 |
|
|
|
|
040-001-00-3 |
zirconiumpulver (ustabiliseret) |
231-176-9 |
7440-67-7 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
040-002-00-9 |
zirkoniumpulver, tør (stabiliseret) |
— |
— |
Self-heat. 1 |
H251 |
GHS02 Dgr |
H251 |
|
|
T |
|
040-003-00-4 |
reaktionsprodukt af 3,5-di-tert-butylsalicylsyre og zirconiumoxychlorid, dehydreret, basisk Zr: DTBS = 1,0:1,0 til 1,0: 1,5 |
430-610-6 |
226996-19-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
042-001-00-9 |
molybdentrioxid |
215-204-7 |
1313-27-5 |
Carc. 2 Eye Irrit. 2 STOT SE 3 |
H351 H319 H335 |
GHS08 GHS07 Wng |
H351 H319 H335 |
|
|
|
|
042-002-00-4 |
tetrakis(dimethylditetradecylammonium)hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdat(4-) |
404-760-8 |
117342-25-3 |
Acute Tox. 3 * Eye Dam. 1 |
H331 H318 |
GHS06 GHS05 Dgr |
H331 H318 |
|
|
|
|
042-003-00-X |
tetrakis(trimethylhexadecylammonium)hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdat(4-) |
404-860-1 |
116810-46-9 |
Flam. Sol. 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H318 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H228 H318 H410 |
|
|
T |
|
042-004-00-5 |
reaktionsprodukt af ammoniummolybdat og C12-C24-diethoxyleret alkylamin (1:5-1:3) |
412-780-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
042-005-00-0 |
blanding af mono- og di-glyceroler af rapsolie; rapsoliefedtsyreamid af forgrenet 1,3-propandiamin, N-[3-(tridecyloxy)-propyl]; N, N-diorgano-dithiocarbamat molybdenkompleks |
434-240-6 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
046-001-00-X |
tetramminpalladium (II) hydrogencarbonat |
425-270-0 |
134620-00-1 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H410 |
|
|
|
|
047-001-00-2 |
sølvnitrat |
231-853-9 |
7761-88-8 |
Ox. Sol. 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H272 H314 H400 H410 |
GHS03 GHS05 GHS09 Dgr |
H272 H314 H410 |
|
|
|
|
047-002-00-8 |
polyphosphorsyre, kobber-, natrium-, magnesium-, calcium-, sølv- og zinksalt |
416-850-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
048-001-00-5 |
cadmiumforbindelser, med undtagelse af cadmiumsulfoselenid (xCdS.yCdSe) og blandinger af cadmiumsulfid med zinksulfid (xCdS.yZnS), blandinger af cadmiumsulfid med kviksølvsulfid (xCdS.yHgS) samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
048-002-00-0 |
cadmium (stabiliseret); [1] cadmiumoxid (stabiliseret) [2] |
231-152-8 [1] 215-146-2 [2] |
7440-43-9 [1] 1306-19-0 [2] |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361fd H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
048-003-00-6 |
cadmiumdiformat; cadmiumformat |
224-729-0 |
4464-23-7 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,25 % |
|
|
048-004-00-1 |
cadmiumcyanid |
208-829-1 |
542-83-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H351 H373 ** H410 |
EUH032 |
STOT RE 2; H373: C ≥ 0,1 % EUH032:C ≥ 1 % |
|
|
048-005-00-7 |
cadmiumhexafluorsilicat(2-); cadmiumfluorsilicat |
241-084-0 |
17010-21-8 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
|
|
048-006-00-2 |
cadmiumfluorid |
232-222-0 |
7790-79-6 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; 0,1 % ≤ C < 7 % |
|
|
048-007-00-8 |
cadmiumiodid |
232-223-6 |
7790-80-9 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
|
|
048-008-00-3 |
cadmiumchlorid |
233-296-7 |
10108-64-2 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: 0,1 % ≤ C < 7 % |
|
|
048-009-00-9 |
cadmiumsulfat |
233-331-6 |
10124-36-4 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373:0,1 % ≤ C < 7 % |
|
|
048-010-00-4 |
cadmiumsulfid |
215-147-8 |
1306-23-6 |
Carc. 1B Muta. 2 Repr. 2 STOT RE 1 Acute Tox. 4 * Aquatic Chronic 4 |
H350 H341 H361fd H372 ** H302 H413 |
GHS08 GHS07 Dgr |
H350 H341 H361fd H372 ** H302 H413 |
|
* STOT RE 1; H372: C ≥ 10 % STOT RE 2; H373: 0,1 % ≤ C < 10 % |
1 |
|
048-011-00-X |
cadmium (ustabiliseret) |
231-152-8 |
7440-43-9 |
Pyr. Sol. 1 Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H250 H350 H341 H361fd H330 H372 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H250 H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
050-001-00-5 |
tintetrachlorid; tinchlorid |
231-588-9 |
7646-78-8 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
STOT SE 3; H335:C ≥ 5 % |
|
|
050-002-00-0 |
cyhexatin (ISO); hydroxytricyclohexylstannan; tri(cyclohexyl)tinhydroxid |
236-049-1 |
13121-70-5 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1 000 |
|
|
050-003-00-6 |
fentinacetat (ISO); triphenyltinacetat |
212-984-0 |
900-95-8 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H410 |
|
M = 10 |
|
|
050-004-00-1 |
fentinhydroxid (ISO); triphenyltinhydroxid |
200-990-6 |
76-87-9 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d *** H330 H311 H301 H372 ** H335 H315 H318 H410 |
|
M = 10 |
|
|
050-005-00-7 |
trimethyltin-forbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-006-00-2 |
triethyltin-forbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-007-00-8 |
tripropyltin-forbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* |
A1 |
|
050-009-00-9 |
fluortripentylstannan; [1] hexapentyldistannoxan [2] |
243-546-7 [1] 247-143-7 [2] |
20153-49-5 [1] 25637-27-8 [2] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
050-010-00-4 |
fluortrihexylstannan |
243-547-2 |
20153-50-8 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
050-011-00-X |
triphenyltinforbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* M = 100 |
A1 |
|
050-012-00-5 |
tetracyclohexylstannan; [1] chlortricyclohexylstannan; [2] butyltricyclohexylstannan [3] |
215-910-5 [1] 221-437-5 [2] 230-358-5 [3] |
1449-55-4 [1] 3091-32-5 [2] 7067-44-9 [3] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
050-013-00-0 |
trioctylin-forbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 4 |
H319 H335 H315 H413 |
GHS07 Wng |
H319 H335 H315 H413 |
|
Skin Irrit. 2; H315: C ≥ 1 % Eye Irrit.2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
A1 |
|
050-017-00-2 |
fenbutatin-oxid (ISO); bis(tris(2-methyl-2-phenylpropyl)tin)-oxid |
236-407-7 |
13356-08-6 |
Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H330 H319 H315 H410 |
|
|
|
|
050-018-00-8 |
tin(II)methansulfonat |
401-640-7 |
53408-94-9 |
Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H314 H302 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H411 |
|
|
|
|
050-019-00-3 |
azocyclotin (ISO); 1-(tricyclohexylstannyl)-1H-1,2,4-triazol |
255-209-1 |
41083-11-8 |
Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H335 H315 H318 H410 |
|
|
|
|
050-020-00-9 |
trioctylstannan |
413-320-4 |
869-59-0 |
STOT RE 1 Skin Irrit. 2 Aquatic Chronic 4 |
H372 ** H315 H413 |
GHS08 GHS07 Dgr |
H372 ** H315 H413 |
|
|
|
|
050-021-00-4 |
dichlordioctylstannan |
222-583-2 |
3542-36-7 |
Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 |
H331 H372 ** H412 |
GHS06 GHS08 Dgr |
H331 H372 ** H412 |
|
|
|
|
050-022-00-X |
dibutyltindichlorid; (DBTC) |
211-670-0 |
683-18-1 |
Muta. 2 Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360FD H330 H301 H312 H372 ** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H360FD H330 H301 H312 H372 ** H314 H410 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 0,01 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,01 % ≤ C < 3 % M = 10 |
|
|
050-023-00-5 |
blanding af: bis[(2-ethyl-1-oxohexyl)oxy]dioctylstannan; bis[((2-ethyl-1-oxohexyl)oxy)dioctylstannyl]oxid; bis(1-phenyl-1,3-decandionyl)dioctylstannan; ((2-ethyl-1-oxohexyl)oxy)-(1-phenyl-1,3-decandionyl)dioctylstannan |
422-920-5 |
— |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
M = 10 |
|
|
050-024-00-0 |
blanding af: tri-p-tolyltinhydroxid; hexa-p-tolyl-distannoxan |
432-230-6 |
— |
STOT RE 1 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H372 ** H302 H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H315 H318 H317 H410 |
|
|
|
|
050-025-00-6 |
trichlormethylstannan |
213-608-8 |
993-16-8 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
050-026-00-1 |
2-ethylhexyl-10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]-thio]-4-octyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat |
260-828-5 |
57583-34-3 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
050-027-00-7 |
2-ethylhexyl-10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat |
239-622-4 |
15571-58-1 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
|
|
050-028-00-2 |
2-ethylhexyl-10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat |
260-829-0 |
57583-35-4 |
Repr. 2 Acute Tox. 4 STOT RE 1 Skin Sens. 1A |
H361d H302 H372 (nervesystem, immunsystem) H317 |
GHS08 GHS07 Dgr |
H361d H302 H372 (nervesystem, immunsystem) H317 |
|
|
|
|
050-029-00-8 |
dimethyltindichlorid |
212-039-2 |
753-73-1 |
Repr. 2 Acute Tox. 2 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Skin Corr. 1B |
H361d H330 H301 H311 H372 (nervesystem, immunsystem) H314 |
GHS08 GHS06 GHS05 Dgr |
H361d H330 H301 H311 H372 (nervesystem, immunsystem) H314 |
EUH071 |
|
|
|
051-001-00-8 |
antimontrichlorid |
233-047-2 |
10025-91-9 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
051-002-00-3 |
antimonpentachlorid |
231-601-8 |
7647-18-9 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
051-003-00-9 |
antimonforbindelser, med undtagelse af antimontetraoxid (Sb2O4), antimonpentoxid (Sb2O5), antimontrisulfid (Sb2S3), antimonpentasulfid (Sb2S5) samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
|
* |
A1 |
|
051-004-00-4 |
antimontrifluorid |
232-009-2 |
7783-56-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
|
|
|
|
051-005-00-X |
antimontrioxid |
215-175-0 |
1309-64-4 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
051-006-00-5 |
diphenyl(4-phenylthiophenyl)sulfoniumhexafluorantimonat |
403-500-0 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
051-007-00-0 |
bis(4-dodecylphenyl)iodonium hexafluorantimonat |
404-420-9 |
71786-70-4 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
053-001-00-3 |
iod |
231-442-4 |
7553-56-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H312 H400 |
GHS07 GHS09 Wng |
H332 H312 H400 |
|
|
|
|
053-002-00-9 |
hydrogeniodid |
233-109-9 |
10034-85-2 |
Press. Gas Skin Corr. 1A |
H314 |
GHS04 GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 0,2 % ≤ C < 10 % Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 % Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 % STOT RE 3; H335: C ≥ 0,02 % |
U5 |
|
053-002-01-6 |
hydrogeniodidsyre … % |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
|
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
053-003-00-4 |
iodoxybenzen |
— |
696-33-3 |
Expl. **** |
**** |
**** |
**** |
|
|
|
|
053-004-00-X |
calciumiodoxybenzoat |
— |
— |
Expl. **** |
**** |
**** |
**** |
|
|
C |
|
053-005-00-5 |
(4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorphenyl)borat(1-) |
422-960-3 |
178233-72-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H410 |
|
|
|
|
056-001-00-1 |
bariumperoxid |
215-128-4 |
1304-29-6 |
Ox. Sol. 2 Acute Tox. 4 * Acute Tox. 4 * |
H272 H332 H302 |
GHS03 GHS07 Dgr |
H272 H332 H302 |
|
|
|
|
056-002-00-7 |
bariumsalte, undtagen bariumsulfat, salte af 1-azo-2-hydroxynaphthalenylarylsulfonsyre, og salte nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
A1 |
|
056-003-00-2 |
bariumcarbonat |
208-167-3 |
513-77-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
056-004-00-8 |
bariumchlorid |
233-788-1 |
10361-37-2 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H332 |
GHS06 Dgr |
H301 H332 |
|
|
|
|
064-001-00-8 |
gadolinium(III)sulfittrihydrat |
456-900-2 |
51285-81-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
072-001-00-4 |
hafnium-tetra-n-butoxid |
411-740-2 |
22411-22-9 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
074-001-00-X |
hexanatrium-dihydrogen-dodecawolframat |
412-770-9 |
12141-67-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
074-002-00-5 |
reaktionsprodukter af wolframhexachlorid med 2-methylpropan-2-ol, nonylphenol og pentan-2,4-dion |
408-250-6 |
— |
Flam. Liq. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H314 H317 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H314 H317 H410 |
|
|
|
|
076-001-00-5 |
osmiumtetraoxid; osmiumsyre |
244-058-7 |
20816-12-0 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1B |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
078-001-00-0 |
tetrachlorplatinater, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-002-00-6 |
diammoniumtetrachlorplatinat |
237-499-1 |
13820-41-2 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
078-003-00-1 |
dinatriumtetrachlorplatinat |
233-051-4 |
10026-00-3 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
078-004-00-7 |
dikaliumtetrachlorplatinat |
233-050-9 |
10025-99-7 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
078-005-00-2 |
hexachlorplatinater, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-006-00-8 |
dinatriumhexachlorplatinat |
240-983-5 |
16923-58-3 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
078-007-00-3 |
dikaliumhexachlorplatinat |
240-979-3 |
16921-30-5 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
078-008-00-9 |
diammoniumhexachlorplatinat |
240-973-0 |
16919-58-7 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
078-009-00-4 |
hexachloroplatinsyre |
241-010-7 |
16941-12-1 |
Acute Tox. 3 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H301 H314 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H314 H334 H317 |
|
|
|
|
078-010-00-X |
tetramminplatin(II)hydrogencarbonat |
426-730-3 |
123439-82-7 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
078-011-00-5 |
hydroxydisulfitoplatin(II)syre |
423-310-1 |
61420-92-6 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 H314 H334 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 H314 H334 H317 H412 |
|
|
|
|
078-012-00-0 |
platin(IV)nitrat/salpetersyreopløsning |
432-400-1 |
— |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
080-001-00-0 |
kviksølv |
231-106-7 |
7439-97-6 |
Repr. 1B Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D *** H330 H372 ** H410 |
|
|
|
|
080-002-00-6 |
uorganiske kviksølvforbindelser, undtagen kviksølv (II) sulfid (cinnober) samt sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
A1 |
|
080-003-00-1 |
dikviksølvdichlorid |
233-307-5 |
10112-91-1 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
080-004-00-7 |
organiske kviksølvforbindelser undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
A1 |
|
080-005-00-2 |
kviksølvdifulminat; kviksølvfulminat; fulminat af kviksølv |
211-057-8 |
628-86-4 |
Unst. Expl. Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
080-005-01-X |
kviksølvdifulmat; kviksølvfulmat; fulmat af kviksølv [≥ 20 % flegmatiseringsmiddel] |
211-057-8 |
628-86-4 |
Expl. 1,1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
080-006-00-8 |
dikviksølvdicyanidoxid; kviksølvoxycyanid |
215-629-8 |
1335-31-5 |
Expl. 1,1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H410 |
|
|
|
|
080-007-00-3 |
dimethylkviksølv; [1] diethylkviksølv [2] |
209-805-3 [1] 211-000-7 [2] |
593-74-8 [1] 627-44-1 [2] |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,05 % |
1 |
|
080-008-00-9 |
phenylkviksølvnitrat; [1] phenylkviksølvhydroxid; [2] blanding af (1) og (2) [3] |
200-242-9 [1] 202-866-7 [2] -[3] |
55-68-5 [1] 100-57-2 [2] 8003-05-2 [3] |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
080-009-00-4 |
2-methoxyethylkviksølvchlorid |
204-659-7 |
123-88-6 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
080-010-00-X |
kviksølvdichlorid; kviksølvchlorid |
231-299-8 |
7487-94-7 |
Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H361f *** H300 H372 ** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H361f *** H300 H372 ** H314 H410 |
|
|
|
|
080-011-00-5 |
phenylkviksølvacetat |
200-532-5 |
62-38-4 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
081-001-00-3 |
thallium |
231-138-1 |
7440-28-0 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
081-002-00-9 |
thalliumforbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
|
|
A |
|
081-003-00-4 |
dithalliumsulfat; thallium(I)sulfat |
231-201-3 |
7446-18-6 |
Acute Tox. 2 * STOT RE 1 Skin Irrit. 2 Aquatic Chronic 2 |
H300 H372 ** H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H300 H372 ** H315 H411 |
|
|
|
|
082-001-00-6 |
blyforbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
Repr.2 H361f C ≥ 2,5 % * STOT RE 2; H373: C ≥ 0,5 % |
A1 |
|
082-002-00-1 |
blyalkyler |
— |
— |
Repr. 1A Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H330 H310 H300 H373 ** H410 |
|
Repr.1A; H360D: C ≥ 0,1 % * STOT RE 2; H373: C ≥ 0,05 % |
A1 |
|
082-003-00-7 |
blydiazid; blyazid |
236-542-1 |
13424-46-9 |
Unst. Expl. Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
082-003-01-4 |
blydiazid; blyazid [≥ 20 % flegmatiseringsmiddel] |
236-542-1 |
13424-46-9 |
Expl. 1,1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
082-004-00-2 |
blychromat |
231-846-0 |
7758-97-6 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
|
|
1 |
|
082-005-00-8 |
blydi(acetat) |
206-104-4 |
301-04-2 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
082-006-00-3 |
triblybis(orthophosphat) |
231-205-5 |
7446-27-7 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
082-007-00-9 |
blyacetat, basisk |
215-630-3 |
1335-32-6 |
Carc. 2 Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H351 H360Df H373 ** H410 |
|
|
1 |
|
082-008-00-4 |
bly(II)methansulfonat |
401-750-5 |
17570-76-2 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H360Df H332 H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H360Df H332 H302 H373 ** H315 H318 |
|
|
1 |
|
082-009-00-X |
blysulfochromatgul; C.I. Pigment Yellow 34; [Denne forbindelse identificeres i Colour Index ved Colour Indeks Constitution Number C.I. 77603.] |
215-693-7 |
1344-37-2 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
|
|
1 |
|
082-010-00-5 |
blychromatmolybdatsulfatrød (C.I. Pigment Red 104; [Denne forbindelse identificeres i Colour Index ved Colour Indeks Constitution-nummer, C.I. 77605.] |
235-759-9 |
12656-85-8 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373 ** H410 |
|
|
1 |
|
082-011-00-0 |
blyhydrogenarsenat |
232-064-2 |
7784-40-9 |
Carc. 1A Repr. 1A Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H360Df H331 H301 H373 ** H410 |
|
|
1 |
|
082-012-00-6 |
barium-bly-calcium-caesium-samarium-strontium-bromid-chlorid-fluorid-iodid, europium-doteret |
431-780-4 |
199876-46-5 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
092-001-00-8 |
uran |
231-170-6 |
7440-61-1 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
092-002-00-3 |
uranforbindelser, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
|
|
A |
|
601-001-00-4 |
methan |
200-812-7 |
74-82-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
601-002-00-X |
ethan |
200-814-8 |
74-84-0 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
601-003-00-5 |
propan |
200-827-9 |
74-98-6 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
601-004-00-0 |
butan; [1] og isobutan [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-004-01-8 |
butan (indhold ≥ 0.1 % butadin (203-450-8)); [1] isobutan (indhold ≥ 0.1 % butadin (203-450-8)) [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
C S U |
|
601-005-00-6 |
2,2-dimethylpropan; neopentan |
207-343-7 |
463-82-1 |
Flam. Gas 1 Press. Gas Aquatic Chronic 2 |
H220 H411 |
GHS02 GHS04 GHS09 Dgr |
H220 H411 |
|
|
U |
|
601-006-00-1 |
pentan |
203-692-4 |
109-66-0 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H336 H411 |
EUH066 |
|
C |
|
601-007-00-7 |
hexan (indeholdende < 5 % n-hexan (203-777-6)); 2-methylpentan; [1] 3-methylpentan; [2] 2,2-dimethylbutan; [3] 2,3-dimethylbutan [4] |
203-523-4 [1] 202-481-4 [2] 200-906-8 [3] 201-193-6 [4] |
107-83-5 [1] 96-14-0 [2] 75-83-2 [3] 79-29-8 [4] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
C |
|
601-008-00-2 |
heptan; n-heptan; [1] 2,4-dimethylpentan; [2] 2,2,3-trimethylbutan; [3] 3,3-dimethylpentan; [4] 2,3-dimethylpentan; [5] 3-methylhexan; [6] 2,2-dimethylpentan; [7] 2-methylhexan; [8] 3-ethylpentan; [9] isoheptan; [10] |
205-563-8 [1] 203-548-0 [2] 207-346-3 [3] 209-230-8 [4] 209-280-0 [5] 209-643-3 [6] 209-680-5 [7] 209-730-6 [8] 210-529-0 [9] 250-610-8 [10] |
142-82-5 [1] 108-08-7 [2] 464-06-2 [3] 562-49-2 [4] 565-59-3 [5] 589-34-4 [6] 590-35-2 [7] 591-76-4 [8] 617-78-7 [9] 31394-54-4 [10] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-009-00-8 |
octan; n-octan; [1] 2,2,4-trimethylpentan; [2] 2,3,3-trimethylpentan; [3] 3,3-dimethylhexan; [4] 2,2,3-trimethylpentan; [5] 2,3,4-trimethylpentan; [6] 3,4-dimethylhexan; [7] 2,3-dimethylhexan; [8] 2,4-dimethylhexan; [9] 4-methylheptan; [10] 3-methylheptan; [11] 2,2-dimethylhexan; [12] 2,5-dimethylhexan; [13] 2-methylheptan; [14] 2,2,3,3-tetramethylbutan; [15] 3-ethyl-2-methylpentan; [16] 3-ethylhexan; [17] 3-ethyl-3-methylpentan; [18] isooctan; [19] |
203-892-1 [1] 208-759-1 [2] 209-207-2 [3] 209-243-9 [4] 209-266-4 [5] 209-292-6 [6] 209-504-7 [7] 209-547-1 [8] 209-649-6 [9] 209-650-1 [10] 209-660-6 [11] 209-689-4 [12] 209-745-8 [13] 209-747-9 [14] 209-855-6 [15] 210-187-2 [16] 210-621-0 [17] 213-923-0 [18] 247-861-0 [19] |
111-65-9 [1] 540-84-1 [2] 560-21-4 [3] 563-16-6 [4] 564-02-3 [5] 565-75-3 [6] 583-48-2 [7] 584-94-1 [8] 589-43-5 [9] 589-53-7 [10] 589-81-1 [11] 590-73-8 [12] 592-13-2 [13] 592-27-8 [14] 594-82-1 [15] 609-26-7 [16] 619-99-8 [17] 1067-08-9 [18] 26635-64-3 [19] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-010-00-3 |
ethylen |
200-815-3 |
74-85-1 |
Flam. Gas 1 Press. Gas STOT SE 3 |
H220 H336 |
GHS02 GHS04 GHS07 Dgr |
H220 H336 |
|
|
U |
|
601-011-00-9 |
propen; propylen |
204-062-1 |
115-07-1 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
601-012-00-4 |
but-1-en; [1] buten, blanding af-1-og-2-isomerer; [2] 2-methylpropen; [3] (Z)-but-2-en; [4] (E)-but-2-en [5] |
203-449-2 [1] 203-452-9 [2] 204-066-3 [3] 209-673-7 [4] 210-855-3 [5] |
106-98-9 [1] 107-01-7 [2] 115-11-7 [3] 590-18-1 [4] 624-64-6 [5] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-013-00-X |
1,3-butadien; buta-1,3-dien |
203-450-8 |
106-99-0 |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
D U |
|
601-014-00-5 |
isopren (stabiliseret) 2-methyl-1,3-butadien |
201-143-3 |
78-79-5 |
Flam. Liq. 1 Carc. 1B Muta. 2 Aquatic Chronic 3 |
H224 H350 H341 H412 |
GHS02 GHS08 Dgr |
H224 H350 H341 H412 |
|
|
D |
|
601-016-00-6 |
cyclopropan |
200-847-8 |
75-19-4 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
601-017-00-1 |
cyclohexan |
203-806-2 |
110-82-7 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
|
|
601-018-00-7 |
methylcyclohexan |
203-624-3 |
108-87-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
601-019-00-2 |
1,4-dimethylcyclohexan |
209-663-2 |
589-90-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
601-020-00-8 |
benzen |
200-753-7 |
71-43-2 |
Flam. Liq. 2 Carc. 1a Muta. 1B STOT RE 1 Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H350 H340 H372 ** H304 H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H340 H372 ** H304 H319 H315 |
|
|
E |
|
601-021-00-3 |
toluen |
203-625-9 |
108-88-3 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 |
H225 H361d *** H304 H373 ** H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H361d *** H304 H373 ** H315 H336 |
|
|
|
|
601-022-00-9 |
o-xylen; [1] p-xylen; [2] m-xylen; [3] xylen [4] |
202-422-2 [1] 203-396-5 [2] 203-576-3 [3] 215-535-7 [4] |
95-47-6 [1] 106-42-3 [2] 108-38-3 [3] 1330-20-7 [4] |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H312 H315 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 |
|
* |
C |
|
601-023-00-4 |
ethylbenzen |
202-849-4 |
100-41-4 |
Flam. Liq. 2 Acute Tox. 4 * STOT RE 2 Asp. Tox. 1 |
H225 H332 H373 (høreorganer) H304 |
GHS02 GHS07 GHS08 Dgr |
H225 H332 H373 (høreorganer) H304 |
|
|
|
|
601-024-00-X |
cumen; [1] propylbenzen [2] |
202-704-5 [1] 203-132-9 [2] |
98-82-8 [1] 103-65-1 [2] |
Flam. Liq. 3 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H304 H335 H411 |
|
|
C |
|
601-025-00-5 |
mesitylen; 1,3,5-trimethylbenzen |
203-604-4 |
108-67-8 |
Flam. Liq. 3 STOT SE 3 Aquatic Chronic 2 |
H226 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
601-026-00-0 |
styren |
202-851-5 |
100-42-5 |
Flam. Liq. 3 Repr. 2 Acute Tox. 4 * STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H226 H361d H332 H372 (høreorganer) H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H226 H361d H332 H372 (høreorganer) H315 H319 |
|
* |
D |
|
601-027-00-6 |
2-phenylpropen; α-methylstyren |
202-705-0 |
98-83-9 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H226 H319 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H319 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
601-028-00-1 |
2-methylstyren; 2-vinyltoluen |
210-256-7 |
611-15-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
601-029-00-7 |
dipenten; limonen; [1] (R)-p-mentha-1,8-dien; d-limonen: [2] (S)-p-mentha-1,8-dien; l-limonen; [3] trans-1-methyl-4-(1-methylvinyl)cyclohexen; [4] (±)-1-methyl-4-(1-methylvinyl)cyclohexen [5] |
205-341-0 [1] 227-813-5 [2] 227-815-6 [3] 229-977-3 [4] 231-732-0 [5] |
138-86-3 [1] 5989-27-5 [2] 5989-54-8 [3] 6876-12-6 [4] 7705-14-8 [5] |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H315 H317 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H317 H410 |
|
|
C |
|
601-030-00-2 |
cyclopentan |
206-016-6 |
287-92-3 |
Flam. Liq. 2 Aquatic Chronic 3 |
H225 H412 |
GHS02 Dgr |
H225 H412 |
|
|
|
|
601-031-00-8 |
2,4,4-trimethylpent-1-en |
203-486-4 |
107-39-1 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
601-032-00-3 |
benzo[a]pyren; benzo[def]chrysen |
200-028-5 |
50-32-8 |
Carc. 1B Muta. 1B Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H360FD H317 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
601-033-00-9 |
benzo[a]anthracen |
200-280-6 |
56-55-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
M = 100 |
|
|
601-034-00-4 |
benzo[e]acephenanthryleno |
205-911-9 |
205-99-2 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
601-035-00-X |
benzo[j]fluoranthen |
205-910-3 |
205-82-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
601-036-00-5 |
benzo[k]fluoranthen |
205-916-6 |
207-08-9 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
601-037-00-0 |
n-hexan |
203-777-6 |
110-54-3 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H361f *** H304 H373 ** H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H361f *** H304 H373 ** H315 H336 H411 |
|
STOT RE 2; H373: C ≥ 5 % |
|
|
601-041-00-2 |
dibenzo[a, h]anthracen |
200-181-8 |
53-70-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % M = 100 |
|
|
601-042-00-8 |
biphenyl; diphenyl |
202-163-5 |
92-52-4 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
601-043-00-3 |
1,2,4-trimethylbenzen |
202-436-9 |
95-63-6 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H319 H335 H315 H411 |
|
|
|
|
601-044-00-9 |
3a,4,7,7a-tetrahydro-4,7-methanoinden |
201-052-9 |
77-73-6 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H332 H302 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H302 H319 H335 H315 H411 |
|
|
|
|
601-045-00-4 |
1,2,3,4-tetrahydronaphtalen |
204-340-2 |
119-64-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
EUH019 |
|
|
|
601-046-00-X |
7-methylocta-1,6-dien |
404-210-7 |
42152-47-6 |
Flam. Liq. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H400 H410 |
GHS02 GHS09 Wng |
H226 H410 |
|
|
|
|
601-047-00-5 |
m-mentha-1,3(8)-dien |
404-150-1 |
17092-80-7 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
601-048-00-0 |
chrysen |
205-923-4 |
218-01-9 |
Carc. 1B Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H400 H410 |
GHS08 GHS09 Dgr |
H350 H341 H410 |
|
|
|
|
601-049-00-6 |
benzo[e]pyren |
205-892-7 |
192-97-2 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
601-051-00-7 |
4-phenylbut-1-en |
405-980-7 |
768-56-9 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
601-052-00-2 |
naphthalen |
202-049-5 |
91-20-3 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
601-053-00-8 |
nonylphenol; [1] 4-nonylphenol, forgrenet [2] |
246-672-0 [1] 284-325-5 [2] |
25154-52-3 [1] 84852-15-3 [2] |
Repr. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361fd H302 H314 H410 |
|
|
|
|
601-054-00-3 |
blanding af isomerer af: dibenzylbenzen; dibenzyl(methyl)benzen; dibenzyl(dimethyl)benzen; dibenzyl(trimethyl)benzen |
405-570-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-055-00-9 |
blanding af isomerer af: mono-(2-tetradecyl)naphthalener og di-(2-tetradecyl)naphthalener og tri-(2-tetradecyl)naphthalener |
410-190-0 |
132983-41-6 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
601-056-00-4 |
blanding af isomerer af: methyldiphenylmethan og dimethyldiphenylmethan |
405-470-4 |
73807-39-3 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
601-057-00-X |
N-dodecyl-[3-(4-dimethylamino)benzamido)-propyl]dimethylammoniumtosylat |
421-130-8 |
156679-41-3 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
601-058-00-5 |
di-L-para-menthen |
417-870-6 |
83648-84-4 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
601-059-00-0 |
methyl 2-benzyliden-3-oxobutyrat |
420-940-9 |
15768-07-7 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
601-060-00-6 |
1,2-bis[4-fluor-6-{4-sulfo-5-(2-(4-sulfonaphthalen-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalen-7-ylazo)phenylamino}-1,3,5-triazin-2ylamino]ethan; x-natrium, y-kaliumsalte x = 7,755 y = 0,245 |
417-610-1 |
155522-09-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
601-061-00-1 |
(ethyl-1,2-ethandiyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethandiyl) |
418-960-8 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
601-062-00-7 |
blanding af: forgrenet triacontan og forgrenet dotriacontan og forgrenet tetratriacontan og forgrenet hexatriacontan |
417-030-9 |
151006-59-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
601-063-00-2 |
blanding af isomerer af forgrenet tetracosan |
417-060-2 |
151006-61-0 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
601-064-00-8 |
forgrenet hexatriacontan |
417-070-7 |
151006-62-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
601-065-00-3 |
en blanding af: (1'α,3'α,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxan-5,2'-norcaran) og (1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro(1,3-dioxan-5,2'-norcaran) |
416-930-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
601-066-00-9 |
1-(4-(trans-4-heptylcyclohexyl)phenyl)ethan |
426-820-2 |
78531-60-9 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
601-067-00-4 |
triethylarsenat |
427-700-2 |
15606-95-8 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
601-068-00-X |
1,2-diacetoxybut-3-en |
421-720-5 |
18085-02-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
601-069-00-5 |
2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridiniumbromid |
422-680-1 |
287933-44-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
601-070-00-0 |
en blanding af: forgrenet icosan og forgrenet docosan og forgrenet tetracosan |
417-050-8 |
151006-58-5 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
601-071-00-6 |
1-dimethoxymethyl-2-nitro-benzen |
423-830-9 |
20627-73-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
601-072-00-1 |
en blanding af: 1-(4-isopropylphenyl)-1-phenylethan og 1-(3-isopropylphenyl)-1-phenylethan og 1-(2-isopropylphenyl)-1-phenylethan |
430-690-2 |
52783-21-8 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
601-073-00-7 |
1-brom-3,5-difluorbenzen |
416-710-2 |
461-96-1 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H317 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Wng |
H226 H302 H373 ** H315 H317 H410 |
|
|
|
|
601-074-00-2 |
en blanding af: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octan og 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octan og spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan] og spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] |
422-040-1 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
601-075-00-8 |
4,4'-bis(N-carbamoyl-4-methylbenzensulfonamid)diphenylmethan |
418-770-5 |
151882-81-4 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
601-076-00-3 |
ethynylcyclopropan |
425-430-1 |
6746-94-7 |
Flam. Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H315 H318 H412 |
GHS02 GHS05 Dgr |
H225 H315 H318 H412 |
|
|
|
|
601-077-00-9 |
en blanding af: 1-heptyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan og 1-nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octan |
426-510-7 |
196965-91-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-078-00-4 |
en blanding af: 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptan og 2,3-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptan |
427-040-5 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
601-079-00-X |
en blanding af: trans-trans-cyclohexadeca-1,9-dien og cis-trans-cyclohexadeca-1,9-dien |
429-620-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
601-080-00-5 |
blanding af: sec-butylphenyl(phenyl)methan, blandede isomerer og 1-(sec-butylphenyl(phenyl)-2-phenylethan, blandede isomerer og 1-(sec-butylphenyl-1-phenylethan, blandede isomerer |
431-100-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-081-00-0 |
cyclohexadeca-1,9-dien |
431-730-1 |
4277-06-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
601-082-00-6 |
blanding af: endo-2-methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptan og exo-2-methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptan |
434-420-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
601-083-00-1 |
5-endo-hexyl-bicyclo[2.2.1]hept-2-en |
435-000-3 |
22094-83-3 |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Chronic 4 |
H304 H315 H413 |
GHS08 GHS07 Dgr |
H304 H315 H413 |
|
|
|
|
601-084-00-7 |
blanding af: 5-endo-butyl-bicyclo[2.2.1]hept-2-en og 5-exo-butyl-bicyclo[2.2.1]hept-2-en (80:20) |
435-180-3 |
— |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H304 H315 H410 |
|
|
|
|
601-085-00-2 |
isopentan; 2-methylbutan |
201-142-8 |
78-78-4 |
Flam. Liq. 1 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H224 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H224 H304 H336 H411 |
EUH066 |
|
|
|
601-087-00-3 |
2,4,4-trimethylpenten |
246-690-9 |
25167-70-8 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 |
H225 H304 H336 |
GHS02 GHS07 GHS08 Dgr |
H225 H304 H336 |
|
|
D |
|
601-088-00-9 |
4-vinylcyclohexen |
202-848-9 |
100-40-3 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
601-089-00-4 |
muscalure; cis-tricos-9-en |
248-505-7 |
27519-02-4 |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
602-001-00-7 |
chlormethan; methylchlorid |
200-817-4 |
74-87-3 |
Flam. Gas 1 Press. Gas Carc. 2 STOT RE 2 * |
H220 H351 H373 ** |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H373 ** |
|
|
U |
|
602-002-00-2 |
brommethan; methylbromid |
200-813-2 |
74-83-9 |
Press. Gas Muta. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Ozone 1 |
H341 H331 H301 H373 ** H319 H335 H315 H400 H420 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H341 H331 H301 H373 ** H319 H335 H315 H400 H420 |
|
|
U |
|
602-003-00-8 |
dibrommethan |
200-824-2 |
74-95-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
|
* |
|
|
602-004-00-3 |
dichlormethan; methylenchlorid |
200-838-9 |
75-09-2 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
602-005-00-9 |
methyliodid; iodmethan |
200-819-5 |
74-88-4 |
Carc. 2 Acute Tox. 4 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 |
H351 H312 H331 H301 H335 H315 |
GHS06 GHS08 Dgr |
H351 H312 H331 H301 H335 H315 |
|
|
|
|
602-006-00-4 |
chloroform; trichlormethan |
200-663-8 |
67-66-3 |
Carc. 2 Repr. 2 Acute Tox. 3 Acute Tox. 4 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H351 H361d H331 H302 H372 H319 H315 |
GHS06 GHS08 Dgr |
H351 H361d H331 H302 H372 H319 H315 |
|
|
|
|
602-007-00-X |
bromoform; tribrommethan |
200-854-6 |
75-25-2 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H331 H302 H319 H315 H411 |
GHS06 GHS09 Dgr |
H331 H302 H319 H315 H411 |
|
|
|
|
602-008-00-5 |
carbontetrachlorid; tetrachlormethan |
200-262-8 |
56-23-5 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 Ozone 1 |
H351 H331 H311 H301 H372 ** H412 H420 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H372 ** H412 H420 |
|
* STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373:0,2 % ≤ C < 1 % |
|
|
602-009-00-0 |
chlorethan |
200-830-5 |
75-00-3 |
Flam. Gas 1 Press. Gas Carc. 2 Aquatic Chronic 3 |
H220 H351 H412 |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H412 |
|
|
U |
|
602-010-00-6 |
1,2-dibromethan |
203-444-5 |
106-93-4 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H350 H331 H311 H301 H319 H335 H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H319 H335 H315 H411 |
|
* |
|
|
602-011-00-1 |
1,1-dichlorethan |
200-863-5 |
75-34-3 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H225 H302 H319 H335 H412 |
GHS02 GHS07 Dgr |
H225 H302 H319 H335 H412 |
|
* |
|
|
602-012-00-7 |
1,2-dichlorethan; ethylendichlorid |
203-458-1 |
107-06-2 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H302 H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H302 H319 H335 H315 |
|
|
|
|
602-013-00-2 |
1,1,1-trichlorethan; methylchloroform |
200-756-3 |
71-55-6 |
Acute Tox. 4 * Ozone 1 |
H332 H420 |
GHS07 Wng |
H332 H420 |
|
|
F |
|
602-014-00-8 |
1,1,2-trichlorethan |
201-166-9 |
79-00-5 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H351 H332 H312 H302 |
GHS08 GHS07 Wng |
H351 H332 H312 H302 |
EUH066 |
* |
|
|
602-015-00-3 |
1,1,2,2-tetrachlorethan |
201-197-8 |
79-34-5 |
Acute Tox. 2 * Acute Tox. 1 Aquatic Chronic 2 |
H330 H310 H411 |
GHS06 GHS09 Dgr |
H330 H310 H411 |
|
|
|
|
602-016-00-9 |
1,1,2,2-tetrabromethan |
201-191-5 |
79-27-6 |
Acute Tox. 2 * Eye Irrit. 2 Aquatic Chronic 3 |
H330 H319 H412 |
GHS06 Dgr |
H330 H319 H412 |
|
|
|
|
602-017-00-4 |
pentachlorethan |
200-925-1 |
76-01-7 |
Carc. 2 STOT RE 1 Aquatic Chronic 2 |
H351 H372 ** H411 |
GHS08 GHS09 Dgr |
H351 H372 ** H411 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
602-018-00-X |
1-chlorpropan; [1] 2-chlorpropan [2] |
208-749-7 [1] 200-858-8 [2] |
540-54-5 [1] 75-29-6 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-019-00-5 |
1-brompropan: n-propylbromid |
203-445-0 |
106-94-5 |
Flam. Liq. 2 Repr. 1B STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 STOT SE 3 |
H225 H360FD H373 ** H319 H335 H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H373 ** H319 H335 H315 H336 |
|
|
|
|
602-021-00-6 |
1,2-dibrom-3-chlorpropan |
202-479-3 |
96-12-8 |
Carc. 1B Muta. 1B Repr. 1A Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H340 H360f *** H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H340 H360f *** H301 H373 ** H412 |
|
|
|
|
602-022-00-1 |
1-chlorpentan; [1] 2-chlorpentan; [2] 3-chlorpentan [3] |
208-846-4 [1] 210-885-7 [2] 210-467-4 [3] |
543-59-9 [1] 625-29-6 [2] 616-20-6 [3] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-023-00-7 |
vinylchlorid; chlorethylen |
200-831-0 |
75-01-4 |
Press. Gas Flam. Gas 1 Carc. 1A |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
D U |
|
602-024-00-2 |
bromethylen |
209-800-6 |
593-60-2 |
Press. Gas Flam. Gas 1 Carc. 1B |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
U |
|
602-025-00-8 |
1,1-dichlorethylen; vinylidenchlorid |
200-864-0 |
75-35-4 |
Flam. Liq. 1 Carc. 2 Acute Tox. 4 * |
H224 H351 H332 |
GHS02 GHS08 GHS07 Dgr |
H224 H351 H332 |
|
* |
D |
|
602-026-00-3 |
1,2-dichlorethylen; [1] cis-dichlorethylen; [2] trans-dichlorethylen [3] |
208-750-2 [1] 205-859-7 [2] 205-860-2 [3] |
540-59-0 [1] 156-59-2 [2] 156-60-5 [3] |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H225 H332 H412 |
GHS02 GHS07 Dgr |
H225 H332 H412 |
|
* |
C |
|
602-027-00-9 |
trichlorethylen; trichlorethen |
201-167-4 |
79-01-6 |
Carc. 1B Muta. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H350 H341 H319 H315 H336 H412 |
GHS08 GHS07 Dgr |
H350 H341 H319 H315 H336 H412 |
|
|
|
|
602-028-00-4 |
tetrachlorethylen |
204-825-9 |
127-18-4 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
602-029-00-X |
3-chlorpropen; allylchlorid |
203-457-6 |
107-05-1 |
Flam. Liq. 2 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
|
|
D |
|
602-030-00-5 |
1,3-dichlorpropen; [1] (Z)-1,3-dichlorpropen [2] |
208-826-5 [1] 233-195-8 [2] |
542-75-6 [1] 10061-01-5 [2] |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Asp. Tox. 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H410 |
|
|
C D |
|
602-031-00-0 |
1,1-dichlorpropen |
209-253-3 |
563-58-6 |
Flam. Liq. 2 Acute Tox. 3 * Aquatic Chronic 3 |
H225 H301 H412 |
GHS02 GHS06 Dgr |
H225 H301 H412 |
|
|
|
|
602-032-00-6 |
3-chlor-2-methylpropen |
209-251-2 |
563-47-3 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H317 H411 |
|
|
|
|
602-034-00-7 |
1,2-dichlorbenzen; ortho-dichlorbenzen |
202-425-9 |
95-50-1 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
* |
|
|
602-035-00-2 |
1,4-dichlorbenzen; para-dichlorbenzen |
203-400-5 |
106-46-7 |
Carc. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H400 H410 |
GHS08 GHS09 Wng |
H351 H319 H410 |
|
|
|
|
602-036-00-8 |
chloropren (stabiliseret); 2-chlor-1,3-butadien (stabiliseret) |
204-818-0 |
126-99-8 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
|
|
D |
|
602-037-00-3 |
α-chlortoluen; benzylchlorid |
202-853-6 |
100-44-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H373 ** H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H373 ** H335 H315 H318 |
|
|
|
|
602-038-00-9 |
α, α,α-trichlortoluen; trichlormethylbenzen |
202-634-5 |
98-07-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H335 H315 H318 |
|
|
|
|
602-039-00-4 |
polychlorerede biphenyler; PCB |
215-648-1 |
1336-36-3 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
STOT RE 2; H373: C ≥ 0.005 % |
C |
|
602-040-00-X |
2-chlortoluen; [1] 3-chlortoluen; [2] 4-chlortoluen; [3] chlortoluen [4] |
202-424-3 [1] 203-580-5 [2] 203-397-0 [3] 246-698-2 [4] |
95-49-8 [1] 108-41-8 [2] 106-43-4 [3] 25168-05-2 [4] |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
C |
|
602-041-00-5 |
pentachlornaphthalen |
215-320-8 |
1321-64-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H410 |
|
|
C |
|
602-042-00-0 |
1,2,3,4,5,6-hexachlorcyclohexaner med undtagelse af sådanne angivet andetsteds i dette bilag |
— |
— |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H410 |
|
|
A C |
|
602-043-00-6 |
lindan (ISO); γ-HCH eller γ-BHC; γ-1,2,3,4,5,6-hexachlorcyclohexan |
200-401-2 |
58-89-9 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H373 ** H362 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H312 H373 ** H362 H410 |
|
M = 10 |
|
|
602-044-00-1 |
camphechlor (ISO); toxaphen |
232-283-3 |
8001-35-2 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H335 H315 H410 |
|
|
|
|
602-045-00-7 |
DDT (ikke anerkendt af ISO); clofenotan (INN); dicophan; 1,1,1-trichlor-2,2-bis(4-chlorphenyl)ethan; dichlordiphenyltrichlorethan |
200-024-3 |
50-29-3 |
Carc. 2 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H372 ** H410 |
|
|
|
|
602-046-00-2 |
heptachlor (ISO); 1,4,5,6,7,8,8-heptachlor-3a,4,7,7a-tetrahydro-4,7-methanoinden |
200-962-3 |
76-44-8 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H373 ** H410 |
|
|
|
|
602-047-00-8 |
chlordan (ISO); 1,2,4,5,6,7,8,8-octachlor-3a,4,7,7a-tetrahydro-4,7-methanoindan |
200-349-0 |
57-74-9 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
|
|
|
|
602-048-00-3 |
aldrin (ISO) |
206-215-8 |
309-00-2 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H372 ** H410 |
|
|
|
|
602-049-00-9 |
dieldrin (ISO) |
200-484-5 |
60-57-1 |
Carc. 2 Acute Tox. 1 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H310 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H310 H301 H372 ** H410 |
|
|
|
|
602-050-00-4 |
isodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-hexachlor-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalen |
207-366-2 |
465-73-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 100 |
|
|
602-051-00-X |
endrin (ISO); 1,2,3,4,10,10-hexachlor-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalen |
200-775-7 |
72-20-8 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
602-052-00-5 |
endosulfan (ISO); 1,2,3,4,7,7-hexachlor-8,9,10-trinorborn-2-en-5,6-ylendimethylsulfit; 1,2,3,4,7,7-hexachlor-8,9,10-trinorborn-5-en-2,3-ylendimethylsulfit |
204-079-4 |
115-29-7 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H312 H410 |
|
|
|
|
602-053-00-0 |
isobenzan (ISO); 1,3,4,5,6,7,8,8-octachlor- 1,3,3a,4,7,7a-hexahydro-4,7- methanoisobenzofuran |
206-045-4 |
297-78-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
602-054-00-6 |
3-iodpropen; allyliodid |
209-130-4 |
556-56-9 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
602-055-00-1 |
bromethan; |
200-825-8 |
74-96-4 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H351 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H302 |
|
|
|
|
602-056-00-7 |
α, α,α-trifluortoluen; trifluormethylbenzen |
202-635-0 |
98-08-8 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
602-057-00-2 |
α-bromtoluen; benzylbromid |
202-847-3 |
100-39-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
|
|
|
602-058-00-8 |
α, α-dichlortoluen; benzylidendichlorid; benzalchlorid |
202-709-2 |
98-87-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H351 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H351 H331 H302 H335 H315 H318 |
|
|
|
|
602-059-00-3 |
1-chlorbutan; butylchlorid |
203-696-6 |
109-69-3 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
602-060-00-9 |
brombenzen |
203-623-8 |
108-86-1 |
Flam. Liq. 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H411 |
|
|
|
|
602-061-00-4 |
hexafluorpropen; hexaflourpropylen |
204-127-4 |
116-15-4 |
Press. Gas Acute Tox. 4 * STOT SE 3 |
H332 H335 |
GHS07 Wng |
H332 H335 |
|
|
U |
|
602-062-00-X |
1,2,3-trichlorpropan |
202-486-1 |
96-18-4 |
Carc. 1B Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H360f *** H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H360f *** H332 H312 H302 |
|
|
D |
|
602-063-00-5 |
heptachlorepoxid; 2,3-epoxy-1,4,5,6,7,8,8-heptachlor-3a,4,7,7a-tetrahydro-4,7-methanoindan |
213-831-0 |
1024-57-3 |
Carc. 2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H373 ** H410 |
|
|
|
|
602-064-00-0 |
1,3-dichlor-2-propanol |
202-491-9 |
96-23-1 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * |
H350 H301 H312 |
GHS06 GHS08 Dgr |
H350 H301 H312 |
|
|
|
|
602-065-00-6 |
hexachlorbenzen |
204-273-9 |
118-74-1 |
Carc. 1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H372 ** H410 |
|
|
|
|
602-066-00-1 |
tetrachlor-p-benzoquinon |
204-274-4 |
118-75-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
602-067-00-7 |
1,3-dichlorbenzen |
208-792-1 |
541-73-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
602-068-00-2 |
ethylenbis(trichloracetat) |
219-732-9 |
2514-53-6 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
602-069-00-8 |
dichloracetylen |
— |
7572-29-4 |
Unst. Expl. Carc. 2 STOT RE 2 * |
H200 H351 H373 ** |
GHS01 GHS08 Wng |
H200 H351 H373 ** |
|
|
|
|
602-070-00-3 |
3-chlor-4,5,α, α,α-pentafluortoluen |
401-930-3 |
77227-99-7 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H332 H302 H400 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H302 H400 |
|
|
|
|
602-071-00-9 |
brombenzylbromtoluen, blanding af isomerer |
402-210-1 |
99688-47-8 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
602-072-00-4 |
dichlor[(dichlorphenyl)methyl]methylbenzen, blanding af isomerer; (dichlorphenyl)(dichlortolyl)methan, blanding af isomerer (IUPAC) |
278-404-3 |
76253-60-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
602-073-00-X |
1,4-dichlorbut-2-en |
212-121-8 |
764-41-0 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H330 H311 H301 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H330 H311 H301 H314 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % STOT SE 3; H335:C ≥ 5 % |
|
|
602-074-00-5 |
pentachlorbenzen |
210-172-0 |
608-93-5 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
602-075-00-0 |
4,4,5,5-tetrachlor-1,3-dioxolan-2-on |
404-060-2 |
22432-68-4 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS05 Dgr |
H330 H302 H314 |
|
|
|
|
602-076-00-6 |
2,3,4-trichlorbut-1-en |
219-397-9 |
2431-50-7 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H302 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H302 H319 H335 H315 H410 |
|
Carc. 2; H351: C ≥ 0,1 % |
|
|
602-077-00-1 |
dodecachlorpentacyclo[5.2.1.02,6.03,9.05,8]decan; mirex |
219-196-6 |
2385-85-5 |
Carc. 2 Repr. 2 Lact. Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H362 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H362 H312 H302 H410 |
|
|
|
|
602-078-00-7 |
hexachlorcyclopentadien |
201-029-3 |
77-47-4 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H302 H314 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H311 H302 H314 H410 |
|
|
|
|
602-079-00-2 |
2,3-dichlorpropen; 2,3-dichlorpropylen |
201-153-8 |
78-88-6 |
Flam. Liq. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
|
|
|
|
602-080-00-8 |
alkaner, C10-13-, chlor-; chlorerede paraffiner, C10-13 |
287-476-5 |
85535-84-8 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
EUH066 |
|
|
|
602-081-00-3 |
2-chlor-4,5-difluorbenzoesyre |
405-380-5 |
— |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H312 H302 H318 H317 |
GHS05 GHS07 Dgr |
H312 H302 H318 H317 |
|
|
|
|
602-082-00-9 |
2,2,6,6-tetrakis(brommethyl)-4-oxaheptan-1,7-diol |
408-020-5 |
109678-33-3 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
602-083-00-4 |
diphenylether, pentabromderivat; pentabromdiphenylether |
251-084-2 |
32534-81-9 |
STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H362 H400 H410 |
GHS08 GHS09 Wng |
H373 ** H362 H410 |
|
|
|
|
602-084-00-X |
1,1-dichlor-1-fluorethan |
404-080-1 |
1717-00-6 |
Aquatic Chronic 3 Ozone 1 |
H412 H420 |
GHS07 Wng |
H412 H420 |
|
|
|
|
602-085-00-5 |
2-brompropan |
200-855-1 |
75-26-3 |
Flam. Liq. 2 Repr. 1a STOT RE 2 * |
H225 H360f *** H373 ** |
GHS02 GHS08 Dgr |
H225 H360f *** H373 ** |
EUH066 |
|
|
|
602-086-00-0 |
trifluoriodmethan; triflourmethyliodid |
219-014-5 |
2314-97-8 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
602-087-00-6 |
1,2,4-trichlorbenzen |
204-428-0 |
120-82-1 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
602-088-00-1 |
2,3-dibrompropan-1-ol; 2,3-dibrom-1-propanol |
202-480-9 |
96-13-9 |
Carc. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H350 H361f *** H311 H332 H302 H412 |
GHS08 GHS07 Dgr |
H350 H361f *** H311 H332 H302 H412 |
|
|
|
|
602-089-00-7 |
4-brom-2-chlorfluorbenzen |
405-580-2 |
60811-21-4 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
602-090-00-2 |
1-allyl-3-chlor-4-fluorbenzen |
406-630-6 |
121626-73-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
602-091-00-8 |
1,3-dichlor-4-fluorbenzen |
406-160-1 |
1435-48-9 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 |
H302 H373 ** H315 H411 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H411 |
|
|
|
|
602-092-00-3 |
1-brom-3,4,5-trifluorbenzen |
418-480-9 |
138526-69-9 |
Flam. Liq. 3 Carc. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H351 H315 H318 H411 |
GHS02 GHS08 GHS05 GHS09 Dgr |
H226 H351 H315 H318 H411 |
|
|
|
|
602-093-00-9 |
α, α,α,4-tetrachlortoluen; p-chlorbenzotrichlorid |
226-009-1 |
5216-25-1 |
Carc. 1B Repr. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H350 H361f *** H372 ** H312 H302 H335 H315 |
GHS08 GHS07 Dgr |
H350 H361f *** H372 ** H312 H302 H335 H315 |
|
|
|
|
602-094-00-4 |
diphenylether, octabromderivat |
251-087-9 |
32536-52-0 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
602-095-00-X |
alkaner, C14-17-, chlor-; chlorerede paraffiner, C14-17 |
287-477-0 |
85535-85-9 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
EUH066 |
|
|
|
602-096-00-5 |
malachite green hydrochlorid; [1] malachite green oxalat [2] |
209-322-8 [1] 219-441-7 [2] |
569-64-2 [1] 2437-29-8 [2] |
Repr. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361d *** H302 H318 H410 |
|
|
|
|
602-097-00-0 |
1-brom-9-(4,4,5,5,5-pentafluorpentylthio)nonan |
422-850-5 |
148757-89-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
602-098-00-6 |
2-(3-bromphenoxy)tetrahydro-2H-pyran |
429-030-6 |
57999-49-2 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
602-099-00-1 |
3-(4-fluorphenyl)-2-methylpropionylchlorid |
426-370-7 |
— |
Skin Corr. 1A Acute Tox. 4 * Aquatic Chronic 3 |
H314 H302 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
EUH014 EUH029 |
|
|
|
602-100-00-5 |
en blanding af: (R,R)-1,1,1,2,2,3,4,5,5,5-decafluorpentan; (S,S)-1,1,1,2,2,3,4,5,5,5-decafluorpentan |
420-640-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
602-101-00-0 |
2-chlor-4-fluor-5-nitrophenyl (isobutyl)carbonat |
427-020-6 |
141772-37-4 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
602-102-00-6 |
1,1,1,3,3-pentafluorbutan |
430-250-1 |
406-58-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
602-103-00-1 |
1-(chlorphenylmethyl)-2-methylbenzen |
431-450-1 |
41870-52-4 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
602-104-00-7 |
1,1,2,2,3,3,4-heptafluorcyclopentan |
430-710-1 |
15290-77-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
602-105-00-2 |
natrium-1,1,2,2,3,3,4,4,4-nonafluor-1-butansulfinat |
422-100-7 |
102061-82-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
602-106-00-8 |
2-brom-4,6-difluoranilin |
429-430-0 |
444-14-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
602-107-00-3 |
3,3,4,4-tetrafluor-4-iod-1-buten |
439-500-2 |
33831-83-3 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
602-108-00-9 |
(2,3,5,6-tetrafluorphenyl)methanol |
443-840-7 |
4084-38-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
602-109-00-4 |
hexabromcyclododecan [1] 1,2,5,6,9,10-hexabromcyclododecan [2] |
247-148-4 [1] 221-695-9 [2] |
25637-99-4 [1] 3194-55-6 [2] |
Repr. 2 Lact. |
H361 H362 |
GHS08 Wng |
H361 H362 |
|
|
|
|
603-001-00-X |
methanol |
200-659-6 |
67-56-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 |
H225 H331 H311 H301 H370** |
GHS02 GHS06 GHS08 Dgr |
H225 H331 H311 H301 H370** |
|
* STOT SE 1; H370: C ≥ 10 % STOT SE 2; H371: 3 % ≤ C < 10 % |
|
|
603-002-00-5 |
ethanol; ethylalkohol |
200-578-6 |
64-17-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
603-003-00-0 |
propan-1-ol; n-propanol |
200-746-9 |
71-23-8 |
Flam. Liq. 2 Eye Dam. 1 STOT SE 3 |
H225 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H225 H318 H336 |
|
|
|
|
603-004-00-6 |
butan-1-ol; n-butanol |
200-751-6 |
71-36-3 |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H302 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H335 H315 H318 H336 |
|
|
|
|
603-005-00-1 |
2-methylpropan-2-ol; tert-butylalkohol |
200-889-7 |
75-65-0 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
|
|
|
|
603-006-00-7 |
pentanol-isomerer, undtagen sådanne nævnt andetsteds i dette bilag |
250-378-8 |
|
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 |
H226 H332 H335 |
GHS02 GHS07 Wng |
H226 H332 H335 |
EUH066 |
|
C |
|
603-007-00-2 |
2-methyl-2-butanol; tert-pentanolalkohol |
200-908-9 |
75-85-4 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H225 H332 H335 H315 |
GHS02 GHS07 Dgr |
H225 H332 H335 H315 |
|
|
|
|
603-008-00-8 |
4-methyl-2-pentanol; methylamylalkohol |
203-551-7 |
108-11-2 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
603-009-00-3 |
cyclohexanol |
203-630-6 |
108-93-0 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H332 H302 H335 H315 |
GHS07 Wng |
H332 H302 H335 H315 |
|
|
|
|
603-010-00-9 |
2-methylcyclohexanol, blanding af isomerer; [1] cis-2-methylcyclohexanol; [2] trans-2-methylcyclohexanol [3] |
209-512-0 [1] 231-187-9 [2] 231-186-3 [3] |
583-59-5 [1] 7443-70-1 [2] 7443-52-9 [3] |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
C |
|
603-011-00-4 |
2-methoxyethanol; methylglycol |
203-713-7 |
109-86-4 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
603-012-00-X |
2-ethoxyethanol; ethylglycol |
203-804-1 |
110-80-5 |
Flam. Liq. 3 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H226 H360FD H331 H302 |
GHS02 GHS08 GHS06 Dgr |
H226 H360FD H331 H302 |
|
|
|
|
603-013-00-5 |
2-isopropoxyethanol; isopropylglycol |
203-685-6 |
109-59-1 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H332 H312 H319 |
GHS07 Wng |
H332 H312 H319 |
|
|
|
|
603-014-00-0 |
2-butoxyethanol; butylglycol |
203-905-0 |
111-76-2 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H332 H312 H302 H319 H315 |
GHS07 Wng |
H332 H312 H302 H319 H315 |
|
|
|
|
603-015-00-6 |
allylalkohol |
203-470-7 |
107-18-6 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H331 H311 H301 H319 H335 H315 H400 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H319 H335 H315 H400 |
|
|
|
|
603-016-00-1 |
4-hydroxy-4-methyl-2-pentanon; diacetonalkohol |
204-626-7 |
123-42-2 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
Eye Irrit. 2; H319: C ≥ 10 % |
|
|
603-018-00-2 |
furfurylalkohol |
202-626-1 |
98-00-0 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 |
H351 H331 H312 H302 H373 ** H319 H335 |
GHS06 GHS08 Dgr |
H351 H331 H312 H302 H373 ** H319 H335 |
|
|
|
|
603-019-00-8 |
dimethylether |
204-065-8 |
115-10-6 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
603-020-00-3 |
methylethylether |
— |
540-67-0 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
603-021-00-9 |
methylvinylether |
203-475-4 |
107-25-5 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
D U |
|
603-022-00-4 |
diethylether; ether |
200-467-2 |
60-29-7 |
Flam. Liq. 1 Acute Tox. 4 * STOT SE 3 |
H224 H302 H336 |
GHS02 GHS07 Dgr |
H224 H302 H336 |
EUH019 EUH066 |
|
|
|
603-023-00-X |
ethylenoxid; oxiran |
200-849-9 |
75-21-8 |
Press. Gas Flam. Gas 1 Carc. 1B Muta. 1B Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H220 H350 H340 H331 H319 H335 H315 |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H350 H340 H331 H319 H335 H315 |
|
|
U |
|
603-024-00-5 |
1,4-dioxan |
204-661-8 |
123-91-1 |
Flam. Liq. 2 Carc. 2 Eye Irrit. 2 STOT SE 3 |
H225 H351 H319 H335 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H319 H335 |
EUH019 EUH066 |
|
D |
|
603-025-00-0 |
tetrahydrofuran |
203-726-8 |
109-99-9 |
Flam. Liq. 2 Carc. 2 Eye Irrit. 2 STOT SE 3 |
H225 H351 H319 H335 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H319 H335 |
EUH019 |
STOT SE 3; H335: C ≥ 25 % Eye Irrit.2; H319: C ≥ 25 % |
|
|
603-026-00-6 |
1-chlor-2,3-epoxypropan; epichlorhydrin |
203-439-8 |
106-89-8 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
* |
|
|
603-027-00-1 |
ethandiol; ethylenglycol |
203-473-3 |
107-21-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
603-028-00-7 |
2-chlorethanol; ethylenchlorhydrin |
203-459-7 |
107-07-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
603-029-00-2 |
bis(2-chlorethyl)ether |
203-870-1 |
111-44-4 |
Carc. 2 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H351 H330 H310 H300 |
GHS06 GHS08 Dgr |
H351 H330 H310 H300 |
|
|
|
|
603-030-00-8 |
2-aminoethanol; ethanolamin |
205-483-3 |
141-43-5 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H332 H312 H302 H314 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
603-031-00-3 |
1,2-dimethoxyethan; ethylenglycoldimethylether; EDGME |
203-794-9 |
110-71-4 |
Flam. Liq. 2 Repr. 1B Acute Tox. 4 * |
H225 H360FD H332 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H332 |
EUH019 |
|
|
|
603-032-00-9 |
ethylendinitrat; ethylenglycoldinitrat |
211-063-0 |
628-96-6 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 |
H200 H330 H310 H300 H373 ** |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** |
|
|
|
|
603-033-00-4 |
oxydiethylendinitrat; diethylenglycoldinitrat; digoldinitrat |
211-745-8 |
693-21-0 |
Unst. Expl Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H200 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** H412 |
|
|
|
|
603-033-01-1 |
oxydiethylendinitrat; diethylenglycoldinitrat; digoldinitrat; [>25 % flegmatiseringsmiddel] |
211-745-8 |
693-21-0 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H201 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H201 H330 H310 H300 H373 ** H412 |
|
|
|
|
603-034-00-X |
glyceroltrinitrat; nitroglycerin |
200-240-8 |
55-63-0 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H200 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H330 H310 H300 H373 ** H411 |
|
|
|
|
603-034-01-7 |
glyceroltrinitrat; nitroglycerin; [>40 % flegmatiseringsmiddel] |
200-240-8 |
55-63-0 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H201 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
|
|
|
|
603-035-00-5 |
pentaerythritoltetranitrat; pentaerythrittetranitrat; PETN |
201-084-3 |
78-11-5 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
603-035-01-2 |
pentaerythritoltetranitrat; pentaerythrittetranitrat; PETN; [>20 % flegmatiseringsmiddel] |
201-084-3 |
78-11-5 |
Expl. 1,1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
603-036-00-0 |
mannitolhexanitrat; nitromannit |
239-924-6 |
15825-70-4 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
603-036-01-8 |
mannitolhexanitrat; nitromannit; [>40 % flegmatiseringsmiddel] |
239-924-6 |
15825-70-4 |
Expl. 1,1 |
H201 |
GHS01 Dgr |
H201 |
|
|
|
|
603-037-00-6 |
cellulosenitrat; nitrocellulose |
— |
— |
Expl. 1,1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
603-038-00-1 |
allylglycidylether; allyl 2,3-epoxypropylether; prop-2-en-1-yl 2,3-epoxypropylether |
203-442-4 |
106-92-3 |
Flam. Liq. 3 Carc. 2 Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
|
|
|
|
603-039-00-7 |
1-butoxy-2,3-epoxypropan; butylglycidylether |
219-376-4 |
2426-08-6 |
Flam. Liq. 3 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H332 H302 H335 H317 H412 |
GHS02 GHS08 GHS07 Wng |
H226 H351 H341 H332 H302 H335 H317 H412 |
|
|
|
|
603-040-00-2 |
natriummethanolat; natriummethoxid; [1] kaliummethanolat; kaliummethoxid; [2] lithiummethanolat; lithiummethoxid [3] |
204-699-5 [1] 212-736-1 [2] 212-737-7 [3] |
124-41-4 [1] 865-33-8 [2] 865-34-9 [3] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-041-00-8 |
kaliumethanolat; kaliumethoxid; [1] natriummethanolat; natriumethoxid [2] |
213-029-0 [1] 205-487-5 [2] |
917-58-8 [1] 141-52-6 [2] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-042-00-3 |
aluminiumtriisopropylat; aluminiumtriisopropoxid |
209-090-8 |
555-31-7 |
Flam. Sol. 1 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
603-043-00-9 |
triarimol (ISO); 2,4-dichlorphenyl-α-phenyl-pyrimidin-5-yl-methanol |
— |
26766-27-8 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
603-044-00-4 |
dicofol (ISO); 2,2,2-trichlor-1,1-bis(4-chlorphenyl)ethanol |
204-082-0 |
115-32-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
|
|
|
|
603-045-00-X |
diisopropylether; [1] dipropylether [2] |
203-560-6 [1] 203-869-6 [2] |
108-20-3 [1] 111-43-3 [2] |
Flam. Liq. 2 STOT SE 3 |
H225 H336 |
GHS02 GHS07 Dgr |
H225 H336 |
EUH019 EUH066 |
|
C |
|
603-046-00-5 |
bis(chlormethyl)ether; oxybis(chlormethan) |
208-832-8 |
542-88-1 |
Flam. Liq. 2 Carc. 1A Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * |
H225 H350 H330 H311 H302 |
GHS02 GHS06 GHS08 Dgr |
H225 H350 H330 H311 H302 |
|
Carc. 1A; H350: C ≥ 0,001 % |
|
|
603-047-00-0 |
2-dimethylaminoethanol; N, N-dimethylethanolamin |
203-542-8 |
108-01-0 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
603-048-00-6 |
2-diethylaminoethanol; N, N-diethylethanolamin |
202-845-2 |
100-37-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
603-049-00-1 |
chlorfenethol (ISO); 1,1-bis (4-chlorphenyl) ethanol |
201-246-3 |
80-06-8 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
603-050-00-7 |
1-(2-butoxypropoxy)-2-propanol |
246-011-6 |
24083-03-2 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
603-051-00-2 |
2-ethylbutanol |
202-621-4 |
97-95-0 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
603-052-00-8 |
3-butoxy-2-propanol; propylenglycolmonobutylether |
225-878-4 |
5131-66-8 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
603-053-00-3 |
2-methyl-2,4-pentandiol |
203-489-0 |
107-41-5 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
603-054-00-9 |
di-n-butylether; dibutylether |
205-575-3 |
142-96-1 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 3 |
H226 H319 H335 H315 H412 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H412 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
603-056-00-X |
[(p-tolyloxy)methyl]oxiran; [1] [[(m-tolyloxy)methyl]oxiran; [2] 2,3-epoxypropyl-o-tolylether; [3][(tolyloxy)methyl]oxiran; cresylglycidylether [4] |
218-574-8 [1] 218-575-3 [2] 218-645-3 [3] 247-711-4 [4] |
2186-24-5 [1] 2186-25-6 [2] 2210-79-9 [3] 26447-14-3 [4] |
Muta. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H315 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H315 H317 H411 |
|
|
C |
|
603-057-00-5 |
benzylalkohol |
202-859-9 |
100-51-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
603-058-00-0 |
oxetan |
207-964-3 |
503-30-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
|
|
603-059-00-6 |
1-hexanol |
203-852-3 |
111-27-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
603-060-00-1 |
2,2'-bioxiran;1,2:3,4-diepoxybutan |
215-979-1 |
1464-53-5 |
Carc. 1B Muta. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H350 H340 H330 H311 H301 H314 |
GHS06 GHS08 GHS05 Dgr |
H350 H340 H330 H311 H301 H314 |
|
|
|
|
603-061-00-7 |
tetrahydro-2-furylmethanol; tetrahydrofurfurylalkohol |
202-625-6 |
97-99-4 |
Repr. 1B Eye Irrit. 2 |
H360Df H319 |
GHS08 GHS07 Dgr |
H360Df H319 |
|
|
|
|
603-062-00-2 |
2,5-bis(hydroxymethyl)oxolan |
203-239-0 |
104-80-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
603-063-00-8 |
2,3-epoxypropan-1-ol; glycidol: oxiranmethanol |
209-128-3 |
556-52-5 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H341 H360f *** H331 H312 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H341 H360f *** H331 H312 H302 H319 H335 H315 |
|
|
|
|
603-064-00-3 |
1-methoxy-2-propanol; monopropylenglycolmethylether |
203-539-1 |
107-98-2 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
603-065-00-9 |
resorcinoldiglycidylether; 1,3-bis(2,3-epoxypropoxy)benzen |
202-987-5 |
101-90-6 |
Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H351 H341 H312 H302 H319 H315 H317 H412 |
GHS08 GHS07 Wng |
H351 H341 H312 H302 H319 H315 H317 H412 |
|
|
|
|
603-066-00-4 |
1,2-epoxy-4-epoxyethylcyclohexan; 4-vinylcyclohexendiepoxid |
203-437-7 |
106-87-6 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H351 H331 H311 H301 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 |
|
* |
|
|
603-067-00-X |
phenylglycidylether; 2,3-epoxypropyl phenyl ether; 1,2-epoxy-3-phenoxypropan |
204-557-2 |
122-60-1 |
Carc. 1B Muta. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H332 H335 H315 H317 H412 |
GHS08 GHS07 Dgr |
H350 H341 H332 H335 H315 H317 H412 |
|
|
|
|
603-068-00-5 |
1-(2-ethylcyclohexanoxy)-2,3-epoxypropan; ethylcyclohexylglycidylether |
— |
130014-35-6 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
603-069-00-0 |
2,4,6-tris(dimethylamino-methyl)-phenol |
202-013-9 |
90-72-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
603-070-00-6 |
2-amino-2-methylpropanol |
204-709-8 |
124-68-5 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
603-071-00-1 |
2,2'-iminodiethanol; diethanolamin |
203-868-0 |
111-42-2 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 |
|
|
|
|
603-072-00-7 |
1,4-bis(2,3 epoxypropoxy)butan; butandioldiglycidylether |
219-371-7 |
2425-79-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H312 H319 H315 H317 |
GHS07 Wng |
H332 H312 H319 H315 H317 |
|
|
|
|
603-073-00-2 |
bisphenol-A-diglycidylether; 2,2-bis(p-(2,3-epoxipropoxi)phenyl]propan |
216-823-5 |
1675-54-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
|
|
603-074-00-8 |
reaktionsprodukt: bisphenol-A-epichlorhydrin; epoxy harpiks (gennemsnitlig molekylevægt ≤ 700) |
500-033-5 |
25068-38-6 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
|
Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit 2; H315: C ≥ 5 % |
|
|
603-075-00-3 |
chlormethylmethylether; chlordimethylether |
203-480-1 |
107-30-2 |
Flam. Liq. 2 Carc. 1A Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H312 H302 |
|
|
|
|
603-076-00-9 |
but-2-yn-1,4-diol; 2-butyn-1,4-diol |
203-788-6 |
110-65-6 |
Skin Corr. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H331 H301 H312 H373 ** H317 |
GHS06 GHS05 GHS08 Dgr |
H314 H331 H301 H312 H373 ** H317 |
|
Skin Corr. 1B; H314: C ≥ 50 % Skin Irrit. 2; H315: 25 % ≤ C < 50 % Eye Irrit. 2; H319: 25 % ≤ C < 50 % |
D |
|
603-077-00-4 |
1-dimethylaminopropan-2-ol; dimepranol (INN) |
203-556-4 |
108-16-7 |
Flam. Liq. 3 Acute Tox. 4 * Skin Corr. 1B |
H226 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 |
|
|
|
|
603-078-00-X |
prop-2-yn-1-ol; propargylalkohol |
203-471-2 |
107-19-7 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H311 H301 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H311 H301 H314 H411 |
|
|
|
|
603-079-00-5 |
2,2'-methyliminodiethanol; N-methyldiethanolamin |
203-312-7 |
105-59-9 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-080-00-0 |
2-methylaminoethanol; N-methylethanolamin; N-methyl-2-ethanolamin; N-methyl-2-aminoethanol; 2-(methylamino)ethanol |
203-710-0 |
109-83-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
603-081-00-6 |
2,2'-thiodiethanol; thiodiglycol |
203-874-3 |
111-48-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-082-00-1 |
1-aminopropan-2-ol; isopropanolamin |
201-162-7 |
78-96-6 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
603-083-00-7 |
1,1'-iminodipropan-2-ol; diisopropanolamin |
203-820-9 |
110-97-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-084-00-2 |
styrenoxid; (epoxyethyl)benzen; phenyloxiran |
202-476-7 |
96-09-3 |
Carc. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H312 H319 |
GHS08 GHS07 Dgr |
H350 H312 H319 |
|
|
|
|
603-085-00-8 |
bronopol (INN); 2-brom-2-nitropropan-1,3-diol |
200-143-0 |
52-51-7 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H312 H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H335 H315 H318 H400 |
|
M = 10 |
|
|
603-086-00-3 |
ethirimol (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
245-949-3 |
23947-60-6 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
603-087-00-9 |
2-ethylhexan-1,3-diol; octylenglycol; ethoexadiol |
202-377-9 |
94-96-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-088-00-4 |
2-(octylthio)ethanol; 2-hydroxyethyloctylsulfid |
222-598-4 |
3547-33-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-089-00-X |
7,7-dimethyl-3-oxa-6-azaoctan-1-ol |
400-390-6 |
— |
Skin Corr. 1A Acute Tox. 4 * |
H314 H302 |
GHS05 GHS07 Dgr |
H314 H302 |
|
|
|
|
603-090-00-5 |
2-(2-bromethoxy)anisol |
402-010-4 |
4463-59-6 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-091-00-0 |
exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol |
402-470-6 |
87172-89-2 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
603-092-00-6 |
2-methyl-4-phenylpentanol |
402-770-7 |
92585-24-5 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
603-093-00-1 |
cinmethylin (ISO); exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptan |
402-410-9 |
87818-31-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Dgr |
H332 H411 |
|
|
|
|
603-094-00-7 |
1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropan |
241-536-7 |
17557-23-2 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
603-095-00-2 |
2-(propyloxy)ethanol; EGPE |
220-548-6 |
2807-30-9 |
Acute Tox. 4 * Eye Irrit. 2 |
H312 H319 |
GHS07 Wng |
H312 H319 |
|
|
|
|
603-096-00-8 |
2-(2-butoxyethoxy)ethanol; diethylenglycolmonobutylether |
203-961-6 |
112-34-5 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-097-00-3 |
1,1',1''-nitrilotripropan-2-ol; triisopropanolamin |
204-528-4 |
122-20-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-098-00-9 |
2-phenoxyethanol |
204-589-7 |
122-99-6 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
603-099-00-4 |
3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propan-1,2-diolhydrochlorid |
403-440-5 |
93633-79-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-100-00-8 |
1,2-dimethoxypropan |
404-630-0 |
7778-85-0 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
603-101-00-3 |
tetrahydro-2-isobutyl-4-methylpyran-4-ol, blanding af isomerer (cis og trans) |
405-040-6 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-103-00-4 |
oxiran, mono[(C12-14-alkyloxy)methyl]derivater |
271-846-8 |
68609-97-2 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
603-104-00-X |
fenarimol (ISO); 2,4'-dichlor-α-(pyrimidin-5-yl)benzhydrylalkohol |
262-095-7 |
60168-88-9 |
Repr. 2 Lact. Aquatic Chronic 2 |
H361fd H362 H411 |
GHS08 GHS09 Wng |
H361fd H362 H411 |
|
|
|
|
603-105-00-5 |
furan |
203-727-3 |
110-00-9 |
Flam. Liq. 1 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 3 |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
EUH019 |
|
|
|
603-106-00-0 |
2-methoxypropanol |
216-455-5 |
1589-47-5 |
Flam. Liq. 3 Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H360D *** H335 H315 H318 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H360D *** H335 H315 H318 |
|
|
|
|
603-107-00-6 |
2-(2-methoxyethoxy)ethanol; diethylenglycolmonomethylether |
203-906-6 |
111-77-3 |
Repr. 2 |
H361d *** |
GHS08 Wng |
H361d *** |
|
|
|
|
603-108-00-1 |
2-methylpropan-1-ol; isobutanol |
201-148-0 |
78-83-1 |
Flam. Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H315 H318 H336 |
|
|
|
|
603-109-00-7 |
en blanding af 1-ethoxy-1,1,2,3,3,3-hexafluor-2-(trifluormethyl)propan og 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorbutan |
425-340-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-110-00-2 |
en blanding af cis-2-isobutyl-5-methyl-1,3-dioxan og trans-2-isobutyl-5-methyl-1,3-dioxan |
426-130-1 |
166301-21-9 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
603-111-00-8 |
en blanding af 1-(1,1-dimethylpropyl)-4-ethoxy-cis-cyclohexan og 1-(1,1-dimethylpropyl)-4-ethoxy-trans-cyclohexan |
426-530-6 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-112-00-3 |
cyclopentyl-2-phenylethyl-ether |
428-340-9 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-113-00-9 |
6-glycidyloxynapht-1-yloxymethyloxiran |
429-960-2 |
27610-48-6 |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H341 H312 H315 H317 H412 |
GHS08 GHS07 Wng |
H341 H312 H315 H317 H412 |
|
|
|
|
603-114-00-4 |
9-(2-propenyloxy)tricyclo[5.2.1.02,6]dec-3(eller-4-)-en |
430-830-2 |
26912-64-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-115-00-X |
en blanding af O, O',O''-(methylsilantriyl)tris(4-methyl-2-pentanonoxim) (3 stereoisomerer) |
423-580-0 |
— |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
603-116-00-5 |
(Z)-(2,4-difluorphenyl)piperidin-4-ylmethanonoxim monohydrochlorid |
424-740-2 |
138271-16-6 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
603-117-00-0 |
propan-2-ol; isopropylalkohol; isopropanol |
200-661-7 |
67-63-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
603-118-00-6 |
6-dimethylaminohexan-1-ol |
404-680-3 |
1862-07-3 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
603-119-00-1 |
1,1'-(1,3-phenylendioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
405-840-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
603-120-00-7 |
2-methyl-5-phenylpentanol |
405-890-8 |
25634-93-9 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
603-121-00-2 |
4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinon |
406-057-1 |
114565-66-1 |
Carc. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
|
|
|
|
603-122-00-8 |
natrium-2-ethylhexanolat |
406-150-7 |
38411-13-1 |
Flam. Sol. 1 Skin Corr. 1B Aquatic Chronic 3 |
H228 H314 H412 |
GHS02 GHS05 Dgr |
H228 H314 H412 |
|
|
T |
|
603-123-00-3 |
4-methyl-8-methylentricyclo[3.3.1.13,7]decan-2-ol |
406-330-5 |
122760-84-3 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
603-124-00-9 |
1,4-bis[2-(vinyloxy)ethoxy]benzen |
406-900-3 |
84563-49-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-125-00-4 |
2-(2,4-dichlorphenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol |
407-850-5 |
89544-40-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
603-126-00-X |
2-((4-methyl-2-nitrophenyl)amino)ethanol |
408-090-7 |
100418-33-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
603-127-00-5 |
butan-2-ol; [1](S)-butan-2-ol; [2] (R)-butan-2-ol; [3] (±)-butan-2-ol [4] |
201-158-5 [1] 224-168-1 [2] 238-967-8 [3] 240-029-8 [4] |
78-92-2 [1] 4221-99-2 [2] 14898-79-4 [3] 15892-23-6 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H226 H319 H335 H336 |
GHS02 GHS07 Wng |
H226 H319 H335 H336 |
|
|
C |
|
603-128-00-0 |
2-(phenylmethoxy)naphthalen |
405-490-3 |
613-62-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-129-00-6 |
1-tert-butoxypropan-2-ol |
406-180-0 |
57018-52-7 |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
603-130-00-1 |
blanding af isomerer af α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylen) |
406-325-8 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-131-00-7 |
en blanding af 1-deoxy-1-[methyl-(1-oxododecyl)amino]-.sc.D.sc.-glucitol og 1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-.sc.D.sc.-glucitol |
407-290-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-132-00-2 |
2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decan |
408-200-3 |
63187-91-7 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
603-133-00-8 |
en blanding af 3-[(4-amino-2-chlor-5-nitrophenyl)amino]propan-1,2-diol og 3,3'-(2-chlor-5-nitro-1,4-phenylendiimino)bis(propan-1,2-diol) |
408-240-1 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-134-00-3 |
blanding af substitueret dodecyl og/eller tetradecyl diphenylethere. Stoffet er fremstillet ved Friedel-Craft-reaktion. Katalysatoren bliver fjernet fra reaktionsprodukter. Diphenylether bliver substitueret med C1-C10 alkylgrupper. Alkylgrupperne bliver bundet tilfældigt til kulstofatomer mellem position 1 og 6. Lineær C12 og C14, 50/50 benyttes. |
410-450-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-135-00-9 |
bis[[2,2',2''-nitrilotris-[ethanolato]]-(1-)N,O]-bis[2-(2-methoxyethoxy)ethoxy]titan |
410-500-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
603-136-00-4 |
3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol |
410-910-3 |
104226-19-9 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
603-137-00-X |
blanding af 1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-.sc.D.sc.-glucitol og 1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-.sc.D.sc.-glucitol |
411-130-6 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-138-00-5 |
3-(2,2-dimethyl-3-hydroxypropyl)toluen; (alt.): 2,2-dimethyl-3-(3-methylphenyl)propan-1-ol |
403-140-4 |
103694-68-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-139-00-0 |
bis(2-methoxyethyl)ether |
203-924-4 |
111-96-6 |
Flam. Liq. 3 Repr. 1B |
H226 H360FD |
GHS02 GHS08 Dgr |
H226 H360FD |
EUH019 |
|
|
|
603-140-00-6 |
2,2'-oxydiethanol; diethylenglycol |
203-872-2 |
111-46-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
603-141-00-1 |
blanding af dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethyl-ethanoxy)]pentadecan og dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethyl-ethanoxy)]heptadecan |
413-780-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-142-00-7 |
2-(2-(2-hydroxyethoxy)-ethyl)-2-aza-bicyclo[2.2.1]heptan |
407-360-1 |
116230-20-7 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H373 ** H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H312 H302 H373 ** H315 H318 |
|
|
|
|
603-143-00-2 |
R-2,3-epoxypropan-1-ol |
404-660-4 |
57044-25-4 |
Self-react. C **** Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H242 H350 H341 H360f *** H331 H312 H302 H314 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H242 H350 H341 H360f *** H331 H312 H302 H314 |
|
|
|
|
603-144-00-8 |
en blanding af 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol og 6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol |
413-530-6 |
111850-00-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-145-00-3 |
2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxy-propan |
406-970-5 |
129228-11-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-146-00-9 |
2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol |
406-080-7 |
83016-70-0 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
603-147-00-4 |
(-)-trans-4-(4'-fluorphenyl)-3-hydroxymethyl-N-methylpiperidin |
406-030-4 |
105812-81-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
603-148-00-X |
1,4-bis[(vinyloxy)methyl]cyclohexan |
413-370-7 |
17351-75-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
603-149-00-5 |
blanding af diastereoisomerer af 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexan |
407-640-3 |
63767-86-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
603-150-00-0 |
(±) trans-3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol |
411-580-3 |
107898-54-4 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-151-00-6 |
(±)-2-(2,4-dichlorphenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol |
413-570-4 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-152-00-1 |
2-(4-tert-butylphenyl)ethanol |
410-020-5 |
5406-86-0 |
Repr. 2 STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H361f *** H373 ** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H361f *** H373 ** H318 H411 |
|
|
|
|
603-153-00-7 |
3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propan-1,2-diol |
410-010-0 |
104333-00-8 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-154-00-2 |
1-[(2-tert-butyl)cyclohexyloxy]-2-butanol |
412-300-2 |
139504-68-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-156-00-3 |
2-(2,4-dichlorphenyl)-2-(2-propenyl)oxiran |
411-210-0 |
89544-48-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
603-157-00-9 |
6,9-bis(hexadecyloxymethyl)-4,7-dioxanonan-1,2,9-triol |
411-450-6 |
143747-72-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-158-00-4 |
blanding af 4 diastereoisomerer af 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-dien |
412-460-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-159-00-X |
2-cyclododecylpropan-1-ol |
411-410-8 |
118562-73-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-160-00-5 |
1,2-diethoxypropan |
412-180-1 |
10221-57-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
603-161-00-0 |
1,3-diethoxypropan |
413-140-6 |
3459-83-4 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
603-162-00-6 |
α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-γ-(nonylphenoxy)poly[oxo(methyl-1,2-ethandiyl)] |
413-420-8 |
144736-29-8 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
603-163-00-1 |
2-phenyl-1,3-propandiol |
411-810-2 |
1570-95-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-164-00-7 |
2-butyl-4-chlor-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazol |
412-420-5 |
133909-99-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-165-00-2 |
en blanding af 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol |
417-470-1 |
— |
Muta. 2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
|
|
|
|
603-166-00-8 |
(R)-1-chlor-2,3-epoxypropan |
424-280-2 |
51594-55-9 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
|
|
|
603-167-00-3 |
3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol |
407-920-5 |
6390-69-8 |
Aquatic Chronic 4 |
H413 |
GHS05 Dgr |
H413 |
|
|
|
|
603-168-00-9 |
3-(2-ethylhexyloxy)propan-1,2-diol |
408-080-2 |
70445-33-9 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
603-169-00-4 |
(±)-trans-4-(4-fluorphenyl)-3-hydroxymethyl-N-methylpiperidin |
415-550-0 |
109887-53-8 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
603-170-00-X |
en blanding af 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol og 2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol og 2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol |
415-990-3 |
67739-11-1 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
603-171-00-5 |
5-tiazolilmetanol |
414-780-9 |
38585-74-9 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
603-172-00-0 |
mono-2-[2-(4-dibenzo[b, f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol-trans-butendioat |
415-180-1 |
773058-82-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
603-173-00-6 |
4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octan |
421-750-9 |
57280-22-5 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
603-174-00-1 |
4-cyclohexyl-2-methyl-2-butanol |
420-630-3 |
83926-73-2 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
603-175-00-7 |
2-(2-hexyloxyethoxy)ethanol; DEGHE; diethylenglycolmonohexylether; 3,6-dioxa-1-dodecanol; hexylcarbitol; 3,6-dioxadodecan-1-ol |
203-988-3 |
112-59-4 |
Acute Tox. 4 * Eye Dam. 1 |
H312 H318 |
GHS05 GHS07 Dgr |
H312 H318 |
|
|
|
|
603-176-00-2 |
1,2-bis(2-methoxyethoxy)ethan; TEGDME; triethylenglycoldimethylether; triglym |
203-977-3 |
112-49-2 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
EUH019 |
|
|
|
603-177-00-8 |
1-ethoxypropan-2-ol; 2PG1EE; 1-ethoxy-2-propanol; propylenglycolmonoethylether; [1] propylenglycolmonoethylether; 2PG1EEA [2] |
216-374-5 [1] 259-370-9 [2] |
1569-02-4 [1] 54839-24-6 [2] |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
603-178-00-3 |
2-hexyloxyethanol; ethylenglycolmonohexylether; n-hexylglycol |
203-951-1 |
112-25-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
603-179-00-9 |
ergocalciferol (ISO); Vitamin D2 |
200-014-9 |
50-14-6 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 |
H330 H311 H301 H372 ** |
GHS06 GHS08 Dgr |
H330 H311 H301 H372 ** |
|
|
|
|
603-180-00-4 |
colecalciferol; Vitamin D3 |
200-673-2 |
67-97-0 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 |
H330 H311 H301 H372 ** |
GHS06 GHS08 Dgr |
H330 H311 H301 H372 ** |
|
|
|
|
603-181-00-X |
(tert-butyl)methylether; MTBE; 2-methoxy-2-methylpropan |
216-653-1 |
04-04-1634 |
Flam. Liq. 2 Skin Irrit. 2 |
H225 H315 |
GHS02 GHS07 Dgr |
H225 H315 |
|
|
|
|
603-182-00-5 |
en blanding af mættede, enkeltumættede og flerumættede langkædede, delvis forestrede alkoholer af vegetabilsk oprindelse (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) med O, O-diisobutyldithiophosphat og 2-ethylhexylamin og hydrogenperoxid |
428-630-5 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-183-00-0 |
2-[2-(2-butoxyethoxy)ethoxy]ethanol; TEGBE; triethylenglycolmonobutylether; butoxytriethylenglycol |
205-592-6 |
143-22-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
Eye Dam.1; H318: C ≥ 30 % Eye Irrit. 2; H319: 20 % ≤ C < 30 % |
|
|
603-184-00-6 |
2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propandiol |
416-380-1 |
146925-83-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-185-00-1 |
2,4-dichlor-3-ethyl-6-nitrophenol |
420-740-1 |
99817-36-4 |
Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
|
|
|
|
603-186-00-7 |
trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol |
419-050-3 |
79944-37-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-187-00-2 |
2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanoldichlorid |
419-360-9 |
163661-77-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-188-00-8 |
en blanding af 6,7-epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalen og 7,8-epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalen |
426-970-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-189-00-3 |
blanding af komplekser af titanium, 2,2'-oxydiethanol, ammoniumlactat, nitrilotris(2-propanol) og ethylenglycol |
405-250-8 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-190-00-9 |
8,8-dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decan |
424-030-2 |
62406-73-9 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
603-191-00-4 |
2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol |
419-740-4 |
137658-79-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-192-00-X |
(E, E)-3,7,11-trimethyldodeca-1,4,6,10-tetraen-3-ol |
423-240-1 |
125474-34-2 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
603-193-00-5 |
dinatrium-9,10-anthracendioxid |
426-030-8 |
46492-07-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
603-194-00-0 |
2-(2-aminoethylamino)ethanol; (AEEA) |
203-867-5 |
111-41-1 |
Repr. 1B Skin Corr. 1B Skin Sens. 1 |
H360Df H314 H317 |
GHS05 GHS08 GHS07 Dgr |
H360Df H314 H317 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
603-195-00-6 |
2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol |
430-810-3 |
154825-62-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-196-00-1 |
2-(7-ethyl-1H-indol-3-yl)ethanol |
431-020-1 |
41340-36-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
603-199-00-8 |
etoxazol (ISO); (RS)-5-tert-butyl-2-[2-(2,6-difluorphenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetol |
— |
153233-91-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 |
|
|
603-200-00-1 |
1-pentanol; [1] 3-pentanol [2] |
200-752-1 [1] 209-526-7 [2] |
71-41-0 [1] 584-02-1 [2] |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H226 H332 H335 H315 |
GHS02 GHS07 Wng |
H226 H332 H335 H315 |
|
|
|
|
603-201-00-7 |
(E)-(7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
416-120-5 |
— |
Skin Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
|
|
|
|
603-202-00-2 |
4,4,5,5,5-pentafluorpentan-1-ol |
421-360-9 |
148043-73-6 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-203-00-8 |
(1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecan |
427-580-1 |
— |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
603-204-00-3 |
en blanding af 2,2'-(heptan-1,7-diyl)bis-1,3-dioxolan og 2,2'-(heptan-1,6-diyl)bis-1,3-dioxolan |
428-110-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-205-00-9 |
(1S-cis)-4-(2-amino-6-chlor-9H-purin-9-yl)-2-cyclopenten-1-methanol hydrochlorid |
426-200-1 |
172015-79-1 |
STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H372 ** H302 H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H372 ** H302 H318 H317 H412 |
|
|
|
|
603-206-00-4 |
2,2-dichlor-1,3-benzodioxol |
426-850-6 |
2032-75-9 |
Flam. Liq. 3 Skin Corr. 1A Acute Tox. 4 * Skin Sens. 1 |
H226 H314 H302 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H314 H302 H317 |
EUH014 |
|
|
|
603-207-00-X |
2-isobutyl-2-isopropyl-1,3-dimethoxypropan |
430-800-9 |
129228-21-3 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-208-00-5 |
1,2-diethoxyethan |
211-076-1 |
629-14-1 |
Flam. Liq. 2 Repr. 1A Eye Irrit. 2 |
H225 H360Df H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H360Df H319 |
EUH019 |
|
|
|
603-209-00-0 |
spinosad (blanding af spinosyn A og spinosyn D i forholdet 95:5 til 50:50); blanding af 50-95 % (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-D-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-14-methyl-1H-8-oxacyclododeca[b]as-indacen-7,15-dion og 50-5 % (2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-D-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-4,14-dimethyl-1H-8-oxacyclododeca[b]as-indacen-7,15-dion; [1]spinosyn A; [2]spinosyn D [3] |
- [1] - [2] - [3] |
- [1] 131929-60-7 [2] 131929-63-0 [3] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
603-210-00-6 |
2,4-diethyl-1,5-pentandiol |
429-310-8 |
57987-55-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-211-00-1 |
2,3-epoxypropyltrimethylammoniumchlorid …%; glycidyltrimethylammoniumchlorid …% |
221-221-0 |
3033-77-0 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H361f *** H312 H302 H373 ** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H350 H341 H361f *** H312 H302 H373 ** H318 H317 H412 |
|
|
B |
|
603-212-00-7 |
1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; galaxolid; (HHCB) |
214-946-9 |
1222-05-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-213-00-2 |
2-methoxy-2-methylbutan; tert-amylmethylether |
213-611-4 |
994-05-8 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 |
H225 H302 H336 |
GHS02 GHS07 Dgr |
H225 H302 H336 |
|
|
|
|
603-214-00-8 |
1,1-diisopropoxycyclohexan |
413-740-8 |
1132-95-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
603-215-00-3 |
1-hydroxy-4-fluor-1,4-diazoniabicyclo[2.2.2]octan-bis(tetrafluorborat) |
418-330-2 |
162241-33-0 |
Expl. 1,1 **** Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H302 H373 ** H318 H317 H400 H410 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H201 H302 H373 ** H318 H317 H410 |
|
|
|
|
603-216-00-9 |
cis-1-amino-2,3-dihydro-1H-inden-2-ol |
422-660-2 |
7480-35-5 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
603-217-00-4 |
2,4,6-tri-tert-butylphenyl-2-butyl-2-ethyl-1,3-propandiolphosphit |
423-560-1 |
161717-32-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
603-220-00-0 |
1-{benzyl[2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol |
432-890-5 |
72955-94-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-221-00-6 |
1-(2-amino-5-chlorphenyl)-2,2,2-trifluor-1,1-ethandiolhydrochlorid; [indeholdende < 0,1 % 4-chloranilin (EF-nr. 203-401-0)] |
433-580-2 |
214353-17-0 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
603-221-01-3 |
1-(2-amino-5-chlorphenyl)-2,2,2-trifluor-1,1-ethandiolhydrochlorid; [indeholdende ≥ 0,1 % 4-chloranilin (EF-nr. 203-401-0)] |
433-580-2 |
214353-17-0 |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H350 H302 H314 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H350 H302 H314 H411 |
|
|
|
|
603-222-00-1 |
(2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)10-[(4-dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-oxo-1-oxacyclotetradecan |
433-820-6 |
118058-74-5 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-223-00-7 |
2-cyclopentylidencyclopentanol; 1,1'-bi(cyclopentyliden)-2-ol |
434-270-1 |
6261-30-9 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
603-224-00-2 |
3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluor-2-(trifluormethyl)-hexan |
435-790-1 |
297730-93-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-225-00-8 |
erythromycin A9-oxim (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6,-dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-trideoxy-3-dimethylamino-β-D-xylohexapyranosyl)oxy)oxacyclotetradecan-2-on-10-oxim (E) |
437-070-0 |
13127-18-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-226-00-3 |
4,4'(4-(4-methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzen-1,3-diol |
444-500-0 |
1440-00-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-227-00-9 |
α-hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethanediyl)]ether med 2,2-bis(hydroxymethyl)-1,3-propandiol (4:1); reaktionsprodukt af α-hydro-ω-((chlorcarbonyl)oxy)-poly(oxy(methyl-1,2-ethandiyl))ether med 2,2-bis(hydroxymethyl)-1,3-propandiol og kalium-1,1-dimethylethylperoxalat |
445-060-2 |
203574-04-3 |
**** Aquatic Acute 1 Aquatic Chronic 1 |
**** H400 H410 |
**** GHS09 Wng |
**** H410 |
|
|
|
|
603-228-00-4 |
(+/-)-(R*,R*)-6-fluor-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-fluor-2-(2-oxiranyl)chroman |
419-620-1 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
603-229-00-X |
nnatrium-(Z)-3-chlor-3-(4-chlorphenyl)-1-hydroxy-2-propen-1-sulfonat |
420-800-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
603-230-00-5 |
2,6,6,7,8,8-hexamethyldecahydro-2H-indeno[4,5-b]furan |
440-030-5 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 4 |
H315 H318 H413 |
GHS05 Dgr |
H315 H318 H413 |
|
|
|
|
603-231-00-0 |
(S)-1,1-diphenyl-1,2-propandiol |
443-220-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-232-00-6 |
3,3,8,8,10,10-hexamethyl-9-[1-(4-oxiranylmethoxy-phenyl)-ethoxy]-1,5-dioxa-9-aza-spiro[5.5]undecan |
444-420-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-233-00-1 |
en blanding af 4-(1,3A,4,6,7,7a-hexahydro-4,7-methanoinden-5-yliden)-3-methylbutan-2-ol og 4-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-yliden)-3-methylbutan-2-ol og 1-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-yliden)pentan-3-ol og 1-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-yliden)pentan-3-ol og (E)-4-(3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol og (E)-4-(3a,4,5,6,7,7a-hexahydro-3H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol |
444-430-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-234-00-7 |
(1R,4R)-4-methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-en |
444-480-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
604-001-00-2 |
phenol; carbolsyre; monohydroxybenzen; phenylalkohol |
203-632-7 |
108-95-2 |
Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B |
H341 H331 H311 H301 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H341 H331 H311 H301 H373 ** H314 |
|
* Skin Corr. 1B; H314: C ≥ 3 % Skin Irrit. 2; H315 1 % ≤ C < 3 % Eye Irrit. 2; H319 1 % ≤ C < 3 % |
|
|
604-002-00-8 |
pentachlorphenol |
201-778-6 |
87-86-5 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
604-003-00-3 |
natriumpentachlorphenolat; [1] kaliumpentachlorphenolat [2] |
205-025-2 [1] 231-911-3 [2] |
131-52-2 [1] 7778-73-6 [2] |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
604-004-00-9 |
m-cresol; [1] o-cresol; [2] p-cresol; [3] mix-cresol [4] |
203-577-9 [1] 202-423-8 [2] 203-398-6 [3] 215-293-2 [4] |
108-39-4 [1] 95-48-7 [2] 106-44-5 [3] 1319-77-3 [4] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
* |
C |
|
604-005-00-4 |
1,4-dihydroxybenzen; hydroquinon; quinol |
204-617-8 |
123-31-9 |
Carc. 2 Muta. 2 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H302 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H341 H302 H318 H317 H400 |
|
M = 10 |
|
|
604-006-00-X |
3,4-xylenol; [1] 2,5-xylenol; [2] 2,4-xylenol; [3] 2,3-xylenol; [4] 2,6-xylenol; [5] xylenol; [6] 2,4(og 2,5)-xylenol [7] |
202-439-5 [1] 202-461-5 [2] 203-321-6 [3] 208-395-3 [4] 209-400-1 [5] 215-089-3 [6] 276-245-4 [7] |
95-65-8 [1] 95-87-4 [2] 105-67-9 [3] 526-75-0 [4] 576-26-1 [5] 1300-71-6 [6] 71975-58-1 [7] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H301 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H301 H314 H411 |
|
|
C |
|
604-007-00-5 |
2-naphthol |
205-182-7 |
135-19-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
|
|
|
|
604-008-00-0 |
2-chlorphenol; [1] 4-chlorphenol; [2] 3-chlorphenol; [3] chlorphenol [4] |
202-433-2 [1] 203-402-6 [2] 203-582-6 [3] 246-691-4 [4] |
95-57-8 [1] 106-48-9 [2] 108-43-0 [3] 25167-80-0 [4] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H312 H302 H411 |
GHS07 GHS09 Wng |
H332 H312 H302 H411 |
|
|
C |
|
604-009-00-6 |
pyrogallol; 1,2,3-trihydroxybenzen |
201-762-9 |
87-66-1 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H341 H332 H312 H302 H412 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H412 |
|
* |
|
|
604-010-00-1 |
resorcinol; 1,3-benzendiol |
203-585-2 |
108-46-3 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H302 H319 H315 H400 |
|
* |
|
|
604-011-00-7 |
2,4-dichlorphenol |
204-429-6 |
120-83-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H411 |
|
|
|
|
604-012-00-2 |
4-chlor-o-cresol; 4-chlor-2-methylphenol |
216-381-3 |
1570-64-5 |
Acute Tox. 3 * Skin Corr. 1A Aquatic Acute 1 |
H331 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H400 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
604-013-00-8 |
2,3,4,6-tetrachlorphenol |
200-402-8 |
58-90-2 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H315 H410 |
|
* Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
|
|
604-014-00-3 |
chlorocresol; 4-chlor-m-cresol; 4-chlor-3-methylphenol |
200-431-6 |
59-50-7 |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H312 H302 H318 H317 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H318 H317 H400 |
|
* |
|
|
604-015-00-9 |
2,2'-methylen-bis-(3,4,6-trichlorphenol); hexachlorophen |
200-733-8 |
70-30-4 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
* |
|
|
604-016-00-4 |
dihydroxybenzen; pyrocatechol |
204-427-5 |
120-80-9 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H312 H302 H319 H315 |
GHS07 Wng |
H312 H302 H319 H315 |
|
|
|
|
604-017-00-X |
2,4,5-trichlorphenol |
202-467-8 |
95-95-4 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
* Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit.2; H315: C ≥ 5 % |
|
|
604-018-00-5 |
2,4,6-trichlorphenol |
201-795-9 |
88-06-2 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H315 H410 |
|
|
|
|
604-019-00-0 |
dichlorophen (ISO) |
202-567-1 |
97-23-4 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
604-020-00-6 |
2-phenylphenol (ISO); biphenyl-2-ol; 2-hydroxybiphenyl |
201-993-5 |
90-43-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
|
|
|
|
604-021-00-1 |
natrium-2-biphenylat; natriumbiphenyl-2-yloxid |
205-055-6 |
132-27-4 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Wng |
H302 H335 H315 H318 H400 |
|
|
|
|
604-022-00-7 |
2,2-dimethyl-1,3-benzodioxol-4-ol |
400-900-7 |
22961-82-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
604-023-00-2 |
2,4-dichlor-3-ethylphenol |
401-060-4 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
604-024-00-8 |
4,4-isobutylethylidendiphenol |
401-720-1 |
6807-17-6 |
Repr. 1B Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360f *** H319 H400 H410 |
GHS08 GHS09 Dgr |
H360f *** H319 H410 |
|
|
|
|
604-025-00-3 |
2,5-bis(1,1-dimethylbutyl)hydroquinon |
400-220-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-026-00-9 |
2,2-spirobi(6-hydroxy-4,4,7-trimethylchroman) |
400-270-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-027-00-4 |
2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinon |
400-530-6 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
604-028-00-X |
4-amino-3-fluorphenol |
402-230-0 |
399-95-1 |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H302 H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H411 |
|
|
|
|
604-029-00-5 |
1-naphtol |
201-969-4 |
90-15-3 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H335 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H335 H315 H318 |
|
|
|
|
604-031-00-6 |
guaiacol |
201-964-7 |
90-05-1 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
604-032-00-1 |
thymol |
201-944-8 |
89-83-8 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
604-033-00-7 |
isobutylbut-3-enoat |
401-170-2 |
24342-03-8 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
604-034-00-2 |
4,4'-thiodi-o-cresol |
403-330-7 |
24197-34-0 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
604-035-00-8 |
4-nonylphenol, reaktionsprodukter med formaldehyd og dodecan-1-thiol |
404-160-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
604-036-00-3 |
4,4'-oxybis(ethylenthio)diphenol |
404-590-4 |
90884-29-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
604-037-00-9 |
3,5-xylenol, 3,5-dimethylphenol |
203-606-5 |
108-68-9 |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
|
|
|
604-038-00-4 |
4-chlor-3,5-dimethylphenol; [1] chlorxylenol [2] |
201-793-8 [1] 215-316-6 [2] |
88-04-0 [1] 1321-23-9 [2] |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H315 H317 |
GHS07 Wng |
H302 H319 H315 H317 |
|
|
|
|
604-039-00-X |
ethyl-2-[4-[(6-chlorbenzoxazol-2-yl)oxy]phenoxy]propionat; fenoxaprop-ethyl |
266-362-9 |
66441-23-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
604-040-00-5 |
fomesafen (ISO); 5-[2-chlor-4-(trifluormethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamid |
276-439-9 |
72178-02-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
604-041-00-0 |
acifluorfen (ISO); 5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrobenzoesyre [1] natrium-5-[2-chlor-4-(trifluormethyl)phenoxy]-2- nitrobenzoat; acifluorfen-natrium [2] |
256-634-5 [1] 263-560-7 [2] |
50594-66-6 [1] 62476-59-9 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
604-042-00-6 |
4-nitrosophenol |
203-251-6 |
104-91-6 |
Muta. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H341 H302 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H302 H318 H411 |
|
|
|
|
604-043-00-1 |
monobenzon; 4-hydroxyphenyl benzylether; hydroquinon monobenzylether |
203-083-3 |
103-16-2 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
604-044-00-7 |
mequinol; 4-methoxyphenol; hydroquinon monomethylether |
205-769-8 |
150-76-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
604-045-00-2 |
2,3,5-trimethylhydroquinon |
211-838-3 |
700-13-0 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H335 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H335 H315 H318 H317 H410 |
|
|
|
|
604-046-00-8 |
4-(4-isopropoxyphenylsulfonyl)phenol |
405-520-5 |
95235-30-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-047-00-3 |
4-(4-tolyloxy)biphenyl |
405-730-7 |
51601-57-1 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
604-048-00-9 |
4,4',4''-(ethan-1,1,1-triyl)triphenol |
405-800-7 |
27955-94-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-049-00-4 |
4-4'-methylenbis(oxyethylenthio)diphenol |
407-480-4 |
93589-69-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-051-00-5 |
3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol |
401-110-5 |
87113-78-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
604-052-00-0 |
2,2'-methylenbis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) |
403-800-1 |
103597-45-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
604-053-00-6 |
2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol |
410-760-9 |
157661-93-3 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
604-054-00-1 |
en blanding af 2-methoxy-4-(tetrahydro-4-methylen-2H-pyran-2-yl)phenol og 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol |
412-020-0 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
604-055-00-7 |
2,2'-((3,3',5,5'-tetramethyl(1,1'-biphenyl)-4,4'-diyl)bis(oxymethylen))bisoxiran |
413-900-7 |
85954-11-6 |
Carc. 2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
|
|
|
|
604-056-00-2 |
2-(2-hydroxy-3,5-dinitroanilin)ethanol |
412-520-9 |
99610-72-7 |
Flam. Sol. 2 Repr. 2 Acute Tox. 4 * |
H228 H361f *** H302 |
GHS02 GHS07 GHS08 Dgr |
H228 H361f *** H302 |
|
|
|
|
604-058-00-3 |
1,2-bis(3-methylphenoxy)ethan |
402-730-9 |
54914-85-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-059-00-9 |
2-n-hexadecylhydroquinon |
406-400-5 |
— |
STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H373 ** H315 H317 H413 |
GHS08 GHS07 Wng |
H373 ** H315 H317 H413 |
|
|
|
|
604-060-00-4 |
9,9-bis(4-hydroxyphenyl)fluoren |
406-950-6 |
3236-71-3 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
604-061-00-X |
en blanding af 2-chlor-5-sec-tetradecylhydroquinoner hvor sec-tetradecyl= 1-methyltridecyl; 1-ethyldodecyl; 1-propylundecyl; 1-butyldecyl; 1-pentylnonyl; 1-hexyloctyl |
407-740-7 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
604-062-00-5 |
2,4-dimethyl-6-(1-methyl-pentadecyl)-phenol |
411-220-5 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
604-063-00-0 |
5,6-dihydroxy-indol |
412-130-9 |
3131-52-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
604-064-00-6 |
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol |
411-380-6 |
147315-50-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
604-065-00-1 |
4,4',4''-(1-methylpropan-1-yl-3-yliden)tris(2-cyclohexyl-5-methylphenol) |
407-460-5 |
111850-25-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-066-00-7 |
blanding af phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-forbindelse) og methan, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]- (C45-forbindelse); 2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol og 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol; 2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol og 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol |
414-550-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-067-00-2 |
en blanding af 2,2'-[[(2-hydroxyethyl)imino]bis(methylen)bis[4-dodecylphenol]; formaldehyd, oligomer med 4-dodecylphenol og 2-aminoethanol(n = 2); formaldehyd, oligomer med 4-dodecylphenol og 2-aminoethanol(n = 3, 4 og derover) |
414-520-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
604-068-00-8 |
(±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenolhydrochlorid |
415-170-5 |
90274-24-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 |
H332 H302 H317 |
GHS07 Wng |
H332 H302 H317 |
|
|
|
|
604-069-00-3 |
2-(1-methylpropyl)-4-tert-butylphenol |
421-740-4 |
51390-14-8 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
604-070-00-9 |
triclosan; 2,4,4'-trichlor-2'-hydroxydiphenylether; 5-chlor-2-(2,4-dichlorphenoxy)phenol |
222-182-2 |
3380-34-5 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
M = 100 |
|
|
604-071-00-4 |
4,4'-(1-{4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl}ethyliden)diphenol |
425-600-3 |
110726-28-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
604-072-00-X |
1,2-bis(phenoxymethyl)benzen |
428-620-0 |
10403-74-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-073-00-5 |
(E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
428-010-4 |
82413-20-5 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360f *** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360f *** H317 H410 |
|
|
|
|
604-074-00-0 |
tetrabrombisphenol-A; 2,2',6,6'-tetrabrom-4,4'-isopropylidendiphenol |
201-236-9 |
79-94-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-075-00-6 |
4-(1,1,3,3-tetramethylbutyl)phenol; 4-tert-octylphenol |
205-426-2 |
140-66-9 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
M = 10 |
|
|
604-076-00-1 |
phenolphthalein |
201-004-7 |
77-09-8 |
Carc. 1B Muta. 2 Repr. 2 |
H350 H341 H361f *** |
GHS08 Dgr |
H350 H341 H361f *** |
|
Carc. 1B; H350: C ≥ 1 % |
|
|
604-077-00-7 |
2-benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
419-750-9 |
98809-58-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
604-079-00-8 |
4,4'-(1,3-phenylen-bis(1-methylethyliden))bis-phenol |
428-970-4 |
13595-25-0 |
Repr. 2 Skin Sens. 1 Aquatic Chronic 2 |
H361f *** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H361f *** H317 H411 |
|
|
|
|
604-080-00-3 |
4-fluor-3-trifluormethylphenol |
432-560-0 |
61721-07-1 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Chronic 2 |
H332 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H314 H317 H411 |
|
|
|
|
604-081-00-9 |
1,1-bis(4-hydroxyphenyl)-1-phenylethan |
433-130-5 |
1571-75-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-082-00-4 |
2-chlor-6-fluorphenol |
433-890-8 |
2040-90-6 |
Muta. 1B Repr. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H340 H361f *** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H340 H361f *** H302 H314 H317 H411 |
|
|
|
|
604-083-00-X |
4,4'-sulfonylbisphenol, polymer med ammoniumchlorid (NH4Cl), pentachlorphosphoran og phenol |
439-270-3 |
260408-02-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
604-084-00-5 |
1-ethoxy-2,3-difluorbenzen |
441-000-4 |
121219-07-6 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
604-087-00-1 |
en blanding af 1,2-naphthoquinondiazid-5-sulfonylchlorid (eller sulfonsyre)monoester og 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol; 1,2-naphthoquinondiazid-5-sulfonylchlorid (eller sulfonsyre)diester og 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol; ,2-naphthoquinondiazid-5-sulfonylchlorid (eller sulfonsyre)triester og 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol |
433-640-8 |
— |
Pyr. Sol. 1 Aquatic Chronic 4 |
H250 H413 |
GHS02 Dgr |
H250 H413 |
EUH044 |
|
|
|
604-089-00-2 |
2-methyl-5-tert-butylthiophenol |
444-970-7 |
— |
Flam. Liq. 3 Repr. 2 STOT RE 2 * Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H361d *** H373 ** H304 H319 H315 H317 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H361d *** H373 ** H304 H319 H315 H317 H336 H410 |
|
|
|
|
604-090-00-8 |
4-tert-butylphenol |
202-679-0 |
98-54-4 |
Repr. 2 Skin Irrit. 2 Eye Dam. 1 |
H361f H315 H318 |
GHS08 GHS05 Dgr |
H361f H315 H318 |
|
|
|
|
604-091-00-3 |
etofenprox (ISO); 2-(4-ethoxyphenyl)-2-methylpropyl 3-phenoxybenzylether |
407-980-2 |
80844-07-1 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
|
M = 100 M = 1 000 |
|
|
605-001-00-5 |
formaldehyd …% |
200-001-8 |
50-00-0 |
Carc. 1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H301 H311 H331 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H350 H341 H301 H311 H331 H314 H317 |
|
* Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 5 % ≤ C < 25 % STOT SE 3; H335: C ≥ 5 % SkinSens.; H317: C ≥ 0,2 % |
B, D |
|
605-002-00-0 |
1,3,5-trioxan; trioxymethylen |
203-812-5 |
110-88-3 |
Flam. Sol. 1 Repr. 2 STOT SE 3 |
H228 H361d *** H335 |
GHS02 GHS08 GHS07 Dgr |
H228 H361d *** H335 |
|
|
T |
|
605-003-00-6 |
acetaldehyd; ethanal |
200-836-8 |
75-07-0 |
Flam. Liq. 1 Carc. 2 Eye Irrit. 2 STOT SE 3 |
H224 H351 H319 H335 |
GHS02 GHS08 GHS07 Dgr |
H224 H351 H319 H335 |
|
|
|
|
605-004-00-1 |
2,4,6-trimethyl-1,3,5-trioxan; paraldehyd |
204-639-8 |
123-63-7 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
605-005-00-7 |
2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctan; metaldehyd |
203-600-2 |
108-62-3 |
Flam. Sol. 2 Acute Tox. 4 * |
H228 H302 |
GHS02 GHS07 Wng |
H228 H302 |
|
|
|
|
605-006-00-2 |
butyraldehyd |
204-646-6 |
123-72-8 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
605-007-00-8 |
1,1-dimethoxyethan; dimethylacetal |
208-589-8 |
534-15-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
605-008-00-3 |
acrolein; prop-2-enal; acrylaldehyd |
203-453-4 |
107-02-8 |
Flam. Liq. 2 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H225 H330 H300 H311 H314 H400 H410 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H225 H330 H300 H311 H314 H410 |
EUH071 |
Skin Corr. 1B; H314:C ≥ 0,1 % M = 100 M = 1 |
D |
|
605-009-00-9 |
crotonaldehyd; 2-butenal; [1] (E)-2-butenal; (E)-crotonaldehyd [2] |
224-030-0 [1] 204-647-1 [2] |
4170-30-3 [1] 123-73-9 [2] |
Flam. Liq. 2 Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
|
|
|
|
605-010-00-4 |
2-furaldehyd |
202-627-7 |
98-01-1 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H331 H301 H312 H319 H335 H315 |
GHS06 GHS08 Dgr |
H351 H331 H301 H312 H319 H335 H315 |
|
|
|
|
605-011-00-X |
2-chlorbenzaldehyd; o-chlorbenzaldehyd |
201-956-3 |
89-98-5 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
605-012-00-5 |
benzaldehyd |
202-860-4 |
100-52-7 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
605-014-00-6 |
chloralhydrat: 2,2,2-trichlorethan-1,1-diol |
206-117-5 |
302-17-0 |
Acute Tox. Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
|
|
|
|
605-015-00-1 |
1,1-diethoxyethan; acetal |
203-310-6 |
105-57-7 |
Flam. Liq. 2 Eye Irrit. 2 Skin Irrit. 2 |
H225 H319 H315 |
GHS02 GHS07 Dgr |
H225 H319 H315 |
|
|
|
|
605-016-00-7 |
glyoxal … %; ethandial … % |
203-474-9 |
107-22-2 |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H341 H332 H319 H315 H317 |
GHS07 GHS08 Wng |
H341 H332 H319 H315 H317 |
|
* |
B |
|
605-017-00-2 |
1,3-dioxolan |
211-463-5 |
646-06-0 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
605-018-00-8 |
propanal; propionaldehyd |
204-623-0 |
123-38-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
605-019-00-3 |
citral |
226-394-6 |
5392-40-5 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
605-020-00-9 |
safrole; 5-allyl-1,3-benzodioxol |
202-345-4 |
94-59-7 |
Carc. 1B Muta. 2 Acute Tox. 4 * |
H350 H341 H302 |
GHS08 GHS07 Dgr |
H350 H341 H302 |
|
|
|
|
605-021-00-4 |
formaldehyd, reaktionsprodukter med butylphenol |
294-145-9 |
91673-30-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-024-00-0 |
2-brom-5-hydroxy-4-methoxybenzaldehyd |
426-540-0 |
2973-59-3 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-025-00-6 |
chloracetaldehyd |
203-472-8 |
107-20-0 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H351 H330 H311 H301 H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H330 H311 H301 H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
605-026-00-1 |
2,5,7,7-tetramethyloctanal |
405-690-0 |
114119-97-0 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
605-027-00-7 |
en blanding af 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-carboxaldehyd; 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-carboxaldehyd |
410-480-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-028-00-2 |
β-methyl-3-(1-methylethyl)-benzenpropanal |
412-050-4 |
125109-85-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
605-029-00-8 |
2-cyclohexyl propanal |
412-270-0 |
2109-22-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-030-00-3 |
1-(p-methoxyphenyl)-acetaldehydoxim |
411-510-1 |
3353-51-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-031-00-9 |
en blanding af 2,2-dimethoxyethanal (denne komponent anses for at være anhydrid, hvad angår identitet, struktur og sammensætning. 2,2-dimethoxyethanal eksisterer dog i hydratform. 60 % anhydrid svarer til 70,4 % hydrat); vand (herunder frit vand og vand i 2,2-dimethoxyethanal-hydrat) |
421-890-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-032-00-4 |
3-[3-(4-fluorphenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal |
425-370-4 |
93957-50-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
605-033-00-X |
en blanding af 3,7,11-trimethyl-cis-6,10-dodecadienal og 3,7,11-trimethyl-trans-6,10-dodecadienal |
425-910-9 |
32480-08-3 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
605-034-00-5 |
en blanding af (1RS,2RS,3SR,6RS,9SR)-9-methoxytricyclo[5.2.1.02,6]decan-3-carbaldehyd; (1RS,2RS,3RS,6RS,8SR)-8-methoxytricyclo[5.2.1.02,6]decan-3-carbaldehyd og (1RS,2RS,4SR,6RS,8SR)-8-methoxytricyclo[5.2.1.02,6]decan-4-carbaldehyd |
429-860-9 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-035-00-0 |
(E)-3-(4-(4-fluorphenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal |
426-330-9 |
177964-68-0 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H319 H317 H413 |
GHS07 Wng |
H319 H317 H413 |
|
|
|
|
605-036-00-6 |
2-brommalonaldehyd |
430-470-6 |
2065-75-0 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
605-037-00-1 |
trans-3-[2-(7-chlor-2-quinolinyl)vinyl]benzaldehyd; 3-[(E)-2-(7-chlor-2-quinolinyl)vinyl]benzaldehyd |
421-800-1 |
120578-03-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
605-038-00-7 |
3-methyl-5-phenylpentan-1-al |
433-900-0 |
55066-49-4 |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H315 H317 H411 |
GHS07 GHS09 Wng |
H302 H315 H317 H411 |
|
|
|
|
605-039-00-2 |
3,4-dihydroxy-5-nitrobenzaldehyd |
441-810-8 |
116313-85-0 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
606-001-00-8 |
acetone; propan-2-on; propanon |
200-662-2 |
67-64-1 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
606-002-00-3 |
butanon; ethylmethylketon |
201-159-0 |
78-93-3 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
606-003-00-9 |
3-heptanon; ethylbutylketon |
203-388-1 |
106-35-4 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 |
H226 H332 H319 |
GHS02 GHS07 Wng |
H226 H332 H319 |
|
|
|
|
606-004-00-4 |
4-methylpentan-2-on; methylisobutylketon |
203-550-1 |
108-10-1 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
EUH066 |
|
|
|
606-005-00-X |
2,6-dimethyl-4-heptanon; diisobutylketon |
203-620-1 |
108-83-8 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
606-006-00-5 |
pentan-3-on; diethylketon |
202-490-3 |
96-22-0 |
Flam. Liq. 2 STOT SE 3 STOT SE 3 |
H225 H335 H336 |
GHS02 GHS07 Dgr |
H225 H335 H336 |
EUH066 |
|
|
|
606-007-00-0 |
3-methyl-2-butanon; ethylisopropylketon |
209-264-3 |
563-80-4 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
606-009-00-1 |
4-methyl-3-penten-2-on; mesityloxid |
205-502-5 |
141-79-7 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
|
* |
|
|
606-010-00-7 |
cyclohexanon |
203-631-1 |
108-94-1 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
606-011-00-2 |
2-methylcyclohexanon |
209-513-6 |
583-60-8 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
606-012-00-8 |
3,5,5-trimethylcyclohex-2-enon; isophoron |
201-126-0 |
78-59-1 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H351 H312 H302 H319 H335 |
GHS08 GHS07 Wng |
H351 H312 H302 H319 H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
606-013-00-3 |
p-benzoquinon; quinon |
203-405-2 |
106-51-4 |
Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H331 H301 H319 H335 H315 H400 |
GHS06 GHS09 Dgr |
H331 H301 H319 H335 H315 H400 |
|
M = 10 |
|
|
606-016-00-X |
pindon (ISO), 2-pivaloylindan-1,3-dion |
201-462-8 |
83-26-1 |
Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H410 |
|
|
|
|
606-017-00-5 |
acetylketen; diketen |
211-617-1 |
674-82-8 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
D |
|
606-018-00-0 |
dichlon (ISO); 2,3-dichlor-1,4-naphthoquinon |
204-210-5 |
117-80-6 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
606-019-00-6 |
chlordecon (ISO); perchloropentacyclo[5,3,0,02,6,03,9,04,8]decan-5-one; decachlorpentacyclo[5,2,1,02,6,03,9,05,8]decan-4-on |
205-601-3 |
143-50-0 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H410 |
|
|
|
|
606-020-00-1 |
5-methyl-3-heptanon |
208-793-7 |
541-85-5 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
606-022-00-2 |
1-phenyl-3-pyrazolidon |
202-155-1 |
92-43-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
606-023-00-8 |
4-methoxy-4-methylpentan-2-on |
203-512-4 |
107-70-0 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
606-024-00-3 |
heptan-2-on; methylpentylketon |
203-767-1 |
110-43-0 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
|
|
|
|
606-025-00-9 |
cyclopentanon |
204-435-9 |
120-92-3 |
Flam. Liq. 3 Eye Irrit. 2 Skin Irrit. 2 |
H226 H319 H315 |
GHS02 GHS07 Wng |
H226 H319 H315 |
|
|
|
|
606-026-00-4 |
5-methylhexan-2-on; isoamylmethylketon |
203-737-8 |
110-12-3 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
606-027-00-X |
heptan-4-on; dipropylketon |
204-608-9 |
123-19-3 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
606-028-00-5 |
2,4-dimethylpentan-3-on; diisopropylketon |
209-294-7 |
565-80-0 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
606-029-00-0 |
2,4-pentandion; acetylacetone |
204-634-0 |
123-54-6 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
|
|
|
|
606-030-00-6 |
hexan-2-on; methylbutylketon; butylmethylketon; methyl-n-butylketon |
209-731-1 |
591-78-6 |
Flam. Liq. 3 Repr. 2 STOT RE 1 STOT SE 3 |
H226 H361f *** H372 ** H336 |
GHS02 GHS08 GHS07 Dgr |
H226 H361f *** H372 ** H336 |
|
|
|
|
606-031-00-1 |
3-propanolid; 1,3-propiolacton |
200-340-1 |
57-57-8 |
Carc. 1B Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 |
H350 H330 H319 H315 |
GHS06 GHS08 Dgr |
H350 H330 H319 H315 |
|
|
|
|
606-032-00-7 |
hexachloracetone |
204-129-5 |
116-16-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
606-033-00-2 |
2-(3,4-dichlorphenyl)-4-methyl-1,2,4-oxadiazolidindion; methazol |
243-761-6 |
20354-26-1 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H312 H302 H319 H315 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
|
|
|
|
606-034-00-8 |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5-(4H)-on; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-on |
244-209-7 |
21087-64-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
606-035-00-3 |
cloridazon (ISO); 5-amino-4-chlor-2-phenylpyridazin-3-on; pyrazon |
216-920-2 |
1698-60-8 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
606-036-00-9 |
quinomethionat; chinomethionat (ISO); 6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-on |
219-455-3 |
2439-01-2 |
Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H332 H312 H302 H373 ** H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H332 H312 H302 H373 ** H319 H317 H410 |
|
|
|
|
606-037-00-4 |
triadimefon (ISO); 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanon |
256-103-8 |
43121-43-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
606-038-00-X |
diphacinon (ISO); 2-diphenylacetylindan-1,3-dion |
201-434-5 |
82-66-6 |
Acute Tox. 2 * STOT RE 1 |
H300 H372 ** |
GHS06 GHS08 Dgr |
H300 H372 ** |
|
|
|
|
606-039-00-5 |
5(eller 6)-tert-butyl-2'-chlor-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
400-680-2 |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H400 H410 |
GHS07 GHS09 Wng |
H332 H410 |
|
|
|
|
606-040-00-0 |
(N-benzyl-N-ethyl)amino-3-hydroxyacetophenonhydrochlorid |
401-840-4 |
55845-90-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
606-042-00-1 |
acetophenon |
202-708-7 |
98-86-2 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
606-043-00-7 |
2,4-di-tert-butylcyclohexanon |
405-340-7 |
13019-04-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
606-044-00-2 |
2,4,6-trimethylbenzophenon |
403-150-9 |
954-16-5 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
606-045-00-8 |
oxadiazon (ISO); 3-[2,4-dichlor-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxdiazol-2(3H)-on |
243-215-7 |
19666-30-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-046-00-3 |
blanding af cis- og trans-cyclohexadec-8-en-1-on |
401-700-2 |
3100-36-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-047-00-9 |
2-benzyl-2-dimethylamino-4-morpholinobutyrophenon |
404-360-3 |
119313-12-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-048-00-4 |
2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
406-480-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-049-00-X |
4-(trans-4-propylcyclohexyl)acetophenon |
406-700-6 |
78531-61-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-050-00-5 |
6-anilin-1-benzoyl-4-(4-tert-pentylphenoxy)naphtho[1,2,3-de]chinolin-2,7-(3H)-dion |
412-480-2 |
72453-58-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-051-00-0 |
4-pentylcyclohexanon |
406-670-4 |
61203-83-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-052-00-6 |
4-(N, N-dibutylamino)-2-hydroxy-2'-carboxy-2-(4-dibutylamino-2-hydroxybenzoyl)benzoesyre |
410-410-5 |
54574-82-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
606-053-00-1 |
flurtamon (ISO); (RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-on |
— |
96525-23-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-055-00-2 |
1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)-ethanon |
411-180-9 |
92836-10-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
606-056-00-8 |
4-chlor-3',4'-dimethoxybenzophenon |
404-610-1 |
116412-83-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-057-00-3 |
4-propylcyclohexanon |
406-810-4 |
40649-36-3 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
606-058-00-9 |
4'-fluor-2,2-dimethoxyacetophenon |
407-500-1 |
21983-80-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
606-059-00-4 |
2,4-difluor-α-(1H-1,2,4-triazol-1-yl)acetophenonhydrochlorid |
412-390-3 |
86386-75-6 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
606-060-00-X |
en blanding af trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalen-2-yl)-1,3-dioxolan; cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalen-2-yl)-1,3-dioxolan |
412-950-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-061-00-5 |
(3-chlorphenyl)-(4-methoxy-3-nitrophenyl)methanon |
423-290-4 |
66938-41-8 |
Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H400 H410 |
GHS08 GHS09 Wng |
H341 H410 |
|
|
|
|
606-062-00-0 |
tetrahydrothiopyran-3-carboxaldehyd |
407-330-8 |
61571-06-0 |
Repr. 1B Eye Dam. 1 Aquatic Chronic 3 |
H360D *** H318 H412 |
GHS08 GHS05 Dgr |
H360D *** H318 H412 |
|
|
|
|
606-063-00-6 |
(E)-3-(2-chlorphenyl)-2-(4-fluorphenyl)propenal |
410-980-5 |
112704-51-5 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
606-064-00-1 |
pregn-5-en-3,20-dionbis(ethylenketal) |
407-450-0 |
7093-55-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-065-00-7 |
1-(4-morpholinphenyl)butan-1-on |
413-790-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-066-00-2 |
(E)-5[(4-chlorphenyl)methylen]-2,2-dimethylcyclopentanon |
410-440-9 |
164058-20-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-067-00-8 |
en blanding af 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanon; 1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanon; 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanon; 1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanon |
414-870-8 |
96792-67-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-068-00-3 |
2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al |
415-770-7 |
07-05-1638 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H317 H412 |
GHS08 GHS07 Wng |
H373 ** H317 H412 |
|
|
|
|
606-069-00-9 |
spiro[1,3-dioxolan-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methannaphthalen)] |
415-460-1 |
154171-76-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-070-00-4 |
butrozydim (ISO);5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-on |
414-790-3 |
138164-12-2 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361fd H302 H315 H410 |
|
|
|
|
606-071-00-X |
17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-dien-3-on |
421-050-3 |
13258-43-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-072-00-5 |
3-acetyl-1-phenyl-pyrrolidin-2,4-dion |
421-600-2 |
719-86-8 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
606-073-00-0 |
4,4'-bis(dimethylamino)benzophenon; Michlers keton |
202-027-5 |
90-94-8 |
Carc. 1B Muta. 2 Eye Dam. 1 |
H350 H341 H318 |
GHS08 GHS05 Dgr |
H350 H341 H318 |
|
|
|
|
606-074-00-6 |
en blanding af (1R*,2S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalen og (2R*,3S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalen |
425-570-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-075-00-1 |
1-benzyl-5-ethoxyimidazolidin-2,4-dion |
417-340-4 |
65855-02-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
606-076-00-7 |
1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidindion |
418-630-3 |
136465-99-1 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
606-077-00-2 |
(3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanon |
418-650-2 |
104872-06-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-078-00-8 |
1-octylazepin-2-on |
420-040-6 |
59227-88-2 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
606-079-00-3 |
2-n-butyl-benzo[d]isothiazol-3-on |
420-590-7 |
4299-07-4 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
606-081-00-4 |
(3β, 5α, 6β)-3-(acetyloxy)-5-brom-6-hydroxy-androstan-17-on |
419-790-7 |
4229-69-0 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
606-082-00-X |
blanding af butan-2-on-oxim; syn-O, O'-di(butan-2-on-oxim)diethoxysilan |
406-930-7 |
|
STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H372 ** H317 H412 |
GHS08 GHS07 Dgr |
H372 ** H317 H412 |
|
|
|
|
606-083-00-5 |
2-chlor-5-sec-hexadexylhydroquinon |
407-750-1 |
137193-60-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H315 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
|
|
|
|
606-084-00-0 |
1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propandion |
414-540-3 |
484-33-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-085-00-6 |
(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-on |
418-530-1 |
79200-56-9 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
606-086-00-1 |
1-(3,3-dimethylcyclohexyl)pent-4-en-1-one |
422-330-8 |
56973-87-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-087-00-7 |
6-ethyl-5-fluor-4(3H)-pyrimidon |
422-460-5 |
137234-87-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
606-088-00-2 |
2,4,4,7-tetramethyl-6-octen-3-on |
422-520-0 |
74338-72-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
606-089-00-8 |
en blanding af 1,4-diamino-2-chlor-3-phenoxyanthraquinon; 1,4-diamino-2,3-bis-phenoxyanthraquinon |
423-220-2 |
12223-77-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-090-00-3 |
1-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]ethanon |
430-920-1 |
73096-98-7 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
606-091-00-9 |
6-chlor-5-(2-chlorethyl)-1,3-dihydroindol-2-on |
421-320-0 |
118289-55-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-092-00-4 |
en blanding af (E)-oxacyclohexadec-12-en-2-on; (E)-oxacyclohexadec-13-en-2-on; a) (Z)-oxacyclohexadec-(12)-en-2-on og b) (Z)-oxacyclohexadec-(13)-en-2-on |
422-320-3 |
|
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-093-00-X |
5-ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-on |
414-470-3 |
95885-13-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
606-094-00-5 |
N-[ethyl(3-methylbutyl)amino]-3-methyl-1-phenyl-spiro[[1]benzo-pyrano[2,3-c]pyrazol-4(1H),1'(3'H)-isobenzofuran]-3'-on |
417-460-7 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-095-00-0 |
(R,S)-2-azabicyclo[2.2.1]hept-5-en-3-on |
421-830-3 |
49805-30-3 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
606-096-00-6 |
3-(6-O-(6-deoxy-α-L-mannopyranosyl-O-(α-D-glucopyranosyl)-(β-D-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-on |
424-170-4 |
130603-71-3 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
606-097-00-1 |
2,2''-dihydroxy-4,4''-(2-hydroxy-propan-1,3-diyldioxy)dibenzophenon |
424-210-0 |
23911-85-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-098-00-7 |
1-benzyl-5-(hexadecyloxy)-2,4-imidazolidindion |
431-220-9 |
158574-65-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-099-00-2 |
5-methoxy-4'-(trifluormethyl)valerophenon |
425-000-1 |
61718-80-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-100-00-6 |
2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-on |
425-150-8 |
94723-86-1 |
Repr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H360f *** H302 H317 H412 |
GHS08 GHS07 Dgr |
H360f *** H302 H317 H412 |
|
|
|
|
606-101-00-1 |
en blanding af 1,5-bis[(2-ethylhexyl)amino]-9,10-anthracendion; 1-[(2-ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracendion; 1,5-bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracendion; 1-[(2-ethylhexyl)amino]-5-[3-methoxypropyl)amino]-9,10-anthracendion: 1-[3-[(2-ethylhexyl)oxy]propyl]amino-5-[(3-methoxypropyl)amino]-9,10-anthracendion og 1,5-bis[(3-methyloxypropyl)amino]-9,10-anthracendion |
426-050-7 |
165038-51-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-102-00-7 |
4-(3-triethoxysilylpropoxy)-2-hydroxybenzophenon |
431-490-8 |
79876-59-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-103-00-2 |
1-(4-(trans-4-ethylcyclohexyl)phenyl)ethanon |
426-460-6 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
606-104-00-8 |
1-(4-(trans-4-pentylcyclohexyl)phenyl)ethanon |
426-830-7 |
78531-59-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-105-00-3 |
3,4,3',4'-tetraphenyl-1,1'-ethandiylbispyrol-2,5-dion |
431-500-0 |
226065-73-2 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-106-00-9 |
1-(4-(trans-4-butylcyclohexyl)phenyl)ethanon |
427-320-7 |
83626-30-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-107-00-4 |
8-azaspiro[4.5]decan-7,9-dion |
427-770-4 |
1075-89-4 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
606-108-00-X |
1,1,1,2,2,4,5,5,5-nonafluor-4-(trifluormethyl)-3-pentanon |
436-710-6 |
756-13-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
606-109-00-5 |
2-(4-methyl-3-pentenyl)anthraquinon |
428-320-1 |
71308-16-2 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 4 |
H302 H317 H413 |
GHS07 Wng |
H302 H317 H413 |
|
|
|
|
606-110-00-0 |
5-ethoxy-5H-furan-2-on |
428-330-4 |
2833-30-9 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H312 H302 H373 ** H317 |
GHS05 GHS08 GHS07 Dgr |
H314 H312 H302 H373 ** H317 |
|
|
|
|
606-111-00-6 |
5-amino-6-methyl-1,3-dihydrobenzoimidazol-2-on |
428-410-9 |
67014-36-2 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
606-112-00-1 |
(4aR*,8aR*)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-e, f][2]benzazepin-6-on |
428-690-2 |
1668-86-6 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
|
|
|
|
606-113-00-7 |
1-[4-(4-benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-on |
429-040-0 |
272460-97-6 |
Eye Dam. 1 Aquatic Chronic 4 |
H318 H413 |
GHS05 Dgr |
H318 H413 |
|
|
|
|
606-114-00-2 |
4,4',5,5',6,6',7,7'-octachlor-(2,2')biisoindolyl-1,1',3,3'-tetraon |
429-150-9 |
67887-47-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-115-00-8 |
profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorphenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-on |
— |
139001-49-3 |
Carc. 2 Repr. 2 Skin Sens. 1 |
H351 H361d H317 |
GHS08 GHS07 Wng |
H351 H361d H317 |
|
|
|
|
606-116-00-3 |
tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chlorallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-on |
— |
149979-41-9 |
Carc. 2 Repr. 2 |
H351 H361fd |
GHS08 Wng |
H351 H361fd |
|
|
|
|
606-117-00-9 |
2,6-bis(1,1-dimethylethyl)-4-(phenylenmethylen)cyclohexa-2,5-dien-1-on |
429-460-4 |
7078-98-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-118-00-4 |
N-(1,3-dimethylbutyl)-N'-(phenyl)-1,4-benzoquinondiimin |
429-640-2 |
52870-46-9 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
606-119-00-X |
(E)-3-methyl-5-cyclopentadecen-1-on |
429-900-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
606-120-00-5 |
2,5-dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-on |
430-170-5 |
114625-74-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
606-121-00-0 |
(+)-(1S,2S,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-spiro-1'-(cyclohex-2'-en-4'-on) |
430-460-1 |
133636-82-5 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
606-122-00-6 |
3-(2-brompropionoyl)-4,4-dimethyl-1,3-oxazolan-2-on |
430-820-8 |
114341-88-7 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H315 H318 H317 H410 |
|
|
|
|
606-123-00-1 |
4-hexadecyl-1-phenylpyrazolidin-3-on |
430-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-124-00-7 |
1-cyclopropyl-3-(2-methylthio-4-trifluormethylphenyl)-1,3-propandion |
421-080-7 |
161462-35-7 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
606-125-00-2 |
1-benzylimidazolidin-2,4-dion |
421-340-1 |
05-05-6777 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
606-126-00-8 |
1,4-bis(2,3-dihydroxypropylamino)anthraquinon |
421-470-7 |
99788-75-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-128-00-9 |
2,2'-(1,3-phenylen)bis[5-chlor-1H-isoindol]-1,3(2H)-dion |
422-650-8 |
148935-94-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-129-00-4 |
5-amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-on; (2S, 4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-on |
423-090-7 |
156732-13-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-130-00-X |
4-(1,4-dioxa-spiro[4.5]dec-8-yl)-cyclohexanon |
423-860-2 |
56309-94-5 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
606-131-00-5 |
cyclisk 3-(1,2-ethandiylacetal)-estra-5(10),9(11)-dien-3,17-dion |
427-230-8 |
5571-36-8 |
Repr. 1B STOT RE 2 * Aquatic Chronic 2 |
H360f *** H373 ** H411 |
GHS08 GHS09 Dgr |
H360f *** H373 ** H411 |
|
|
|
|
606-132-00-0 |
(6β)-6,19-epoxyandrost-4-en-3,17-dion |
433-490-3 |
6563-83-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
606-134-00-1 |
androsta-1,4,9(11)-trien-3,17-dion |
433-560-3 |
15375-21-0 |
Repr. 2 |
H361f *** |
GHS08 Wng |
H361f *** |
|
|
|
|
606-135-00-7 |
cyclohexadecanon |
438-930-8 |
2550-52-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-136-00-2 |
(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclo-tetracosan-2,5,8,11,14,17,20,23-octaon |
444-350-6 |
133413-70-4 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
606-137-00-8 |
trans-7,7'-dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinyliden]-3,3'-dion |
444-750-0 |
211387-26-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-138-00-3 |
(2-butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanon |
444-800-1 |
141645-23-0 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H226 H302 H373 ** H315 H318 H317 H410 |
|
M = 10 |
|
|
606-139-00-9 |
(S)-4-(3,4-dichlorphenyl)-3,4-dihydro-2H-naphthalen-1-on |
444-830-5 |
124379-29-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-140-00-4 |
2-hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-on |
444-860-9 |
474510-57-1 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wn |
H373 ** H410 |
|
|
|
|
606-141-00-X |
natrium-3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolat |
418-410-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
606-142-00-5 |
en blanding af (1RS,2SR,7SR,8SR,E)-9- og 10-ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on; (1RS,2SR,7SR,8SR,Z)-10-ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on; (1RS,2SR,7SR,8SR,Z)-9-ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on |
434-290-9 |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
606-143-00-0 |
abamectin (kombination af avermectin B1a og avermectin B1b) (ISO); [1] avermectin B1a (renhed ≥ 80 %); [2] |
_ [1] 265-610-3 [2] |
71751-41-2 [1] 65195-55-3 [2] |
Repr. 2 Acute Tox. 2 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H300 H330 H372 (nervesystem) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d H300 H330 H372 (nervesystem) H410 |
|
STOT RE 1; H372: C ≥ 5 % STOT RE 2; H373: 0,5 % ≤ C < 5 % M = 10 000 |
|
|
606-144-00-6 |
acequinocyl (ISO); 3-dodecyl-1,4-dioxo-1,4-dihydronaphthalen-2-ylacetat |
— |
57960-19-7 |
Skin Sens. 1 STOT SE 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H370 (lunge) (inhalation) H373 (blodsystem) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H317 H370 (lunge) (inhalation) H373 (blodsystem) H410 |
|
M = 1 000 |
|
|
606-145-00-1 |
sulcotrion (ISO); 2-[2-chlor-4-(methylsulfonyl)benzoyl]cyclohexan-1,3-dion |
|
99105-77-8 |
Repr. 2 STOT RE 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H373 (nyrer) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H373 (nyrer) H317 H410 |
|
M = 1 M = 10 |
|
|
606-146-00-7 |
tralkoxydim (ISO); 2-(N-ethoxypropanimidoyl)-3-hydroxy-5- mesitylcyclohex-2-en-1-on |
— |
87820-88-0 |
Carc. 2 Acute Tox. 4 Aquatic Chronic 2 |
H351 H302 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H411 |
|
|
|
|
606-147-00-2 |
cycloxydim (ISO); 2-(N-ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3- yl)cyclohex-2-en-1-on |
405-230-9 |
101205-02-1 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
607-001-00-0 |
myresyre … % |
200-579-1 |
64-18-6 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 10 % ≤ C < 90 % Skin Irrit. 2; H315: 2 % ≤ C < 10 % Eye Irrit. 2; H319: 2 % ≤ < 10 % |
B |
|
607-002-00-6 |
eddikesyre … % |
200-580-7 |
64-19-7 |
Flam. Liq. 3 Skin Corr. 1A |
H226 H314 |
GHS02 GHS05 Dgr |
H226 H314 |
|
Skin Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 25 % ≤ C < 90 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
607-003-00-1 |
chloreddikesyre |
201-178-4 |
79-11-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H331 H311 H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
607-004-00-7 |
TCA (ISO); trichloreddikesyre |
200-927-2 |
76-03-9 |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
607-005-00-2 |
TCA-Na (ISO); natriumtrichloracetat |
211-479-2 |
650-51-1 |
STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H400 H410 |
GHS07 GHS09 Wng |
H335 H410 |
|
|
|
|
607-006-00-8 |
oxalsyre |
205-634-3 |
144-62-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
|
|
607-007-00-3 |
oxalsyrens salte undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
A |
|
607-008-00-9 |
eddikesyreanhydrid |
203-564-8 |
108-24-7 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H302 H314 |
|
Skin Corr. 1B; H314: C ≥ 2 % Skin Irrit. 2; H315: 5 % ≤ C < 25 % Eye Dam. 1; H318: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 1 % ≤ C < 5 % STOT SE 3; H335: C ≥ 5 % |
|
|
607-009-00-4 |
phthalsyreanhydrid |
201-607-5 |
85-44-9 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H335 H315 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H335 H315 H318 H334 H317 |
|
|
|
|
607-010-00-X |
propionsyreanhydrid |
204-638-2 |
123-62-6 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C <25 % Eye Irrit. 2; H319: 10 % ≤ C <25 % |
|
|
607-011-00-5 |
acetylchlorid |
200-865-6 |
75-36-5 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
|
|
607-012-00-0 |
benzoylchlorid |
202-710-8 |
98-88-4 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H332 H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 H317 |
|
|
|
|
607-013-00-6 |
dimethylcarbonat |
210-478-4 |
616-38-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
607-014-00-1 |
methylformiat |
203-481-7 |
107-31-3 |
Flam. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H224 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H224 H332 H302 H319 H335 |
|
|
|
|
607-015-00-7 |
ethylformiat |
203-721-0 |
109-94-4 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H302 H319 H335 |
|
|
|
|
607-016-00-2 |
propylformiat; [1] isopropylformiat [2] |
203-798-0 [1] 210-901-2 [2] |
110-74-7 [1] 625-55-8 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H225 H319 H335 H336 |
GHS02 GHS07 Dgr |
H225 H319 H335 H336 |
|
|
C |
|
607-017-00-8 |
butylformiat; [1] tert-butylformiat; [2] isobutylformiat [3] |
209-772-5 [1] 212-105-0 [2] 208-818-1 [3] |
592-84-7 [1] 762-75-4 [2] 542-55-2 [3] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-018-00-3 |
isopentylformiat; [1] 2-methylbutylformiat [2] |
203-769-2 [1] 252-343-2 [2] |
110-45-2 [1] 35073-27-9 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-019-00-9 |
methylchlorformiat |
201-187-3 |
79-22-1 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H312 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H312 H302 H314 |
|
|
|
|
607-020-00-4 |
ethylchlorformiat |
208-778-5 |
541-41-3 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H302 H314 |
|
|
|
|
607-021-00-X |
methylacetat |
201-185-2 |
79-20-9 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
607-022-00-5 |
ethylacetat |
205-500-4 |
141-78-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
607-023-00-0 |
vinylacetat |
203-545-4 |
108-05-4 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 |
H225 H351 H332 H335 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H335 |
|
|
D |
|
607-024-00-6 |
propylacetat; [1] isopropylacetat [2] |
203-686-1 [1] 203-561-1 [2] |
109-60-4 [1] 108-21-4 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
C |
|
607-025-00-1 |
n-butylacetat |
204-658-1 |
123-86-4 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
EUH066 |
|
|
|
607-026-00-7 |
sec-butylacetat; [1] isobutylacetat; [2] tert-butylacetat [3] |
203-300-1 [1] 203-745-1 [2] 208-760-7 [3] |
105-46-4 [1] 110-19-0 [2] 540-88-5 [3] |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH066 |
|
C |
|
607-027-00-2 |
methylpropionat |
209-060-4 |
554-12-1 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
607-028-00-8 |
ethylpropionat |
203-291-4 |
105-37-3 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
607-029-00-3 |
n-butylpropionat; [1] sec-butylpropionat; [2] iso-butylpropionat [3] |
209-669-5 [1] - [2] 208-746-0 [3] |
590-01-2 [1] 591-34-4 [2] 540-42-1 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-030-00-9 |
propylpropionat |
203-389-7 |
106-36-5 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
607-031-00-4 |
butylbutyrat |
203-656-8 |
109-21-7 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-032-00-X |
ethylacrylat |
205-438-8 |
140-88-5 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H332 H312 H302 H319 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H335 H315 H317 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % STOT SE 3; H335: C ≥ 5 % |
D |
|
607-033-00-5 |
n-butylmethacrylat |
202-615-1 |
97-88-1 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
607-034-00-0 |
methylacrylat; methylpropenoat |
202-500-6 |
96-33-3 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H332 H312 H302 H319 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H335 H315 H317 |
|
|
D |
|
607-035-00-6 |
methylmethacrylat; methyl 2-methylprop2enoat; methyl 2-methylpropenoat |
201-297-1 |
80-62-6 |
Flam. Liq. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H335 H315 H317 |
|
|
D |
|
607-036-00-1 |
2-methoxyethylacetat; methylglycolacetat |
203-772-9 |
110-49-6 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H360FD H332 H312 H302 |
GHS08 GHS07 Dgr |
H360FD H332 H312 H302 |
|
|
|
|
607-037-00-7 |
2-ethoxyethylacetat; ethylglycolacetat |
203-839-2 |
111-15-9 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
607-038-00-2 |
2-butoxyethylacetat; butylglycolacetat |
203-933-3 |
112-07-2 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 |
GHS07 Wng |
H332 H312 |
|
|
|
|
607-039-00-8 |
2,4-D (ISO); 2,4-dichlorphenoxyeddikesyre |
202-361-1 |
94-75-7 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H335 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H317 H412 |
|
|
|
|
607-040-00-3 |
salte af 2,4-D |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
A |
|
607-041-00-9 |
2,4,5-T; 2,4,5-trichlorphenoxyeddikesyre |
202-273-3 |
93-76-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
607-042-00-4 |
salte og estere af 2,4,5-T; salte og estere af 2,4,5-trichlorphenoxyeddikesyre |
— |
— |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
A |
|
607-043-00-X |
dicamba (ISO); 2,5-dichlor-6-methoxybenzoesyre; 3,6-dichlor-2-methoxybenzoesyre |
217-635-6 |
1918-00-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
607-044-00-5 |
3,6-dichlor-o-anissyre, forbindelse med dimethylamin (1:1); [1] kalium-3,6-dichlor-o-anisat [2] |
218-951-7 [1] 233-002-7 [2] |
2300-66-5 [1] 10007-85-9 [2] |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
607-045-00-0 |
dichlorprop (ISO); 2-(2,4-dichlorphenoxy) propionsyre |
204-390-5 |
120-36-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 |
|
|
|
|
607-046-00-6 |
salte af dichlorprop |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
A |
|
607-047-00-1 |
fenoprop (ISO); 2-(2,4,5-trichlorphenoxy)propionsyre |
202-271-2 |
93-72-1 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
607-048-00-7 |
salte af fenoprop; salte af 2-(2,4,5-trichlorphenoxy)propionsyre |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-049-00-2 |
mecoprop (ISO); 2-(4-chlor-o-tolyloxy) propionsyre; (RS)-2-(4-chlor-o-tolyloxy) propionsyre; [1] 2-2-(4-chlor-2-methylphenoxy)propionsyre [2] |
230-386-8 [1] 202-264-4 [2] |
7085-19-0 [1] 708519-0 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
M = 100 |
|
|
607-050-00-8 |
salte af mechlorprop |
— |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
A |
|
607-051-00-3 |
MCPA (ISO); 4-chlor-o-tolyloxyeddikesyre |
202-360-6 |
94-74-6 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
607-052-00-9 |
salte og estere af MCPA |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-053-00-4 |
MCPB (ISO); 4-(4-chlor-o-tolyloxy) smørsyre |
202-365-3 |
94-81-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-054-00-X |
salte og estere af MCPB |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
A |
|
607-055-00-5 |
endothalnatrium (ISO); dinatrium-7-oxabicyclo(2,2,1)heptan-2,3-dicarboxylat |
204-959-8 |
129-67-9 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
607-057-00-6 |
coumachlor (ISO); 3-(1-(4-chlorphenyl)-3-oxobutyl)-4-hydroxycumarin |
201-378-1 |
81-82-3 |
STOT RE 2 * Aquatic Chronic 3 |
H373 ** H412 |
GHS08 Wng |
H373 ** H412 |
|
|
|
|
607-058-00-1 |
coumafuryl (ISO); fumarin; (RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin; 4-hydroxy-3-[3-oxo-1-(2-furyl)-butyl]-coumarin |
204-195-5 |
117-52-2 |
Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 |
H301 H372 ** H412 |
GHS06 GHS08 Dgr |
H301 H372 ** H412 |
|
|
|
|
607-060-00-2 |
dicumarol; 4,4'-dihydroxy-3,3' methylenbis(2H-chromen-2-on) |
200-632-9 |
66-76-2 |
STOT RE 1 Acute Tox. 4 * Aquatic Chronic 2 |
H372 ** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H411 |
|
|
|
|
607-061-00-8 |
acrylsyre; 2-propensyre |
201-177-9 |
79-10-7 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 H400 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
607-062-00-3 |
butylacrylat |
205-480-7 |
141-32-2 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
607-063-00-9 |
isosmørsyre |
201-195-7 |
79-31-2 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
607-064-00-4 |
benzylchlorformiat |
207-925-0 |
501-53-1 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
607-065-00-X |
bromeddikesyre |
201-175-8 |
79-08-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H331 H311 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H317 H400 |
|
|
|
|
607-066-00-5 |
dichloreddikesyre |
201-207-0 |
79-43-6 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
607-067-00-0 |
dichloracetylchlorid |
201-199-9 |
79-36-7 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
607-068-00-6 |
iodeddikesyre |
200-590-1 |
64-69-7 |
Acute Tox. 3 * Skin Corr. 1A |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
|
|
|
607-069-00-1 |
ethylbromacetat |
203-290-9 |
105-36-2 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
607-070-00-7 |
ethylchloracetat |
203-294-0 |
105-39-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H331 H311 H301 H400 |
GHS06 GHS09 Dgr |
H331 H311 H301 H400 |
|
|
|
|
607-071-00-2 |
ethylmethacrylat |
202-597-5 |
97-63-2 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H319 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 H317 |
|
|
D |
|
607-072-00-8 |
2-hydroxyethylacrylat |
212-454-9 |
818-61-1 |
Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H311 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H317 H400 |
|
* Skin Sens. 1; H317: C ≥ 0,2 % |
D |
|
607-073-00-3 |
4-CPA (ISO); 4-chlorphenoxyeddikesyre |
204-581-3 |
122-88-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-074-00-9 |
chlorfenac; 2,3,6-trichlorphenyleddikesyre |
201-599-3 |
85-34-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-075-00-4 |
chlorfenprop-methyl; methyl-2-chlor-3-(4-chlorphenyl)propionat |
238-413-5 |
14437-17-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
607-076-00-X |
dodin; dodecylguanidinacetat |
219-459-5 |
2439-10-3 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
607-077-00-5 |
erbon; 2-(2,4,5-trichlorphenoxy)ethyl-2,2-dichlorpropionat |
— |
136-25-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-078-00-0 |
fluenetil (ISO); 2-fluorethylbiphenyl-4-ylacetat |
— |
4301-50-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
607-079-00-6 |
kelevan (ISO);ethyl 5-(perchlor-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoat; ethyl 5-(1,2,3,5,6,7,8,9,10,10- decachlor-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4- yl)-4-oxovalerat |
— |
4234-79-1 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H311 H302 H411 |
GHS06 GHS09 Dgr |
H311 H302 H411 |
|
|
|
|
607-080-00-1 |
chloracetylchlorid |
201-171-6 |
79-04-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Aquatic Acute 1 |
H331 H311 H301 H372 ** H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H311 H301 H372 ** H314 H400 |
EUH014 EUH029 |
|
|
|
607-081-00-7 |
fluoreddikesyre |
205-631-7 |
144-49-0 |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
|
|
607-082-00-2 |
monofluoracetater, opløselige |
— |
— |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
A |
|
607-083-00-8 |
2,4-DB (ISO); 4-(2,4-dichlorphenoxy)smørsyre |
202-366-9 |
94-82-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-084-00-3 |
salte af 2,4-DB |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
A |
|
607-085-00-9 |
benzylbenzoat |
204-402-9 |
120-51-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-086-00-4 |
diallylphthalat |
205-016-3 |
131-17-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-088-00-5 |
methacrylsyre; 2-methylpropensyre |
201-204-4 |
79-41-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
607-089-00-0 |
propionsyre … % |
201-176-3 |
79-09-4 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H319 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
607-090-00-6 |
thioglycolsyre |
200-677-4 |
68-11-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H331 H311 H301 H314 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 |
|
* |
|
|
607-091-00-1 |
trifluoreddikesyre . . . % |
200-929-3 |
76-05-1 |
Acute Tox. 4 * Skin Corr. 1A Aquatic Chronic 3 |
H332 H314 H412 |
GHS05 GHS07 Dgr |
H332 H314 H412 |
|
* |
B |
|
607-092-00-7 |
methyllactat; [1] methyl-(±)-lactat; [2] methyl-(R)-lactat; [3] methyl-(S)-(-)-lactat [4] |
208-930-0 [1] 218-449-8 [2] 241-420-6 [3] 248-704-9 [4] |
547-64-8 [1] 2155-30-8 [2] 17392-83-5 [3] 27871-49-4 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
|
C |
|
607-093-00-2 |
propionylchlorid |
201-170-0 |
79-03-8 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
B D |
|
607-094-00-8 |
pereddikesyre . . . % |
201-186-8 |
79-21-0 |
Flam. Liq. 3 Org. Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H242 H332 H312 H302 H314 H400 |
|
* STOT SE 3; H335: C ≥ 1 % |
B D |
|
607-095-00-3 |
maleinsyre |
203-742-5 |
110-16-7 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H335 H315 H317 |
GHS07 Wng |
H302 H319 H335 H315 H317 |
|
Skin Sens. 1; H317: C ≥ 0,1 % |
|
|
607-096-00-9 |
maleinsyreanhydrid |
203-571-6 |
108-31-6 |
Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H302 H314 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H314 H334 H317 |
|
|
|
|
607-097-00-4 |
benzen-1,2,4-tricarboxylsyre-1,2-anhydrid; trimellitsyreanhydrid |
209-008-0 |
552-30-7 |
STOT SE 3 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H335 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H335 H318 H334 H317 |
|
|
|
|
607-098-00-X |
benzen-1,2:4,5-tetracarboxylsyredianhydrid; 1,2,4,5-benzentetracarboxylsyredianhydrid |
201-898-9 |
89-32-7 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
|
|
607-099-00-5 |
1,2,3,6-tetrahydrophtalsyreanhydrid; [1] cis-1,2,3,6-tetrahydrophthalsyreanhydrid; [2] 3,4,5,6-tetrahydrophtalsyreanhydrid; [3] tetrahydrophthalsyreanhydrid [4] |
201-605-4 [1] 213-308-7 [2] 219-374-3 [3] 247-570-9 [4] |
85-43-8 [1] 935-79-5 [2] 2426-02-0 [3] 26266-63-7 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H334 H317 H412 |
GHS08 GHS05 Dgr |
H318 H334 H317 H412 |
|
|
C |
|
607-100-00-9 |
3,3',4,4'-benzophenontetracarboxylsyredianhydrid; 4,4'-carbonyldi(phtalsyreanhydrid) |
219-348-1 |
2421-28-5 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
607-101-00-4 |
1,4,5,6,7,7-hexachlorbicyclo-[2,2,1]-hept-5-en-2,3-dicarboxylsyreanhydrid; chlorendinsyreanhydrid |
204-077-3 |
115-27-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
607-102-00-X |
cyclohexan-1,2-dicarboxylsyreanhydrid; [1] cis-cyclohexan-1,2-dicarboxylsyreanhydrid; [2] trans-cyclohexan-1,2-dicarboxylsyreanhydrid [3] |
201-604-9 [1] 236-086-3 [2] 238-009-9 [3] |
85-42-7 [1] 13149-00-3 [2] 14166-21-3 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-103-00-5 |
ravsyreanhydrid |
203-570-0 |
108-30-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H302 H319 H335 |
GHS07 Wng |
H302 H319 H335 |
|
* Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
607-104-00-0 |
1,2,3,4-cyclopentantetracarboxylsyredianhydrid |
227-964-7 |
6053-68-5 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
607-105-00-6 |
8,9,10-trinorborn-5-en-2,3-dicarboxylsyreanhydrid; [1] 1,2,3,6-tetrahydro-3,6-methanophthalsyreanhydrid; [2](1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalsyreanhydrid [3] |
204-957-7 [1] 212-557-9 [2] 220-384-5 [3] |
129-64-6 [1] 826-62-0 [2] 2746-19-2 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-106-00-1 |
1-methyl-5-norbornen-2,3-dicarboxylsyreanhydrid; 8,9-dinorborn-5-en-2,3-dicarboxylsyreanhydrid |
— |
123748-85-6 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H302 H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H302 H319 H335 H315 H334 |
|
STOT SE 3; H335: C ≥ 10 % |
C |
|
607-107-00-7 |
2-ethylhexylacrylat |
203-080-7 |
103-11-7 |
STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H335 H315 H317 |
GHS07 Wng |
H335 H315 H317 |
|
|
D |
|
607-108-00-2 |
2-hydroxy-1-methylethylacrylat; [1] 2-hydroxypropylacrylat; [2] acrylsyre, monoester med propan-1,2-diol [3] |
220-852-9 [1] 213-663-8 [2] 247-118-0 [3] |
2918-23-2 [1] 999-61-1 [2] 25584-83-2 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥ 0,2 % |
C D |
|
607-109-00-8 |
hexamethylendiacrylat; 1,6-hexandioldiacrylat |
235-921-9 |
13048-33-4 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-110-00-3 |
pentaerythritoltriacrylat |
222-540-8 |
3524-68-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-111-00-9 |
2,2-bis(acryloyloxymethyl)butylacrylat; trimethylolpropantriacrylat |
239-701-3 |
15625-89-5 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-112-00-4 |
2,2-dimethylpropandiol-1,3-diacrylat; neopentylglycoldiacrylat |
218-741-5 |
2223-82-7 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* |
D |
|
607-113-00-X |
isobutylmethacrylat |
202-613-0 |
97-86-9 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H226 H319 H335 H315 H317 H400 |
GHS02 GHS07 GHS09 Wng |
H226 H319 H335 H315 H317 H400 |
|
|
D |
|
607-114-00-5 |
ethylendimethacrylat |
202-617-2 |
97-90-5 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
607-115-00-0 |
isobutylacrylat |
203-417-8 |
106-63-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H226 H332 H312 H315 H317 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 H317 |
|
|
D |
|
607-116-00-6 |
cyclohexylacrylat |
221-319-3 |
3066-71-5 |
STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H335 H315 H411 |
GHS07 GHS09 Wng |
H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
607-117-00-1 |
2,3-epoxypropylacrylat, glycidylacrylat |
203-440-3 |
106-90-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥ 0,2 % |
D |
|
607-118-00-7 |
1-methyltrimethylendiacrylat; 1,3-butylenglycoldiacrylat |
243-105-9 |
19485-03-1 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
607-119-00-2 |
tetramethylendiacrylat; 1,4-butylenglycoldiacrylat |
213-979-6 |
1070-70-8 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
607-120-00-8 |
2,2'-oxydiethyldiacrylat; diethylenglycoldiacrylat |
223-791-6 |
4074-88-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* Skin Sens. 1; H317:C ≥ 0,2 % |
D |
|
607-121-00-3 |
8,9,10-trinorborn-2-ylacrylat |
— |
10027-06-2 |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H312 H315 H317 |
GHS07 Wng |
H312 H315 H317 |
|
|
D |
|
607-122-00-9 |
pentaerythritoltetraacrylat |
225-644-1 |
4986-89-4 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-124-00-X |
2-hydroxyethylmethacrylat |
212-782-2 |
868-77-9 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-125-00-5 |
2-hydroxypropylmethacrylat; [1] 3-hydroxypropylmethacrylat [2] |
213-090-3 [1] 220-426-2 [2] |
923-26-2 [1] 2761-09-3 [2] |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
C D |
|
607-126-00-0 |
2,2'-(ethylendioxy)diethyldiacrylat; triethylenglycoldiacrylat |
216-853-9 |
1680-21-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-127-00-6 |
2-diethylaminoethylmethacrylat |
203-275-7 |
105-16-8 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H319 H315 H317 |
GHS07 Wng |
H332 H319 H315 H317 |
|
|
D |
|
607-128-00-1 |
2-tert-butylaminoethylmethacrylat |
223-228-4 |
3775-90-4 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
607-129-00-7 |
ethyllactat; ethyl DL-lactat; [1] ethyl (S)-2-hydroxypropionat; ethyl L-lactat; ethyl-(S)-lactat [2] |
202-598-0 [1] 211-694-1 [2] |
97-64-3 [1] 687-47-8 [2] |
Flam. Liq. 3 STOT SE 3 Eye Dam. 1 |
H226 H335 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H318 |
|
|
C |
|
607-130-00-2 |
pentylacetat; [1] isopentylacetat; [2] 1-methylbutylacetat; [3] 2-methylbutylacetat; [4] 2(eller 3)-methylbutyl acetat [5] |
211-047-3 [1] 204-662-3 [2] 210-946-8 [3] 210-843-8 [4] 282-263-3 [5] |
628-63-7 [1] 123-92-2 [2] 626-38-0 [3] 624-41-9 [4] 84145-37-9 [5] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
EUH066 |
|
C |
|
607-131-00-8 |
isopentylpropionat; [1] pentylpropionat; [2] 2-methylbutylpropionat [3] |
203-322-1 [1] 210-852-7 [2] 219-449-0 [3] |
105-68-0 [1] 624-54-4 [2] 2438-20-2 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-132-00-3 |
2-dimethylaminoethylmethacrylat |
220-688-8 |
2867-47-2 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H312 H302 H319 H315 H317 |
GHS07 Wng |
H312 H302 H319 H315 H317 |
|
|
D |
|
607-133-00-9 |
monoalkyl eller monoaryl eller monoalkylaryl esters af acrylsyre undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H335 H315 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
A |
|
607-134-00-4 |
monoalkyl eller monoaryl eller monoalkylaryl esters af methacrylater undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
A |
|
607-135-00-X |
smørsyre |
203-532-3 |
107-92-6 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
607-136-00-5 |
butyroylchlorid |
205-498-5 |
141-75-3 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
607-137-00-0 |
methylacetoacetat |
203-299-8 |
105-45-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-138-00-6 |
butylchlorformiat; chlormyresyrebutylester |
209-750-5 |
592-34-7 |
Flam. Liq. 3 Acute Tox. 3 * Skin Corr. 1B |
H226 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H314 |
|
|
|
|
607-139-00-1 |
2-chlorpropionsyre |
209-952-3 |
598-78-7 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
607-140-00-7 |
isobutyroylchlorid |
201-194-1 |
79-30-1 |
Flam. Liq. 2 Skin Corr. 1A |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
607-141-00-2 |
oxydiethylenbis(chloroformiat) |
203-430-9 |
106-75-2 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H411 |
|
|
|
|
607-142-00-8 |
propylchlorformiat; chlormyresyrepropylester; n-propylchlorformiat |
203-687-7 |
109-61-5 |
Flam. Liq. 2 Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H314 |
|
|
|
|
607-143-00-3 |
valerianesyre |
203-677-2 |
109-52-4 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
607-144-00-9 |
adipinsyre |
204-673-3 |
124-04-9 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-145-00-4 |
methansulfonsyre |
200-898-6 |
75-75-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
607-146-00-X |
fumarsyre |
203-743-0 |
110-17-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-147-00-5 |
diethyloxalat; ethyloxalat |
202-464-1 |
95-92-1 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
607-148-00-0 |
guanidinhydrochlorid; guanidiniumchlorid |
200-002-3 |
50-01-1 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
607-149-00-6 |
urethan (INN); ethylcarbamat |
200-123-1 |
51-79-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
607-150-00-1 |
endothal; 7-oxabicyclo(2,2,1)heptan-2,3-dicarboxylsyre |
205-660-5 |
145-73-3 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
607-151-00-7 |
propargit (ISO); 2-(4-tert-butylphenoxy) cyclohexylprop-2-ynylsulfit |
219-006-1 |
2312-35-8 |
Carc. 2 Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H315 H318 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H331 H315 H318 H410 |
|
M = 10 |
|
|
607-152-00-2 |
2,3,6-TBA (ISO), 2,3,6-trichlorbenzoesyre |
200-026-4 |
50-31-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-153-00-8 |
benazolin (ISO), 4-chlor-2-oxobenzothiazolin-3-yleddikesyre |
223-297-0 |
3813-05-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
607-154-00-3 |
ethyl-N-benzoyl-N-(3,4-dichlorphenyl)-.sc.DL.sc.-alaninat; benzoylprop-ethyl (ISO) |
244-845-5 |
22212-55-1 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-155-00-9 |
3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylsyre; blasticidin-s |
— |
2079-00-7 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
607-156-00-4 |
chlorfenson (ISO); 4-chlorphenyl-4-chlorbenzensulfonat |
201-270-4 |
80-33-1 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
607-158-00-5 |
natrium-salt af chloreddikesyre; natriumchloracetat |
223-498-3 |
3926-62-3 |
Acute Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 |
H301 H315 H400 |
GHS06 GHS09 Dgr |
H301 H315 H400 |
|
|
|
|
607-159-00-0 |
chlorobenzilat (ISO); ethyl 2,2-di(4-chlorphenyl)-2-hydroxyacetat; ethyl-4,4'-dichlorbenzilat |
208-110-2 |
510-15-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-160-00-6 |
isobutyl-2-(4-(4-chlorphenoxy)phenoxy)propionat; clofop-isobutyl (ISO) |
— |
51337-71-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-161-00-1 |
salt af diethanolamin af 4-CPA |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-162-00-7 |
dalapon; 2,2-dichlorpropionsyre; [1] dalapon-natrium; natrium-2,2-dichlorpropionat [2] |
200-923-0 [1] 204-828-5 [2] |
75-99-0 [1] 127-20-8 [2] |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-163-00-2 |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dion; dehydracetsyre |
208-293-9 |
520-45-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-164-00-8 |
natrium-1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-yliden)ethanolat; natrium dehydracetat |
224-580-1 |
4418-26-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-165-00-3 |
diclofop-methyl (ISO); methyl-2-(4-(2,4-dichlorphenoxy)phenoxy)propionat; methyl (RS)-2-[4-(2,4-dichlorphenoxy)phenoxy]propionat |
257-141-8 |
51338-27-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-166-00-9 |
medinoterbacetat (ISO); 6-tert-butyl-3-methyl-2,4-dinitrophenylacetat |
219-634-6 |
06-01-2487 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
607-167-00-4 |
natrium-3-chloracrylat |
— |
4312-97-4 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
607-168-00-X |
dipropyl-6,7-methylendioxy-1,2,3,4-tetrahydro-3-methylnaphthalen-1,2-dicarboxylat; propylisom |
— |
83-59-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H400 H410 |
GHS06 GHS09 Dgr |
H311 H302 H410 |
|
|
|
|
607-169-00-5 |
natriumfluoracetat |
200-548-2 |
62-74-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H330 H310 H300 H400 |
GHS06 GHS09 Dgr |
H330 H310 H300 H400 |
|
|
|
|
607-170-00-0 |
bis(1,2,3-trithiacyclohexyldimethylammonium)oxalat; thiocyclamhydrogenoxalat |
250-859-2 |
31895-22-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
607-173-00-7 |
dimethyl-(3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionat |
400-460-6 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-174-00-2 |
blanding af tetradecyl-3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionat og dodecyl-3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionat |
400-580-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-175-00-8 |
methyl-2-(2-nitrobenzyliden)acetoacetat |
400-650-9 |
39562-27-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-176-00-3 |
blanding af α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylen) og α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylen) |
400-830-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-177-00-9 |
tribenuron-methyl (ISO); 2-[4-methoxy-6-methyl-1,3,5-triazin-2-yl(methyl)carbamoylsulfamoyl]benzoesyre-methylester; methyl-2-(3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)3-methylureidosulfonyl)benzoat |
401-190-1 |
101200-48-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 100 |
|
|
607-178-00-4 |
methyl-α-((4,6-dimethoxypyrimidin-2-yl)ureidosulfonyl)-o-toluat |
401-340-6 |
83055-99-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-179-00-X |
(benzothiazol-2-ylthio)ravsyre |
401-450-4 |
95154-01-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-180-00-5 |
kalium-2-hydroxycarbazol-1-carboxylat |
401-630-2 |
96566-70-0 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H302 H319 H335 H412 |
GHS07 Wng |
H302 H319 H335 H412 |
|
|
|
|
607-181-00-0 |
3,5-dichlor-2,4-difluorbenzoylfluorid |
401-800-6 |
101513-70-6 |
Acute Tox. 3 * Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H331 H314 H302 H317 H412 |
GHS06 GHS05 Dgr |
H331 H314 H302 H317 H412 |
EUH029 |
|
|
|
607-182-00-6 |
methyl-3-sulfamoyl-2-thenoat |
402-050-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-183-00-1 |
zink-2-hydroxy-5-C13-18-alkylbenzoat |
402-280-3 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
607-184-00-7 |
S-(3-trimethoxysilyl)propyl-19-isocyanoato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanthioat |
402-290-8 |
85702-90-5 |
Flam. Liq. 3 Resp. Sens. 1 Skin Sens. 1 |
H226 H334 H317 |
GHS02 GHS08 Dgr |
H226 H334 H317 |
|
|
|
|
607-185-00-2 |
ethyl-trans-3-dimethylaminoacrylat |
402-650-4 |
1117-37-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-186-00-8 |
quinclorac (ISO); 3,7-dichlorquinolin-8-carboxylsyre |
402-780-1 |
84087-01-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-187-00-3 |
bis(2,2,6,6-tetramethyl-4-piperidyl)succinat |
402-940-0 |
62782-03-0 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
607-188-00-9 |
hydrogennatrium-N-carboxylatoethyl-N-octadec-9-enylmaleamat |
402-970-4 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-189-00-4 |
trimethylendiamintetraeddikesyre |
400-400-9 |
1939-36-2 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
607-190-00-X |
methylacrylamidomethoxyacetat (der indeholder ≥ 0,1 % acrylamid) |
401-890-7 |
77402-03-0 |
Carc. 1B Muta. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H340 H302 H319 |
GHS08 GHS07 Dgr |
H350 H340 H302 H319 |
|
|
|
|
607-191-00-5 |
isobutyl-3,4-epoxybutyrat |
401-920-9 |
100181-71-3 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
607-192-00-0 |
dinatrium-N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinat |
402-360-8 |
92511-22-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-194-00-1 |
propylencarbonat |
203-572-1 |
108-32-7 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-195-00-7 |
2-methoxy-1-methylethylacetat |
203-603-9 |
108-65-6 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
607-196-00-2 |
heptansyre |
203-838-7 |
111-14-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
607-198-00-3 |
propyl-3,4,5-trihydroxybenzoat |
204-498-2 |
121-79-9 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
607-199-00-9 |
octyl-3,4,5-trihydroxybenzoat |
213-853-0 |
1034-01-1 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
607-200-00-2 |
dodecyl-3,4,5-trihydroxybenzoat |
214-620-6 |
1166-52-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-201-00-8 |
tiocarbonylchlorid |
207-341-6 |
463-71-8 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H331 H302 H319 H335 H315 |
GHS06 Dgr |
H331 H302 H319 H335 H315 |
|
|
|
|
607-203-00-9 |
2-ethylhexyl-[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetat |
279-452-8 |
80387-97-9 |
Repr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H360D *** H317 H412 |
GHS08 GHS07 Dgr |
H360D *** H317 H412 |
|
|
|
|
607-204-00-4 |
(chlorphenyl)(chlortolyl)methan, blanding af isomerer |
400-140-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-205-00-X |
methylchloracetat |
202-501-1 |
96-34-4 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H331 H301 H335 H315 H318 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H301 H335 H315 H318 |
|
|
|
|
607-206-00-5 |
isopropylchloracetat |
203-301-7 |
105-48-6 |
Flam. Liq. 3 Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H226 H301 H319 H335 H315 |
GHS02 GHS06 Dgr |
H226 H301 H319 H335 H315 |
|
|
|
|
607-207-00-0 |
haloxyfop-etotyl (ISO); 2-ethoxyethyl-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat; haloxyfop-(2-etoxyethyl) |
402-560-5 |
87237-48-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-208-00-6 |
4,8,12-trimethyltrideca-3,7,11-triensyre, blanding af isomerer |
403-000-2 |
91853-67-7 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
607-209-00-1 |
blanding af O, O'-diisopropyl-(trithio)dithioformiat og O, O'-diisopropyl-(tetrathio)dithioformiat og O, O'-diisopropyl-(pentathio)dithioformiat |
403-030-6 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-210-00-7 |
methylacrylamidoglycolat (der indeholder ≥ 0,1 % acrylamid) |
403-230-3 |
77402-05-2 |
Carc. 1B Muta. 1B Skin Corr. 1B Skin Sens. 1 |
H350 H340 H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H340 H314 H317 |
|
|
|
|
607-211-00-2 |
methyl-3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionat |
403-270-1 |
6386-39-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-212-00-8 |
poly(oxypropylencarbonyl-co-oxy(ethylethylen)carbonyl), indholdende 27 % hydroxyvalerat |
403-300-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-213-00-3 |
ethyl-3,3-bis(tert-pentylperoxy)butyrat |
403-320-2 |
67567-23-1 |
Org. Perox. D **** Flam. Liq. 3 Aquatic Chronic 2 |
H242 H226 H411 |
GHS02 GHS09 Dgr |
H242 H226 H411 |
|
|
|
|
607-214-00-9 |
N, N-hydrazinodieddikesyre |
403-510-5 |
19247-05-3 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H373 ** H317 H412 |
GHS06 GHS08 Dgr |
H301 H373 ** H317 H412 |
|
|
|
|
607-215-00-4 |
3-(3-tert-butyl-4-hydroxyphenyl)propionsyre |
403-920-4 |
107551-67-7 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
607-216-00-X |
glutaminsyre, reaktionsprodukter med N-(C12-14-alkyl)propylendiamin |
403-950-8 |
— |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H330 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H314 H400 |
|
|
|
|
607-217-00-5 |
2-ethoxyethyl-2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetat |
403-960-2 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-218-00-0 |
dichlorprop-P ISO; (+)-R-2-(2,4-dichlorphenoxy)propionsyre |
403-980-1 |
15165-67-0 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-219-00-6 |
bis(2-ethylhexyl)dithiodiacetat |
404-510-8 |
62268-47-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
607-221-00-7 |
6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalen-2-carboxylsyre |
404-550-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-222-00-2 |
6-(2,3-dimethylmaleimido)hexylmethacrylat |
404-870-6 |
63740-41-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-223-00-8 |
transfluthrin (ISO); 2,3,5,6-tetrafluorbenzyl-trans-2-(2,2-dichlorvinyl)-3,3-dimethylcyclopropancarboxylat |
405-060-5 |
118712-89-3 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
607-224-00-3 |
methyl-2-(3-nitrobenzyliden)acetoacetat |
405-270-7 |
39562-17-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-225-00-9 |
3-azidosulfonylbenzoesyre |
405-310-3 |
15980-11-7 |
Self-React. C **** STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H241 H373 ** H318 H317 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H241 H373 ** H318 H317 |
|
|
|
|
607-226-00-4 |
blanding af 2-methacryloyloxyethylhydrogencyclohexan-1,2-dicarboxylat og 2-acryloyloxyethylhydrogencyclohexan-1,2-dicarboxylat |
405-360-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H315 H318 H317 H412 |
|
|
|
|
607-227-00-X |
kalium-2-amino-2-methylpropionatoctahydrat |
405-560-3 |
120447-91-8 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
607-228-00-5 |
bis(2-methoxyethyl)phthalat |
204-212-6 |
117-82-8 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
607-229-00-0 |
diethylcarbamoylchlorid |
201-798-5 |
88-10-8 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H332 H302 H319 H335 H315 |
GHS08 GHS07 Wng |
H351 H332 H302 H319 H335 H315 |
|
|
|
|
607-230-00-6 |
2-ethylhexansyre |
205-743-6 |
149-57-5 |
Repr. 2 |
H361d *** |
GHS08 Wng |
H361d *** |
|
|
|
|
607-231-00-1 |
clopyralid (ISO); 3,6-dichlorpyridin-2-carboxylsyre |
216-935-4 |
1702-17-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-232-00-7 |
pyridat (ISO); O-(6-chlor-3-phenylpyridazin-4-yl)-S-octylthiocarbonat |
259-686-7 |
55512-33-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
607-233-00-2 |
hexylacrylat |
219-698-5 |
2499-95-8 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
|
|
|
607-234-00-8 |
flurenol (ISO); 9-hydroxy-9H-fluoren-9-carboxylsyre |
207-397-1 |
467-69-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-235-00-3 |
mecrilat; methyl-2-cyanacrylat |
205-275-2 |
137-05-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
607-236-00-9 |
ethyl-2-cyanacrylat |
230-391-5 |
7085-85-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
607-237-00-4 |
benzyl-2-chlor-4-(trifluormethyl)thiazol-5-carboxylat; flurazol |
276-942-3 |
72850-64-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-238-00-X |
tau-fluvalinat; cyan(3-phenoxyphenyl)methyl-N-[2-chlor-4-(trifluoromethyl)phenyl-.sc.D.sc.-valinat |
— |
102851-06-9 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
607-239-00-5 |
fenpropathrin (ISO); α-cyan-3-phenoxybenzyl-2,2,3,3-tetramethylcyclopropancarboxylat |
254-485-0 |
39515-41-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
|
|
|
607-240-00-0 |
cis-1,2,3,6-tetrahydro-4-methylphthalsyreanhydrid; [1]1,2,3,6-tetrahydro-4-methylphthalsyreanhydrid; [2]1,2,3,6-tetrahydro-3-methylphthalsyreanhydrid; [3] tetrahydromethylphthalsyreanhydrid; [4] 1,2,3,6-tetrahydromethylphthalsyreanhydrid; [5] tetrahydro-4-methylphthalsyreanhydrid; [6]2,3,5,6-tetrahydro-2-methylphthalsyreanhydrid [7] |
216-906-6 [1] 222-323-8 [2] 226-247-6 [3] 234-290-7 [4] 247-830-1 [5] 251-823-9 [6] 255-853-3 [7] |
1694-82-2 [1] 3425-89-6 [2] 5333-84-6 [3] 11070-44-3 [4] 26590-20-5 [5] 34090-76-1 [6] 42498-58-8 [7] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-241-00-6 |
hexahydro-4-methylphthalsyreanhydrid; [1] hexahydromethylphthalsyreanhydrid; [2] hexahydro-1-methylphthalsyreanhydrid; [3] hexahydro-3-methylphthalsyreanhydrid [4] |
243-072-0 [1] 247-094-1 [2] 256-356-4 [3] 260-566-1 [4] |
19438-60-9 [1] 25550-51-0 [2] 48122-14-1 [3] 57110-29-9 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-242-00-1 |
tetrachlorphthalsyreanhydrid |
204-171-4 |
117-08-8 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H317 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H318 H334 H317 H410 |
|
|
|
|
607-243-00-7 |
natrium-3,6-dichlor-o-anisat; [1] 3,6-dichlor-o-anissyre, forbindelse med 2,2'-iminodiethanol (1:1); [2] 3,6-dichlor-o-anissyre, forbindelse med 2-aminoethanol (1:1) [3] |
217-846-3 [1] 246-590-5 [2] 258-527-9 [3] |
1982-69-0 [1] 25059-78-3 [2] 53404-28-7 [3] |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-244-00-2 |
isooctylacrylat |
249-707-8 |
29590-42-9 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
607-245-00-8 |
tert-butylacrylat |
216-768-7 |
1663-39-4 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H312 H302 H335 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H312 H302 H335 H315 H317 H411 |
|
|
D |
|
607-246-00-3 |
allylmethacrylat; 2-methylpropensyreprop-2-en-1-ylester |
202-473-0 |
96-05-9 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H331 H312 H302 H400 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H312 H302 H400 |
|
|
|
|
607-247-00-9 |
dodecylmethacrylat |
205-570-6 |
142-90-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
607-248-00-4 |
naptalam-natrium (ISO); natrium N-naphth-1-ylphthalamat |
205-073-4 |
132-67-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-249-00-X |
(1-methyl-1,2-ethandiyl)bis[oxy(methyl-2,1-ethandiyl)]diacrylat |
256-032-2 |
42978-66-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
607-250-00-5 |
4H-3,1-benzoxazin-2,4(1H)-dion |
204-255-0 |
118-48-9 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
607-251-00-0 |
2-methoxypropylacetat |
274-724-2 |
70657-70-4 |
Flam. Liq. 3 Repr. 1B STOT SE 3 |
H226 H360D *** H335 |
GHS02 GHS08 GHS07 Dgr |
H226 H360D *** H335 |
|
|
|
|
607-252-00-6 |
lambda-cyhalothrin (ISO); en 1:1 blanding af (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chlor-3,3,3-trifluorpropenyl)-2,2-dimethylcyclopropancarboxylat og (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chlor-3,3,3-trifluorpropenyl)-2,2-dimethylcyclopropancarboxylat |
415-130-7 |
91465-08-6 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
M = 10 000 |
|
|
607-253-00-1 |
cyfluthrin (ISO); α-cyan-4-fluor-3-phenoxybenzyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
269-855-7 |
68359-37-5 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H331 H400 H410 |
GHS06 GHS09 Dgr |
H300 H331 H410 |
|
M = 1 000 |
|
|
607-254-00-7 |
a-cyan-4-fluor-3-phenoxybenzyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat; beta-cyfluthrin |
269-855-7 |
68359-37-5 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
|
607-255-00-2 |
fluroxypyr (ISO); 4-amino-3,5-dichlor-6-fluor-2-pyridyloxyeddikesyre |
— |
69377-81-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-256-00-8 |
azoxystrobin (ISO); methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4- yloxy]phenyl}-3-methoxyacrylat |
— |
131860-33-8 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H400 H410 |
GHS06 GHS09 Dgr |
H331 H410 |
|
|
|
|
607-257-00-3 |
isopropylpropionat |
211-300-8 |
637-78-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
607-258-00-9 |
dodecyl-3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorbenzoat |
403-990-6 |
70950-45-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-259-00-4 |
methyl-2R,3S-(-)-3-(4-methoxyphenyl)oxirancarboxylat |
404-130-2 |
105560-93-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-260-00-X |
ethyl-2-(3-nitrobenzyliden)acetoacetat |
404-490-0 |
39562-16-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-261-00-5 |
iso(C10-C14)alkyl-(3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetat |
404-800-4 |
118832-72-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-262-00-0 |
7-chlor-1-cyclopropyl-6-fluor-1,4-dihydro-4-oxochinolin-3-carboxylsyre |
405-050-0 |
86393-33-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
607-263-00-6 |
kalium/jern(III)-1,3-propandiamin-N, N,N',N'-tetraacetathemihydrat |
405-680-6 |
— |
Self-heat. 2 **** Aquatic Chronic 2 |
H252 H411 |
GHS02 GHS09 Wng |
H252 H411 |
|
|
|
|
607-264-00-1 |
2-chlor-4-(methylsulfonyl)benzoesyre |
406-520-8 |
53250-83-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-265-00-7 |
ethyl-2-chlor-2,2-diphenylacetat |
406-580-5 |
52460-86-3 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
607-266-00-2 |
blanding af hydroxyaluminium-bis[2-hydroxy-3,5-di-tert-butylbenzoat]; 3,5-di-tert-butyl-salicylsyre |
406-890-0 |
130296-87-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-267-00-8 |
tert-butyl-(5S,6R,7R)-3-brommethyl-5,8-dioxo-7-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-en-2-carboxylat |
407-620-4 |
33610-13-8 |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
|
|
|
|
607-268-00-3 |
2-methylpropyl-(R)-2-hydroxypropanoat |
407-770-0 |
61597-96-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-269-00-9 |
(R)-2-(4-hydroxyphenoxy)propansyre |
407-960-3 |
94050-90-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-270-00-4 |
3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10- tetraoxaspiro[5.5]undecan |
410-730-5 |
90498-90-1 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
607-271-00-X |
2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropan |
417-420-9 |
156324-82-2 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
607-272-00-5 |
fluroxypyr-meptyl (ISO); methylheptyl, O-(4-amino-3,5-dichlor-6-fluor-2-pyridyloxy) acetat; [1] fluroxypyr-butometyl (ISO); 2-butoxy-1-methylethyl, O-(4-amino-3,5-dichlor-6-fluor-2-pyridyloxy) acetat [2] |
279-752-9 [1] - [2] |
81406-37-3 [1] 154486-27-8 [2] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-273-00-0 |
ammonium-7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoat |
404-520-2 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-274-00-6 |
2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoat |
405-350-1 |
54527-73-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-275-00-1 |
natrium-4-(benzoyloxy)benzensulfonat |
405-450-5 |
66531-87-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-276-00-7 |
bis[(1-methylimidazol)-(2-ethyl-hexanoat)], zinkcomplex |
405-635-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-277-00-2 |
en blanding af 2-(hexylthio)ethylaminhydrochlorid; natriumpropionat |
405-720-2 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
607-278-00-8 |
blanding af isomerer af natriumphenethylnaphthalensulfonat og natrium(2-naphthylethyl)benzensulfonat |
405-760-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-279-00-3 |
blanding af N-octadecylaminodiethylbis(hydrogenmaleat) og N-octadecylaminodiethylhydrogenmaleathydrogenphthalat |
405-960-8 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-280-00-9 |
natrium-4-chlor-1-hydroxybutan-1-sulfonat |
406-190-5 |
54322-20-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
607-281-00-4 |
blanding af forgrenet og lineær C7-C9 alkyl-3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionater |
407-000-3 |
127519-17-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-282-00-X |
2-acetoxymethyl-4-benzyloxybut-1-ylacetat |
407-140-5 |
131266-10-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-283-00-5 |
(E)-ethyl-4-oxo-4-phenylcrotonat |
408-040-4 |
15121-89-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H317 H410 |
|
|
|
|
607-284-00-0 |
en blanding af natrium-3,3’ (1,4-phenylenbis(carbonylimino-3,1-propandiylimino))bis(10-amino-6,13-dichlor)-4,11-triphenodioxazindisulfonat); lithium-3,3'-(1,4-phenylenbis(carbonylimino-3,1-propandiylimino))bis(10-amino-6,13-dichlor)-4,11-triphenodioxazindisulfonat) |
410-040-4 |
136213-76-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-285-00-6 |
en blanding af 7-(((3-aminophenyl)sulfonyl)amino)naphthalen-1,3-disulfonsyre; natrium-7-(((3-aminophenyl)sulfonyl)amino)naphthalen-1,3-disulfonat; kalium-7-(((3-aminophenyl)sulfonyl)amino)naphthalen-1,3-disulfonat |
410-065-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
|
|
|
|
|
607-286-00-1 |
blanding af natrium/kalium-7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]naphthalen-1,3-disulfonat |
410-070-8 |
141880-36-6 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-287-00-7 |
O'-methyl-O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalat |
410-140-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-288-00-2 |
tetranatrium-(c-(3-(1-(3-(e-6-dichlor-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phtalocyanin-a, b,d-trisulfonat(6-))nikkel (II), hvor a er 1 eller 2 eller 3 eller 4, b er 8 eller 9 eller 10 eller 11, c er 15 eller 16 eller 17 eller 18, d er 22 eller 23 eller 24 eller 25, og hvor e og f er enten 2 og 4 eller 4 og 2 |
410-160-7 |
148732-74-5 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
607-289-00-8 |
3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propansyre |
410-370-9 |
105488-33-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-290-00-3 |
blanding (forhold ukendt) af ammonium-1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat og ammonium-2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat |
410-540-2 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
607-291-00-9 |
dodecyl-ω-(C5/C6-cycloalkyl)alkylcarboxylat |
410-630-1 |
104051-92-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-292-00-4 |
en blanding af [1-(methoxymethyl)-2-(C12-alkoxy)ethoxy]eddikesyre og [1-(methoxymethyl)-2-(C14-alkoxy)ethoxy]eddikesyre |
410-640-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-293-00-X |
en blanding af N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenylether di-sulfonat; N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenylether di-sulfonat |
410-650-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
607-294-00-5 |
natrium-2-benzoyloxy-1-hydroxyethan-sulfonat |
410-680-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-295-00-0 |
blanding af tetranatrium-phosphonethan-1,2-dicarboxylat; hexanatrium-phosphonbutan-1,2,3,4-tetracarboxylat |
410-800-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-296-00-6 |
blanding af tetraestere af pentaerythriol med heptansyre og 2-ethylhexansyre |
410-830-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-297-00-1 |
(E,E)-3,3'-(1,4-phenylendimethyliden)bis(2-oxobornan-10-sulfonsyre) |
410-960-6 |
92761-26-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-298-00-7 |
2-(trimethylammonium)-ethoxycarboxybenzen-4-sulfonat |
411-010-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-299-00-2 |
methyl-3-(acetylthio)-2-methylpropanat |
411-040-7 |
97101-46-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-300-00-6 |
trinatrium-[2-(5-chlor-2,6-difluorpyrimidin-4-ylamino)-5-(b-sulfamoyl-c,d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprat(II) hvor a =1,2,3 eller 4, b =8,9,10 eller 11, c=15,16,17 eller 18 og d =22,23,24 eller 25 |
411-430-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-301-00-1 |
blanding af dodecansyre; poly(1-7)lactatestere af dodecansyre |
411-860-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-302-00-7 |
blanding af tetradecansyre og poly(1-7)lactatestere af tetradecansyre |
411-910-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
607-303-00-2 |
1-cyclopropyl-6,7-difluor-1,4-dihydro-4-oxoquinolin-3-carboxylsyre |
413-760-7 |
93107-30-3 |
Repr. 2 Aquatic Chronic 3 |
H361f *** H412 |
GHS08 Wng |
H361f *** H412 |
|
|
|
|
607-304-00-8 |
fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluormethyl-2-pyridyloxy)phenoxy]propianat |
274-125-6 |
69806-50-4 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H400 H410 |
GHS08 GHS09 Dgr |
H360D *** H410 |
|
|
|
|
607-305-00-3 |
fluazifop-butyl (ISO); butyl-2-[4-[[5-(trifluormethyl)-2-pyridyl]oxy]phenoxy]propionat |
— |
79241-46-6 |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H400 H410 |
GHS08 GHS09 Wng |
H361d *** H410 |
|
|
|
|
607-306-00-9 |
chlozolinate (ISO); ethyl-(RS)-3-(3,5-dichlorphenyl)-5-methyl-2,4-dioxo-oxazolidin-5-carboxylat |
282-714-4 |
84332-86-5 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
607-307-00-4 |
vinclozolin (ISO); N-3,5-dichlorphenyl-5-methyl-5-vinyl-1,3-oxazolidin-2,4-dion |
256-599-6 |
50471-44-8 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H360FD H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360FD H317 H411 |
|
|
|
|
607-308-00-X |
estere af 2,4-D |
— |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
A |
|
607-309-00-5 |
carfentrazon-ethyl (ISO); ethyl (RS)-2-chlor-3-[2-chlor-4-fluor-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionat |
— |
128639-02-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-310-00-0 |
kresoxim-methyl (ISO); methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetat |
— |
143390-89-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
607-311-00-6 |
benazolin-ethyl; ethyl-4-chlor-2-oxo-2H-benzothiazol-3-acetat |
246-591-0 |
25059-80-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-312-00-1 |
methoxyeddikesyre |
210-894-6 |
625-45-6 |
Repr. 1B Acute Tox. 4 * Skin Corr. 1B |
H360FD H302 H314 |
GHS08 GHS05 GHS07 Dgr |
H360FD H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
607-313-00-7 |
neodecanoylchlorid |
254-875-0 |
40292-82-8 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS06 Dgr |
H330 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
607-314-00-2 |
ethofumesat (ISO); (±)-(2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl)methansulfonat |
247-525-3 |
26225-79-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-315-00-8 |
glyphosat (ISO); N-(phosphonomethyl)glycin |
213-997-4 |
1071-83-6 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
607-316-00-3 |
gliphosal-trimesium; glyphosat-trimethylsulfonium |
— |
81591-81-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-317-00-9 |
bis(2-ethylhexyl)phthalat; di-(2-ethylhexyl)phthalat; DEHP |
204-211-0 |
117-81-7 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
607-318-00-4 |
dibutylphthalat; DBP |
201-557-4 |
84-74-2 |
Repr. 1B Aquatic Acute 1 |
H360Df H400 |
GHS08 GHS09 Dgr |
H360Df H400 |
|
|
|
|
607-319-00-X |
deltamethrin (ISO); (S)-α-cyan-3-phenoxybenzyl-(1R, 3R)-3-(2,2-dibromvinyl)-2,2-dimethylcyclopropancarboxylat |
258-256-6 |
52918-63-5 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
M=1 000 000 |
|
|
607-320-00-5 |
bis[4-(ethenyloxy)butyl]-1,3-benzendicarboxylat |
413-930-0 |
130066-57-8 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-321-00-0 |
(S)-methyl-2-chlorpropionat |
412-470-8 |
73246-45-4 |
Flam. Liq. 3 STOT RE 2 * Eye Irrit. 2 |
H226 H373 ** H319 |
GHS02 GHS08 Wng |
H226 H373 ** H319 |
|
|
|
|
607-322-00-6 |
4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoesyre |
413-120-7 |
107144-30-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-323-00-1 |
2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl-acrylat |
413-850-6 |
123968-25-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-324-00-7 |
en blanding af N, N-di(hydrogeneret alkyl C14-C18) phthalamidsyre; dihydrogeneret alkyl (C14-C18)amin |
413-800-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-325-00-2 |
(S)-2-chlorpropionsyre |
411-150-5 |
29617-66-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
607-326-00-8 |
blanding af isobutylhydrogen-2-(α-2,4,6-trimethylnon-2-enyl)succinat og isobutylhydrogen-2-(ß-2,4,6-trimethylnon-2-enyl)succinat |
410-720-0 |
141847-13-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
607-327-00-3 |
2-(2-iodethyl)-1,3-propandioldiacetat |
411-780-0 |
127047-77-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-328-00-9 |
methyl-4-brommethyl-3-methoxybenzoat |
410-310-1 |
70264-94-7 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
607-329-00-4 |
blanding af natrium-2-(C12-18-n-alkyl)amino-1,4-butandioat og natrium-2-octadecenyl-amino-1,4-butandioat |
411-250-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-330-00-X |
(S)-2,3-dihydro-1H-indol-2-carboxylsyre |
410-860-2 |
79815-20-6 |
Repr. 2 STOT RE 2 * Skin Sens. 1 |
H361f *** H373 ** H317 |
GHS08 GHS07 Wng |
H361f *** H373 ** H317 |
|
|
|
|
607-331-00-5 |
blanding af bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decandioat og 1,8-bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]octan |
406-750-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-332-00-0 |
cyclopentylchlorformiat |
411-460-0 |
50715-28-1 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H226 H331 H302 H373 ** H318 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H331 H302 H373 ** H318 H317 |
|
|
|
|
607-333-00-6 |
blanding af dodecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninat og tetradecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninat |
405-670-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H410 |
|
|
|
|
607-334-00-1 |
ethyl-1-ethyl-6,7,8-trifluor-1,4-dihydro-4-oxoquinolin-3-carboxylat |
405-880-3 |
100501-62-0 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-335-00-7 |
methyl-(R)-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat |
406-250-0 |
72619-32-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
607-336-00-2 |
4-methyl-8-methylentricyclo[3.3.1.13,7]dec-2-ylacetat |
406-560-6 |
122760-85-4 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
607-337-00-8 |
di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinat |
406-052-4 |
125078-60-6 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H302 H315 H318 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H302 H315 H318 H411 |
|
|
|
|
607-338-00-3 |
2-methylpropyl-2-hydroxy-2-methylbut-3-enoat |
406-235-9 |
72531-53-4 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
607-339-00-9 |
2,3,4,5-tetrachlorbenzoylchlorid |
406-760-3 |
42221-52-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
607-340-00-4 |
1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-ylacetat |
406-990-4 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-341-00-X |
(9S)-9-amino-9-deoxyerythromycin |
406-790-7 |
26116-56-3 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
607-342-00-5 |
4-chlorbutylveratrat |
410-950-1 |
69788-75-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-343-00-0 |
4,7-methanooctahydro-1H-inden-diyldimethylbis(2-carboxybenzoat) |
407-410-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-344-00-6 |
en blanding af 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoralkylsulfonamido)propionsyre og N-[dimethyl-3-(C4-8-perfluoralkylsulfonamido)propylammonium-propionat og 3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoralkylsulfonamido)propionsyre-propionat |
407-810-7 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
607-345-00-1 |
kalium-2-(2,4-dichlorphenoxy)-(R)-propanat |
413-580-9 |
113963-87-4 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-346-00-7 |
3-icosyl-4-henicosyliden-2-oxetanon |
401-210-9 |
83708-14-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-347-00-2 |
natrium-(R)-2-(2,4-dichlorphenoxy)propionat |
413-340-3 |
119299-10-4 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-348-00-8 |
magnesium-bis((R)-2-(2,4-dichlorphenoxy)propionat) |
413-360-2 |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-349-00-3 |
mono-(tetrapropylammonium)hydrogen-2,2'-dithiobisbenzoat |
411-270-8 |
— |
Aquatic Chronic 3 |
H412 |
|
H412 |
|
|
|
|
607-350-00-9 |
bis(4-(1,2-bis(ethoxycarbonyl)-ethylamino)-3-methyl-cyclohexyl)-methan |
412-060-9 |
136210-32-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-351-00-4 |
methyl-O-(4-amino-3,5-dichlor-6-fluorpyridin-2-yloxy)acetat |
407-550-4 |
69184-17-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-352-00-X |
4,4'-oxydiphtalsyreanhydrid |
412-830-4 |
1823-59-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-353-00-5 |
blanding af ethyl-exo-tricyclo[5.2.1.02,6]decan-endo-2-carboxylat; ethyl-endo-tricyclo[5.2.1.02,6]decan-exo-2-carboxylat |
407-520-0 |
80657-64-3 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-354-00-0 |
ethyl-2-cyclohexylpropionat |
412-280-5 |
2511-00-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-355-00-6 |
p-tolyl-4-chlorbenzoat |
411-530-0 |
15024-10-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-356-00-1 |
ethyl-trans-2,2,6-trimethylcyclohexancarboxylat |
412-540-8 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-357-00-7 |
en blanding af trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran og cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran |
412-450-9 |
131766-73-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-358-00-2 |
(1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylat |
412-670-5 |
54275-93-3 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
607-359-00-8 |
(1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylen-1-oxo-7-phenylacetamido-cepham-4-carboxylat |
412-800-0 |
76109-32-5 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
607-360-00-3 |
natrium-3-acetoacetylamino-4-methoxytolyl-6-sulfonat |
411-680-7 |
133167-77-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-361-00-9 |
methyl-(R)-2-(4-hydroxyphenoxy)-propionat |
411-950-4 |
96562-58-2 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-362-00-4 |
en blanding af (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]-ammonium-2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoat; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]-ammonium-2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoat; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]-ammonium-2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoat; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]-ammonium-2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoat |
413-500-2 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H315 H318 H411 |
GHS05 GHS09 Dgr |
H315 H318 H411 |
|
|
|
|
607-363-00-X |
methyl-3-methoxyacrylat |
412-900-4 |
5788-17-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-364-00-5 |
3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dion |
413-330-9 |
134724-55-3 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
607-365-00-0 |
2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetylchloridhydrochlorid |
410-620-7 |
119154-86-8 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
607-366-00-6 |
3,5-dimethylbenzoylchlorid |
413-010-9 |
6613-44-1 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
607-367-00-1 |
kalium-bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N, O,O, N)-ferrat-(1-) monohydrat |
411-640-9 |
153352-59-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-368-00-7 |
1-(N, N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazol |
411-650-3 |
110895-43-7 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
607-369-00-2 |
en blanding af trans-(2R)-5-acetoxy-1,3-oxathiolan-2-carboxylsyre og cis-(2R)-5-acetoxy-1,3-oxathiolan-2-carboxylsyre |
411-660-8 |
147027-04-1 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-370-00-8 |
2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
412-210-3 |
41620-33-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-371-00-3 |
3-ethyl-5-methyl-4-(2-chlorphenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridindicarboxylat |
413-410-3 |
88150-62-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-372-00-9 |
ethoxyleret-bisphenol A di-(norbornencarboxylat) |
412-410-0 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-373-00-4 |
(±) tetrahydrofurfuryl-(R)-2-[4-(6-chlorchinoxalin-2-yloxy)-phenyloxy]propanoat |
414-200-4 |
119738-06-6 |
Muta. 2 Repr. 1B Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360Df H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H341 H360Df H302 H373 ** H410 |
|
|
|
|
607-374-00-X |
5-amino-2,4,6-triiodo-1,3-benzendicarbonyldichlorid |
417-220-1 |
37441-29-5 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-376-00-0 |
benzyl-2,4-dibrombutanoat |
420-710-8 |
23085-60-1 |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H315 H317 H410 |
|
|
|
|
607-377-00-6 |
trans-4-cyclohexyl-sc.L.sc.-prolinmonohydrochlorid |
419-160-1 |
90657-55-9 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H361f *** H302 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H361f *** H302 H315 H318 H317 |
|
|
|
|
607-378-00-1 |
ammonium-(Z)-α-methoxyimino-2-furylacetat |
405-990-1 |
97148-39-5 |
Flam. Sol. 2 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
607-379-00-7 |
en blanding af 2-[N-(2-hydroxyethyl)stearamido]ethyl-stearat og natrium-[bis[2-(stearoyloxy)ethyl]amino]methylsulfonat og natrium-[bis(2-hydroxyethyl)amino]methylsulfonat og N, N-bis(2-hydroxyethyl)stearamid |
401-230-8 |
|
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-380-00-2 |
blanding af ammonium-1,2-bis(hexyloxycarbonyl)ethansulfonat; ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethansulfonat; ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethansulfonat |
407-320-3 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-381-00-8 |
blanding af triestere af 2,2-bis(hydroxymethyl)butanol med C7-alkansyre og 2-ethylhexansyre |
413-710-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-382-00-3 |
2-((4-amino-2-nitrophenyl)amino)benzoesyre |
411-260-3 |
117907-43-4 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-383-00-9 |
en blanding af 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoat og 2,2,6,6-tetramethylpiperidin-4-yl-octadecanoat |
415-430-8 |
86403-32-9 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
607-384-00-4 |
blanding af estere af C14-C15-forgrenede alkoholer med 3,5-di-t-butyl-4-hydroxyphenyl-propionsyre og C15-forgrenet og ligekædet alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenpropanoat og C13-forgrenet og ligekædet alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenpropanoat |
413-750-2 |
171090-93-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-385-00-X |
copolymer af vinyl-alkohol og vinyl-acetat delvis acetileret med 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium-methylsulfat |
414-590-6 |
125229-74-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-386-00-5 |
blanding af tetradecansyre (42.5-47,5 %) og poly(1-7)lactatestere af tetradecansyre (52,5-57,5 %) |
412-580-6 |
174591-51-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
607-387-00-0 |
blanding af dodecansyre (35-40 %) og poly(1-7)lactatestere af dodecansyre (60-65 %) |
412-590-0 |
58856-63-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
607-388-00-6 |
4-ethylamino-3-nitrobenzoesyre |
412-090-2 |
2788-74-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
607-389-00-1 |
trinatrium N, N-bis(carboxymethyl)-3-amino-2-hydroxypropionat |
414-130-4 |
119710-96-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-390-00-7 |
1,2,3,4-tetrahydro-6-nitro-quinoxalin |
414-270-6 |
41959-35-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-391-00-2 |
dimethylcyclopropan-1,1-dicarboxylat |
414-240-2 |
6914-71-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-392-00-8 |
2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoat |
414-260-1 |
88938-37-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-393-00-3 |
3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-carbonsyre |
415-750-8 |
106447-44-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-394-00-9 |
5-methylpyrazin-2-carboxylsyre |
413-260-9 |
5521-55-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-395-00-4 |
blanding af natrium-1-tridecyl-4-allyl-(2 eller 3)-sulfobutandioat og natrium-1-dodecyl-4allyl-(2 eller 3)-sulfobutandioat |
410-230-7 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
607-396-00-X |
bis(1,2,2,6,6-pentamethyl-4-piperidinyl)-2-(4-methoxybenzyliden)malonat |
414-840-4 |
147783-69-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-397-00-5 |
en blanding af Ca-salicylater (forgrenet C10-14- og C18-30-alkyleret) og Ca-phenater (forgrenet C10-14- og C18-30-alkyleret) og Ca-phenater, svovlbehandlede (forgrenet C10-14- og C18-30-alkyleret) |
415-930-6 |
— |
Repr. 2 Skin Sens. 1 |
H361f *** H317 |
GHS08 GHS07 Wng |
H361f *** H317 |
|
|
|
|
607-398-00-0 |
ethyl-N-(5-chlor-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamat |
414-820-5 |
125630-94-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-399-00-6 |
2,2-dimethyl-3-methyl-3-butenylpropanoat |
415-610-6 |
104468-21-5 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
607-400-00-X |
methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoat |
414-400-1 |
32750-89-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-401-00-5 |
ethyl-3-hydroxy-5-oxo-3-cyclohexen-1-carboxylat |
414-450-4 |
88805-65-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
607-402-00-0 |
methyl N-(phenyloxycarbonyl)-.sc.L.sc.-valinat |
414-500-5 |
153441-77-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-403-00-6 |
blanding af bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammoniumsuccinat og isopropylalkohol |
414-810-0 |
— |
STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H318 H410 |
|
|
|
|
607-404-00-1 |
en blanding af ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropansyre; di-((E)-3,7-dimethyl-2,6-octadienyl)butandioat; di-((Z)-3,7-dimethyl-2,6-octadienyl)butandioat; (Z)-3,7-dimethyl-2,6-octadienylbutandioat; ((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropansyre |
415-190-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-405-00-7 |
2-hexyldecyl-p-hydroxybenzoat |
415-380-7 |
148348-12-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-406-00-2 |
kalium-2,5-dichlorbenzoat |
415-700-5 |
184637-62-5 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
607-407-00-8 |
ethyl-2-carboxy-3-(2-thienyl)propionat |
415-680-8 |
143468-96-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
607-408-00-3 |
kalium-N-(4-fluorophenyl)glycinat |
415-710-1 |
184637-63-6 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H373 ** H318 H317 H412 |
|
|
|
|
607-409-00-9 |
en blanding af (3R)-[1S-(1α, 2α, 6β ((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalen]-3,5-dihydroxyheptansyre og inert biomasse fra Aspergillus terreus |
415-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-410-00-4 |
mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butandioat og/eller mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butandioat |
415-880-5 |
779343-34-9 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
607-411-00-X |
oxiranmethanol, 4-methylbenzen-sulfonat, (S)- |
417-210-7 |
70987-78-9 |
Carc. 1B Muta. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H341 H318 H317 H411 |
|
|
|
|
607-412-00-5 |
ethyl-2-(1-cyanocyclohexyl)acetat |
415-970-4 |
133481-10-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
607-413-00-0 |
trans-4-phenyl-.sc.L.sc.-prolin |
416-020-1 |
96314-26-0 |
Repr. 2 Skin Sens. 1 |
H361f *** H317 |
GHS08 GHS07 Wng |
H361f *** H317 |
|
|
|
|
607-414-00-6 |
tris(2-ethylhexyl)-4,4',4''-(1,3,5-triazin-2,4,6-triyltriimino)tribenzoat |
402-070-1 |
88122-99-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-415-00-1 |
poly-(methylmethacrylat)-co-(butylmethacrylat)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzylcarbamat)-co-(maleinsyreanhydrid) |
419-590-1 |
— |
Flam. Sol. 1 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Dgr |
H228 H317 |
|
|
T |
|
607-416-00-7 |
4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamid |
420-730-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-417-00-2 |
3-chlorpropylchlorformiat |
425-770-9 |
628-11-5 |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H331 H302 H373 ** H315 H318 H317 |
GHS06 GHS05 GHS08 Dgr |
H331 H302 H373 ** H315 H318 H317 |
|
|
|
|
607-418-00-8 |
2-ethylhexyl-4-aminobenzoat |
420-170-3 |
26218-04-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-419-00-3 |
(3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-yliden)-1-methyl-ethyliden)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-eddikesyre |
422-240-9 |
166596-68-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-420-00-9 |
2,2-bis(hydroxymethyl)butansyre |
424-090-1 |
10097-02-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-421-00-4 |
cypermethrin cis/trans +/- 40/60; α-cyan-3-phenoxybenzyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
257-842-9 |
52315-07-8 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H335 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H335 H410 |
|
|
|
|
607-422-00-X |
α-cypermethrin (ISO); racemat bestående af (R)-α-cyan-3-phenoxybenzyl-(1S,3S)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat og (S)-α-cyan-3-phenoxybenzyl-(1R,3R)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
257-842-9 |
67375-30-8 |
Acute Tox. 3 * STOT RE 2 * STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H335 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H335 H410 |
|
M = 1 000 |
|
|
607-423-00-5 |
mechlorprop og mechlorprop-P, estere heraf |
— |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
A |
|
607-424-00-0 |
trifloxystrobin (ISO); (E,E)-α-(methoxyimino)-2-[[[[1-[3-(trifluormethyl)phenyl]ethyliden]amino]oxy]methyl]phenyleddikesyremethylester |
— |
141517-21-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-425-00-6 |
metalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-.sc.DL.sc.-alaninat |
260-979-7 |
57837-19-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
607-426-00-1 |
1,2-benzendicarboxylsyredipentylester, forgrenet og ligekædet; [1] isopentyl-n-pentylphthalat; [2] dipentylphthalat; [3] diisopentylphthalat [4] |
284-032-2 [1] - [2] 205-017-9 [3] 210-088-4 [4] |
84777-06-0 [1] - [2] 131-18-0 [3] 605-50-5 [4] |
Repr. 1B Aquatic Acute 1 |
H360FD H400 |
GHS08 GHS09 Dgr |
H360FD H400 |
|
|
|
|
607-427-00-7 |
bromoxynil-heptanoat (ISO); 2,6-dibrom-4-cyanphenylheptanoat |
260-300-4 |
56634-95-8 |
Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H332 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d *** H332 H302 H317 H410 |
|
|
|
|
607-428-00-2 |
tetranatrium-ethylendiamintetraacetat |
200-573-9 |
64-02-8 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
607-429-00-8 |
edetinsyre; (EDTA) |
200-449-4 |
60-00-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-430-00-3 |
BBP; benzylbutylphthalat |
201-622-7 |
85-68-7 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H400 H410 |
GHS08 GHS09 Dgr |
H360Df H410 |
|
|
|
|
607-431-00-9 |
prallethrin (ISO); ETOC; 2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-yl-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat |
245-387-9 |
23031-36-9 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
|
|
|
|
607-432-00-4 |
S-metolachlor; blanding af (S)-2-chlor-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamid (80-100 %); [1](R)-2-chlor-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamid (0-20 %) [2] |
- [1] - [2] |
87392-12-9 [1] 178961-20-1 [2] |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-433-00-X |
cypermethrin cis/trans +/- 80/20; (RS)-α-cyan-3-phenoxybenzyl(1RS;3RS; 1RS,3SR)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
257-842-9 |
52315-07-8 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H335 H315 H317 H410 |
|
|
|
|
607-434-00-5 |
mecoprop-P [1] og salte heraf; (R)-2-(4-chlor-2-methylphenoxy)propionsyre |
240-539-0 |
16484-77-8 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
607-435-00-0 |
2S-isopropyl-5R-methyl-1R-cyclohexyl-2,2-dihydroxyacetat |
416-810-6 |
111969-64-3 |
STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H373 ** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H318 H411 |
|
|
|
|
607-436-00-6 |
2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoat |
417-350-9 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-437-00-1 |
3-(4-aminophenyl)-2-cyano-2-propensyre |
417-480-6 |
252977-62-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-438-00-7 |
methyl-2-[(aminosulfonyl)methyl]benzoat |
419-010-5 |
112941-26-1 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
607-439-00-2 |
methyl tetrahydro-2-furancarboxylat |
420-670-1 |
37443-42-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-440-00-8 |
methyl 2-aminosulfonyl-6-(trifluormethyl)pyridin-3-carboxylat |
421-220-7 |
144740-59-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-441-00-3 |
3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthio]propionsyre |
421-490-6 |
167684-63-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-442-00-9 |
benzyl-[hydroxy-(4-phenylbutyl)phosphinyl]acetat |
416-050-5 |
87460-09-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-444-00-X |
blanding af cis-1,4-dimethylcyclohexyldibenzoat og trans-1,4-dimethylcyclohexyldibenzoat |
416-230-3 |
35541-81-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-445-00-5 |
jern (III) tris(4-methylbenzensulfonat) |
420-960-8 |
77214-82-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-446-00-0 |
methyl-2-[4-(2-chlor-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionat |
416-240-8 |
155522-12-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-447-00-6 |
natrium-4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzensulfonat |
416-370-5 |
156738-27-1 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-448-00-1 |
2,3,5,6-tetrafluorbenzoesyre |
416-800-1 |
652-18-6 |
Skin Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
|
|
|
|
607-449-00-7 |
en blanding af 4,4',4''-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazin-1,3,5-triyl)tris[methylen(3,5,5-trimethyl-3,1-cyclohexandiyl)iminocarbonyloxy-2,1-ethandiyl(ethyl)amino]]trisbenzendiazoniumtri[bis(2-methylpropyl)naphthalensulfonat] og 4,4',4'',4'''-[[5,5'-[carbonylbis[imino(1,5,5-trimethyl-3,1-cyclohexandiyl)methylen]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazin-1,1',3,3'-tetrayl]tetrakis[methylen(3,5,5-trimethyl-3,1-cyclohexandiyl)iminocarbonyloxy-2,1-ethandiyl(ethyl)amino]]tetrakisbenzendiazoniumtetra[bis(2-methylpropyl)naphthalensulfonat] |
417-080-1 |
— |
Self-react. D Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H317 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H317 H410 |
|
|
|
|
607-450-00-2 |
2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetat |
419-040-9 |
89604-92-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-451-00-8 |
4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]phenylcarbonylamino]benzensulfonsyre, natriumsalt |
417-640-5 |
161935-19-9 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-453-00-9 |
4-benzyl-2,6-dihydroxy-4-azaheptylen bis(2,2-dimethyloctanoat) |
418-100-1 |
172964-15-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-454-00-4 |
blanding af trans-2-(1-methylethyl)-1,3-dioxan-5-carboxylsyre og cis-2-(1-methylethyl)-1,3-dioxan-5-carboxylsyre |
418-170-3 |
116193-72-7 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-455-00-X |
1-amino-4-(3-[4-chlor-6-(2,5-di-sulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinon-2-sulfonsyre, na/li-salt |
419-520-8 |
172890-93-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-456-00-5 |
3-amino-4-chlorbenzoesyre, hexadecylester |
419-700-6 |
143269-74-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-457-00-0 |
tetranatriumdihydrogen 1,1''-dihydroxy-8,8''-[p-phenylbis(imino-{6-[4-(2-aminoethyl)piperazin-1-yl]}-1,3,5-triazin-4,2-diyl-imino)]bis(2,2'-azonaphthalen-1',3,6-trisulfonat) |
420-350-1 |
172277-97-3 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
607-458-00-6 |
en blanding af 2-ethyl-[2,6-dibrom-4-[1-[3,5-dibrom-4(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoat og 2,2'-diethyl-[4,4'-bis(2,6-dibromphenoxy)-1-methylethyliden] dipropenoat og 2,2'-[(1-methylethyliden)bis[[2,6-dibrom-4,1-phenylen)oxy]ethanol]] |
420-850-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-459-00-1 |
isopentyl 4-{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridyliden]hydrazino}benzoat |
418-930-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-460-00-7 |
3-tridecyloxy-propyl-ammonium 9-octadecenoat |
418-990-1 |
778577-53-0 |
STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H319 H315 H410 |
|
|
|
|
607-461-00-2 |
blanding af pentanatrium 2-{4-{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethansulfonyl)-phenylamino]-1.3.5-triazin-2-ylamino}-benzen-1,4-disulfonat og pentanatrium 2-{4-{3-methyl-4-[7-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethansulfonyl)-phenylamino]-1.3.5-triazin-2-ylamino}-benzen-1,4-disulfonat |
421-160-1 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-462-00-8 |
en blanding af 1-hexylacetat og 2-methyl-1-pentylacetat og 3-methyl-1-pentylacetat og 4-methyl-1-pentylacetat og andre blandede ligekædede og forgrenede C6-alkylacetater |
421-230-1 |
88230-35-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-463-00-3 |
3-(phenothiazin-10-yl)propionsyre |
421-260-5 |
362-03-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-464-00-9 |
en blanding af blanding af 7-chlor-1-ethyl-6-fluor-1,4-dihydro-4-oxo-quinolin-3-carboxylsyre og 5-chlor-1-ethyl-6-fluor-1,4-dihydro-4-oxo-quinolin-3-carboxylsyre |
421-280-4 |
|
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-465-00-4 |
tris(2-hydroxyethyl)ammonium 7-{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}naphthalen-1,3-disulfonat |
421-440-3 |
778583-04-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-466-00-X |
blanding af phenyl 1-(1-[2-chlor-5-(hexadecyloxycarbonyl)phenylcarbamoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazol-5-carboxylat og phenyl 2-(1-(2-chlor-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazol-5-carboxylat og phenyl 3-(1-(2-chlor-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazol-5-carboxylat |
421-480-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-467-00-5 |
1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate |
419-430-9 |
56533-00-7 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H410 |
|
|
|
|
607-468-00-0 |
en blanding af mononatrium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chlor-1,3,5-triazin-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridin-3-yl)azo)benzensulfonat og dinatrium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chlor-1,3,5-triazin-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridin-3-yl)azo)benzensulfonat og trinatrium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chlor-1,3,5-triazin-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridin-3-yl)azo)benzensulfonat og tetranatrium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chlor-1,3,5-triazin-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridin-3-yl)azo)benzensulfonat |
419-450-8 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-469-00-6 |
dinatrium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalensulfonat |
419-460-2 |
120029-06-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-470-00-1 |
kalium natrium 6,13-dichlor-3,10-bis{2-[4-[3-(2-idrossisulfonylossiethansulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}benzo[5,6][1,4]oxazino-[2,3-b]phenoxazin-4,11-disulfonat |
414-100-0 |
154336-20-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-471-00-7 |
1,6-bis((dibenzylthiocarbamoyl)disulfanyl)hexan |
429-280-6 |
151900-44-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-473-00-8 |
pentaerythritol, dipentaerythritol, fedtsyrer, C6-10, blandede estere med adipinsyre, heptansyre og isostearinsyre |
426-590-3 |
187412-41-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-474-00-3 |
(4-(-4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo2-pyrazolin-1-yl)benzoesyre |
410-430-4 |
117573-89-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-475-00-9 |
blanding (50/50) af tetranatrium-7-(4-[4-chlor-6-[methyl-(3-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat og tetranatrium-7-(4-[4-chlor-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat |
412-940-2 |
148878-18-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-476-00-4 |
N, N-bis(carbossimetil)-β-alanina di trisodio |
414-070-9 |
129050-62-0 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
607-477-00-X |
(1α,5α,6α)-6-nitro-3-benzyl-3-azabicyclo[3.1.0]hexan-methansulfonatsalt |
426-740-8 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
607-478-00-5 |
tetramethylammoniumhydrogenphthalat |
416-900-5 |
79723-02-7 |
Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H301 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H400 |
|
|
|
|
607-479-00-0 |
hexadecyl 4-chlor-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoat |
418-550-9 |
168689-49-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-480-00-6 |
1,2-benzendicarboxylsyre, di-C7-11-forgrenede og ligekædede alkylestere |
271-084-6 |
68515-42-4 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
607-481-00-1 |
blanding af trihexylcitrat; dihexyloctylcitrat, dioctylhexylcitrat og dihexyldecylcitrat |
430-290-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-482-00-7 |
N-[1-(S)-ethoxycarbonyl-3-phenylpropyl]-L-alanyl-N-carboxyanhydrid |
430-360-8 |
84793-24-8 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-483-00-2 |
1,2-benzendicarboxylsyre; di-C6-8-forgrenede og lineære alkylestere, C7-rige |
276-158-1 |
71888-89-6 |
Repr. 1B |
H360D *** |
GHS08 Dgr |
H360D *** |
|
|
|
|
607-484-00-8 |
ethyl-2-{[3-acetylamino-4-(6-brom-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)phenyl]ethylamino}propionat |
430-480-0 |
221452-67-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-485-00-3 |
(3S-trans)-phenyl-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorphenyl)-1-piperidincarboxylat |
430-510-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-486-00-9 |
kaliumnatrium-5'-(6-chlor-4-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-4'-hydroxy-2,3'-azodinaphthalen-1,2',5,7'-disulfonat |
402-110-8 |
110081-40-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-487-00-4 |
blanding af dinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienyliden)-4,5-dihydro-5-oxopyrazol-1-yl)benzensulfonatog trinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienyliden)-4,5-dihydro-5-oxopyrazol-1-yl)benzensulfonat |
402-660-9 |
— |
Repr. 1B Aquatic Chronic 3 |
H360D *** H412 |
GHS08 Dgr |
H360D *** H412 |
|
|
|
|
607-488-00-X |
ethyl (2-acetylamino-5-fluor-4-isothiocyanatphenoxy)acetat |
414-210-9 |
147379-38-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-489-00-5 |
en blanding af 2-ethylhexyllinolenat, linolat og olat og 2-ethylhexylepoxyolat og 2-ethylhexyldiepoxylinolat og 2-ethylhexyltriepoxylinolenat |
414-890-7 |
71302-79-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-490-00-0 |
N-[2-hydroxy-3-(C12-16-alkyloxy)propyl]-N-methylglycinat |
415-060-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-491-00-6 |
blanding af diester af 4,4'-methylenbis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] og 6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonsyre (1:2) og triester af 4,4'-methylenbis[2-(2-hydroxy-5-methylbenzyl)-3,6-dimethylphenol] og 6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonsyre (1:3) |
427-140-9 |
— |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
607-492-00-1 |
2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methylpropylpropanoat |
415-490-5 |
141773-73-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-493-00-7 |
methyl-(3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazol-6-carboxylat |
415-670-3 |
78850-37-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-494-00-2 |
bis(2-ethylhexyl)octylphosphonat |
417-170-0 |
52894-02-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-495-00-8 |
natrium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoat |
417-550-6 |
168151-92-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-496-00-3 |
2,2'-methylenbis(4,6-di-tert-butyl-phenyl)-2-ethylhexylphosphit |
418-310-3 |
126050-54-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-497-00-9 |
ceriumoxidisostearat |
419-760-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-498-00-4 |
(E)-3,7-dimethyl-2,6-octadienylhexadecanoat |
421-370-3 |
3681-73-0 |
Skin Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
|
|
|
|
607-499-00-X |
bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethandiyl-bis(2-hexadecenylsuccinat) |
421-660-1 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
607-500-00-3 |
calcium 2,2,bis[(5-tetrapropylen-2-hydroxy)phenyl]ethanoat |
421-670-4 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
607-501-00-9 |
blanding af triphenylthiophosphat og tertiære butylerede phenylderivater |
421-820-9 |
192268-65-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-502-00-4 |
(N-benzyl-N, N,N-tributyl)ammonium 4-dodecylbenzensulfonat |
422-200-0 |
178277-55-9 |
Skin Corr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H314 H302 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H411 |
|
|
|
|
607-503-00-X |
2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinan |
422-210-5 |
68957-94-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
607-504-00-5 |
diammonium-1-hydroxy-2-(4-(4-carboxyphenylazo)-2,5-dimethoxy-phenylazo)-7-amino-3-naphthalensulfonat |
422-670-7 |
— |
Repr. 2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f H301 H373 ** H410 |
|
|
|
|
607-505-00-0 |
pentanatrium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chlor-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat |
422-930-1 |
|
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-506-00-6 |
blanding af strontium-(4-chlor-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzensulfonat og dinatrium-(4-chlor-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzensulfonat |
422-970-8 |
|
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-507-00-1 |
kalium, natrium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzensulfonat |
422-980-2 |
187026-95-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-508-00-7 |
dinatrium 3,3'-[iminobis[sulfonyl-4,1-phenylen-(5-hydroxy-3-methylpyrazol-1,4-diyl)azo-4,1-phenylensulfonylimino-(4-amino-6-hydroxypyrimidin-2,5-diyl)azo-4,1-phenylensulfonylimino(4-amino-6-hydroxypyrimidin-2,5-diyl)azo]bis(benzensulfonat)] |
423-110-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-509-00-2 |
2-phenoxyethyl-4-aminobenzoat |
430-880-5 |
88938-23-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-510-00-8 |
(2S,5R)-6,6-dibrom-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-carboxylsyre-4,4-dioxid |
427-200-4 |
76646-91-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-511-00-3 |
en blanding af 4-[(3-decyloxypropyl)(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)amino]-4-oxosmørsyre og 4-[(3-isobutoxy-1-isobutoxycarbonyl-3-oxopropyl)(3-octyloxypropyl)amino]-4-oxosmørsyre |
423-750-4 |
— |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
607-512-00-9 |
trinatrium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzensulfonat |
423-970-0 |
182926-43-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-513-00-4 |
en blanding af trinatrium 4-benzoylamiino-6-(6-ethensulfonyl-1-sulfato-naphthalen-2-ylazo)-5-hyroxynaphthalen-2,7-disulfonat og 5-(benzoylamino)-4-hyroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphtyl)azo)naphthalen-2,7-disulfonsyre natriumsalt og 5-(benzoylamino)-4-hyroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphtyl)azo)naphthalen-2,7-disulfonsyre |
423-200-3 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-514-00-X |
kalium-N-(1-methoxy-1-oxobut-2-en-3-yl)valinat |
427-240-2 |
134841-35-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-515-00-5 |
en blanding af dinatrium hexyldiphenyletherdisulfonat og dinatrium dihexyldiphenyletherdisulfonat |
429-650-7 |
147732-60-3 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
607-516-00-0 |
N, N'-bis(trifluoracetyl)-S,S'-bis-.sc.L.sc.-homocystein |
429-670-6 |
105996-54-1 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-517-00-6 |
(S)-α-(acetylthio)benzenpropansyre |
430-300-0 |
76932-17-7 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
607-518-00-1 |
3-oxoandrost-4-en-17β-carboxylsyre |
414-990-0 |
302-97-6 |
Repr. 2 Aquatic Chronic 4 |
H361f H413 |
GHS08 Wng |
H361f H413 |
|
|
|
|
607-519-00-7 |
poly-[((4-((4-ethyl-ethylen)amino)phenyl)-(4-(ethyl-(2-oxyethylen)amino)phenyl)methinyl)cyclohexa-2,5-dienyliden)-N-ethyl-N-(2-hydroxyethyl)ammoniumacetat] |
427-280-0 |
176429-27-9 |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H335 H315 H318 H410 |
|
|
|
|
607-520-00-2 |
blanding af natrium-4,5-dihydro-2-[(propionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphat og dinatrium-4,5-dihydro-2-[(dipropionato)(C6-18)alkyl]-3H-imidazolium-N-ethylphosphat |
427-740-0 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-521-00-8 |
tetraethyl-N, N'-(methylendicyclohexan-4,1-diyl)bis-DL-aspartat |
429-270-1 |
136210-30-5 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-522-00-3 |
natriumsalt af polymer af natrium-2-methyl-buta-1,3-dien-1-sulfonat med acrylsyre og 2-hydroxyethyl-2-methylacrylat |
429-720-7 |
184246-86-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-523-00-9 |
blanding af mono- til tetra(lithium og/eller natrium)-3-amino-10-[4-(4-amino-3-sulfonatoanilino)-6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2-ylamino]-6,13-dichlorbenzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-disulfonat og mono- til tetra(lithium og/eller natrium)-3-amino-10-[4,6-bis(4-amino-3-sulfonatoanilino)-1,3,5-triazin-2-ylamino]-6,13-dichlorbenzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-disulfonat og mono- til penta(lithium og/eller natrium)-10,10'-diamino-6,6',13,13'-tetrachlor-3,3'-[6-[methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-disulfonat og mono- til hepta(lithium og/eller natrium)-10-amino-6,6',13,13'-tetrachlor-10'[4-(4-amino-3-sulfonatoanilino)-[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-disulfonat og mono- til hepta(lithium og/eller natrium)-10,10'-diamino-6,6',3,3'[(2-sulfonato)-1,4-phenylendiiminobis[6-methyl-(2-sulfonatoethyl)amino]-1,3,5-triazin-2,4-diyldiimino]bis[benzo[1,2-B:4,5-B']di[1,4]benzoxazin-4,11-disulfonat |
430-200-7 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-524-00-4 |
tallolie-2-[(tetrahydro-2H-pyran-2-yl)thio]ethylestere |
430-310-5 |
— |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
607-525-00-X |
(Z)-2-methoxyimino-2-[2-(tritylamino)thiazol-4-yl]eddikesyre |
431-520-1 |
64485-90-1 |
Flam. Sol. 1 **** Carc. 2 Aquatic Chronic 3 |
H228 H351 H412 |
GHS02 GHS08 Dgr |
H228 H351 H412 |
|
|
|
|
607-526-00-5 |
cartap (ISO); 1,3-bis(carbamoylthio)-2-(dimethylamino)propan |
— |
15263-53-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-527-00-0 |
en blanding af 1-(1'H,1'H,2'H,2'H-tridecafluoroctyl) 12-(1''H,1''H,2''H,2''H-tridecafluoroctyl)dodecandioat og 1-(1'H,1'H,2'H,2'H-tridecafluoroctyl) 12-(1''H,1''H,2''H,2''H-heptdecafluordecyl)dodecandioat og 1-(1'H,1'H,2'H,2'H-tridecafluoroctyl)12-(1''H,1''H,2''H,2''H-heneicosafluordodecyl)dodecandioat og 1-(1'H,1'H,2'H,2'H-tridecafluoroctyl) 12-(1''H,1''H,2''H,2''H-pentacosafluortetradecyl)dodecandioat og 1-(1'H,1'H,2'H,2'H-heptadecafluordecyl) 12 (1''H,1''H,2''H,2''H-heptadecafluordecyl)dodecandioat og 1-(1'H,1'H,2'H,2'H-heptadecafluordecyl) 12-(1''H,1''H,2''H,2''H-heneicosafluordodecyl)dodecandioat |
423-180-6 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
607-528-00-6 |
(S)-3-methyl-2-(2-oxotetrahydropyrimidin-1-yl)smørsyre |
430-900-2 |
192725-50-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-529-00-1 |
benzyl-cis-4-ammonium-4'-toluensulfonato-1-cyclohexancarboxylat |
426-070-6 |
67299-45-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-530-00-7 |
blanding af isomerer af C7-9-alkyl-3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionat |
406-040-9 |
125643-61-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-531-00-2 |
methyl-3-amino-4,6-dibrom-2-methyl-benzoat |
425-190-6 |
119916-05-1 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
607-532-00-8 |
(S)-1-[2-tert-butoxycarbonyl-3-(2-methoxyethoxy)propyl]-1-cyclopentancarboxylsyre, cyclohexylaminsalt |
425-510-4 |
167944-94-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-533-00-3 |
pentanatrium-monohydrogen-6-chlor-3,10-bis[2-[4-chlor-6-(2,4-disulfophenylamino)-1,3,5-triazin-2-yl-amino]ethylamino]-13-ethylbenzo[5,6][1,4]oxazino[2,3-b]phenoxazin-4,11-disulfonat |
414-910-4 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-534-00-9 |
ethyl-2-(3-benzoylphenyl)propanoat |
414-920-9 |
60658-04-0 |
Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Chronic 2 |
H301 H372 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H317 H411 |
|
|
|
|
607-535-00-4 |
kalium-4-iod-2-sulfonato-benzoesyre |
426-620-5 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-536-00-X |
(2,6-xylyloxy)eddikesyre |
430-910-7 |
13335-71-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
607-537-00-5 |
isopropylammonium-2-(3-benzoylphenyl)propionat |
417-970-1 |
— |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H372 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H312 H372 ** H318 H410 |
|
|
|
|
607-539-00-6 |
propyl-((4-(5-oxo-3-propylisoxazolidin-4-ylidenmethin)phenyl)propoxycarbonylmethylenamino)acetat |
431-000-2 |
198705-81-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-540-00-1 |
1-(mercaptomethyl)cyclopropyleddikesyre |
420-240-3 |
162515-68-6 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H314 H312 H302 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H312 H302 H317 H411 |
|
|
|
|
607-541-00-7 |
[(1-methyl-1,2-ethandiyl)bis[nitrilobis(methylen)]]tetrakis(phosphonsyre) |
421-940-1 |
28698-31-9 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
607-542-00-2 |
methyl-2-(4-butansulfonamido-phenoxy)tetradecanoat |
422-110-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-543-00-8 |
poly-[((4-((4-(ethyl-ethylen)amino)phenyl)-(4-(ethyl-(2-oxyethylen)amino)phenyl)methinyl)-3-methylcyclohexa-2,5-dienyliden)-N-ethyl-N-(2-hydroxyethyl)ammoniumacetat] |
427-480-8 |
176429-22-4 |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H335 H315 H318 H410 |
|
|
|
|
607-544-00-3 |
ethyl-6,8-difluor-1-(formylmethylamino)-1,4-dihydro-7-(4-methyl)piperazin-1-yl)-4-oxo-quinolin-3-carboxylat |
427-490-2 |
158585-86-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-545-00-9 |
1,2-dimethyl-3-(1-methylethenyl)cyclopentylacetat |
424-070-0 |
94346-09-5 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-546-00-4 |
blanding af methyl-{[5-acetylamino-4-(2-chlor-4-nitro-phenylazo)phenyl]methoxy-carbonylmethylamino}acetat og methyl-{[5-acetylamino-4-(2-chlor-4-nitro-phenylazo)phenyl]ethoxy-carbonylmethylamino}acetat |
424-290-7 |
188070-47-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-547-00-X |
18-methylnonadecyl-2,2-dimethylpropanoat |
424-370-1 |
125496-22-2 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
607-548-00-5 |
1-(2,4-dichlorphenyl)-2-(1H-imidazol-1-yl)ethanonmethansulfonat |
431-010-7 |
154486-26-7 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
607-549-00-0 |
methyl-(E)-2((3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl)amino)benzoat |
424-430-7 |
125778-19-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-550-00-6 |
2-amino-4-brom-5-chlorbenzoesyre |
424-700-4 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-551-00-1 |
tetrabutylammonium-2-amino-6-iodpurinat |
424-710-9 |
156126-48-6 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H317 H411 |
|
|
|
|
607-552-00-7 |
hexadecyl-3-amino-4-isopropoxybenzoat |
424-830-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-553-00-2 |
7-amino-4-hydroxy-2-naphthalensulfonsyre, koblet med 5 (eller 8) -amino-8 (eller 5)-[[4-[[4-[[4-amino-6 (eller 7)-sulfo-1-naphthyl]azo]phenyl]amino]-3-sulfophenyl]azo]-2-naphthalensulfonsyre og 4-hydroxy-7-(phenylamino)-2-naphthalensulfonsyre, natriumsalt |
424-850-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-554-00-8 |
2,4-diamino-5-[4-[(2-sulfoxylethyl)sulfonyl]phenylazo]benzensulfonsyre |
424-870-1 |
27624-67-5 |
Expl. 1,1 Eye Dam. 1 Aquatic Chronic 3 |
H201 H318 H412 |
GHS01 GHS05 Dgr |
H201 H318 H412 |
|
|
|
|
607-555-00-3 |
1,1,3,3-tetramethylbutylperoxypivalat |
424-980-8 |
22288-41-1 |
Flam. Liq. 2 Org. Perox. D Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H242 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H242 H315 H317 H411 |
|
|
|
|
607-556-00-9 |
2-acetoxymethylen-4-acetylphenylacetat |
425-160-2 |
24085-06-1 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H410 |
|
|
|
|
607-557-00-4 |
salt af (1S-cis)-1-amino-2,3-dihydro-1H-inden-2-ol og [R-[R*R*]]-2,3-dihydroxybutandisyre |
425-210-3 |
169939-84-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-558-00-X |
2S-isopropyl-5R-methyl-1R-cyclohexyl-(2R,5S)-5-(4-amino-2-oxo-2H-pyrimidin-1-yl)-[1,3]-oxathiolan-2-carboxylat |
425-250-1 |
147027-10-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-559-00-5 |
kokosolie, reaktionsprodukter med glycerolestere af 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenpropansyre |
425-400-6 |
179986-09-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-560-00-0 |
(R,S)-2-butyloctandisyre |
431-210-4 |
50905-10-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-561-00-6 |
natrium-4-hydroxy-3-(N'-(2-(2-hydroxyethylensulfonyl)ethylen)ureido)-5-nitro-benzensulfonat |
425-460-3 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-562-00-1 |
en blanding af (2R,3R)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium-methansulfonat og (2S,3S)-3-(2-ethoxyphenoxy)-2-hydroxy-3-phenylpropylammonium-methansulfonat |
425-530-3 |
98769-75-6 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
607-563-00-7 |
5,7-dichlor-4-hydroxyquinolin-3-carboxylsyre |
431-250-2 |
171850-30-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-564-00-2 |
1,6-hexandiammonium-natrium-5-sulfato-1,3-benzendicarboxylat |
425-730-0 |
51178-75-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-565-00-8 |
3-ethyl-5-methyl-2-(2-aminoethoxymethyl)-4-(2-chlorphenyl)-1,4-dihydro-6-methyl-3,5-pyridindicarboxylat |
425-820-1 |
88150-42-9 |
Acute Tox. 3 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H373 ** H318 H410 |
|
|
|
|
607-566-00-3 |
blanding af dodecylphenyl-dodecylhydroxybenzencarboxylat og bis(dodecylphenyl)dodecyl-hydroxybenzendicarboxylat |
426-140-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-567-00-9 |
kalium-3-iod-6-methylbenzensulfonat |
426-300-5 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-568-00-4 |
kalium-2-chlor-3-(benzyloxy)propionat |
426-350-8 |
138666-92-9 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 |
|
|
|
|
607-569-00-X |
blanding af natrium-2-amino-4-(2,6-difluorpyrimidin-4-ylamino)benzensulfonat og natrium-2-amino-4-(4,6-difluorpyrimidin-4-ylamino)benzensulfonat |
426-470-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-570-00-5 |
natrium-(6R-trans)-7-amino-8-oxo-3-[[[1-(sulfomethyl)-1H-tetrazol-5-yl]thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-carboxylat monohydrat |
426-520-1 |
71420-85-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-571-00-0 |
2-cyclopenten-1-eddikesyre, 3-hydroxy-2-pentyl-, methylesteracetat |
431-400-7 |
57374-49-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-572-00-6 |
diethyl-thiophosphoryl-(Z)-(2-aminothiazol-4-yl)methoxyimino acetat |
426-790-0 |
162208-27-7 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H317 H410 |
|
|
|
|
607-573-00-1 |
blanding af dinatrium-7-(2,4-difluorpyrimidin-6-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalen-2-sulfonat og dinatrium-7-(4,6-difluorpyrimidin-2-ylamino)-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)naphthalen-2-sulfonat |
426-840-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-574-00-7 |
[1R-(1α,2β,5α)]-mono[5-methyl-2-(1-methylethyl)cyclohexyl]butandioat |
426-890-4 |
77341-67-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-575-00-2 |
4-(5-(5-[1-(4-carboxyphenyl)hexahydro-2,4,6-trioxopyrimidin-5-yliden]penta-1,3-dienyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-1-yl)benzoesyre triethylaminsalt |
426-900-7 |
— |
STOT SE 3 Aquatic Chronic 3 |
H335 H412 |
GHS07 Wng |
H335 H412 |
|
|
|
|
607-576-00-8 |
forgrenet octyl-3-[3,5-di(tert-butyl)-4-hydroxyphenyl]propanoat |
427-030-0 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-577-00-3 |
(2R*,3S*)-2-(2,4-difluorphenyl)-3-(5-fluor-4-pyrimidinyl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol (1R)-10-camphorsulfonat |
427-100-0 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
607-578-00-9 |
ethyl-4-((4-diethylamino-2-methylphenyl)imino)-4,5-dihydro-1-isopropyl-5-oxo-1H-pyrazol-3-carboxylat |
427-110-5 |
— |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 4 |
H302 H373 ** H413 |
GHS08 GHS07 Wng |
H302 H373 ** H413 |
|
|
|
|
607-579-00-4 |
diethyl[(p-ethoxyanilino)methylen]malonat |
431-430-0 |
103976-28-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
607-580-00-X |
ethyl-7-chlor-1-(2,4-difluorphenyl)-6-fluor-1,4-dihydro-4-oxo-1,8-naphthyridin-3-carboxylat |
422-360-1 |
100491-29-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-581-00-5 |
ethyl-2-ethoxy-4-carboxymethylbenzoat |
427-630-2 |
99469-99-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-582-00-0 |
blanding af tetranatrium-7-(4-(4-fluor-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat og tetranatrium-7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat |
427-650-1 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-583-00-6 |
4-amino-3-[[4-[[2-(sulfoxy)ethyl]sulfonyl]phenyl]azo]-1-naphthalensulfonsyre |
427-680-5 |
188907-52-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-584-00-1 |
trinatrium-3-[2-acetylamino-4-[4-chlor-6-[4-(2-sulfonatoxyethylsulfonyl)phenylamino]-1,3,5-triazine-2-ylamino]phenylazo]naphthalen-1,5-disulfonat |
427-710-7 |
215612-56-9 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-585-00-7 |
strontium-2-[(2-hydroxy-6-sulfonato-1-naphthyl)azo]naphthalen-1-sulfonat |
427-930-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-586-00-2 |
dodecyl-3-amino-4-chlorbenzoat |
428-020-9 |
6195-20-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-587-00-8 |
ethyl-cis-4-[4-[[2-(2,4-dichlorphenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-carboxylat |
428-030-3 |
67914-69-6 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
607-588-00-3 |
en blanding af 2-ethylhexyl-2,3,4,5-tetrabrombenzoat og bis(2-ethylhexyl)-3,4,5,6-tetrabromphthalat |
428-050-2 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-589-00-9 |
tetrakis(1,2,2,6,6-pentamethyl-4-piperidyl)-1,2,3,4-butantetracarboxylat |
428-070-1 |
91788-83-9 |
STOT RE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H372 ** H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H410 |
|
|
|
|
607-590-00-4 |
hexadecyl-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxovaleramido]-4-isopropoxybenzoat |
428-140-1 |
210706-50-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-591-00-X |
blanding af trinatrium-5-(4-fluor-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-sulfoxyethansulfonyl)phenylazo)naphthalen-2,7-disulfonat og dinatrium-3-(4-ethensulfonylphenylazo)-5 (4-fluor-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxynaphthalen-2,7-disulfonat |
428-400-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-592-00-5 |
di(C9-11-alkyl)cyclohexan-1,4-dicarboxylat |
428-870-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-593-00-0 |
4-(2-methylacryloyloxy)phenyl-4-allyloxybenzoat |
429-000-2 |
159235-16-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-594-00-6 |
ethyl-(1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-en-3-carboxylat |
429-020-1 |
204254-96-6 |
STOT RE 2 * Skin Sens. 1 |
H373 ** H317 |
GHS08 GHS07 Wng |
H373 ** H317 |
|
|
|
|
607-595-00-1 |
N-amidino-N-methylglycin-2-oxopropionat |
429-120-5 |
208535-04-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-596-00-7 |
ethyl-2-(4-phenoxyphenyl)lactat |
429-220-9 |
132584-17-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-597-00-2 |
tetranatrium-4,4'-bis{4-[4-(2-hydroxyethylamino)-6-(4-sulfonatoanilino)-1,3,5-triazin-2-ylamino]phenylazo}stilben-2,2'-disulfonat |
429-230-3 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-598-00-8 |
trinatrium-3-amino-4-[4-[4-(2-(2-ethenylsulfonylethoxy)ethylamino)-6-fluor-1,3,5-triazin-2-ylamino]-2-sulfophenylazo]-5-hydroxynaphthalen-2,7-disulfonat |
429-240-8 |
212652-59-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-599-00-3 |
1,1-dimethylpropyl-3,5,5-trimethylperoxyhexanoat |
431-610-9 |
68860-54-8 |
Org. Perox. D Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H317 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H317 H410 |
|
|
|
|
607-600-00-7 |
(1S,1'R)-[1-(3',3'-dimethyl-1'-cyclohexyl)ethoxycarbonyl]methyl-propanoat |
431-700-8 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-601-00-2 |
1,4-dihydroxy-2,2,6,6-tetramethylpiperidinium-2-hydroxy-1,2,3-propantricarboxylat |
429-370-5 |
220410-74-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-602-00-8 |
ethyl-(3-cyanmethyl-3,4-dihydro-4-oxophthalazin-1-yl)acetat |
429-680-0 |
122665-86-5 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-603-00-3 |
lithium-natrium-4,4',4''-(nitrilotris(ethan-2,1-diylimino(6-chlor-1,3,5-triazin-4,2-diyl)imino))-tris(5-hydroxy-6-(1-sulfonaphthalen-2-ylazo)-2,7-naphthalen)disulfonat |
429-730-1 |
193562-37-7 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-604-00-9 |
guanidiniumbenzoat |
429-820-0 |
26739-54-8 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-605-00-4 |
methyl-4-iod-2-(3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)ureidosulfonyl)benzoat |
429-890-2 |
144550-06-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-606-00-X |
(Z)-2-(2-tert-butoxycarbonylamino-4-thiazolyl)pent-2-ensyre |
430-100-3 |
86978-24-7 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-607-00-5 |
en blanding af calcium-bis(C10-14 forgrenet alkyl-salicylat) og calcium-bis(C18-30-alkylsalicylat) og calcium-C10-14 forgrenet alkyl-salicylato-C18-30-alkylsalicylat og calcium-bis(C10-14 forgrenet alkyl-phenolat) og calcium-bis(C18-30-alkylphenolat) og calcium-C10-14 forgrenet alkyl-phenolato-C18-30-alkylphenolat og C10-14 forgrenet alkyl-phenol og C18-30-alkylphenol |
430-180-1 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-608-00-0 |
pentakalium-2-(4-{5-[1-(2,5-disulfophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-yliden]-3-(2-pyrrolidinon-1-yl)-1,3-pentadienyl}-3-methylcarbamoyl-5-oxopyrazol-1-yl)benzen-1,4-disulfonat |
430-210-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-609-00-6 |
ethyl-(3R)-4-cyan-3-hydroxybutanoat |
430-220-6 |
141942-85-0 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-610-00-1 |
trinatrium-4-hydroxy-6-(sulfonatomethylamino)-5-(2-(2-sulfatoethylsulfonyl)phenylazo)naphthalen-2-sulfonat |
430-280-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-611-00-7 |
methyl-3-amino-2,2,3-trimethylbutyrat |
431-720-7 |
90886-53-6 |
Skin Corr. 1B Acute Tox. 4 * Aquatic Chronic 3 |
H314 H302 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
|
|
|
|
607-612-00-2 |
blanding af 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluor-1-octansulfonsyre og ammonium-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluor-1-octansulfonat |
432-190-1 |
182176-52-9 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 |
H302 H373 ** H318 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 |
|
|
|
|
607-613-00-8 |
blanding af ravsyre; monoperoxyravsyre; diperoxyravsyre; monomethylester af ravsyre; monomethylester af peroxyravsyre; dimethylsuccinat; glutarsyre; monoperoxyglutarsyre; diperoxyglutarsyre; monomethylester af glutarsyre; monomethylester af peroxyglutarsyre; dimethylglutarat; adipinsyre; monoperoxyadipinsyre; diperoxyadipinsyre; monomethylester af adipinsyre; monomethylester af peroxyadipinsyre; dimethyladipat; hydrogenperoxid; methanol og vand |
432-790-1 |
|
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B STOT SE 2 |
H332 H312 H302 H314 H371 (øjne) |
GHS07 GHS05 GHS08 Dgr |
H332 H312 H302 H314 H371 (øjne) |
|
|
|
|
607-614-00-3 |
2-(10-oxo-10H-9-oxa-10-phosphaphenanthren-10-ylmethyl)ravsyre |
426-480-5 |
63562-33-4 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-615-00-9 |
reaktionsprodukt af thioglycerol og mercaptoeddikesyre, som hovedsagelig består af 3-mercapto-1,2-bismercaptoacetoxypropan og oligomerer heraf |
431-120-5 |
— |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H331 H302 H319 H317 |
GHS06 Dgr |
H331 H302 H319 H317 |
|
|
|
|
607-616-00-4 |
2,4-dichlor-5-fluorbenzoylchlorid |
428-390-1 |
86393-34-2 |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H335 H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H317 H412 |
|
|
|
|
607-617-00-X |
bis(2-ethylhexyl)-4,5-epoxycyclohexan-1,2-dicarboxylat |
430-700-5 |
10138-36-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-618-00-5 |
menadionnatriumbisulfit; 2-naphthalensulfonsyre, 1,2,3,4-tetrahydro-2-methyl-1,4-dioxo-, natriumsalt |
204-987-0 |
130-37-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
607-619-00-0 |
menadionnicotinamidbisulfit; 1,2,3,4-tetrahydro-2-methyl-1,4-dioxonaphthalen-2-sulfonsyre, forbindelse med nicotin-3-amid (1:1) |
277-543-7 |
73581-79-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
607-620-00-6 |
trinatriumnitrilotriacetat |
225-768-6 |
5064-31-3 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 |
H351 H302 H319 |
GHS08 GHS07 Wng |
H351 H302 H319 |
|
Carc. 2; H351: C ≥ 5 % |
|
|
607-621-00-1 |
milbemectin (ISO); [blanding af milbemycin A3 (CAS-nr. 51596-10-2) og milbemycin A4 (CAS-nr. 51596-11-3) (30:70)] |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
M = 100 |
|
|
607-622-00-7 |
2-ethylhexyl-2-ethylhexanoat |
231-057-1 |
7425-14-1 |
Repr. 2 |
H361d *** |
GHS08 Wng |
H361d *** |
|
|
|
|
607-624-00-8 |
perfluoroctansulfonsyre; heptadecafluoroctan-1-sulfonsyre; [1] kaliumperfluoroctansulfonat; kaliumheptadecafluoroctan-1-sulfonat; [2] diethanolaminperfluoroctansulfonat; [3] ammoniumperfluoroctansulfonat; ammoniumheptadecafluoroctansulfonat; [4] lithiumperfluoroctansulfonat; lithiumheptadecafluoroctansulfonat [5] |
217-179-8 [1] 220-527-1 [2] 274-460-8 [3] 249-415-0 [4] 249-644-6 [5] |
1763-23-1 [1] 2795-39-3 [2] 70225-14-8 [3] 29081-56-9 [4] 29457-72-5 [5] |
Carc. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Lact. Aquatic Chronic 2 |
H351 H360D *** H372 ** H332 H302 H362 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H372 ** H332 H302 H362 H411 |
|
|
|
|
607-625-00-3 |
clodinafop-propargyl (ISO) |
— |
105512-06-9 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
Skin Sens. 1; H317: C ≥ 0,001 % M = 1 |
|
|
607-626-00-9 |
ethyl-1-(2,4-dichlorphenyl)-5-(trichlormethyl)-1H-1,2,4-triazol-3-carboxylat |
401-290-5 |
103112-35-2 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
607-627-00-4 |
[(4S,5S)-4-benzyl-2-oxo-5-oxazolidinyl]methyl 4-nitrobenzensulfonat |
416-360-0 |
162221-28-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-628-00-X |
4-oxo-4-(p-tolyl)smørsyre, addukt med 4-ethylmorpholin |
419-240-6 |
171054-89-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-629-00-5 |
[[2-methyl-1-(1-oxopropoxy)propoxy](4-phenylbutyl)phosphinyl]eddikesyre |
419-270-1 |
123599-82-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-630-00-0 |
acrylsyre, 3-(trimethoxysilyl)propylester |
419-560-6 |
4369-14-6 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H332 H314 H317 H412 |
GHS05 GHS07 Dgr |
H332 H314 H317 H412 |
|
|
|
|
607-631-00-6 |
en blanding af 2-(2-((oxo(phenyl)acetyl)oxy)ethoxy)ethyl-oxo(phenyl)acetat og (2-(2-hydroxyethoxy)ethyl)-oxo(phenyl)acetat |
442-300-8 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-632-00-1 |
N-[3-(2,4-di-(1,1-dimethyl-propyl)phenoxy)-propyl]-1-hydroxy-5-(2-methylpropyl-oxycarbonylamino)-naphthamid |
420-210-1 |
111244-14-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-633-00-7 |
trinatrium-5-{[4-chlor-6-(1-naphthylamino)-1,3,5-triazin-2-yl]amino}-4-hydroxy-3-[(E)-(4-methoxy-2-sulfonatophenyl)diazenyl]-2,7-naphthalendisulfonat |
440-480-2 |
341026-59-3 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-634-00-2 |
(S)-(-)-2-acetoxypropionylchlorid; (1S)-2-chlor-1-methyl-2-oxoethylacetat |
420-610-4 |
36394-75-9 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
607-635-00-8 |
trinatrium-N-(3-propionato)-L-aspartat |
422-090-4 |
172737-80-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-636-00-3 |
1-brom-2-methylpropylpropionat |
422-900-6 |
158894-67-8 |
Flam. Liq. 3 Carc. 2 Skin Corr. 1B Skin Sens. 1 |
H226 H351 H314 H317 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H351 H314 H317 |
|
|
|
|
607-637-00-9 |
dinatrium-8-amino-5-{4-[2-(sulfonatoethoxy)sulfonyl]phenylazo}naphthalen-2-sulfonat |
423-730-5 |
250688-43-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-638-00-4 |
2-hydroxybenzoesyre-2-butyloctylester |
431-090-3 |
190085-41-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-639-00-X |
2-(2-oxo-5-(1,1,3,3-tetramethylbutyl)-2,3-dihydro-1-benzofuran-3-yl)-4-(1,1,3,3-tetramethylbutyl)phenylacetat |
431-770-1 |
216698-07-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-641-00-0 |
2-(formylamino)-3-thiophencarboxylsyre; 2-formamido-3-thiophencarboxylsyre |
431-930-9 |
43028-69-9 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
607-642-00-6 |
3,6,9-trithiaundecamethylen-1,11-dimethacrylat |
432-210-7 |
141631-22-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-643-00-1 |
dimethyl (2S)-2-hydroxysuccinat |
432-310-0 |
617-55-0 |
Flam. Liq. 3 Eye Dam. 1 Skin Sens. 1 |
H226 H318 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H318 H317 |
|
|
|
|
607-644-00-7 |
methyl-2,2-dimethyl-6-methylencyclohexancarboxylat |
432-350-9 |
81752-87-6 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
607-645-00-2 |
tetranatrium-2-(4-fluor-6-(methyl-(2-(sulfatoethylsulfonyl)ethyl)amino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-methyl-2-sulfonatophenylazo)naphthalen-1,7-disulfonat |
432-550-6 |
243858-01-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-646-00-8 |
D-erythro-hexansyre-2,4-dideoxy-3,5-O-(1-methylethyliden)-1,1-dimethylethylester; tert-butyl-2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetat |
432-960-5 |
124655-09-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-647-00-3 |
5-acetoxy-2-(R,S)butyryloxymethyl-1,3-oxathiolan |
433-530-1 |
143446-73-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 |
H302 H317 H400 |
GHS07 GHS09 Wng |
H302 H317 H400 |
|
|
|
|
607-649-00-4 |
[3-(chlorcarbonyl)-2-methylphenyl]acetat |
433-690-0 |
167678-46-8 |
Skin Corr. 1A Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
607-650-00-X |
2-methyl-1,5-pentandiamin-1,3-benzendicarboxylat |
433-910-5 |
145153-52-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-651-00-5 |
natrium-2-(nonanoyloxy)benzensulfonat |
434-360-9 |
91125-43-8 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-652-00-0 |
ethyl-N2-dodecanoyl-L-argininathydrochlorid |
434-630-6 |
60372-77-2 |
Eye Dam. 1 Aquatic Acute 1 |
H318 H400 |
GHS05 GHS09 Dgr |
H318 H400 |
|
|
|
|
607-653-00-6 |
tetrakis(bis(2-hydroxyethyl)methylammonium)-3-(4-(7-acetylamino-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-5-methoxy-2-sulfonatophenylazo)-7-(4-amino-3-sulfonatophenylamino)-4-hydroxynaphthalen-2-sulfonat |
434-840-8 |
225786-91-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-654-00-1 |
(S)-3-hydroxy-γ-butyrolacton |
434-990-4 |
7331-52-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-655-00-7 |
ethyl-6,8-dichloroctanoat |
435-080-1 |
1070-64-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-656-00-2 |
natriumsalt af 4-amino-3,6-bis[[5-[[4-chlor-6-[(2-methyl-4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]azo]-5-hydroxy-2,7-naphthalendisulfonsyre |
435-350-7 |
141250-43-3 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-657-00-8 |
pentanatrium-7-(4-(4-(3-(2-sulfatoethansulfonyl)phenylamino)-6-(4-(2-sulfatoethansulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalen-1,3,6-trisulfonat |
436-920-8 |
172399-10-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-658-00-3 |
3,10-diamino-6,13-dichlor-2-((6-(((4-(1,1-dimethylethyl)phenyl)sulfonyl)amino)-2-naphthalenyl)sulfonyl)-4,11-triphenodioxazindisulfonsyre, lithiumkaliumnatriumsalt |
440-770-9 |
371921-63-0 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-659-00-9 |
pentanatrium-N-[5-[[4-[[3-[(aminocarbonyl)amino]-4-[(3,6,8-trisulfonatonaphthalen-2-yl)azo]phenyl]amino]-6-chlor-1,3,5-triazin-2-yl]amino]-2-sulfonato-4-[[4-[[-2-(oxysulfonato)ethyl] sulfonyl]phenyl]azo]phenyl]-3-aminopropansyre |
442-030-0 |
321912-47-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-660-00-4 |
2-{4-[4-[4-fluor-6-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino]phenylazo]phenylazo}naphthalen-4,6,8-trisulfonat, trinatriumsalt |
442-230-8 |
321679-52-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
607-661-00-X |
1,1-dimethylethyl-4'-(brommethyl)biphenyl-2-carboxylat |
442-850-9 |
114772-40-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-662-00-5 |
methyl-2-(acetylamino)-3-chlorpropionat |
442-860-3 |
87333-22-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
607-663-00-0 |
bis(2-ethylhexyl)-naphthalen-2,6-dicarboxylat |
442-980-6 |
127474-91-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-664-00-6 |
methyl-2-chlorsulfonyl-4-(methansulfonylaminomethyl)benzoat |
443-120-2 |
393509-79-0 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
607-665-00-1 |
trans-methyl-2-ethyl-but-2-enoat |
443-150-6 |
101226-85-1 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
607-666-00-7 |
(2S)-5-(benzyloxy)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentansyre |
443-560-5 |
88784-33-2 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
607-667-00-2 |
chlor-1-ethylcyclohexylcarbonat |
444-950-8 |
99464-83-2 |
Muta. 2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
|
|
|
|
607-668-00-8 |
trans-2-isopropyl-5-carboxy-1,3-dioxan |
445-770-2 |
42031-28-7 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
607-669-00-3 |
methyl-(9-acetoxy-3,8,10-triethyl-7,8,10-trimethyl-1,5-dioxa-9-aza-spiro[5.5]undec-3-yl)octadecanoat |
445-990-9 |
376588-17-9 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-670-00-9 |
dibutyl-3-(4-(5-ammonio-2-butyl)benzofuran-3-yl)carbonyl)phenoxy)propylammoniumoxalat; (5-amino-2-butylbenzofuran-3-yl)-[4-(3-dibutylaminopropoxy)phenyl]methanon, dioxalat |
448-700-9 |
500791-70-8 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H373 ** H318 H317 H410 |
|
M = 10 |
|
|
607-671-00-4 |
diethyl-1,4-cyclohexandicarboxylat |
417-310-0 |
72903-27-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-672-00-X |
en blanding af 2-hydroxy-3-(methacryloyloxy)propyl-(2-benzoyl)benzoat; 1-hydroxymethyl-2-(methacryloyloxy)ethyl-(2-benzoyl)benzoat; x-hydroxy-y-(methacryloyloxy)propyl(eller -ethyl)-(2-benzoyl)benzoat |
419-000-0 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-673-00-5 |
1-ethyl-5,6,7,8-tetrahydroquinoliniumtosylat |
419-570-0 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
607-675-00-6 |
blanding af cis-9-octadecendisyre; cis-9-cis-12-octadecadiendisyre; hexadecandisyre; octadecandisyre |
422-260-8 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
607-676-00-1 |
en blanding af 2-methylnonandisyre; 2,4-dimethyl-4-methoxycarbonylundecandisyre; 2,4,6-trimethyl-4,6-dimethoxycarbonyltridecandisyre; 8,9-dimethyl-8,9-dimethoxycarbonylhexadecandisyre |
423-670-1 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-677-00-7 |
2,5-dioxopyrrolidin-1-yl N-{[methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl}-L-valinat |
424-660-8 |
— |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H373 ** H318 H317 |
|
|
|
|
607-678-00-2 |
blanding af ethyl-(2R,3R)-3-isopropylbicyclo[2.2.1]hept-5-en-2-carboxylat og ethyl-(2S,3S)-3-isopropylbicyclo[2.2.1]hept-5-en-2-carboxylat |
427-090-8 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-679-00-8 |
en blanding af 3-{5-[3-(4-{1,6-dihydro-2-hydroxy-4-methyl-1-[3 (methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(methyl)ammoniumdi(acetat); 3-{5-[4-(3-{1,6-dihydro-2-hydroxy-4-methyl-1-[3-(methylammonio)propyl]-6-oxo-3-pyridylazo}benzamido]phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(dimethyl)ammoniumdi(acetat); 3-{5-[3-(4-{1-[3-(dimethylammonio)propyl]-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo}benzamido)phenylazo]-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl}propyl(dimethyl)ammoniumdi(acetat) |
431-440-5 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
607-680-00-3 |
tert-butyl(6-{2-[4-(4-fluorphenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl]vinyl}(4S,6S)-2,2-dimethyl[1,3]dioxan-4-yl)acetat |
432-810-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-681-00-9 |
en blanding af 9-nonyl-10-octyl-19-carbonyloxyhexadecylnonadecansyre; 9-nonyl-10-octyl-19-carbonyloxyoctadecylnonadecansyre; dihexadecyl-9-nonyl-10-octylnonadecandioat; 1-octadecyl-19-hexadecyl-9-nonyl-10-octylnonadecandioat; dioctadecyl-9-nonyl-10-octylnonadecandioat |
432-910-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-682-00-4 |
kompleks blanding af kinesisk gummiharpiks, efterfølgende behandlet med acrylsyre |
434-230-1 |
144413-22-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-683-00-X |
blanding af methyl-3-((1E)-2-methylprop-1-enyl)-2,2-dimethylcyclopropancarboxylat; methyl-3-((1Z)-2-methylprop-1-enyl)-2,2-dimethylcyclopropancarboxylat (20:80) |
435-450-0 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-684-00-5 |
alkener, C12-14, hydroformyleringsprodukter, destillationsrester, C-(hydrogensulfobutandioater), dinatriumsalte |
435-660-2 |
243662-67-1 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
607-685-00-0 |
ammonium-2-cocoyloxyethansulfonat |
441-050-7 |
— |
Skin Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
|
|
|
|
607-686-00-6 |
6,6'-bis(diazo-5,5',6,6'-tetrahydro-5,5'-dioxo)[methylen-bis(5-(6-diazo-5,6-dihydro-5-oxo-1-naphthylsulfonyloxy)-6-methyl-2-phenylen]di(naphthalen-1-sulfonat) |
441-550-5 |
— |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
607-687-00-1 |
en blanding af 2-{3,6-bis-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (2-10 %); 2-{3,6-bis-[(2,3-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (2-10 %); 2-{3,6-bis-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (2-10 %); 2-{3,6-bis-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (2-10 %); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %); 2-{3-[(2,4-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %); 2-{3-[(2,5-dimethylphenyl)-methylamino]-6-[(2-ethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2,4-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %); 2-{3-[(2,3-dimethylphenyl)-methylamino]-6-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %); 2-{3-[(2,4-dimethylphenyl)-methylamino]-6-[(2,5-dimethylphenyl)-methylamino]-xanthylium-9-yl}-benzensulfonat (7-20 %) |
442-800-6 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-688-00-7 |
(R)-1-cyclohexa-1,4-dienyl-1-methoxycarbonyl-methylammoniumchlorid |
444-320-2 |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-689-00-2 |
blanding af methyl-1,4-dimethylcyclohexancarboxylat (»para-isomer« inkl. cis- og trans-isomerer); methyl-1,3-dimethylcyclohexancarboxylat (»meta-isomer« inkl. cis- og trans-isomerer) |
444-920-4 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-690-00-8 |
dimethyl-[2S,2S']-6,6,6'6'-tetramethoxy-2,2'-[N, N'-bis(trifluoracetyl)-S,S'-bi(L-homocysteinyl) diimino]dihexanoat |
432-860-1 |
255387-46-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-691-00-3 |
magnesiumsalte, fedtsyrer, C16-18- og C18-umættede, forgrenede og lineære |
448-690-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-692-00-9 |
zinksalte, fedtsyrer, C16-18- og C18-umættede, forgrenede og lineære |
446-470-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-693-00-4 |
hexyl-2-(1-(diethylaminohydroxyphenyl)methanoyl)benzoat |
443-860-6 |
302776-68-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-694-00-X |
ethyl-5,5-diphenyl-2-isoxazolin-3-carboxylat |
443-870-0 |
163520-33-0 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-696-00-0 |
pentylformat |
211-340-6 |
638-49-3 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Dgr |
H226 H319 H335 |
|
|
C |
|
607-697-00-6 |
tert-butylpropionat |
— |
20487-40-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
C |
|
607-698-00-1 |
4-tert-butylbenzoesyre |
202-696-3 |
98-73-7 |
Repr. 1B STOT RE 1 Acute Tox. 4 |
H360F H372 H302 |
GHS07 GHS08 Dgr |
H360F H372 H302 |
|
|
|
|
607-699-00-7 |
bifenthrin (ISO); (2-methylbiphenyl-3-yl)methylrel-(1R,3R)-3-[(1Z)-2-chlor-3,3,3-trifluorprop-1-en-1-yl]-2,2-dimethylcyclopropancarboxylat |
|
82657-04-3 |
Carc. 2 Acute Tox. 3 Acute Tox. 2 STOT RE 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H300 H372 (nervesystem) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H300 H372 (nervesystem) H317 H410 |
|
M = 10 000 M = 100 000 |
|
|
607-700-00-0 |
indoxacarb (ISO); methyl (4aS)-7-chlor-2-{(methoxycarbonyl)[4-(trifluorme thoxy)phenyl]carbamoyl}-2,5- dihydroindeno[1,2-e][1,3,4]oxadiazin-4a(3H)-carboxylat [1] blanding af (S)-indoxacarb og (R)-indoxacarb 75:25; methyl 7-chlor-2-{(methoxy-carbonyl)[4-(triflourmethoxy)phenyl]-2,5-dihydroindeno[1,2-e][1,3,4]oxadiazin-4a(3H)-carboxylat |
|
173584-44-6 [1] 144171-61-9 [2] |
Acute Tox. 3 Acute Tox. 4 STOT RE 1 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H372 (blod, nervesystem, hjerte) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H372 (blod, nervesystem, hjerte) H317 H410 |
|
M = 1 M = 1 |
|
|
607-702-00-1 |
dihexylphthalat |
201-559-5 |
84-75-3 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
607-703-00-7 |
ammoniumpentadecafluoroctansyre |
223-320-4 |
3825-26-1 |
Carc. 2 Repr. 1B Lact. Acute Tox. 4 Acute Tox. 4 STOT RE 1 Eye Dam.1 |
H351 H360D H362 H332 H302 H372 (lever) H318 |
GHS08 GHS07 GHS05 Dgr |
H351 H360D H362 H332 H302 H372 (lever) H318 |
|
|
|
|
607-704-00-2 |
perfluoroctansyre |
206-397-9 |
335-67-1 |
Carc. 2 Repr. 1B Lact. Acute Tox. 4 Acute Tox. 4 STOT RE 1 Eye Dam. 1 |
H351 H360D H362 H332 H302 H372 (lever) H318 |
GHS08 GHS07 GHS05 Dgr |
H351 H360D H362 H332 H302 H372 (lever) H318 |
|
|
|
|
607-705-00-8 |
benzoesyre |
200-618-2 |
65-85-0 |
STOT RE 1 Skin Irrit. 2 Eye Dam. 1 |
H372 (lunger) (indånding) H315 H318 |
GHS08 GHS05 Dgr |
H372 (lunger) (indånding) H315 H318 |
|
|
|
|
607-706-00-3 |
methyl 2,5-dichlorbenzoat |
220-815-7 |
2905-69-3 |
Acute Tox. 4 STOT SE 3 Aquatic Chronic 2 |
H302 H336 H411 |
GHS07 GHS09 Wng |
H302 H336 H411 |
|
|
|
|
608-001-00-3 |
acetonitril; cyanmethan |
200-835-2 |
75-05-8 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H225 H332 H312 H302 H319 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 |
|
|
|
|
608-002-00-9 |
trichloracetonitril |
208-885-7 |
545-06-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
|
|
|
|
608-003-00-4 |
acrylonitril |
203-466-5 |
107-13-1 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H225 H350 H331 H311 H301 H335 H315 H318 H317 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H311 H301 H335 H315 H318 H317 H411 |
|
* |
D |
|
608-004-00-X |
2-hydroxy-2-methylpropionitril; 2-cyan-2-propanol; acetonecyanhydrin |
200-909-4 |
75-86-5 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
|
|
608-005-00-5 |
n-butyronitril |
203-700-6 |
109-74-0 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H311 H301 |
GHS02 GHS06 Dgr |
H225 H331 H311 H301 |
|
|
|
|
608-006-00-0 |
bromoxynil (ISO), 3,5-dibrom-4-hydroxybenzonitril; bromoxynil-phenol |
216-882-7 |
1689-84-5 |
Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H330 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d *** H330 H301 H317 H410 |
|
M = 10 |
|
|
608-007-00-6 |
ioxynil (ISO); 4-hydroxy-3,5-diiodbenzonitril |
216-881-1 |
1689-83-4 |
Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H331 H301 H312 H373 ** H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d *** H331 H301 H312 H373 ** H319 H410 |
|
M = 10 |
|
|
608-008-00-1 |
chloracetonitril |
203-467-0 |
107-14-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
|
|
|
|
608-009-00-7 |
malononitril |
203-703-2 |
109-77-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
608-010-00-2 |
methacrylnitril; 2-methyl-2-propennitril |
204-817-5 |
126-98-7 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 |
H225 H331 H311 H301 H317 |
GHS02 GHS06 Dgr |
H225 H331 H311 H301 H317 |
|
* Skin Sens. 1; H317: C ≥ 0,2 % |
D |
|
608-011-00-8 |
oxalonitril; cyanogen |
207-306-5 |
460-19-5 |
Press. Gas Flam. Gas 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U |
|
608-012-00-3 |
benzonitril |
202-855-7 |
100-47-0 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
608-013-00-9 |
2-chlorbenzonitril |
212-836-5 |
873-32-5 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H312 H302 H319 |
GHS07 Wng |
H312 H302 H319 |
|
|
|
|
608-014-00-4 |
chlorothalonil (ISO); tetrachlorisophthalonitril |
217-588-1 |
1897-45-6 |
Carc. 2 Acute Tox. 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H335 H318 H317 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H330 H335 H318 H317 H410 |
|
M = 10 |
|
|
608-015-00-X |
dichlobenil (ISO); 2,6-dichlorbenzonitril |
214-787-5 |
1194-65-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H312 H411 |
GHS07 GHS09 Wng |
H312 H411 |
|
|
|
|
608-016-00-5 |
1,4-dicyano-2,3,5,6-tetra-chlor-benzen |
401-550-8 |
1897-41-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
608-017-00-0 |
bromoxynil-octanoat (ISO); 2,6-dibrom-4-cyanophenyloctanoat |
216-885-3 |
1689-99-2 |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H331 H302 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d *** H331 H302 H317 H410 |
|
M = 10 |
|
|
608-018-00-6 |
ioxynil-octanoat (ISO); 4-cyan-2,6-diiodophenyloctanoat |
223-375-4 |
3861-47-0 |
Repr. 2 Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d *** H301 H319 H317 H410 |
|
M = 10 |
|
|
608-019-00-1 |
2,2'-dimethyl-2,2'-azodipropiononitril; ADZN |
201-132-3 |
78-67-1 |
Self-react. C Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H242 H332 H302 H412 |
GHS02 GHS07 Dgr |
H242 H332 H302 H412 |
|
|
T |
|
608-020-00-7 |
diphenoxymethylencyanamid |
427-300-8 |
79463-77-7 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
608-021-00-2 |
3-(2-(diaminomethylenamino)thiazol-4-ylmethylthio)propiononitril |
403-710-2 |
76823-93-3 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
608-022-00-8 |
3,7-dimethyloctannitril |
403-620-3 |
40188-41-8 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
608-023-00-3 |
fenbuconazol (ISO); 4-(4-chlorphenyl)-2-phenyl-2-[(1H-1,2,4-triazol-1-yl)methyl]butannitril |
406-140-2 |
114369-43-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-024-00-9 |
2-(4-(N-butyl-N-phenethylamino)phenyl)ethen-1,1,2-tricarbonitril |
407-650-8 |
97460-76-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
608-025-00-4 |
2-nitro-4,5-bis(benzyloxy)phenylacetonitril |
410-970-0 |
117568-27-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
608-026-00-X |
3-cyano-3,5,5-trimethylcyclohexanon |
411-490-4 |
04-11-7027 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 ** H317 H412 |
GHS08 GHS07 Wng |
H302 H373 ** H317 H412 |
|
|
|
|
608-027-00-5 |
en blanding af 3-(4-ethylphenyl)-2,2-dimethylpropannitril; 3-(2-ethylphenyl)-2,2-dimethylpropannitril; 3-(3-ethylphenyl)-2,2-dimethylpropannitril |
412-660-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
608-028-00-0 |
4-(2-cyano-3-phenylamino)-acryloyloxy-methyl-cyclohexyl-methyl-2-cyano-3-phenylamino)-acrylat |
413-510-7 |
147374-67-2 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373 ** H317 H411 |
GHS08 GHS09 Wng |
H373 ** H317 H411 |
|
|
|
|
608-029-00-6 |
1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-3-pyridincarbonitril |
411-990-2 |
68612-94-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
608-030-00-1 |
N-acetyl-N-[5-cyano-3-(2-dibutylamino-4-phenylthiazol-5-yl-methylen)-4-methyl-2,6-dioxo-1,2,3,6-tetrahydropyridin-1-yl]benzamid |
412-340-0 |
147741-93-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-031-00-7 |
2-benzyl-2-methyl-3-butenitril |
407-870-4 |
97384-48-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
608-032-00-2 |
acetamiprid (ISO); (E)-N1-[(6-chlor-3-pyridyl)methyl]-N2-cyan-N1-methylacetamidin |
— |
135410-20-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
608-033-00-8 |
N-butyl-3-(2-chlor-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-en-1,3-dicarboximid |
407-970-8 |
75511-91-0 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
608-034-00-3 |
chlorfenapyr (ISO); 4-brom-2-(4-chlorphenyl)-1-ethoxymethyl-5-trifluormethylpyrrol-3-carbonitril |
— |
122453-73-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
|
M = 100 |
|
|
608-035-00-9 |
(±)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorbenzen-aceto-nitril |
419-290-9 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
608-036-00-4 |
3-(2-{4-[2-(4-cyanophenyl)vinyl]phenyl}vinyl)benzonitril |
419-060-8 |
79026-02-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
608-037-00-X |
en blanding af (E)-2,12-tridecadiennitril; (E)-3,12-tridecadiennitril; (Z)-3,12-tridecadiennitril |
422-190-8 |
|
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-038-00-5 |
2,2,4-trimethyl-4-phenyl-butannitril |
422-580-8 |
75490-39-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
608-039-00-0 |
2-phenylhexannitril |
423-460-8 |
3508-98-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
608-040-00-6 |
4,4'-dithiobis(5-amino-1-(2,6-dichlor-4-(trifluormethyl)phenyl)-1H-pyrazol-3-carbonitril) |
423-490-1 |
130755-46-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-041-00-1 |
4'-((2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl)(1,1'-biphenyl)-2-carbonitril |
423-500-4 |
138401-24-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-042-00-7 |
(S)-2,2-diphenyl-2-(3-pyrrolidinyl)acetonitrilhydrobromid |
421-810-4 |
194602-27-2 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
608-043-00-2 |
3-(cis-3-hexenyloxy)propannitril |
415-220-6 |
142653-61-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H410 |
|
|
|
|
608-044-00-8 |
2-cyclohexyliden-2-phenylacetonitril |
423-740-1 |
10461-98-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
608-046-00-9 |
5-(4-chlor-2-nitro-phenylazo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-pyridin-3-carbonitril |
425-310-7 |
77889-90-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
608-047-00-4 |
2-piperidin-1-yl-benzonitril |
427-330-1 |
72752-52-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
608-048-00-X |
1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxo-cyclohexancarbonitril |
427-450-4 |
152630-47-2 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H411 |
|
|
|
|
608-049-00-5 |
2-(4-(4-(butyl-(1-methylhexyl)amino)phenyl)-3-cyan-5-oxo-1,5-dihydropyrrol-2-yliden)propandinitril |
429-180-2 |
157362-53-3 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
608-050-00-0 |
en blanding af 5-(2-cyan-4-nitrophenylazo)-2-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-6-phenylamino-nicotinonitril og 5-(2-cyan-4-nitrophenylazo)-6-(2-(2-hydroxyethoxy)ethylamino)-4-methyl-2-phenylamino-nicotinonitril |
429-760-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
608-051-00-6 |
(R)-4-(4-dimethylamino-1-(4-fluorphenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitril |
430-760-2 |
219861-18-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
608-052-00-1 |
(S)-4-(4-dimethylamino-1-(4-fluorphenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitril |
430-770-7 |
128173-52-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
608-053-00-7 |
(R,S)-4-(4-dimethylamino-1-(4-fluorphenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitril |
430-780-1 |
103146-25-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
608-054-00-2 |
(R,S)-4-(4-dimethylamino-1-(4-fluorphenyl)-1-hydroxybutyl)-3-(hydroxymethyl)benzonitril hemisulfat |
430-790-6 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
608-056-00-3 |
N-methyl-N-cyanmethylmorpholinium-methylsulfat |
429-340-1 |
— |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
608-057-00-9 |
4-cyanmethyl-4-methylmorpholin-4-ium-hydrogensulfat |
431-200-1 |
208538-34-5 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
608-058-00-4 |
esfenvalerat (ISO); (S)-α-cyan-3-phenoxybenzyl-(S)-2-(4-chlorphenyl)-3-methylbutyrat |
— |
66230-04-4 |
Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H317 H410 |
|
M = 10 000 |
|
|
608-059-00-X |
5-amino-1-(2,6-dichlor-4-(trifluormethyl)phenyl)-1H-pyrazol-3-carbonitril |
421-240-6 |
120068-79-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
608-060-00-5 |
5-methyl-2-[(2-nitrophenyl)amino]-3-thiophencarbonitril |
421-300-1 |
138564-59-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
608-062-00-6 |
2-fluor-4-hydroxybenzonitril |
422-810-7 |
82380-18-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
608-063-00-1 |
(S)-α-hydroxy-3-phenoxy-benzenacetonitril |
441-070-6 |
61826-76-4 |
Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
|
|
|
|
608-064-00-7 |
cyanmethyltrimethylammoniummethylsulfat |
433-720-2 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
608-065-00-2 |
salte af bromoxynil undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361D *** H330 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361D *** H330 H301 H317 H410 |
|
M = 10 |
A |
|
608-066-00-8 |
salte af ioxynil undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361D *** H331 H301 H312 H373 ** H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361D *** H331 H301 H312 H373 ** H319 H410 |
|
M = 10 |
A |
|
609-001-00-6 |
1-nitropropan |
203-544-9 |
108-03-2 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H 226 H332 H312 H302 |
|
* |
|
|
609-002-00-1 |
2-nitropropan |
201-209-1 |
79-46-9 |
Flam. Liq. 3 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H226 H350 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H350 H332 H302 |
|
|
|
|
609-003-00-7 |
nitrobenzen |
202-716-0 |
98-95-3 |
Carc. 2. Repr. 1B Acute Tox. 3 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Aquatic Chronic 3 |
H351 H360F H301 H331 H311 H372 (blod) H412 |
GHS06 GHS08 Dgr |
H351 H360F H301 H331 H311 H372 (blod) H412 |
|
|
|
|
609-004-00-2 |
dinitrobenzen; [1] 1,4-dinitrobenzen; [2] 1,3-dinitrobenzen; [3] 1,2-dinitrobenzen; [4] |
246-673-6 [1] 202-833-7 [2] 202-776-8 [3] 208-431-8 [4] |
25154-54-5 [1] 100-25-4 [2] 99-65-0 [3] 528-29-0 [4] |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
|
|
|
609-005-00-8 |
1,3,5-trinitrobenzen |
202-752-7 |
99-35-4 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H330 H310 H300 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H410 |
|
|
|
|
609-006-00-3 |
4-nitrotoluen |
202-808-0 |
99-99-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
|
|
|
609-007-00-9 |
2,4-dinitrotoluen; [1] dinitrotoluen [2] |
204-450-0 [1] 246-836-1 [2] |
121-14-2 [1] 25321-14-6 [2] |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361f *** H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H410 |
|
|
|
|
609-008-00-4 |
2,4,6-trinitrotoluen; TNT |
204-289-6 |
118-96-7 |
Expl. 1,1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H201 H331 H311 H301 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H411 |
|
|
|
|
609-009-00-X |
2,4,6-trinitrophenol; picrinsyre |
201-865-9 |
88-89-1 |
Expl. 1,1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H201 H331 H311 H301 |
GHS01 GHS06 Dgr |
H201 H331 H311 H301 |
|
|
|
|
609-010-00-5 |
picrinsyrens salte |
— |
— |
Unst. Expl Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H201 H331 H311 H301 |
GHS01 GHS06 Dgr |
H201 H331 H311 H301 |
|
|
T |
|
609-011-00-0 |
2,4,6-trinitroanisol |
— |
606-35-9 |
Expl. 1,1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H201 H332 H312 H302 H411 |
GHS01 GHS07 GHS09 Wng |
H201 H332 H312 H302 H411 |
|
|
|
|
609-012-00-6 |
2,4,6-trinitro-m-cresol |
210-027-1 |
602-99-3 |
Expl. 1,1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Wng |
H201 H332 H312 H302 |
|
|
|
|
609-013-00-1 |
2,4,6-trinitro-m-xylen |
211-187-5 |
632-92-8 |
Expl. 1,1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H201 H332 H312 H302 H373 ** |
GHS01 GHS08 GHS07 Wng |
H201 H332 H312 H302 H373 ** |
|
|
|
|
609-015-00-2 |
4-nitrophenol; p-nitrophenol |
202-811-7 |
100-02-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H332 H312 H302 H373 ** |
GHS08 GHS07 Wng |
H332 H312 H302 H373 ** |
|
|
|
|
609-016-00-8 |
dinitrophenol, (blanding af isomerer); [1] 2,4(eller 2,6)-dinitrophenol [2] |
247-096-2 [1] 275-732-9 [2] |
25550-58-7 [1] 71629-74-8 [2] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
|
|
609-018-00-9 |
2,4,6-trinitroresorcinol styphninsyre |
201-436-6 |
82-71-3 |
Expl. 1,1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 |
|
|
|
|
609-019-00-4 |
bly-2,4,6-trinitro-m-phenylendioxid; bly-2,4,6-trinitroresorcinoxid; blystyphnat |
239-290-0 |
15245-44-0 |
Unst. Expl Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
609-019-01-1 |
bly-2,4,6-trinitro-m-phenylendioxid; bly-2,4,6-trinitroresorcinoxid; blystyphnat (≥ 20 % flegmatiseret) |
239-290-0 |
15245-44-0 |
Expl. 1,1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
609-020-00-X |
DNOC (ISO); 4,6-dinitro-o-cresol |
208-601-1 |
534-52-1 |
Muta. 2 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H310 H300 H315 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H330 H310 H300 H315 H318 H317 H410 |
EUH044 |
|
|
|
609-021-00-5 |
DNOC-Na; natrium 4,6-dinitro-o-cresolat; [1] DNOC-K; kalium 4,6-dinitro-o-cresolat [2] |
219-007-7 [1] - [2] |
2312-76-7 [1] 5787-96-2 [2] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
|
|
609-022-00-0 |
DNOC-ammonium; ammonium 4,6-dinitro-o-tolyloxid |
221-037-0 |
2980-64-5 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
|
|
|
609-023-00-6 |
dinocap (ISO); (RS)-2,6-dinitro-4-octylphenylcrotonater og (RS)-2,4-dinitro-6-octylphenylcrotonater, hvori »octyl« er en blanding af 1-methylheptyl-, 1-ethylhexyl- og 1-propylpentylgrupper |
254-408-0 |
39300-45-3 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H332 H302 H373 ** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D *** H332 H302 H373 ** H315 H317 H410 |
|
M = 100 |
|
|
609-024-00-1 |
binapacryl (ISO); 2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonat |
207-612-9 |
485-31-4 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D *** H312 H302 H410 |
|
|
|
|
609-025-00-7 |
dinoseb(ISO); 6-sec-butyl-2,4-dinitrophenol |
201-861-7 |
88-85-7 |
Repr. 1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H311 H301 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H311 H301 H319 H410 |
EUH044 |
|
|
|
609-026-00-2 |
salte og estere af dinoseb, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Repr. 1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H311 H301 H319 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H311 H301 H319 H410 |
EUH044 |
|
A |
|
609-027-00-8 |
dinocton blanding af isomerer: methyl 2-octyl-4,6-dinitrophenylcarbonat og methyl 4-octyl-2,6- dinitrophenylcarbonat |
— |
63919-26-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
609-028-00-3 |
dinex (ISO); 2-cyclohexyl-4,6-dinitrophenol |
205-042-5 |
131-89-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
609-029-00-9 |
salte og estere af dinex |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
A |
|
609-030-00-4 |
dinoterb (ISO); 2-tert-butyl-4,6-dinitrophenol |
215-813-8 |
1420-07-1 |
Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D *** H300 H311 H410 |
EUH044 |
|
|
|
609-031-00-X |
salte og estere af dinoterb |
— |
— |
Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D *** H300 H311 H410 |
|
|
A |
|
609-032-00-5 |
bromophenoxim (ISO); 3,5-dibrom-4-hydroxybenzaldehyd-O-(2,4-dinitrophenyl)-oxim |
236-129-6 |
13181-17-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
609-033-00-0 |
dinosam (ISO); 2-(1-methyl-n-butyl)-4,6-dinitrophenol |
— |
4097-36-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
609-034-00-6 |
salte og estere af dinosam |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
A |
|
609-035-00-1 |
nitroethan |
201-188-9 |
79-24-3 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
|
* |
|
|
609-036-00-7 |
nitromethan |
200-876-6 |
75-52-5 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
|
* |
|
|
609-037-00-2 |
5-nitroacenaphthen |
210-025-0 |
602-87-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
609-038-00-8 |
2-nitronaphthalen |
209-474-5 |
581-89-5 |
Carc. 1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
|
|
|
|
609-039-00-3 |
4-nitrobiphenyl |
202-204-7 |
92-93-3 |
Carc. 1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
|
|
|
|
609-040-00-9 |
nitrofen (ISO); 2,4-dichlorphenyl-4-nitrophenylether |
217-406-0 |
1836-75-5 |
Carc. 1B Repr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360D *** H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H360D *** H302 H410 |
|
|
|
|
609-041-00-4 |
2,4-dinitrophenol |
200-087-7 |
51-28-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H311 H301 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H400 |
|
|
|
|
609-042-00-X |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidin |
254-938-2 |
40487-42-1 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
609-043-00-5 |
quintozen (ISO); pentachlornitrobenzen |
201-435-0 |
82-68-8 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
609-044-00-0 |
tecnazen (ISO) 1,2,4,5-tetrachlor-3-nitrobenzen |
204-178-2 |
117-18-0 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
609-045-00-6 |
en blanding af 4,6-dinitro-2-(3-octyl)phenylmethylcarbonat og 4,6-dinitro-2-(4-octyl)phenylmethylcarbonat og dinocton-6 |
— |
8069-76-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
609-046-00-1 |
trifluralin (ISO) (indeholdende < 0,5 ppm NPDA); α, α,α-trifluor-2,6-dinitro-N, N-dipropyl-p-toluidin (indeholdende < 0,5 ppm NPDA); 2,6-dinitro-N, N-dipropyl-4-trifluormethylanilin (indeholdende < 0,5 ppm NPDA); N, N-dipropyl-2,6-dinitro-4-trifluormethylanilin (indeholdende < 0,5 ppm NPDA) |
216-428-8 |
1582-09-8 |
Carc. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H317 H410 |
|
M = 10 |
|
|
609-047-00-7 |
2-nitroanisol |
202-052-1 |
91-23-6 |
Carc. 1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
|
|
609-048-00-2 |
natrium-3-nitrobenzensulfonat |
204-857-3 |
127-68-4 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
609-049-00-8 |
2,6-dinitrotoluen |
210-106-0 |
606-20-2 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
|
|
|
|
609-050-00-3 |
2,3-dinitrotoluen |
210-013-5 |
602-01-7 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361f *** H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H410 |
|
|
|
|
609-051-00-9 |
3,4-dinitrotoluen |
210-222-1 |
610-39-9 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
|
|
|
|
609-052-00-4 |
3,5-dinitrotoluen |
210-566-2 |
618-85-9 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H412 |
|
|
|
|
609-053-00-X |
hydrazin (trinitromethan) |
414-850-9 |
— |
Expl. 1,1 **** Self-react. A Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 |
H201 H240 H350 H331 H301 H317 |
GHS01 GHS06 GHS08 Dgr |
H201 H240 H350 H331 H301 H317 |
|
|
|
|
609-054-00-5 |
2,3-dinitrophenol; [1] 2,5-dinitrophenol; [2] 2,6-dinitrophenol; [3] 3,4-dinitrophenol; [4] salte af dinitrophenol [5] |
200-628-7 [1] 206-348-1 [2] 209-357-9 [3] 209-415-3 [4]-[5] |
66-56-8 [1] 329-71-5 [2] 573-56-8 [3] 577-71-9 [4]-[5] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
|
|
|
609-055-00-0 |
2,5-dinitrotoluen |
210-581-4 |
619-15-8 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H331 H311 H301 H373 ** H411 |
|
|
|
|
609-056-00-6 |
2,2-dibrom-2-nitroethanol |
412-380-9 |
69094-18-4 |
Expl. 1,1 Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H351 H302 H373 ** H314 H317 H400 H410 |
GHS01 GHS08 GHS05 GHS07 GHS09 Dgr |
H201 H351 H302 H373 ** H314 H317 H410 |
|
* STOT SE 3; H335: C ≥ 1 % |
T |
|
609-057-00-1 |
3-chlor-2,4-difluornitrobenzen |
411-980-8 |
3847-58-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
|
|
|
|
609-058-00-7 |
2-nitro-2-phenylpropan-1,3-diol |
410-360-4 |
5428-02-4 |
STOT RE 1; Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H372 ** H312 H302 H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H312 H302 H317 H411 |
EUH070 |
|
|
|
609-059-00-2 |
2-chlor-6-(ethylamino)-4-nitrophenol |
411-440-1 |
131657-78-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
609-060-00-8 |
4-[(3-hydroxypropyl)amino]-3-nitrophenol |
406-305-9 |
92952-81-3 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
609-061-00-3 |
(E,Z)-4-chlorphenyl(cyclopropyl)keton-O-(4-nitrophenylmethyl)oxim |
406-100-4 |
94097-88-8 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
609-062-00-9 |
2-brom-2-nitropropanol |
407-030-7 |
24403-04-1 |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H373 ** H314 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H311 H302 H373 ** H314 H317 H410 |
|
|
|
|
609-063-00-4 |
2-[(4-chlor-2-nitrophenyl)amino]ethanol |
413-280-8 |
59320-13-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
609-064-00-X |
mesotrion (ISO); 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexandion |
— |
104206-82-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
609-065-00-5 |
2-nitrotoluen |
201-853-3 |
88-72-2 |
Carc. 1B Muta. 1B Repr. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H350 H340 H361f *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H361f *** H302 H411 |
|
|
|
|
609-066-00-0 |
lithium natrium 3-amino-10-{4-(10-amino-6,13-dichlor-4,11-disulfonatobenzo[5,6][1,4]oxazino[2,3-b]phenoxazin-3-ylamino)-6-[methyl(2-sulfonato-ethyl)amino]-1,3,5-triazin-2-ylamino}-6,13-dichlorbenzo[5,6][1,4]oxazino[2,3-b]phenoxazin-4,11-disulfonat |
418-870-9 |
154212-58-5 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 2 ** |
H332 H312 H302 H371 ** |
GHS08 GHS07 Dgr |
H332 H312 H302 H371 ** |
|
|
|
|
609-067-00-6 |
natrium- og kalium-4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazin |
416-280-6 |
156769-97-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
609-068-00-1 |
moskusxylen; 5-tert-butyl-2,4,6-trinitro-m-xyleno |
201-329-4 |
81-15-2 |
Expl. 1,1 Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H351 H400 H410 |
GHS01 GHS08 GHS09 Wng |
H201 H351 H410 |
|
|
T |
|
609-069-00-7 |
moskusketon; 3,5-dinitro-2,6-dimethyl-4-tert-butylacetophenon; 4'-tert-butyl-2',6'-dimethyl-3', 5'-dinitroacetophenon |
201-328-9 |
81-14-1 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
609-070-00-2 |
1,4-dichlor-2-(1,1,2,3,3,3-hexafluorpropoxy)-5-nitrobenzen |
415-580-4 |
130841-23-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
609-071-00-8 |
en blanding af 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazin og 2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol |
423-520-3 |
156137-33-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
609-072-00-3 |
4-mesyl-2-nitrotoluen |
430-550-0 |
1671-49-4 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H361f *** H302 H317 H412 |
GHS08 GHS07 Wng |
H361f *** H302 H317 H412 |
|
|
|
|
609-073-00-9 |
lithium-kalium-natrium-N, N''-bis(6-(7-(4-(4-chlor-1,3,5-triazin-2-yl)amino)-4-(2-ureidophenylazo))naphthalen-1,3,6-trisulfonato)-N'-(2-aminoethyl)piperazin |
427-850-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
610-001-00-3 |
trichlornitromethan; chlorpicrin |
200-930-9 |
76-06-2 |
Acute Tox. 2 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H330 H302 H319 H335 H315 |
GHS06 Dgr |
H330 H302 H319 H335 H315 |
|
|
|
|
610-002-00-9 |
1,1-dichlor-1-nitroethan |
209-854-0 |
594-72-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
610-003-00-4 |
chlordinitrobenzen |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
C |
|
610-004-00-X |
2-chlor-1,3,5-trinitrobenzen |
201-864-3 |
88-88-0 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H330 H310 H300 H400 H410 |
GHS01 GHS06 GHS09 Dgr |
H201 H330 H310 H300 H410 |
|
|
|
|
610-005-00-5 |
1-chlor-4-nitrobenzen |
202-809-6 |
100-00-5 |
Carc. 2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H351 H341 H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H331 H311 H301 H373 ** H411 |
|
|
|
|
610-006-00-0 |
chlornitroaniliner undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H310 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H411 |
|
|
A C |
|
610-007-00-6 |
1-chlor-1-nitropropan |
209-990-0 |
600-25-9 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
|
610-008-00-1 |
2,6-dichlor-4-nitroanisol |
403-350-6 |
17742-69-7 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
610-009-00-7 |
2-chlor-4-nitroanilin |
204-502-2 |
121-87-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
610-010-00-2 |
2-(2-brom-2-nitroethenyl)furan |
406-110-9 |
35950-52-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
|
611-001-00-6 |
azobenzen |
203-102-5 |
103-33-3 |
Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H332 H302 H373 ** H410 |
|
|
|
|
611-002-00-1 |
azoxybenzen |
207-802-1 |
495-48-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
611-003-00-7 |
fenaminosulf (ISO); natrium-4-dimethylaminobenzendiazosulfonat |
205-419-4 |
140-56-7 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 3 |
H301 H312 H412 |
GHS06 Dgr |
H301 H312 H412 |
|
|
|
|
611-004-00-2 |
(methyl-ONN-azoxy)methylacetat; (methylazoxymethyl)acetat |
209-765-7 |
592-62-1 |
Carc. 1B Repr. 1B |
H350 H360D *** |
GHS08 Dgr |
H350 H360D *** |
|
|
|
|
611-005-00-8 |
dinatrium-{5-[(4'-((2,6-dihydroxy-3-((2-hydroxy-5-sulfophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}cuprat(2-); CI Direct Brown 95 |
240-221-1 |
16071-86-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
611-006-00-3 |
4-o-tolylazo-o-toluidin; 4-amino-2',3-dimethylazobenzen; fast garnet GBC base; AAT; o-aminoazotoluen |
202-591-2 |
97-56-3 |
Carc. 1B Skin Sens. 1 |
H350 H317 |
GHS08 Dgr |
H350 H317 |
|
|
|
|
611-007-00-9 |
tricyclazol (ISO); 5-methyl-1,2,4-triazolo(3,4-b)benzo-1,3-thiazol |
255-559-5 |
41814-78-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
611-008-00-4 |
4-aminoazobenzen; 4-phenylazoanilin |
200-453-6 |
60-09-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
611-009-00-X |
natrium-(1-(5-(4-(4-anilino-3-sulfophenylazo)-2-methyl-5-methylsulfonamidophenylazo)-4-hydroxy-2-oxido-3-(phenylazo)phenylazo)-5-nitro-4-sulfonato-2-naphtholato)jern(II) |
401-220-3 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
|
|
|
|
611-010-00-5 |
2'-(2-cyan-4,6-dinitrophenylazo)-5'-(N, N-dipropylamino)propionanilid |
403-010-7 |
106359-94-8 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
611-011-00-0 |
N, N,N',N'-tetramethyl-3,3'-(propylenbis(iminocarbonyl-4,1-phenylenazo(1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3,1-diyl)))di(propylammonium)dilactat |
403-340-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-012-00-6 |
blanding af 2-methylaminoethanol-6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonat og N, N-diethylpropan-1,3-diamin-6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonat og 2,2-iminodiethanol-6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonat |
403-410-1 |
114565-65-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-013-00-1 |
trilithium-1-hydroxy-7-(3-sulfonatoanilino)-2-(3-methyl-4-(2-methoxy-4-(3-sulfonatophenylazo)phenylazo)phenylazo)naphthalen-3-sulfonat |
403-650-7 |
117409-78-6 |
Expl. 1,3 **** Aquatic Chronic 2 |
H203 H411 |
GHS01 GHS09 Dgr |
H203 H411 |
|
|
|
|
611-014-00-7 |
(tetranatrium-1-(4-(3-acetamido-4-(4'-nitro-2,2'-disulfonatostilben-4-ylazo)anilino)-6-(2,5-disulfonatoanilino)-1,3,5-triazin-2-yl)-3-carboxypyridinium)hydroxid |
404-250-5 |
115099-55-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-015-00-2 |
tetranatrium-4-amino-5-hydroxy-6-(3-(2-(2-(sulfonatooxy)ethylsulfonyl)ethylcarbamoyl)phenylazo)-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalen-2,7-disulfonat |
404-320-5 |
116889-78-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-016-00-8 |
blanding af; 1-(1-(3-dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylaminopropyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridinio-3-pyridylazo)phenylazo)-2,4(eller2,6 eller3,5)-dihydroxyphenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridiniumdichlo og 1,1'-((dihydroxyphenylen)bis(azo-3,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridin-5,3-diyl)))dipyridiniumdichlorid, dihydrochlorid, blanding af isomerer |
404-540-1 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-017-00-3 |
2-(4-(diethylaminopropylcarbamoyl)phenylazo)-3-oxo-N-(2,3-dihydro-2-oxobenzimidazol-5-yl)butyramid |
404-910-2 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-018-00-9 |
tetraammonium-5-(4-(7-amino-1-hydroxy-3-sulfonato-2-naphthylazo)-6-sulfonato-1-naphthylazo)isophthalat |
405-130-5 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-019-00-4 |
tetralithium-6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalen-2,7-disulfonat |
405-150-4 |
106028-58-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-020-00-X |
tetrakis(tetramethylammonium)- 6-amino-4-hydroxy-3-(7-sulfonato-4-(4-sulfonatophenylazo)-1-naphthylazo)naphthalen-2,7-disulfonat |
405-170-3 |
116340-05-7 |
Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H317 H412 |
GHS06 Dgr |
H301 H317 H412 |
|
|
|
|
611-021-00-5 |
2-(4-(4-cyan-3-methylisothiazol-5-ylazo)-N-ethyl-3-methylanilino)ethylacetat |
405-480-9 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 4 |
H302 H373 ** H315 H413 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H413 |
|
|
|
|
611-022-00-0 |
4-dimethylaminobenzendiazonium-3-carboxy-4-hydroxybenzensulfonat |
404-980-4 |
— |
Self-react. C Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H331 H301 H312 H373 ** H318 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H242 H331 H301 H312 H373 ** H318 H317 H410 |
|
|
T |
|
611-023-00-6 |
dinatrium-7-(4,6-dichlor-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo) naphthalen-2-sulfonat |
404-600-7 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-024-00-1 |
benzidinbaserede azofarvestoffer; 4,4'-diarylazobiphenyl farvestoffer, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
A |
|
611-025-00-7 |
dinatrium-4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphthalen-2,7-disulfonat; C.I. Direct Black 38 |
217-710-3 |
1937-37-7 |
Carc. 1B Repr. 2 |
H350 H361D *** |
GHS08 Dgr |
H350 H361D *** |
|
|
|
|
611-026-00-2 |
tetranatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalen-2,7-disulfonat]; C.I. Direct Blue 6 |
220-012-1 |
2602-46-2 |
Carc. 1B Repr. 2 |
H350 H361D *** |
GHS08 Dgr |
H350 H361D *** |
|
|
|
|
611-027-00-8 |
dinatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalen-1-sulfonat); C.I. Direct Red 28 |
209-358-4 |
573-58-0 |
Carc. 1B Repr. 2 |
H350 H361D *** |
GHS08 Dgr |
H350 H361D *** |
|
|
|
|
611-028-00-3 |
C, C'-azodi(formamid) |
204-650-8 |
123-77-3 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
G |
|
611-029-00-9 |
o-dianisidin azobaserede farvestoffer; 4,4-diarylazo-3,3'dimethoxybiphenyl farvestoffer, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
A |
|
611-030-00-4 |
4,4'-bi-o-toluidin baserede azofarvestoffer, undtagen sådanne nævnt andetsteds i dette bilag; 4,4'-diarylazo-3,3'dimethylbiphenyl farvestoffer, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
A |
|
611-031-00-X |
4,4'-(4-iminocyclohexa-2,5-dienylidenmethylen)dianilinhydrochlorid; C.I. Basic Red 9 |
209-321-2 |
569-61-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
611-032-00-5 |
1,4,5,8-tetraaminoanthra- quinon; C.I. Disperse Blue 1 |
219-603-7 |
2475-45-8 |
Carc. 1B Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H350 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H315 H318 H317 |
|
|
|
|
611-033-00-0 |
hexanatrium-[4,4''-azoxybis(2,2'-disulfonatostilben-4,4'-diylazo)]-bis[5'-sulfonatobenzen-2,2'-diolato-O(2),O(2),N(1)]-kobber(II) |
400-020-3 |
82027-60-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-034-00-6 |
N-(5-(bis(2-methoxyethyl)amino)-2-((5-nitro-2,1-benzisothiazol-3-yl)azo)phenylacetamid |
402-430-8 |
105076-77-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-035-00-1 |
tetralithium-6-amino-4-hydroxy-3-[7-sulfonato-4-(5-sulfonato-2-naphthylazo)-1-naphthylazo]naphthalen-2,7-disulfonat |
403-660-1 |
107246-80-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-036-00-7 |
2-(4-(5,6(eller 6,7)-dichlor-1,3-benzothiazol-2-ylazo)-N-methyl-m-toluidino)ethylacetat |
405-440-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-037-00-2 |
3(eller 5)-(4-(N-benzyl-N-ethylamino)-2-methylphenylazo)-1,4-dimethyl-1,2,4-triazoliummethylsulfat |
406-055-0 |
124584-00-5 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
611-038-00-8 |
trinatrium-1-hydroxynaphthalen-2-azo-4'(5',5''-dimethylbiphenyl)-4''-azo(4''-phenylsulfonyloxybenzen)-2',2'',4-trisulfonat |
406-820-9 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
611-039-00-3 |
7-[((4,6-dichlor-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(4-((2-sulfoxy)ethyl)sulfonyl)phenylazo]naphthalen-2-sulfonsyre |
407-050-6 |
117715-57-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-040-00-9 |
3-(5-acetamido-4-(4-[4,6-bis(3-diethylaminopropylamino)-1,3,5-triazin-2-ylamino]phenylazo)-2-(2-methoxyethoxy)phenylazo)-6-amino-4-hydroxy-2-naphthalensulfonsyre |
407-670-7 |
115099-58-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
611-041-00-4 |
2-[[4[[4,6-bis[[3-(diethylamino)propyl]amino]-1,3,5-triazin-2-yl]amino]phenyl]azo]-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxobutanamid |
407-680-1 |
98809-11-1 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
611-042-00-X |
trinatrium-5-amino-3-[5-(2-bromacryloylamino)-2-sulfonatophenylazo]-4-hydroxy-6-(4-vinylsulfonylphenylazo)naphthalen-2,7-disulfonat |
411-770-6 |
136213-71-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-043-00-5 |
blanding (2:1:1) af trinatrium-N(1')-N(2):N(1''')-N(2'')-η-6-[2-amino-4(eller 6)-hydroxy-(eller 4-amino-2-hydroxy)phenylazo]-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalen-2,1'-azobenzen-1,2'-diolato-O(1),O(2'))-chromat; trinatrium-N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonato bis(naphthalen-2,1'-azobenzen-1,2'-diolato-O(1),O(2'))-chromat; trinatrium-N(1')-N(2):N(1''')-N(2'')-η-6,6''-bis[2-amino-4-(eller 6)-hydroxy-(eller 4-amino-2-hydroxy)phenylazo]-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalen-2,1'-azobenzen-1,2'-diolato-O(1),O(2'))-chromat |
402-850-1 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-044-00-0 |
en blanding af tert-alkyl(C12-C14)ammoniumbis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromat(1-); tert-alkyl(C12-C14)ammonium-bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]chromat(1-); tert-alkyl(C12-C14)ammoniumbis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]chromat(1-); tert-alkyl(C12-C14)ammonium-[[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]chromat(1-); tert-alkyl(C12-C14)ammonium-[[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]chromat(1-); C12-14-tert-alkylammonium ((1-(4(eller 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromat(1-) |
403-720-7 |
117527-94-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-045-00-6 |
2-[4-[N-(4-acetoxybutyl)-N-ethyl]amino-2-methylphenylazo]-3-acetyl-5-nitrothiophen |
404-830-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-046-00-1 |
4,4'-diamino-2-methylazobenzen |
407-590-2 |
43151-99-1 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H410 |
|
|
|
|
611-047-00-7 |
en blanding af 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorbenzothiazol og 2-[[4-[N-ethyl-N-(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorbenzothiazol |
407-890-3 |
111381-11-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-048-00-2 |
en blanding (1:1) af 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-5,6-dichlorbenzothiazol og 2-[[4-[bis(2-acetoxyethyl)amino]phenyl]azo]-6,7-dichlorbenzothiazol |
407-900-6 |
111381-12-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-049-00-8 |
en blanding af 7-[4-(3-diethylaminopropylamino)-6-(3-diethylammoniopropylamino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-phenylazophenylazo)naphthalen-2-sulfonat, eddikesyre, malkesyre (2:1:1) |
408-000-6 |
118658-98-3 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H317 H412 |
GHS08 Wng |
H373 ** H317 H412 |
|
|
|
|
611-050-00-3 |
en blanding af pentanatrium -3-(4-(4-(7-(2,4-diamino-5-sulfonato-3-(4-sulfonatophenylazo)phenylazo)-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-2-sulfonatophenylamino)phenylazo)-4-hydroxy-6-(2-oxo-1-phenylcarbamoylpropylazo)naphthalen-2-sulfonat; pentanatrium-6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonatophenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)phenyl)amino)-2-sulfonatophenyl)azo)-4-hydroxynaphthalen-2-sulfonat; pentanatrium-6-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-3-((4-((4-((1,7-dihydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalen-2-sulfonat og hexanatrium-6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalen-2-sulfonat |
415-350-3 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-051-00-9 |
2-(4-(N-ethyl-N-(2-hydroxy)ethyl)amino-2-methylphenyl)azo-6-methoxy-3-methylbenzothiazoliumchlorid |
411-110-7 |
136213-74-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
611-052-00-4 |
mononatrium-aqua-[5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonat], jernkomplex |
400-720-9 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-053-00-X |
2,2'-azobis[2-methylpropionamidin]dihydrochlorid |
221-070-0 |
2997-92-4 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
611-055-00-0 |
C.I. Disperse Yellow 3; N-[4-[(2-hydroxy-5-methylphenyl)azo]phenyl]acetamid |
220-600-8 |
2832-40-8 |
Carc. 2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
|
|
|
|
611-056-00-6 |
C.I. Solvent Yellow 14; 1-phenylazo-2-naphthol |
212-668-2 |
842-07-9 |
Carc. 2 Muta. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H341 H317 H413 |
GHS08 GHS07 Wng |
H351 H341 H317 H413 |
|
|
|
|
611-057-00-1 |
6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridincarbonitril |
400-340-3 |
85136-74-9 |
Carc. 1B Aquatic Chronic 4 |
H350 H413 |
GHS08 Wng |
H350 H413 |
|
|
|
|
611-058-00-7 |
(6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium]-format |
402-060-7 |
108225-03-2 |
Carc. 1B Eye Dam. 1 Aquatic Chronic 2 |
H350 H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H350 H318 H411 |
|
|
|
|
611-059-00-2 |
octanatrium 2-(6-(4-chlor-6-(3-(N-methyl-N-(4-chlor-6-(3,5-disulfonato-2-naphthylazo)-1-hydroxy-6-naphthylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,5-disulfonato-1-hydroxy-2-naphthylazo)naphthalen-1,5-disulfonat |
412-960-1 |
148878-21-1 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
611-060-00-8 |
blanding af natrium-5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophtalat; ammonium-5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophtalat; 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatnaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatnaphthalen-2-ylazo]-isophthalsyre |
413-180-4 |
187285-15-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-061-00-3 |
dinatrium-5-[5-[4-(5-chlor-2,6-difluorpyrimidin-4-ylamino)benzamido]-2-sulfonatophenylazo]-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridylmethylsulfonat |
412-530-3 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-062-00-9 |
octanatrium-2-(8-(4-chlor-6-(3-((4-chlor-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalen-2-ylazo)-1-hydroxynaphthalen-8-ylamino)-1,3,5-triazin-2-yl)aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalen-2-ylazo)naphthalen-1,5-disulfonat |
413-550-5 |
— |
Skin Irrit. 2 Eye Dam. 1 |
H315 H318 |
GHS05 Dgr |
H315 H318 |
|
|
|
|
611-063-00-4 |
trinatrium-[4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O, O',O'',O''']kobber(II) |
413-590-3 |
164058-22-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
611-064-00-X |
4-(3,4-dichlorphenylazo)-2,6-di-sec-butyl-phenol |
410-600-8 |
124719-26-2 |
STOT RE 2 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H315 H410 |
|
|
|
|
611-065-00-5 |
4-(4-nitrophenylazo)-2,6-di-sec-butyl-phenol |
410-610-2 |
111850-24-9 |
STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H319 H315 H317 H410 |
|
|
|
|
611-066-00-0 |
tetranatrium-5-[4-chlor-6-(N-ethyl-anilino)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1,5-disulfonatonaphthalen-2-ylazo)-naphthalen-2,7-disulfonat |
411-540-5 |
130201-57-9 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
611-067-00-6 |
en blanding af bis(tris(2-(2-hydroxy(1-methyl)ethoxy)ethyl)ammonium)-7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalen-2-sulfonat og bis(tris(2-(2-hydroxy(2-methyl)ethoxy)ethyl)ammonium)-7-anilino-4-hydroxy-3-(2-methoxy-5-methyl-4-(4-sulfonatophenylazo)phenylazo)naphthalen-2-sulfonat |
406-910-8 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
611-068-00-1 |
tetranatrium-4-amino-3,6-bis(5-[4-chlor-6-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino]-2-sulfonatophenylazo)-5-hydroxynaphthalen-2,7-disulfonat |
400-690-7 |
85665-98-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-069-00-7 |
N, N-di-[poly(oxyethylen)-co-poly(oxypropylen)]-4-[(3,5-dicyano-4-methyl-2-thienyl)azo)]-3-methylanilin |
413-380-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-070-00-2 |
en blanding (1:1) af dinatrium-(6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chlor-2-oxidophenylazo)-2-naphtholato)chromat(1-) og trinatriumbis(5-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromat(1-) |
405-665-4 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
611-071-00-8 |
tris(tetramethylammonium)-5-hydroxy-1-(4-sulfonatophenyl)-4-(4-sulfonatophenylazo)pyrazol-3-carboxylat |
406-073-9 |
131013-81-5 |
Acute Tox. 3 * Aquatic Chronic 3 |
H301 H412 |
GHS06 Dgr |
H301 H412 |
|
|
|
|
611-072-00-3 |
2,4-bis[2,2'-[2-(N,N-dimethylamino)ethyloxycarbonyl]phenylazo]-1,3-dihydroxybenzendihydrochlorid |
407-010-8 |
118208-02-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
611-073-00-9 |
dimethyl-3,3'-(N-(4-(4-bromo-2,6-dicyanophenylazo)-3-hydroxyphenyl)imino)dipropionat |
407-310-9 |
122630-55-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-074-00-4 |
blanding af natrium/kalium-(3-(4-(5-(5-chlor-2,6-difluorpyrimidin-4-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)kobber(II) og natrium/kalium-(3-(4-(5-(5-chlor-4,6-difluorpyrimidin-2-ylamino)-2-methoxy-3-sulfonatophenylazo)-2-oxidophenylazo)-2,5,7-trisulfonato-4-naphtholato)kobber(II) |
407-100-7 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-075-00-X |
blanding (2:1) af tris(3,5,5-trimethylhexylammonium)-4-amino-3-(4-(4-(2-amino-4-hydroxyphenyl azo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalen-2,7-disulfonat og tris(3,5,5-trimethylhexylammonium)-2-amino-3-(4-(4-(4-amino-2-hydroxyphenylazo)anilino)-3-sulfonatophenylazo)-5,6-dihydro-5-oxo-6-phenylhydrazononaphthalen-2,7-disulfonat |
406-000-0 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-076-00-5 |
3-(2,6-dichlor-4-nitrophenylazo)-1-methyl-2-phenylindol |
406-280-4 |
117584-16-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
611-077-00-0 |
dilithiumdinatrium-(5,5'-diamino-(μ-4,4'-dihydroxy-1:2-κ-2,O4,O4',-3,3'-[3,3'-dihydroxy-1:2-κ-2-O3,O3'-biphenyl-4,4'-ylenbisazo-1:2-(N3,N4-η:N3',N4'-η)]-dinaphthalen-2,7-disulfonato(8)))dicuprat(2-) |
407-230-4 |
126637-70-5 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
611-078-00-6 |
(2,2'-(3,3'-dioxidobiphenyl-4,4'-diyldiazo)bis(6-(4-(3-(diethylamino)propylamino)-6-(3-(diethylammonio)propylamino)-1,3,5-triazin-2-ylamino)-3-sulfonato-1-naphtholato))dikobber(II)acetatlactat |
407-240-9 |
159604-94-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-079-00-1 |
dinatrium-7-[4-chlor-6-(N-ethyl-o-toluidin)-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(4-methoxy-2-sulfonatophenylazo)-2-naphthalensulfonat |
410-390-8 |
147703-64-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-080-00-7 |
natrium-3-(2-acetamid-4-(4-(2-hydroxybutoxy)phenylazo)phenylazo)benzensulfonat |
410-150-2 |
147703-65-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-081-00-2 |
tetranatrium-[7-(2,5-dihydroxy-КO2-7-sulfonato-6-[4-(2,5,6-trichlor-pyrimidin-4-ylamino)phenylazo]-(N1,N7-N)-1-naphthylazo)-8-hydroxy-КO8-naphthalen-1,3,5-trisulfonato(6-)]cuprat(II) |
411-470-5 |
141048-13-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
611-082-00-8 |
blanding af pentanatriumbis(1-(3(eller 5)-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)ferrat(1-) og pentanatrium-[(1-(3-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato)-(5-(4-anilino-3-sulfonatophenylazo)-4-hydroxy-2-oxidophenylazo)-6-nitro-4-sulfonato-2-naphtholato]ferrat(1-) |
407-570-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-083-00-3 |
en blanding (1:1) af 2-[N-ethyl-4-[(5,6-dichlorbenzothiazol-2-yl)azo]-m-toludin]ethyl-acetat og 2-[N-ethyl-4-[(6,7-dichlorbenzothiazol-2-yl)azo]-m-toludin]ethyl-acetat |
411-560-4 |
— |
STOT RE 1 Skin Sens. 1 Aquatic Chronic 2 |
H372 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H317 H411 |
|
|
|
|
611-085-00-4 |
en blanding af 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-(2-hydroxy-ethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)-propylamino]-pyridin; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-(2-hydroxy-ethylamino)-4-methyl-2-[3-(2-phenoxyethoxy)-propylamino]-pyridin; 3-cyano-5-(2-cyano-4-nitro-phenylazo)-2-amino-4-methyl-6-[3-(3-hydroxypropoxy)propylamino]-pyridin og 3-cyano-5-(2-cyano-4-nitro-phenylazo)-6-amino-4-methyl-2-[3-(3-methoxypropoxy)propylamino]-pyridin |
411-880-4 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-086-00-X |
monolithium-5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)azo]phenyl]azo]-2-naphthalensulfonat], jernkomplex, monohydrat |
411-360-7 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-087-00-5 |
en blanding af 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethylphenol og 3-((5-cyano-1,6-dihydro-1,4-dimethyl-2-hydroxy-6-oxo-3-pyridinyl)azo)-benzoyloxy-2-ethyloxy-2-(ethylphenol) |
411-710-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-088-00-0 |
blanding af trilithium-4-amino-3-((4-((4-((2-amino-4-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)-naphthalen-2,7-disulfonat og trilithium-4-amino-3-((4-((4-((4-amino-2-hydroxyphenyl)azo)phenyl)amino)-3-sulfophenyl)azo)-5-hydroxy-6-(phenylazo)-naphthalen-2,7-disulfonat |
411-890-9 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
611-089-00-6 |
2-((4-(ethyl-(2-hydroxyethyl)amino)-2-methylphenyl)azo)-6-methoxy-3-methyl-benzothiazolium-methylsulfat |
411-100-2 |
136213-73-5 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
611-090-00-1 |
2,5-dibutoxy-4-(morpholin-4-yl)-benzendiazonium 4-methylbenzensulfonat |
413-290-2 |
93672-52-7 |
Self-react. C Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H242 H302 H318 H317 H412 |
GHS02 GHS05 GHS07 Dgr |
H242 H302 H318 H317 H412 |
|
|
T |
|
611-091-00-7 |
natrium (1.0-1.95)/lithium (0.05-1)-5-((5-((5-chlor-6-fluor-pyrimidin-4-yl)amino)-2-sulfonatophenyl)azo)-1,2-dihydro-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinmethylsulfonat |
413-470-0 |
134595-59-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-092-00-2 |
tert-(dodecyl/tetradecyl)-ammonium-bis(3-(4-((5-(1,1-dimethyl-propyl)-2-hydroxy-3-nitrophenyl)azo)-3-methyl-5-hydroxy-(1H)pyrazol-1-yl)benzensulfonamidat)chromat |
413-210-6 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-093-00-8 |
natrium-2-(4-(4-fluor-6-(2-sulfo-ethylamino)-[1,3,5]triazin-2-ylamino)-2-ureido-phenylazo)-5-(4-sulfophenylazo)benzen-1-sulfonat |
410-770-3 |
146177-84-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-094-00-3 |
en blanding (50:50) af 2-[2-acetylamino-4-[N, N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-5,6-dichlor-1,3-benzothiazol og 2-[2-acetylamino-4-[N, N-bis[2-ethoxy-carbonyloxy)ethyl]amino]phenylazo]-6,7-dichlor-1,3-benzotriazol |
411-600-0 |
143145-93-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-095-00-9 |
hexanatrium-1,1'-[(1-amino-8-hydroxy-3,6-disulfonato-2,7-naphthalendiyl)bis(azo(4-sulfonato-1,3-phenyl)imino[6-[(4-chlor-3-sulfonatophenyl)amino]-1,3,5-triazin-2,4-diyl]]]bis[3-carboxypyridinium] dihydroxid |
412-240-7 |
89797-03-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-096-00-4 |
methyl-N-[3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl]-N-[(1-methoxy)acetyl]glycinat |
413-040-2 |
149850-30-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-097-00-X |
blanding af jernkomplekser af 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-(5-amino-sulfonyl-2-hydroxyphenylazo)-benzen og 1,3-dihydroxy-4-[(5-phenylaminosulfonyl)-2-hydroxyphenylazo]-n-[4-(4-nitro-2-sulfophenylamino)phenylazo]-benzen (n=2,5,6) |
414-150-3 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-098-00-5 |
tetrakis(tetramethylammonium)-3,3'-(6-(2-hydroxyethylamino)1,3,5-triazin-2,4-diyldiiminobis(2-methyl-4,1-phenylenazo))dinaphthalen-1,5-disulfonat |
405-950-3 |
131013-83-7 |
Acute Tox. 3 * Aquatic Chronic 3 |
H301 H412 |
GHS06 Dgr |
H301 H412 |
|
|
|
|
611-099-00-0 |
(methylenbis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridin-5,3-diyl)))-1,1'-dipyridiniumdichloriddihydrochlorid |
401-500-5 |
118658-99-4 |
Carc. 1B Aquatic Chronic 2 |
H350 H411 |
GHS08 GHS09 Dgr |
H350 H411 |
|
|
|
|
611-100-00-4 |
kaliumnatrium-3,3'-(3(eller4)-methyl-1,2-phenylenbis(imino(6-chlor)-1,3,5-triazin-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalen-1,5-disulfonat |
403-810-6 |
140876-13-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-101-00-X |
2'-(4-chlor-3-cyan-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilid |
405-200-5 |
104366-25-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-102-00-5 |
reaktionsprodukt af C.I. Leuco Sulfur Black 1 og en blanding af dinatrium-4-{4-[8-amino-1-hydroxy-7-(4-sulfamoylphenylazo)-3,6-disulfonato-2-naphthylazo]phenylsulfonylamino}benzendiazoniumchlorid og dinatrium-4-{4-[2,6-dihydroxy-3-(8-hydroxy-3,6-disulfonato-1-naphthylazo)phenylazo]phenylsulfonylamino}benzendiazoniumchlorid |
424-500-7 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-103-00-0 |
trinatrium-(1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nikkel(II) |
407-110-1 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
611-104-00-6 |
en blanding (1:1) af trinatrium-(2,4(eller 2,6 eller 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(eller 4 eller 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(eller 2 eller 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrat(1-); trinatrium-bis(2,4(eller 2,6 eller 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)ferrat(1-); trinatrium-(2,4(eller 2,6 eller 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(eller 4 eller 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(eller 2 eller 6)-(4-nitro-2-sulfonatophenylazo)phenolato)ferrat(1-); trinatrium-(2,4(eller 2,6 eller 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(eller 4 eller 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(eller 2 eller 6)-(3-sulfonatophenylazo)phenolato)ferrat(1-) og dinatrium-3,3'-(2,4-dihydroxy-1,3(eller 1,5 eller 3,5)-phenylendiazo)dibenzensulfonat |
406-870-1 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-105-00-1 |
natrium-4-(4-chlor-6-(N-ethylanilino)-,1,3,5-triazin-2-ylamino)-2-(1-(2-chlorphenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzensulfonat |
407-800-2 |
136213-75-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-106-00-7 |
hexanatrium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'[p-phenylenbis[imino(6-chlor-1,3,5-triazin-4,2-diyl)imino]]dinaphthalen-2-sulfonat |
410-180-6 |
157627-99-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-107-00-2 |
kalium natrium 4-(4-chlor-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethansulfonyl)-phenylazo)-naphthalen-1,7-disulfonat |
412-490-7 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-108-00-8 |
dinatrium-5-((4-((4-chlor-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalensulfonat |
413-600-6 |
6527-62-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-109-00-3 |
reaktionsprodukter af kobber(II)sulfat og tetranatrium-2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylamino]-6-(2-hydroxyethylamino)-1,3,5-triazin (2:1) |
407-710-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-110-00-9 |
tetra-natrium/lithium-4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzen |
408-210-8 |
124605-82-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-111-00-4 |
dinatrium 2-[[4-(2-chlor ethylsulfonyl)phenyl]-[(2- hydroxy-5-sulfo-3-[3-[2-(2-(sul fooxy)ethylsulfonyl)ethylazo]-4- sulfobenzoato(3-)cuprat(1-) |
414-230-8 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-112-00-X |
tetranatrium-4-hydroxy-5-[4-[3-(2-sulfatethansulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalen-2,7-disulfonat |
413-070-6 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-113-00-5 |
lithiumnatrium (2-(((5-((2,5-dichlorphenyl)azo)-2-hydroxyphenyl)methylen)amino)benzoato(2-))-(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-))-chromat(2-) |
414-280-0 |
149626-00-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-114-00-0 |
lithiumnatrium (4-((5-chlor-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))-(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzensulfonato(3-))-chromat(2-) |
414-250-7 |
149564-66-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
611-115-00-6 |
trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalensulfonato(3-))chromat(3-) |
414-290-5 |
149564-65-8 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
611-116-00-1 |
blanding af trinatrium 5-{4-chlor-6-[2-(2,6-dichlor-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalen-2,7-disulfonat; trinatrium 5-{4-chlor-6-[2-(2,6-dichlor-5-cyanopyrimidin-4-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalen-2,7-disulfonat; trinatrium 5-{4-chlor-6-[2-(4,6-dichlor-5-cyanopyrimidin-2-ylamino)-propylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalen-2,7-disulfonat og trinatrium 5-{4-chlor-6-[2-(4,6-dichlor-5-cyanopyrimidin-2-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalen-2,7-disulfonat |
414-620-8 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-117-00-7 |
1,3-bis{6-fluor-4-[1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino}propan lithium-, natriumsalt |
415-100-3 |
149850-29-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-118-00-2 |
natrium 1,2-bis[4-[4-{4-(4-sulfophenylazo)-2-sulfophenylazo}-2-ureido-phenyl-amino]-6-fluor-1,3,5-triazin-2-ylamino]-propan, natriumsalt |
413-990-8 |
|
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
611-119-00-8 |
tetranatrium-4-[4-chlor-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalen-2,7-disulfonat |
415-400-4 |
148878-22-2 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-120-00-3 |
5-{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-sulfo-phenylamino]-6-chlor-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfo-naphtalen-2-ylazo)-naphthalen-2,7-disulfonsyre natriumsalt |
418-340-7 |
157707-94-3 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-121-00-9 |
hovedkomponent 6 (isomer): asym. 1:2 Cr(III)-kompleks af A: 3-hydroxy-4-(2-hydroxy-naphthalen-1-ylazo)-naphthalen-1-sulfonsyre, natriumsalt og B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalen-2-ol; hovedkomponent 8 (isomer): asym. 1:2 Cr-kompleks af A: 3-hydroxy-4-(2-hydroxy-naphthalen-1-ylazo)-naphthalen-1-sulfonsyre, natriumsalt og B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalen-2-ol |
417-280-9 |
30785-74-1 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
611-122-00-4 |
hexanatrium (di[N-(3-(4-[5-(5-amino-3-methyl-1-phenylpyrazol-4-yl-azo)-2,4-disulfonatoanilino]-6-chlor-1,3,5-triazin-2-ylamino}phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nikkel |
417-250-5 |
151436-99-6 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-123-00-X |
3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,3,5-triazin-6-ylamino)propyldiethylammoniumlactat |
424-310-4 |
178452-66-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-124-00-5 |
en blanding af pentanatrium 5-amino-3-(5-{4-chlor-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-6-[5-(2,3-dibrompropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalen-2,7-disulfonat; pentanatrium 5-amino-6-[5-(2-bromacryloylamino)-2-sulfonatophenylazo]-3-(5-{4-chlor-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-4-hydroxynaphthalen-2,7-disulfonat tetranatrium 5-amino-3-[5-{4-chlor-6-[4-(vinylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo]-6-[5-(2,3-dibrompropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalen-2,7-disulfonat |
424-320-9 |
|
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-125-00-0 |
en blanding af dinatrium 4-((8-oxido-7-(2-oxido-4-ethenylsulfonyl-5-(methoxyphenyl)azo)-6-sulfonato)naphthalen-2-ylazo)-5-oxo-1-(4-sulfonatophenyl)-4,5-dihydro-1H-pyrazol-3-carboxylsyre kobber (II) kompleks og dinatrium 4-((8-oxido-7-(2-oxido-4-(2-hydroxyethylsulfonyl)-5-(methoxyphenyl)azo)-6-sulfonato)naphthalen-2-ylazo)-5-oxo-1-(4-sulfonatophenyl)-4,5-dihydro-1H-pyrazol-3-carboxylsyre kobber (II) kompleks |
423-940-7 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-126-00-6 |
2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazin, dichlorid |
424-120-1 |
174514-06-8 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
611-127-00-1 |
pentanatrium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethansulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethansulfonyl)phenylazo)naphthalen-2,7-disulfonat |
423-790-2 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
G |
|
611-128-00-7 |
N, N'-bis{6-chlor-4-[6-(4-vinylsulfonylphenylazo)-2,7-disulfonsyre-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl}-N-(2-hydroxyethyl)ethan-1,2-diamin, natriumsalt |
419-500-9 |
171599-85-2 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-129-00-2 |
en blanding af 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoesyre og 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoesyre |
418-230-9 |
163879-69-4 |
Expl. 1,3 **** Repr. 2 STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H203 H361f *** H373 ** H317 H411 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H203 H361f *** H373 ** H317 H411 |
|
|
|
|
611-130-00-8 |
tetraammonium-2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoat |
418-520-5 |
183130-96-3 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
611-131-00-3 |
2-[2-hydroxy-3-(2-chlorphenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-on |
420-580-2 |
151798-26-4 |
Repr. 1B Aquatic Chronic 4 |
H360D *** H413 |
GHS08 Dgr |
H360D *** H413 |
|
|
|
|
611-132-00-9 |
pentanatrium bis{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalen-2-azobenzen-1,2'-diolato} chromat (III) |
419-210-2 |
178452-71-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-133-00-4 |
procesprodukt-jernkompleks af azo-farvestoffer opnået ved kobling af en blanding af diazoteret 2-amino-1-hydroxybenzen-4-sulfanilid og 2-amino-1-hydroxybenzen-4-sulfonamid med resorcin, hvor den herved opnåede blanding efterfølgende underkastes en yderligere koblingsreaktion med en blanding af diazoteret 3-aminobenzen-1-sulfonsyre (metanilsyre) og 4'-amino-4-nitro-1,1'-diphenylamin-2-sulfonsyre og en metallisering med ferrichlorid, natriumsalt |
419-260-5 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-134-00-X |
trinatrium 2-{α[2-hydroxy-3-[4-chlor-6-[4-(2,3-dibrompropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenhydrazino}-4-sulfonatobenzoat, kobberkompleks |
423-770-3 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-135-00-5 |
reaktionsprodukt af 2-[[4-amino-2-ureidophenylazo]-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzensulfonsyre med 2,4,6-trifluorpyrimidin og delvis hydrolyse til det tilsvarende vinylsulfonylderivat, blandet kalium/natriumsalt |
424-250-9 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-136-00-0 |
2-{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-2-aminopropylformat |
424-260-3 |
— |
Repr. 2 Eye Dam. 1 Aquatic Chronic 2 |
H361f *** H318 H411 |
GHS05 GHS08 GHS09 Dgr |
H361f *** H318 H411 |
|
|
|
|
611-137-00-6 |
6-tert-butyl-7-chlor-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazol |
419-870-1 |
159038-16-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
611-138-00-1 |
2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazol |
415-910-7 |
152828-25-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
611-139-00-7 |
reaktionsprodukt af C.I. Leuco Sulfur Black 1 med (3-chlor-2-hydroxypropyl)trimethylammoniumchlorid |
424-510-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
611-140-00-2 |
azafenidin (ISO); 2-(2,4-dichlor-5-prop-2-ynyloxyphenyl)-5,6,7,8-tetrahydro1,2,4-triazolo[4,3-a]pyridin3(2H)-on |
— |
68049-83-2 |
Repr. 1B STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
M = 1 000 |
|
|
611-141-00-8 |
5-(4-[4-[4-(3,5-dicarboxy-phenyl-azo)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]phenyl-azo)isophthalsyre, blandet mononatrium- og diammoniumsalt |
414-410-6 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-142-00-3 |
procesprodukt-defineret polyazo-farvestof fremkommet ved kobling af 4-[4-(1-amino-8-hydroxy-3,6-disulfo-2-naphthylazo)phenylsulfonylamino]benzendiazonium med en blanding af 4-carboxybenzendiazonium og diphenylamin-3-sulfo-4,4'-bisdiazonium, og yderligere kobling af de herved opnåede forbindelser med en blanding af naphth-2-ol og 3-aminophenol, natriumsalte og natriumchlorid |
425-740-5 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-143-00-9 |
en blanding af trinatrium-2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzyliden]hydrazino-κ-N')-6-(2,6-difluorpyrimidin-4-ylamino)-4-sulfonatophenolatocuprat(II) og trinatrium-2-(2-[α-(2-carboxylato-κ-O-4-sulfonatophenylazo)benzyliden]hydrazino-κ-N')-6-(4,6-difluorpyrimidin-2-ylamino)-4-sulfonatophenolatocuprat(II) |
428-260-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-144-00-4 |
en blanding af 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxynaphthalen-2-sulfonsyre, Na/K-salt; 7-amino-3-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxy-8-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalen-2-sulfonsyre, Na/K-salt; 7-amino-8-[4-(2-sulfoxyethylsulfonyl)phenylazo]-4-hydroxy-3-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]naphthalen-2-sulfonsyre, Na/K-salt og 7-amino-3,8-bis-[4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo]-4-hydroxynaphthalen-2-sulfonsyre, Na/K-salt |
429-070-4 |
214362-06-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-145-00-X |
en blanding af tetranatrium-3-(1,5-disulfonatonaphthalen-2-ylazo)-4-hydroxy-7-{4-chlor-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}naphthalen-2-sulfonat og 3-(2,5-disulfophenylazo)-4-hydroxy-7-{4-chlor-6-[4-(2-sulfoxyethylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}naphthalen-2-sulfonsyre, natriumsalt |
429-440-5 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-146-00-5 |
en blanding af pentanatrium-3-(4-(4-(7-(2,4-diamino-5-sulfonato-3-(4-sulfonatophenylazo)phenylazo)-1-hydroxy-3-sulfonatonaphthalen-2-ylazo)-2-sulfonatophenylamino)phenylazo)-4-hydroxy-6-(2-oxo-1-phenylcarbamoylpropylazo)naphthalen-2-sulfonat; pentanatrium-6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonatophenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)phenyl)amino)-2-sulfonatophenyl)azo)-4-hydroxynaphthalen-2-sulfonat; pentanatrium-6-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-3-((4-((4-((1,7-dihydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalen-2-sulfonat og hexanatrium-6-((2,4-diamino-5-sulfonatophenyl)azo)-3-((4-((4-((7-((2,4-diamino-5-sulfonato-3-((4-sulfonatophenyl)azo)phenyl)azo)-1-hydroxy-3-sulfonatonaphthalen-2-yl)azo)-2-sulfonatophenyl)amino)phenyl)azo)-4-hydroxynaphthalen-2-sulfonat |
430-070-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-147-00-0 |
natrium-, kalium-, lithium-5-amino-3,6-bis(5-(4-chlor-6-(methyl-(2-methylaminoacetyl)amino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalen-2,7-disulfonat |
430-090-0 |
205764-96-1 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-148-00-6 |
en blanding af 2-(3-(2,6-dichlor-4-nitrophenylazo)carbazol-9-yl)ethanol; 2-(2-(3-(2,6-dichlor-4-nitro-phenylazo)carbazol-9-yl)ethoxy)ethanol og 3-(2,6-dichlor-4-nitrophenylazo)carbazol |
429-590-1 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
611-149-00-1 |
2-(2-chloracetoxy)ethyl-3-((4-(2,5-dichlor-4-fluorsulfonylphenylazo)-3-methylphenyl)ethylamino)propionat |
427-570-7 |
193486-83-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
611-150-00-7 |
tetralithium-2-[6-[7-[2-(carboxylato)phenylazo]-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoat |
440-460-3 |
— |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
611-151-00-2 |
chrysoidin; 4-(phenylazo)benzen-1,3-diamin |
207-803-7 |
495-54-5 |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H315 H410 |
|
|
|
|
611-152-00-8 |
chrysoidin monohydrochlorid; 4-phenylazophenylen-1,3-diamin monohydrochlorid; [1] chrysoidinmonoacetat; 4-(phenylazo)benzen-1,3-diaminmonoacetat; [2] chrysoidinacetat 4-(phenylazo)benzen-1,3-diaminacetat; [3] chrysoidin-p-dodecylbenzensulfonat; dodecylbenzensulfonsyre, forbindelse med 4-(phenylazo)benzen-1,3-diamin (1:1); [4] chrysoidin dihydrochlorid; 4-(phenylazo)benzen-1,3-diamin dihydrochlorid; [5] chrysoidinsulfat; bis[4-(phenylazo)benzen-1,3-diamin]sulfat; [6] |
208-545-8 [1] 278-290-5 [2] 279-116-0 [3] 264-409-8 [4] 281-549-5 [5] 282-432-1 [6] |
532-82-1 [1] 75660-25-2 [2] 79234-33-6 [3] 63681-54-9 [4] 83968-67-6 [5] 84196-22-5 [6] |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H315 H318 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H341 H302 H315 H318 H410 |
|
|
|
|
611-153-00-3 |
chrysoidin C10-14-alkylderivater; benzensulfonsyre, mono-C10-14-alkylderivater, forbindelser med 4-(phenylazo)-1,3-benzendiamin; [1] chrysoidin, forbindelse med dibutylnaphtalensulfon syre; dibutylnaphthalensulfonsyre, forbindelse med 4-(phenylazo)benzen-1,3-diamin (1:1) [2] |
286-946-7 [1] 304-236-8 [2] |
85407-90-5 [1] 94247-67-3 [2] |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H341 H302 H315 H318 |
GHS05 GHS08 GHS07 Dgr |
H341 H302 H315 H318 |
|
|
|
|
611-154-00-9 |
trinatrium-5-benzamido-4-hydroxy-3-(4-methyl-2-sulfonatophenylazo)naphthalen-2,7-disulfonat |
403-670-6 |
92408-46-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-155-00-4 |
4,4'-oxybis(benzensulfonylazid) |
431-850-4 |
7456-68-0 |
Expl. 1.1 **** STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H373 ** H400 H410 |
GHS01 GHS08 GHS09 Dgr |
H201 H373 ** H410 |
|
|
|
|
611-156-00-X |
triammonium-4-[4-[7-(4-carboxylatoanilino)-1-hydroxy-3-sulfonato-2-naphthylazo]-2,5-dimethoxyphenylazo]benzoat |
432-270-4 |
221354-37-6 |
Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H361f *** H373 ** H411 |
GHS08 GHS09 Wng |
H361f *** H373 ** H411 |
|
|
|
|
611-157-00-5 |
benzensulfonsyre, 3,3'-(methylenbis((dihydroxyphenylen)azo))bis-, kaliumnatriumsalt kaliumnatrium-3-[(E)-(6-{3,4-dihydroxy-2-[(Z)-(3-sulfonatophenyl)diazenyl]benzyl}-2,3-dihydroxyphenyl)diazenyl]benzensulfonat |
432-590-4 |
243869-48-9 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
611-158-00-0 |
reaktionsprodukt af 2,3,4,2',3', 4'-hexahydroxy-5,5'-diacetyl-diphenylmethan og 6-diazo-5,6-dihydro-5-oxo-1-naphthalensulfonylchlorid og 3-diazo-3,4-dihydro-6-methoxy-4-oxo-1-naphthalensulfonylchlorid |
421-520-8 |
— |
**** Aquatic Chronic 4 |
**** H413 |
**** |
**** H413 |
|
|
|
|
611-159-00-6 |
dinatrium-4-amino-6-((4-((4-(2,4-diaminophenyl)azo)phenylsulfamoyl)phenyl)azo)-5-hydroxy-3-((4-nitrophenyl)azo)naphthalen-2,7-disulfonat |
421-880-6 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-160-00-1 |
en blanding af 1,1,1-tris(phenyl-4'-(3''-diazo-3'',4''-dihydro-4''-oxo-naphthalen-1''-sulfonato)ethan; 1,1,1-tris(phenyl-4'-(6''-diazo-5'', 6''-dihydro-5''-oxo-naphthalen-1''-sulfonato)ethan; reaktionsprodukt af 1,1,1-tris(p-hydroxyphenyl)ethan med 6-diazo-5,6-dihydro-5-oxo-1-naphthylsulfonylchlorid og 3-diazo-3,4-dihydro-4-oxo-1-naphthylsulfonylchlorid (2:1) reaktionsprodukt af 1,1,1-tris(p-hydroxyphenyl)ethan med 6-diazo-5,6-dihydro-5-oxo-1-naphthylsulfonylchlorid og 3-diazo-3,4-dihydro-4-oxo-1-naphthylsulfonylchlorid (1:2) |
422-760-6 |
— |
**** Aquatic Chronic 4 |
**** H413 |
**** |
**** H413 |
|
|
|
|
611-161-00-7 |
trinatrium-[1,2'-(2-(8-amino-3,5-disulfonatonaphthalen)azo)-(4'-nitrobenzen)diolato-O, O,N][(Z)-2,2-((phenylcarbamoylprop-1'-enyl)azo)-5-sulfamoylbenzen)diolato-O, O,N]chromat(III) |
423-100-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-162-00-2 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzen-1,3-diolbis(methansulfonat) |
429-600-4 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
611-163-00-8 |
2,4-bis(((2-(dimethylammonio)ethyloxy)carbonyl)phen-2-ylazo)benzen-1,3-diolsulfat |
429-610-9 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
611-164-00-3 |
en blanding af 2,2'-dimethyl-2,2'-azobutannitril; 2-methylpentannitril-2-azo-2'-(2'-methylpropannitril); 2,2'-dimethyl-2,2'-azoheptannitril; 2-methylheptannitril-2-azo-2'-(2'-methylpropannitril) og 2-methylheptannitril-2-azo-2'-(2'-methylbutannitril) |
429-710-2 |
— |
Self-react. D Acute Tox. 4 * Aquatic Chronic 2 |
H242 H302 H411 |
GHS02 GHS07 GHS09 Dgr |
H242 H302 H411 |
|
|
|
|
611-165-00-9 |
blanding af tetranatrium-4-amino-6-(5-(2,6-difluorpyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(sulfatoethylsulfonyl)phenylazo)naphthalen-2,7-disulfonat og tetranatrium-4-amino-6-(5-(4,6-difluorpyrimidin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethylsulfonyl)phenylazo)naphthalen-2,7-disulfonat |
431-830-5 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-166-00-4 |
en blanding af pentanatrium 4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalen-2,7-disulfonat og tetranatrium-4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat og tetranatrium-4-amino-5-hydroxy-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-3-[(E)-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat |
432-100-9 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-167-00-X |
natrium-bis[tris(2-hydroxyethyl)ammonium][6-anilino-4'-(4,8-disulfonato-2-naphthylazo)-5'-methyl-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato]cuprat(II) |
435-240-9 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-168-00-5 |
en blanding af 3-[[4-chlor-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-5-[[4-chlor-6-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)azo]-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzoesyre og 3,5-bis[[4-chlor-6-[[7-[(1,5-disulfo-2-naphthalenyl)azo]-8-hydroxy-3,6-disulfo-1-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]benzoesyre |
435-440-6 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-169-00-0 |
natrium-5-(2-carboxyphenylazo)-6-hydroxynaphthalen-2-sulfonat |
435-800-2 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-170-00-6 |
blanding af trinatrium-2-((1-(2-hydroxy-κ-O-5-(2-sulfonatoethansulfonyl)phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoat(5-)-κ-O)cuprat(II) dinatrium-2-((1-(5-ethensulfonyl-2-hydroxy-κ-O-phenylazo-κ-N2)-1-phenylmethyl)azo-κ-N1)-4-sulfonatobenzoat-κ-O-(5-))cuprat(II) |
435-880-9 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
611-171-00-1 |
blanding af trinatrium-3-(5-(2,6-difluorpyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-(4-fluor-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalendisulfonat og trinatrium-3-(5-(4,6-difluorpyrimidin-2-ylamino)-2-sulfonatophenylazo)-5-(4-fluor-6-morpholin-4-yl-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-naphthalendisulfonat |
436-890-6 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-172-00-7 |
en blanding af triammonium- 6-amino-3-((2,5-diethoxy-4-(3-phosphonophenyl)azo)phenyl)azo-4-hydroxy-2-naphthalensulfonat og diammonium-3-((4-((7-amino-1-hydroxy-3-sulfo-naphthalen-2-yl)azo)-2,5-diethoxyphenyl)azo)benzoat |
438-310-7 |
— |
Self-react. C **** Repr. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H242 H361f *** H302 H373 ** H412 |
GHS02 GHS08 GHS07 Dgr |
H242 H361f *** H302 H373 ** H412 |
|
|
|
|
611-173-00-2 |
en blanding af 3-[3-carbamoyl-5-(5-{4-chlor-6-[4-(2-sulfonatooxyethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propansyre, trinatriumsalt og 3-[3-carbamoyl-5-(5-{4-chlor-6-[4-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-1-pyridyl]propansyre, dinatriumsalt |
440-510-4 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-174-00-8 |
en blanding af 3-[5-(4-ethensulfonylbutyrylamino)-2-sulfophenylazo]-5-{4-chlor-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalen-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalen-2,7-disulfonsyre, natriumsalt og 3-[5-(4-(2-chlorethansulfonyl)butyrylamino)-2-sulfophenylazo]-5-{4-chlor-[6-(4-(3-amino-5-hydroxy-2,7-disulfonaphthalen-4-ylazo)-3-sulfophenylamino]-1,3,5-triazin-2-ylamino}-4-hydroxynaphthalen-2,7-disulfonsyre, natriumsalt |
442-290-5 |
457624-86-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
611-175-00-3 |
blanding af trinatrium-5-{4-chlor-6-[N-ethyl-(3-(2-sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat trinatrium-5-{4-chlor-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo]naphthalen-2,7-disulfonat; dinatrium-5-{4-chlor-6-[N-ethyl-3-(vinylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-4-hydroxy-3-[(4-vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat og tetranatrium-5-{4-chlor-6-[N-ethyl-3-(2-(sulfonatooxy)ethylsulfonyl)anilino]-1,3,5-triazin-2-ylamino}-3-[4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo]-4-hydroxynaphthalen-2,7-disulfonat |
444-050-5 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
611-176-00-9 |
2,6-bis(2,3,4-trihydroxybenzyl)-p-cresol, ester med 6-diazo-5,6-dihydro-5-oxo-1-naphthalensulfonat |
444-250-2 |
— |
Self-react. C **** Aquatic Chronic 2 |
H242 H411 |
GHS02 GHS09 Dgr |
H242 H411 |
|
|
|
|
611-177-00-4 |
blanding af pentanatrium-bis[6-anilino-3,5'-disulfonatonaphthalen-2-azobenzen-1,2'-diolato]cobaltat(III); tetranatrium-[6-anilino-3,5'-disulfonatonaphthalen-2-azobenzen-1,2'-diolato][6-anilino-5'-sulfamoyl-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato]cobaltat(III) og trinatrium-bis[6-anilino-5'-sulfamoyl-3-sulfonatonaphthalen-2-azobenzen-1,2'-diolato]cobaltat(III) |
444-290-0 |
508202-43-5 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
611-178-00-X |
en blanding af pentanatrium -4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-{(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}naphthalen-2,7-disulfonat; tetranatrium-4-amino-5-hydroxy-3-{(E)-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat; tetranatrium-4-amino-5-hydroxy-6-[(E)-2-sulfonato-4-[2-(sulfonatooxy)ethylsulfonyl]phenylazo}-3-[(E)-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat; trinatrium-4-amino-5-hydroxy-3-[(E)-4-(vinylsulfonyl)phenylazo]-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat; trinatrium-4-amino-5-hydroxy-3-[(2-hydroxyethylsulfonyl)-phenylazo]-6-[(E)-2-sulfonato-4-(vinylsulfonyl)phenylazo]naphthalen-2,7-disulfonat; trinatrium-4-amino-5-hydroxy-3-[(E)-4-(vinylsulfonyl)phenylazo]-6-[2-sulfonato-4-(2-hydro xyethylsulfonyl)phenylazo]naphthalen-2,7-disulfonat |
445-280-9 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
611-179-00-5 |
en blanding af pentanatrium -2-[[8-[[4-chlor-6-[[4-(2-sulfonatoethylsulfonyl)]phe nyl]amino]-1,3,5-triazin-2-yl]amino-1- hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalen-1,5-disulfonat og 2-[[8-[[4-chlor-6-[[4-[[2-ethenyl]sulfonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonato-2-naphthalenyl]azo]naphthalen-1,5-disulfonat |
450-010-8 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
611-180-00-0 |
jern, komplekser med diazoteret 4-aminobenzensulfonamid, diazoteret 3-aminobenzensulfonsyre, diazoteret 3-amino-4-hydroxybenzensulfonamid, diazoteret 3-amino-4-hydroxy-N-phenylbenzensulfonamid, diazoteret 5-amino-2-(phenylamino)benzensulfonsyre og resorcinol, natriumsalte |
417-850-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-001-00-9 |
mono-methylamin; [1] di-methylamin; [2] tri-methylamin [3] |
200-820-0 [1] 204-697-4 [2] 200-875-0 [3] |
74-89-5 [1] 124-40-3 [2] 75-50-3 [3] |
Flam. Gas 1 Press. Gas Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H220 H332 H335 H315 H318 |
GHS02 GHS04 GHS05 GHS07 Dgr |
H220 H332 H335 H315 H318 |
|
* Skin Irrit. 2; H315: C ≥ 5 % Eye Dam. 1; H318: C ≥ 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: C ≥ 5 % |
U5 |
|
612-001-01-6 |
mono-methylamin … %; [1] di-methylamin … %; [2] tri-methylamin … % [3] |
200-820-0 [1] 204-697-4 [2] 200-875-0 [3] |
74-89-5 [1] 124-40-3 [2] 75-50-3 [3] |
Flam. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H224 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H332 H302 H314 |
|
* STOT SE 3; H335: C ≥ 5 % |
B |
|
612-002-00-4 |
ethylamin |
200-834-7 |
75-04-7 |
Flam. Gas 1 Press. Gas Eye Irrit. 2 STOT SE 3 |
H220 H319 H335 |
GHS02 GHS04 GHS07 Dgr |
H220 H319 H335 |
|
|
U |
|
612-003-00-X |
diethylamin |
203-716-3 |
109-89-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
612-004-00-5 |
triethylamin |
204-469-4 |
121-44-8 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
612-005-00-0 |
butylamin |
203-699-2 |
109-73-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
612-006-00-6 |
ethylendiamin; 1,2-diaminoethan |
203-468-6 |
107-15-3 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H226 H312 H302 H314 H334 H317 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H312 H302 H314 H334 H317 |
|
|
|
|
612-007-00-1 |
2-propanamin; isopropylamin |
200-860-9 |
75-31-0 |
Flam. Liq. 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H224 H319 H335 H315 |
GHS02 GHS07 Dgr |
H224 H319 H335 H315 |
|
|
|
|
612-008-00-7 |
anilin |
200-539-3 |
62-53-3 |
Carc. 2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
|
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
612-009-00-2 |
salte af anilin |
— |
— |
Carc. 2 Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H341 H331 H311 H301 H372 ** H318 H317 H400 |
|
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
A |
|
612-010-00-8 |
chloraniliner, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
C |
|
612-011-00-3 |
4-nitrosoanilin |
211-535-6 |
659-49-4 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
612-012-00-9 |
o-nitroanilin; [1] m-nitroanilin; [2] p-nitroanilin [3] |
201-855-4 [1] 202-729-1 [2] 202-810-1 [3] |
88-74-4 [1] 99-09-2 [2] 100-01-6 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
|
|
C |
|
612-013-00-4 |
3-aminobenzensulfonsyre; metanilsyre |
204-473-6 |
121-47-1 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
612-014-00-X |
sulfanilsyre; 4-aminobenzensulfonsyre |
204-482-5 |
121-57-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
612-015-00-5 |
N-methylanilin |
202-870-9 |
100-61-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
|
|
612-016-00-0 |
N, N-dimethylanilin |
204-493-5 |
121-69-7 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H351 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H311 H301 H411 |
|
|
|
|
612-017-00-6 |
N-methyl-N-2,4,6-tetranitroanilin; tetryl |
207-531-9 |
479-45-8 |
Expl. 1,1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 |
H201 H331 H311 H301 H373 ** |
GHS01 GHS06 GHS08 Dgr |
H201 H331 H311 H301 H373 ** |
|
|
|
|
612-018-00-1 |
bis(2,4,6-trinitrophenyl)amin; hexyl |
205-037-8 |
131-73-7 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H201 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
|
|
|
|
612-019-00-7 |
dipicrylamin, ammoniumsalt |
220-639-0 |
2844-92-0 |
Expl. 1,1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H201 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
|
|
|
|
612-020-00-2 |
1-naphthylamin |
205-138-7 |
134-32-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
612-022-00-3 |
2-naphthylamin |
202-080-4 |
91-59-8 |
Carc. 1A Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
Carc. 1A; H350: C ≥ 0,01 % |
|
|
612-023-00-9 |
phenylhydrazin; [1] phenylhydraziniumchlorid; [2] phenylhydrazin-hydrochlorid; [3] phenylhydraziniumsulfat (2:1) [4] |
202-873-5 [1] 200-444-7 [2] 248-259-0 [3] 257-622-2 [4] |
100-63-0 [1] 59-88-1 [2] 27140-08-5 [3] 52033-74-6 [4] |
Carc. 1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H350 H341 H331 H311 H301 H372 ** H319 H315 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H331 H311 H301 H372 ** H319 H315 H317 H400 |
|
|
|
|
612-024-00-4 |
m-toluidin; 3-aminotoluen |
203-583-1 |
108-44-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H311 H301 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H400 |
|
|
|
|
612-025-00-X |
nitrotoluidiner, med undtagelse af sådanne specificeret andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
|
C |
|
612-026-00-5 |
diphenylamin |
204-539-4 |
122-39-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H410 |
|
|
|
|
612-027-00-0 |
xylidiner, med undtagelse af sådanne specificeret andetsteds i dette bilag dimethylaniliner, med undtagelse af sådanne specificeret andetsteds i dette bilag |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
|
C |
|
612-028-00-6 |
p-phenylendiamin |
203-404-7 |
106-50-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H319 H317 H410 |
|
|
|
|
612-029-00-1 |
benzen-1,4-diamindihydrochlorid; p-phenylendiamindihydrochlorid |
210-834-9 |
624-18-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H319 H317 H410 |
|
|
|
|
612-030-00-7 |
2-methyl-p-phenylendiaminsulfat [1] |
210-431-8 [1] 228-871-4 [2] |
615-50-9 [1] 6369-59-1 [2] |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H332 H312 H317 H411 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H411 |
|
|
|
|
612-031-00-2 |
N, N-dimethylbenzen-1,3-diamin; [1] 4-amino-N, N-dimethylanilin; 3-amino-N, N'-dimethylanilin [2] |
220-623-3 [1] 202-807-5 [2] |
2836-04-6 [1] 99-98-9 [2] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
C |
|
612-032-00-8 |
N, N,N'-N'-tetramethyl-p-pheny lendiamin |
202-831-6 |
100-22-1 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
612-033-00-3 |
2-aminofenol |
202-431-1 |
95-55-6 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H341 H332 H302 |
GHS08 GHS07 Wng |
H341 H332 H302 |
|
|
|
|
612-034-00-9 |
2-amino-4,6-dinitrophenol; picraminsyre |
202-544-6 |
96-91-3 |
Expl. 1,1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H201 H332 H312 H302 H412 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 H412 |
|
|
|
|
612-034-01-6 |
2-amino-4,6-dinitrophenol; picraminsyre; [≥ 20 % vand] |
202-544-6 |
96-91-3 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
|
|
G |
|
612-035-00-4 |
2-methoxyanilin; ortho-anisidin |
201-963-1 |
90-04-0 |
Carc. 1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H350 H341 H331 H311 H301 |
GHS06 GHS08 Dgr |
H350 H341 H331 H311 H301 |
|
|
|
|
612-036-00-X |
3,3'-dimethoxybenzidin; o-dianisidin |
204-355-4 |
119-90-4 |
Carc. 1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
|
|
612-037-00-5 |
salte af 3,3'-dimethoxyben zidin; salte af o-dianisidin |
— |
— |
Carc. 1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
A |
|
612-038-00-0 |
2-nitro-p-anisidin 4-methoxy-2-nitroanilin |
202-547-2 |
96-96-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H330 H310 H300 H373 ** H412 |
GHS06 GHS08 Dgr |
H330 H310 H300 H373 ** H412 |
|
|
|
|
612-039-00-6 |
2-ethoxyanilin; ortho-phenetidin |
202-356-4 |
94-70-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H311 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** |
|
|
|
|
612-040-00-1 |
2,4-dinitroanilin |
202-553-5 |
97-02-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H310 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H411 |
|
|
|
|
612-041-00-7 |
4,4'-bis-o-toluidin |
204-358-0 |
119-93-7 |
Carc. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
|
|
|
612-042-00-2 |
benzidin 1,1'-biphenyl-4,4'-diamin; 4,4'-diaminobiphenyl; biphenyl-4,4'-ylendiamin |
202-199-1 |
92-87-5 |
Carc. 1A Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
Carc. 1A; H350: C ≥ 0,01 % |
|
|
612-043-00-8 |
N, N'-dimethylbenzidin |
— |
2810-74-4 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
612-044-00-3 |
N, N'-diacetylbenzidin |
210-338-2 |
613-35-4 |
Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H341 H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H341 H332 H312 H302 |
|
|
|
|
612-046-00-4 |
allylamin |
203-463-9 |
107-11-9 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H225 H331 H311 H301 H411 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H411 |
|
|
|
|
612-047-00-X |
benzylamin |
202-854-1 |
100-46-9 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
612-048-00-5 |
dipropylamin |
205-565-9 |
142-84-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
612-049-00-0 |
dibutylamin; [1] di-sec-butylamin [2] |
203-921-8 [1] 210-937-9 [2] |
111-92-2 [1] 626-23-3 [2] |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
|
|
|
|
612-050-00-6 |
cyclohexylamin |
203-629-0 |
108-91-8 |
Flam. Liq. 3 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H361f *** H312 H302 H314 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H361f *** H312 H302 H314 |
|
|
|
|
612-051-00-1 |
4,4'-diaminodiphenylmethan; 4,4'-methylendianilin |
202-974-4 |
101-77-9 |
Carc. 1B Muta. 2 STOT SE 1 STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H370 ** H373 ** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H370 ** H373 ** H317 H411 |
|
|
|
|
612-052-00-7 |
(S)-sec-butylamin (S)-2-aminobutan; [1] (R)-sec-butylamin; (R)-2-aminobutan; [2] sec-butylamin; 2-aminobutan [3] |
208-164-7 [1] 236-232-6 [2] 237-732-7 [3] |
513-49-5 [1] 13250-12-9 [2] 13952-84-6 [3] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H225 H332 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H400 |
|
|
C |
|
612-053-00-2 |
N-ethylanilin |
203-135-5 |
103-69-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H311 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** |
|
|
|
|
612-054-00-8 |
N, N-diethylanilin |
202-088-8 |
91-66-7 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
* |
|
|
612-055-00-3 |
N-methyl-o-toluidin; [1] N-methyl-m-toluidin; [2] N-methyl-p-toluidin [3] |
210-260-9 [1] 211-795-0 [2] 210-769-6 [3] |
611-21-2 [1] 696-44-6 [2] 623-08-5 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
|
|
C |
|
612-056-00-9 |
N, N-dimethyl-p-toluidin; [1] N, N-dimethyl-m-toluidin; [2] N, N-dimethyl-o-toluidin [3] |
202-805-4 [1] 204-495-6 [2] 210-199-8 [3] |
99-97-8 [1] 121-72-2 [2] 609-72-3 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H331 H311 H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H331 H311 H301 H373 ** H412 |
|
* |
C |
|
612-057-00-4 |
piperazin; [fast] |
203-808-3 |
110-85-0 |
Repr. 2 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H361fd H314 H334 H317 |
GHS05 GHS08 Dgr |
H361fd H314 H334 H317 |
|
|
|
|
612-057-01-1 |
piperazin; [væske] |
203-808-3 |
110-85-0 |
Repr. 2 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H361fd H314 H334 H317 |
GHS05 GHS08 Dgr |
H361fd H314 H334 H317 |
|
|
|
|
612-058-00-X |
2,2'-iminodiethylamin; diethylentriamin |
203-865-4 |
111-40-0 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 |
|
|
|
|
612-059-00-5 |
3,6-diazaoctanethylendiamin; triethylentetramin |
203-950-6 |
112-24-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H314 H317 H412 |
|
|
|
|
612-060-00-0 |
3,6,9-triazaundecamethylendiamin; tetraethylen-pentamin |
203-986-2 |
112-57-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H411 |
|
|
|
|
612-061-00-6 |
3-(dimethylamino)propylamin; N, N-dimethyl-1,3-diaminopropan |
203-680-9 |
109-55-7 |
Flam. Liq. 3 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H226 H302 H314 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 H317 |
|
|
|
|
612-062-00-1 |
3-(diethylamino)propylamin); N, N-diethyl-1,3-diaminopropan |
203-236-4 |
104-78-9 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H226 H312 H302 H314 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H312 H302 H314 H317 |
|
|
|
|
612-063-00-7 |
3,3'-iminodi(propylamin) dipropylentriamin |
200-261-2 |
56-18-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H330 H311 H302 H314 H317 |
GHS06 GHS05 Dgr |
H330 H311 H302 H314 H317 |
|
|
|
|
612-064-00-2 |
3,6,9,12-tetraazatetradecan-k,4-diamin; pentaethylenhexamin |
223-775-9 |
4067-16-7 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
612-065-00-8 |
polyethylenpolyaminer undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
|
|
|
|
612-066-00-3 |
dicyclohexylamin |
202-980-7 |
101-83-7 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
|
|
|
612-067-00-9 |
3-aminomethyl-3,5,5-trimethylcyclohexylamin |
220-666-8 |
2855-13-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 H412 |
|
|
|
|
612-068-00-4 |
3,3'-dichlorbenzidin 3,3'-dichlorbiphenyl-4,4'-ylendiamin |
202-109-0 |
91-94-1 |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H312 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H312 H317 H410 |
|
|
|
|
612-069-00-X |
salte af 3,3'-dichlorbenzidin; salte af 3,3'-dichlorbiphenyl4,4'-ylendiamin |
— |
— |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H312 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H312 H317 H410 |
|
|
A |
|
612-070-00-5 |
salte af benzidin |
208-519-6 208-520-1 244-236-4 252-984-8 |
531-85-1 531-86-2 21136-70-9 36341-27-2 |
Carc. 1A Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
A |
|
612-071-00-0 |
salte af 2-nafthylamin |
209-030-0 210-313-6 |
553-00-4 612-52-2 |
Carc. 1A Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
|
A |
|
612-072-00-6 |
biphenyl-4-ylamin; xenylamin; 4-aminobiphenyl |
202-177-1 |
92-67-1 |
Carc. 1A Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
|
|
612-073-00-1 |
salte af biphenyl-4-ylamin; salte af xenylamin; salte af 4-aminobiphenyl |
— |
— |
Carc. 1A Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
A |
|
612-074-00-7 |
benzyldimethylamin |
203-149-1 |
103-83-3 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H226 H332 H312 H302 H314 H412 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 H412 |
|
|
|
|
612-075-00-2 |
2-aminoethyldimethylamin 2-dimethylaminoethylamin |
203-541-2 |
108-00-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H225 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H312 H302 H314 |
|
|
|
|
612-076-00-8 |
ethyldimethylamin |
209-940-8 |
598-56-1 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
|
|
|
|
612-077-00-3 |
dimethylnitrosoamin; N-nitrosodimethylamin |
200-549-8 |
62-75-9 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 2 |
H350 H330 H301 H372 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H330 H301 H372 ** H411 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
612-078-00-9 |
2,2'-dichlor-4,4'-methylendianilin 4,4'-methylenbis(2-chloranilin) |
202-918-9 |
101-14-4 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
612-079-00-4 |
salte af 2,2'-dichlor-4,4'-methylendianilin; salte af 4,4'-methylenbis(2-chloranilin) |
— |
— |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
A |
|
612-080-00-X |
4-amino-N, N-diethylanilin; N, N-diethyl-4-aminoanilin |
202-214-1 |
93-05-0 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
|
|
|
612-081-00-5 |
salte af 4,4'-bi-o-toluidin; salte af 3,3′-dimethoxybenzidin; salte af o-tolidin |
210-322-5 265-294-7 277-985-0 |
612-82-8 64969-36-4 74753-18-7 |
Carc. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
|
A |
|
612-082-00-0 |
thiourea; thiourinstof |
200-543-5 |
62-56-6 |
Carc. 2 Repr. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H351 H361D *** H302 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H361D *** H302 H411 |
|
|
|
|
612-083-00-6 |
1-methyl-3-nitro-1-nitrosoguanidin |
200-730-1 |
70-25-7 |
Carc. 1B Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H350 H332 H319 H315 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H332 H319 H315 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
612-084-00-1 |
dapson; 4,4'-diaminodiphenylsulfon |
201-248-4 |
80-08-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
612-085-00-7 |
4,4'-methylendi-o-toluidin |
212-658-8 |
838-88-0 |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
|
|
|
|
612-086-00-2 |
amitraz (ISO) N, N-bis(2,4-xylyliminomethyl) methylamin |
251-375-4 |
33089-61-1 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
M = 10 |
|
|
612-087-00-8 |
guazatin (ISO) |
|
108173-90-6 |
Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H312 H302 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H312 H302 H335 H315 H318 H410 |
|
|
|
|
612-088-00-3 |
simazin (ISO) 6-chlor-N, N'-diethyl-1,3,5- triazin-2,4-diamin |
204-535-2 |
122-34-9 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
612-089-00-9 |
1,5-naphthylendiamin |
218-817-8 |
2243-62-1 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
612-090-00-4 |
2,2'-(nitrosoimino)bisethanol |
214-237-4 |
1116-54-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
612-091-00-X |
o-toluidin; 2-aminotoluen |
202-429-0 |
95-53-4 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 |
H350 H331 H301 H319 H400 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H319 H400 |
|
|
|
|
612-092-00-5 |
N, N'-(2,2-dimethylpropyli den)hexamethylendiamin |
401-660-6 |
1000-78-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
612-093-00-0 |
3,5-dichlor-4-(1,1,2,2-tetrafluorethoxy)anilin |
401-790-3 |
104147-32-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
612-094-00-6 |
4-(2-chlor-4-trifluormethyl)phenoxy-2-fluoranilin hydrochlorid |
402-190-4 |
113674-95-6 |
STOT RE 1 Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H372 ** H302 H373 ** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H373 ** H318 H317 H410 |
|
|
|
|
612-095-00-1 |
benzyl-2-hydroxydodecyldi- methylammoniumbenzoat |
402-610-6 |
113694-52-3 |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
|
612-096-00-7 |
4,4'-carbonimidoylbis[N, N-dimethylanilin] |
207-762-5 |
492-80-8 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H351 H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H411 |
|
|
|
|
612-097-00-2 |
salte af 4,4'-carbonimid- oylbis[N, N-dimethylanilin] |
— |
— |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H351 H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H411 |
|
|
A |
|
612-098-00-8 |
nitrosodipropylamin |
210-698-0 |
621-64-7 |
Carc. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
612-099-00-3 |
4-methyl-m-phenylendiamin; 2,4-toluendiamin |
202-453-1 |
95-80-7 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H361f *** H301 H312 H373 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H301 H312 H373 ** H317 H411 |
|
|
|
|
612-100-00-7 |
propylendiamin |
201-155-9 |
78-90-0 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H226 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H312 H302 H314 |
|
|
|
|
612-101-00-2 |
methenamin; hexamethylentetramin |
202-905-8 |
100-97-0 |
Flam. Sol. 2 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Wng |
H228 H317 |
|
|
|
|
612-102-00-8 |
N, N-bis(3-aminopro- pyl)methylamin |
203-336-8 |
105-83-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B |
H331 H311 H302 H314 |
GHS06 GHS05 Dgr |
H331 H311 H302 H314 |
|
|
|
|
612-103-00-3 |
N, N,N',N'-tetramethylethylendiamin |
203-744-6 |
110-18-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
|
|
|
|
612-104-00-9 |
hexamethylendiamin |
204-679-6 |
124-09-4 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Corr. 1B |
H312 H302 H335 H314 |
GHS05 GHS07 Dgr |
H312 H302 H335 H314 |
|
|
|
|
612-105-00-4 |
2-piperazin-1-ylethylamin |
205-411-0 |
140-31-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H317 H412 |
|
|
|
|
612-106-00-X |
2,6-diethylanilin |
209-445-7 |
579-66-8 |
Acute Tox. 4 * |
H302 |
— |
H302 |
|
|
|
|
612-107-00-5 |
1-phenylethylamin; [1] .sc.DL.sc.-α-methylbenzylamin [2] |
202-706-6 [1] 210-545-8 [2] |
98-84-0 [1] 618-36-0 [2] |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
612-108-00-0 |
3-aminopropyltriethoxysilan |
213-048-4 |
919-30-2 |
Acute Tox. 4 * Skin Corr. 1B |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
612-109-00-6 |
bis(2-dimethylaminoe- thyl)(methyl)amin |
221-201-1 |
3030-47-5 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B |
H311 H302 H314 |
GHS06 GHS05 Dgr |
H311 H302 H314 |
|
|
|
|
612-110-00-1 |
2,2'-dimethyl-4,4'-methylenbis(cyclohexylamin) |
229-962-1 |
6864-37-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Chronic 2 |
H331 H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H302 H314 H411 |
|
|
|
|
612-111-00-7 |
2-methyl-m-phenylendiamin; 2,6-toluendiamin |
212-513-9 |
823-40-5 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H341 H312 H302 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H312 H302 H317 H411 |
|
|
|
|
612-112-00-2 |
p-anisidin; 4-methoxyanilin |
203-254-2 |
104-94-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 |
H330 H310 H300 H373 ** H400 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H400 |
|
|
|
|
612-113-00-8 |
6-methyl-2,4-bis(methylthio)phenylen-1,3-diamin |
403-240-8 |
106264-79-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
612-114-00-3 |
R,R-2-hydroxy-5-(1-hydroxy-2-(4-phenylbut-2-ylamino)ethyl)benzamidhydrogen-2,3-bis(benzoyloxy)succinat |
404-390-7 |
— |
Flam. Sol. 1 Skin Sens. 1 Aquatic Chronic 3 |
H228 H317 H412 |
GHS02 GHS07 Wng |
H228 H317 H412 |
|
|
|
|
612-115-00-9 |
dimethyldioctadecylammoniumhydrogensulfat |
404-050-8 |
123312-54-9 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
612-116-00-4 |
C8-18salkylbis(2-hydroxyethyl)ammoniumbis(2-ethylhexyl)phosphat |
404-690-8 |
68132-19-4 |
Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H317 H410 |
|
|
|
|
612-117-00-X |
C12-14-tert-alkylamin, methylphosphonsyresalt |
404-750-3 |
119415-07-5 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
612-118-00-5 |
en blanding af (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium-4-toluensulfonat og (1,3-dioxo-2H-benz(de)isoquinolin-2-ylpropyl)hexadecyldimethylammonium bromid |
405-080-4 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
612-119-00-0 |
benzyldimethyloctadecylammonium-3-nitrobenzensulfonat |
405-330-2 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
612-120-00-6 |
aclonifen (ISO); 2-chlor-6-nitro-3-phenoxyanilin |
277-704-1 |
74070-46-5 |
Carc. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GH09 Wng |
H351 H317 H410 |
|
M = 100 M = 10 |
|
|
612-121-00-1 |
aminer, polyethylenpoly-; HEPA |
268-626-9 |
68131-73-7 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
|
|
|
|
612-122-00-7 |
hydroxylamin ....%, [> 55 % i vandig opløsning] |
232-259-2 |
7803-49-8 |
Unst. Expl. Met. Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H200 H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H200 H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
|
|
B |
|
612-122-01-4 |
hydroxylamin …% [≤ 55 % i vandig opløsning] |
232-259-2 |
7803-49-8 |
Met. Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H290 H351 H312 H302 H373 ** H335 H315 H318 H317 H400 |
|
|
B |
|
612-123-00-2 |
hydroxylammoniumchlorid; hydroxylamin hydrochlorid; [1] bis(hydroxylammonium)sulfat; hydroxylamin sulfat (2:1) [2] |
226-798-2 [1] 233-118-8 [2] |
5470-11-1 [1] 10039-54-0 [2] |
Met. Corr. 1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H290 H351 H312 H302 H373 ** H319 H315 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Wng |
H290 H351 H312 H302 H373 ** H319 H315 H317 H400 |
|
|
|
|
612-124-00-8 |
N, N,N-trimethylaniliniumchlorid |
205-319-0 |
138-24-9 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
612-125-00-3 |
2-methyl-p-phenylendiamin 2,5-toluendiamin |
202-442-1 |
95-70-5 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H332 H312 H317 H411 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H411 |
|
|
|
|
612-126-00-9 |
toluen-2,4-diammoniumsulfat; 4-methyl-m-phenylendiamin sulfat |
265-697-8 |
65321-67-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350 H301 H312 H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H301 H312 H319 H317 H411 |
|
|
|
|
612-127-00-4 |
3-aminophenol |
209-711-2 |
591-27-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
|
|
|
|
612-128-00-X |
4-aminophenol |
204-616-2 |
123-30-8 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H302 H410 |
|
|
|
|
612-129-00-5 |
diisopropylamin |
203-558-5 |
108-18-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H225 H332 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
612-130-00-0 |
2,6-diamino-3,5-diethyltoluen; 4,6-diethyl-2-methylbenzen-1,3-diamin; [1] 2,4-diamino-3,5-diethyltoluen; 2,4-diethyl-6-methylbenzen-1,3-diamin; [2] diethylmethylbenzendiamin [3] |
218-255-3 [1] 218-256-9 [2] 270-877-4 [3] |
04-01-2095 [1] 05-02-2095 [2] 68479-98-1 [3] |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H319 H410 |
|
|
C |
|
612-131-00-6 |
didecyldimethylammoniumchlorid |
230-525-2 |
7173-51-5 |
Acute Tox. 4 * Skin Corr. 1B |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
612-132-00-1 |
N, N'-diphenyl-p-phenylendiamin N, N'-diphenyl-1,4-benzendiamin |
200-806-4 |
74-31-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
612-133-00-7 |
(4-ammonio-m-tolyl)ethyl(2-hydroxyethyl)ammoniumsulfat; 4-(N-ethyl-N-2-hydroxyethyl)-2-methylphenyldiamin sulfat |
247-162-0 |
25646-77-9 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H410 |
|
|
|
|
612-134-00-2 |
N-(2-(4-amino-N-ethyl-m-toluidino)ethyl)methansulfonamidsesquisulfat 4-(N-ethyl-N-2-metansulfonylaminoethyl)-2-methylphenylendiamin sesquisulfat monohydrat |
247-161-5 |
25646-71-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
612-135-00-8 |
N-2-naphthylanilin; N-phenyl-2-napthylamin |
205-223-9 |
135-88-6 |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H351 H319 H315 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H317 H411 |
|
|
|
|
612-136-00-3 |
N-isopropyl-N'-phenyl-p-phenylendiamin |
202-969-7 |
101-72-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
Skin Sens. 1; H317:C ≥ 0,1 % |
|
|
612-137-00-9 |
4-chloranilin |
203-401-0 |
106-47-8 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
|
|
612-138-00-4 |
furalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(2-furylcarbonyl)-.sc.DL.sc.-alaninat |
260-875-1 |
57646-30-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
612-139-00-X |
mefenacet (ISO); 2-(benzothiazol-2-yloxy)-N-methyl-N-phenylacetamid |
277-328-8 |
73250-68-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-140-00-5 |
kvaternære ammoniumforbindelser, benzyl-C8-18-alkyldimethyl-, chlorider |
264-151-6 |
63449-41-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H312 H302 H314 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H400 |
|
|
|
|
612-141-00-0 |
4,4'-methylenbis(2-ethylanilin); 4,4'-methylenbis(2-ethylbenzenamin) |
243-420-1 |
19900-65-3 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
612-142-00-6 |
biphenyl-2-ylamin |
201-990-9 |
90-41-5 |
Carc. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H351 H302 H412 |
GHS08 GHS07 Wng |
H351 H302 H412 |
|
|
|
|
612-143-00-1 |
N5,N5-diethyltoluen-2,5-diaminmonohydrochlorid 4-diethylamino-2-methylanilinmonohydrochlorid |
218-130-3 |
2051-79-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H317 H410 |
|
|
|
|
612-144-00-7 |
flumethralin (ISO) N-(2-chlor-6-fluorbenzyl)-N-ethyl-α, α,α-trifluor-2,6-dinitro-p-toluidin |
— |
62924-70-3 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H317 H410 |
|
|
|
|
612-145-00-2 |
o-phenylendiamin |
202-430-6 |
95-54-5 |
Carc. 2 Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H301 H332 H312 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H301 H332 H312 H319 H317 H410 |
|
|
|
|
612-146-00-8 |
o-phenylendiamindihydrochlorid |
210-418-7 |
615-28-1 |
Carc. 2 Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H301 H332 H312 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H341 H301 H332 H312 H319 H317 H410 |
|
|
|
|
612-147-00-3 |
m-phenylendiamin |
203-584-7 |
108-45-2 |
Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H311 H301 H319 H317 H410 |
|
|
|
|
612-148-00-9 |
m-phenylendiamindihydrochlorid |
208-790-0 |
541-69-5 |
Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H311 H301 H319 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H311 H301 H319 H317 H410 |
|
|
|
|
612-149-00-4 |
1,3-diphenylguanidin |
203-002-1 |
102-06-7 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H361f *** H302 H319 H335 H315 H411 |
GHS08 GHS07 GHS09 Wng |
H361f *** H302 H319 H335 H315 H411 |
|
|
|
|
612-151-00-5 |
methyl-phenylendiamin; diaminotoluen; [teknisk produkt — blanding af 4-methyl-m-phenylendiamin (EF-nr. 202-453-1) og 2-methyl-m-phenylendiamin (EF-nr. 212-513-9)] |
— |
— |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H361f *** H301 H312 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361f *** H301 H312 H373 ** H319 H317 H411 |
|
|
|
|
612-152-00-0 |
N, N-diethyl-N',N'-dimethylpropan-1,3-diyl-diamin |
406-610-7 |
62478-82-4 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Chronic 3 |
H226 H332 H302 H373 ** H314 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H332 H302 H373 ** H314 H412 |
|
|
|
|
612-153-00-6 |
4-[N-ethyl-N-(2-hydroxyethyl)amino]-1-(2-hydroxyethyl)amino-2-nitrobenzenmonohydrochlorid |
407-020-2 |
132885-85-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
612-154-00-1 |
6'-(isobutylethylamino)-3'-methyl-2'-phenylamino-spiro[isobenzo-2-oxofuran-7,9'-[9H]-xanthen] |
410-890-6 |
95235-29-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-155-00-7 |
2'-anilino-6'-((3-ethoxypropyl)ethylamino)-3'-methylspiro(isobenzo-3-oxofuran)-1-(1H)-9'-xanthen |
411-730-8 |
93071-94-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-156-00-2 |
blanding af trihexadecylmethylammoniumchlorid og dihexadecyldimethylammoniumchlorid |
405-620-9 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
612-157-00-8 |
(Z)-1-benzo[b]thien-2-ylethanonoximhydrochlorid |
410-780-8 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H411 |
|
|
|
|
612-158-00-3 |
blanding af bis(5-dodecyl-2-hydroxybenzald-oximat)-kobber (II) C12-alkyl gruppen er forgrenet og 4-dodecylsalicylaldoxim |
410-820-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-159-00-9 |
reaktionsprodukter af trimethylhexamethylendiamine (en blanding af 2,2,4-trimethyl-1,6-hexandiamin og 2,4,4-trimethyl-1,6-hexandiamin, EINECS listet), Epoxide 8 (mono[(C10-C16-alkyloxy)methyl]oxiran-derivater) og p-toluen-sulfonsyre |
410-880-1 |
— |
Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
|
|
|
612-160-00-4 |
p-toluidin; 4-aminotoluen; [1] p-toluidiniumchlorid [2] p-toluidinsulfat (1:1) [3] |
203-403-1 [1] 208-740-8 [2] 208-741-3 [3] |
106-49-0 [1] 540-23-8 [2] 540-25-0 [3] |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H351 H331 H311 H301 H319 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H311 H301 H319 H317 H400 |
|
|
|
|
612-161-00-X |
2,6-xylidin; 2,6-dimethylanilin |
201-758-7 |
87-62-7 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H351 H332 H312 H302 H335 H315 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H312 H302 H335 H315 H411 |
|
|
|
|
612-162-00-5 |
dimethyldioctadecylammoniumchlorid DODMAC |
203-508-2 |
107-64-2 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
612-163-00-0 |
metalaxyl-M (ISO) mefenoxam (R)-2-[(2,6-dimethylphenyl)-methoxyacetylamino]propion syremethylester |
— |
70630-17-0 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
612-164-00-6 |
2-butyl-2-ethyl-1,5-diaminopentan |
412-700-7 |
137605-95-9 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H312 H302 H373 ** H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H312 H302 H373 ** H314 H317 H412 |
|
|
|
|
612-165-00-1 |
N, N'-diphenyl-N, N'-bis(3-methylphenyl)-(1,1'-diphenyl)-4,4'-diamin |
413-810-8 |
65181-78-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-166-00-7 |
blanding af cis-(5-ammonium-1,3,3-trimethyl)-cyclohexanmethylammonium-phosphat (1:1) og trans-(5-ammonium-1,3,3-trimethyl)-cyclohexanmethylammonium-phosphat (1:1) |
411-830-1 |
114765-88-7 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
612-167-00-2 |
5-acetyl-3-amino-10,11-dihydro-5H-dibenz[b, f]azepin hydrochlorid |
410-490-1 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H373 ** H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H318 H317 H411 |
|
|
|
|
612-168-00-8 |
3,5-dichlor-2,6-difluorpyridin-4-amin |
220-630-1 |
2840-00-8 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
|
|
|
612-169-00-3 |
bis(N-methyl-N-phenylhydrazin)sulfat |
423-170-1 |
618-26-8 |
Flam. Liq. 2 STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H372 ** H302 H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H225 H372 ** H302 H318 H317 H410 |
|
|
|
|
612-170-00-9 |
4-chlorphenylcyclopropylketon-O-(4-aminobenzyl)oxim |
405-260-2 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
612-171-00-4 |
N, N,N',N'-tetraglycidyl-4,4'-diamino-3,3'-diethyldiphenylmethan |
410-060-3 |
130728-76-6 |
Muta. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H317 H411 |
GHS08 GHS09 Wng |
H341 H317 H411 |
|
|
|
|
612-172-00-X |
4,4'-methylenbis(N, N'-dimethyl-cyclohexanamin) |
412-840-9 |
13474-64-1 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Chronic 3 |
H302 H373 ** H314 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H412 |
|
|
|
|
612-173-00-5 |
lithium-1-amino-4-(4-tert-butylanilino)-anthraquinon-2-sulfonat |
411-140-0 |
125328-86-1 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
612-174-00-0 |
4,4-dimethoxybutylamin |
407-690-6 |
19060-15-2 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
|
|
|
|
612-175-00-6 |
2-(O-aminooxy)ethylamindihydrochlorid |
412-310-7 |
37866-45-8 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
612-176-00-1 |
polymer af 1,3-dibrompropan og N, N-dietyl-N',N'-dimetyl-1,3-propandiamin |
410-570-6 |
143747-73-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
612-177-00-7 |
2-naphthylamino-6-sulfo methylamid |
412-120-4 |
104295-55-8 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373 ** H317 H411 |
GHS08 GHS09 Wng |
H373 ** H317 H411 |
|
|
|
|
612-178-00-2 |
1,4,7,10-tetraazacyclododecan disulfat |
412-080-8 |
112193-77-8 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 Aquatic Chronic 3 |
H302 H335 H318 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H412 |
|
|
|
|
612-179-00-8 |
1-(2-propenyl)pyridiniumchlorid |
412-740-5 |
25965-81-5 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
612-180-00-3 |
3-aminobenzylamin |
412-230-2 |
4403-70-7 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
612-181-00-9 |
2-phenylthioanilin |
413-030-8 |
1134-94-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
612-182-00-4 |
1-ethyl-1-methylmorpholiniumbromid |
418-210-1 |
65756-41-4 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
612-183-00-X |
1-ethyl-1-methylpyrrolidiniumbromid |
418-200-5 |
69227-51-6 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
612-184-00-5 |
6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofuran-1(3H),9-(9H)-xanthen]-3-on |
403-830-5 |
89331-94-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
612-185-00-0 |
1-[3-[4-((heptadecafluornonyl)oxy)-benzamido]propyl]-N, N,N-trimethylammoniumiodid |
407-400-8 |
59493-72-0 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
612-186-00-6 |
bis(N-(7-hydroxy-8-methyl-5-phenylphenazin-3-yliden)dimethylammonium)sulfat |
406-770-8 |
149057-64-7 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H373 ** H318 H317 H410 |
|
|
|
|
612-187-00-1 |
2,3,4-trifluoranilin |
407-170-9 |
3862-73-5 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H411 |
|
|
|
|
612-188-00-7 |
4,4'-(9H-fluoren-9-yliden)bis(2-chloranilin) |
407-560-9 |
107934-68-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-189-00-2 |
4-amino-2-(aminomethyl)phenoldihydrochlorid |
412-510-4 |
135043-64-0 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
612-190-00-8 |
4,4'-methylenbis(2-isopropyl-6-methylanilin) |
415-150-6 |
16298-38-7 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
612-191-00-3 |
polymer af allylaminhydrochlorid |
415-050-2 |
71550-12-4 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
612-192-00-9 |
2-isopropyl-4-(N-methyl)aminomethylthiazol |
414-800-6 |
154212-60-9 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
|
|
|
|
612-193-00-4 |
3-methylaminomethylphenylamin |
414-570-7 |
18759-96-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H317 H410 |
|
|
|
|
612-194-00-X |
2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino]-N, N,N-trimethyl-1-propanammoniumchlorid |
414-670-0 |
141890-30-4 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
612-195-00-5 |
bis[tributyl(4-methylbenzyl)ammonium]-1,5-naphthalendisulfonat |
415-210-1 |
160236-81-7 |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H302 H318 H410 |
|
|
|
|
612-196-00-0 |
4-chlor-o-toluidin; [1] 4-chlor-o-toluidiniumchlorid [2] |
202-441-6 [1] 221-627-8 [2] |
95-69-2 [1] 3165-93-3 [2] |
Carc. 1B Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H331 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H331 H311 H301 H410 |
|
|
|
|
612-197-00-6 |
2,4,5-trimethylanilin [1] 2,4,5-trimethylaniliniumchlorid [2] |
205-282-0 [1]-[2] |
137-17-7 [1] 21436-97-5 [2] |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
|
|
|
612-198-00-1 |
4,4'-thiodianilin salte heraf |
205-370-9 |
139-65-1 |
Carc. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H350 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H411 |
|
|
|
|
612-199-00-7 |
4,4'-oxydianilin, salte heraf p-aminophenylether |
202-977-0 |
101-80-4 |
Carc. 1B Muta. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H340 H361f *** H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H361f *** H331 H311 H301 H411 |
|
|
|
|
612-200-00-0 |
2,4-diaminoanisol 4-methoxy-m-phenylendiamin [1] 2,4-diaminoanisolsulfat [2] |
210-406-1 [1] 254-323-9 [2] |
615-05-4 [1] 39156-41-7 [2] |
Carc. 1B Muta. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H350 H341 H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H302 H411 |
|
|
|
|
612-201-00-6 |
N, N,N',N'-tetramethyl-4,4'-methylendianilin |
202-959-2 |
101-61-1 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
612-202-00-1 |
3,4-dichloranilin |
202-448-4 |
95-76-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H318 H317 H410 |
|
|
|
|
612-203-00-7 |
dimethyl (hydroxyethyl) (C8-10-alkyl) ammoniumchlorid, kæde < C8: < 3 %; kæde = C8: 40-70 %; kæde = C10: 30-60 %; kæde > C10: < 3 % |
417-360-3 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H312 H302 H315 |
GHS07 Wng |
H312 H302 H315 |
|
|
|
|
612-204-00-2 |
C.I. Basic Violet 3; 4-[4,4'-bis(dimethylamino) benzhydryliden]cyclohexa-2,5-dien-1-yliden]dimethylammoniumchlorid |
208-953-6 |
548-62-9 |
Carc. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H318 H410 |
|
|
|
|
612-205-00-8 |
C.I. Basic Violet 3 med ≥ 0,1 % af Michlers keton (EF-nr. 202-027-5) |
208-953-6 |
548-62-9 |
Carc. 1B Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H302 H318 H410 |
|
|
|
|
612-206-00-3 |
famoxadon (ISO) 3-anilin-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidin-2,4-dion |
— |
131807-57-3 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
612-207-00-9 |
4-ethoxyanilin; p-phenetidin |
205-855-5 |
156-43-4 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H341 H332 H312 H302 H319 H317 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H319 H317 |
|
|
|
|
612-208-00-4 |
N-methylbenzen-1,2-diammoniumhydrogenphosphat |
424-460-0 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
612-209-00-X |
6-methoxy-m-toluidin; p-cresidin |
204-419-1 |
120-71-8 |
Carc. 1B Acute Tox. 4 * |
H350 H302 |
GHS08 GHS07 Dgr |
H350 H302 |
|
|
|
|
612-210-00-5 |
5-nitro-o-toluidin; [1] 5-nitro-o-toluidinhydrochlorid [2] |
202-765-8 [1] 256-960-8 [2] |
99-55-8 [1] 51085-52-0 [2] |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 3 |
H351 H331 H311 H301 H412 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H412 |
|
|
|
|
612-211-00-0 |
N-[(benzotriazol-1-yl)methyl)]-4-carboxybenzensulfonamid |
416-470-9 |
170292-97-4 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
612-212-00-6 |
2,6-dichlor-4-trifluormethylanilin |
416-430-0 |
24279-39-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H315 H317 H410 |
|
|
|
|
612-213-00-1 |
isobutyliden-(2-(2-isopropyl-4,4-dimethyloxazolidin-3-yl)-1,1-dimethylethyl)amin |
419-850-2 |
148348-13-4 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
612-214-00-7 |
4-(2,2-diphenylethenyl)-N, N-di-phenylbenzenamin |
421-390-2 |
89114-90-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-215-00-2 |
3-chlor-2-(isopropylthio)anilin |
421-700-6 |
179104-32-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
612-216-00-8 |
1-amino-1-cyanamino-2,2-dicya- nethylen, natriumsalt |
425-870-2 |
19450-38-5 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
612-217-00-3 |
1-methoxy-2-propylamin |
422-550-4 |
37143-54-7 |
Flam. Liq. 2 Skin Corr. 1B Acute Tox. 4 * Aquatic Chronic 3 |
H225 H314 H302 H412 |
GHS02 GHS05 GHS07 Dgr |
H225 H314 H302 H412 |
|
|
|
|
612-219-00-4 |
(2-hydroxy-3-(3,4-dimethyl-9-oxo-10-thiaanthracen-2-yloxy)propyl)trimethylammoniumchlorid |
402-200-7 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
612-220-00-X |
N-nitro-N-(3-methyl-3,6-dihydro-2H-1,3,5-oxadiazin-4-yl)amin |
431-060-1 |
153719-38-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
612-221-00-5 |
2-amino-4-(trifluormethyl)benzenthiol hydrochlorid |
429-560-8 |
4274-38-8 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H314 H332 H312 H302 H373 ** H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H314 H332 H312 H302 H373 ** H317 H400 |
|
|
|
|
612-222-00-0 |
cis-1-(3-(4-fluorphenoxy)propyl)-3-methoxy-4-piperidinamin |
425-080-8 |
104860-26-6 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H318 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H312 H302 H373 ** H318 H410 |
|
|
|
|
612-223-00-6 |
N-benzyl-N-ethyl-(4-(5-nitro-benzo[c]isothiazol-3-ylazo)phenyl)amin |
425-300-2 |
186450-73-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
612-224-00-1 |
N2,N4,N6-tris{4-[(1,4-dimethylpentyl)amino]phenyl}-1,3,5-triazin-2,4,6-triamin |
426-150-0 |
121246-28-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
612-225-00-7 |
1,4,7,10-tetraazacyclododecan |
425-450-9 |
294-90-6 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H312 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H312 H302 H410 |
|
|
|
|
612-226-00-2 |
3-(2'-phenoxyethoxy)propylamin |
427-870-8 |
6903-18-0 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H315 H318 H412 |
GHS05 GHS07 Dgr |
H302 H315 H318 H412 |
|
|
|
|
612-227-00-8 |
benzyl-N-(2-(2-methoxyphenoxy)ethyl)amin hydrochlorid |
428-290-8 |
120606-08-8 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
612-228-00-3 |
en blanding af N-(3-(trimethoxysilyl)propyl)ethylendiamin; N-benzyl-N-(3-trimethoxysilyl)propyl)ethylendiamin; N-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylendiamin; N, N'-bis-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylendiamin; N, N,N'-tris-benzyl-N'-[3-(trimethoxysilyl)propyl]ethylendiamin og N, N-bis-benzyl-N'-[3-(trimetho- xysilyl)propyl]ethylendiamin |
414-340-6 |
— |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H332 H312 H302 H371 H318 H317 H412 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H226 H332 H312 H302 H371 H318 H317 H412 |
|
|
|
|
612-229-00-9 |
mepanipyrim 4-methyl-N-phenyl-6-(1-propynyl)-2-pyrimidinamin |
— |
110235-47-7 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
612-230-00-4 |
N, N-bis(cocoyl-2-oxypropyl)-N, N-dibutylammoniumbromid |
431-530-4 |
— |
Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
612-231-00-X |
3-((C12-18)-acylamino)-N-(2-((2-hydroxyethyl)amino)-2-oxoethyl)-N, N-dimethyl-1-propanaminiumchlorid |
427-370-1 |
164288-56-6 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
612-232-00-5 |
en blanding af triisopropanolaminsalt af 1-amino-4-(3-propionamidoanilino)anthraquinon-2-sulfonsyre og triisopropanolaminsalt af 1-amino-4-[3,4-dimethyl-5-(2-hydroxyethylaminosulfonyl)anilino]anthraquinon-2-sulfonsyre |
430-410-9 |
186148-38-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
612-237-00-2 |
hydroxylammoniumhydrogensulfat; hydroxylaminsulfat (1:1); [1] hydroxylaminphosphat; [2] hydroxylamindihydrogenphosphat; [3] hydroxylamin-4-methylben zensulfonat [4] |
233-154-4 [1] 244-077-0 [2] 242-818-2 [3] 258-872-5 [4] |
10046-00-1 [1] 20845-01-6 [2] 19098-16-9 [3] 53933-48-5 [4] |
Expl. 1,1 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H312 H302 H373 ** H319 H315 H317 H400 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H351 H312 H302 H373 ** H319 H315 H317 H400 |
|
|
T |
|
612-238-00-8 |
(3-chlor-2-hydroxypropyl) trimethylammoniumchlorid …% |
222-048-3 |
3327-22-8 |
Carc. 2 Aquatic Chronic 3 |
H351 H412 |
GHS08 Wng |
H351 H412 |
|
|
B |
|
612-239-00-3 |
biphenyl-3,3',4,4'-tetrayltetraamin; diaminobenzidin |
202-110-6 |
91-95-2 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
612-240-00-9 |
pyrimethanil (ISO); N-(4,6-dimethylpyrimidin-2-yl)anilin |
— |
53112-28-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-241-00-4 |
piperazinhydrochlorid; [1] piperazindihydrochlorid; [2] piperazinphosphat [3] |
228-042-7 [1] 205-551-2 [2] 217-775-8 [3] |
6094-40-2 [1] 142-64-3 [2] 1951-97-9 [3] |
Repr. 2 Eye Irrit. 2 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H361fd H319 H315 H334 H317 H412 |
GHS08 Dgr |
H361fd H319 H315 H334 H317 H412 |
|
|
|
|
612-242-00-X |
cyprodinil (ISO); 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amin |
— |
121552-61-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10 |
|
|
612-243-00-5 |
(1S-cis)-4-(3,4-dichlorphenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamin-2-hydroxy-2-phenylacetat |
420-560-3 |
79617-97-3 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
M = 10 |
|
|
612-244-00-0 |
3-(piperazin-1-yl)-benzo[d]isothiazolhydrochlorid |
421-310-6 |
87691-88-1 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H302 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H302 H319 H317 H410 |
|
|
|
|
612-245-00-6 |
2-ethylphenylhydrazinhydrochlorid |
421-460-2 |
19398-06-2 |
Carc. 2 STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H372 ** H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H372 ** H302 H318 H317 H410 |
|
M = 10 |
|
|
612-246-00-1 |
(2-chlorethyl)(3-hydroxypropyl)ammoniumchlorid |
429-740-6 |
40722-80-3 |
Carc. 1B Muta. 1B STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H350 H340 H373 ** H317 H412 |
GHS08 GHS07 Dgr |
H350 H340 H373 ** H317 H412 |
|
|
|
|
612-247-00-7 |
N-[3-(1,1-dimethylethyl)-1H-pyrazol-5-yl]-N'-hydroxy-4-nitrobenzencarboximidamid |
423-530-8 |
152828-23-4 |
STOT RE 1 Acute Tox. 4 * Aquatic Chronic 3 |
H372 ** H302 H412 |
GHS08 GHS07 Dgr |
H372 ** H302 H412 |
|
|
|
|
612-248-00-2 |
reaktionsprodukt af diphenylamin, phenothiazin og alkener, forgrenede (C8-10, C9-rige) |
439-540-0 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
612-249-00-8 |
4-[(3-chlorphenyl)(1H-imidazol-1-yl)methyl]-1,2-benzendiamindihydrochlorid |
425-030-5 |
159939-85-2 |
Repr. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H361f *** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H361f *** H302 H314 H317 H411 |
|
|
|
|
612-250-00-3 |
chlor-N, N-dimethylformiminiumchlorid |
425-970-6 |
3724-43-4 |
Repr. 1B Acute Tox. 4 * Skin Corr. 1A |
H360D *** H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H360D *** H302 H314 |
EUH014 |
|
|
|
612-251-00-9 |
cis-1-(3-chlorallyl)-3,5,7-triaza-1-azoniaadamantanchlorid |
426-020-3 |
51229-78-8 |
Flam. Sol. 2 Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H228 H361D *** H302 H315 H317 H411 |
GHS02 GHS08 GHS07 GHS09 Wng |
H228 H361D *** H302 H315 H317 H411 |
|
|
|
|
612-252-00-4 |
imidacloprid (ISO); 1-(6-chlorpyridin-3-ylmethyl)-N-nitroimidazolidin-2-ylidenamin |
428-040-8 |
138261-41-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
612-253-00-X |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-on; [indeholdende < 0,5 % formamid (EF-nr. 200-842-0)] |
429-400-7 |
199327-61-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
612-253-01-7 |
7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-on; [indeholdende ≥ 0,5 % formamid (EF-nr. 200-842-0)] |
429-400-7 |
199327-61-2 |
Repr. 1B Aquatic Chronic 3 |
H360D *** H412 |
GHS08 Dgr |
H360D *** H412 |
|
|
|
|
612-254-00-5 |
reaktionsprodukter af diisopropanolamin med formaldehyd (1:4) |
432-440-8 |
220444-73-5 |
Carc. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H302 H314 H317 H411 |
|
|
|
|
612-255-00-0 |
1-(3-methoxypropyl)-4-piperidinamin |
431-950-8 |
179474-79-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H312 H302 H314 H412 |
GHS05 GHS07 Dgr |
H312 H302 H314 H412 |
|
|
|
|
612-256-00-6 |
benzyl(S)-2-[(2'-cyanbiphenyl-4-ylmethyl)pentanoylamino]-3-methylbutyrat |
427-470-3 |
137864-22-3 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
612-257-00-1 |
tripropylammoniumdihydrogenphosphat |
433-700-3 |
35687-90-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
612-259-00-2 |
N-ethyl-3-trimethoxysilyl-2-methyl-propanamin |
437-720-3 |
227085-51-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
612-261-00-3 |
3,5-dichlor-2-fluor-4-(1,1,2,3,3,3-hexafluorpropoxy)anilin |
441-190-9 |
121451-05-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M = 10 |
|
|
612-265-00-5 |
bis(2-hydroxyethyl)-(2-hydroxypropyl)ammoniumacetat |
444-360-0 |
191617-13-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
612-266-00-0 |
3-chlor-4-(3-fluorbenzyloxy)anilin |
445-590-4 |
202197-26-0 |
Muta. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H373 ** H410 |
|
|
|
|
612-267-00-6 |
bis(hydrogeneret C16-18-talgalkyl)hydroxylamin |
418-370-0 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
612-269-00-7 |
en blanding af 1-[di(4-octylp- henyl)aminomethyl]-5-methyl-1H-benzotriazol og 1-[di(4-octylphenyl)aminomethyl]-4-methyl-1H-benzotriazol en blanding af N-[(5-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)anilin og N-[(4-methyl-1H-benzotriazol-1-yl)methyl]-4-octyl-N-(4-octylphenyl)anilin |
420-720-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-270-00-2 |
(S)-azetidin-2-carboxylsyre -4-cyanbenzylamidhydrochlorid |
433-010-2 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
612-271-00-8 |
blanding af ethyl-2-((4-(5,6-dichlorbenzothiazol-2-ylazo)phenyl)ethylamino)benzoat og ethyl-2-((4-(6,7-dichlorbenzothiazol-2-ylazo)phenyl)ethylamino)benzoat |
434-970-5 |
160987-57-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
612-272-00-3 |
ammonium-(η-6-2-(2-(1,2-dicarboxylatoethylamino)ethylamino)butan-1,4-dioato(4-))jern(3+)monohydrat |
435-210-5 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
612-273-00-9 |
alkyl(rapsolie), bis(2-hydroxyethyl)ammoniumfluorid |
435-650-8 |
— |
Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
|
|
|
612-274-00-4 |
(R,S)-1-[2-amino-1(4-methoxyphenyl)ethyl]cyclohexanolacetat |
445-750-3 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
612-275-00-X |
fedtsyrer, C18-umættede, dimerer, reaktionsprodukter med 1-piperazinethanamin og tallolie |
447-880-6 |
206565-89-1 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
M = 10 |
|
|
612-276-00-5 |
1-amino-4-[(4-amino-2-sulfophenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracensulfonsyre, dinatriumsalt, reaktionsprodukter med 2-[[3-[(4,6-dichlor-1,3,5-triazin-2-yl)ethylamino]phenyl]sulfonyl]ethylhydrogensulfat, natriumsalte |
451-430-4 |
500717-36-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
612-277-00-0 |
en blanding af 4-amino-3-(4-ethensulfonyl-2-sulfonatophenylazo)-5-hydroxy-6-(5-{4-chlor-6-[4-(2-sulfonatooxyethansulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)naphthalen-2,7-disulfonat kalium/natrium og 4-amino-5-hydroxy-6-(5-{4-chlor-6-[4-(2-sulfonatooxyethansulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-3-(2-sulfonato-4-(2-sulfonatooxyethansulfonyl)phenylazo)naphthalen-2,7-disulfonat kalium/natrium |
451-440-9 |
586372-44-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
612-278-00-6 |
ethidiumbromid; 3,8-diamino-1-ethyl-6-phenylphenantridiniumbromid |
214-984-6 |
1239-45-8 |
Muta. 2 Acute Tox. 2 * Acute Tox. 4 * |
H341 H330 H302 |
GHS06 GHS08 Dgr |
H341 H330 H302 |
|
|
|
|
612-279-00-1 |
(R,S)-2-amino-3,3-dimethylbutanamid |
447-860-7 |
144177-62-8 |
Repr. 2 STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H361f *** H373 ** H319 H315 H317 |
GHS08 GHS07 Wng |
H361f *** H373 ** H319 H315 H317 |
|
|
|
|
612-280-00-7 |
3-amino-9-ethylcarbazol; 9-ethylcarbazol-3-ylamin |
205-057-7 |
132-32-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
612-281-00-2 |
leucomalakit grønt; N, N,N',N'-tetramethyl-4,4'- benzylidendianilin |
204-961-9 |
129-73-7 |
Carc. 2 Muta. 2 |
H351 H341 |
GHS08 Wng |
H351 H341 |
|
|
|
|
612-282-00-8 |
octadecylamin |
204-695-3 |
124-30-1 |
Asp. Tox. 1 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H373 (mavetarmkanal, lever, immun system) H315 H318 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H304 H373 (mavetarmkanal, lever, immun system) H315 H318 H410 |
|
M = 10 M = 10 |
|
|
612-283-00-3 |
(Z)-octadec-9-enylamin |
204-015-5 |
112-90-3 |
Acute Tox. 4 Asp Tox. 1 STOT SE 3 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H335 H373 (mavetarmkanal, lever, immunsystem) H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H304 H335 H373 (mavetarmkanal, lever, immunsystem) H314 H410 |
|
M = 10 M = 10 |
|
|
612-284-00-9 |
aminer, hydrogeneret talg-alkyl |
262-976-6 |
61788-45-2 |
Asp Tox. 1 STOT RE 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H373 (mavetarmkanal, lever, immunsystem) H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H304 H373 (mavetarmkanal, lever, immunsystem) H315 H318 H410 |
|
M = 10 M = 10 |
|
|
612-285-00-4 |
aminer, kokosalkyl |
262-977-1 |
61788-46-3 |
Acute Tox. 4 Asp. Tox. 1 STOT SE 3 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H335 H373 (mavetarmkanal, lever, immunsystem) H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H304 H335 H373 (mavetarmkanal, lever, immunsystem) H314 H410 |
|
M = 10 M = 10 |
|
|
612-286-00-X |
aminer, talg-alkyl |
263-125-1 |
61790-33-8 |
Acute Tox. 4 Asp. Tox. 1 STOT RE 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H304 H373 (mavetarmkanal, lever, immunsystem) H314 H400 H410 |
GHS05 GHS07 GHS08 GHS09 Dgr |
H302 H304 H373 (mavetarmkanal, lever, immunsystem) H314 H410 |
|
M = 10 M = 10 |
|
|
612-287-00-5 |
fluazinam (ISO); 3-chlor-N-[3-chlor-2,6-dinitro-4-(trifluormethyl)phenyl]-5-(trifluormethyl)pyridin-2-amin |
— |
79622-59-6 |
Repr. 2 Acute Tox. 4 Eye Dam. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H318 H317 H400 H410 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H361d H332 H318 H317 H410 |
|
M = 10 M = 10 |
|
|
613-001-00-1 |
ethyleneimin; aziridin |
205-793-9 |
151-56-4 |
Flam. Liq. 2 Carc. 1B Muta. 1B Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H340 H330 H310 H300 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H340 H330 H310 H300 H314 H411 |
|
|
D |
|
613-002-00-7 |
pyridin |
203-809-9 |
110-86-1 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
* |
|
|
613-003-00-2 |
1,2,3,4-tetranitrocarbazol |
— |
6202-15-9 |
Expl. 1.1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H201 H332 H312 H302 |
GHS01 GHS07 Dgr |
H201 H332 H312 H302 |
|
|
|
|
613-004-00-8 |
crimidin (ISO); 2-chlor-6-methylpyrimidin-4- yldimethylamin |
208-622-6 |
535-89-7 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
613-007-00-4 |
desmetryne (ISO); 6-isopropylamino-2-methylamino-4-methylthio-1,3,5- triazine |
213-800-1 |
1014-69-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
613-008-00-X |
dazomet (ISO); tetrahydro-3,5-dimethyl-1,3,5- thiadiazine-2-thion |
208-576-7 |
533-74-4 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
613-009-00-5 |
2,4,6-trichlor-1,3,5-triazin; cyanurchlorid |
203-614-9 |
108-77-0 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H330 H302 H314 H317 |
GHS06 GHS05 Dgr |
H330 H302 H314 H317 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
613-010-00-0 |
ametryn (ISO); 2-ethylamino-4-isopropylamino-6-methylthio-1,3,5-triazin |
212-634-7 |
834-12-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
613-011-00-6 |
amitrol (ISO); 1,2,4-triazol-3-ylamin |
200-521-5 |
61-82-5 |
Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H361d *** H373 ** H411 |
GHS08 GHS09 Wng |
H361d *** H373 ** H411 |
|
|
|
|
613-012-00-1 |
bentazon (ISO); 3-isopropyl-2,1,3-benzothiadiazin-4-on-2,2-dioxid |
246-585-8 |
25057-89-0 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H302 H319 H317 H412 |
GHS07 Wng |
H302 H319 H317 H412 |
|
|
|
|
613-013-00-7 |
cyanazin (ISO); 2-(4-chlor-6-ethylamino-1,3,5-triazin-2-ylamino)-2-methylpropionitril |
244-544-9 |
21725-46-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-014-00-2 |
ethoxyquin (ISO); 6-ethoxy-1,2-dihydro-2,2,4-trimethylquinolin |
202-075-7 |
91-53-2 |
Acute Tox. 4* |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-015-00-8 |
fenazaflor (ISO); phenyl 5,6-dichlor-2-trifluormethylbenzimidazol-1-carboxylat |
238-134-9 |
14255-88-0 |
Acute Tox. 4* Acute Tox. 4* Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
613-016-00-3 |
fuberidazol (ISO); 2-(2-furyl-)-1H-benzimidazol |
223-404-0 |
3878-19-1 |
Carc. 2 Acute Tox. 4 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 (heart) H317 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H373 (heart) H317 H410 |
|
M = 1 |
|
|
613-017-00-9 |
bis(8-hydroxyquinolinium)sulfat |
205-137-1 |
134-31-6 |
Acute Tox. 4* |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-018-00-4 |
morfamquat (ISO); 1,1'-bis(3,5-dimethylmorpholinocarbonylmethyl)-4,4'-bipyridyl |
|
7411-47-4 |
Acute Tox. 4* Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 3 |
H302 H319 H335 H315 H412 |
GHS07 Wng |
H302 H319 H335 H315 H412 |
|
|
|
|
613-019-00-X |
thioquinox (ISO); 2-thio-1,3-dithiolo(4,5,b)quinoxalin |
202-272-8 |
93-75-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-020-00-5 |
tridemorph (ISO); 2,6-dimethyl-4-tridecylmorpholin |
246-347-3 |
24602-86-6 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H332 H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360D *** H332 H302 H315 H410 |
|
|
|
|
613-021-00-0 |
dithianon (ISO); 5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazin-2,3-dicarbonitril |
222-098-6 |
3347-22-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-022-00-6 |
pyrethriner indeholdende cineriner, med undtagelse af sådanne specificeret andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
613-023-00-1 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl [1R-[1α[S*(Z)],3β]]-chrysanthemat; pyrethrin I |
204-455-8 |
121-21-1 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
|
|
613-024-00-7 |
2-methyl-4-oxo-3-(penta-2,4-dienyl)cyclopent-2-enyl[1R-[1α[S*(Z)](3β)]]-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)-2,2-dimethylcyclopropancarboxylat; pyrethrin II |
204-462-6 |
121-29-9 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
|
|
613-025-00-2 |
cinerin I; 3-(but-2-enyl)-2-methyl-4- oxocyclopent-2-enyl 2,2- dimethyl-3-(2-methylprop-1- enyl)cyclopropanecarboxylate |
246-948-0 |
25402-06-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-026-00-8 |
cinerin II; 3-(but-2-enyl)-2-methyl-4-oxocyclopent-2-enyl-2,2-dimethyl-3-(3-methoxy-2-methyl-3-oxoprop-1-enyl)cyclopropancarboxylat |
204-454-2 |
121-20-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-027-00-3 |
piperidin |
203-813-0 |
110-89-4 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H311 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H311 H314 |
|
* |
|
|
613-028-00-9 |
morpholin |
203-815-1 |
110-91-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dg |
H226 H332 H312 H302 H314 |
|
|
|
|
613-029-00-4 |
dichlor-1,3,5-triazintrion; dichlorisocyanursyre |
220-487-5 |
2782-57-2 |
Ox. Sol. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H319 H335 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
|
T |
|
613-030-00-X |
troclosen-kalium; [1] troclosen-natrium [2] |
218-828-8 [1] 220-767-7 [2] |
2244-21-5 [1] 2893-78-9 [2] |
Ox. Sol. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H319 H335 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
* STOT SE 3; H335: C ≥ 10 % EUH031: C ≥10 % |
G |
|
613-030-01-7 |
troclosennatrium, dihydrat |
220-767-7 |
51580-86-0 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H410 |
EUH031 |
|
|
|
613-031-00-5 |
symclosen; trichlorisocyanursyre; trichlor-1,3,5-triazinetrion |
201-782-8 |
87-90-1 |
Ox. Sol. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H302 H319 H335 H400 H410 |
GHS03 GHS07 GHS09 Dgr |
H272 H302 H319 H335 H410 |
EUH031 |
|
|
|
613-032-00-0 |
methyl-2,3,5,6-tetrachlor-4-pyridylsulfon; 2,3,5,6-tetrachlor-4-(methylsulfonyl)pyridin |
236-035-5 |
13108-52-6 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H312 H302 H319 H317 |
GHS07 Wng |
H312 H302 H319 H317 |
|
|
|
|
613-033-00-6 |
2-methylaziridin; propyleneimin |
200-878-7 |
75-55-8 |
Flam. Liq. 2 Carc. 1B Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Eye Dam. 1 Aquatic Chronic 2 |
H225 H350 H330 H310 H300 H318 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H330 H310 H300 H318 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
613-034-00-1 |
1,2-dimethylimidazol |
217-101-2 |
1739-84-0 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
|
613-035-00-7 |
1-methylimidazol |
210-484-7 |
616-47-7 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
613-036-00-2 |
2-methylpyridin; 2-picolin |
203-643-7 |
109-06-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H312 H302 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 H319 H335 |
|
|
|
|
613-037-00-8 |
4-methylpyridin; 4-picolin |
203-626-4 |
108-89-4 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H226 H311 H332 H302 H319 H335 H315 |
GHS02 GHS06 Dgr |
H226 H311 H332 H302 H319 H335 H315 |
|
|
|
|
613-038-00-3 |
6-phenyl-1,3,5-triazin-2,4- diyldiamin; 6-phenyl-1,3,5-triazin-2,4-diamin; benzoguanamin |
202-095-6 |
91-76-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
613-039-00-9 |
ethylenthiourinstof; imidazolidin-2-thion; 2-imidazolin-2-thiol |
202-506-9 |
96-45-7 |
Repr. 1B Acute Tox. 4 * |
H360D *** H302 |
GHS08 GHS07 Dgr |
H360D *** H302 |
|
|
|
|
613-040-00-4 |
azaconazol (ISO); 1-{[2-(2,4-dichlorphenyl)-1,3-dioxolan-2-yl]methyl}-1H-1,2.4-triazol |
262-102-3 |
60207-31-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-041-00-X |
morpholin-4-carbonylchlorid |
239-213-0 |
15159-40-7 |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 |
H351 H319 H315 |
GHS08 Wng |
H351 H319 H315 |
EUH014 |
|
|
|
613-043-00-0 |
imazalilsulfat (ISO) pulver; 1-[2-(allyloxy)ethyl-2-(2,4-dichlorphenyl)]-1H-imidazoliumhydrogensulfat; [1] (±)-1-[2-(allyloxy)ethyl-2-(2,4-dichlorphenyl)]-1H-imidazoliumhydrogensulfat [2] |
261-351-5 [1] 281-291-3 [2] |
58594-72-2 [1] 83918-57-4 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
613-043-01-8 |
imazalilsulfat (ISO), vandig opløsning; 1-[2-(allyloxy)ethyl-2-(2,4- dichlorphenyl)]-1H-imidazoliumhydrogensulfat; [1] (±)-1-[2-(allyloxy)ethyl-2-(2,4- dichlorphenyl)]-1H-imidazoliumhydrogensulfat [2] |
261-351-5 [1] 281-291-3 [2] |
58594-72-2 [1] 83918-57-4 [2] |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Wng |
H302 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 50 % Skin Irrit. 2; H315: 30 % ≤ C < 50 % Eye Dam. 1; H318: 15 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
|
|
613-044-00-6 |
captan (ISO); 1,2,3,6-tetrahydro-N-(trichlormethylthio)phthalimid |
205-087-0 |
133-06-2 |
Carc. 2 Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H331 H318 H317 H400 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H331 H318 H317 H400 |
|
M=10 |
|
|
613-045-00-1 |
folpet (ISO); N-(trichlormethylthio)phthalimid |
205-088-6 |
133-07-3 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H351 H332 H319 H317 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H319 H317 H400 |
|
M=10 |
|
|
613-046-00-7 |
captafol (ISO); 1,2,3,6-tetrahydro-N-(1,1,2,2- tetrachlorethylthio)phthalimid |
219-363-3 |
2425-06-1 |
Carc. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350 H317 H410 |
|
|
|
|
613-047-00-2 |
1-dimethylcarbamoyl-5-methylpyrazol-3-yldimethylcarbamat; dimetilan (ISO) |
211-420-0 |
644-64-4 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
613-048-00-8 |
carbendazim (ISO); methylbenzimidazol-2-ylcarbamat |
234-232-0 |
10605-21-7 |
Muta. 1B Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H340 H360FD H400 H410 |
GHS08 GHS09 Dgr |
H340 H360FD H410 |
|
|
|
|
613-049-00-3 |
benomyl (ISO); methyl-1-(butylcarbamoyl)benzimidazol-2-ylcarbamat |
241-775-7 |
17804-35-2 |
Muta. 1B Repr. 1B STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H340 H360FD H335 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H340 H360FD H335 H315 H317 H410 |
|
M = 10 |
|
|
613-050-00-9 |
carbadox (INN); methyl 3-(quinoxalin-2-ylmethylen)carbazat-1,4-dioxid; 2-(methoxycarbonylhydrazonomethyl)quinoxalin-1,4-dioxid |
229-879-0 |
6804-07-5 |
Flam. Sol. 1 Carc. 1B Acute Tox. 4 * |
H228 H350 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H350 H302 |
|
|
T |
|
613-051-00-4 |
molinat (ISO); S-ethyl-1-perhydroazepincarbothioat; S-ethyl-perhydroazepin-1-carbothioat |
218-661-0 |
2212-67-1 |
Carc. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f *** H332 H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361f *** H332 H302 H373 ** H317 H410 |
|
M = 100 |
|
|
613-052-00-X |
trifenmorph (ISO); 4-tritylmorpholin |
215-812-2 |
1420-06-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-053-00-5 |
anilazin (ISO); 2-chlor-N-(4,6-dichlor-1,3,5- triazin-2-yl)anilin |
202-910-5 |
101-05-3 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
613-054-00-0 |
thiabendazol (ISO); 2-(thiazol-4-yl)benzimidazol |
205-725-8 |
148-79-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-056-00-1 |
1,2-dimethyl-3,5-diphenylpyrazoliummethylsulfat; difenzoquatmethylsulfat |
256-152-5 |
43222-48-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS09 Wng |
H302 H410 |
|
|
|
|
613-058-00-2 |
permethrin (ISO); m-phenoxybenzyl 3-(2,2-dichorovinyl)-2,2-dimethylcyclopropancarboxylat |
258-067-9 |
52645-53-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H317 H410 |
|
M = 1 000 |
|
|
613-059-00-8 |
profluralin (ISO); N-(cyclopropylmethyl)-α, α,α-trifluor-2,6-dinitro-N-propyl-p-toluidin |
247-656-6 |
26399-36-0 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
613-060-00-3 |
resmethrin (ISO); 5-benzyl-3-furylmethyl (±)-cis-trans-chrysanthemat |
233-940-7 |
10453-86-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M=1000 |
|
|
613-061-00-9 |
6-(1α,5aβ,8aβ,9-pentahydroxy-7β-isopropyl-2β,5β,8β-trimethylperhydro-8bα,9-epoxy-5,8-ethanocyclopenta[1,2-b]indenyl)pyrrol-2-carboxylat; ryania |
239-732-2 |
15662-33-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
613-062-00-4 |
sabadilla (ISO); veratrin |
— |
8051-02-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
|
|
|
613-063-00-X |
secbumeton (ISO); 2-sec-butylamino-4-ethylamino-6-methoxy-1,3,5-triazin |
247-554-1 |
26259-45-0 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
613-064-00-5 |
5-(3,6,9-trioxa-2-undecyloxy)benzo(d)-1,3-dioxolan; sesamex |
— |
51-14-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-065-00-0 |
simetryn (ISO); 2,4-bis(ethylamino)-6-methylthio-1,3,5-triazin |
213-801-7 |
1014-70-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-066-00-6 |
terbumeton (ISO); 2-tert-butylamino-4-ethylamino-6-methoxy-1,3,5-triazin |
251-637-8 |
33693-04-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-067-00-1 |
propazin (ISO); 2-chlor-4,6-bis(isopropylamino)-1,3,5-triazin |
205-359-9 |
139-40-2 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
613-068-00-7 |
atrazin (ISO); 2-chlor-4-ethylamin-6-isopropylamin-1,3,5-triazin |
217-617-8 |
1912-24-9 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
613-069-00-2 |
ε-caprolactam |
203-313-2 |
105-60-2 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H332 H302 H319 H335 H315 |
GHS07 Wng |
H332 H302 H319 H335 H315 |
|
|
|
|
613-070-00-8 |
propylenthiourinstof |
— |
2122-19-2 |
Repr. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H361d *** H302 H412 |
GHS08 GHS07 Wng |
H361d *** H302 H412 |
|
|
|
|
613-071-00-3 |
2-fluor-5-trifluormethylpyridin |
400-290-2 |
69045-82-5 |
Flam. Liq. 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H317 H412 |
GHS02 GHS07 Wng |
H226 H317 H412 |
|
|
|
|
613-072-00-9 |
N, N-bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amin |
401-280-0 |
91273-04-0 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
613-073-00-4 |
N, N-dimethyl-2-(3-(4-chlorphenyl)-4,5-dihydropyrazol-1-ylphenylsulfonyl)ethylamin |
401-410-6 |
10357-99-0 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H373 ** H317 H411 |
GHS08 GHS09 Wng |
H373 ** H317 H411 |
|
|
|
|
613-074-00-X |
3-(3-methylpent-3-yl)isoxazol-5-ylamin |
401-460-9 |
82560-06-3 |
Acute Tox. 3 * Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 3 |
H331 H301 H318 H412 |
GHS06 GHS05 Dgr |
H331 H301 H318 H412 |
|
|
|
|
613-075-00-5 |
1,3-dichlor-5-ethyl-5-methylimidazolidin-2,4-dion |
401-570-7 |
89415-87-2 |
Ox. Sol. 1 **** Acute Tox. 3 * Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 |
H271 H331 H314 H302 H317 H400 |
GHS03 GHS06 GHS05 GHS09 Dgr |
H271 H331 H314 H302 H317 H400 |
|
|
|
|
613-076-00-0 |
3-chlor-5-trifluormethyl-2-pyridylamin |
401-670-0 |
79456-26-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
613-077-00-6 |
blanding af 5-heptyl-1,2,4-triazol-3-ylamin og 5-nonyl-1,2,4-triazol-3-ylamin |
401-940-8 |
— |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H302 H319 H411 |
GHS07 GHS09 Wng |
H302 H319 H411 |
|
|
|
|
613-078-00-1 |
N,N,N,N-tetrakis(4,6-bis(butyl-(N-methyl-2,2,6,6-tetramethylpiperidin-4-yl)amino)triazin-2-yl)-4,7-diazadecan-1,10- diamin |
401-990-0 |
106990-43-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-079-00-7 |
4-(1(eller 4 eller 5 eller 6)-methyl-8,9,10-trinorborn-5-en-2-yl)pyridin, blanding af isomerer |
402-520-7 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
|
|
|
|
613-080-00-2 |
3-(bis(2-ethylhexyl)aminomethyl)benzothiazol-2(3H)-thion |
402-540-6 |
105254-85-1 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
613-081-00-8 |
1-butyl-2-methylpyridiniumbromid |
402-680-8 |
26576-84-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
613-082-00-3 |
2-methyl-1-pentylpyridiniumbromid |
402-690-2 |
— |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H312 H302 H412 |
GHS07 Wng |
H312 H302 H412 |
|
|
|
|
613-083-00-9 |
2-(4-(3-(4-chlorphenyl)-2-pyrazolin-1-yl)phenylsulfonyl)ethyldimethylammoniumformiat |
402-120-2 |
— |
Skin Corr. 1B STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H373 ** H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H314 H373 ** H317 H410 |
|
|
|
|
613-084-00-4 |
2-(4-(3-(4-chlorphenyl)-4,5-dihydropyrazolyl)phenylsulfonyl)ethyldimethylammoniumhydrogenphosphonat |
402-490-5 |
106359-93-7 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
613-085-00-X |
blanding af 1,1'-(methylenbis(4,1-phenylen))dipyrrol-2,5-dion og N-(4-(4-(2,5-dioxopyrrol-1-yl)benzyl)phenyl)acetamid og 1-(4-(4-(5-oxo-2H-2-furylidenamino)benzyl)phenyl)pyrrol-2,5-dion |
401-970-1 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-086-00-5 |
coffein |
200-362-1 |
58-08-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-087-00-0 |
tetrahydrothiophen |
203-728-9 |
110-01-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H225 H332 H312 H302 H319 H315 H412 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 H319 H315 H412 |
|
|
|
|
613-088-00-6 |
1,2-benzisothiazol-3(2H)-on; 1,2-benzisothiazolin-3-on |
220-120-9 |
2634-33-5 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H315 H318 H317 H400 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H317 H400 |
|
Skin Sens. 1; H317: C ≥ 0,05 % |
|
|
613-089-00-1 |
diquatdibromid; [1] diquatdichlorid; [2] 6,7-dihydrodipyrido[1,2-α:2',1'- c]pyrazindiyliumdihydroxid [3] |
201-579-4 [1] 223-714-6 [2] 301-467-6 [3] |
85-00-7 [1] 4032-26-2 [2] 94021-76-8 [3] |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H372 ** H302 H319 H335 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H372 ** H302 H319 H335 H315 H317 H410 |
|
|
|
|
613-090-00-7 |
paraquat-dichlorid; 1,1-dimethyl-4,4'-bipyridiniumdichlorid; [1] paraquat-dimethylsulfat; 1,1-dimethyl-4,4'-bipyridiniumdimethylsulfat [2] |
217-615-7 [1] 218-196-3 [2] |
1910-42-5 [1] 2074-50-2 [2] |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H372 ** H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H372 ** H319 H335 H315 H410 |
|
|
|
|
613-091-00-2 |
morfamquatdichlorid; [1] morfamquatsulfat [2] |
225-062-8 [1] [2] |
4636-83-3 [1] 29873-36-7 [2] |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 3 |
H302 H319 H335 H315 H412 |
GHS07 Wng |
H302 H319 H335 H315 H412 |
|
|
|
|
613-092-00-8 |
1,10-phenanthrolin |
200-629-2 |
66-71-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
613-093-00-3 |
hexanatrium-6,13-dichlor-3,10-bis((4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacen-4,11-disulfonat |
400-050-7 |
85153-92-0 |
Resp. Sens. 1 Skin Sens. 1 |
H334 H317 |
GHS08 Dgr |
H334 H317 |
|
|
|
|
613-094-00-9 |
4-methoxy-N,6-dimethyl-1,3,5-triazin-2-ylamin |
401-360-5 |
5248-39-5 |
Acute Tox. 4 * STOT RE 2 * |
H302 H373 ** |
GHS08 GHS07 Wng |
H302 H373 ** |
|
|
|
|
613-095-00-4 |
natrium-3-(2H-benzotriazol-2-yl)-5-sec-butyl-4-hydroxybenzensulfonat |
403-080-9 |
92484-48-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-096-00-X |
2-amino-6-ethoxy-4-methylamino-1,3,5-triazin |
403-580-7 |
62096-63-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-097-00-5 |
7-amino-3-((5-carboxymethyl-4-methyl-1,3-thiazol-2-ylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-2-carboxylsyre |
403-690-5 |
111298-82-9 |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
|
|
|
|
613-098-00-0 |
N-(n-octyl)-2-pyrrolidon |
403-700-8 |
2687-94-7 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
613-099-00-6 |
1-dodecyl-2-pyrrolidon |
403-730-1 |
2687-96-9 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
613-100-00-X |
2,9-bis(3-(diethylamino)propylsulfamoyl)quino(2,3-b)acridin-7,14-dion |
404-230-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
613-101-00-5 |
N-tert-pentyl-2-benzothiazolsulfenamid |
404-380-2 |
110799-28-5 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-102-00-0 |
dimethomorph (ISO); 4-(3-(4-chlorphenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholin |
404-200-2 |
110488-70-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-103-00-6 |
natrium-5-n-butylbenzotriazol |
404-450-2 |
118685-34-0 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H302 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H411 |
|
|
|
|
613-104-00-1 |
5-tert-butyl-3-isoxazolylaminhydrochlorid |
404-840-2 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H318 H412 |
|
|
|
|
613-105-00-7 |
hexakis(tetramethylammonium)-4,4'-vinylenbis((3-sulfonato-4,1-phenylen)imino(6-morpholino-1,3,5-triazin-4,2-diyl)imino)bis(5-hydroxy-6-phenylazonaphthalen-2,7-disulfonat) |
405-160-9 |
124537-30-0 |
Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H317 H412 |
GHS06 Dgr |
H301 H317 H412 |
|
|
|
|
613-106-00-2 |
tetrakalium-2-(4-(5-(1-(2,5-disulfonatophenyl)-3-ethoxycarbonyl-5-hydroxypyrazol-4-yl)penta-2,4-dienyliden)-3-ethoxycarbonyl-5-oxo-2-pyrazolin-1-yl)benzen-1,4-disulfonat |
405-240-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
613-107-00-8 |
hexanatrium-2,2'-vinylenbis((3-sulfonato-4,1-phenylen)imino(6-(N-cyanethyl-N-(2-hydroxypropyl)amino)-1,3,5-triazin-4,2-diyl)imino)dibenzen-1,4-disulfonat |
405-280-1 |
76508-02-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
613-108-00-3 |
benzothiazol-2-thiol |
205-736-8 |
149-30-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-109-00-9 |
bis(piperidinothiocarbonyl)disulfid |
202-328-1 |
94-37-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H319 H335 H315 H317 |
GHS07 Wng |
H319 H335 H315 H317 |
|
|
|
|
613-110-00-4 |
dimepiperat (ISO); S-(1-methyl-1-phenylethyl)piperidin-1-carbothioat |
262-784-2 |
61432-55-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
613-111-00-X |
1,2,4-triazol |
206-022-9 |
288-88-0 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 |
H361d *** H302 H319 |
GHS08 GHS07 Wng |
H361d *** H302 H319 |
|
|
|
|
613-112-00-5 |
octhilinon (ISO); 2-octyl-2H-isothiazol-3-on |
247-761-7 |
26530-20-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H302 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H302 H314 H317 H410 |
|
Skin Sens. 1; H317: C ≥ 0,05 % |
|
|
613-113-00-0 |
2-(morpholinothio)benzothiazol |
203-052-4 |
102-77-2 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
|
|
|
|
613-114-00-6 |
2,2',2''-(hexahydro-1,3,5-triazin-1,3,5-triyl)triethanol; 1,3,5-tris(2-hydroxyethyl)hexahydro-1,3,5-triazin |
225-208-0 |
4719-04-4 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
Skin Sens. 1; H317: C ≥ 0,1 % |
|
|
613-115-00-1 |
hymexazol (ISO); 3-hydroxy-5-methylisoxazol |
233-000-6 |
10004-44-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
613-116-00-7 |
tolylfluanid (ISO); dichlor-N-[(dimethylamino)sulfonyl]fluor-N-(p-tolyl)methansulfenamid indeholdende < 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm |
211-986-9 |
731-27-1 |
Acute Tox. 2 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H330 H372** H319 H335 H315 H317 H400 |
GHS06 GHS08 GHS09 Dgr |
H330 H372** H319 H335 H315 H317 H400 |
|
M=10 |
|
|
613-116-01-4 |
tolylfluanid (ISO); dichlor-N-[(dimethylamino)sulfonyl]fluor-N-(p-tolyl)methansulfenamid indeholdende < 0,1 % (w/w) partikler med en aerodynamisk diameter på mindre end 50 μm |
211-986-9 |
731-27-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H319 H335 H315 H317 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H400 |
|
M=10 |
|
|
613-117-00-2 |
diniconazol (ISO); (E)-β-[(2,4-dichlorphenyl)methylen]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol; (E)-(RS)-1-(2,4-dichlorphenyl)-4,4-dimethyl-2-(1H-1,2,4- triazol-1-yl)pent-1-en-3-ol |
— |
76714-88-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-118-00-8 |
flubenzimin (ISO); N-[3-phenyl-4,5-bis[(trifluormethyl)imino]thiazolidin-2-yliden]anilin |
253-703-1 |
37893-02-0 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
613-119-00-3 |
(benzothiazol-2-ylthio)methylthiocyanat; TCMTB |
244-445-0 |
21564-17-0 |
Acute Tox. 2 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H319 H315 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H302 H319 H315 H317 H410 |
|
|
|
|
613-120-00-9 |
bioresmethrin (ISO); (5-benzylfur-3-yl)methyl(1R)-trans-2,2-dimethyl-3-(2-methylpropenyl)cyclopropancarboxylat |
249-014-0 |
28434-01-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1000 |
|
|
613-122-00-X |
diclobutrazol (ISO); (R*, R*)-(±)-β-[(2,4-dichlorphenyl)methyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazol-1-ethanol; (2RS, 3RS)-1-(2,4-dichlorphenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1yl)pentan-3-ol |
— |
75736-33-3 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
613-123-00-5 |
5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazol-3-thion; etem |
251-684-4 |
33813-20-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-124-00-0 |
fenpropimorph (ISO); cis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholin |
266-719-9 |
67564-91-4 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H361d *** H302 H315 H411 |
GHS08 GHS07 GHS09 Wng |
H361d *** H302 H315 H411 |
|
|
|
|
613-125-00-6 |
hexythiazox (ISO); trans-5-(4-chlorphenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidincarboxamid |
— |
78587-05-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-126-00-1 |
imazapyr (ISO); 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridincarboxylat |
— |
81334-34-1 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
613-127-00-7 |
1,1-dimethylpiperidiniumchlorid; mepiquat-chlorid |
246-147-6 |
24307-26-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
613-128-00-2 |
prochloraz (ISO); N-propyl-N-[2-(2,4,6-trichlorphenoxy)ethyl]-1H-imidazol-1-carboxamid |
266-994-5 |
67747-09-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-129-00-8 |
metamitron (ISO); 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-on |
255-349-3 |
41394-05-2 |
Acute Tox. 4 * Aquatic Acute 1 |
H302 H400 |
GHS07 GHS09 Wng |
H302 H400 |
|
|
|
|
613-131-00-9 |
pyroquilon (ISO); 1,2,5,6-tetrahydropyrrolo[3,2,1-ij]quinolin-4-on |
— |
57369-32-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
613-132-00-4 |
hexazinon (ISO); 3-cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazin-2,4-dion |
257-074-4 |
51235-04-2 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
613-134-00-5 |
myclobutanil (ISO); 2-(4-chlorphenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexannitril |
— |
88671-89-0 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H361d *** H302 H319 H411 |
GHS08 GHS07 GHS09 Wng |
H361d *** H302 H319 H411 |
|
|
|
|
613-135-00-0 |
di(benzothiazol-2-yl)disulfid |
204-424-9 |
120-78-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
EUH031 |
|
|
|
613-136-00-6 |
N-cyclohexylbenzothiazol-2-sulfenamid |
202-411-2 |
95-33-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-137-00-1 |
methabenzthiazuron (ISO); 1-(1,3-benzothiazol-2-yl)1,3-dimethylurinstof |
242-505-0 |
18691-97-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-138-00-7 |
quinoxyfen (ISO); 5,7-dichlor-4-(4-fluorphenoxy)quinolin |
— |
124495-18-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-139-00-2 |
metsulfuron-methyl (ISO); 2-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)benzoesyre |
— |
74223-64-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1000 |
|
|
613-140-00-8 |
cycloheximid (ISO); 4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidin-2,6-dion |
200-636-0 |
66-81-9 |
Muta. 2 Repr. 1B Acute Tox. 2 * Aquatic Chronic 2 |
H341 H360D *** H300 H411 |
GHS06 GHS08 GHS09 Dgr |
H341 H360D *** H300 H411 |
|
|
|
|
613-141-00-3 |
1,4-diamino-2-(2-butyltetrazol-5-yl)-3-cyanoanthraquinon |
401-470-3 |
93686-63-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-142-00-9 |
trans-N-methyl-2-styryl-[4'-aminomethin-(1-acetyl-1-(2-methoxyphenyl)acetamido)]pyridiniumacetat |
405-860-4 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-143-00-4 |
1-(3-phenylpropyl)-2-methylpyridiniumbromid |
405-930-4 |
10551-42-5 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
|
|
|
|
613-144-00-X |
reaktionsprodukter af: poly(vinylacetat), delvist hydrolyseret, med (E)-2-(4-formylstyryl)-3,4-dimethylthiazoliummethylsulfat |
406-460-2 |
125139-08-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-145-00-5 |
(S)-3-benzyloxycarbonyl-1,2,3,4-tetrahydro-isoquinolinium-4-methylbenzensulfonat |
406-960-0 |
77497-97-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-146-00-0 |
N-ethyl-N-methylpiperidiniumiodid |
407-780-5 |
4186-71-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
613-147-00-6 |
4-[2-(1-methyl-2-(4-morpholinyl)ethoxy)ethyl]morpholin |
407-940-4 |
111681-72-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-148-00-1 |
tetranatrium-1,2-bis(4-fluor-6-[5-(1-amino-2-sulfonatoanthraquinon-4-ylamino)-2,4,6-trimethyl-3-sulfonatophenylamino]-1,3,5-triazin-2-ylamino)ethan |
411-240-4 |
143683-23-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-150-00-2 |
2,2'-[3,3'-(piperazin-1,4-diyl)dipropyl]bis(1H-benzimidazo[2,1-b]benzo[l, m,n][3,8]phenanthrolin-1,3,6-trion |
406-295-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-151-00-8 |
1-(3-mesyloxy-5-trityloxymethyl-2-D-threofuryl)thymin |
406-360-9 |
104218-44-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-152-00-3 |
phenyl-N-(4,6-dimethoxypyrimidin-2-yl)carbamat |
406-600-2 |
89392-03-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-153-00-9 |
2,3,5-trichlorpyridin |
407-270-2 |
16063-70-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-154-00-4 |
2-amino-4-chlor-6-methoxypyrimidin |
410-050-9 |
5734-64-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-155-00-X |
5-chlor-2,3-difluorpyridin |
410-090-7 |
89402-43-7 |
Flam. Liq. 3 Acute Tox. 4 * Aquatic Chronic 3 |
H226 H302 H412 |
GHS02 GHS07 Wng |
H226 H302 H412 |
|
|
|
|
613-156-00-5 |
2-butyl-4-chlor-5-formylimidazol |
410-260-0 |
83857-96-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-157-00-0 |
2,4-diamino-5-methoxymethylpyrimidin |
410-330-0 |
54236-98-5 |
Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 |
H302 H373 ** H319 |
GHS08 GHS07 Wng |
H302 H373 ** H319 |
|
|
|
|
613-158-00-6 |
2,3-dichlor-5-trifluormethylpyridin |
410-340-5 |
69045-84-7 |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H332 H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H302 H318 H317 H411 |
|
|
|
|
613-159-00-1 |
fenazaquin (ISO); 4-[2-[4-(1,1-dimethylethyl)phenyl]ethoxy]quinazolin |
410-580-0 |
120928-09-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H410 |
|
|
|
|
613-160-00-7 |
(1S)-2-methyl-2,5-diazobicyclo[2.2.1]heptandihydrobromid |
411-000-9 |
125224-62-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
613-161-00-2 |
2,4-diamino-6-hydroxymethylpteridin hydrobromid |
430-620-0 |
76145-91-0 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373** H317 H412 |
GHS08 GHS07 Wng |
H373** H317 H412 |
|
|
|
|
613-162-00-8 |
(6R-trans)-1-((7-ammonio-2-carboxylato-8-oxo-5-thia-1- azabicyclo[4.2.0]oct-2-en-3-yl)methyl)pyridiniumiodid |
423-260-0 |
100988-63-4 |
Muta. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H317 H411 |
|
|
|
|
613-163-00-3 |
azimsulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-methyl-4-(2-methyl-2H-tetrazol-5-yl)pyrazol-5-ylsulfonyl]urinstof |
— |
120162-55-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M=1000 |
|
|
613-164-00-9 |
flufenacet (ISO); N-(4-fluorphenyl)-N-isopropyl-2-(5-trifluormethyl-[1,3,4]thiadiazol-2-yloxy)acetamid |
— |
142459-58-3 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373** H317 H410 |
|
M=100 |
|
|
613-165-00-4 |
flupyrsulfuron-methyl-natrium (ISO); methyl-2-[[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-trifluormethyl]nicotinat, mononatriumsalt |
— |
144740-54-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M=100 |
|
|
613-167-00-5 |
en blanding af: 5-chlor-2-methyl-4-isothiazolin-3-on [EF nr. 247-500-7] og 2-methyl-2H-isothiazol-3-on [EF nr. 220-239-6] (3:1) |
— |
55965-84-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥0,6 % Skin Irrit. 2; H315: 0,06 % ≤ C < 0,6 % Eye Irrit. 2; H319: 0,06 % ≤ C < 0,6 % Skin Sens. 1; H317: C ≥ 0,0015 % |
|
|
613-168-00-0 |
1-vinyl-2-pyrrolidon |
201-800-4 |
88-12-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 |
H351 H332 H312 H302 H373 ** H335 H318 |
GHS06 GHS05 GHS09 Dgr |
H351 H332 H312 H302 H373 ** H335 H318 |
|
|
D |
|
613-169-00-6 |
9-vinylcarbazol |
216-055-0 |
1484-13-5 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H312 H302 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H312 H302 H315 H317 H410 |
|
M=100 |
|
|
613-170-00-1 |
2,2-ethylmethylthiazolidin |
404-500-3 |
694-64-4 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
613-171-00-7 |
hexaconazol (ISO); (RS)-2-(2,4-dichlorphenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
413-050-7 |
79983-71-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
613-172-00-2 |
5-chlor-1,3-dihydro-2H-indol-2-on |
412-200-9 |
17630-75-0 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H361f *** H302 H317 H412 |
GHS08 GHS07 Wng |
H361f *** H302 H317 H412 |
|
|
|
|
613-173-00-8 |
fluquinconazol (ISO); 3-(2,4-dichlorphenyl)-6-fluor-2-(1H-1,2,4-triazol-1-yl)quinazolin-4-(3H)-on |
411-960-9 |
136426-54-5 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H372 ** H312 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H372 ** H312 H315 H410 |
|
|
|
|
613-174-00-3 |
tetraconazol (ISO); (+/-) 2-(2,4-dichlorphenyl)-3-(1H-1,2,4-triazol-1-yl)propyl-1,1,2,2-tetrafluorethylether |
407-760-6 |
112281-77-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
|
|
|
|
613-175-00-9 |
epoxiconazol (ISO); (2RS,3SR)-3-(2-chlorphenyl)-2-(4-fluorphenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxiran |
406-850-2 |
133855-98-8 |
Carc. 2 Repr. 1B Aquatic Chronic 2 |
H351 H360Df H411 |
GHS08 GHS09 Dgr |
H351 H360Df H411 |
|
|
|
|
613-176-00-4 |
2-methyl-2-azabicyclo[2.2.1]heptan |
404-810-9 |
4524-95-2 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H226 H312 H302 H373 ** H314 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H312 H302 H373 ** H314 |
|
|
|
|
613-177-00-X |
8-amino-7-methylquinolin |
412-760-4 |
5470-82-6 |
Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H317 H411 |
GHS07 GHS09 Wng |
H312 H302 H317 H411 |
|
|
|
|
613-178-00-5 |
4-ethyl-2-methyl-2-isopentyl-1,3-oxazolidin |
410-470-2 |
137796-06-6 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
613-179-00-0 |
lithium-3-oxo-1,2-(2H)-benzisothiazol-2-id |
411-690-1 |
111337-53-2 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H302 H314 H317 H411 |
GHS05 GHS07 Dgr |
H302 H314 H317 H411 |
|
|
|
|
613-180-00-6 |
N-(1,1-dimethylethyl)bis(2-benzothiazolsulfen)amid |
407-430-1 |
3741-80-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-181-00-1 |
5,5-dimethyl-perhydro-pyrimidin-2-on-α-(4-trifluormethyltyryl)-α-(4-trifluormethyl)cinnamylidenhydrazon |
405-090-9 |
67485-29-4 |
STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H372 ** H302 H319 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H319 H410 |
|
|
|
|
613-182-00-7 |
1-(1-naphthylmethyl)quinoliniumchlorid |
406-220-7 |
65322-65-8 |
Carc. 2 Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H351 H341 H302 H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H351 H341 H302 H315 H318 H412 |
|
|
|
|
613-183-00-2 |
en blanding af 5-(N-methylperfluoroctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-on og 5-(N-methylperfluorheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-on |
413-640-4 |
— |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
613-184-00-8 |
nitrilotriethylenammoniopropan-2-ol-2-ethylhexanat |
413-670-8 |
— |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
613-185-00-3 |
2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-on |
407-630-9 |
82633-79-2 |
Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
|
|
|
|
613-186-00-9 |
(2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-ylacetat |
408-050-9 |
76855-69-1 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H317 H411 |
|
|
|
|
613-187-00-4 |
5-(2-amino-5-cyan-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridin-3-ylazo)-3-methyl-2,4-dicarbonitrilthiophen |
410-530-8 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
613-188-00-X |
1-(3-(4-fluorphenoxy)propyl)-3-methoxy-4-piperidinon |
411-500-7 |
116256-11-2 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
613-189-00-5 |
1,4,7,10-tetrachis(p-toluensolfonil)-1,4,7,10-tetraazaciclododecano |
414-030-0 |
52667-88-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-190-00-0 |
dinatrium 1-amino-4-(2-(5-chlor-6-fluor-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo-phenylamino)-9,10-dioxo-9,10-dihydro-anthracen-2-sulfonat |
414-040-5 |
149530-93-8 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
613-191-00-6 |
3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidin |
421-150-7 |
143860-04-2 |
Repr. 1B Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360f *** H314 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H360f *** H314 H410 |
|
|
|
|
613-192-00-1 |
3-benzyl-exo-6-nitro-2,4-dioxo-3-aza-cis-bicyclo[3.1.0]hexan |
426-750-2 |
151860-15-0 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-193-00-7 |
pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaundecan-1,11-diyldisulfamoyl)di[phthalocyaninkobber(II)]heptalactat |
414-930-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-194-00-2 |
6,13-dichlor-3,10-bis{2-[4-fluor-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino]propylamino}benzo[5,6][1,4]oxazino[2,3-.b.]phenoxazin-4,11-disulfonsyre, lithium-, natriumsalt |
418-000-8 |
163062-28-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-195-00-8 |
2,2-(1,4-phenylen)bis((4H-3,1-benzoxazin-4-on) |
418-280-1 |
18600-59-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
613-196-00-3 |
5-[[4-chlor-6-[[2-[[4-fluor-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphthalen-2,7-disulfonsyre, natriumsalt |
418-380-5 |
168113-78-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-197-00-9 |
en blanding af 2,4,6-tri(butylcarbamoyl)-1,3,5-triazin; 2,4,6-tri(methylcarbamoyl)-1,3,5-triazin; [(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazin og [(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazin |
420-390-1 |
187547-46-2 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-198-00-4 |
2-amino-4-dimethylamino-6-trifluorethoxy-1,3,5-triazin |
415-500-8 |
145963-84-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
613-199-00-X |
en blanding af 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazin-2,4,6-trion; blanding af oligomerer af 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazin-2,4,6-trion |
421-550-1 |
— |
Carc. 1B Repr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H360D *** H317 H412 |
GHS08 Dgr |
H350 H360D *** H317 H412 |
|
|
|
|
613-200-00-3 |
reaktionsprodukt af kobber, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorsvovlsyre og 3-(2-sulfooxyethylsulfonyl)anilin, natriumsalte |
420-980-7 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-201-00-9 |
(R)-5-brom-3-(1-methyl-2-pyrrolidinylmethyl)-1H-indol |
422-390-5 |
143322-57-0 |
Repr. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H372 ** H332 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H361f *** H372 ** H332 H302 H317 H410 |
EUH070 |
|
|
|
613-202-00-4 |
pymetrozin (ISO); (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethylenamino)-1,2,4-triazin-3(2H)-on |
— |
123312-89-0 |
Carc. 2 Aquatic Chronic 3 |
H351 H412 |
GHS08 Wng |
H351 H412 |
|
|
|
|
613-203-00-X |
pyraflufen-ethyl (ISO); 2-chlor-5-(4-chlor-5-difluormethoxy-1-methylpyrazol-3-yl)-4-fluorphenoxyeddikesyreethylester; [1] pyraflufen (ISO); 2-chlor-5-(4-chlor-5-difluormethoxy-1-methylpyrazol-3-yl)-4-fluorphenoxyeddikesyre [2] |
- [1] - [2] |
129630-19-9 [1] 129630-17-7 [2] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1 000 |
|
|
613-204-00-5 |
oxadiargyl (ISO); 3-[2,4-dichlor-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-on |
254-637-6 |
39807-15-3 |
Repr. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H361D *** H373 ** H400 H410 |
GHS08 GHS09 Wng |
H361D *** H373 ** H410 |
|
M = 1 000 |
|
|
613-205-00-0 |
propiconazol (ISO); (+)-1-[2-(2,4-dichlorphenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazol |
262-104-4 |
60207-90-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
613-206-00-6 |
fenamidon (ISO); (S)-5-methyl-2-methylthio-5-phenyl-3-phenyl-3,5-dihydroimidazol-4-on |
— |
161326-34-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-208-00-7 |
imazamox (ISO); (RS)-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-(methoxymethyl)nicotinsyre |
— |
114311-32-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-209-00-2 |
cis-1-(3-chlorpropyl)-2,6-dimethyl-piperidinhydrochlorid |
417-430-3 |
63645-17-0 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H317 H411 |
|
|
|
|
613-210-00-8 |
2-(3-chlorpropyl)-2,5,5-trimethyl-1,3-dioxan |
417-650-1 |
88128-57-8 |
STOT RE 2 * Aquatic Chronic 3 |
H373 ** H412 |
GHS08 Wng |
H373 ** H412 |
|
|
|
|
613-211-00-3 |
N-methyl-4-(p-formylstyryl)-pyridiniummethylsulfat |
418-240-3 |
74401-04-0 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-212-00-9 |
4-[4-(2-ethylhexyloxy)phenyl](1,4-thiazinan-1,1-dioxid) |
418-320-8 |
133467-41-1 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-213-00-4 |
cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-.sc.L.sc.-prolin |
416-040-0 |
120807-02-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-214-00-X |
N, N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-chinolyliden)-1,3-dioxoindan-5-carboxamid |
416-260-7 |
147613-95-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-215-00-5 |
2-chlormethyl-3,4-dimethoxypyridiniumchlorid |
416-440-5 |
72830-09-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H312 H302 H373 ** H315 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H315 H318 H317 H411 |
|
|
|
|
613-216-00-0 |
6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazol |
416-490-8 |
162208-01-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-217-00-6 |
4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl]-2,2,6,6-tetramethylpiperidin |
416-770-1 |
73754-27-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-218-00-1 |
6-hydroxyindol |
417-020-4 |
2380-86-1 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
613-219-00-7 |
7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazol |
417-140-7 |
79185-77-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
613-220-00-2 |
trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol-, 7,7-dioxid |
417-290-3 |
147086-81-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
613-221-00-8 |
2-chlor-5-methyl-pyridin |
418-050-0 |
18368-64-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 3 |
H312 H302 H315 H412 |
GHS07 Wng |
H312 H302 H315 H412 |
|
|
|
|
613-222-00-3 |
4-(1-oxo-2-propenyl)-morpholin |
418-140-1 |
04-12-5117 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H318 H317 |
|
|
|
|
613-223-00-9 |
N-isopropyl-3-(4-fluorphenyl)-1H-indol |
418-790-4 |
93957-49-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-224-00-4 |
2,5-dimercaptomethyl-1,4-dithian |
419-770-8 |
136122-15-1 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
|
|
|
|
613-225-00-X |
blanding af [2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl]-1,3,5-triazin og 2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazin |
421-290-9 |
— |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
613-226-00-5 |
1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl-pyridiniumdichlorid |
420-950-3 |
163831-67-2 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
613-227-00-0 |
(±)-[(R*,R*) og (R*,S*)]-6-fluor-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
419-600-2 |
99199-90-3 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
613-228-00-6 |
(±)-(R*,S*)-6-fluor-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
419-630-6 |
793669-26-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-229-00-1 |
1-acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidin |
411-930-5 |
106917-31-1 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
613-230-00-7 |
florasulam; 2',6',8-trifluor-5-methoxy-5-triazolo[1,5-c]; pyrimidin-2-sulfonanilid |
— |
145701-23-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-231-00-2 |
2,6-diamino-3-((pyridin-3-yl)azo)pyridin |
421-430-9 |
28365-08-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
613-232-00-8 |
3-(benzo[b]thien-2-yl)-5,6-dihydro-1,4,2-oxathiazin-4-oxid |
431-030-6 |
163269-30-5 |
Acute Tox. 3 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H373 ** H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H331 H373 ** H318 H410 |
|
|
|
|
613-233-00-3 |
4,4'-(oxy-(bismethylen))-bis-1,3-dioxolan |
423-230-7 |
56552-15-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-234-00-9 |
imidazo[1,2-b]pyridazin hydrochlorid |
431-510-5 |
18087-70-2 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
613-235-00-4 |
2,3-dihydro-2,2-dimethyl-1H-perimidin |
424-060-6 |
6364-17-6 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
613-236-00-X |
2-chlor-3-trifluormethylpyridin |
424-520-6 |
65753-47-1 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Chronic 3 |
H311 H301 H372 ** H314 H412 |
GHS06 GHS05 GHS08 Dgr |
H311 H301 H372 ** H314 H412 |
|
|
|
|
613-237-00-5 |
6-tert-butyl-3-(3-dodecylsulfonyl)propyl-7H-1,2,4-triazolo[3,4-b][1,3,4]thiadiazin |
424-950-4 |
133949-92-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-238-00-0 |
natrium-2-[[4-[(4,6-dichlor-1,3,5-triazin-2-yl)amino]phenyl]sulfonyl]ethylsulfat |
430-890-1 |
81992-66-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
613-239-00-6 |
2-[3-(methylamino)propyl]-1H-benzimidazol |
425-760-4 |
64137-52-6 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
613-241-00-7 |
3-(2H-tetrazol-5-yl)pyridin |
426-810-8 |
3250-74-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-242-00-2 |
reaktionsprodukter af 3,10-bis((2-aminopropyl)amino)-6,13-dichlor-4,11-triphenodioxazindisulfonsyre med 2-amino-1,4-benzendisulfonsyre, 2-((4-aminophenyl)sulfonyl)ethylhydrogensulfat og 2,4,6-trifluor-1,3,5-triazin, natriumsalte |
426-860-0 |
191877-09-5 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-243-00-8 |
4,4'-(1,6-hexamethylenbis(formylimino))bis(2,2,6,6-tetramethyl-1-oxylpiperidin) |
427-350-0 |
182235-14-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-244-00-3 |
5,7-dichlor-4-hydroxyquinolin |
427-420-0 |
21873-52-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-245-00-9 |
2-fluor-6-trifluormethylpyridin |
428-100-3 |
94239-04-0 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H226 H332 H302 H412 |
GHS02 GHS07 Wng |
H226 H332 H302 H412 |
|
|
|
|
613-246-00-4 |
2-hydroxymethyl-3-methyl-4-(2,2,2-trifluorethoxy)pyridin |
428-200-7 |
103577-66-8 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-247-00-X |
3-(2-methoxy-4-methoxycarboxybenzyl)-5-nitroindol |
428-910-7 |
107786-36-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-248-00-5 |
3,4-dimethyl-1H-pyrazol |
429-130-1 |
2820-37-3 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
613-249-00-0 |
1-(2-hydroxyethyl)-1H-pyrazol-4,5-diyldiammoniumsulfat |
429-300-3 |
155601-30-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
613-250-00-6 |
blanding af carbonato-bis-N-ethyl-2-isopropyl-1,3-oxazolidin; methyl-carbonato-N-ethyl-2-isopropyl-1,3-oxazolidin og 2-isopropyl-N-hydroxyethyl-1,3-oxazolidin |
429-990-6 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
613-251-00-1 |
(R)-3-[(1-methylpyrrolidin-2-yl)methyl]-5-[2-(phenylsulfonyl)ethenyl]-1H-indol |
430-560-5 |
180637-89-2 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373 ** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 |
|
|
|
|
613-253-00-2 |
2,2-dialkyl-4-hydroxymethyl-1,3-dioxolan; reaktionsprodukter med ethylenoxid, alkyl er C1-12 og tilsammen på C13, med en gennemsnitlig ethoxyleringsgrad på 3,5 |
430-580-4 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
EUH019 |
|
|
|
613-254-00-8 |
forchlorfenuron (ISO); 1-(2-chlor-4-pyridyl)-3-phenylurinstof |
— |
68157-60-8 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
613-255-00-3 |
blanding af isomerer af natrium-[(2-hydroxyethylsulfamoyl){[2-(2-piperazin-1-ylethylamino)ethylsulfamoyl][2-(4-aminoethylpiperazin-1-yl)ethylsulfamoyl](sulfamoyl)}(sulfophthalocyaninato)]kobber(II) |
424-270-8 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-256-00-9 |
3'5'-anhydrothymidin |
425-810-5 |
38313-48-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-257-00-4 |
2-phthalimidoethyl-N-[4-(2-cyan-4-nitrophenylazo)phenyl]-N-methyl-β-alaninat |
426-400-9 |
170222-39-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
613-258-00-X |
en blanding af 4-chlor-7-methylbenzotriazol natriumsalt; 4-chlor-5-methylbenzotriazol natriumsalt og 5-chlor-4-methylbenzotriazol natriumsalt |
427-730-6 |
202420-04-0 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
613-259-00-5 |
en blanding af [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-cis-chrysanthemat og [2,4-dioxo-(2-propyn-1-yl)imidazolidin-3-yl]methyl(1R)-trans-chrysanthemat |
428-790-6 |
72963-72-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
613-260-00-0 |
(±)-4-(3-chlorphenyl)-6-[(4-chlorphenyl)hydroxy(1-methyl-1H-imidazol-5-yl)methyl]-1-methyl-2(1H)-quinolin |
430-730-9 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
613-261-00-6 |
pyrazol-1-carboxamidin monohydrochlorid |
429-520-1 |
4023-02-3 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 ** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H317 H412 |
|
|
|
|
613-262-00-1 |
dinatrium-(E)-1,2-bis-(4-(4-methylamino-6-(4-methylcarbamoylphenylamino)-1,3,5-triazin-2-ylamino)phenyl-2-sulfonato)ethen |
427-310-2 |
180850-95-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-263-00-7 |
mononatrium-3-cyan-5-fluor-6-hydroxy-pyridin-2-olat |
429-570-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
613-266-00-3 |
2-chlor-5-chlormethylthiazol |
429-830-5 |
105827-91-6 |
Acute Tox. 3 * Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H311 H314 H302 H317 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H302 H317 H411 |
|
|
|
|
613-267-00-9 |
thiamethoxam (ISO) 3-(2-chlorthiazol-5-ylmethyl)-5-methyl[1,3,5]oxadiazinan-4-yliden-N-nitroamin |
428-650-4 |
153719-23-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
613-268-00-4 |
(4aS-cis-)-6-benzyl-octahydropyrrolo[3,4-b]pyridin |
425-930-8 |
151213-39-7 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H314 H332 H302 H373 ** H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H314 H332 H302 H373 ** H411 |
|
|
|
|
613-269-00-X |
2-thiazolidinylidencyanamid |
427-720-1 |
26364-65-8 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
613-270-00-5 |
5-amino-N-(2,6-dichlor-3-methylphenyl)-1H-1,2,4-triazol-3-sulfonamid |
428-150-6 |
113171-13-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-271-00-0 |
tritosulfuron (indeholdende ≤ 0,02 % AMTT); 1-[4-methoxy-6-(trifluormethyl)-1,3,5-triazin-2-yl]-3-[2-(trifluormethyl)benzensul-fonyl]urinstof (indeholdende ≤ 0,02 % AMTT) |
— |
142469-14-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10 |
|
|
613-272-00-6 |
pyraclostrobin; (ISO) methyl-N-{2-[1-(4-chlorphenyl)-1H-pyrazol-3-yloxymethyl]phenyl}(N-methoxy)carbamat |
— |
— |
Acute Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H315 H400 H410 |
GHS06 GHS09 Dgr |
H331 H315 H410 |
|
M = 100 |
|
|
613-273-00-1 |
tetrahydro-3-methyl-5-((2-phenylthio)thiazol-5-ylmethyl)-[4H]-1,3,5-oxadiazinan-4-yliden-N-nitroamin |
427-600-9 |
192439-46-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-274-00-7 |
2,6-dichlor-1-fluorpyridiniumtetrafluorborat |
427-400-1 |
140623-89-8 |
Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H410 |
|
|
|
|
613-275-00-2 |
3-(2-chlorethyl)-6,7,8,9-tetra-hydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-on monohydrochlorid |
424-530-0 |
93076-03-0 |
Acute Tox. 3 * STOT SE 2 STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H301 H371 ** H373 ** H318 H317 H411 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H301 H371 ** H373 ** H318 H317 H411 |
|
|
|
|
613-276-00-8 |
1-(2-chlorphenyl)-1,2-dihydro-5H-tetrazol-5-on |
426-110-2 |
98377-35-6 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-277-00-3 |
(4-(6-diethylamino-2-methylpyridin-3-yl)imino-4,5-dihydro-3-methyl-1-(4-methylphenyl)-1H-pyrazol-5-on |
427-070-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-278-00-9 |
(3-aminophenyl)pyridin-3-ylmethanon |
428-230-0 |
79568-06-2 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
613-279-00-4 |
2-ethyl-2,3-dihydro-2-methyl-1H-perimidin |
424-380-6 |
43057-68-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
613-280-00-X |
tetrahydro-1,3-dimethyl-1H-pyrimidin-2-on; dimethylpropylenurinstof |
230-625-6 |
7226-23-5 |
Repr. 2 Acute Tox. 4 * Eye Dam. 1 |
H361f *** H302 H318 |
GHS05 GHS08 GHS07 Dgr |
H361f *** H302 H318 |
|
|
|
|
613-281-00-5 |
quinolin |
202-051-6 |
91-22-5 |
Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H350 H341 H312 H302 H319 H315 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H341 H312 H302 H319 H315 H411 |
|
|
|
|
613-282-00-0 |
triticonazol (ISO); (RS)-(E)-5-(4-chlorbenzyliden)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-methyl)cyclopentanol |
— |
131983-72-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
613-283-00-6 |
ketoconazol; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorphenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanon |
265-667-4 |
65277-42-1 |
Repr. 1B Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360F *** H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360f *** H301 H373 ** H410 |
|
|
|
|
613-284-00-1 |
metconazol (ISO); (1RS,5RS;1RS,5SR)-5-(4-chlorbenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
— |
125116-23-6 |
Repr. 2 Acute Tox. 4 * Aquatic Chronic 2 |
H361D *** H302 H411 |
GHS08 GHS07 GHS09 Wng |
H361D *** H302 H411 |
|
|
|
|
613-285-00-7 |
1-hydroxybenzotriazol, vandfri; [1] 1-hydroxybenzotriazol, monohydrat [2] |
219-989-7 [1] 219-989-7 [2] |
2592-95-2 [1] 123333-53-9 [2] |
Expl. 1,3 |
H203 |
GHS01 Dgr |
H203 |
|
|
|
|
613-286-00-2 |
kalium-1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-yliden)-1-propenyl]pyrazol-5-olat; [indeholdende < 0,5 % N, N-dimethylformamid (EF-nr. 200-679-5)] |
418-260-2 |
183196-57-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
613-286-01-X |
kalium-1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-yliden)-1-propenyl]pyrazol-5-olat [indeholdende ≥ 0,5 % N, N-dimethylformamid (EF-nr. 200-679-5)] |
418-260-2 |
183196-57-8 |
Repr. 1B Skin Sens. 1 |
H360D *** H317 |
GHS08 GHS07 Dgr |
H360D *** H317 |
|
|
|
|
613-287-00-8 |
1-(3-iod-4-aminobenzyl)-1H-1,2,4-triazol |
419-540-7 |
160194-26-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
613-288-00-3 |
1,3-bis(dimethylcarbamoyl)-imidazoliumchlorid |
420-930-4 |
135756-61-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
613-289-00-9 |
3-(4-chlor-2-fluor-5-methylphenyl)-1-methyl-5-(trifluormethyl)-1H-pyrazol |
432-020-4 |
142623-48-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-290-00-4 |
4-hydroxy-7-(2-aminoethyl)-1,3-benzothiazol-2(3H)-onhydrochlorid |
432-470-1 |
189012-93-9 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
613-291-00-X |
2,4-dihydro-4-(4-(4-(4-hydroxyphenyl)-1-piperazinyl)phenyl)-2-(1-methylpropyl)-3H-1,2,4-triazol-3-on |
434-820-9 |
106461-41-0 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
613-292-00-5 |
N, N',N''-tris(2-methyl-2,3-epoxypropyl)-perhydro-2,4,6-oxo-1,3,5-triazin |
435-010-8 |
26157-73-3 |
Muta. 2 Aquatic Chronic 3 |
H341 H412 |
GHS08 Wng |
H341 H412 |
|
|
|
|
613-293-00-0 |
2-(4-tert-butylphenyl)-6-cyan-5-[bis(ethoxycarbonyl- methyl)carbamoyloxy]-1H-pyrrolo[1,2-b][1,2,4] triazol-7-carboxylsyre-2,6-di-tert-butyl-4-methylcyclohexylester |
448-050-6 |
444065-11-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-294-00-6 |
2-hexyldecansyre-[4-(6-tert-butyl-7-chlor-1H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenylcarbamoyl]methylester |
448-260-8 |
379268-96-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-295-00-1 |
11-amino-3-chlor-6,11-dihydro-5,5-dioxo-6-methyl-dibenzo[c, f][1,2]thiazepinhydrochlorid |
448-720-8 |
363138-44-7 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
613-296-00-7 |
pentakalium-2-(4-(5-[1-(2,5-disulfonatophenyl)-4,5-dihydro-3-methylcarbamoyl-5-oxopyrazol-4-yliden]-3-methyl-1,3-pentadienyl)-3-methylcarbamoyl-5-oxidopyrazol-1-yl)benzen-1,4-disulfonat |
418-270-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
613-297-00-2 |
5-(2-bromphenyl)-2-tert-butyl-2H-tetrazol |
420-820-6 |
— |
Flam. Liq. 3 Acute Tox. 4 * Aquatic Chronic 2 |
H226 H302 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H411 |
|
|
|
|
613-298-00-8 |
bis-(6-hydroxy-4-methyl-5-(3-methylimidazolium-1-yl)-3-(4-phenylazo)-1H-pyridin-2-on)ethylendilactat |
421-560-6 |
— |
STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H373 ** H318 H411 |
GHS05 GHS08 GHS09 Dgr |
H373 ** H318 H411 |
|
|
|
|
613-299-00-3 |
hovedkomponent 1 (isomer 1): 2-{6-fluor-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonapht-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluor-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}propan natriumsalt; hovedkomponent 1 (isomer 2): 2-{6-fluor-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-3-{6-fluor-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}propan natriumsalt; hovedkomponent 2: 2,3-bis-{6-fluor-4-[3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}propan natriumsalt; hovedkomponent 3: 2,3-bis-{6-fluor-4-[3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}propan natriumsalt; |
422-610-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-300-00-7 |
1-imidazol-1-yl-octadecan-2-ol |
434-120-3 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
613-301-00-2 |
dimethyl-1-{[2-methoxy-5-(2-methyl-butoxycarbonyl)phenylcarbamoyl]-[2-octadecyl-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]methyl}imidazol-4,5-dicarboxylat |
443-910-7 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-302-00-8 |
dinatrium-2-(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydro-pyridin-3-ylazo)-4-(4-fluor-6-(4-(2-sulfonyloxy-ethylsulfonyl)-phenylamino)-1,3,5-triazin-2-ylamino)benzensulfonat |
432-980-4 |
243858-60-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
613-303-00-3 |
2-(1-methyl-2-(4-phenoxyphenoxy)ethoxy)pyridin |
429-800-1 |
95737-68-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-304-00-9 |
5,6-dihydroxy-2,3-dihydro-1H-indoliumbromid |
421-170-6 |
138937-28-7 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
613-305-00-4 |
2-(2-hydroxy-4-octyloxyphenyl)-2H-benzotriazol |
448-630-9 |
3147-77-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
613-306-00-X |
(2,5-dioxopyrrolidin-1-yl)-9H-fluoren-9-ylmethylcarbonat |
433-520-5 |
82911-69-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
613-307-00-5 |
clothianidin (ISO); 3-[(2-chlor-1,3-thiazol-5-yl)methyl]-2-methyl-1-nitroguanidin |
— |
210880-92-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
613-308-00-0 |
2-amino-5-methylthiazol |
423-800-5 |
7305-71-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
613-309-00-6 |
1-methyl-3-phenyl-1-piperazin |
431-180-2 |
5271-27-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H312 H302 H315 H318 H412 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 H412 |
|
|
|
|
613-310-00-1 |
(-)(3S,4R)-4-(4-fluorphenyl)-3-(3,4-methylendioxy-phenoxymethyl)-N-benzylpiperidinhydrochlorid |
432-360-3 |
105813-13-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
613-311-00-7 |
methyl-5-nitrophenyl-guanidin |
435-500-1 |
152460-07-6 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H302 H319 H317 H412 |
GHS07 Wng |
H302 H319 H317 H412 |
|
|
|
|
613-312-00-2 |
2-(4-methyl-2-phenyl-1-piperazinyl)benzenmethanolmonohydrochlorid |
420-200-5 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
613-313-00-8 |
2-(4-(4-(3-pyridinyl)-1H-imidazol-1-yl)butyl)-1H-isoindol-1,3(2H)-dion |
442-780-9 |
173838-67-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
613-314-00-3 |
4-decyloxazolidin-2-on; 4-decyl-1,3-oxazolidin-2-on |
443-770-7 |
7693-82-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
613-315-00-9 |
tetrakalium-4-[5-[3-carboxylato-4,5-dihydro-5-oxo-1-(4-sulfonatophenyl)pyrazol-4-yliden]-3-(piperidinocarbonyl)penta-1,3-dienyliden]-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-3-carboxylat |
430-390-1 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
|
|
|
|
613-316-00-4 |
trimethylopropan-tri(3-aziridinylpropanoat); (TAZ) |
257-765-0 |
52234-82-9 |
Muta. 2 Eye Dam. 1 Skin Sens. 1 |
H341 H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H341 H318 H317 |
|
|
|
|
613-317-00-X |
penconazol (ISO); 1-[2-(2,4- dichlorphenyl)pentyl]-1H1,2,4-triazol |
266-275-6 |
66246-88-6 |
Repr. 2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H302 H410 |
|
M = 1 M = 1 |
|
|
614-002-00-X |
salte af nicotin |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
A |
|
614-003-00-5 |
strychnin |
200-319-7 |
57-24-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
614-004-00-0 |
salte af strychnin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
A |
|
614-005-00-6 |
colchicin |
200-598-5 |
64-86-8 |
Muta. 1B Acute Tox. 2 * |
H340 H300 |
GHS06 GHS08 Dgr |
H340 H300 |
|
|
|
|
614-006-00-1 |
brucin; 2,3-dimethoxystrychnin |
206-614-7 |
357-57-3 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Chronic 3 |
H330 H300 H412 |
GHS06 Dgr |
H330 H300 H412 |
|
|
|
|
614-007-00-7 |
brucinsulfat; [1] brucinnitrat; [2] strychnidin-10-on, 2,3-dimethoxy-, mono[(R)-1-methylheptyl-1,2-benzendicarboxylat]; [3] strychnidin-10-on, 2,3-dimethoxy-, forbindelse med (S)-mono(1-methylheptyl)-1,2-benzendicarboxylat (1:1) [4] |
225-432-9 [1] 227-317-9 [2] 269-439-5 [3] 269-710-8 [4] |
4845-99-2 [1] 5786-97-0 [2] 68239-26-9 [3] 68310-42-9 [4] |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Chronic 3 |
H330 H300 H412 |
GHS06 Dgr |
H330 H300 H412 |
|
|
A |
|
614-008-00-2 |
aconitin |
206-121-7 |
302-27-2 |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
|
|
614-009-00-8 |
salte af aconitin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
A |
|
614-010-00-3 |
atropin |
200-104-8 |
51-55-8 |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
|
|
614-011-00-9 |
salte af atropin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
A |
|
614-012-00-4 |
hyoscyamin |
202-933-0 |
101-31-5 |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
|
|
614-013-00-X |
salte af hyoscyamin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
A |
|
614-014-00-5 |
scopolamin |
200-090-3 |
51-34-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
614-015-00-0 |
salte af scopolamin |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
A |
|
614-016-00-6 |
pilocarpin |
202-128-4 |
92-13-7 |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
|
|
614-017-00-1 |
salte af pilocarpin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
A |
|
614-018-00-7 |
papaverin |
200-397-2 |
58-74-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
614-019-00-2 |
salte af papaverin |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
A |
|
614-020-00-8 |
physostigmin |
200-332-8 |
57-47-6 |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
|
|
614-021-00-3 |
salte af physostigmin |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * |
H330 H300 |
GHS06 Dgr |
H330 H300 |
|
|
A |
|
614-022-00-9 |
digitoxin |
200-760-5 |
71-63-6 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
|
|
|
|
614-023-00-4 |
ephedrin |
206-080-5 |
299-42-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
614-024-00-X |
salte af ephedrin |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
A |
|
614-025-00-5 |
G-strophantin |
211-139-3 |
630-60-4 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
|
|
|
|
614-026-00-0 |
K-strophantin |
234-239-9 |
11005-63-3 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * |
H331 H301 H373 ** |
GHS06 GHS08 Dgr |
H331 H301 H373 ** |
|
|
|
|
614-027-00-6 |
6β-acetoxy-3y(β-D-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolid |
208-077-4 |
507-60-8 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
614-028-00-1 |
en blanding af 2-ethylhexyl-mono-D-glucopyranosid og 2-ethylhexyl-di-D-glucopyranosid |
414-420-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
614-029-00-7 |
strukturisomerer af penta-O-allyl-β-.sc.D.sc.-fructofuranosyl-α-.sc.D.sc.-glucopyranosid; strukturisomerer af hexa-O-allyl-β-.sc.D.sc.-fructofuranosyl-α-.sc.D.sc.-glucopyranosid og strukturisomerer af hepta-O-allyl-β-.sc.D.sc.-fructofuranosyl-α-.sc.D.sc.-glucopyranosid |
419-640-0 |
68784-14-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
615-001-00-7 |
methylisocyanat |
210-866-3 |
624-83-9 |
Flam. Liq. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Resp. Sens. 1 Skin Sens. 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H225 H361D *** H330 H311 H301 H334 H317 H335 H315 H318 |
GHS02 GHS06 GHS05 GHS08 Dgr |
H225 H361D *** H330 H311 H301 H334 H317 H335 H315 H318 |
|
|
|
|
615-002-00-2 |
methylisothiocyanat |
209-132-5 |
556-61-6 |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H314 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H331 H301 H314 H317 H410 |
|
|
|
|
615-003-00-8 |
thiocyansyre |
207-337-4 |
463-56-9 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
EUH032 |
|
|
|
615-004-00-3 |
salte af thiocyansyre, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
EUH032 |
|
A |
|
615-005-00-9 |
4,4'-methylendiphenyldiisocyanat; diphenylmethan-4,4'-diisocyanat; [1] 2,2'-methylendiphenyldiisocyanat; diphenylmethan-2,2'-diisocyanat; [2] o-(p-isocyanatobenzyl)phenylisocyanat; diphenylmethan-2,4'-diisocyanat; [3] methylendiphenyldiisocyanat [4] |
202-966-0 [1] 219-799-4 [2] 227-534-9 [3] 247-714-0 [4] |
101-68-8 [1] 2536-05-2 [2] 5873-54-1 [3] 26447-40-5 [4] |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H351 H332 H373 ** H319 H335 H315 H334 H317 |
GHS08 GHS07 Dgr |
H351 H332 H373 ** H319 H335 H315 H334 H317 |
|
Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % Resp. Sens. 1; H334: C ≥ 0,1 % STOT SE 3; H335: C ≥ 5 % |
C2 |
|
615-006-00-4 |
2-methyl-m-phenylendiisocyanat; 2,4-diisocyanatotoluen; [1] 4-methyl-m-phenylendiisocyanat; 2,6-diisocyanatotoluen; [2] m-tolylidendiisocyanat; diisocyanatoluen [3] |
202-039-0 [1] 209-544-5 [2] 247-722-4 [3] |
91-08-7 [1] 584-84-9 [2] 26471-62-5 [3] |
Carc. 2 Acute Tox. 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H330 H319 H335 H315 H334 H317 H412 |
GHS06 GHS08 Dgr |
H351 H330 H319 H335 H315 H334 H317 H412 |
|
Resp. Sens. 1; H334: C ≥ 0,1 % |
C |
|
615-007-00-X |
1,5-naphthylendiisocyanat |
221-641-4 |
3173-72-6 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Aquatic Chronic 3 |
H332 H319 H335 H315 H334 H412 |
GHS08 GHS07 Dgr |
H332 H319 H335 H315 H334 H412 |
|
|
|
|
615-008-00-5 |
3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanat; isophorondiisocyanat |
223-861-6 |
4098-71-9 |
Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 2 |
H331 H319 H335 H315 H334 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H319 H335 H315 H334 H317 H411 |
|
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens.1; H317: C ≥ 0,5 % |
2 |
|
615-009-00-0 |
4,4'-methylendi(cyclohexylisocyanat); dicyclohexylmethan-4,4'-diisocyanat |
225-863-2 |
5124-30-1 |
Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H331 H319 H335 H315 H334 H317 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 H317 |
|
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
2 |
|
615-010-00-6 |
2,2,4-trimethylhexamethylen-1,6-diisocyanat; [1] 2,4,4-trimethylhexamethylen-1,6-diisocyanat [2] |
241-001-8 [1] 239-714-4 [2] |
16938-22-0 [1] 15646-96-5 [2] |
Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H331 H319 H335 H315 H334 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 |
|
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
C2 |
|
615-011-00-1 |
hexamethylen-1,6-diisocyanat |
212-485-8 |
822-06-0 |
Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H331 H319 H335 H315 H334 H317 |
GHS06 GHS08 Dgr |
H331 H319 H335 H315 H334 H317 |
|
* Resp. Sens. 1; H334: C ≥ 0,5 % Skin Sens. 1; H317: C ≥ 0,5 % |
2 |
|
615-012-00-7 |
4-toluensulfonylisocyanat; tosylisocyanat |
223-810-8 |
4083-64-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
EUH014 |
Eye Irrit. H319: C ≥ 5 % STOT SE 3; H335: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % |
|
|
615-014-00-8 |
tris(1-dodecyl-3-methyl-2-phenylbenzimidazolium)hexacyanoferrat |
— |
7276-58-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
615-015-00-3 |
1,7,7-trimethylbicyclo(2,2,1)hept-2-ylthiocyanatoacetat; isobornyl thiocyanoacetat |
204-081-5 |
115-31-1 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
615-016-00-9 |
kaliumcyanat |
209-676-3 |
590-28-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
615-017-00-4 |
calciumcyanamid |
205-861-8 |
156-62-7 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
|
|
|
615-018-00-X |
2-(2-butoxythoxy)ethylthio cyanat |
203-985-7 |
112-56-1 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * |
H226 H311 H301 |
GHS02 GHS06 Dgr |
H226 H311 H301 |
|
|
|
|
615-019-00-5 |
dicyclohexylcarbodiimid |
208-704-1 |
538-75-0 |
Acute Tox. 3 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H311 H302 H318 H317 |
GHS06 GHS05 Dgr |
H311 H302 H38 H317 |
|
|
|
|
615-020-00-0 |
methylendithiocyanat |
228-652-3 |
6317-18-6 |
Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H330 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H314 H317 H400 |
|
|
|
|
615-021-00-6 |
1,3,5-tris(oxiranylmethyl)-1,3,5-triazin-2,4,6(1H,3H,5H)-trion; TGIC |
219-514-3 |
2451-62-9 |
Muta. 1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H340 H331 H301 H373 ** H318 H317 H412 |
GHS06 GHS08 GHS05 Dgr |
H340 H331 H301 H373 ** H318 H317 H412 |
|
|
|
|
615-022-00-1 |
methyl-3-isocyanatosulfonyl-2-thiophencarboxylat |
410-550-7 |
79277-18-2 |
STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 |
H373 ** H334 H317 |
GHS08 Dgr |
H373 ** H334 H317 |
EUH014 |
|
|
|
615-023-00-7 |
2-(isocyanatosulfonylmethyl)benzoesyre-methylester; (alt.):methyl 2-(isocyanatosulfo nylmethyl)benzoat |
410-900-9 |
83056-32-0 |
Flam. Liq. 3 Muta. 2 Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Resp. Sens. 1 |
H226 H341 H332 H373 ** H318 H334 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H341 H332 H373 ** H318 H334 |
EUH014 |
|
|
|
615-024-00-2 |
2-phenylethylisocyanat |
413-080-0 |
1943-82-4 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 2 |
H331 H302 H314 H334 H317 H411 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H302 H314 H334 H317 H411 |
|
|
|
|
615-025-00-8 |
4,4'-ethylidendiphenyldicyanat |
405-740-1 |
47073-92-7 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H302 H373 ** H318 H410 |
|
|
|
|
615-026-00-3 |
4,4'-methylenbis(2,6-dimethylphenylcyanat) |
405-790-4 |
101657-77-6 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
615-028-00-4 |
ethyl-2-(isocyanatosulfonyl)benzoat |
410-220-2 |
77375-79-2 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H373 ** H318 H334 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 ** H318 H334 H317 |
EUH014 |
|
|
|
615-029-00-X |
2,5-bis-isocyanatomethyl-bicyclo[2.2.1]heptan |
411-280-2 |
— |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H330 H302 H314 H334 H317 H412 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H314 H334 H317 H412 |
|
|
|
|
615-030-00-5 |
alkalisalte og jordalkalisalte af thiocyansyre, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H332 H312 H302 H412 |
GHS07 Wng |
H332 H312 H302 H412 |
|
|
A |
|
615-031-00-0 |
thalliumthiocyanat |
222-571-7 |
3535-84-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H312 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H312 H373 ** H411 |
|
|
|
|
615-032-00-6 |
metalsalt af thiocyansyre, undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
615-033-00-1 |
reaktionsprodukt af diphenylmethandiisocyanat, octylamin, oleylamin og cyclohexylamin (1:1.58:0.32:0.097) |
430-980-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-034-00-7 |
reaktionsprodukt af diphenylmethandiisocyanat, octylamin, 4-ethoxyanilin og ethylendiamin (1:0.37:1.53:0.05) |
430-750-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-035-00-2 |
reaktionsprodukt af diphenylmethandiisocyanat, octylamin og oleylamin (molforholdet 1:1.86:0.14) |
430-930-6 |
122886-55-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-036-00-8 |
reaktionsprodukt af diphenylmethandiisocyanat, toluendiisocyanat (isomerblanding med: 65 % 2,4- og 35 % 2,6-diisocyanat), octylamin, oleylamin og 4-ethoxyanilin (molforholdet 4:1:7:1:2) |
430-940-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-037-00-3 |
reaktionsprodukt af diphenylmethandiisocyanat, toluendiisocyanat (isomerblanding med: 65 % 2,4- og 35 % 2,6-diisocyanat), octylamin og oleylamin (molforholdet 4:1:9:1) |
430-950-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-038-00-9 |
reaktionsprodukt af toluendiisocyanat (isomerblanding med: 65 % 2,4- og 35 % 2,6-diisocyanat) og anilin (molforholdet 1:2) |
430-960-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-039-00-4 |
reaktionsprodukt af diphenylmethandiisocyanat, toluendiisocyanat (isomerblanding med: 65 % 2,4- og 35 % 2,6-diisocyanat), octylamin, oleylamin og 4-ethoxyanilin (molforholdet 3.88:1:6.38:0.47:2.91) |
430-970-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
615-044-00-1 |
4-chlorphenylisocyanat |
203-176-9 |
104-12-1 |
Acute Tox. 2 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H335 H315 H318 H334 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H330 H302 H335 H315 H318 H334 H410 |
|
|
|
|
615-045-00-7 |
4,4'-methylen-bis(3-chlor-2,6-di-ethylphenylisocyanat) |
420-530-1 |
— |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H334 H317 H413 |
GHS08 Dgr |
H334 H317 H413 |
|
|
|
|
616-001-00-X |
N, N-dimethylformamid; dimethylformamid |
200-679-5 |
68-12-2 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H360D *** H332 H312 H319 |
GHS08 GHS07 Dgr |
H360D *** H332 H312 H319 |
|
|
|
|
616-002-00-5 |
2-fluoracetamid |
211-363-1 |
640-19-7 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
616-003-00-0 |
acrylamid; prop-2-enamid |
201-173-7 |
79-06-1 |
Carc. 1B Muta. 1B Repr. 2 Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H350 H340 H361f *** H301 H372 ** H332 H312 H319 H315 H317 |
GHS06 GHS08 Dgr |
H350 H340 H361f *** H301 H372 ** H332 H312 H319 H315 H317 |
|
|
D |
|
616-004-00-6 |
allidochlor (ISO); N, N-diallylchloracetamid |
202-270-7 |
93-71-0 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H312 H302 H319 H315 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
|
|
|
|
616-005-00-1 |
chlorthiamid (ISO); 2,6-dichlor (thiobenzamid) |
217-637-7 |
1918-13-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
616-007-00-2 |
diphenamid (ISO); N, N-dimethyl-2,2-diphenylacetamid |
213-482-4 |
957-51-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-008-00-8 |
propachlor (ISO); 2-chlor-N-isopropylacetanilid α-chlor-N-isopropylacetanilid |
217-638-2 |
1918-16-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
|
|
|
|
616-009-00-3 |
propanil (ISO); 3',4'-dichlorpropionanilid |
211-914-6 |
709-98-8 |
Acute Tox. 4 * Aquatic Acute 1 |
H302 H400 |
GHS07 GHS09 Wng |
H302 H400 |
|
M = 10 |
|
|
616-010-00-9 |
tosylchloramidnatrium |
204-854-7 |
127-65-1 |
Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 |
H302 H314 H334 |
GHS08 GHS05 GHS07 Dgr |
H302 H314 H334 |
EUH031 |
|
|
|
616-012-00-X |
N-(dichlorfluormethylthio)phthalimid; N-(fluorodichloromethylthio)-phtalimid |
211-952-3 |
719-96-0 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
616-013-00-5 |
butyraldehydoxim |
203-792-8 |
110-69-0 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 |
H311 H302 H319 |
GHS06 Dgr |
H311 H302 H319 |
|
|
|
|
616-014-00-0 |
2-butanonoxim; ethylmethylketoxim; ethylmethylketonoxim |
202-496-6 |
96-29-7 |
Carc. 2 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H351 H312 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H351 H312 H318 H317 |
|
|
|
|
616-015-00-6 |
alachlor (ISO); 2-chlor-2',6'-diethyl-N-(methoxymethyl)acetanilid |
240-110-8 |
15972-60-8 |
Carc. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H317 H410 |
|
M = 10 |
|
|
616-016-00-1 |
1-(3,4-dichlorphenylimino) thiosemicarbazid |
— |
5836-73-7 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
616-017-00-7 |
cartaphydrochlorid |
239-309-2 |
15263-52-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
616-018-00-2 |
N, N-diethyl-m-toluamid; deet |
205-149-7 |
134-62-3 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H302 H319 H315 H412 |
GHS07 Wng |
H302 H319 H315 H412 |
|
|
|
|
616-019-00-8 |
perfluidon (ISO); 1,1,1-trifluor-N-(4-phenylsulfonyl-o-tolyl)methansulfonamid |
253-718-3 |
37924-13-3 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
616-020-00-3 |
tebuthiuron (ISO); 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurinstof |
251-793-7 |
34014-18-1 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
616-021-00-9 |
thiazfluron (ISO); 1,3-dimethyl-1-(5-trifluormethyl-1,3,4-thiadiazol-2-yl)urinstof |
246-901-4 |
25366-23-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
616-022-00-4 |
acetamid |
200-473-5 |
60-35-5 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
616-023-00-X |
N-hexadecyl(eller octadecyl)-N-hexadecyl(eller octadecyl)benzamid |
401-980-6 |
— |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
616-024-00-5 |
2-(4,4-dimethyl-2,5-dioxooxazolidin-1-yl)-2-chlor-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilid |
402-260-4 |
54942-74-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-025-00-0 |
valinamid |
402-840-7 |
20108-78-5 |
Repr. 2 Eye Irrit. 2 Skin Sens. 1 |
H361f *** H319 H317 |
GHS08 Wng |
H361f *** H319 H317 |
|
|
|
|
616-026-00-6 |
thioacetamid |
200-541-4 |
62-55-5 |
Carc. 1B Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H350 H302 H319 H315 H412 |
GHS08 GHS07 Dgr |
H350 H302 H319 H315 H412 |
|
|
|
|
616-027-00-1 |
tris(-(2-hydroxyethoxy)ethyl)ammonium-3-acetoacetamido-4-methoxybenzensulfonat |
403-760-5 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-028-00-7 |
N-(4-(3-(4-cyanphenyl)ureido)-3-hydroxyphenyl)-2-(2,4-di-tert-pentylphenoxy)octanamid |
403-790-9 |
108673-51-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-029-00-2 |
N, N'-ethylenbis(vinylsulfonylacetamid) |
404-790-1 |
66710-66-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
616-030-00-8 |
ethidimuron (ISO); 1-(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurinstof |
250-010-6 |
30043-49-3 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
616-031-00-3 |
dimethachlor (ISO): 2-chlor-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamid |
256-625-6 |
50563-36-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
616-032-00-9 |
diflufenican (ISO); N-(2,4-difluorphenyl)-2-[3-(trifluormethyl)phenoxy]-3-pyridincarboxamid |
— |
83164-33-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-033-00-4 |
cyprofuram (ISO); N-(3-chlorphenyl)-N-(tetrahydro-2-oxo-3-furyl)cyclopropancarboxamid |
274-050-9 |
69581-33-5 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
616-034-00-X |
pyracarbolid (ISO); 3,4-dihydro-6-methyl-2H-pyran5-carboxanilid |
246-419-4 |
24691-76-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-035-00-5 |
cymoxanil (ISO); 2-cyan-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamid |
261-043-0 |
57966-95-7 |
Repr. 2 Acute Tox. 4 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H373 (blod, brissel) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361fd H302 H373 (blod, brissel) H317 H410 |
|
M = 1 M = 1 |
|
|
616-036-00-0 |
2-chloracetamid |
201-174-2 |
79-07-2 |
Repr. 2 Acute Tox. 3 * Skin Sens. 1 |
H361f *** H301 H317 |
GHS06 GHS08 Dgr |
H361f *** H301 H317 |
|
Skin Sens. 1; H317: C ≥ 0,1 % |
|
|
616-038-00-1 |
(4-aminophenyl)-N-methylmethylensulfonamidhydrochlorid |
406-010-5 |
88918-84-7 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
616-039-00-7 |
3',5'-dichlor-4'-ethyl-2'-hydro xypalmitanilid |
406-200-8 |
117827-06-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-040-00-2 |
kalium-N-(4-toluensulfonyl)-4-toluensulfonamid |
406-650-5 |
97888-41-0 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
616-041-00-8 |
3',5'-dichlor-2-(2,4-di-tert-pentylphenoxy)-4'-ethyl-2'-hydroxy-hexananilid |
406-840-8 |
101664-25-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-042-00-3 |
N-(2-(6-ethyl-7-(4-methylphenoxy)-1H-pyrazol[1,5-b][1,2,4]triazol-2-yl)propyl)-2-octadecyloxybenzamid |
407-070-5 |
142859-67-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-043-00-9 |
isoxaben (ISO); N-(3-(1-ethyl-1-methylpropyl)-1,2-oxazol-5-yl)-2,6-dimethoxybenzamid |
407-190-8 |
82558-50-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-044-00-4 |
N-(3,5-dichlor-4-ethyl-2-hydroxyphenyl)-2-(3-pentadecylphenoxy)butanamid |
402-510-2 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
616-045-00-X |
2'-(4-chlor-3-cyan-5-formyl-2-thienylazo)-5'-diethylamino-2-methoxyacetanilid |
405-190-2 |
122371-93-1 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-046-00-5 |
N-(2-(6-chlor-7-methylpyrazolo(1,5-b)-1,2,4-triazol-4-yl)propyl)-2-(2,4-di-tert-pentylphenoxy)octanamid |
406-390-2 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-047-00-0 |
en blanding af 2,2',2'',2'''-(ethylendinitrilotetrakis-N, N-di(C16)alkylacetamid og 2,2',2'',2'''-(ethylendinitrilotetrakis-N, N-di(C18)alkylacetamid |
406-640-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-048-00-6 |
3'-trifluormethylisobutyranilid |
406-740-4 |
1939-27-1 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
616-049-00-1 |
2-(2,4-bis(1,1-dimethylethyl)phenoxy)-N-(3,5-dichlor-4-ethyl-2-hydroxyphenyl)hexanamid |
408-150-2 |
99141-89-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-050-00-7 |
lufenuron (ISO); N-[2,5-dichlor-4-(1,1,2,3,3,3-hexafluorpropoxy)-phenyl-aminocarbonyl]-2,6-difluorbenzamid |
410-690-9 |
103055-07-8 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
616-051-00-2 |
en blanding af 2,4 -bis(N'-(4-methylphenyl)ureido)toluen og 2,6 -bis(N'-(4-methylphenyl)ureido)toluen |
411-070-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-052-00-8 |
formamid |
200-842-0 |
75-12-7 |
Repr. 1B |
H360D *** |
GHS08 Dgr |
H360D *** |
|
|
|
|
616-053-00-3 |
N-methylacetamid |
201-182-6 |
79-16-3 |
Repr. 1B |
H360D *** |
GHS08 Dgr |
H360D *** |
|
|
|
|
616-054-00-9 |
iprodion (ISO); 3-(3,5-dichlorphenyl)-2,4-dioxo-N-isopropylimidazolidin-1-carboxamid |
253-178-9 |
36734-19-7 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
616-055-00-4 |
propyzamid (ISO); 3,5-dichlor-N-(1,1-dimethylprop-2-ynyl)benzamid |
245-951-4 |
23950-58-5 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
616-056-00-X |
N-methylformamid |
204-624-6 |
123-39-7 |
Repr. 1B Acute Tox. 4 * |
H360D *** H312 |
GHS08 GHS07 Dgr |
H360D *** H312 |
|
|
|
|
616-057-00-5 |
en blanding af N-[3-hydroxy-2-(2-methyl-acryloylamino-methoxy)-propoxymethyl]-2-methyl-acrylamid; N-[2,3-bis-(2-methyl-acryloylamino-methoxy)propoxymethyl]-2-methylacrylamid; methacrylamid; 2-methyl-N-(2-methyl-acryloylamino-methoxy-methyl)-acrylamid og N-(2,3-dihydroxy-propoxymethyl)-2-methyl-acrylamid |
412-790-8 |
— |
Carc. 1B Muta. 2 STOT RE 2 * |
H350 H341 H373 ** |
GHS08 Dgr |
H350 H341 H373 ** |
|
|
|
|
616-058-00-0 |
1,3-bis(3-methyl-2,5-dioxo-1H-pyrrolinylmethyl)benzen |
412-570-1 |
119462-56-5 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H373 ** H318 H317 H410 |
|
|
|
|
616-059-00-6 |
4-((4-(diethylamino)-2-ethoxyphenyl)imino)-1,4-dihydro-1-oxo-N-propyl-2-naphthalencarboxamid |
412-650-6 |
121487-83-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-060-00-1 |
kondensationsprodukt af 3-(7-carboxyhept-1-yl)-6-hexyl-4-cyclohexen-1,2-dicarboxylsyre med polyaminer (fortrinsvis amino-ethyl-piperazin og triethylentetramin) |
413-770-1 |
— |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
|
|
|
|
616-061-00-7 |
N, N'-1,6-hexandiylbis(N-(2,2,6,6-tetramethyl-piperidin-4-yl)-formamid |
413-610-0 |
124172-53-8 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
616-062-00-2 |
N-[3-[(2-acetyloxy)ethyl](phenyl-methyl)amino]-4-methoxyphenyl-acetamid |
411-590-8 |
70693-57-1 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
616-063-00-8 |
3-dodecyl-(1-(1,2,2,6,6-pentamethyl-4-piperidin)yl) pyrrolidin-2,5-dion |
411-920-0 |
106917-30-0 |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H373 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H302 H373 ** H314 H410 |
|
|
|
|
616-064-00-3 |
N-tert-butyl-3-methylpicolinamid |
406-720-5 |
32998-95-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-065-00-9 |
3'-(3-acetyl-4-hydroxyphenyl)-1,1-diethylurinstof |
411-970-3 |
79881-89-3 |
Acute Tox. 4 * STOT RE 2 * |
H302 H373 ** |
GHS08 GHS07 Wng |
H302 H373 ** |
|
|
|
|
616-066-00-4 |
5,6,12,13-tetrachloranthra(2,1,9-def:6,5,10-d'e'f)diisoquinolin-1,3,8,10(2H,9H)-tetron |
405-100-1 |
115662-06-1 |
Repr. 2 |
H361f *** |
GHS08 Wng |
H361f *** |
|
|
|
|
616-067-00-X |
dodecyl-3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxovaleramido)-4-chlorbenzoat |
407-300-4 |
92683-20-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-068-00-5 |
kalium-4-(11-methacrylamidoundecanamido)benzensulfonat |
406-500-9 |
174393-75-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-069-00-0 |
1-hydroxy-5-(2-methylpropyloxycarbonylamino)-N-(3-dodecyloxypropyl)-2-naphthoamidchlorbenzoat |
406-210-2 |
110560-22-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-070-00-6 |
en blanding af 3,3'-dicyclohexyl-1,1'-methylenbis(4,1-phenylen)diurinstof 3-cyclohexyl-1-(4-(4-(3-octadecylureido)benzyl)phenyl)urinstof 3,3'-dioctadecyl-1,1'-methylenbis(4,1-phenylen)diurinstof |
406-530-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-071-00-1 |
blanding (1:2:1) af bis(N-cyclohexyl-N'-phenylenureido)methylen; bis(N-octadecyl-N'-phenylenureido)methylen bis(N-dicyclohexyl-N'-phenylenureido)methylen |
406-550-1 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-072-00-7 |
1-(2-deoxy-5-O-trityl-β-.sc.D.sc.-threopentofuranosyl)thymin |
407-120-6 |
55612-11-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-073-00-2 |
4'-ethoxy-2-benzimidazol-anilid |
407-600-5 |
120187-29-3 |
Muta. 2 Aquatic Chronic 4 |
H341 H413 |
GHS08 Wng |
H341 H413 |
|
|
|
|
616-074-00-8 |
N-butyl-2-(4-morpholinylcarbonyl)benzamid |
407-730-2 |
104958-67-0 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
616-075-00-3 |
.sc.D.sc.,.sc.L.sc.-(N, N-diethyl-2-hydroxy-2-phenylacetamid) |
408-120-9 |
65197-96-8 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
616-076-00-9 |
tebufenozid (ISO); N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazid |
412-850-3 |
112410-23-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
616-077-00-4 |
en blanding af 2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-yl-ethansulfonsyre; kalium-2-(9-methyl-1,3,8,10-tetraoxo-2,3,9,10-tetrahydro-(1H,8H)-anthra[2,1,9-def: 6,5,10-d'e'f']diisoquinolin-2-yl-ethansulfat |
411-310-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
616-078-00-X |
2-[2,4-bis(1,1-dimethyl-ethyl)phenoxy]-N-(2-hydroxy-5-methyl-phenyl)-hexanamid |
411-330-3 |
104541-33-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-079-00-5 |
1,6-hexandiyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamat |
411-700-4 |
140921-24-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-080-00-0 |
4-(2-((3-ethyl-4-methyl-2-oxo-pyrrolin-1-yl)carboxamido)ethyl)benzensulfonamid) |
411-850-0 |
119018-29-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-081-00-6 |
5-brom-8-naphtholactam |
413-480-5 |
24856-00-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
616-082-00-1 |
N-(5-chlor-3-((4-(diethylamino)-2-methylphenyl)imino-4-methyl-6-oxo-1,4-cyclohexadien-1-yl)-benzamid |
413-200-1 |
129604-78-0 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-083-00-7 |
[2-[(4-nitrophenyl)amino]ethyl]urinstof |
410-700-1 |
27080-42-8 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
616-084-00-2 |
2,4-bis[N'-(4-methylphenyl)ureido]-toluen |
411-790-5 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-085-00-8 |
3-(2,4-dichlorphenyl)-6-fluorquinazolin-2,4(1H,3H)-dion |
412-190-6 |
168900-02-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-086-00-3 |
2-acetylamino-6-chlor-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadien |
412-250-1 |
102387-48-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-087-00-9 |
en blanding af 7,9,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoat og 7,7,9-trimethyl-3,14-dioxa-4,13-dioxo-5,12-diazahexadecan-1,16-diyl-prop-2-enoat |
412-260-6 |
52658-19-2 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H317 H411 |
GHS07 GHS09 Wng |
H319 H317 H411 |
|
|
|
|
616-088-00-4 |
2-aminosulfonyl-N, N-dimethylnicotinamid |
413-440-7 |
112006-75-4 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
616-089-00-X |
5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin)-3- fluor-2-hydroxymethyltetrahydrofuran |
415-360-8 |
41107-56-6 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
616-090-00-5 |
1-(1,4-benzodioxan-2-ylcarbonyl)piperazinhydrochlorid |
415-660-9 |
70918-74-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 2 |
H331 H311 H301 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H301 H373 ** H411 |
|
|
|
|
616-091-00-0 |
1,3,5-tris-[(2S og 2R)-2,3-epoxypropyl]-1,3,5-triazin-2,4,6-(1H,3H,5H)-trion |
423-400-0 |
59653-74-6 |
Muta. 1B Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H340 H331 H302 H373 ** H318 H317 |
GHS06 GHS08 GHS05 Dgr |
H340 H331 H302 H373 ** H318 H317 |
|
|
|
|
616-092-00-6 |
polymerreaktionsprodukt af bicyclo[2.2.1]hepta-2,5-dien, ethen, 1,4-hexadien, 1-propen med N, N-di-2-propenylformamid |
404-035-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-093-00-1 |
reaktionsprodukter af anilin-terephthalaldehyd-o-toluidinkondensat med maleinsyreanhydrid |
406-620-1 |
129217-90-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-095-00-2 |
3,3'-dioctadecyl-1,1'-methylen -bis(4,1-phenylen)diurinstof |
406-690-3 |
43136-14-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-096-00-8 |
N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamid |
408-110-4 |
110483-07-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-097-00-3 |
N, N'-1,4-phenylenbis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamid |
411-840-6 |
83372-55-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-098-00-9 |
1-[4-chlor-3-((2,2,3,3,3-pentafluorpropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazol-3-carboxamid |
411-750-7 |
119126-15-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
616-099-00-4 |
2-[4-[(4-idrossifenil)solfonil]fenossi]-4,4-dimetil-N-[5-[(metilsolfonil)ammino]-2-[4-(1,1,3,3-tetrametilbutil)fenossi]fenil]-3-ossopentanammide |
414-170-2 |
135937-20-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-100-00-8 |
1,3-dimetil-1,3-bis(trimetilsilil)urea |
414-180-7 |
10218-17-4 |
Acute Tox. 4 * Skin Irrit. 2 |
H302 H315 |
GHS07 Wng |
H302 H315 |
|
|
|
|
616-101-00-3 |
(S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isochinolincarboxamid |
414-600-9 |
149182-72-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-102-00-9 |
blanding af α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylen-co-oxypropylen); 1,2-(eller 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl)-ω-oxy-poly(oxyethylen-co-oxypropylen)]-3-(eller 2-)propanol og 1,2,3-tris[α-(3-mercaptopropanoxycarbonyl-amino)methylphenylaminocarbonyl)-ω-oxy-poly-(oxyethylen-co-oxypropylen)]propan] |
415-870-0 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-103-00-4 |
(S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamid |
415-030-3 |
120298-38-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
616-104-00-X |
benalaxyl (ISO); methyl-N-(2,6-dimethylphenyl)-N-(phenylacetyl)-.sc.DL.sc.-alaninat |
275-728-7 |
71626-11-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-105-00-5 |
chlortoluron (ISO); 3-(3-chlor-p-tolyl)-1,1-dimethylurinstof |
239-592-2 |
15545-48-9 |
Carc. 2 Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361D *** H400 H410 |
GHS08 GHS09 Wng |
H351 H361D *** H410 |
|
|
|
|
616-106-00-0 |
phenmedipham (ISO); methyl-3-(3-methylcarbaniloyloxy)carbanilat |
237-199-0 |
13684-63-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-107-00-6 |
cinidon ethyl (ISO); ethyl-(Z)-2-chlor-3-[2-chlor-5-(cyclohex-1-en-1,2-dicarboximido)phenyl]acrylat |
— |
142891-20-1 |
Carc. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H317 H410 |
|
|
|
|
616-108-00-1 |
iodsulfuron-methyl-natrium; natrium ({[5-iod-2-(methoxycarbonyl)phenyl]sulfonyl}}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanid |
— |
144550-36-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-109-00-7 |
sulfosulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2- yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
— |
141776-32-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-110-00-2 |
cyclanilid (ISO); 1-(2,4-dichloranilinocarbonyl)cyclopropancarboxylsyre |
419-150-7 |
113136-77-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
616-111-00-8 |
fenhexamid (ISO); N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid |
422-530-5 |
126833-17-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
616-112-00-3 |
oxasulfuron (ISO); oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl]-carbamoylsulfamoyl]benzoat |
— |
144651-06-9 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
|
|
|
616-113-00-9 |
desmedipham (ISO); ethyl 3-phenylcarbamoyloxyphenylcarbamat |
237-198-5 |
13684-56-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
616-114-00-4 |
dodecanamid, N, N'-(9,9',10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracen)-4,4'-diyl)bis- |
418-010-2 |
136897-58-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-115-00-X |
N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamid |
416-150-9 |
136450-06-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-116-00-5 |
N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidat |
416-790-9 |
143052-96-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-117-00-0 |
N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamid |
416-860-9 |
777891-21-1 |
Repr. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H317 H400 H410 |
GHS08 GHS09 Wng |
H361f *** H317 H410 |
|
|
|
|
616-118-00-6 |
N-(2',6'-dimethylphenyl)-2-piperidincarboxamid hydrochlorid |
417-950-0 |
65797-42-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-119-00-1 |
2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamid |
418-060-5 |
118020-93-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-120-00-7 |
en blanding af N-(3-dimethylamino-4-methyl-phenyl)-benzamid; N-(3-dimethylamino-2-methyl-phenyl)-benzamid og N-(3-dimethylamino-3-methyl-phenyl)-benzamid |
420-600-1 |
— |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
616-121-00-2 |
2,4-dihydroxy-N-(2-methoxyphenyl)benzamid |
419-090-1 |
129205-19-2 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-122-00-8 |
methylneodecanamid |
414-460-9 |
105726-67-8 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
616-123-00-3 |
N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyl]acetamid |
414-740-0 |
96141-86-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-124-00-9 |
lithium-bis(trifluormethylsulfonyl)imid |
415-300-0 |
90076-65-6 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B Aquatic Chronic 3 |
H311 H301 H373 ** H314 H412 |
GHS06 GHS05 GHS08 Dgr |
H311 H301 H373 ** H314 H412 |
|
|
|
|
616-125-00-4 |
3-cyano-N-(1,1-dimethylethyl)androsta-3,5-dien-17-β-carboxamid |
415-730-9 |
151338-11-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
410 |
|
|
|
|
616-126-00-X |
1-methyl-4-nitro-3-propyl-1H-pyrazol-5-carboxamid |
423-960-6 |
139756-01-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
616-127-00-5 |
en blanding af N, N'-ethan-1,2-diylbis(decanamid); 12-hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamid og N, N'-ethan-1,2-diylbis(12-hydroxyoctadecanamid) |
430-050-2 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-128-00-0 |
N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)acetamid |
417-530-7 |
123590-00-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-129-00-6 |
N, N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamid |
419-710-0 |
42774-15-2 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
616-130-00-1 |
N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamid |
421-780-2 |
150919-56-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-131-00-7 |
1-aminocyclopentancarboxamid |
422-950-9 |
17193-28-1 |
STOT RE 1 Acute Tox. 4 * Eye Dam. 1 |
H372 ** H302 H318 |
GHS05 GHS08 GHS07 Dgr |
H372 ** H302 H318 |
|
|
|
|
616-132-00-2 |
N-[4-(4-cyano-2-furfuryliden-2,5-dihydro-5-oxo-3-furyl)phenyl]butan-1-sulfonamid |
423-250-6 |
130016-98-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-133-00-8 |
N-cyclohexyl-S,S-dioxo -benzo[b]tiophen-2-carboxamid |
423-990-1 |
149118-66-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
616-134-00-3 |
3,3'-bis(dioctyloxythiophosphinoylthio)-N, N'-oxybis(methylen)dipropionamid |
401-820-5 |
793710-14-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-135-00-9 |
(3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinolin-3-carboxamid |
430-230-0 |
136522-17-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-136-00-4 |
reaktionsprodukt af kokosalkyldiethanolamider og kokosalkylmonoglycerider og molybdentrioxid (1,75-2,2: 0,75-1,0:0,1-1,1) |
430-380-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
616-137-00-X |
4-dichloracetyl-1-oxa-4-azaspiro[4.5]decan |
401-130-4 |
71526-07-3 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-138-00-5 |
benzoesyre, N-tert-butyl-N'-(4-chlorbenzoyl)hydrazid |
431-600-4 |
112226-61-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-139-00-0 |
(3S,4aS,8aS)-N-tert-butyldecahydro-3-isoquinolincarboxamid |
420-380-5 |
136465-81-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
616-140-00-6 |
N, N''-(methylendi-4,1-phenylen)bis[N'-(4-methylphenyl)urinstof] |
429-380-1 |
133336-92-2 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-141-00-1 |
zoxamid (ISO) (RS)-3,5-dichlor-N-(3-chlor-1-ethyl-1-methyl-2-oxopropyl)-p-toluamid |
— |
156052-68-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10 |
|
|
616-142-00-7 |
1,3-bis(vinylsulfonylacetamido)propan |
428-350-3 |
93629-90-4 |
Muta. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H341 H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H341 H318 H317 H412 |
|
|
|
|
616-143-00-2 |
N, N'-dihexadecyl-N, N'-bis(2-hydroxyethyl)propandiamid |
422-560-9 |
149591-38-8 |
Repr. 2 Eye Irrit. 2 Aquatic Chronic 4 |
H361f *** H319 H413 |
GHS08 Wng |
H361f *** H319 H413 |
|
|
|
|
616-144-00-8 |
3,4-dichlor-N-[5-chlor-4-[2-[4-dodecyloxyphenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamid |
431-130-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-145-00-3 |
pethoxamid (ISO); 2-chlor-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamid |
— |
106700-29-2 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M = 100 |
|
|
616-146-00-9 |
N-(2-methoxy-5-octadecanoylaminophenyl)-2-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-4,4-dimethyl-3-oxopentansyreamid |
431-330-7 |
142776-95-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-147-00-4 |
1-methyl-4-(2-methyl-2H-tetrazol-5-yl)-1H-pyrazol-5-sulfonamid |
424-160-1 |
139481-22-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-148-00-X |
N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamid |
424-550-1 |
84245-12-5 |
Carc. 1B Muta. 1B Repr. 1B |
H350 H340 H360FD |
GHS08 Dgr |
H350 H340 H360FD |
|
|
|
|
616-150-00-0 |
(2R,3S)-N-(3-amino-2-hydroxy-4-phenylbutyl)-N-isobutyl-4-nitrobenzensulfonamid hydrochlorid |
425-260-6 |
— |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H373 ** H318 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H373 ** H318 H317 H411 |
|
|
|
|
616-151-00-6 |
N-(2-amino-4,6-dichlorpyrimidin-5-yl)formamid |
425-650-6 |
171887-03-9 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
616-152-00-1 |
4-(4-fluorphenyl)-2-(2-methyl-1-oxopropyl)-4-oxo-3,N-diphenylbutanamid |
425-850-3 |
125971-96-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-153-00-7 |
4-methyl-3-oxo-N-phenyl-2-(phenylmethylen)pentanamid |
425-860-8 |
125971-57-5 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-154-00-2 |
3,4-dichlor-N-[5-chlor-4-[2-[4-(hexadecyloxy)phenylsulfonyl]butyramido]-2-hydroxyphenyl]benzamid |
431-110-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-155-00-8 |
N, N,N',N'-tetracyclohexyl-1,3-benzendicarboxamid |
431-040-0 |
104560-40-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-156-00-3 |
6-(2-chlor-6-cyan-4-nitrophenylazo)-4-methoxy-3-[N-(methoxycarbonylmethyl)-N-(1-methoxycarbonylethyl)amino]acetanilid |
430-500-8 |
204277-61-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-157-00-9 |
3-amino-4-hydroxy-N-(3-isopropoxypropyl)benzensulfonamid hydrochlorid |
427-780-9 |
114565-70-7 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
616-158-00-4 |
N-[4-cyan-3-trifluormethylphenyl]methacrylamid |
427-880-2 |
90357-53-2 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
616-160-00-5 |
2,2'-azobis[N-(2-hydroxyethyl)-2-methylpropionamid] |
429-090-3 |
61551-69-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
616-161-00-0 |
2,4-dichlor-5-hydroxyacetanilid |
429-110-0 |
67669-19-6 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-162-00-6 |
isostearinsyre monoisopropanolamid |
431-540-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
616-163-00-1 |
4,4'-methylenbis[N-(4-chlorphenyl)-3-hydroxynaphthalen-2-carboxamid] |
430-350-3 |
192463-88-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-164-00-7 |
dimoxystrobin (ISO); (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamid |
— |
149961-52-4 |
Carc. 2 Repr. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361D *** H332 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361D *** H332 H410 |
|
M = 10 |
|
|
616-165-00-2 |
beflubutamid (ISO); (RS)-N-benzyl-2-(α, α,α,4-tetrafluor-m-tolyoxy)butyramid |
— |
113614-08-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 |
|
|
616-166-00-8 |
cyazofamid (ISO); 4-chlor-2-cyan-N, N-dimethyl-5-p-tolylimidazol-1-sulfonamid |
— |
120116-88-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
616-167-00-3 |
N, N-dibutyl-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)acetamid |
418-290-6 |
168612-06-4 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
616-168-00-9 |
1-dimethylcarbamoyl-4-(2-sulfonatoethyl)pyridinium |
418-440-0 |
136997-71-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
616-169-00-4 |
4-[4-(2,2-dimethyl-propanamido)]phenylazo-3-(2-chlor-5-(2-(3-pentadecylphenoxy)butylamido)anilino)-1-(2,4,6-trichlorphenyl)-2-pyrazolin-5-on |
420-220-4 |
92771-56-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-170-00-X |
(2R)-2-amino-2-phenylacetamid |
420-370-0 |
6485-67-2 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
616-171-00-5 |
2-(p-chlorphenyl)glycinamid |
420-830-0 |
102333-75-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
616-172-00-0 |
N-(2,2,6,6,-tetramethyl-1-oxylpiperidin-4-yl)acetamid; (4-acetamido-2,2,6,6-tetra -methyl-1-piperidinyl)oxidanyl |
423-840-3 |
14691-89-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
616-174-00-1 |
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-onhydrochlorid |
424-560-4 |
151257-01-1 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
616-175-00-7 |
2-(2-hexyldecyloxy)benzamid |
431-230-3 |
202483-62-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-176-00-2 |
3-N, N-bis(methoxyethyl)aminoacetanilid |
432-530-7 |
24294-01-7 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
616-177-00-8 |
(3-(4-(2-(butyl-(4-methylphenylsulfonyl)-amino)-phenylthio)-5-oxo-1-(2,4,6-trichlorphenyl)-4,5-dihydro-1H-pyrazol-3-ylamino)-4-chlorphenyl)tetradecanamid; N-[3-({4-[(2-{butyl[(4-methylphenyl)sulfonyl]amino}phenyl)thio]-5-oxo-1-(2,4,6-trichlorphenyl)-4,5-dihydro-1H-pyrazol-3-yl}amino)-4-chlorphenyl]tetradecanamid |
432-970-1 |
217324-98-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-178-00-3 |
N-(5-(bis(2-methoxyethyl)amino)-2-((2-cyan-4,6-dinitrophenyl)azo)phenyl)acetamid |
434-500-9 |
52583-35-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-179-00-9 |
2-chlor-N-(4-methylphenyl)acetamid |
435-170-9 |
16634-82-5 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
616-180-00-4 |
N, N-(dimethylamino)thioacetamidhydrochlorid |
435-470-1 |
27366-72-9 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H400 H410 |
GHS08 GHS09 Dgr |
H360D *** H410 |
|
|
|
|
616-181-00-X |
4'-methyldodecan-1-sulfonanilid |
435-490-9 |
17417-32-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-182-00-5 |
N'-(1,3-dimethylbutyliden)-3-hydroxy-2-naphthohydrazid |
435-860-1 |
214417-91-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
616-183-00-0 |
N-dodecyl-4-methoxybenzamid |
442-340-6 |
1854-15-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-184-00-6 |
3-methyl-N-(5,8,13,14-tetrahydro-5,8,14-trioxonaphth[2,3-c]acridin-6-yl)benzamid |
442-560-2 |
105043-55-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-186-00-7 |
N, N'-(2-chlor-1,4-phenylen)bis(3-oxobutanamid) |
443-010-4 |
53641-10-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
616-188-00-8 |
2-(5,5-dimethyl-2,4-dioxooxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-octadecanoylaminophenyl)pentansyreamid |
443-980-9 |
221215-20-9 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-189-00-3 |
N-[5-(bis-(2-methoxy-ethyl)-amino]-2-(6-brom-2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-phenyl]acetamid |
444-780-4 |
452962-97-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-190-00-9 |
N-decyl-4-nitrobenzamid |
445-880-0 |
64026-19-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-191-00-4 |
2-ethyl-N-methyl-N-(3-methylphenyl)butanamid |
446-190-2 |
406488-30-0 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H319 H315 H317 H411 |
GHS07 GHS09 Wng |
H302 H319 H315 H317 H411 |
|
|
|
|
616-192-00-X |
2-[2-(3-butoxypropyl)-1,1-dioxo-1,2,4-benzothiadiazin-3-yl]-5'-tert-butyl-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2'-[(2-ethylhexyl)thio]acetanilid |
448-060-0 |
727678-39-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-193-00-5 |
N-[2-(2-butyl-4,6-dicyan-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-5-diethylamino-phenyl]acetamid |
449-940-7 |
368450-39-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-194-00-0 |
2,2-diethoxy-N, N-dimethylacetamid |
449-950-1 |
34640-92-1 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
616-196-00-1 |
dinatriumsalt af 1-hydroxy-4-(β-(4-(1-hydroxy-3,6-disulfo-8-acetylamino-2-naphthylazo)phenoxy)ethoxy)-N-dodecyl-2-naphthamid |
419-990-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
616-197-00-7 |
blanding af kalium-N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoroctansulfonamidat og N-[3-(dimethyloxidoamino)propyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoroctan sulfonamid |
422-500-1 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
616-198-00-2 |
1,3-bis[12-hydroxy-octadecamid-N-methylen]benzen |
423-300-7 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
616-200-00-1 |
blanding af N, N'-ethan-1,2-diylbis(hexanamid) og 12-hydroxy-N-[2-[(1-oxyhexyl)amino]ethyl]octadecanamid og N, N'-ethan-1,2-diylbis(12-hydroxyoctadecanamid) |
432-430-3 |
|
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
616-201-00-7 |
12-hydroxyoctadecansyre, reaktionsprodukter med 1,3-benzendimethanamin og hexamethylendiamin |
432-840-2 |
220926-97-6 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
616-202-00-2 |
en blanding af 2,2'-[(3,3'-dichlor[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)]-3-oxo-butanamid; 2-[[3,3'-dichlor-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-methylphenyl)-3-oxo-butanamid og 2-[[3,3'-dichlor-4'-[[1[[(2,4-dimethylphenyl)amino]carbonyl]-2-oxopropyl]azo][1,1'-biphenyl]-4-yl]azo]-N-(2-carboxylphenyl)-3-oxo-butanamid |
434-330-5 |
— |
Carc. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
|
|
|
|
616-203-00-8 |
en blanding af N-[5-[bis-(2-methoxy-ethyl)-amino]-2-(2-butyl-4,6-dicyan-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl-azo)-phenyl]-acetamid og N-[2-(2-butyl-4,6-dicyan-1,3-dioxo-2,3-dihydro-1H-isoindol-5-ylazo)-5-diethylamino-phenyl]-acetamid |
442-280-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-204-00-3 |
N, N''-(methylendi-4,1-phenylen)bis[N'-octylurinstof] |
451-060-3 |
122886-55-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
616-205-00-9 |
metazachlor (ISO); 2-chlor-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamid |
266-583-0 |
67129-08-2 |
Skin Sens. 1B Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H351 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H317 H351 H410 |
|
M = 100 M = 100 |
|
|
616-206-00-4 |
flufenoxuron (ISO); 1-(4-(2-chlor-α, α,α-p-trifluortolyloxy)-2-fluorphenyl)-3- (2,6-difluorbenzolyl)urinstof |
417-680-3 |
101463-69-8 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
|
M = 10 000 M = 10 000 |
|
|
616-208-00-5 |
N-ethyl-2-pyrrolidon; N-ethyl-2-pyrrolidon; |
220-250-6 |
2687-91-4 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
|
|
616-209-00-0 |
amidosulfuron (ISO); 3-(4,6-dimethoxypyrimidin-2-yl)-1-((N-methyl-N-methylsulfonylamino)sulfonyl)urinstof |
407-380-0 |
120923-37-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 M = 100 |
|
|
616-210-00-6 |
tebufenpyrad (ISO); N-(4-tertbutylbenzyl)-4-chlor-3-ethyl-1-methyl-1H-pyrazol-5-carboxamid |
|
119168-77-3 |
Acute Tox. 3 Acute Tox. 4 STOT RE 2 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H373 (mavetarmkanal) (oral) H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H373 (mavetarmkanal) (oral) H317 H410 |
|
M = 10 M = 10 |
|
|
616-211-00-1 |
proquinazid (ISO); 6-iod-2-propoxy-3-propylquinazolin-4(3H)-on |
|
189278-12-4 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 |
|
|
616-212-00-7 |
3-iod-2-propynyl-butylcarbamat; 3-iodprop-2-yn-1-yl-butylcarbamat |
259-627-5 |
55406-53-6 |
Acute Tox. 3 Acute Tox. 4 STOT RE 1 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H372 (strubehoved) H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H302 H372 (strubehoved) H318 H317 H410 |
|
M = 10 M = 1 |
|
|
617-001-00-2 |
di-tert-butylperoxid |
203-733-6 |
110-05-4 |
Org. Perox. E Flam. Liq. 2 Muta. 2 |
H242 H225 H341 |
GHS02 GHS08 Dgr |
H242 H225 H341 |
|
|
|
|
617-002-00-8 |
α, α-dimethylbenzylhydroperoxid cumenhydroperoxid |
201-254-7 |
80-15-9 |
Org. Perox. E Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Chronic 2 |
H242 H331 H312 H302 H373 ** H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H242 H331 H312 H302 H373 ** H314 H411 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Dam. 1; H318: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 3 % STOT SE 3; H335: C < 10 % |
|
|
617-003-00-3 |
dilauroylperoxid |
203-326-3 |
105-74-8 |
Org. Perox. D |
H242 |
GHS02 Dgr |
H242 |
|
|
|
|
617-004-00-9 |
1,2,3,4-tetrahydro-1-naphthylhydroperoxid |
212-230-0 |
771-29-9 |
Org. Perox. D Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H242 H302 H314 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H302 H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
617-006-00-X |
bis (α, α-dimethylbenzyl) peroxid |
201-279-3 |
80-43-3 |
Org. Perox. F Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H242 H319 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H242 H319 H315 H411 |
|
|
|
|
617-007-00-5 |
tert-butyl-α, α-dimethylbenzylperoxid |
222-389-8 |
3457-61-2 |
Org. Perox. E Skin Irrit. 2 Aquatic Chronic 2 |
H242 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H242 H315 H411 |
|
|
|
|
617-008-00-0 |
dibenzoylperoxid; benzoylperoxid |
202-327-6 |
94-36-0 |
Org. Perox. B Eye Irrit. 2 Skin Sens. 1 |
H241 H319 H317 |
GHS01 GHS02 GHS07 Dgr |
H241 H319 H317 |
|
|
|
|
617-010-00-1 |
1-hydroperoxycyclohexyl-1-hydroxycyclohexylperoxid; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidenhydroperoxid; [3] cyclohexanonperoxid [4] |
201-091-1 [1] 219-306-2 [2] 220-279-4 [3] 235-527-7 [4] |
78-18-2 [1] 2407-94-5 [2] 2699-11-8 [3] 12262-58-7 [4] |
Org. Perox. A Skin Corr. 1B Acute Tox. 4 * |
H240 H314 H302 |
GHS01 GHS05 GHS07 Dgr |
H240 H314 H302 |
|
STOT SE 3; H335: C ≥ 5 % |
C |
|
617-010-01-9 |
1-hydroperoxycyclohexyl-1-hydroxycyclohexylperoxid; [1] 1,1'-dioxybiscyclohexan-1-ol; [2] cyclohexylidenhydroperoxid; [3] cyclohexanon, peroxid [4] [≤ 91 % opløsning] |
201-091-1 [1] 219-306-2 [2] 220-279-4 [3] 235-527-7 [4] |
78-18-2 [1] 2407-94-5 [2] 2699-11-8 [3] 12262-58-7 [4] |
Org. Perox. C Acute Tox. 4 * Skin Corr. 1B |
H242 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H242 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
C T |
|
617-012-00-2 |
8-p-menthanylhydroperoxid; p-menthanhydroperoxid |
201-281-4 |
80-47-7 |
Org. Perox. D Skin Corr. 1B Acute Tox. 4 * |
H242 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H242 H314 H332 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
617-013-00-8 |
O, O-tert-butyl-O-docosylmonoperoxyoxalat |
404-300-6 |
116753-76-5 |
Org. Perox. C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
|
|
|
|
617-014-00-3 |
6-(nonylamino)-6-oxo-peroxyhexansyre |
406-680-9 |
104788-63-8 |
Org. Perox. C **** Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H242 H318 H317 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H318 H317 H400 |
|
|
|
|
617-015-00-9 |
bis(4-methylbenzoyl)peroxid |
407-950-9 |
895-85-2 |
Org. Perox. B**** Aquatic Acute 1 Aquatic Chronic 1 |
H241 H400 H410 |
GHS01 GHS02 GHS09 Dgr |
H241 H410 |
|
|
|
|
617-016-00-4 |
3-hydroxy-1,1-dimethylbutyl-2-ethyl-2-methylheptanperoxoat |
413-910-1 |
— |
Org. Perox. C **** Flam. Liq. 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H242 H226 H315 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H242 H226 H315 H410 |
|
|
|
|
617-017-00-X |
en blanding af 2,2'-bis(tert-pentylperoxy)-p-diisopropylbenzen og 2,2'-bis(tert-pentylperoxy)-m-diisopropylbenzen |
412-140-3 |
32144-25-5 |
Org. Perox. D Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
|
|
T |
|
617-018-00-5 |
en blanding af 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxid, 63 vægtprocent og 1-methyl-1-(4-(1-methyl- ethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxid, 31 vægtprocent |
410-840-3 |
71566-50-2 |
Org. Perox. C **** Aquatic Chronic 2 |
H242 H411 |
GHS02 GHS09 Dgr |
H242 H411 |
|
|
T |
|
617-019-00-0 |
6-(phthalimido)peroxyhexansyre |
410-850-8 |
128275-31-0 |
Org. Perox. D Eye Dam. 1 Aquatic Acute 1 |
H242 H318 H400 |
GHS02 GHS05 GHS09 Dgr |
H242 H318 H400 |
|
|
T |
|
617-020-00-6 |
1,3-di(prop-2,2-diyl)benzen bis(neodecanoylperoxid) |
420-060-5 |
117663-11-3 |
Flam. Liq. 3 Org. Perox. D **** Aquatic Chronic 2 |
H226 H242 H411 |
GHS02 GHS09 Dgr |
H226 H242 H411 |
|
|
|
|
617-021-00-1 |
methylethylketonperoxid trimer |
429-320-2 |
— |
Org. Perox. B**** Asp. Tox. 1 Skin Irrit. 2 Skin Sens. 1 |
H241 H304 H315 H317 |
GHS01 GHS02 GHS08 GHS07 Dgr |
H241 H304 H315 H317 |
|
|
|
|
617-022-00-7 |
en blanding af 1,2-dimethylpropylidendihydroperoxid og dimethyl-1,2-benzendicarboxylat |
442-480-8 |
— |
Org. Perox. C Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H242 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H302 H314 H317 H411 |
|
|
|
|
647-001-00-8 |
glucosidase, β- |
232-589-7 |
9001-22-3 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
647-002-00-3 |
cellulase |
232-734-4 |
9012-54-8 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
647-003-00-9 |
cellobiohydrolase, exo- |
253-465-9 |
37329-65-0 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
647-004-00-4 |
cellulaser undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
A |
|
647-005-00-X |
bromelain, saft |
232-572-4 |
9001-00-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-006-00-5 |
ficin |
232-599-1 |
9001-33-6 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-007-00-0 |
papain |
232-627-2 |
9001-73-4 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-008-00-6 |
pepsin A |
232-629-3 |
9001-75-6 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-009-00-1 |
rennin |
232-645-0 |
9001-98-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-010-00-7 |
trypsin |
232-650-8 |
9002-07-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-011-00-2 |
chymotrypsin |
232-671-2 |
9004-07-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-012-00-8 |
subtilisin |
232-752-2 |
9014-01-1 |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 |
H335 H315 H318 H334 |
GHS08 GHS05 GHS07 Dgr |
H335 H315 H318 H334 |
|
|
|
|
647-013-00-3 |
proteinase, mikrobiel neutral |
232-966-6 |
9068-59-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-014-00-9 |
proteaser undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H319 H335 H315 H334 |
|
|
|
|
647-015-00-4 |
amylase, α- |
232-565-6 |
9000-90-2 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
647-016-00-X |
amylaser undtagen sådanne nævnt andetsteds i dette bilag |
— |
— |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
647-017-00-5 |
laccase |
420-150-4 |
80498-15-3 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
648-001-00-0 |
destillat (stenkulstjære), benzenfraktion; letolie; [en sammensat blanding af carbonhydrider opnået ved destillationen af stenkulstjære. Den består af carbonhydrider, primært C4 til C10, med kogeinterval omtrent fra 80 oC til 160 oC.] |
283-482-7 |
84650-02-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-002-00-6 |
tjæreolier, brunkul; letolie; [destillatet fra brunkulstjære, med kogeinterval omtrent fra 80 oC til 250 oC. Sammensat primært af aliphatiske og aromatiske carbonhydrider og monobasiske phenoler.] |
302-674-4 |
94114-40-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-003-00-1 |
benzenforløb (kul); redestilleret letolie, lavtkogende; [destillat fra koksovns letolie med et omtrentligt destillationsinterval under 100 oC. Sammensat primært af aliphatiske C4- til C6-carbonhydrider.] |
266-023-5 |
65996-88-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-004-00-7 |
destillater (stenkulstjære), benzenfraktion, benzen-, toluen- og xylenrige; redestilleret letolie, lavtkogende; [en rest fra destillationen af rå benzen til fjernelse af de første benzendestillationsprodukter.] Sammensat primært af benzen, toluen og xylen, med kogeinterval omtrent fra 75 oC til 200 oC. |
309-984-9 |
101896-26-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-005-00-2 |
aromatiske carbonhydrider, C6-10-, C8-rige; redestilleret letolie, lavtkogende |
292-697-5 |
90989-41-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-006-00-8 |
solventnaphtha (kul), let; redestilleret letolie, lavtkogende |
287-498-5 |
85536-17-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-007-00-3 |
solventnaphtha (kul), xylen-styrenfraktion; redestilleret letolie, mellemdestillat |
287-502-5 |
85536-20-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-008-00-9 |
solventnaphtha (kul), coumaron-styrenholdig; redestilleret letolie, mellemdestillat |
287-500-4 |
85536-19-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-009-00-4 |
naphtha (kul), destillationsrester; redestilleret letolie, højtkogende; [resten tilbageblevet ved destillation af genvundet naphta. Sammensat primært af naphthalen og kondensationsprodukter af inden og styren.] |
292-636-2 |
90641-12-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-010-00-X |
aromatiske carbonhydrider, C8; redestilleret letolie, højtkogende |
292-694-9 |
90989-38-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-012-00-0 |
aromatiske carbonhydrider, C8-9, biprodukter fra carbonhydridharpikspolymerisation; redestilleret letolie, højtkogende; [en sammensat blanding af carbonhydrider opnået ved afdampning af solvent, under vakuum, fra polymeriseret carbonhydridharpiks. Den består overvejende af aromatiske carbonhydrider, overvejende C8 til og med C9, med kogeinterval omtrent fra 120 oC til 215 oC.] |
295-281-1 |
91995-20-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-013-00-6 |
aromatiske carbonhydrider, C9-12-, benzendestillation; redestilleret letolie, højtkogende lavtkogende |
295-551-9 |
92062-36-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-014-00-1 |
ekstraktionsrester (kul), alkalisk benzenfraktion, syreekstrakt; syrefri letolie, lavtkogende; [redestillatet fra destillatet, befriet for tjæresyrer og tjærebaser, fra højtemperaturstjære fra bituminøse kul, med kogeinterval omtrent fra 90 oC til 160 oC. Det består overvejende af benzen, toluen og xylener.] |
295-323-9 |
91995-61-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-015-00-7 |
ekstraktionsrester (stenkulstjære), benzolfraktion alkaliske, syreekstrakt; syrefri letolie, lavtkogende [en sammensat blanding af carbonhydrider opnået ved redestillationen af destillatet af højtemperatursstenkulstjære (tjæresyre- og tjærebasefri). Den består overvejende af usubstituerede og substituerede monocycliske, aromatiske carbonhydrider med kogeinterval fra 85 oC til 195 oC.] |
309-868-8 |
101316-63-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-016-00-2 |
ekstraktionsrester (kul), benzenfraktion, syre; syrefri letolie, lavtkogende; [et syreslamsbiprodukt fra svovlsyreraffineringen af rå højtemperaturskul. Sammensat primært af svovlsyre og organiske forbindelser.] |
298-725-2 |
93821-38-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-017-00-8 |
ekstraktionsrester (kul), letolie alkaliske, destillationstopfraktioner; syrefri letolie, lavtkogende; [den første fraktion fra destillation af aromatiske carbonhydrider, coumaron-, naphthalen- og indenrige præfraktioneringskolonnebundfraktioner eller vasket carbololie, kogt væsentligt under 145 oC. Sammensat primært af C7 og C8 aliphatiske og aromatiske carbonhydrider.] |
292-625-2 |
90641-02-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-018-00-3 |
ekstraktionsrester (kul), letolie-alkaliske, syreekstrakt, indenfraktion; syrefri letolie, mellemdestillat |
309-867-2 |
101316-62-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-019-00-9 |
ekstraktionsrester (kul), letolie alkaliske, indennaphthafraktion; syrefri letolie, højkogende; [destillatet fra aromatiske carbonhydrider, coumaron-, naphthalen- og indenrige præfraktioneringskolonnebundfraktioner eller vasket carbololie, med kogeinterval omtrent fra 155 oC til 180 oC. Sammensat primært af inden, indan og trimethylbenzener.] |
292-626-8 |
90641-03-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-020-00-4 |
solventnaphtha (kul); syrefri letolie, højtkogende; destillatet fra enten højtemperatursstenkulstjære, koksovnsletolie eller alkalisk ekstraktionsrest af stenkulstjæreolie, med et omtrentligt destillationsinterval fra 130 oC til 210 oC. Sammensat primært af inden og andre polycycliske ringsystemer indeholdende en enkelt aromatisk ring. Kan indeholde phenolforbindelser og aromatiske nitrogenbaser.] |
266-013-0 |
65996-79-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-021-00-X |
destillater (stenkulstjære), letolier, neutral fraktion; syrefri letolie, højtkogende [et destillat fra den fraktionerede destillation af højtemperatursstenkulstjære. Sammensat primært af alkylsubstituerede, monocycliske, aromatiske carbonhydrider, med kogeinterval omtrent fra 135 oC til 210 oC. Kan også indeholde umættede carbonhydrider såsom inden og coumaron.] |
309-971-8 |
101794-90-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-022-00-5 |
destillater (stenkulstjære), lette olier, syreekstrakter; syrefri letolie, højtkogende; [denne olie er en sammensat blanding af aromatiske carbonhydrider, primært inden, naphthalen, coumaron, phenol og o-, m- og p-cresol, med kogeinterval fra 140 oC til 215 oC.] |
292-609-5 |
90640-87-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-023-00-0 |
destillater (stenkulstjære), lette olier; karbololie; [en sammensat blanding af carbonhydrider opnået ved destillation af stenkulstjære. Den består af aromater og andre carbonhydrider, phenolforbindelser og aromatiske nitrogenforbindelser og med destillationsinterval omtrent fra 150 oC til 210 oC.] |
283-483-2 |
84650-03-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-024-00-6 |
tjæreolier, stenkuls; letolie; [destillat fra højtemperatursstenkulstjære med et omtrentligt destillationsinterval fra 130 oC til 250 oC. Sammensat primært af naphthalen, alkylnaphthalener, phenolforbindelser og aromatiske nitrogenbaser.] |
266-016-7 |
65996-82-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-026-00-7 |
ekstraktionsrester (kul), letolie alkaliske, syreekstrakt; syrefri karbololie; [olien fremkommet ved syrevask af alkalivasket carbololie for at fjerne mindre mængder af basiske forbindelser (tjærebaser). Sammensat primært af inden, indan og alkylbenzener.] |
292-624-7 |
90641-01-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-027-00-2 |
ekstraktionsrester (kul), tjæreolie alkaliske; syrefri karbololie [rest opnået fra stenkulstjæreolie ved en alkalisk vask, såsom vandig natriumhydroxid, efter fjernelsen af råstenkulstjæresyrer. Sammensat primært af naphthalener og aromatiske nitrogenbaser.] |
266-021-4 |
65996-87-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-028-00-8 |
ekstraktionsolier (stenkul), letolier; syreekstrakt; [det vandige ekstrakt fremstillet ved sur vask af alkalivasket carbololie. Sammensat primært af syresalte af forskellige aromatiske nitrogenbaser, inklusive pyridin, quinolin og deres alkylderivater.] |
292-622-6 |
90640-99-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-029-00-3 |
pyridin, alkylderivater; råtjærebaser; [den sammensatte blanding af polyalkylerede pyridiner opnået ved stenkulstjæredestillation eller som højtkogende destillater, omtrent højere end 150 oC, fra reaktion mellem ammoniak og acetaldehyd, formaldehyd eller paraformaldehyd.] |
269-929-9 |
68391-11-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-030-00-9 |
tjærebaser, stenkuls-, picolinfraktion; basedestillater; [pyridinbaser, med kogeinterval omtrent fra 125 oC til 160 oC, opnået ved destillation af et neutraliseret syreekstrakt fra den baseholdige tjærefraktion, opnået ved destillationen af bituminøs stenkulstjære. Sammensat hovedsagelig af lutidiner og picoliner.] |
295-548-2 |
92062-33-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-031-00-4 |
tjærebaser, stenkuls-, lutidinfraktion; basedestillater |
293-766-2 |
91082-52-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-032-00-X |
ekstraktionsolier (kul), tjærebase, collidinfraktion; basedestillater; [ekstraktet fremstillet ved den sure ekstraktion af baser fra aromatiske olier fra rå kultjære, neutralisation og destillation af baserne. Sammensat primært af collidiner, anilin, toluidiner, lutidiner og xylidiner.] |
273-077-3 |
68937-63-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-033-00-5 |
tjærebaser, stenkuls-, collidinfraktion; basedestillater; [destillationsfraktionen, med kogeinterval omtrent fra 181 oC til 186 oC, fra råbaser, opnået fra den neutraliserede, syreekstraherede, baseholdige tjærefraktion, opnået ved destillationen af bituminøs stenkulstjære. Den indeholder hovedsagelig anilin og collidiner.] |
295-543-5 |
92062-28-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-034-00-0 |
tjærebaser, stenkuls-, anilinfraktion; basedestillater; [destillationsfraktionen med kogeinterval omtrent fra 180 oC til 200 oC, fra råbaser opnået ved at fjerne phenoler og baser fra den carbolerede olie fra destillationen af stenkulstjære. Den indeholder hovedsagelig anilin, collidiner, lutidiner og toluidiner.] |
295-541-4 |
92062-27-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-035-00-6 |
tjærebaser, stenkuls-, toluidinfraktion; basedestillater |
293-767-8 |
91082-53-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-036-00-1 |
destillater (råolie), alken-alkyn-fabrikations-pyrolyseolie, blandet med højtemperatursstenkulstjære, indenfraktion; redestillater; [en sammensat blanding af carbonhydrider opnået som et redestillat fra den fraktionerede destillation af højtemperaturstjære fra bituminøse kul, og restolier, der er opnået fra den pyrolytiske fremstilling af alkener og alkyner ud fra råolieprodukter eller naturgas. Den består overvejende af inden og har kogeinterval omtrent fra 160 oC til 190 oC.] |
295-292-1 |
91995-31-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-037-00-7 |
destillater (kul), stenkulstjære-restpyrolyseolier, naphthalenolier; redestillater; [redestillatet, opnået fra den fraktionerede destillation af højtemperaturstjære fra bituminøse kul og pyrolyserestolier, med kogeinterval omtrent fra 190 oC til 270 oC. Sammensat primært af substituerede, bicycliske aromater.] |
295-295-8 |
91995-35-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-038-00-2 |
ekstraktionsrester (kul), stenkulstjære restpyrolyseolier, naphthalenolie, restdestillat; redestillater; [redestillatet fra den fraktionerede destillation af phenol og basefri methylnaphthalenolie opnået fra højtemperaturstjære fra bituminøse kul og restpyrolyseolier, med kogeinterval omtrent fra 220 oC til 230 oC. Det består overvejende af usubstituerede og substituerede, bicycliske, aromatiske carbonhydrider.] |
295-329-1 |
91995-66-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-039-00-8 |
ekstraktionsolier (stenkul), stenkulstjære rest-pyrolyseolier, naphthalenolier; redestillater; [en neutral olie opnået ved fjernelse af base og phenol fra olien opnået ved destillation af højtemperaturstjære og pyrolyserestolier, med kogeinterval omtrent fra 225 oC til 255 oC. Sammensat primært af substituerede bicykliske aromatiske carbonhydrider.] |
310-170-0 |
122070-79-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-040-00-3 |
ekstraktionsolier (stenkul), stenkulstjære rest-pyrolyseolier, naphthalenolie, destillationsrester; redestillater; [rest fra destillationen af methylnaphthalenolie (fra tjære fra bituminøse kul og pyrolyserestolier), der er befriet for phenol og baser, med et kogeinterval fra 240 oC til 260 oC. Sammensat primært af substituerede bicykliske aromatiske og heterocycliske carbonhydrider.] |
310-171-6 |
122070-80-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-041-00-9 |
absorptionsolier, bicycliske aromater og heterocyclisk carbonhydridfraktion; redestilleret vaskeolie; [en sammensat blanding af carbonhydrider opnået som et redestillat fra destillationen af vaskeolie. Den består overvejende af 2-ringede aromatiske og heterocycliske carbonhydrider, med kogeinterval omtrent fra 260 oC til 290 oC.] |
309-851-5 |
101316-45-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-042-00-4 |
destillater (stenkulstjære), øvre, fluorenrige; redestilleret vaskeolie; [en sammensat blanding af carbonhydrider opnået ved krystallisationen af tjæreolie. Den består af aromatiske og polycycliske carbonhydrider, primært fluoren og noget acenaphthen.] |
284-900-0 |
84989-11-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-043-00-X |
creosotolie, acenaphthenfraktion, acenaphthenfri; redestilleret vaskeolie; [den tiloversblevne olie efter fjernelse, ved en krystallisationsproces, af acenaphthen fra acenaphthenolie fra stenkulstjære. Sammensat primært af naphthalen og alkylnaphthalener.] |
292-606-9 |
90640-85-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-044-00-5 |
destillater (stenkulstjære), tunge olier; tung antracenolie; [destillater, fra fraktioneret destillation af stenkulstjære fra bituminøse kul, med kogeinterval omtrent fra 240 oC til 400 oC. Sammensat primært af tri- og polycycliske, carbonhydrider og heterocycliske forbindelser.] |
292-607-4 |
90640-86-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-045-00-0 |
destillater (stenkulstjære), øvre; tung antracenolie; [destillatet fra stenkulstjære med et omtrentligt destillationsinterval fra 220 oC til 450 oC. Sammensat primært af aromatiske carbonhydrider, bestående af tre- til firleddede kondenserede ringe og andre carbonhydrider.] |
266-026-1 |
65996-91-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-046-00-6 |
anthracenolie, syreekstrakt; basefri antracenolie; [en sammensat blanding af carbonhydrider, fra den basebefriede fraktion opnået fra destillationen af stenkulstjære, med kogeinterval omtrent fra 325 oC til 365 oC. Den indeholder overvejende anthracen og phenanthren og deres alkylderivater] |
295-274-3 |
91995-14-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-047-00-1 |
destillater (stenkulstjære); tung antracenolie; [destillatet fra stenkulstjære med et omtrentligt destillationsinterval fra 100 oC til 450 oC. Sammensat primært af aromatiske carbonhydrider, bestående af to- til firleddede kondenserede ringe, phenolforbindelser og aromatiske nitrogenbaser.] |
266-027-7 |
65996-92-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-048-00-7 |
destillater (stenkulstjære), beg-, tunge olier; tung antracenolie; [destillatet fra destillationen af begen opnået fra bituminøs højtemperaturstjære. Sammensat primært af tri- og polycycliske aromatiske carbonhydrider, med kogeinterval omtrent fra 300 oC til 470 oC. Produktet kan også indeholde heteroatomer.] |
295-312-9 |
91995-51-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-049-00-2 |
destillater (kultjære) beg; tung antracenolie; [olien opnået ved kondensering af dampene fra varmebehandlingen af beg. Sammensat primært af to- til firringede aromatiske forbindelser, med kogeinterval omtrent fra 200 oC til mere end 400 oC.] |
309-855-7 |
101316-49-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-050-00-8 |
destillater (stenkulstjære), tunge olier, pyrenfraktion; redestilleret tung antracenolie; [redestillatet, opnået fra fraktioneret destillation af begdestillat, med kogeinterval omtrent fra 350 oC til 400 oC. Består overvejende af tri- og polycycliske aromater og heterocycliske carbonhydrider.] |
295-304-5 |
91995-42-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-051-00-3 |
destillater (stenkulstjære), beg-, pyrenfraktion; redestilleret tung antracenolie; [redestillatet, opnået fra fraktioneret destillation af begdestillat, med kogeinterval omtrent fra 380 oC til 410 oC. Sammensat primært af tri- og polycycliske aromatiske carbonhydrider og heteocycliske forbindelser.] |
295-313-4 |
91995-52-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-052-00-9 |
paraffinvokser (kul), brunkulhøjtemperaturstjære, carbonbehandlet; syre- og basefri kultjære; [en sammensat blanding af carbonhydrider opnået ved behandlingen af brunkul-forkulningstjære med aktivt kul for at fjerne sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-296-6 |
97926-76-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-053-00-4 |
paraffinvokser (kul), brunkulhøjtemperaturstjære, lerbehandlet; syre- og basefri kultjære; [en sammensat blanding af carbonhydrider opnået ved behandlingen af brunkul-forkulningstjære med bentonit for at fjerne sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-297-1 |
97926-77-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-054-00-X |
beg; tjærebeg |
263-072-4 |
61789-60-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-055-00-5 |
beg, kultjære-, højtemperaturs-; tjærebeg; [resten fra destillationen af højtemperatursstenkulstjære. Et sort, fast stof med et blødgøringspunkt omtrent fra 30 oC til 180 oC. Består primært af en sammensat blanding af aromatiske carbonhydrider, bestående af tre- eller flerleddede kondenserede ringe.] |
266-028-2 |
65996-93-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-056-00-0 |
beg, kultjære, højtemperatur, varmebehandlet; tjærebeg; [den varmebehandlede rest fra destillationen af højtemperaturstenkulstjære. Et sort, fast stof med et blødgøringspunkt omtrent fra 80 oC til 180 oC. Sammensat primært af en kompleks blanding af tre- eller flerleddede, kondenserede, aromatiske carbonhydrider.] |
310-162-7 |
121575-60-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-057-00-6 |
beg, kultjære-, højtemperaturs, sekundær; redestilleret tjærebeg; [resten opnået under destillationen af højtkogende fraktioner fra højtemperaturstjære fra bituminøse kul og/eller begkoksolie, med et blødgøringspunkt fra 140 oC til 170 oC ifølge DIN 52025. Sammensat primært af tri-og polycycliske, aromatiske forbindelser, som også indeholder heteroatomer.] |
302-650-3 |
94114-13-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-058-00-1 |
rester (stenkulstjære), begdestillations-; redestilleret tjærebeg; [rest, fra den fraktionerede destillation af begdestillat, med kogeinterval omtrent fra 400 oC til 470 oC. Sammensat primært af polycycliske, aromatiske carbonhydrider og heterocycliske forbindelser.] |
295-507-9 |
92061-94-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-059-00-7 |
tjære, stenkuls-, højtemperatur, destillations- og oplageringsrester; kultjæresediment; [koks- og askeholdige, faste rester, der adskilles ved destillation og termisk behandling af højtemperaturstjære fra bituminøse kul i destillationsinstallationer og oplageringsbeholdere. Består overvejende af carbon, og indeholder små mængder af heteroforbindelser, så vel som askekomponenter.] |
295-535-1 |
92062-20-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-060-00-2 |
tjære, stenkuls-, lagerrester; kultjæresediment; [aflejringer, fjernet fra lagre af rå stenkulstjære. Består primært af stenkulstjære og kulholdigt, findelt stof.] |
293-764-1 |
91082-50-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-061-00-8 |
tjære, stenkuls-, højtemperaturs-, rester, kultjæresediment; [faste stoffer dannet under forkoksningen af bituminøse kul for at fremstille rå højtemperaturstjære. Sammensat primært af koks- og kulpartikler, højt aromatiserede forbindelser og mineralske stoffer.] |
309-726-5 |
100684-51-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-062-00-3 |
tjære, stenkuls-, højtemperatur, højt indhold af faste stoffer; kultjæresediment; [kondensationsproduktet opnået ved køling, omtrent til omgivende temperatur, af gassen udviklet ved højtemperaturstørdestillationen (højere end 700 oC) af kul. Består primært af en sammensat blanding af kondenserede aromatiske carbonhydrider med et højt faststof indhold af kul-og koks-lignende materialer.] |
273-615-7 |
68990-61-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-063-00-9 |
affaldsstoffer, faste, kultjærebegsforkoksnings-; kultjæresediment; [det samlede affald dannet ved forkoksningen af bituminøs kultjærebeg. Der består overvejende af carbon.] |
295-549-8 |
92062-34-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-064-00-4 |
ekstraktrester (kul), brunkul; syre- og basefri kultjære; [resten fra toluenekstraktion af tørret brunkul.] |
294-285-0 |
91697-23-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-065-00-X |
paraffinvokser (kul), brunkulshøjtemperaturstjære; syre -og basefri kultjære; [en sammensat blanding af carbonhydrider, opnået fra brunkulsforkulningstjære ved solventkrystallisation (solventafoliering), ved svedning eller en adduktionsproces. Den består overvejende af ligekædede og forgrenede, mættede carbonhydrider, overvejende større end C12.] |
295-454-1 |
92045-71-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-066-00-5 |
paraffinvokser (kul), brunkulshøjtemperaturstjære, hydrogenbehandlede; syre -og basefri kultjære; [en sammensat blanding af carbonhydrider, opnået fra brunkulsforkulningstjære ved solventkrystallisation (solventafoliering), ved svedning eller en adduktionsproces, behandlet med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af ligekædede og forgrenede, mættede carbonhydrider, overvejende større end C12.] |
295-455-7 |
92045-72-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-067-00-0 |
paraffinvokser (kul), brunkulhøjtemperaturstjære, kiselsyrebehandlet; syre- og basefri kultjære; [en sammensat blanding af carbonhydrider opnået ved behandlingen af brunkul-forkulningstjære med kiselsyre for af fjerne sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-298-7 |
97926-78-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-068-00-6 |
tjære, stenkuls-, lavtemperatur, destillationsrester; kultjæreolie, mellemdestillat; [rester fra fraktioneret destillation af lavtemperatursstenkulstjære for at fjerne olier, der koger i området op til omtrent 300 oC. Sammensat primært af aromatiske forbindelser.] |
309-887-1 |
101316-85-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-069-00-1 |
beg, kultjære-, lavtemperatur, tjærebeg; [et sammensat sort, fast, eller halvfast stof opnået ved destillation af en lavtemperaturstenkulstjære. Det har et blødgøringspunkt mellem omtrent 40 oC og 180 oC. Sammensat primært af en kompleks blanding af carbonhydrider.] |
292-651-4 |
90669-57-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-070-00-7 |
beg, kultjære, lavtemperatur, oxideret; tjærebeg, oxideret; [produktet opnået ved at luftgennemblæse lavtemperaturkultjærebeg ved forhøjet temperatur. Det har et blødgøringspunkt mellem omtrent 70 oC og 180 oC. Sammensat primært af en kompleks blanding af carbonhydrider.] |
292-654-0 |
90669-59-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-071-00-2 |
beg, kultjære-, lavtemperatur, varmebehandlet; tjærebeg, oxideret; tjærebeg, varmebehandlet; [et sammensat sort, fast, stof opnået ved varmebehandling af lavtemperaturkultjærebeg. Det har et blødgøringspunkt mellem omtrent 50 oC og 140 oC. Sammensat primært af en kompleks blanding af aromatiske forbindelser.] |
292-653-5 |
90669-58-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-072-00-8 |
destillater (kul og råolie), kondenserede aromat-; destillater; [destillatet fra en blandning af stenkulstjære og aromatiske råoliestrømme med destillationsområde omtrent fra 220 oC til 450 oC. Sammensat primært af aromatiske carbonhydrider, bestående af 3- til 4-ledede kondenserede ringe.] |
269-159-3 |
68188-48-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-073-00-3 |
aromatiske carbonhydrider, C20-28-, polycycliske, blandet kultjærebeg, polyethylen og polypropylen, pyrolyse-afledte; pyrolyseprodukter; [en sammensat blanding af carbonhydrider opnået ved pyrolyse af blandet kultjærebeg, polyethylen og polypropylen. Sammensat primært af polycycliske, aromatiske carbonhydrider, overvejende C20 til og med C28, med et blødgøringspunkt fra 100 oC til 220 oC ifølge DIN 52025.] |
309-956-6 |
101794-74-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-074-00-9 |
aromatiske carbonhydrider, C20-28-, polycycliske, blandet kultjærebeg og polyethylen, pyrolyseafledte; pyrolyseprodukter; [en sammensat blanding af carbonhydrider opnået ved pyrolyse af blandet kultjærebeg og polyethylen. Sammensat primært af polycycliske, aromatiske carbonhydrider, overvejende C20 til og med C28, med et blødgøringspunkt fra 100 oC til 220 oC ifølge DIN 52025.] |
309-957-1 |
101794-75-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-075-00-4 |
aromatiske carbonhydrider, C20-28-, polycycliske, blandet kultjærebeg og polystyren, pyrolyseafledte; pyrolyseprodukter; [en sammensat blanding af carbonhydrider opnået ved pyrolyse af blandet kultjærebeg og polystyren. Sammensat primært af polycycliske, aromatiske carbonhydrider, overvejende C20 til og med C28, med et blødgøringspunkt fra 100 oC til 220 oC ifølge DIN 52025.] |
309-958-7 |
101794-76-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-076-00-X |
beg, kultjære- og råolie-; tjærebeg; [resten fra destillationen af en blanding af stenkulstjære og aromatiske råoliestrømme. Et fast stof med et blødgøringspunkt fra 40 oC til 180 oC. Sammensat primært af en kompleks blanding af aromatiske carbonhydrider, bestående af tre- eller flerleddede kondenserede ringe.] |
269-109-0 |
68187-57-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-077-00-5 |
phenanthren, destillationsrester; redestilleret tung antracenolie; [rest, fra destillationen af rå phenanthren, kogende i området omtrent fra 340 oC til 420 oC. Den består overvejende af phenanthren, anthracen og carbazol.] |
310-169-5 |
122070-78-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-078-00-0 |
destillater (stenkulstjære), øvre, fluorenfri; redestilleret vaskeolie; [en sammensat blanding af carbonhydrider opnået ved krystallisationen af tjæreolie. Den består af aromatiske, polycykliske carbonhydrider, primært diphenyl, dibenzofuran og acenaphthen.] |
284-899-7 |
84989-10-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-079-00-6 |
anthracenolie; antracenolie; [en sammensat blanding af polycycliske aromatiske carbonhydrider opnået fra stenkulstjære, med destillationsinterval omtrent fra 300 oC til 400 oC. Sammensat primært af phenanthren, anthracen og carbazol.] |
292-602-7 |
90640-80-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-080-00-1 |
rester (stenkulstjære), creosotolie detillations-; redestilleret vaskeolie; [resten, fra fraktioneret destillation af vaskeolie, med kogeinterval omtrent fra 270 oC til 330 oC. Den består overvejende af bicycliske aromatiske og heterocycliske carbonhydrider.] |
295-506-3 |
92061-93-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-081-00-7 |
tjære, stenkuls-; stenkulstjære; [biproduktet fra tørdestillation af kul. Næsten sort halvfast stof. En sammensat blanding af aromatiske carbonhydrider, phenolforbindelser, nitrogenbaser og thiophen.] |
232-361-7 |
8007-45-2 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-082-00-2 |
tjære, stenkuls-, højtemperaturs-; stenkulstjære; [kondensationsproduktet opnået ved at nedkøle, til omtrent omgivelsestemperatur, den gas, der udvikles ved tørdestillation af kul ved høj temperatur (højere end 700 oC). En sort, viskøs væske tungere end vand. Består primært af en sammensat blanding af kondenserede aromatiske carbonyhdrider. Kan indeholde mindre mængder phenolforbindelser og aromatiske nitrogenbaser.] |
266-024-0 |
65996-89-6 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-083-00-8 |
tjære, stenkuls-, lavtemperatur; stenkulsolie; [kondensationsproduktet opnået ved at nedkøle, til omtrent omgivelsestemperatur, den gas, der udvikles ved tørdestillation af kul ved lav temperatur (lavere end 700 oC). En sort, viskøs væske tungere end vand. Sammensat primært af kondenserede aromatiske carbonhydrider, phenolforbindelser, aromatiske nitrogenbaser og deres alkylderivater.] |
266-025-6 |
65996-90-9 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-084-00-3 |
destillater (kul), koksovns-letolie, naphthalenfraktion; naftalinolie; [den sammensatte blanding af carbonhydrider opnået ved præfraktionering (kontinuerlig destillation) af koksovnsletolie. Den består overvejende af naphtalen, coumaron og inden og koger højere end 148 oC.] |
285-076-5 |
85029-51-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-085-00-9 |
destillater (stenkulstjære), naph thalenolier; naftalinolie; [en sammensat blanding af carbonhydrider opnået ved destillationen af stenskulstjære. Den består primært af aromater og andre carbonhydrider, phenolforbindelser og aromatiske nitrogenforbindelser med destillationsinterval omtrent fra 200 oC til 250 oC.] |
283-484-8 |
84650-04-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-086-00-4 |
destillater (stenkulstjære), naphthalenolier, med lavt indhold af naphthalen; redestilleret naftalinolie; [en sammensat blanding af carbonhydrider opnået ved krystallisation af naphthalenolie. Sammensat primært af naphthalen, alkylnaphthalen og phenolforbindelser.] |
284-898-1 |
84989-09-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-087-00-X |
destillater (stenkulstjære), naphthalenolie-krystallisationsmoderlud; redestilleret naftalinolie; [en sammensat blanding af organiske forbindelser, opnået som et filtrat fra krystallisationen af naphthalenfraktionen fra stenkulstjære, med kogeinterval omtrent fra 200 oC til 230 oC. Indeholder hovedsagelig naphthalen, thionaphthalen og alkylnaphthalener.] |
295-310-8 |
91995-49-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-088-00-5 |
ekstraktionsrester (stenkul), naphtahalenolie, alkaliske; syrefri naftalinolie ; [en sammensat blanding af carbonhydrider opnået fra den alkaliske vask af naphthalenolie for at fjerne phenolforbindelser (tjæresyrer). Den består af naphthalen og alkylnaphthalener.] |
310-166-9 |
121620-47-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-089-00-0 |
ekstraktionsrester (stenkul), naphthalenolie, alkaliske, med lavt indhold af naphthalen; syrefri naftalinolie ; [en sammensat blanding af carbonhydrider, der er blevet tilbage efter fjernelsen af naphthalen fra alkalivasket naphthalenolie ved en krystalliseringsproces. Den er sammensat primært af naphthalen og alkylnaphthalener.] |
310-167-4 |
121620-48-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-090-00-6 |
destillater (stenkulstjære), naphthalenolier, naphthalenfrie, alkaliske ekstrakter; syrefri naftalinolie ; [Den tilbageblevne olie efter fjernelse af phenolforbindelser (tjæresyrer) fra drænet naphthalenolie ved en alkalisk vask. Sammensat primært af naphthalen og alkylnaphthalener.] |
292-612-1 |
90640-90-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-091-00-1 |
ekstrationsrester (kul), naphthalenolie alkaliske, destillationstopfraktioner; syrefri naftalinolie ; [destillatet fra alkalivasket naphthalenolie med destillationsinterval omtrent fra 180 oC til 220 oC. Sammensat primært af naphthalen, alkylbenzener, inden og indan.] |
292-627-3 |
90641-04-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-092-00-7 |
destillater (stenkulstjære), naphthalenolier, methylnaphthalenfraktion; methylnaftalin; [et destillat fra den fraktionerede destillation af højtemperaturs- stenkulstjære. Sammensat primært af substituerede, bicycliske, aromatiske carbonhydrider og aromatiske nitrogenbaser med kogeinterval omtrent fra 225 oC til 255 oC.] |
309-985-4 |
101896-27-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-093-00-2 |
destillater (stenkulstjære), naphthalenolier, indol-methylnaphthalenfraktion; methylnaftalin; [et destillat fra den fraktionerede destillation af højtemperaturs- stenkulstjære. Sammensat primært af indol og methylnaphthalen, med kogeinterval omtrent fra 235 oC til 255 oC.] |
309-972-3 |
101794-91-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-094-00-8 |
destillater (stenkulstjære), naphtalenolier, syreekstrakter; methylnaftalinolie; [en sammensat blanding af carbonhydrider, opnået ved at fjerne baser fra methylnaphthalenfraktionen opnået ved destillation af stenkulstjære, med kogeinterval omtrent fra 230 oC til 255 oC. Indeholder hovedsagelig 1(2)-methylnaphthalen, naphthalen, dimethylnaphthalen og biphenyl.] |
295-309-2 |
91995-48-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-095-00-3 |
ekstraktionsrester (kul), naphthalenolie alkaliske, destillationsrester; methylnaftalinolie; [resten fra destillationen af alkalivasket naphthalenolie, med destillationsinterval omtrent fra 220 oC til 300 oC. Sammensat primært af naphthalen, alkylnaphthalener og aromatiske nitrogenbaser.] |
292-628-9 |
90641-05-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-096-00-9 |
ekstraktionsolier (kul), sure, tjærebase-frie; methylnaftalinolie; [ekstraktionsolien, med kogeinterval omtrent fra 220 oC til 265 oC, fra alkaliske stenkultjære-ekstraktionsrester fremstillet ved en sur vask, såsom vandig svovlsyre, efter destillation for at fjerne tjærebaser. Sammensat primært af alkylnaphthalener.] |
284-901-6 |
84989-12-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-097-00-4 |
destillater (stenkulstjære), benzolfraktion, destillationsrester; vaskeolie; [en sammensat blanding af carbonhydrider opnået ved destillation af rå benzol (højtemperaturstenkulstjære). Den kan være en væske med et destillationsinterval omtrent fra 150 oC til 300 oC eller et halvfast eller fast stof med et smeltepunkt på op til 70 oC. Den er sammensat primært af naphthalen og alkylnaphthalener.] |
310-165-3 |
121620-46-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-098-00-X |
creosotolie, acenaphthenfraktion; vaskeolie; [en sammensat blanding af carbonhydrider, fremstillet ved destillation af stenkulstjære, med kogeinterval omtrent fra 240 oC til 280 oC. Sammensat primært af acenaphthen, naphthalen og alkylnaphthalen.] |
292-605-3 |
90640-84-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-099-00-5 |
creosotolie; [En sammensat blanding af carbonhydrider opnået ved destillationen af stenkulstjære. Den består primært af aromatiske carbonhydrider og kan indeholde betydelige mængder tjæresyrer og tjærebaser. Den destillerer i området omtrent fra 200 oC til 325 oC.] |
263-047-8 |
61789-28-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-100-00-9 |
creosotolie, højtkogende destillat; vaskeolie; [Den højtkogende destillationsfraktion opnået fra højtemperaturforkulningen af bituminøse kul, som yderligere raffineres for at fjerne overskud af krystallinske salte. Den består primært af creosotolie, hvorfra nogle af de normale polycykliske aromatiske salte, som er komponenter af stenkulstjæredestillater, er fjernet. Den er krystalfri ved omtrent 5 oC.] |
274-565-9 |
70321-79-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-101-00-4 |
creosot; [destillatet af stenkulstjære fremstillet ved højtemperatursforkulning af bituminøs kul. Det består primært af aromatiske carbonhydrider, tjæresyrer og tjærebaser.] |
232-287-5 |
8001-58-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-102-00-X |
ekstraktionsrester (stenkul), creosotolie sure; vaskeolieekstraktionsrest; [en sammensat blanding af carbonhydrider fra den basebefriede fraktion fra destillationen af stenkulstjære, med kogeinterval omtrent fra 250 oC til 280 oC. Den består overvejende af biphenyl og isomere diphenylnaphthener.] |
310-189-4 |
122384-77-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-103-00-5 |
Anthracenolie, anthracenpasta; Antracenoliefraktion; det anthracenrige faste stof, der fremkommer ved krystallisation og centrifugering af anthracenolie. Det er sammensat primært af anthracen, carbazol og phenanthren.] |
292-603-2 |
90640-81-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-104-00-0 |
anthracenolie, med lavt indhold af anthracen; antracenoliefraktion; [den tiloversblevne olie efter fjernelse, ved en krystallisationsproces, af et anthracenrigt fast stof (anthracenpasta) fra anthracenolie. Den er sammensat primært af bi, tri og tetracykliske aromatiske forbindelser.] |
292-604-8 |
90640-82-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-105-00-6 |
rester (stenkulstjære), anthracenolie destillations-; antracenoliefraktion; [resten fra fraktioneret destillation af rå anthracen, med kogeinterval omtrent fra 340 oC til 400 oC. Den består overvejende af tri- og polycycliske, aromatiske og heterocycliske carbonhydrider.] |
295-505-8 |
92061-92-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-106-00-1 |
anthracenolie, anthracenpasta, anthracenfraktion; antracenoliefraktion; [en sammensat blanding af carbonhydrider fra destillationen af anthracen, opnået ved krystallisation af anthracenolie fra bituminøs højtemperaturstjære, med kogeinterval omtrent fra 330 oC til 350 oC. Den indeholder hovedsagelig anthracen, carbazol og phenanthren.] |
295-275-9 |
91995-15-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-107-00-7 |
anthracenolie, anthracenpasta, carbazolfraktion; antracenoliefraktion; [en sammensat blanding af carbonhydrider fra destillationen af anthracen, opnået ved krystallisation af anthracenolie fra højtemperaturstjære fra bituminøse kul, med kogeinterval omtrent fra 350 oC til 360 oC. Den indeholder hovedsagelig anthracen, carbazol og phenanthren.] |
295-276-4 |
91995-16-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-108-00-2 |
anthracenolie, anthracenpasta, lette destillationsfraktioner; antracenoliefraktion; [en sammensat blanding af carbonhydrider fra destillationen af anthracen, opnået ved krystallisation af anthracenolie fra bituminøs højtemperaturstjære, med kogeinterval omtrent fra 290 oC til 340 oC. Den indeholder hovedsagelig tricycliske aromater og deres dihydroderivater.] |
295-278-5 |
91995-17-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-109-00-8 |
tjæreolier, stenkuls-, lavtemperaturs; kultjæreolie, højtkogende; [et destillat fra lavtemperatursstenkulstjære. Sammensat primært af carbonhydrider, phenolforbindelser og aromatiske nitrogenbaser, med kogeinterval omtrent fra 160 oC til 340 oC.] |
309-889-2 |
101316-87-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-110-00-3 |
ekstraktionsrester (stenkul), lavtemperaturstenkulstjære alkaliske; [resten fra lavtemperaturstenkulstjæreolier efter en alkalisk vask, såsom vandig natriumhydroxid, for at fjerne råstenkulstjæresyrer. Sammensat primært af carbonhydrider og aromatiske nitrogenbaser.] |
310-191-5 |
122384-78-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-111-00-9 |
phenoler, ammoniakludsekstrakt; alkaliske ekstrakter; [blandingen af phenoler, ekstraheret ved brug af isobutylacetat, fra ammoniakluden, der er kondenseret fra gassen fra lavtemperaturstørdestillation (mindre end 700 oC) af kul. Den består overvejende af en blanding af mono og dihydroxyphenoler.] |
284-881-9 |
84988-93-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-112-00-4 |
destillater (stenkulstjære), letolier, alkaliske ekstrakter; alkaliske ekstrakter; [det vandige ekstrakt fra carbololie fremstillet ved en alkalisk vask med f. eks. vandig natriumhydroxid. Sammensat primært af alkalimetalsalte af forskellige phenolforbindelser.] |
292-610-0 |
90640-88-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-113-00-X |
ekstrakter, stenkulstjæreolie, alkaliske; alkaliske ekstrakter; [ekstrakt fra stenkulstjæreolie fremstillet ved en alkalisk vask med f.eks. vandig natriumhydroxid. Sammensat primært af alkalimetalsalte af forskellige phenolforbindelser.] |
266-017-2 |
65996-83-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-114-00-5 |
destillater (stenkulstjære), naph thalenolier, alkaliske ekstrakter; alkaliske ekstrakter; [det vandige ekstrakt fra naph thalenolie fremstillet ved en alkalisk vask med f. eks vandig natriumhydroxid. Sammensat primært af alkalimetalsalte af forskellige phenolforbindelser.] |
292-611-6 |
90640-89-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-115-00-0 |
ekstraktionsrester (kul), tjæreolie, alkaliske, carbonaterede, kalkede; råfenol; [produktet fra behandling af et alkalisk stenkulstjæreolieekstrakt med CO2 og CaO. Sammensat primært af CaCO3, Ca(OH)2, Na2CO3 og andre organiske og uorganiske urenheder.] |
292-629-4 |
90641-06-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-116-00-6 |
tjæresyrer, stenkuls-, rå; råfenol; [reaktionsprodukt opnået ved at neutralisere alkalisk ekstrakt fra stenkulstjæreolie med en sur opløsning, såsom vandig svovlsyre, eller gasformig carbondioxid, for at udvinde de frie syrer. Sammensat primært af tjæresyrer såsom phenol, cresoler og xylenoler.] |
266-019-3 |
65996-85-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-117-00-1 |
tjæresyrer, brunkuls-, rå; råfenol; [et forsuret alkalisk ekstrakt af brunkulstjæredestillat. Sammensat primært af phenol og phenolhomologer.] |
309-888-7 |
101316-86-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-118-00-7 |
tjæresyrer, brunkulsforgas nings-; råfenol; [en sammensat blanding af organiske forbindelser fra brunkulsforgasning. Sammensat primært af C6-10-hydroxyaromatiske phenoler og deres homologer.] |
295-536-7 |
92062-22-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-119-00-2 |
tjæresyrer, destillationsrester; fenoldestillater; [en rest fra destillationen af råphenol fra kul. Den består overvejende af phenoler, C8 til og med C10, med blødgøringspunkt fra 60 oC til 80 oC.] |
306-251-5 |
96690-55-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-120-00-8 |
tjæresyrer, methylphenolfraktion; fenoldestillater; [fraktionen af tjæresyre, rig på 3- og 4-methylphenol, genvundet ved destillation af rå tjæresyre fra lavtemperatursstenkuls tjære.] |
284-892-9 |
84989-04-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-121-00-3 |
tjæresyrer, polyalkylphenolfraktion; fenoldestillater; [fraktionen af tjæresyrer, genvundet ved destillation af rå tjæresyrer fra lavtemperatursstenkulstjære, med kogeinterval omtrent fra 225 oC til 320 oC.] Sammensat primært af polyalkylphenoler.] |
284-893-4 |
84989-05-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-122-00-9 |
tjæresyrer, xylenolfraktion; fenoldestillater; [fraktionen af tjæresyrer, rig på 2,4- og 2,5-dimethylphenol, genvundet ved destillation af rå tjæresyrer fra lavtemperatursstenkuls tjære.] |
284-895-5 |
84989-06-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-123-00-4 |
tjæresyrer, ethylphenolfraktion; fenoldestillater; [fraktionen af tjæresyrer, rig på 3- og 4-ethylphenol, genvundet ved destillation af rå tjæresyrer fra lavtemperatursstenkulstjære.] |
284-891-3 |
84989-03-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-124-00-X |
tjæresyrer, 3,5-xylenolfraktion; fenoldestillater; [fraktionen af tjæresyrer, rig på 3,5-dimethylphenol, genvundet ved destillation af lavtemperatursstenkultjæresyrer.] |
284-896-0 |
84989-07-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-125-00-5 |
tjæresyrer, rester, destillater, første fraktion; fenoldestillater; [resten fra destillationen i området fra 235 oC til 355 oC af let karbololie.] |
270-713-1 |
68477-23-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-126-00-0 |
tjæresyrer, cresyliske, rester; fenoldestillater; [resten fra rå stenkulstjæresyrer efter fjernelse af phenol, cresoler, xylenoler og alle højerekogende phenoler. Et sort fast stof med et smeltepunkt på omtrent 80 oC. Sammensat primært af polyalkylphenoler, harpiksgummier og uorganiske salte.] |
271-418-0 |
68555-24-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-127-00-6 |
phenoler, C9-11; fenoldestillater |
293-435-2 |
91079-47-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-128-00-1 |
tjæresyrer, cresyliske; fenoldestillater; [en sammensat blanding af organiske forbindelser, opnået fra brunkul, med kogeinterval omtrent fra 200 oC til 230 oC. Den består hovedsagelig af phenoler og pyridinbaser.] |
295-540-9 |
92062-26-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-129-00-7 |
tjæresyrer, brunkuls-, C2-alkylphenolfraktion fenoldestillater; [destillatet fra syrebehandlingen af alkalisk vasket brunkulstjæredestillat, med kogeinterval omtrent fra 200 oC til 230 oC. Sammensat primært af m- og p-ethylphenol såvel som cresoler og xylenoler.] |
302-662-9 |
94114-29-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-130-00-2 |
ekstraktionsolier (stenkul), naphtalenolier; syreekstrakt; [det vandige ekstrakt fremstillet ved en sur vask af alkali vasket naphthalenolie. Sammensat primært af syresalte af forskellige aromatiske nitrogenbaser, inklusive pyridin, quinolin og deres alkylderivater.] |
292-623-1 |
90641-00-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-131-00-8 |
tjære, quinolinderivater; basedestillater |
271-020-7 |
68513-87-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-132-00-3 |
tjærebaser, stenkuls-, quinolinderivatfraktion; basedestillater |
274-560-1 |
70321-67-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-133-00-9 |
tjærebaser, stenkuls-, destillationsrester; basedestillater; [destillationsresten efter destillationen af den neutraliserede, syreekstraherede, baseholdige tjærefraktion, opnået ved destillationen af stenkulstjærer. Den indeholder hovedsagelig anilin, collidiner, quinolinderivater og toluidiner.] |
295-544-0 |
92062-29-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-134-00-4 |
carbonhydridolier, aromatiske, blandet med polyethylen og polypropylen, pyrolyserede, let oliefraktion; varmebehandlede produkter [Olie opnået ved varmebehandling af en polyethylen/polypropylenblanding med kultjærebeg eller aromatiske olier. Den består overvejende af benzen og dens homologer, med kogeinterval omtrent fra 70 oC til 120 oC.] |
309-745-9 |
100801-63-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-135-00-X |
carbonhydridolier, aromatiske, blandet med polyethylen, pyrolyserede, let oliefraktion; varmebehandlede produkter; [olie opnået ved varmebehandling af polyethylen med kultjærebeg eller aromatiske olier. Den består overvejende af benzen og dens homologer, med kogeinterval omtrent fra 70 oC til 120 oC.] |
309-748-5 |
100801-65-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-136-00-5 |
carbonhydridolier, aromatiske, blandet med polystyren, pyrolyserede, let oliefraktion; varmebehandlede produkter; [olie opnået ved varmebehandling af polystyren med kultjærebeg eller aromatiske olier. Den består overvejende af benzen og dens homologer, med kogeinterval omtrent fra 70 oC til 210 oC .] |
309-749-0 |
100801-66-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-137-00-0 |
ekstraktionsrester (kul), alkalisk tjæreolie, naphthalendestillationsrester; syrefri naftalinolie; [resten opnået fra kemisk olie ekstraheret efter fjernelsen af naphthalen ved destillation, består primært af bi til tetracykliske kondenserede aromatiske carbonhydrider og aromatiske nitrogenbaser.] |
277-567-8 |
73665-18-6 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-138-00-6 |
creosotolie, lavtkogende destillat; vaskeolie; [den lavtkogende destillationsfraktion opnået fra højtemperaturforkulningen af bituminøse kul, som yderligere raffineres for at fjerne overskud af krystallinske salte. Den består primært af creosotolie, hvorfra nogle af de normale polycykliske aromatiske salte, som er komponenter af stenkulstjæredestillat, er fjernet. Den er krystalfri ved omtrent 38 oC.] |
274-566-4 |
70321-80-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-139-00-1 |
tjæresyrer, cresyliske, natriumsalte, kaustiske opløsninger; alkaliske ekstrakter |
272-361-4 |
68815-21-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-140-00-7 |
ekstraktionsolier (kul), tjærebase-; syreekstrakt; [ekstrakt fra alkalisk ekstraktionrest af stenkulstjæreolie fremstillet ved en sur vask med f.eks. vandig svovlsyre efter destillation for at fjerne naphthalen. Sammensat primært af syresalte af forskellige aromatiske nitrogenbaser, herunder pyridin, quinolin og deres alkylderivater.] |
266-020-9 |
65996-86-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-141-00-2 |
tjærebaser, stenkuls-, rå; råtjærebaser [reaktionsprodukt opnået ved at neutralisere ekstraktionsolie fra stenkulstjærebase med en alkalisk opløsning, såsom vandig natriumhydroxid, for at udvinde de frie baser. Sammensat primært af organiske baser, såsom acridin, phenanthridin, pyridin, quinolin og deres alkylderivater.] |
266-018-8 |
65996-84-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
JM |
|
648-142-00-8 |
rester (kul), flydende solventekstraktions-; [et kohæsivt pulver sammensat af kulmineralsk stof og uopløst kul tilbageblevet efter ekstraktion af kul med et flydende solvent.] |
302-681-2 |
94114-46-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-143-00-3 |
kulvæsker, flydende solventekstraktionsopløsning; (produkt opnået ved filtrering af kulmineralsk stof og uopløst kul fra kulekstraktionsopløsning fremstillet ved at omsætte kul i et flydende solvent. En sort, viskøs og højkompleks væskeblanding sammensat primært af aromatiske og delvist hydrogenerede, aromatiske carbonhydrider, aromatiske nitrogenforbindelser, aromatiske svovlforbindelser, phenolske og andre aromatiske oxygenforbindelser og deres alkylderivater.] |
302-682-8 |
94114-47-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-144-00-9 |
kulvæsker, flydende solventekstraktion; [det substantielle solventfrie produkt opnået ved destillation af solventet fra filtreret kulekstraktionsopløsning fremstillet ved at omsætte kul i et flydende solvent. Et sort, halvfast stof, bestående primært af en sammensat blanding af ringkondenserede, aromatiske carbonhydrider, aromatiske nitrogenforbindelser, aromatiske svovlforbindelser, phenolforbindelser og andre aromatiske oxygenforbindelser og deres alkylderivater.] |
302-683-3 |
94114-48-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
M |
|
648-145-00-4 |
tjære, brunkuls-; [en olie destilleret fra brunkulstjære. Sammensat primært af aliphatiske, naphthenske og bi- til tricycliske aromatiske carbonhybrider, deres alkylderivater, heteroaromater og en- og toringede phenoler, med kogeinterval omtrent fra 150 oC til 360 oC.] |
309-885-0 |
101316-83-0 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-146-00-X |
tjære, brunkuls-, lavtemperaturs-; [en tjære, opnået ved lavtemperatursforkulning og lavtemperatursforgasning af brunkul. Sammensat primært af aliphatiske, naphtenske og cycliske aromatiske carbonhydrider, heteroaromatiske carbonhydrider og cycliske phenoler.] |
309-886-6 |
101316-84-1 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-147-00-5 |
letolie (kul), koksovns-; rå benzol; [den flygtige, organiske væske ekstraheret fra gassen fra tørdestillation af kul ved høj temperatur (højere end 700 oC). Sammensat primært af benzen, toluen og xylener. Kan indeholde andre mindre carbonhydridkomponenter.] Kan indeholde andre mindre carbonhydridkomponenter.] |
266-012-5 |
65996-78-3 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-148-00-0 |
destillater (kul), flydende solventekstraktion, primære; [det flydende produkt fra kondensation af dampe afgivet under omsætningen af kul i et flydende solvent, med kogeinterval omtrent fra 30 oC til 300 oC. Sammensat primært af delvist hydrogenerede polycykliske annelerede aromatiske carbonhydrider, aromatiske forbindelser indeholdende nitrogen, oxygen og svovl og deres alkylderivater, med carbonantal overvejende i området fra C4 til og med C14.] |
302-688-0 |
94114-52-0 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-149-00-6 |
destillater (kul), solvent-ekstraktion, hydrokrakket; [destillat fra hydrokrakning af kulekstrakt eller opløsning fremstillet ved flydende solventekstraktions- eller superkritiske gasekstraktionsprocesser, med kogeinterval omtrent fra 30 oC til 300 oC. Sammensat primært af aromatiske, hydrogenerede aromatiske og naphthenske forbindelser, deres alkylderivater og alkaner med carbonantal overvejende C4 til og med C14. Nitrogen-, svovl- og oxygenholdige aromatiske og hydrogenerede aromatiske forbindelser er også til stede.] |
302-689-6 |
94114-53-1 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-150-00-1 |
naphta (kul), solventekstraktion, hydrokrakket; [fraktion af destillatet opnået ved hydrokrakning af kulekstrakt eller opløsning fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med kogeinterval omtrent fra 30 oC til 180 oC. Sammensat primært af aromatiske, hydrogenerede aromatiske og naphtheniske forbindelser, deres alkylderivater og alkaner med carbonantal overvejende C4 til C9. Nitrogen-, svovl- og oxygenholdige aromatiske og hydrogenerede aromatiske forbindelser er også til stede.] |
302-690-1 |
94114-54-2 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-151-00-7 |
benzin, kul solventekstraktion, hydrokrakket naphtha [motorbrændstof fremstillet ved reformering af den raffinerede naphthafraktion fra produkterne fra hydrokrakning af kulekstrakt eller opløsning, fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med kogeinterval omtrent fra 30 oC til 180 oC. Sammensat primært af aromatiske og naphthenske carbonhydrider, deres alkylderivater og alkylcarbonhydrider, C4 til og med C9.] |
302-691-7 |
94114-55-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
648-152-00-2 |
destillater (kul), solventekstraktion, hydrokrakkede middeltunge; [destillat opnået ved hydrokrakning af kulekstrakt eller opløsning, fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med kogeinterval omtrent fra 180 oC til 300 oC. Sammesat primært af bicycliske aromatiske, hydrogenerede aromatiske og naphtheniske forbindelser, deres alkylderivater og alkaner med carbonantal overvejende C9 til og med C14. Nitrogen-, svovl- og oxygenholdige forbindelser er også til stede.] |
302-692-2 |
94114-56-4 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-153-00-8 |
destillater (kul), solventekstraktion hydrokrakkede hydrogenerede middeltunge; [destillat fra hydrogeneringen af et hydrokrakket middeltungt destillat fra kulekstrakt eller opløsning, fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med kogeinterval omtrent fra 180 oC til 280 oC. Sammensat primært af hydrogenerede, bicycliske carbonforbindelser og deres alkylderivater med carbonantal overvejende C9 til og med C14.] |
302-693-8 |
94114-57-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
648-154-00-3 |
brændstoffer, jetfly-, kulsolventekstraktion, hydrokrakkede-hydrogenerede; [jetmotorbrændstof fremstillet ved hydrogenering af den middeltunge destillationsfraktion fra produkterne fra hydrokrakning af kul-ekstrakt eller opløsning, fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med koge-interval omtrent fra 180 oC til 225 oC. Sammensat primært af hydrogenerede, bicycliske carbonhydrider og deres alkylderivater, overvejende C10 til og med C12.] |
302-694-3 |
94114-58-6 |
Carc. 2 |
H351 |
GHS08 Wng |
H350 |
|
|
|
|
648-155-00-9 |
brændstoffer, diesel- kul solventekstraktion, hydrokrakkede hydrogenerede; [dieselmotorbrændstof fremstillet ved hydrogenering af den middeltunge destillationsfraktion fra produkterne fra hydrokrakning af kulekstrakt eller opløsning, fremstillet ved flydende solventekstraktions- eller superkritisk gasekstraktionsprocesser, med kogeinterval omtrent fra 200 oC til 280 oC. Sammensat primært af hydrogenerede, bicycliske carbonhydrider og deres alkylderivater, overvejende C11 til og med C14.] |
302-695-9 |
94114-59-7 |
Carc. 2 |
H351 |
GHS08 Wng |
H350 |
|
|
|
|
648-156-00-4 |
letolie (kul), halvforkoksningsproces-; frisk olie; [den flygtige organiske væske kondenseret fra gassen udviklet ved lavtemperaturstørdestillation (lavere end 700 oC) af kul. Sammensat primært af C6-10-carbonhydrider.] |
292-635-7 |
90641-11-5 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
J |
|
649-001-00-3 |
ekstrakter (råolie), let naphthendestillat solvent |
265-102-1 |
64742-03-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-002-00-9 |
ekstrakter (råolie), tungt paraffindestillat solvent |
265-103-7 |
64742-04-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-003-00-4 |
ekstrakter (råolie), let paraffindestillat solvent |
265-104-2 |
64742-05-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-004-00-X |
ekstrakter (råolie), tungt naphthendestillat solvent |
265-111-0 |
64742-11-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-005-00-5 |
ekstrakter (råolie), let vakuumgasolie solvent |
295-341-7 |
91995-78-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-006-00-0 |
carbonhydrider, C26-55, aromatrige |
307-753-7 |
97722-04-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-007-00-6 |
fedtsyrer, tallolie, reaktionsprodukter med iminodiethanol og borsyre |
400-160-5 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
649-008-00-1 |
rester (råolie), atmosfærisk tårn; fuelolie; (en sammensat remanens fra atmosfærisk destillation af råolie. Den består af carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-045-2 |
64741-45-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-009-00-7 |
gasolier (råolie), tunge vakuum; fuelolie; (en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillationen af remanensen fra den atmosfæriske destillation af råolie. Den består af carbonhydrider, overvejende C20 til og med C50, med kogeinterval omtrent fra 350 oC til 600 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-058-3 |
64741-57-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-010-00-2 |
destillater (råolie), tunge katalytisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C15 til og med C35, med kogeinterval omtrent fra 260 oC til 500 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-063-0 |
64741-61-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-011-00-8 |
klarede olier (råolie), katalytisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-064-6 |
64741-62-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-012-00-3 |
rester (råolie), hydro- krakkede; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillation af produkterne fra en hydrokrakningsproces. Den består af carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC.] |
265-076-1 |
64741-75-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-013-00-9 |
rester (råolie), termisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillation af produkterne fra en termisk krakningsproces. Den består overvejende af umættede carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-081-9 |
64741-80-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-014-00-4 |
destillater (råolie), tunge termisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en termisk krakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C15 til og med C36, med kogeinterval omtrent fra 260 oC til 480 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-082-4 |
64741-81-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-015-00-X |
gasolier (råolie), hydrogenbehandlede vakuum-; fuelolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C13 til og med C50, med kogeinterval omtrent fra 230 oC til 600 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-162-9 |
64742-59-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-016-00-5 |
rester (råolie), hydroafsvovlede atmosfærisk tårn; fuelolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en remanens fra et atmosfærisk tårn med hydrogen i tilstedeværelse af en katalysator, under betingelser primært for at fjerne organiske svovlforbindelser. Den består af carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-181-2 |
64742-78-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-017-00-0 |
gasolier (råolie), hydroafsvovlede tunge vakuum-; fuelolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk hydroafsvovlningsproces. Den består af carbonhydrider, overvejende C20 til og med C50 med kogeinterval omtrent fra 350 oC til 600 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent eller mere aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-189-6 |
64742-86-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-018-00-6 |
rester (råolie), dampkrakkede; fuelolie; [en sammensat blanding af carbonhydrider opnået som restfraktionen fra destillation af produkterne fra en dampkrakningsproces (herunder dampkrakning for at fremstille ethylen). Den består overvejende af umættede carbonhydrider, overvejende større end C14, og koger omtrent over 260 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-193-8 |
64742-90-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-019-00-1 |
rester (råolie), atmosfæriske; fuelolie; [en sammensat remanens fra atmosfærisk destillation af råolie. Den består af carbonhydrider, overvejende større end C11, og koger omtrent over 200 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
269-777-3 |
68333-22-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-020-00-7 |
klarede olier (råolie), hydroafsvovlede katalytisk krakkede; fuelolie; [En sammensat blanding af carbonhydrider opnået ved at behandle katalytisk krakkede, klarede olier med hydrogen for at omdanne organisk svovl til hydrogensulfid, som fjernes. Den består af carbonhydrider, overvejende større end C20, og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
269-782-0 |
68333-26-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-021-00-2 |
destillater (råolie), hydroafsvovlede intermediære katalytisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider opnået ved at behandle intermediære katalytisk krakkede destillater med hydrogen for at omdanne organisk svovl til hydrogensulfid, som fjernes. Den består af carbonhydrider, overvejende C11 til og med C30, med kogeinterval omtrent fra 205 oC til 450 oC. Den indeholder en forholdsvis stor del tricycliske, aromatiske carbonhydrider.] |
269-783-6 |
68333-27-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-022-00-8 |
destillater (råolie), hydroafsvovlede tunge katalytisk krakkede; fuelolie; [en sammensat blanding af carbonhydrider opnået ved behandling af tunge katalytisk krakkede destillater med hydrogen for at omdanne organisk svovl til hydrogensulfid, som fjernes. Den består af carbonhydrider, overvejende C15 til og med C35, med kogeinterval omtrent fra 260 oC til 500 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
269-784-1 |
68333-28-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-023-00-3 |
brændselsolie, rester af straight-run gasolier, med højt indhold af svovl; fuelolie; |
270-674-0 |
68476-32-4 |
Carc. 1B |
H350 |
HS08 Dgr |
H350 |
|
|
|
|
649-024-00-9 |
brændselsolie, rest-; fuelolie; [væskeproduktet fra forskellige raffinaderistrømme, sædvanligvis rester. Sammensætningen er kompleks og varierer med råoliekilden.] |
270-675-6 |
68476-33-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-025-00-4 |
rester (råolie), katalytisk reformerfraktioneringskolonnerest, destillations-; fuelolie; (En sammensat remanens fra destillationen af katalytisk reformer- fraktioneringskolonnerest. Den koger omtrent over 399 oC.] |
270-792-2 |
68478-13-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-026-00-X |
rester (råolie), tung cokergasolie og vakuumgasolie; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillationen af tung coker-gasolie og vakuumgasolie. Den består overvejende af carbonhydrider, overvejende større end C13, og koger omtrent over 230 oC.] |
270-796-4 |
68478-17-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-027-00-5 |
rester (råolie), tunge coker- og lette vakuum-; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillationen af tung coker-gasolie og let vakuumgasolie. Den består overvejende af carbonhydrider, overvejende større end C13, og koger omtrent over 230 oC.] |
270-983-0 |
68512-61-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-028-00-0 |
rester (råolie), lette vakuum-; fuelolie; [en sammensat remanens fra vakuumdestillationen af remanensen fra den atmosfæriske destillation af råolie. Den består af carbonhydrider, overvejende større end C13, og koger omtrent over 230 oC.] |
270-984-6 |
68512-62-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-029-00-6 |
rester (råolie), dampkrakkede, lette; fuelolie; [en sammensat remanens fra destillationen af produkterne fra en dampkrakningsproces. Den består overvejende af aromatiske og umættede carbonhydrider, større end C7, med kogeinterval omtrent fra 101 oC til 555 oC.] |
271-013-9 |
68513-69-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-030-00-1 |
brændselsolie, nr. 6; fuelolie; [en brændselsolie med en minimumsviskositet på 900cSt og en maximumsviskositet på 9000cSt ved 37,7 oC.] |
271-384-7 |
68553-00-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-031-00-7 |
rester (råolie, topanlægs-, svovlfattige; fuelolie; [en sammensat, svovlfattig blanding af carbonhybrider fremstillet som restfraktionen fra topanlægsdestillation af råolie. Den udgør resten, efter at straight-run benzinfraktionen, petroleumfraktionen og gasoliefraktionen er blevet fjernet.] |
271-763-7 |
68607-30-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-032-00-2 |
gasolier (råolie), tunge, atmosfæriske; fuelolie; (en sammensat, blanding af carbonhydrider opnået ved destillationen af råolie. Den består af carbonhydrider, overvejende C7 en C35, med kogeinterval omtrent fra 121 oC til 510 oC.] |
272-184-2 |
68783-08-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-033-00-8 |
rester (råolie), coker skrubber, indeholder kondenserede aromater; fuelolie; [en meget sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillationen af vakuumremanensen og produkterne fra en termisk krakningsproces. Den består overvejende af carbonhydrider, overvejende større end C20 og koger omtrent over 350 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
272-187-9 |
68783-13-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-034-00-3 |
destillater (råolie), råolierester vakuum-; fuelolie [en sammensat blanding af carbonhydrider ved vakuumdestillationen af remanensen fra den atmosfæriske destillation af råolie.] |
273-263-4 |
68955-27-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-035-00-9 |
rester (råolie), dampkrakket, harpiksholdige; fuelolie; [en sammensat remanens fra destillationen af dampkrakkede råolierester.] |
273-272-3 |
68955-36-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-036-00-4 |
destillater (råolie), intermediær vakuum; fuelolie; [en sammensat blanding af carbonhybrider fremstillet ved destillationen af remanensen af den atmosfæriske destillation af råolie. Den består af carbonhydrider, overvejende C14 og til og med C42 og koger omtrent i intervallet fra 250 oC til 545 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent eller mere af 4- til 6-leddede kondenserede aromatiske carbonhydrider.] |
274-683-0 |
70592-76-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-037-00-X |
destillater (råolie), lette vakuum-; fuelolie; [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillationen af remanensen fra den atmosfæriske destillation af råolie. Den består af carbonhydrider, overvejende C11 til og med C35, med kogeinterval omtrent fra 250 oC til 545 oC.] |
274-684-6 |
70592-77-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-038-00-5 |
destillater (råolie), vakuum-; fuelolie [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillationen af remanensen fra den atmosfæriske destillation af råolie. Den består af carbonhydrider, overvejende C15 til og med C50, med kogeinterval omtrent fra 270 oC til 600 oC. Denne strøm kan indeholde 5 vægtprocent, eller mere, aromatisk carbonhydrider bestående af 4- til 6-leddede kondenserede ringe.] |
274-685-1 |
70592-78-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-039-00-0 |
gasolier (råolie), hydroafsvovlede tunge coker vakuum-; fuelolie; [en sammensat blanding af carbonhydrider opnået ved hydroafsvovling af tunge coker-destillat råstoffer. Den består overvejende af carbonhydrider, overvejende C18 til C44, med kogeinterval omtrent fra 304 oC til 548 oC. Indeholder sandsynligvis 5 %, eller mere, aromatiske carbonhydrider bestående, af 4- til 6-leddede kondenserede ringe.] |
285-555-9 |
85117-03-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-040-00-6 |
rester (råolie), dampkrakkede, destillater; fuelolie; [en sammensat blanding af carbonhydrider opnået under fremstillingen af raffineret råolietjære ved destillation af dampkrakket tjære. Den består overvejende af aromatiske og andre carbonhydrider organiske svovlforbindelser.] |
292-657-7 |
90669-75-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-041-00-1 |
rester (råolie), vakuum-, lette; fuelolie; [en sammensat remanens fra vakuumdestillation af remanensen fra atmosfærisk destillation af råolie. Den består overvejende af carbonhydrider, overvejende større end C24, og koger omtrent over 390 oC.] |
292-658-2 |
90669-76-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-042-00-7 |
brændselsolie, tung, højt svovlindhold; fuelolie; [en sammensat blanding af carbonhydrider opnået ved destillation af rå råolie. Den består overvejende af aliphatiske, aromatiske og cycloaliphatiske carbonhydrider, overvejende større end C25, der koger højere end omtrent over 400 oC.] |
295-396-7 |
92045-14-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-043-00-2 |
rester (råolie), katalytisk kraknings-; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillationen af produkterne fra en katalytisk krakningsproces. Den består overvejende af carbonhydrider, overvejende større end C11, der koger omtrent over 200 oC.] |
295-511-0 |
92061-97-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-044-00-8 |
destillater (råolie), intermediære, katalytisk krakkede, termisk nedbrudte; fuelolie; [en sammensat blanding af carbonhydrider, fremstillet ved destillationen af produkter fra en katalytisk krakningsproces, som har været brugt som en varmeoverførselsvæske. Den består overvejende af carbonhydrider med kogeinterval omtrent fra 220 oC til 450 oC. Denne strøm indeholder sandsynligvis organiske svovlforbindelser.] |
295-990-6 |
92201-59-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-045-00-3 |
restolier (råolie); fuelolie; [en sammensat blanding af carbonhydrider, svovlforbindelser og metalholdige organiske forbindelser opnået som resten fra raffinaderifraktionerings-krakningsprocesser. Den danner en færdig olie med viskositet over 2cSt. ved 100 oC.] |
298-754-0 |
93821-66-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-046-00-9 |
rester, dampkrakkede, termisk behandlede; fuelolie; [en sammensat blanding af carbonhydrider opnået ved behandling og destillation af rå, dampkrakket naphtha. Den består overvejende af umættede carbonhydrider, der koger omtrent over 180 oC.] |
308-733-0 |
98219-64-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-047-00-4 |
destillater (råolie), hydroafsvovlede full-range middeltunge; fuelolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en rå råolie med hydrogen. Den består overvejende af carbonhydrider, overvejende C9 til og med C25, med kogeinterval omtrent fra 150 oC til 400 oC.] |
309-863-0 |
101316-57-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-048-00-X |
rester (råolie), katalytiske reformer-fraktionator-; fuelolie; [en sammensat blanding af carbonhydrider fremstillet som restfraktionen fra destillation af produkterne fra en katalytisk reformeringsproces. Den består af overvejende aromatiske carbonhydrider, overvejende C10 til og med C25, med kogeinterval omtrent fra 160 oC til 400 oC. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
265-069-3 |
64741-67-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-049-00-5 |
råolie; [en sammensat blanding af carbonhybrider. Den består overvejende af aliphatiske, alicycliske og aromatiske carbonhybrider. Den kan også indeholde små mængder af nitrogen, oxygen- og svovlforbindelser. Denne kategori omfatter lette, middeltunge og tunge råolier, såvel som olier ekstraherede fra tjæresand. Carbonhydridholdige materialer, der kræver større kemiske forandringer for deres udvinding eller omdannelse til råolieraffinaderiføde såsom rå skiferolier, oprensede skiferolier og flydende kulbrændsel er ikke medtaget i denne beskrivelse.] |
232-298-5 |
8002-05-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-050-00-0 |
destillater (råolie), lette paraffin-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillation af remanensen fra atmosfærisk destillation af råolie. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede, aliphatiske carbonhydrider normalt til stede i dette råoliedestillationsinterval.] |
265-051-5 |
64741-50-0 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-051-00-6 |
destillater (råolie), tunge paraffin-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillation af remanensen fra atmosfærisk destillation af råolie. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede, aliphatiske carbonhydrider.] |
265-052-0 |
64741-51-1 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-052-00-1 |
destillater (råolie), lette naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillation af remanensen fra atomsfærisk destillation af råolie. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cST ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-053-6 |
64741-52-2 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-053-00-7 |
destillater (råolie), tunge naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved vakuumdestillation af remanensen fra atmosfærisk destillation af råolie. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-054-1 |
64741-53-3 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-054-00-2 |
destillater (råolie), syrebehandlede tunge naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhybrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cST ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-117-3 |
64742-18-3 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-055-00-8 |
destillater (råolie), syrebehandlede tunge naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhybrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-118-9 |
64742-19-4 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-056-00-3 |
destillater (råolie), syrebehandlede tunge naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består overvejende af mættede carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC.] |
265-119-4 |
64742-20-7 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-057-00-9 |
destillater (råolie), syrebehandlede lette paraffin-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består overvejende af mættede carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC.] |
265-121-5 |
64742-21-8 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-058-00-4 |
Destillater (råolie), kemisk neutraliserede tunge paraffin-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider opnået ved en behandlingsproces til fjernelse af sure materialer. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder en forholdsvis stor del aliphatiske carbonhydrider.] |
265-127-8 |
64742-27-4 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-059-00-X |
destillater (råolie), kemisk neutraliserede lette paraffin-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet mindre end 19cSt ved 40 oC.] |
265-128-3 |
64742-28-5 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-060-00-5 |
destillater (råolie) kemisk neutraliserede tunge naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-135-1 |
64742-34-3 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-061-00-0 |
destillater (råolie), kemisk neutraliserede lette naphthen-; uraffineret eller let raffineret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C15 til og med C30 og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-136-7 |
64742-35-4 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-062-00-6 |
gasser (råolie), katalytisk krakket naphtha depropanizer-topfraktion, C3-rige syrefrie; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktionering af katalytisk krakkede carbonhydrider og behandlet for at fjerne sure urenheder. Den består af carbonhydrider, C2 til og med C4, overvejende C3.] |
270-755-0 |
68477-73-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-063-00-1 |
gasser (råolie), katalytiske krakker; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en katalytisk krakningsproces.] Den består overvejende af aliphatiske carbonhydrider, overvejende C1 til og med C6. |
270-756-6 |
68477-74-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-064-00-7 |
gasser (råolie), katalytisk krakker, C1-5-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkter fra en katalytisk krakningsproces. Den består af aliphatiske carbonhydrider, C1 til og med C6, overvejende C1 til og med C5.] |
270-757-1 |
68477-75-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-065-00-2 |
gasser (råolie), katalytisk polymeriseret; naphtha stabilizer-topfraktion, C2-4-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringsstabiliseringen af katalytisk polymeriseret naphtha. Den består af aliphatiske carbonhydrider, C2 til og med C6, overvejende C2 til og med C4.] |
270-758-7 |
68477-76-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-066-00-8 |
gasser (råolie), katalytisk krakker, C1-4-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en katalytisk reformeringsproces. Den består af carbonhydrider, C1 til og med C6, overvejende C1 til og med C4.] |
270-760-8 |
68477-79-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-067-00-3 |
gasser (råolie), C3-5 -olefin- og paraffin-alkyleringsføde-; kulbrintegasser; [en sammensat blanding af olefin- og paraffin-carbonhydrider, C3 til og med C5, der anvendes som alkyleringsføde. De omgivende temperaturer er normalt højere end disse blandingers kritiske temperatur.] |
270-765-5 |
68477-83-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-068-00-9 |
gasser (råolie), C4-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en katalytisk fraktioneringsproces. Den består af aliphatiske carbonhydrider, C3 til og med C5, overvejende C4.] |
270-767-6 |
68477-85-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-069-00-4 |
gasser (råolie), deethanizer-topfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af gas- og benzinfraktionerne fra den katalytiske krakningsproces. Den indeholder overvejende ethan og ethylen.] |
270-768-1 |
68477-86-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-070-00-X |
gasser (råolie), deisobutanizertårn-topfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved den atmosfæriske destillation af en butan-butylenstrøm. Den består af aliphatiske carbonhydrider, overvejende C3 til og med C4.] |
270-769-7 |
68477-87-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-071-00-5 |
gasser (råolie), tørre depropanizer-, propenrige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra gas- og benzinfranktionerne fra en katalytisk krakningsproces. Den består overvejende af propylen med noget ethan og propan.] |
270-772-3 |
68477-90-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-072-00-0 |
gasser (råolie), depropanizer-topfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra gas- og benzinfraktionerne fra en katalytisk krakningsproces. Den består af aliphatiske carbonhydrider, overvejende C2 til og med C4.] |
270-773-9 |
68477-91-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-073-00-6 |
gasser (råolie), gas-genvindingsanlæg depropanizer-topfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktionering af diverse carbonhydridstrømme. Den består overvejende af carbonhydrider, C1 til og med C4, overvejende propan.] |
270-777-0 |
68477-94-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-074-00-1 |
gasser (råolie), Girbatol-enhed føde-; kulbrintegasser; (en sammensat blanding af carbonhydrider, der anvendes som føde i Girbatol-enheden for at fjerne hydrogensulfid. Den består af aliphatiske carbonhydrider, overvejende C3 til og med C4.] |
270-778-6 |
68477-95-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-075-00-7 |
gasser (råolie), isomeriseret naphtha-fraktioneringskolonne-, C4-rige, hydrogensulfidfri; kulbrintegasser |
270-782-8 |
68477-99-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-076-00-2 |
slutgas (råolie), katalytisk krakket klaret olie og termisk krakket vakuumrest fraktioneringsrefluxkammer; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktionering af katalytisk krakket, klaret olie og termisk krakket vakuumrest. Den består overvejende af carbonhydrider, overvejende C1 til og med C6.] |
270-802-5 |
68478-21-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-077-00-8 |
slutgas (råolie), katalytisk krakket naphtha stabiliseringsabsorber-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved stabiliseringen af katalytisk krakket naphtha. Den består overvejende af carbonhydrider, overvejende C1 til og med C6.] |
270-803-0 |
68478-22-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-078-00-3 |
slutgas (råolie), katalytisk krakker, katalytisk reformer og hydroafsvovler, kombineret fraktioneringskolonne-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af produkterne fra katalytiske kraknings-, katalytiske reformerings- og hydroafsvovlingsprocesser, behandlet for at fjerne sure urenheder. Den består overvejende af carbonhydrider, overvejende C1 til og med C5.] |
270-804-6 |
68478-24-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-079-00-9 |
slutgas (råolie), katalytisk reformeret naphtha fraktioneringsstabilizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringsstabiliseringen af katalytisk reformeret naphtha. Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
270-806-7 |
68478-26-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-080-00-4 |
slutgas (råolie), blandet saturatgasanlægsstrøm, C4-rig; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringsstabiliseringen af straight-run naphtha, destillationsslutgas og katalytisk reformeret naphthastabilizerslutgas. Den består af carbonhydrider, C3 til og med C6, overvejende butan og isobutan.] |
270-813-5 |
68478-32-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-081-00-X |
slutgas (råolie), saturatgasanlæg genvindings-, C1-2-rig; kulbrintegasser [en sammensat blanding af carbonhydrider opnået ved fraktionering af destillatslutgas, straight-run naphtha, katalytisk reformeret naphthastabilizerslutgas. Den består overvejende af carbonhydrider, C1 til og med C5, overvejende methan og ethan.] |
270-814-0 |
68478-33-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-082-00-5 |
slutgas (råolie), vakuumrester, termisk krakker-; kulbrintegasser [en sammensat blanding af carbonhydrider opnået ved termisk krakning af vakuumrester. Den består af carbonhydrider, overvejende C1 til og med C5.] |
270-815-6 |
68478-34-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-083-00-0 |
carbonhydrider, C3-4-rige, råoliedestillat; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation og kondensation af råolie. Den består af carbonhydrider, C3 til og med C5, overvejende C3 til og med C4.] |
270-990-9 |
68512-91-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-084-00-6 |
gasser (råolie), full-range straight-run naphtha dehexanizer-aftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af full-range, straight-run naphtha. Den består af carbonhydrider, overvejende C2 til og med C6.] |
271-000-8 |
68513-15-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-085-00-1 |
gasser (råolie), hydrokrakningsdepropanizer-aftræks-, carbonhydridrige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en hydrokrakningsproces. Den består overvejende af carbonhydrider, overvejende C1 til og med C4. Den kan også indeholde små mængder hydrogen og hydrogensulfid.] |
271-001-3 |
68513-16-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-086-00-7 |
gasser (råolie), let straight-run naphtha stabilizer-aftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved stabiliseringen af let, straight-run naphtha. Den består af mættede, aliphatiske carbonhydrider, overvejende C2 til og med C6.] |
271-002-9 |
68513-17-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-087-00-2 |
rester (råolie), alkyleringssplitter-, C4-rige kulbrintegasser; [en sammensat remanens fra destillationen af strømme fra forskellige raffinaderiprocesser. Den består af carbonhydrider C4 til og med C5, overvejende butan, med kogeinterval omtrent fra -11,7 oC til 27,8 oC.] |
271-010-2 |
68513-66-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-088-00-8 |
carbonhydrider, C1-4-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved termiske kraknings- og absorberprocesser samt ved destillation af råolie. Den består af carbonhydrider, overvejende C1 til og med C4, med kogeinterval omtrent fra - 164 oC til -0,5 oC.] |
271-032-2 |
68514-31-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-089-00-3 |
carbonhydrider, C1-4-, sweetened; kulbrintegasser; [ensammensat blanding af carbonhydrider opnået ved at underkaste carbonhydrider en sweetening-proces for at omdanne mercaptaner eller for at fjerne sure urenheder. Den består af carbonhydrider, overvejende C1 til og med C4 med kogeinterval omtrent fra - 164 oC til -0,5 oC .] |
271-038-5 |
68514-36-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-090-00-9 |
carbonhydrider, C1-3-; kulbrintegasser; [en sammensat blanding af carbonhydrider, overvejende C1 til og med C3, med kogeinterval omtrent fra - 164 oC til - 42 oC.] |
271-259-7 |
68527-16-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-091-00-4 |
carbonhydrider, C1-4-, debutanizer-fraktion; kulbrintegasser |
271-261-8 |
68527-19-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-092-00-X |
gasser (råolie), C1-5-, våde; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af råolie og/eller krakningen af tårn-gasolie. Den består af carbonhydrider, overvejende C1 til og med C5.] |
271-624-0 |
68602-83-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-093-00-5 |
carbonhydrider, C2-4-; kulbrintegasser |
271-734-9 |
68606-25-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-094-00-0 |
carbonhydrider, C3-; kulbrintegasser |
271-735-4 |
68606-26-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-095-00-6 |
gasser (råolie), alkyleringsføde; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved den katalytiske krakning af gasolie. Den består af carbonhydrider, overvejende C3 til og med C4.] |
271-737-5 |
68606-27-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-096-00-1 |
gasser (råolie), depropanizer-bundfraktioner, fraktioneringsaftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af depropanizer-bundfraktioner. Den består overvejende af butan, isobutan og butadien.] |
271-742-2 |
68606-34-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-097-00-7 |
gasser (råolie), raffinaderiblandings-; kulbrintegasser; [en sammensat blanding opnået fra forskellige raffinaderiprocesser. Den består af hydrogen, hydrogensulfid og carbonhydrider, overvejende C1 til og med C5.] |
272-183-7 |
68783-07-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-098-00-2 |
gasser (råolie), katalytisk krakkede; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en katalytisk krakningsproces.] Den består overvejende af carbonhydrider, overvejende C3 til og med C5.] |
272-203-4 |
68783-64-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-099-00-8 |
gasser (råolie), C2-4-, sweetenede; kulbrintegasser; [en sammensat blanding af carbonhydrider, opnået ved at underkaste et råoliedestillat en sweeteningsproces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af mættede og umættede carbonhydrider, overvejende C2 til og med C4, med kogeinterval omtrent fra - 51 oC til - 34 oC.] |
272-205-5 |
68783-65-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-100-00-1 |
gasser (råolie), råoliefraktioneringsaftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved fraktioneringen af råolie. Den består af mættede aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
272-871-7 |
68918-99-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-101-00-7 |
gasser (råolie), dehexanizer-aftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af kombinerede naphthastrømme. Den består af mættede aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
272-872-2 |
68919-00-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-102-00-2 |
gasser (råolie), let straight-run benzinfraktioneringsstabilizer-aftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af let straight-run benzin. Den består af mættede aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
272-878-5 |
68919-05-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-103-00-8 |
gasser (råolie), naphthaunifiner-afsvovling, stripperaftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved en naphtha unifiner-afsvovlingsproces og strippet fra naphthaproduktet. Den består af mættede aliphatiske carbonhydrider, overvejende C1 til og med C4.] |
272-879-0 |
68919-06-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-104-00-3 |
gasser (råolie), straight-run naphtha katalytisk reformeringsaftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved den katalytiske reformering af straight-run naphtha og fraktionering af det totale udløb. Den består af methan, ethan og propan.] |
272-882-7 |
68919-09-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-105-00-9 |
gasser (råolie), fluidiseret katalytisk krakker splitter-topfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved fraktioneringen af chargen til C3 -C4-splitteren. Den består overvejende af C3-carbonhydrider.] |
272-893-7 |
68919-20-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-106-00-4 |
gasser (råolie), straight-run stabilizeraftræks-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af væsken fra det første tårn brugt ved destillationen af råolie. Den består af mættede aliphatiske carbonhydrider, overvejende C1 til og med C4.] |
272-883-2 |
68919-10-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-107-00-X |
gasser (råolie), katalytisk krakker naphtha debutanizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af katalytisk krakket naphtha. Den består af carbonhydrider, overvejende C1 til og med C4.] |
273-169-3 |
68952-76-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-108-00-5 |
slutgas (råolie), katalytisk krakket destillat- og naphthastabilizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af katalytisk krakket naphta og destillat. Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
273-170-9 |
68952-77-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-109-00-0 |
slutgas (råolie), termisk krakket destillat, gasolie og naphtha absorber-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved separationen af termisk krakkede destillater, naphtha og gasolie. Den består overvejende af carbonhydrider, overvejende C1 til og med C6.] |
273-175-6 |
68952-81-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-110-00-6 |
slutgas (råolie), termisk krakket carbonhydrid fraktioneringsstabilizer, råolieforkoksnings-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringsstabiliseringen af termisk krakkede carbonhydrider fra en råolieforkoksningsproces. Den består af carbonhydrider, overvejende C1 til og med C6.] |
273-176-1 |
68952-82-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-111-00-1 |
gasser (råolie), lette, dampkrakkede, butadienkoncentrat; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en termisk krakningsproces. Den består af carbonhydrider, overvejende C4.] |
273-265-5 |
68955-28-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-112-00-7 |
gasser (råolie), straight-run naphtha katalytisk reformer stabilizer topfraktions-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved naphtha og fraktioneringen af det totale udløb. Den består af mættede aliphatiske carbonhydrider, overvejende C2 til og med C4.] |
273-270-2 |
68955-34-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-113-00-2 |
carbonhydrider, C4-; kulbrintegasser |
289-339-5 |
87741-01-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-114-00-8 |
alkaner, C1-4-, C3-rige; kulbrintegasser |
292-456-4 |
90622-55-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-115-00-3 |
gasser (råolie), dampkrakker, C3-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en dampkrakningsproces. Den består overvejende af propylen, sammen med noget propan, med kogeinterval omtrent fra - 70 oC til 0 oC.] |
295-404-9 |
92045-22-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-116-00-9 |
carbonhydrider, C4-, dampkrakker-destillat; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en dampkrakningsproces. Den består overvejende af C4-carbonhydrider, overvejende 1-buten og 2-buten, og indeholder også butan og isobuten, med kogeinterval omtrent fra - 12 oC til 5 oC.] |
295-405-4 |
92045-23-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-117-00-4 |
råoliegasser, fortættede, sweetenede, C4-fraktion; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved at underkaste en fortættet råoliegasblanding en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af mættede og umættede C4-carbonhydrider.] |
295-463-0 |
92045-80-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K S U |
|
649-118-00-X |
carbonhydrider, C4-, 1,3-butadien- og isobutenfrie; kulbrintegasser |
306-004-1 |
95465-89-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-119-00-5 |
raffinater (råolie), dampkrakket C4-fraktion, kobberammoniumacetatekstraktion, C3-5- og C3-5-umættede, butadienfrie; kulbrintegasser |
307-769-4 |
97722-19-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-120-00-0 |
gasser (råolie), aminsystemføde-; raffinaderigas; [fødegassen til aminsystemet for fjernelse af hydrogensulfid. Den består af hydrogen. Carbonmonoxid, carbondioxid, hydrogensulfid og aliphatiske carbonhydrider, C1 til og med C5, kan også være til stede.] |
270-746-1 |
68477-65-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-121-00-6 |
gasser (råolie), benzenenheds-hydroafsvovleraftræks-; raffinaderigas; [aftræksgasser fra benzenenheden. De består primært af hydrogen. Carbonmonoxid og carbonhydrider, overvejende C1 til og med C6, herunder benzen, kan også være til stede.] |
270-747-7 |
68477-66-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-122-00-1 |
gasser (råolie), benzenenhed recirkulations-, hydrogenrige; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved at recirkulere gasserne fra benzenenheden. Den består primært af hydrogen med forskellige små mængder carbonmonoxid og carbonhydrider, C1 til og med C6.] |
270-748-2 |
68477-67-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-123-00-7 |
gasser (råolie), blandingsolie-, hydrogen- og nitrogenrige; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved destillation af en blandingsolie. Den består primært af hydrogen og nitrogen med forskellige små mængder carbonmonoxid, carbondioxid og aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
270-749-8 |
68477-68-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-124-00-2 |
gasser (råolie), katalytisk reformeret naphtha-stripper-topfraktioner; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved stabiliseringen af katalytisk reformeret naphtha. Den består af hydrogen og mættede aliphatiske carbonhydrider, overvejende C1 til og med C4.] |
270-759-2 |
68477-77-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-125-00-8 |
gasser (råolie), C6-8-katalytisk reformer recirkulations-; raffinaderigas; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra katalytisk reformering af C6-C8-føde, og recirkuleret for at bevare hydrogen. De består primært af hydrogen. Den kan også indeholde varierende små mængder carbonmonoxid, carbondioxid, nitrogen og carbonhydrider, overvejende C1 til og med C6.] |
270-761-3 |
68477-80-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-126-00-3 |
gasser (råolie), C6-8-katalytisk reformer-; raffinaderigas; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra katalytisk reformering af C6-C8-føde. Den består af C1 til og med C5-carbonhydrider og hydrogen.] |
270-762-9 |
68477-81-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-127-00-9 |
gasser (råolie), C6-8-katalytisk reformer recirkulations-, hydrogenrige; raffinaderigas |
270-763-4 |
68477-82-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-128-00-4 |
gasser (råolie), C2-returstrøms-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved ekstraktionen af hydrogen fra en gasstrøm, som primært består af hydrogen med små mængder nitrogen, carbonmonoxid, methan, ethan og ethylen. Den består overvejende af carbonhydrider, såsom methan, ethan og ethylen, med små mængder hydrogen, nitrogen og carbonmonoxid.] |
270-766-0 |
68477-84-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-129-00-X |
gasser (råolie), tørre sure, gaskoncentreringsenhed aftræks-; raffinaderigas; [den sammensatte blanding af tørre gasser fra en gaskoncentreringsenhed. Den består af hydrogen, hydrogensulfid og carbonhydrider, overvejende C1 til og med C3.] |
270-774-4 |
68477-92-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-130-00-5 |
gasser (råolie), gaskoncentrering reabsorberdestillations-; raffinaderigas; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra blandede gasstrømme i en gaskoncentreringsreabsorber. Den består overvejende af hydrogen, carbonmonoxid, carbondioxid, nitrogen, hydrogensulfid og carbonhydrider, C1 til og med C3.] |
270-776-5 |
68477-93-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-131-00-0 |
gasser (råolie), hydrogenabsorber- aftræks-; raffinaderigas; [en sammensat blanding opnået ved at absorbere hydrogen fra en hydrogenrig strøm. Den består af hydrogen, carbonmonoxid, nitrogen og methan med små mængder C2-carbonhydrider.] |
270-779-1 |
68477-96-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-132-00-6 |
gasser (råolie), hydrogenrige; raffinaderigas; [en sammensat blanding separeret som en gas fra carbonhydridgasser ved afkøling. Den består primært af hydrogen med forskellige små mængder carbonmonoxid, nitrogen, methan og C2-carbonhydrider.] |
270-780-7 |
68477-97-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-133-00-1 |
gasser (råolie), hydrogenbehandler blandingsolierecirkulations-, hydrogen- og nitrogenrige; raffinaderigas; [en sammensat blanding opnået fra recirkuleret hydrogenbehandlet blandingsolie. Den består primært af hydrogen og nitrogen med forskellige små mængder carbonmonoxid, carbondioxid og carbonhydrider, overvejende C1 til og med C5.] |
270-781-2 |
68477-98-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-134-00-7 |
gasser (råolie), recirkulations-, hydrogenrige; raffinaderigas; [en sammensat blanding opnået fra recirkulerede reaktorgasser. Den består primært af hydrogen med forskellige små mængder carbonmonoxid, carbondioxid, nitrogen, hydrogensulfid og mættede, aliphatiske carbonhydrider, C1 til og med C5.] |
270-783-3 |
68478-00-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-135-00-2 |
gasser (råolie), reformer-make-up, hydrogenrige; raffinaderigas; [en sammensat blanding opnået fra reformerne. Den består primært af hydrogen med forskellige små mængder carbonmonoxid og aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
270-784-9 |
68478-01-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-136-00-8 |
gasser (råolie), reformeringshydrogenbehandler-; raffinaderigas; [en sammensat blanding opnået fra reformeringshydrogenbehandlingsprocessen. Den består primært af hydrogen, methan og ethan med forskellige små mængder hydrogensulfid og aliphatiske carbonhydrider, overvejende C3 til og med C5.] |
270-785-4 |
68478-02-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-137-00-3 |
gasser (råolie), reformeringshydrogenbehandler-, hydrogen- og methanrige; raffinaderigas; [en sammensat blanding opnået fra reformerings hydrogenbehandlingsprocessen. Den består primært af hydrogen og methan med forskellige små mængder carbonmonoxid, carbondioxid, nitrogen og mættede, aliphatiske carbonhydrider, overvejende C2 til og med C5.] |
270-787-5 |
68478-03-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-138-00-9 |
gasser (råolie), reformeringshydrogenbehandler make-up-, hydrogenrige; raffinaderigas; [en sammensat blanding opnået fra reformerings hydrogenbehandlingsprocessen. Den består primært af hydrogen med forskellige små mængder carbonmonoxid og aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
270-788-0 |
68478-04-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-139-00-4 |
gasser (råolie), termisk krakning destillations-; raffinaderigas; [en sammensat blanding fremstillet ved destillation af produkterne fra en termisk krakningsproces. Den består af hydrogen, hydrogensulfid, carbonmonoxid, carbondioxid og carbonhydrider, overvejende C1 til og med C6.] |
270-789-6 |
68478-05-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-140-00-X |
slutgas (råolie), katalytisk krakker-refraktioneringsabsorber-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved fraktionering af produkter fra en katalytisk krakningsproces. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C3.] |
270-805-1 |
68478-25-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-141-00-5 |
slutgas (råolie), katalytisk reformeret naphtha-separator-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved den katalytiske reformering af straight-run naphtha. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C6.] |
270-807-2 |
68478-27-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-142-00-0 |
slutgas (råolie), katalytisk reformeret naphtha-stabilizer-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved stabiliseringen af katalytisk reformeret naphta. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C6.] |
270-808-8 |
68478-28-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-143-00-6 |
slutgas (råolie), krakket destillat hydrogenbehandlerseparator-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved at behandle krakkede destillater med hydrogen i tilstedeværelse af en katalysator. Den består af hydrogen og mættede, aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
270-809-3 |
68478-29-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-144-00-1 |
slutgas (råolie), hydroafsvovlet straight-run-naphtha-separator-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved hydroafsvovling af straight-run naphtha. Den består af hydrogen og mættede, aliphatiske carbonhydrider, overvejende C1 til og med C6.] |
270-810-9 |
68478-30-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-145-00-7 |
gasser (råolie), katalytisk reformeret straight-run naphtha stabilizer-topfraktioner; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved den katalytiske reformering af straight-run naphtha, efterfulgt af fraktionering af det totale udløb. Den består af hydrogen, methan, ethan og propan.] |
270-999-8 |
68513-14-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-146-00-2 |
gasser (råolie), reformer-udløbs højtryksflashkammer aftræks-; raffinaderigas; [en sammensat blanding fremstillet ved højtryks-flashing af udløbet fra reformeringsreaktoren. Den består primært af hydrogen med forskellige små mængder methan, ethan og propan.] |
271-003-4 |
68513-18-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-147-00-8 |
gasser (råolie), reformer-udløbs lavtryks-flashkammer aftræks-; raffinaderigas; [en sammensat blanding fremstillet ved lavtryks-flashing af udløbet fra reformeringsreaktoren. Den består primært af hydrogen med forskellige små mængder methan, ethan og propan.] |
271-005-5 |
68513-19-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-148-00-3 |
gasser (råolie), olieraffinaderigas destillationsaftræks-; raffinaderigas; [en sammensat blanding separeret ved destillation af en gasstrøm indeholdende hydrogen, carbonmonoxid, carbondioxid og carbonhydrider, C1 til og med C6, eller opnået ved krakning af ethan og propan. Den består af carbonhydrider, overvejende C1 til og med C2, hydrogen, nitrogen og carbonmonoxid.] |
271-258-1 |
68527-15-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-149-00-9 |
gasser (råolie), benzenenhed hydrogenbehandler depentanizer-topfraktioner; raffinaderigas; [en sammensat blanding fremstillet ved at behandle føden fra benzenenheden med hydrogen i tilstedeværelse af en katalysator, efterfulgt af depentanisering. Den består primært af hydrogen, ethan og propan med forskellige små mængder nitrogen, carbonmonoxid, carbondioxid og carbonhydrider, overvejende C1 til og med C6. Den kan indeholde spormængder af benzen.] |
271-623-5 |
68602-82-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-150-00-4 |
gasser (råolie), sekundære absorberaftræks-, fluidiseret katalytisk krakker-topfraktioner fraktionerings-; raffinaderigas; [en sammensat blanding fremstillet ved fraktioneringen af topfraktionsprodukterne fra den katalytiske krakningsproces i den fluidiserede katalytiske krakker. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C3.] |
271-625-6 |
68602-84-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-151-00-X |
råolieprodukter, raffinaderigasser; rafinaderigas; [en sammensat blanding, som primært består af hydrogen med forskellige små mængder methan, ethan og propan.] |
271-750-6 |
68607-11-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-152-00-5 |
gasser (råolie), hydrokrakning lavtryks-separator-; raffinaderigas; [en sammensat blanding opnået ved væske-damp-separationen af udløbet fra hydrokrakningsprocesreaktoren. Den består overvejende af hydrogen og mættede carbonhydrider, overvejende C1 til og med C3.] |
272-182-1 |
68783-06-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-153-00-0 |
gasser (råolie), raffinaderi; raffinaderigas; [en sammensat blanding opnået fra forskellige råolieraffineringsoperationer. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C3.] |
272-338-9 |
68814-67-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-154-00-6 |
gasser (råolie), platformer-produkter separatoraftræks-; raffinaderigas; [en sammensat blanding opnået fra den kemiske reformering af naphthener til aromater. Den består af hydrogen og mættede aliphatiske carbonhydrider, overvejende C2 til og med C4.] |
272-343-6 |
68814-90-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-155-00-1 |
gasser (råolie), hydrogenbehandlet sur petroleum depentanizer stabilisatoraftræks-; raffinaderigas; [den sammensatte blanding opnået fra depentanizer-stabiliseringen af hydrogenbehandlet petroleum. Den består primært af hydrogen, methan, ethan og propan med forskellige små mængder af nitrogen, hydrogensulfid, carbonmonoxid og carbonhydrider, overvejende C4 til og med C5.] |
272-775-5 |
68911-58-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-156-00-7 |
gasser (råolie), hydrogenbehandlet, sur petroleum-flashkammer-; raffinaderigas; [en sammensat blanding opnået fra flashkammeret fra enheden, der behandler sur petroleum med hydrogen i tilstedeværelse af en katalysator. Den består primært af hydrogen og methan med forskellige små mængder af nitrogen, carbonmonoxid, og carbonhydrider, overvejende C2 til og med C5.] |
272-776-0 |
68911-59-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-157-00-2 |
gasser (råolie), destillat unifiner afsvovlingsstripper aftræks-; raffinaderigas; [en sammensat blanding strippet fra væskeproduktet fra unifiner afsvovlingsprocessen. Den består af hydrogensulfid, methan, ethan og propan.] |
272-873-8 |
68919-01-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-158-00-8 |
gasser (råolie), fluidiseret katalytisk krakker fraktioneringsaftræks-; raffinaderigas; [en sammensat blanding fremstillet ved fraktioneringen af topfraktionsproduktet fra den fluidiserede katalytiske krakningsproces. Den består af hydrogen, hydrogensulfid, nitrogen og carbonhydrider, overvejende C1 til og med C5.] |
272-874-3 |
68919-02-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-159-00-3 |
gasser (råolie), fluidiseret katalytisk krakker skrubning, sekundære absorberaftræks-; raffinaderigas; [en sammensat blanding fremstillet ved at skrubbe topfraktionsgassen fra den fluidiserede, katalytiske krakker. Den består af hydrogen, nitrogen, methan, ethan og propan.] |
272-875-9 |
68919-03-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-160-00-9 |
gasser (råolie), tungt destillat, hydrogenbehandlerafsvovler stripper aftræks-; raffinaderigas; [en sammensat blanding strippet fra væskeproduktet fra hydrogenbehandling-afsvovling af tungt destillat. Den består af hydrogen, hydrogensulfid og mættede aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
272-876-4 |
68919-04-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-161-00-4 |
gasser (råolie), platformerstabilizer aftræks-, fraktionering af lette produkter; raffinaderigas; [en sammensat blanding opnået ved fraktioneringen af de lette produkter fra platinreaktorerne fra platformerenheden. Den består af hydrogen, methan, ethan og propan.] |
272-880-6 |
68919-07-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-162-00-X |
gasser (råolie), preflash-tårn aftræks-, rådestillation; raffinaderigas; [en sammensat blanding fremstillet fra det første tårn brugt ved destillationen af råolie. Den består af nitrogen og mættede aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
272-881-1 |
68919-08-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-163-00-5 |
gasser (råolie), tjærestripperaftræks-; raffinaderigas; [en sammensat blanding opnået ved fraktioneringen af reduceret råolie. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C4.] |
272-884-8 |
68919-11-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-164-00-0 |
gasser (råolie), unifiner stripperaftræks-; raffinaderigas; [en blanding af hydrogen og methan opnået ved fraktioneringen af produkterne fra unifiner-enheden.] |
272-885-3 |
68919-12-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-165-00-6 |
slutgas (råolie), katalytisk hydroafsvovlet naphthaseparator-; raffinaderigas; [en sammensat blanding af carbonhydrider opnået ved hydroafsvovlingen af naphtha. Den består af hydrogen, methan, ethan og propan.] |
273-173-5 |
68952-79-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-166-00-1 |
slutgas (råolie), straight-run naphtha hydroafsvovler-; raffinaderigas; [en sammensat blanding opnået ved hydroafsvovlingen af straight-run naphtha. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C5.] |
273-174-0 |
68952-80-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-167-00-7 |
gasser (råolie), sponge absorber aftræks-, fluidiseret katalytisk krakker og gasolieafsvovler topfraktionsfraktionering; raffinaderigas; [en sammensat blanding opnået ved fraktionering af produkterne fra den fluidiserede katalytiske krakker og gasolieafsvovler. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C4.] |
273-269-7 |
68955-33-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-168-00-2 |
gasser (råolie), rådestillation og katalytisk krakning; raffinaderigas; [en sammensat blanding fremstillet ved rådestillations og katalytiske krakningsprocesser. Den består af hydrogen, hydrogensulfid, nitrogen, carbonmonoxid og paraffin- og olefincarbonhydrider, overvejende C1 til og med C6.] |
273-563-5 |
68989-88-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-169-00-8 |
gasser (råolie), gasolie diethanolaminskrubber- aftræks-; raffinaderigas; [en sammensat blanding fremstillet ved afsvovling af gasolier med diethanolamin. Den består overvejende af hydrogensulfid, hydrogen og aliphatiske carbonhydrider, overvejende C1 til og med C5.] |
295-397-2 |
92045-15-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-170-00-3 |
gasser (råolie), gasolie, hydroafsvovlingsudløbs-; raffinaderigas; [en sammensat blanding opnået ved separation af væskefasen fra udløbet fra hydrogeneringsreaktionen. Den består overvejende af hydrogen, hydrogensulfid og aliphatiske carbonhydrider, overvejende C1 til og med C3.] |
295-398-8 |
92045-16-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-171-00-9 |
gasser (råolie), gasoliehydroafsvovling-udblæsnings-; raffinaderigas; [en sammensat blanding af gasser opnået fra reformeren og fra udblæsningerne fra hydrogeneringsreaktoren. Den består overvejende af hydrogen og aliphatiske carbonhydrider, overvejende C1 til og med C4.] |
295-399-3 |
92045-17-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-172-00-4 |
gasser (råolie), hydrogenatorudløb-flashkammer- aftræks-; raffinaderigas; [en sammensat blanding af gasser opnået fra flashing af udløbene efter hydrogeneringsreaktionen. Den består overvejende af hydrogen og aliphatiske carbonhydrider, overvejende C1 til og med C6.] |
295-400-7 |
92045-18-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-173-00-X |
gasser (råolie), naphthadampkrakning højtryksrest-; raffinaderigas; [en sammensat blanding opnået som en blanding af de ikke-kondenserbare dele af produktet fra en naphthadampkrakningsproces samt restgasser opnået under bearbejdningen af efterfølgende produkter. Den består overvejende af hydrogen og paraffin og olefincarbonhydrider, overvejende C1 til og med C5, og kan også være iblandet naturgas.] |
295-401-2 |
92045-19-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-174-00-5 |
gasser (råolie), restvisbreaking-aftræks-; raffinaderigas; [en sammensat blanding opnået fra viskositetsreduktion af rester i en ovn. Den består overvejende af hydrogensulfid og paraffin og olefincarbonhydrider, overvejende C1 til og med C5.] |
295-402-8 |
92045-20-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-175-00-0 |
Foot's olie (råolie), syrebehandlet; Foot's olie; [en sammensat blanding af carbonhydrider opnået ved behandling af Foot's oil med svovlsyre. Den består overvejende af forgrenede carbonhydrider, overvejende C20 til og med C50.] |
300-225-7 |
93924-31-3 |
Flam. Gas 1 Press. Gas Carc. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-176-00-6 |
Foot's oil (råolie), lerbehandlet; solventekstraherede eller afvoksede tunge restolier; [en sammensat blanding af carbonhydrider opnået ved behandling af Foot's oil med naturligt eller modificeret ler, enten i en kontakt- eller perkolationsproces for at fjerne spor af polære forbindelser og urenheder, som er til stede. Den består overvejende af forgrenede carbonhydrider, overvejende C20 til og med C50.] |
300-226-2 |
93924-32-4 |
Flam. Gas 1 Press. Gas Carc. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-177-00-1 |
gasser (råolie), C3-4-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra krakningen af råolie. Den består af carbonhydrider, C3 til og med C4, overvejende propan og propylen, med kogeinterval omtrent fra - 51 oC til - 1 oC.] |
268-629-5 |
68131-75-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-178-00-7 |
slutgas (råolie), katalytisk krakket destillat- og katalytisk krakket naphtha fraktioneringsabsorber-; kulbrintegasser [den sammensatte blanding af carbonhydrider fra destillationen af produkterne fra katalytisk krakkede destillater og katalytisk krakket naphtha. Den består overvejende af carbonhydrider, C1 til og med C4.] |
269-617-2 |
68307-98-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-179-00-2 |
slutgas (råolie), katalytisk polymeriseret naphtha fraktionerings-stabilizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider fra fraktionerings-stabiliseringsprodukterne fra polymerisering af naphtha. Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
269-618-8 |
68307-99-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-180-00-8 |
slutgas (råolie), katalytisk reformeret naphtha fraktionerings-stabilizer-, hydrogensulfid-fri; kulbrintegasser; [en sammensat blanding af carbonhydrider, opnået ved fraktioneringsstabilisering af katalytisk reformeret naphtha, og fra hvilken hydrogensulfid er blevet fjernet ved aminbehandling. Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
269-619-3 |
68308-00-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-181-00-3 |
slutgas (råolie), krakket destillat hydrogenbehandler-stripper-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved at behandle termisk krakkede destillater med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af mættede carbonhydrider, overvejende C1 til og med C6.] |
269-620-9 |
68308-01-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-182-00-9 |
slutgas (råolie), straight-run destillat hydroafsvovler-, hydrogensulfidfri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved katalytisk hydroafsvovling af straight-run destillater og fra hvilken hydrogensulfid er blevet fjernet ved aminbehandling. Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
269-630-3 |
68308-10-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-183-00-4 |
slutgas (råolie), katalytisk gasoliekrakningsabsorber-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved destillation af produkter fra den katalytiske krakning af gasolie. Den består overvejende af carbonhydrider, overvejende C1 til og med C5.] |
269-623-5 |
68308-03-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-184-00-X |
slutgas (råolie), gas-genudvindingsanlægs-; kulbrintegasser; [en sammensat blanding af carbonhydrider fra destillationen af produkter fra diverse carbonhydridstrømme. Den består overvejende af carbonhydrider, overvejende C1 til og med C5.] |
269-624-0 |
68308-04-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-185-00-5 |
slutgas (råolie), gas-genvindingsanlæg deethanizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider fra destillationen af produkter fra diverse carbonhydridstrømme. Den består af carbonhydrider, overvejende C1 til og med C4.] |
269-625-6 |
68308-05-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-186-00-0 |
slutgas (råolie), hydroafsvovlet destillat- og hydroafsvovlet naphtha fraktioneringskolonne-, syrefri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktionering af hydroafsvovlet naphtha og destillat carbonhydridstrømme og behandlet for at fjerne sure urenheder. Den består overvejende af carbonhydrider, overvejende C1 til og med C5.] |
269-626-1 |
68308-06-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-187-00-6 |
slutgas (råolie), hydroafsvovlet vakuumgasolie stripper-, hydrogensulfidfri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved stripningsstabilisering af katalytisk hydroafsvovlet vakuumgasolie og fra hvilken hydrogensulfid er blevet fjernet ved aminbehandling. Den består overvejende af carbonhydrider, overvejende C1 til og med C6.] |
269-627-7 |
68308-07-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-188-00-1 |
slutgas (råolie), let straight-run naphtha stabilizer-, hydrogensulfidfri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktioneringsstabilisering af straight-run naphtha og fra hvilken hydrogensulfid er blevet fjernet ved aminbehandling. Den består overvejende af carbonhydrider, overvejende C1 til og med C5.] |
269-629-8 |
68308-09-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-189-00-7 |
slutgas (råolie), propan- og propylenalkyleringsføde forarbejdningsdeethanizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra reaktionen mellem propan og propylen. Den består af carbonhydrider, overvejende C1 til og med C4.] |
269-631-9 |
68308-11-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-190-00-2 |
slutgas (råolie), vakuumgasolie hydroafsvovler-, hydrogensulfidfri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved katalytisk hydroafsvovling af vakuumgasolie og fra hvilken hydrogensulfid er blevet fjernet ved aminbehandling. Den består overvejende af carbonhydrider, overvejende C1 til og med C6.] |
269-632-4 |
68308-12-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-191-00-8 |
gasser (råolie), katalytisk krakker naphtha debutanizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkter fra den katalytiske krakningsproces. Den består af carbonhydrider, overvejende C3 til og med C5, med kogeinterval omtrent fra - 48 oC til 32 oC.] |
270-071-2 |
68409-99-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-193-00-9 |
alkaner, C1-2-; kulbrintegasser |
270-651-5 |
68475-57-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-194-00-4 |
alkaner, C2-3-; kulbrintegasser |
270-652-0 |
68475-58-1 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-195-00-X |
alkaner, C3-4-; kulbrintegasser |
270-653-6 |
68475-59-2 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-196-00-5 |
alkaner, C4-5-; kulbrintegasser |
270-654-1 |
68475-60-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-197-00-0 |
brændselsgasser; kulbrintegasser; [en blanding af lette gasser. Den består overvejende af hydrogen og/eller lavmolekylære carbonhydrider.] |
270-667-2 |
68476-26-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-198-00-6 |
brændselsgasser, råoliedestillater; kulbrintegasser; [en sammensat blanding af lette gasser fremstillet ved destillation af råolie og ved katalytisk reformering af naphtha. Den består af hydrogen og carbonhydrider, overvejende C1 til og med C4, med kogeinterval omtrent fra - 217 oC til - 12 oC.] |
270-670-9 |
68476-29-9 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-199-00-1 |
carbonhydrider, C3-4-; kulbrintegasser |
270-681-9 |
68476-40-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-200-00-5 |
carbonhydrider, C4-5-; kulbrintegasser |
270-682-4 |
68476-42-6 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-201-00-0 |
carbonhydrider, C2-4-, C3-rige; kulbrintegasser |
270-689-2 |
68476-49-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-202-00-6 |
råoliegasser, fortættede; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af råolie. Den består af carbonhydrider, overvejende C3 til og med C7, med kogeinterval omtrent fra 40 oC til 80 oC.] |
270-704-2 |
68476-85-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K S U |
|
649-203-00-1 |
råoliegasser, fortættede sweetenede; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved at underkaste en fortættet råoliegasblanding en sweetening-process for at omdanne mercaptaner eller for at fjerne sure urenheder. Den består af carbonhydrider, overvejende C3 til og med C7, med kogeinterval omtrent fra - 40 oC til 80 oC.] |
270-705-8 |
68476-86-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K S U |
|
649-204-00-7 |
gasser (råolie), C3-4-, isobutanrige; kulbrintegasser; [en sammensat blanding af carbonhydrider fra destillationen af mættede og umættede carbonhydrider, sædvanligvis C3 til og med C6, overvejende butan og isobutan. Den består af mættede og umættede carbonhydrider, C3 til og med C4, overvejende isobutan.] |
270-724-1 |
68477-33-8 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-205-00-2 |
gasser (råolie), C3-6-, piperylenrige; kulbrintegasser; [en sammensat blanding af carbonhydrider fra destillationen af mættede og umættede, aliphatiske carbonhydrider, sædvanligvis C3 til og med C6. Den består af mættede og umættede carbonhydrider, C3 til og med C6, overvejende piperylener.] |
270-726-2 |
68477-35-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-206-00-8 |
gasser (råolie), butansplitter- opfraktioner; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved destillationen af butanstrømmen. Den består af aliphatiske carbonhydrider, overvejende C3 til og med C4.] |
270-750-3 |
68477-69-0 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-207-00-3 |
gasser (råolie), C2-3-; kulbrintegasser; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkter fra en katalytisk fraktioneringsproces. Den indeholder overvejende ethan, ethylen, propan og propylen.] |
270-751-9 |
68477-70-3 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-208-00-9 |
gasser (råolie), katalytisk krakket gasolie depropanizer-bundfraktioner, C4-rige syrefri; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved fraktionering af katalytisk krakket gasoliecarbonhydridstrøm og behandlet for at fjerne hydrogensulfid og andre sure komponenter. Den består af C3 til og med C5-carbonhydrider, overvejende C4.] |
270-752-4 |
68477-71-4 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-209-00-4 |
gasser (råolie), katalytisk krakket naphtha debutanizer-bundfraktioner, C3-5-rige; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået ved stabilisering af katalytisk krakket naphtha. Den består af aliphatiske carbonhydrider, overvejende C3 til og med C5.] |
270-754-5 |
68477-72-5 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-210-00-X |
slutgas (råolie), isomeriseret naphtha fraktioneringsstabilizer-; kulbrintegasser; [en sammensat blanding af carbonhydrider opnået fra produkter fra fraktioneringsstabiliseringen af isomeriseret naphtha Den består overvejende af carbonhydrider, overvejende C1 til og med C4.] |
269-628-2 |
68308-08-7 |
Press. Gas Flam. Gas 1 Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS04 GHS02 GHS08 Dgr |
H220 H350 H340 |
|
|
K U |
|
649-211-00-5 |
Foot's oil (råolie), carbonbehandlet; solventekstraherede eller afvoksede tunge restolier [en sammensat blanding af carbonhydrider opnået ved behandlingen af Foots oil med aktivt kul for at fjerne sporbestandele og urenheder. Den består overvejende af mættede ligekædede carbonhydrider, overvejende større end C12.] |
308-126-0 |
97862-76-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-212-00-0 |
destillater (råolie), sweetenede, middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved at underkaste et råoliedestillat en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består af carbonhydrider, overvejende C9 til og med C20, med kogeinterval omtrent fra 150 oC til 345 oC.] |
265-088-7 |
64741-86-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-213-00-6 |
gasolier (råolie), solventraffinerede; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består overvejende af aliphatiske carbonhydrider, overvejende C11 til og med C25, med kogeinterval omtrent fra 205 oC til 400 oC.] |
265-092-9 |
64741-90-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-214-00-1 |
destillater (råolie), solventraffinerede middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består overvejende af aliphatiske carbonhydrider, overvejende C9 til og med C20, med kogeinterval omtrent fra 150 oC til 345 oC.] |
265-093-4 |
64741-91-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-215-00-7 |
gasolier (råolie), syrebehandlede; upecificeret gasolie; [en sammensat blanding af carbonhybrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhybrider, overvejende C13 til og med C25, med kogeinterval omtrent fra 230 oC til 400 oC.] |
265-112-6 |
64742-12-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-216-00-2 |
destillater (råolie), syrebehandlede, middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhybrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhydrider, overvejende C11 til og med C20, med kogeinterval omtrent fra 205 oC til 345 oC.] |
265-113-1 |
64742-13-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-217-00-8 |
destillater (råolie), syrebehandlede, lette; upecificeret gasolie; [en sammensat blanding af carbonhybrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 150 oC til 290 oC.] |
265-114-7 |
64742-14-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-218-00-3 |
gasolier (råolie), kemisk neutraliserede; upecificeret gasolie; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C13 til og med C25, med kogeinterval omtrent fra 230 oC til 400 oC.] |
265-129-9 |
64742-29-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-219-00-9 |
destillater (råolie), kemisk neutraliserede, middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C11 til og med C20, med kogeinterval omtrent fra 205 oC til 345 oC.] |
265-130-4 |
64742-30-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-220-00-4 |
destillater (råolie), lerbehandlede, middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider fremkommet ved behandling af en råoliefraktion med naturligt eller modificeret ler, i enten en kontakt- eller perkoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende C9 til og med C20, med kogeinterval omtrent fra 150 oC til 345 oC.] |
265-139-3 |
64742-38-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-221-00-X |
destillater (råolie), hydrogen behandlede middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C11 til og med C25, med kogeinterval omtrent fra 205 oC til 400 oC.] |
265-148-2 |
64742-46-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-222-00-5 |
gasolier (råolie), hydro afsvovlede upecificeret gasolie; [en sammensat blandning af carbonhydrider opnået fra en rå råolie ved behandling med hydrogen for at omdanne organisk svovl til hydrogensulfid, der fjernes. Den består overvejende af carbonhydrider, overvejende C13 til og med C25, med kogeinterval omtrent fra 230 oC til 400 oC] |
265-182-8 |
64742-79-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-223-00-0 |
destillater (råolie), hydroafsvovlede, middeltunge; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået fra en rå råolie ved behandling med hydrogen for at omdanne organisk svovl til hydrogensulfid, der fjernes. Den består af carbonhydrider, overvejende C11 til og med C25, med kogeinterval omtrent fra 205 oC til 400 oC.] |
265-183-3 |
64742-80-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-224-00-6 |
brændstoffer, diesel-; upecificeret gasolie; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af råolie. Den består af carbonhydrider, overvejende C9 til og med C20, med kogeinterval omtrent fra 163 oC til 357 oC.] |
269-822-7 |
68334-30-5 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
N |
|
649-225-00-1 |
brændselsolie, nr. 2; upecificeret gasolie; [en destillatolie med en minimumsviskositet på 2 cSt ved 37,7 oC til et maximum på 3.7 cSt ved 37,7 oC.] |
270-671-4 |
68476-30-2 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
649-226-00-7 |
brændselsolie, nr. 4; upecificeret gasolie; [en destillatolie med en minimumsviskositet på 5.8 cSt ved 37,7 oC til et maximum på 26.4 cSt ved 37,7 oC.] |
270-673-5 |
68476-31-3 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
649-227-00-2 |
brændstoffer, diesel-, nr. 2; uspecificeret gasolie; [destillatolien med en minimumsviskositet på 2 cSt ved 37,7 oC til et maximum på 4.3 cSt ved 37,7 oC.] |
270-676-1 |
68476-34-6 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
649-228-00-8 |
destillater (råolie), katalytisk reformer-fraktioneringskolonnerest, højtkogende; upecificeret gasolie; [en sammensat blanding af carbonhydrider fra destillationen af en rest fra en katalytisk reformer fraktioneringskolonne. Den koger omtrent fra 343 oC til 399 oC.] |
270-719-4 |
68477-29-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-229-00-3 |
destillater (råolie), katalytisk reformer-fraktioneringskolonnerest, intermediært kogende; upecificeret gasolie; [en sammensat blanding af carbonhydrider fra destillationen af en rest fra en katalytisk reformer fraktioneringskolonne. Den koger omtrent fra 288 oC til 371 oC.] |
270-721-5 |
68477-30-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-230-00-9 |
destillater (råolie), katalytisk reformer-fraktioneringskolonnerest, lavtkogende; upecificeret gasolie; [en sammensat blanding af carbonhydrider fra destillationen af en rest fra en katalytisk reformer fraktioneringskolonne. Den koger omtrent under 288 oC.] |
270-722-0 |
68477-31-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-231-00-4 |
destillater (råolie), højt raffinerede, middeltunge; upecificeret gasolie; (en sammensat blanding af carbonhydrider opnået ved at underkaste en råoliefraktion flere af følgende trin: filtrering, centrifugering, atmosfærisk destillation, vakuumdestillation, syrebehandling, neutralisering og lerbehandling. Den består overvejende af carbonhydrider, overvejende C10 til og med C20) |
292-615-8 |
90640-93-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-232-00-X |
destillater (råolie), katalytisk reformer-, tungt aromatisk koncentrat; uspecificeret gasolie; [en sammensat blanding af carbonhydrider opnået fra destillation af en katalytisk reformeret råoliefraktion. Den består overvejende af aromatiske carbonhydrider, overvejende C10 til og med C16, med kogeinterval omtrent fra 200 oC til 300 oC.] |
295-294-2 |
91995-34-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-233-00-5 |
gasolier, paraffin-; uspecificeret gasolie; [et destillat opnået ved redestillationen af en sammensat blanding af carbonhydrider, opnået ved destillationen af spildevandet fra kraftig, katalytisk hydrogenbehandling af paraffiner. Det har kogeinterval omtrent fra 190 oC til 330 oC.] |
300-227-8 |
93924-33-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-234-00-0 |
naphtha (råolie), solvent-raffineret hydroafsvovlet tung; uspecificeret gasolie |
307-035-3 |
97488-96-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-235-00-6 |
carbonhydrider, C16-20-hydrogenbehandlet middeltungt destillat, lette destillater; uspecificeret gasolie; [en sammensat blanding af carbonhydrider opnået som forløb fra vakuumdestillationen af udløb fra behandlingen af et middeltungt destillat med hydrogen. Den består overvejende af carbonhydrider C16 til og med C20, med kogeinterval omtrent fra 290 oC til 350 oC. Den danner en færdig olie med en viskositet på 2 cSt ved 100 oC.] |
307-659-6 |
97675-85-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-236-00-1 |
carbonhydrider, C12-20-, hydrogenbehandlet paraffin, lette destillater; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået som forløb fra vakuumdestillationen af udløb fra behandlingen af tunge paraffiner med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende fra C12 til og med C20, med kogeinterval omtrent fra 230 oC til 350 oC. Den danner en færdig olie med en viskositet på 2 cSt ved 100 oC.] |
307-660-1 |
97675-86-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-237-00-7 |
carbonhydrider, C11-17-solvent-ekstraherede, lette, naphthenske; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved ekstraktionen af aromaterne fra et let naphthen destillat med en viskositet på 2,2 cSt.] ved 40 oC. Den består overvejende af carbonhydrider, overvejende fra C11 til og med C17, med kogeinterval omtrent fra 200 oC til 300 o.] |
307-757-9 |
97722-08-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-238-00-2 |
gasolier, hydrogenbehandlede; uspecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved redestillation af udløbene fra behandlingen af paraffiner med hydrogen, i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende fra C17 til og med C27, med kogeinterval omtrent fra 330 oC til 340 oC.] |
308-128-1 |
97862-78-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-239-00-8 |
destillater (råolie), carbonbehandlet lette paraffin-; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved behandling af en råoliefraktion med aktivt kul, til fjernelse af spor af polære bestanddele og urenheder. Den består overvejende af carbonhydrider, overvejende C12 til og med C28.] |
309-667-5 |
100683-97-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-240-00-3 |
destillater (råolie), intermediære paraffin-, carbonbehandlede; upecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved behandlingen af råolie med aktivt kul, til fjernelse af spor af polære bestanddele og urenheder. Den består overvejende af carbonhydrider, overvejende C16 til og med C36.] |
309-668-0 |
100683-98-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-241-00-9 |
destillater (råolie), intermediære paraffin-, lerbehandlede; uspecificeret gasolie; [en sammensat blanding af carbonhydrider opnået ved behandlingen af råolie med blegejord, til fjernelse af spor polære bestanddele og urenheder. Den består overvejende af carbonhydrider, overvejende C16 til og med C36.] |
309-669-6 |
100683-99-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-242-00-4 |
alkaner, C12-26-forgrenede og ligekædede |
292-454-3 |
90622-53-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-243-00-X |
smørefedtstoffer; fedt; [en sammensat blanding af carbonhydrider, overvejende C12 til og med C50, som kan indeholde organiske salte af alkalimetaller, jordalkalimetaller, og/eller aluminiumforbindelser.] |
278-011-7 |
74869-21-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-244-00-5 |
slack wax (råolie), råparaffin; [en sammensat blanding af carbonhydrider opnået fra en råoliefraktion ved solventkrystallisation (solventafvoksning), eller som en destillationsfraktion fra en meget voksagtig olie. Den består overvejende af mættede, ligekædede og forgrenede carbonhydrider, overvejende større end C20.] |
265-165-5 |
64742-61-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-245-00-0 |
slack wax (råolie), syrebehandlet; råparaffin; [en sammensat blandning ekstraktcarbonhydrider opnået som et raffinat ved behandling af en råolie-slack wax i en svovlsyrebehandlingsproces. Den består overvejende af mættede, ligekædede og forgrenede carbonhydrider, overvejende større end C20.] |
292-659-8 |
90669-77-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-246-00-6 |
slack wax (råolie), lerbehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandling af en råolie-slack wax-fraktion med neutralt eller modificeret ler i enten en kontakt- eller en perkoleringsproces. Den består overvejende af mættede, ligekædede og forgrenede carbonhydrider, overvejende større end C20.] |
292-660-3 |
90669-78-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-247-00-1 |
slack wax (råolie), hydrogen behandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved at behandle slack wax med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af mættede, ligekædede og forgrenede carbonhydrider, overvejende større end C20.] |
295-523-6 |
92062-09-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-248-00-7 |
slack wax (råolie), lavtsmeltende; råparaffin; [en sammensat blanding af carbonhydrider opnået fra en råoliefraktion ved solventafparaffinering. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
295-524-1 |
92062-10-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-249-00-2 |
slack wax (råolie), lavtsmeltende, hydrogenbehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandling af lavtsmeltende råolie-slack wax med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af mættede, ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
295-525-7 |
92062-11-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-250-00-8 |
slack wax (råolie), lavtsmeltende, carbonbehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandlingen af lavtsmeltende slack wax med aktivt kul for at fjerne polære sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-155-9 |
97863-04-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-251-00-3 |
slack wax (råolie), lavtsmeltende, lerbehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandlingen af lavtsmeltende råolie-slack wax med bentonit for at fjerne polære sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-156-4 |
97863-05-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-252-00-9 |
slack wax (råolie), lavtsmeltende, kiselsyrebehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandlingen af lavtsmeltende råolie-slack wax med kiselsyre for at fjerne polære sporbestanddele og urenheder. Den består overvejende af mættede ligekædede og forgrenede carbonhydrider, overvejende større end C12.] |
308-158-5 |
97863-06-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-253-00-4 |
slack wax (råolie), carbonbehandlet; råparaffin; [en sammensat blanding af carbonhydrider opnået ved behandling af råolie-slack wax med aktivt kul, for at fjerne spor af polære bestanddele og urenheder.] |
309-723-9 |
100684-49-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-254-00-X |
vaselin; [en sammensat blanding af carbonhydrider udvundet som et halvfast stof fra afvoksning af paraffinrestolie. Den består overvejende af mættede krystallinske og flydende carbonhydrider, overvejende større end C25.] |
232-373-2 |
08-03-8009 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-255-00-5 |
vaselin (råolie), oxideret; vaselin; [en sammensat blanding af organiske forbindelser, overvejende højmolekylære carboxylsyrer, opnået ved luftoxidation af vaselin.] |
265-206-7 |
64743-01-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-256-00-0 |
vaselin (råolie), aluminiumoxidbehandlet; vaselin; [en sammensat blanding af carbonhydrider opnået når vaselin er behandlet med AL2O3 for at fjerne polære komponenter og urenheder. Den består overvejende af mættede, krystallinske og flydende carbonhydrider, overvejende større end C25.] |
285-098-5 |
85029-74-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-257-00-6 |
vaselin (råolie), hydrogen behandlet; vaselin; [en sammensat blanding af carbonhydrider opnået som et halvfast stof fra afvokset paraffinrestolie behandlet med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af mættede mikrokrystallinske og flydende carbonhydrider, overvejende større end C20.] |
295-459-9 |
92045-77-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-258-00-1 |
vaselin (råolie) carbonbehandlet; vaselin; [en sammensat blanding af carbonhydrider opnået ved behandlingen af råolievaselin med aktivt kul for at fjerne polære sporbestanddele og urenheder. Den består overvejende af mættede carbonhydrider, overvejende større end C20.] |
308-149-6 |
97862-97-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-259-00-7 |
vaselin (råolie), kiselsyrebehandlede; vaselin; [en sammensat blanding af carbonhydrider opnået ved behandlingen af råolievaselin med kiselsyre for at fjerne polære sporbestandele og urenheder. Den består overvejende af mættede carbonhydrider, overvejende større end C20.] |
308-150-1 |
97862-98-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-260-00-2 |
vaselin (råolie), lerbehandlet; vaselin; [en sammensat blanding af carbonhydrider opnået ved behandling af vaselin med blegejord, for at fjerne spor af polære bestanddele og urenheder. Den består overvejende af carbonhydrider, overvejende større end C25.] |
309-706-6 |
100684-33-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
N |
|
649-261-00-8 |
kondensat, naturgas-; lavtkogende nafta; [en sammensat blanding af carbonhydrider adskilt fra naturgas ved processer, såsom køling eller absorption. Den består overvejende af mættede aliphatiske carbonhydrider, overvejende C4 til og med C8, med kogeinterval omtrent fra - 20 oC til 120 oC.] |
232-349-1 |
8006-61-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-262-00-3 |
naphtha; lavtkogende nafta; [raffinerede, delvist raffinerede, eller uraffinerede råolieprodukter fremstillet ved destillation af naturgas. De består af carbonhydrider, overvejende C5 til og med C6, med kogeinterval omtrent fra 100 oC til 200 oC.] |
232-443-2 |
8030-30-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-263-00-9 |
ligroin; lavtkogende nafta; [en sammensat blanding af carbonhydrider opnået ved fraktioneret destillation af råolie. Denne fraktion har kogeinterval omtrent fra 20 oC til 135 oC.] |
232-453-7 |
8032-32-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-264-00-4 |
naphtha (råolie), tung straight-run; lavtkogende nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af råolie. Den består af carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 65 oC til 230 oC.] |
265-041-0 |
64741-41-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-265-00-X |
naphtha (råolie), full-range straight-run-; lavtkogende nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af råolie. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 220 oC.] |
265-042-6 |
64741-42-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-266-00-5 |
naphtha (råolie), let straight-run-; lavtkogende nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af råolie. Den består overvejende af aliphatiske carbonhydrider, overvejende C4 til og med C10, med kogeinterval omtrent fra - 20 oC til 180 oC.] |
265-046-8 |
64741-46-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-267-00-0 |
solventnaphtha (råolie), let aliphatisk; lavtkogende nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af råolie eller naturgaskondensat. Den består overvejende af mættede carbonhydrider, overvejende C5 til og med C10, med kogeinterval omtrent fra 35 oC til 160 oC.] |
265-192-2 |
64742-89-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-268-00-6 |
destillater (råolie), straight-run, lette; lavtkogende nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af råolie. Den består af carbonhydrider, overvejende C2 til og med C7, med kogeinterval omtrent fra - 88 oC til 99 oC.] |
270-077-5 |
68410-05-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-269-00-1 |
benzin, damp-genudvindings-; lavtkogende nafta; [en sammensat blanding af carbonhydrider separeret fra gasserne fra dampgenvindingssystemer ved afkøling. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 196 oC.] |
271-025-4 |
68514-15-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-270-00-7 |
benzin, straight-run topanlægs; lavtkogende nafta; [en sammensat blanding af carbonhydrider fremstillet fra topanlægget ved destillation af råolie. Den har et kogeinterval omtrent fra 36,1 oC til 193,3 oC.] |
271-727-0 |
68606-11-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-271-00-2 |
naphtha (råolie), ikke-sweetenet; [en sammensat blanding af carbonhydrider fremstillet ved destillation af naphthastrømme fra forskellige raffinaderiprocesser. Den består af carbonhydrider, overvejende C5 til og med C12, med kogeinterval omtrent fra 0 oC til 230 oC.] |
272-186-3 |
68783-12-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-272-00-8 |
destillater (råolie), fraktionering af let straight-run benzin stabilizertopfraktioner; lavtkogende nafta; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af let straight-run benzin. Den består af mættede aliphatiske carbonhydrider, overvejende C3 til og med C6.] |
272-931-2 |
68921-08-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-273-00-3 |
naphtha (råolie), tung straight-run-, aromatholdig; lavtkogende nafta; [en sammensat blanding af carbonhydrider opnået ved en destillationsproces af rå råolie. Den består overvejende af carbonhydrider, overvejende C8 til og med C12, med kogeinterval omtrent fra 130 oC til 210 oC.] |
309-945-6 |
101631-20-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-274-00-9 |
naphtha (råolie), full-range alkylat-; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra reaktionen mellem isobutan og monoolefiniske carbonhydrider, sædvanligvis C3 til og med C5. Den består af overvejende forgrenede, mættede carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 220 oC.] |
265-066-7 |
64741-64-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-275-00-4 |
naphtha (råolie), tung alkylat-; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra reaktionen mellem isobutan og monoolefiniske carbonhydrider, sædvanligvis C3 til og med C5. Den består af overvejende forgrenede, mættede carbonhydrider, overvejende C9 til og med C12, med kogeinterval omtrent fra 150 oC til 220 oC.] |
265-067-2 |
64741-65-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-276-00-X |
naphtha (råolie), let alkylat-; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra reaktionen mellem isobutan og monoolefiniske carbonhydrider, sædvanligvis C3 til og med C5. Den består af overvejende forgrenede, mættede carbonhydrider, overvejende C7 til og med C10, med kogeinterval omtrent fra 90 oC til 160 oC.] |
265-068-8 |
64741-66-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-277-00-5 |
naphtha (råolie), isomeriserings-; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået ved en katalytisk isomerisering af ligekædede paraffincarbonhydrider, C4 til og med C6. Den består overvejende af mættede carbonhydrider, såsom isobutan, isopentan, 2,2-dimethylbutan, 2-methylpentan og 3-methylpentan.] |
265-073-5 |
64741-70-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-278-00-0 |
naphtha (råolie), solventraffineret let; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består overvejende af aliphatiske carbonhydrider, overvejende C5 til og med C11, med kogeinterval omtrent fra 35 oC til 190 oC.] |
265-086-6 |
64741-84-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-279-00-6 |
naphtha (råolie), solventraffineret, tung; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består overvejende af aliphatiske carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 230 oC.] |
265-095-5 |
64741-92-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-280-00-1 |
raffinater (råolie), katalytisk reformer ethylenglycol-vand modstrømsekstrakter; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået som raffinatet fra UDEX-ekstraktionsprocessen af den katalytiske reformerstrøm. Den består af mættede carbonhydrider, overvejende C6 til og med C9.] |
270-088-5 |
68410-71-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-281-00-7 |
raffinater (råolie), reformer-, Lurgi-enhedsseparerede; lavtkogende modificeret nafta; [den sammensatte blanding af carbonhydrider opnået som et raffinat fra en Lurgi-separationsenhed. Den består overvejende af ikke-aromatiske carbonhydrider med varierende små mængder aromatiske carbonhydrider, overvejende C6 til og med C8.] |
270-349-3 |
68425-35-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-282-00-2 |
naphtha (råolie), full-range-alkylat-, butanholdig; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra reaktion mellem isobutan og monoolefiniske carbonhydrider, sædvanligvis C3 til og med C5. Den består af overvejende forgrenede, mættede carbonhydrider, overvejende C7 til og med C12, med nogle butaner, med kogeinterval omtrent fra 35 oC til 200 oC.] |
271-267-0 |
68527-27-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-283-00-8 |
destillater (råolie), naphthadampkrakningsudvundne, solventraffinerede lette hydrogenbehandlede; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået som raffinaterne fra en solventekstraktionsproces af et hydrogenbehandlet let destillat fra dampkrakket naphtha.] |
295-315-5 |
91995-53-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-284-00-3 |
naphtha (råolie), C4-12 butanalkylat, isooctan-rig; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået ved alkylering af butaner. Den består overvejende af carbonhydrider, overvejende C4 til og med C12, rig på isooctan, med kogeinterval omtrent fra 35 oC til 210 oC.] |
295-430-0 |
92045-49-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-285-00-9 |
carbonhydrider, hydrogenbehandlede, lette naphthadestillater, solventraffinerede; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået fra destillationen af hydrogenbehandlet naphtha, efterfulgt af en solventekstraktions- og destillationsproces. Den består overvejende af mættede carbonhydrider, med kogeinterval omtrent fra 94 oC til 99 oC.] |
295-436-3 |
92045-55-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-286-00-4 |
naphtha (råolie), isomerisation, C6-fraktion; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af en benzin, der er blevet katalytisk isomeriseret. Den består overvejende af hexanisomerer med kogeinterval omtrent fra 60 oC til 66 oC.] |
295-440-5 |
92045-58-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-287-00-X |
carbonhydrider, C6-7 naphthakraknings-, solventraffinerede; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået ved sorptionen af benzen fra en katalytisk, fuldt hydrogeneret, benzen-rig carbonhydridfraktion, opnået ved destillation af præhydrogeneret, krakket naphtha. Den består overvejende af paraffin- og naphthencarbonhydrider, overvejende C6 til og med C7, med kogeinterval omtrent fra 70 oC til 100 oC.] |
295-446-8 |
92045-64-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-288-00-5 |
carbonhydrider, C6-rige, hydrogenbehandlede lette naphthadistillater, solvent-raffinerede; lavtkogende modificeret nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af hydrogenbehandlet naphtha efterfulgt af solventekstraktion. Den består overvejende af mættede carbonhydrider, med kogeinterval omtrent fra 65 oC til 70 oC.] |
309-871-4 |
101316-67-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-289-00-0 |
naphtha (råolie), tung, katalytisk krakket; lavtkogende katalytisk krakket nafta: [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 65 oC til 230 oC. Den indeholder en forholdsvis stor del umættede carbonhydrider.] |
265-055-7 |
64741-54-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-290-00-6 |
naphtha (råolie), let katalytisk krakket; lavtkogende katalytisk krakket nafta: [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 190 oC. Den indeholder en forholdsvis stor del umættede carbonhydrider.] |
265-056-2 |
64741-55-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-291-00-1 |
carbonhydrider, C3-11-, katalytisk krakkerdestillater; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C3 til og med C11, og koger omtrent op til 204 oC.] |
270-686-6 |
68476-46-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-292-00-7 |
naphtha (råolie), katalytisk krakket let destilleret; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C1 til og med C5.] |
272-185-8 |
68783-09-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-293-00-2 |
destillater (råolie), naphthadampkrakningsudvundne, hydrogenbehandlede, lette, aromatiske; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider opnået ved at behandle et let destillat fra dampkrakket naphtha. Den består overvejende af aromatiske carbonhydrider.] |
295-311-3 |
91995-50-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-294-00-8 |
naphtha (råolie), tung katalytisk krakket sweetened; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider opnået ved at underkaste et katalytisk krakket råoliedestillat en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 60 oC til 200 oC.] |
295-431-6 |
92045-50-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-295-00-3 |
naphtha (råolie), let katalytisk krakket sweetenet; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider, opnået ved at underkaste naphtha fra en katalytisk krakningsproces en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af carbonhydrider med kogeinterval omtrent fra 35 oC til 210 oC.] |
295-441-0 |
92045-59-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-296-00-9 |
carbonhydrider, C8-12 katalytisk kraknings-, kemisk neutraliserede; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af en fraktion fra den katalytiske krakningsproces, der er undergået en alkalisk vask. Den består overvejende af carbonhydrider, overvejende C8 til og med C12, med kogeinterval omtrent fra 130 oC til 210 oC.] |
295-794-0 |
92128-94-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-297-00-4 |
carbonhydrider, C8-12- katalytisk krakkerdestillater; lavtkogende katalytisk krakket nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af produkter fra en katalytisk krakningsproces. Den består overvejende af carbonhydrider, overvejende C8 til og med C12, med kogeinterval omtrent fra 140 oC til 210 oC.] |
309-974-4 |
101794-97-2 |
Carc. 1B Muta. 1B A Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-298-00-X |
carbonhydrider, C8-12 katalytisk kraknings-, kemisk neutraliserede, sweetenede; lavtkogende katalytisk krakket nafta |
309-987-5 |
101896-28-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-299-00-5 |
naphtha (råolie), let katalytisk reformeret; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en katalytisk reformeringsproces. Den består af carbonhydrider, overvejende C5 til og med C11, med kogeinterval omtrent fra 35 oC til 190 oC. Den indeholder en forholdsvis stor del aromatiske og forgrenede carbonhydrider. Denne strøm kan indeholde 10 volumenprocent eller mere benzen.] |
265-065-1 |
64741-63-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-300-00-9 |
naphtha (råolie), tung katalytisk reformeret; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en katalytisk reformeringsproces. Den består af overvejende aromatiske carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 230 oC.] |
265-070-9 |
64741-68-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-301-00-4 |
destillater (råolie), katalytisk reformerede depentanizer-; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider fra destillationen af produkterne fra en katalytisk reformeringsproces. Den består overvejende af aliphatiske carbonhydrider, overvejende C3 til og med C6, med kogeinterval omtrent fra - 49 oC til 63 oC.] |
270-660-4 |
68475-79-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-302-00-X |
carbonhydrider, C2-6-, C6-8- katalytisk reformer; lavtkogende katalytisk reformeret nafta |
270-687-1 |
68476-47-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-303-00-5 |
rester (råolie), C6-8-, katalytisk reformer; lavtkogende katalytisk reformeret nafta; [en sammensat remanens fra den katalytiske reformering af C6-8-føde. Den består af carbonhydrider, overvejende C2 til og med C6.] |
270-794-3 |
68478-15-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-304-00-0 |
naphtha (råolie), let katalytisk reformeret, aromatfri; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra en katalytisk reformeringsproces. Den består overvejende af carbonhydrider, overvejende C5 til og med C8, med kogeinterval omtrent fra 35 oC til 120 oC. Den indeholder en forholdsvis stor del forgrenede carbonhydrider, hvorfra de aromatiske komponenter er fjernet.] |
270-993-5 |
68513-03-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-305-00-6 |
destillater (råolie), katalytisk reformeret straight-run naphtha topfraktioner; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider opnået ved den katalytiske reformering af straight-run naphtha, efterfulgt af fraktionering af det totale udløb. Den består af mættede, aliphatiske carbonhydrider, overvejende C2 til og med C6.] |
271-008-1 |
68513-63-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-306-00-1 |
råolieprodukter, hydrofiner-powerformer reformater; lavtkogende katalytisk reformeret nafta; [den sammensatte blanding af carbonhydrider, opnået ved en hydrofiner-powerformer-proces, med kogeinterval omtrent fra 27 oC til 210 oC.] |
271-058-4 |
68514-79-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-307-00-7 |
naphtha (råolie), full-range reformeret; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en katalytisk reformeringsproces. Den består af carbonhydrider, overvejende C5 til og med C12, med kogeinterval omtrent fra 35 oC til 230 oC.] |
272-895-8 |
68919-37-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-308-00-2 |
naphtha (råolie), katalytisk reformeret; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkter fra en katalytisk reformeringsproces. Den består af carbonhydrider, overvejende C4 til og med C12, med kogeinterval omtrent fra 30 oC til 220 oC. Den indeholder en forholdsvis stor del aromatiske og forgrenede carbonhydrider. Denne strøm kan indeholde 10 volumenprocent, eller mere, benzen.] |
273-271-8 |
68955-35-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-309-00-8 |
destillater (råolie), katalytiske reformerede hydrogenbehandlede lette, C8-12-aromatfraktion; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af alkylbenzener opnået ved katalytisk reformering af råolienaphta. Den består overvejende af alkylbenzener, overvejende C8 til og med C10, med kogeinterval omtrent fra 160 oC til 180 oC.] |
285-509-8 |
85116-58-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-310-00-3 |
aromatiske carbonhydrider, C8-, katalytisk reformeringsudvundne; lavtkogende katalytisk reformeret nafta |
295-279-0 |
91995-18-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-311-00-9 |
aromatiske carbonhydrider, C7-12, C8-rige; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider opnået ved separation fra den platformatholdige fraktion. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til og med C12 (primært C8) og kan indeholde ikke-aromatiske carbonhydrider, begge med kogeinterval omtrent fra 130 oC til 200 oC.] |
297-401-8 |
93571-75-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-312-00-4 |
benzin, C5-11-, højoktan stabiliseret reformeret; lavtkogende katalytisk reformeret nafta; [en sammensat højoktanblanding af carbonhydrider opnået ved katalytisk dehydrogenering af en overvejende naphthenisk naphtha. Den består overvejende af aromater og ikke-aromater, overvejende C5 til og med C11, med kogeinterval omtrent fra 45 oC til 185 oC.] |
297-458-9 |
93572-29-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-313-00-X |
carbonhydrider, C7-12-, C>9-aromatrige, reformering, tung fraktion; lavtkogende katalytisk reformeret nafta [en sammensat blanding af carbonhydrider opnået ved separation fra den platformatholdige fraktion. Den består overvejende af ikke-aromatiske carbonhydrider, overvejende C7 til og med C12, med kogeinterval 120 oC til 210 oC, samt C9 og højere aromatiske carbonhydrider.] |
297-465-7 |
93572-35-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-314-00-5 |
carbonhydrider, C5-11-, ikke-aromatrige, reformering, let fraktion; lavtkogende katalytisk reformeret nafta; [en sammensat blanding af carbonhydrider opnået ved separation fra den platformatholdige fraktion. Den består overvejende af ikke-aromatiske carbonhydrider, overvejende C5 til og med C11, med kogeinterval omtrent fra 35 oC til 125 oC, samt benzen og toluen.] |
297-466-2 |
93572-36-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-315-00-0 |
Foot's oil (råolie), kiselsyrebehandlet; solventekstraherede eller afvoksede tunge restolier; [en sammensat blanding af carbonhydrider opnået ved behandlingen af Foots oil med kiselsyre for at fjerne sporbestandele og urenheder. Den består overvejende af mættede ligekædede carbonhydrider, overvejende større end C12.] |
308-127-6 |
97862-77-6 |
Carc. 1B |
H350 H304 |
GHS08 Dgr |
H350 H304 |
|
|
L |
|
649-316-00-6 |
naphtha (råolie), let termisk krakket; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en termisk krakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C4 til og med C8, med kogeinterval omtrent fra - 10 oC til 130 oC.] |
265-075-6 |
64741-74-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-317-00-1 |
naphtha (råolie), tung termisk krakket; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en termisk krakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 65 oC til 220 oC.] |
265-085-0 |
64741-83-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-318-00-7 |
destillater (råolie), tunge aromatiske; lavtkogende termisk krakket nafta; [den sammensatte blanding af carbonhydrider opnået ved destillationen af produkterne fra den termiske krakning af ethan og propan. Denne højerekogende fraktion består overvejende af aromatiske C5-7-carbonhydrider med nogle umættede aliphatiske carbonhydrider, overvejende C5. Denne strøm kan indeholde benzen.] |
267-563-4 |
67891-79-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-319-00-2 |
destillater (råolie), lette aromatiske; lavtkogende termisk krakket nafta; [den sammensatte blanding af carbonhydrider opnået ved destillationen af produkterne fra den termiske krakning af ethan og propan. Denne laverekogende fraktion består overvejende af aromatiske C5-7-carbonhydrider med nogle umættede aliphatiske carbonhydrider, overvejende C5. Denne strøm kan indeholde benzen.] |
267-565-5 |
67891-80-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
HS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-320-00-8 |
destillater (råolie), naphtha- og raffinatpyrolysatafledte, benzinblanding; lavtkogende termisk krakket nafta; [den sammensatte blanding af carbonhydrider opnået ved pyrolysefraktionering ved 816 oC af naphtha og raffinat. Den består overvejende af C9-carbonhydrider og koger omtrent ved 204 oC.] |
270-344-6 |
68425-29-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-321-00-3 |
aromatiske carbonhydrider, C6-8-, naphtha- og raffinatpyrolysatafledte; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider opnået ved fraktioneringspyrolyse ved 816 oC af naphtha og raffinat. Den består overvejende af aromatiske carbonhydrider, overvejende C6 til og med C8, herunder benzen.] |
270-658-3 |
68475-70-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-322-00-9 |
destillater (råolie), termisk krakket naphtha og gasolie; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af termisk krakket naphtha og/eller gasolie. Den består overvejende af olefincarbonhydrider, C5, med kogeinterval omtrent fra 33 oC til 60 oC.] |
271-631-9 |
68603-00-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-323-00-4 |
destillater (råolie), termisk krakket naphtha og gasolie, C5-dimer-holdige; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved den ekstraktive destillation af termisk krakket naphtha og/eller gasolie. Den består overvejende af C5-carbonhydrider med nogle dimeriserede C5-olefiner, og har kogeinterval omtrent fra 33 oC til 184 oC.] |
271-632-4 |
68603-01-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-324-00-X |
destillater (råolie), termisk krakket naphtha og gasolie, ekstraktive; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved den ekstraktive destillation af termisk krakket naphtha og/eller gasolie. Den består af paraffin og olefincarbonhydrider, overvejende isoamylener, såsom 2-methyl-1-buten og 2-methyl-2-buten, med kogeinterval omtrent fra 31 oC til 40 oC.] |
271-634-5 |
68603-03-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-325-00-5 |
destillater (råolie), lette termisk krakkede, debutaniserede aromatiske; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en termisk krakningsproces. Den består overvejende af aromatiske carbonhydrider, primært benzen.] |
273-266-0 |
68955-29-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-326-00-0 |
naphtha (råolie), let termisk krakket sweetenet; lavtkogende termisk krakket nafta; [en sammensat blanding af carbonhydrider opnået ved at underkaste et råoliedestillat fra højtemperaturtermisk krakning af tunge oliefraktioner en sweetening-proces for at omdanne mercaptaner. Den består overvejende af aromater, olefiner og mættede carbonhydrider med kogeinterval omtrent fra 20 oC til 100 oC.] |
295-447-3 |
92045-65-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-327-00-6 |
naphtha (råolie), hydro- genbehandlet tung; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C6 til og med C13, med kogeinterval omtrent fra 65 oC til 230 oC.] |
265-150-3 |
64742-48-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-328-00-1 |
naphtha (råolie), hydro- genbehandlet let; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 190 oC.] |
265-151-9 |
64742-49-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-329-00-7 |
naphtha (råolie), hydro- afsvovlet let; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved en katalytisk hydroafsvovlingsproces. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 190 oC.] |
265-178-6 |
64742-73-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-330-00-2 |
naphtha (råolie), hydro- afsvovlet tung; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved en katalytisk hydroafsvovlningsproces. Den består af carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 230 oC.] |
265-185-4 |
64742-82-1 |
Carc. 1B Muta. 1B STOT RE 1 Asp. Tox. 1 |
H350 H340 H372 (centralnervesystem) H304 |
GHS08 Dgr |
H350 H340 H372 (centralnervesystem) H304 |
|
|
P |
|
649-331-00-8 |
destillater (råolie), hydrogenbehandlede middeltunge, intermediært kogende; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved destillationen af produkter fra en hydrogenbehandlingsproces af middeltunge destillater. Den består af carbonhydrider, overvejende C5 til og med C10, med kogeinterval omtrent fra 127 oC til 188 oC.] |
270-092-7 |
68410-96-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-332-00-3 |
destillater (råolie), let destillat hydrogenbehandlingsproces-, lavtkogende; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved destillationen af produkter fra hydrogenbehandlingsprocessen af et let destillat. Den består af carbonhydrider, overvejende C6 til og med C9, med kogeinterval omtrent fra 3 oC til 194 oC.] |
270-093-2 |
68410-97-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-333-00-9 |
destillater (råolie), hydrogenbehandlet tung naphtha, deisohexanizer-topfraktioner; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra en hydrogenbehandlingsproces af tung naphtha. Den består af carbonhydrider, overvejende C3 til og med C6, med kogeinterval omtrent fra - 49 oC til 68 oC.] |
270-094-8 |
68410-98-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-334-00-4 |
solventnaphtha (råolie), let aromatisk, hydrogenbehandlet; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, overvejende C8 til og med C10, med kogeinterval omtrent fra 135 oC til 210 oC.] |
270-988-8 |
68512-78-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-335-00-X |
naphtha (råolie), hydroafsvovlet termisk krakket let; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved fraktionering af et hydroafsvovlet termisk krakket destillat. Den består overvejende af carbonhydrider, overvejende C5 til C11, med kogeinterval omtrent fra 23 oC til 195 oC.] |
285-511-9 |
85116-60-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-336-00-5 |
naphtha (råolie), hydrogenbehandlet let, cycloalkanholdig; lavtkogende hydrogeneret nafta; [en sammensat blanding af carbonhydrider opnået ved destillationen af en råoliefraktion. Den består overvejende af alkaner og cycloalkaner med kogeinterval omtrent fra - 20 oC til 190 oC.] |
285-512-4 |
85116-61-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-337-00-0 |
naphtha (råolie), tung dampkrakket, hydrogeneret; lavtkogende hydrogeneret nafta |
295-432-1 |
92045-51-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-338-00-6 |
naphtha (råolie), hydroafsvovlet full-range; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået ved en katalytisk hydroafsvovlingsproces. Den består overvejende af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra 30 oC til 250 oC.] |
295-433-7 |
92045-52-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-339-00-1 |
naphtha (råolie), hydrogenbehandlet let dampkrakket; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion, fremkommet ved en pyrolyseproces, med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af umættede carbonhydrider, overvejende C5 til og med C11, med kogeinterval omtrent fra 35 oC til 190 oC.] |
295-438-4 |
92045-57-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-340-00-7 |
carbonhydrider, C4-12 naphtha-krakning, hydrogenbehandelede; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af produktet fra en naphtha-dampkrakningsproces og efterfølgende selektiv katalytisk hydrogenering af gummidannere. Den består af carbonhydrider, overvejende C4 til og med C12, med kogeinterval omtrent fra 30 oC til 230 oC.] |
295-443-1 |
92045-61-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-341-00-2 |
solventnaphtha (råolie), hydrogenbehandlet let naphthen-; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af cycloparaffincarbonhydrider, overvejende C6 til og med C7, med kogeinterval omtrent fra 73 oC til 85 oC.] |
295-529-9 |
92062-15-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-342-00-8 |
naphtha (råolie), let dampkrakket, hydrogeneret; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved separation og efterfølgende hydrogenering af produkterne fra en dampkrakningsproces til fremstilling af ethylen. Den består overvejende af mættede og umættede paraffiner, cycliske paraffiner og cycliske aromatiske carbonhydrider, overvejende C4 til og med C10, med kogeinterval omtrent fra 50 oC til 200 oC. Andelen af benzencarbonhydrider kan være på til 30 vægtprocent, og strømmen kan også indeholde mindre mængder svovlforbindelser og oxygenerede forbindelser.] |
296-942-7 |
93165-55-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-343-00-3 |
carbonhydrider, C6-11-, hydrogenbehandlede, dearomatiserede; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået som solventer, der har været underkastet hydrogenbehandling for at omdanne aromater til naphthener ved katalytisk hydrogenering.] |
297-852-0 |
93763-33-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-344-00-9 |
carbonhydrider, C9-12-, hydrogenbehandlede, dearomatiserede; lavtkogende hydrogeneret naphtha; [en sammensat blanding af carbonhydrider opnået som solventer, der har været underkastet hydrogenbehandling for at omdanne aromater til naphthener ved katalytisk hydrogenering.] |
297-853-6 |
93763-34-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-345-00-4 |
mineralsk terpentin; lavtkogende uspecificeret naphtha; [et farveløst, raffineret råoliedestillat, der er fri for harske eller frastødende lugte, med kogeinterval omtrent fra 148,8 oC til 204,2 oC.] |
232-489-3 |
8052-41-3 |
Carc. 1B Muta. 1B STOT RE 1 Asp. Tox. 1 |
H350 H340 H372 (centralnervesystem) H304 |
GHS08 Dgr |
H350 H340 H372 (centralnervesystem) H304 |
|
|
P |
|
649-346-00-X |
naturgaskondensater (råolie); lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider adskilt som en væske fra naturgas i en overfladeseparator ved retrograd kondensation. Den består hovedsagelig af carbonhydrider, overvejende C2 til C20. Den er en væske ved atmosfærisk temperatur og tryk.] |
265-047-3 |
64741-47-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-347-00-5 |
naturgas (råolie), rå væskeblanding; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider adskilt som en væske fra naturgas i et gasgenanvendelsesanlæg ved sådanne processer som køling eller absorption. Den består hovedsagelig af mættede, aliphatiske carbonhydrider, C2 til og med C8.] |
265-048-9 |
64741-48-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-348-00-0 |
naphtha (råolie), let hydrokrakket; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en hydrokrakningsproces. Den består overvejende af mættede carbonhydrider, overvejende C4 til og med C10, med kogeinterval omtrent fra - 20 oC til 180 oC.] |
265-071-4 |
64741-69-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-349-00-6 |
naphtha (råolie), tung hydrokrakket; lavtkogende uspecificeret nafta; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en hydrokrakningsproces. Den består overvejende af mættede carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 65 oC til 230 oC.] |
265-079-8 |
64741-78-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-350-00-1 |
naphtha (råolie), sweetenet; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved at underkaste en råolienaphta en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består af carbonhydrider, overvejende C4 til og med C12, med kogeinterval omtrent fra - 10 oC til 230 oC.] |
265-089-2 |
64741-87-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-351-00-7 |
naphtha (råolie), syrebehandlet; lavtkogende uspecificeret nafta; [en sammensat blanding af carbonhydrider opnået som et raffinat fra en svovlsyrebehandlingsproces. Den består af carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 230 oC.] |
265-115-2 |
64742-15-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-352-00-2 |
naphtha (råolie), kemisk neutraliseret tung; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C6 til og med C12, med kogeinterval omtrent fra 65 oC til 230 oC.] |
265-122-0 |
64742-22-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-353-00-8 |
nphtha (råolie), kemisk neutraliseret let; lavtkogende uspecificeret naphtha; (en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 190 oC.] |
265-123-6 |
64742-23-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-354-00-3 |
naphtha (råolie), katalytisk afvokset; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved katalytisk afvoksning af en råoliefraktion. Den består overvejende af carbonhydrider, overvejende C5 til og med C12, med kogeinterval omtrent fra 35 oC til 230 oC.] |
265-170-2 |
64742-66-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-355-00-9 |
naphtha (råolie), let dampkrakket; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en dampkrakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 190 oC. Denne strøm indeholder sædvanligvis 10 volumenprocent, eller mere, benzen.] |
265-187-5 |
64742-83-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-356-00-4 |
solventnaphtha (råolie), let aromatisk; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af aromatiske strømme. Den består overvejende af aromatiske carbonhydrider, overvejende C8 til og med C10, med kogeinterval omtrent fra 135 oC til 210 oC.] |
265-199-0 |
64742-95-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-357-00-X |
aomatiske carbonhydrider, C6-10-, syrebehandlede, neutraliserede; lavtkogende uspecificeret naphtha |
268-618-5 |
68131-49-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-358-00-5 |
destillater (råolie), C3-5, 2-methyl-2-butenrige; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fra destillationen af carbonhydrider, sædvanligvis C3 til og med C5, overvejende isopentan og 3-methyl-1-buten. Den består af mættede og umættede carbonhydrider, C3 til og med C5, overvejende 2-methyl-2-buten.] |
270-725-7 |
68477-34-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-359-00-0 |
destillater (råolie), polymeriserede dampkrakkede råoliedestillater, C5-12-fraktion; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillationen af polymeriseret dampkrakket råoliedestillat. Den består overvejende af carbonhydrider, overvejende C5 til og med C12.] |
270-735-1 |
68477-50-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-360-00-6 |
destillater (råolie), dampkrakkede, C5-12-fraktion; lavtkogende uspecificeret naphtha; [en sammensat blanding af organiske forbindelser opnået ved destillationen af produkter fra en dampkrakningsproces. Den består af umættede carbonhydrider, overvejende C5 til og med C12.] |
270-736-7 |
68477-53-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-361-00-1 |
destillater (råolie), dampkrakkede, C5-10-fraktion, blandet med let dampkrakket råolienaphtha-C5-fraktion; lavtkogende uspecificeret naphtha |
270-738-8 |
68477-55-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-362-00-7 |
ekstrakter (råolie), koldsyre-, C4-6; lavtkogende uspecificeret naphtha; [en sammensat blanding af organiske forbindelser, fremstillet ved koldsyre-enhedsekstraktion af mættede og umættede, aliphatiske carbonhydrider, sædvanligvis C3 til og med C6, overvejende pentaner og amylener. Den består overvejende af mættede og umættede carbonhydrider, C4 til og med C6, overvejende C5.] |
270-741-4 |
68477-61-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-363-00-2 |
destillater (råolie), depentanizer- topfraktioner; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved en katalytisk krakket gasstrøm. Den består af aliphatiske carbonhydrider, overvejende C4 til og med C6.] |
270-771-8 |
68477-89-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-364-00-8 |
rester (råolie), butansplitter-bundfraktioner; lavtkogende uspecificeret naphtha; [en sammensat remanens fra destillationen af butanstrøm. Den består af aliphatiske carbonhydrider, overvejende C4 til og med C6.] |
270-791-7 |
68478-12-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-365-00-3 |
restolier (råolie), deisobutanizertårn-; lavtkogende uspecificeret naphtha; [en sammensat remanens fra den atmosfæriske destillation af butan-butylenstrømmen. Den består af aliphatiske carbonhydrider, overvejende C4 til og med C6.] |
270-795-9 |
68478-16-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-366-00-9 |
naphtha (råolie), full-range coker-; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en væske-coker. Den består overvejende af umættede carbonhydrider, overvejende C4 til og med C15, med kogeinterval omtrent fra 43 oC til 250 oC.] |
270-991-4 |
68513-02-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-367-00-4 |
naphtha (råolie), dampkrakket middeltung aromatisk; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en dampkrakningsproces. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra - 130 oC til 220 oC.] |
271-138-9 |
68516-20-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-368-00-X |
naphtha (råolie), lerbehandlet full-range straight-run; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremkomet ved behandling af full-range straight-run naphtha med naturligt eller modificeret ler, sædvanligvis i en perkoleringsproces til fjernelse af spormængderne af polære forbindelser og urenheder. Den består af carbonhydrider, overvejende C4 til og med C11, med kogeinterval omtrent fra - 20 oC til 220 oC.] |
271-262-3 |
68527-21-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-369-00-5 |
naphtha (råolie), lerbehandlet let straight-run; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremkommet ved behandling af let straight-run naphtha med naturligt eller modificeret ler, sædvanligvis i en perkoleringsproces til fjernelse af spormængderne af polære forbindelser og urenheder. Den består af carbonhydrider, overvejende C7 til og med C10, med kogeinterval omtrent fra 93 oC til 180 oC.] |
271-263-9 |
68527-22-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-370-00-0 |
naphtha (råolie), let dampkrakket aromatisk; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en dampkrakningsproces. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til og med C9, med kogeinterval omtrent fra 110 oC til 165 oC.] |
271-264-4 |
68527-23-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-371-00-6 |
naphtha (råolie), let dampkrakket, afbenzeneret; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkterne fra en dampkrakningsproces. Den består overvejende af carbonhydrider, overvejende C4 til og med C12, med kogeinterval omtrent fra 80 oC til 218 oC.] |
271-266-5 |
68527-26-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-372-00-1 |
naphtha (råolie), aromatholdig; lavtkogende uspecificeret naphtha |
271-635-0 |
68603-08-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-373-00-7 |
benzin, pyrolyse-, debutanizer-bundfraktioner; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af depropanizer-bundfraktioner. Den består af carbonhydrider, overvejende større end C5.] |
271-726-5 |
68606-10-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-374-00-2 |
naphtha (råolie), let sweetenet; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider, opnået ved at underkaste et råoliedestillat en sweeteningsproces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af mættede og umættede carbonhydrider, overvejende C3 til og med C6, med kogeinterval omtrent fra - 20 oC til 100 oC.] |
272-206-0 |
68783-66-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-375-00-8 |
naturgaskondensater; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider, som er separeret og/eller kondenseret fra naturgas under transport, og som opsamles ved borehullet og/eller fra produktions, opsamlings-, transmissions- og distributionspipelines i undergrunden, skrubbere etc. Den består overvejende af carbonhydrider, overvejende C2 til og med C8.] |
272-896-3 |
68919-39-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-376-00-3 |
destillater (råolie), naphtaunifiner stripper-; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider fremstillet ved stripning af produkterne fra naphthaunifineren. Den består af mættede, aliphatiske carbonhydrider, overvejende C2 til og med C6.] |
272-932-8 |
68921-09-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-377-00-9 |
naphtha (råolie), katalytisk reformeret let, aromatfri fraktion; lavtkogende uspecificeret naphtha; |
285-510-3 [en sammensat blanding af carbonhydrider tilbageblevet efter fjernelse af aromatiske forbindelser fra katalytisk reformeret let naphta i en selektiv absorptionsproces. Den består overvejende af paraffiniske og cycliske forbindelser, overvejende C5 til C8, med kogeinterval omtrent fra 66 oC til 121 oC.] |
85116-59-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-378-00-4 |
benzin; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider bestående primært af paraffiner, cycloparaffiner, aromatiske og olefiniske carbonhydrider, overvejende større end C3, og med kogeinterval fra 30 oC til 260 oC.] |
289-220-8 |
86290-81-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-379-00-X |
aromatiske carbonhydrider, C7-8-, dealkyleringsprodukter, destillationsrester; lavtkogende uspecificeret naphtha |
292-698-0 |
90989-42-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-380-00-5 |
carbonhydrider, C4-6-, depentanizer lette, aromatisk hydrogenbehandling; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået som det første gennemløb fra depentanizerkolonnen før hydrogenbehandling af de aromatiske charger. Den består overvejende af carbonhydrider, overvejende C4 til og med C6, overvejende pentaner og pentener, med kogeinterval omtrent fra 25 oC til 40 oC.] |
295-298-4 |
91995-38-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-381-00-0 |
destillater (råolie), varmeudblødt dampkrakket naphtha, C5-rige; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af varmeudblødt dampkrakket naphtha. Den består overvejende af carbonhydrider, C4 til og med C6, overvejende C5.] |
295-302-4 |
91995-41-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-382-00-6 |
ekstrakter (råolie), katalytisk reformeret let naphtha solvent-; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået som ekstraktet fra solventekstraktionen af en katalytisk reformeret råoliefraktion. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til og med C8, med kogeinterval omtrent fra 100 oC til 200 oC.] |
295-331-2 |
91995-68-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-383-00-1 |
naphtha (råolie), hydroafsvovlet let, dearomatiseret; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af hydroafsvovlede og dearomatiserede lette råoliefraktioner. Den består overvejende af C7-paraffiner og cycloparaffiner med kogeinterval omtrent fra 90 oC til 100 oC.] |
295-434-2 |
92045-53-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-384-00-7 |
naphtha (råolie), let, C5-rig, sweetenet; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved at underkaste en råolienaphtha en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består af carbonhydrider, overvejende C4 til og med C5, overvejende C5, med kogeinterval omtrent fra - 10 oC til 35 oC.] |
295-442-6 |
92045-60-8 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-385-00-2 |
carbonhydrider, C8-11-, naphtha-krakning, toluenfraktion; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation fra præhydrogeneret, krakket naphtha. Den består overvejende af carbonhydrider, overvejende C8 til og med C11, med kogeinterval omtrent fra 130 oC til 205 oC.] |
295-444-7 |
92045-62-0 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-386-00-8 |
carbonhydrider, C4-11-, naphtha-krakning, aromatfrie; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået fra præhydrogeneret, krakket naphtha efter destillativ separation af benzen- og toluenholdige carbonhydridfraktioner og en højerekogende fraktion. Den består overvejende af carbonhydrider, overvejende C4 til og med C11 med kogeinterval omtrent fra 30 oC til 205 oC.] |
295-445-2 |
92045-63-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-387-00-3 |
naphtha (råolie), let varmeudblødt, dampkrakket; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved fraktioneringen af dampkrakket] naphtha efter genindvinding fra en varmeudblødningsproces. Den består overvejende af carbonhydrider, overvejende C4 til og med C6, med kogeinterval omtrent fra 0 oC til 80 oC.] |
296-028-8 |
92201-97-3 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-388-00-9 |
destillater (råolie), C6-rige; Lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af råolieføde. Den består af carbonhydrider, overvejende C5 til og med C7, rig på C6, med kogeinterval omtrent fra 60 oC til 70 oC.] |
296-903-4 |
93165-19-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-389-00-4 |
benzin, pyrolyse-, hydrogeneret; lavtkogende uspecificeret naphtha; [en destillationsfraktion fra hydrogeneringen af pyrolysebenzin med kogeinterval omtrent fra 20 oC til 200 oC.] |
302-639-3 |
94114-03-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-390-00-X |
destillater (råolie), dampkrakkede, C8-12-fraktion, polymeriserede, lette destillationsfraktioner; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af den polymeriserede C8 til og med C12-fraktion fra dampkrakkede råoliedestillater. Den består overvejende af aromatiske carbonhydrider, overvejende C8 til og med C12.] |
305-750-5 |
95009-23-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-391-00-5 |
ekstrakter (råolie), tunge naphthasolvent-, lerbehandlede; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved behandlingen af tung naphthasolventråolieekstrakt med blegejord. Består overvejende af carbonhydrider, overvejende C6 til og med C10, med kogeinterval omtrent fra 80 oC til 180 oC.] |
308-261-5 |
97926-43-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-392-00-0 |
naphtha (råolie), let dampkrakket, debenzeneret, termisk behandlet; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved behandling og destillation af debenzeneret, let dampkrakket råolienaphtha. Den består overvejende af carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 95 oC til 200 oC.] |
308-713-1 |
98219-46-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-393-00-6 |
naphtha (råolie), let dampkrakket, termisk behandlet; lavtkogende uspecificeret naphtha; [en sammensat blanding af [en sammensat blanding af carbonhydrider opnået ved behandling og destillation af let dampkrakket råolienaphtha. Den består overvejende af carbonhydrider, overvejende C5 til og med C6, med kogeinterval omtrent fra 35 oC til 80 oC.] |
308-714-7 |
98219-47-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-394-00-1 |
destillater (råolie), C7-9 , C8-rige, hydroafsvovlede dearomatiserede; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af en let råoliefraktion, hydroafsvovlet og dearomatiseret. Den består overvejende af carbonhydrider, C7 til og med C9, overvejende C8 paraffiner og cycloparaffiner, med kogeinterval omtrent fra 120 oC til 130 oC.] |
309-862-5 |
101316-56-7 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-395-00-7 |
carbonhydrider, C6-8-, hydrogenerede sorption-dearomatiserede, toluenraffinering; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået under sorptionen af toluen fra en carbonhydridfraktion fra krakket benzin, der er behandlet med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende C6 til og med C8, med kogeinterval omtrent fra 80 oC til 135 oC.] |
309-870-9 |
101316-66-9 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-396-00-2 |
naphtha (råolie), hydroafsvovlet full-range coker-; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved fraktionering af hydroafsvovlet cokerdestillat. Den består overvejende af carbonhydrider, overvejende C5 til og med C11, med kogeinterval omtrent fra 23 oC til 196 oC.] |
309-879-8 |
101316-76-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-397-00-8 |
naphtha (råolie), sweetenet let; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved at underkaste en råolienaphtha en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af carbonhydrider, overvejende C5 til og med C8, med kogeinterval omtrent fra 20 oC til 130 oC.] |
309-976-5 |
101795-01-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-398-00-3 |
carbonhydrider, C3-6-, C5-rige, dampkrakket naphtha; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af dampkrakket naphtha. Den består overvejende af carbonhydrider, C3 til og med C6, overvejende C5.] |
310-012-0 |
102110-14-5 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-399-00-9 |
carbonhydrider, C5-rige, dicyclopentadienholdige; lavtkogende uspecificeret nafta; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra en dampkrakningsproces. Den består overvejende af, C5 carbonhydrider og dicyclopentadien, med kogeinterval omtrent fra 30 oC til 170 oC.] |
310-013-6 |
102110-15-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-400-00-2 |
rester (råolie), dampkrakkede lette, aromatiske; lavtkogende uspecificeret naphtha; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra dampkrakning eller lignende processer, efter fjernelse af de meget lette produkter, resulterende i en rest begyndende med C>5-carbonhydrider. Den består overvejende af aromatiske carbonhydrider, større end C5, med kogepunkt over omtrent 40 oC.]. |
310-057-6 |
102110-55-4 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-401-00-8 |
carbonhydrider, C5-, C5-6-rige; lavtkogende uspecificeret naphtha |
270-690-8 |
68476-50-6 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-402-00-3 |
carbonhydrider, C5-rige; lavtkogende uspecificeret naphtha |
270-695-5 |
68476-55-1 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-403-00-9 |
aromatiske carbonhydrider, C8-10; lavtkogende uspecificeret naphtha |
292-695-4 |
90989-39-2 |
Carc. 1B Muta. 1B Asp. Tox. 1 |
H350 H340 H304 |
GHS08 Dgr |
H350 H340 H304 |
|
|
P |
|
649-404-00-4 |
petroleum (råolie); straight-run, petroleum; [en sammensat blanding af carbonhydrider fremstillet ved destillation af råolie. Den består af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 150 oC til 290 oC.] |
232-366-4 |
8008-20-6 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-405-00-X |
solventnaphtha (råolie), middeltung aliphatisk; straight run petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af råolie eller naturgaskondensat. Den består overvejende af mættede carbonhydrider, overvejende C9 til og med C12, med kogeinterval omtrent fra 140 oC til 220 oC.] |
265-191-7 |
64742-88-7 |
STOT RE 1 Asp. Tox. 1 |
H372 (centralnervesystem) H304 |
GHS08 Dgr |
H372 (centralnervesystem) H304 |
|
|
|
|
649-406-00-5 |
solventnaphtha (råolie), tung aliphatisk; straight run petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af råolie eller naturgaskondensat. Den består overvejende af mættede carbonhydrider, overvejende C11 til og med C16, med kogeinterval omtrent fra 190 oC til 290 oC.] |
265-200-4 |
64742-96-7 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-407-00-0 |
petroleum (råolie); straight-run bred fraktion; straight run petroleum; [en sammensat blandning af carbonhydrider, opnået som en bred fraktion fra atmosfærisk destillation fra en carbonhydridbrændselsfraktion, med kogeinterval omtrent fra 70 oC til 220 oC.] |
295-418-5 |
92045-37-9 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-408-00-6 |
destillater (råolie), dampkrakkede; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra en dampkrakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C7 til og med C16, med kogeinterval omtrent fra 90 oC til 290 oC.] |
265-194-3 |
64742-91-2 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-409-00-1 |
destillater (råolie), krakkede strippede dampkrakkede råoliedestillater, C8-10-fraktion; krakket petroleum; [en sammensat blanding af carbonhydrider, opnået ved at destillere krakkede, strippede, dampkrakkede destillater. Den består af carbonhydrider, C8 til og med C10, med kogeinterval omtrent fra 129 oC til 194 oC.] |
270-728-3 |
68477-39-4 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-410-00-7 |
destillater (råolie), krakkede strippede dampkrakkede råoliedestillater, C10-12-fraktion; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved at destillere krakkede, strippede, dampkrakkede destillater. Den består overvejende af aromatiske carbonhydrider, C10 til og med C12.] |
270-729-9 |
68477-40-7 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-411-00-2 |
destillater (råolie), dampkrakkede, C8-12-fraktion; krakket petroleum; [en sammensat blanding af organiske forbindelser opnået ved destillationen af produkter fra en dampkrakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C8 til og med C12.] |
270-737-2 |
68477-54-3 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-412-00-8 |
petroleum (råolie), hydroafsvovlet termisk krakket; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved fraktionering af hydroafsvovlet termisk krakket destillat. Den består overvejende af carbonhydrider, overvejende C8 til C16, med kogeinterval omtrent fra 120 oC til 283 oC.] |
285-507-7 |
85116-55-8 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-413-00-3 |
aromatiske carbonhydrider, C≥10, dampkrakning, hydrogenbehandlede; krakket petroleum; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en dampkrakningsproces og behandling med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, overvejende større end C10, med kogeinterval omtrent fra 150 oC til 320 oC.] |
292-621-0 |
90640-98-5 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-414-00-9 |
naphtha (råolie), dampkrakket, hydrogenbehandlet, C9-10-aromatrig; krakket petroleum [en sammensat blanding af carbonhydrider opnået ved destillation af produkterne fra en dampkrakningsproces, efterfulgt af behandling med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, C9 til og med C10, med kogeinterval omtrent fra 140 oC til 200 oC.] |
292-637-8 |
90641-13-7 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-415-00-4 |
destillater (råolie), termisk krakkede, alkylaromat carbonhydrid-rige; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af termisk krakkede tunge tjærer. Den består overvejende af polyalkylerede aromatiske carbonhydrider, med kogeinterval omtrent fra 100 oC til 250 oC.] |
309-866-7 |
101316-61-4 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-416-00-X |
destillater (råolie), katalytisk krakket tung tjære, lette; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af katalytisk krakkede tunge tjærer. Den består overvejende af polyalkylerede aromatiske carbonhydrider, med kogeinterval omtrent fra 100 oC til 250 oC.] |
309-938-8 |
101631-13-4 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-417-00-5 |
solventnaphtha (råolie), hydrokrakket tung aromatisk; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved destillationen af hydrokrakket råoliedestillat. Den består overvejende af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 235 oC til 290 oC.] |
309-881-9 |
101316-80-7 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-418-00-0 |
destillater (råolie), dampkrakket tung tjære, lette; krakket petroleum; [en sammensat blanding af carbonhydrider opnået ved destillation af dampkrakkede tunge tjærer. Den består overvejende af polyalkylerede aromatiske carbonhydrider, med kogeinterval omtrent fra 100 oC til 250 oC.] |
309-940-9 |
101631-15-6 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-419-00-6 |
destillater (råolie), alkylat-; uspecificeret petroleum; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra reaktionen mellem isobutan og monoolefinske carbonhydrider, sædvanligvis C3 til og med C5. Den består af overvejende forgrenede, mættede carbonhydrider, overvejende C11 til og med C17, med kogeinterval omtrent fra 205 oC til 320 oC.] |
265-074-0 |
64741-73-7 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-420-00-1 |
ekstrakter (råolie), tung naphtha solvent-; uspecifeceret petroleum [en sammensat blanding af carbonhydrider opnået som ekstraktet fra en solventekstraktionsproces. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til og med C12, med kogeinterval omtrent fra 90 oC til 220 oC.] |
265-099-7 |
64741-98-6 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-421-00-7 |
destillater (råolie), kemisk neutraliserede lette; uspecificeret petroleum; [en sammensat blanding af carbonhydrider fremstillet ved en behandlingsproces til fjernelse af sure materialer. Den består af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 150 oC til 290 oC.] |
265-132-5 |
64742-31-0 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-422-00-2 |
destillater (råolie), hydrogenbehandlede lette; uspecifeceret petroleum [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 150 oC til 290 oC.] |
265-149-8 |
64742-47-8 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-423-00-8 |
petroleum (råolie), hydroafsvovlet; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået fra en rå råolie ved behandling med hydrogen for at omdanne organisk svovl til hydrogensulfid, der fjernes. Den består af carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 150 oC til 290 oC.] |
265-184-9 |
64742-81-0 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-424-00-3 |
solventnaphtha (råolie), let aromatisk; uspecifeceret petroleum [en sammensat blanding af carbonhydrider opnået ved destillation af aromatiske strømme. Den består overvejende af aromatiske carbonhydrider, overvejende C9 til og med C16, med kogeinterval omtrent fra 165 oC til 290 oC .] |
265-198-5 |
64742-94-5 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-425-00-9 |
naphtha (råolie), tung coker-; uspecificeret petroleum [en sammensat blanding af carbonhydrider fra destillationen af produkterne fra en væske-coker. Den består overvejende af umættede carbonhydrider, overvejende C6 til og med C15, med kongeinterval omtrent fra 157 oC til 288 oC.] |
269-778-9 |
68333-23-3 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-426-00-4 |
naphtha (råolie), katalytisk reformeret hydroafsvovlet tung, aromatfraktion; uspecificeret petroleum; [en sammensat blanding af carbonhydrider fremstillet ved fraktionering af katalytisk reformeret, hydroafsvovlet naphtha. Den består overvejende af aromatiske carbonhydrider, overvejende C7 til C13, med kogeinterval omtrent fra 98 oC til 218 oC.] |
285-508-2 |
85116-57-0 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-427-00-X |
petroleum (råolie), sweetenet; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået ved at underkaste et råoliedestillat en sweetening-proces for at omdanne mercaptaner eller fjerne sure urenheder. Den består overvejende af carbonhydrider, overvejende C9 til og med C16, med koge-interval omtrent fra 130 oC til 290 oC.] |
294-799-5 |
91770-15-9 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-428-00-5 |
petroleum (råolie), solventraffineret sweetenet; uspecificeret petroleum; [en sammensat blanding af carbonhydrider, opnået fra en rå råolie ved solventraffinering og sweetening, med kogeinterval omtrent fra 150 oC til 260 oC.] |
295-416-4 |
92045-36-8 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-429-00-0 |
carbonhydrider, C9-16-, hydrogenbehandlede, afaromatiserede; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået som solventer, der har været underkastet hydrogenbehandling for at omdanne aromater til naphthener ved katalytisk hydrogenering.] |
297-854-1 |
93763-35-0 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-430-00-6 |
petroleum (råolie), solvent-raffineret hydroafsvovlet; uspecificeret petroleum |
307-033-2 |
97488-94-3 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-431-00-1 |
destillater (råolie), hydroafsvovlede full-range middeltunge coker-; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået ved fraktionering fra hydroafsvovlet coker-destillat. Den består overvejende af carbonhydrider, overvejende C8 til og med C16, med kogeinterval omtrent fra 120 oC til 283 oC.] |
309-864-6 |
101316-58-9 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-432-00-7 |
solventnaphtha (råolie), hydroafsvovlet tung aromatisk; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået ved den katalytiske hydroafsvovling af en råoliefraktion. Den består overvejende af carbonhydrider, overvejende C10 til og med C13, med kogeinterval omtrent fra 180 oC til 240 oC.] |
309-882-4 |
101316-81-8 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-433-00-2 |
solventnaphtha (råolie), hydroafsvovlet middeltung; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået ved den katalytiske hydroafsvovling af en råoliefraktion. Den består overvejende af carbonhydrider, overvejende C10 til og med C13, med kogeinterval omtrent fra 175 oC til 220 oC.] |
309-884-5 |
101316-82-9 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-434-00-8 |
petroleum (råolie), hydrogenbehandlet; uspecificeret petroleum; [en sammensat blanding af carbonhydrider opnået ved destillationen af råolie og efterfølgende hydrogenbehandling. Den består overvejende af alkaner, cycloalkaner og alkylbenzener, overvejende C12 til og med C16, med kogeinterval omtrent fra 230 oC til 270 oC.] |
309-944-0 |
101631-19-0 |
Asp. Tox. 1 |
H304 |
GHS08 Dgr |
H304 |
|
|
|
|
649-435-00-3 |
destillater (råolie), lette katalytisk krakkede; krakket gasolie; [en sammensat blanding af carbonhydrider fremstillet ved destillationen af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C9 til og med C25, med kogeinterval omtrent fra 150 oC til 400 oC. Den indeholder en forholdsvis stor del bicycliske, aromatiske carbonhydrider.] |
265-060-4 |
64741-59-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-436-00-9 |
destillater (råolie), intermediære katalytisk krakkede; krakket gasolie; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkter fra en katalytisk krakningsproces. Den består af carbonhydrider, overvejende C11 til og med C30, med kogeinterval omtrent fra 205 oC til 450 oC. Den indeholder en forholdsvis stor del tricycliske, aromatiske carbonhydrider.] |
265-062-5 |
64741-60-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-437-00-4 |
destillater (råolie), lette hydrokrakkede; krakket gasolie; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en hydrokrakningsproces. Den består overvejende af mættede carbonhydrider, overvejende C10 til og med C18, med kogeinterval omtrent fra 160 oC til 320 oC.] |
265-078-2 |
64741-77-1 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
649-438-00-X |
destillater (råolie), lette termisk krakkede; krakket gasolie; [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en temisk krakningsproces. Den består overvejende af umættede carbonhydrider, overvejende C10 til og med C22, med kogeinterval omtrent fra 160 oC til 370 oC.] |
265-084-5 |
64741-82-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-439-00-5 |
destillater (råolie), hydroafsvovlede lette katalytisk krakkede; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved at behandle lette, katalytisk krakkede destillater med hydrogen for at omdanne organisk svovl til hydrogensulfid, som fjernes. Den består overvejende af carbonhydrider, overvejende C9 til og med C25, med kogeinterval omtrent fra 150 oC til 400 oC. Den indeholder en forholdsvis stor del bicycliske, aromatiske carbonhydrider.] |
269-781-5 |
68333-25-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-440-00-0 |
destillater (råolie), let dampkrakket naphtha; krakket gasolie; [en sammensat blanding af carbonhydrider fra den multiple destillation af produkter fra en dampkrakningsproces. Den består af carbonhydrider, overvejende C10 til og med C18.] |
270-662-5 |
68475-80-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-441-00-6 |
destillater (råolie), krakkede dampkrakkede råoliedestillater; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved at destillere et krakket dampkrakket destillat og/eller dets fraktioneringsprodukter. Den består af carbonhydrider, overvejende C10 til lavmolekylære polymerer.] |
270-727-8 |
68477-38-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-442-00-1 |
gasolier (råolie), dampkrakkede; krakket gasolie; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en dampkrakningsproces. Den består af carbonhydrider, overvejende større end C9, med kogeinterval omtrent fra 205 oC til 400 oC.] |
271-260-2 |
68527-18-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-443-00-7 |
destillater (råolie), hydroafsvovlede termisk krakkede middeltunge; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved fraktionering fra hydroafsvovlet, termiske krakkede destillatråstoffer. Den består overvejende af carbonhydrider, overvejende C11 til C25, med kogeinterval omtrent fra 205 oC til 400 oC.] |
285-505-6 |
85116-53-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-444-00-2 |
gasolier (råolie), termisk krakkende, hydrogenafsvovlede; krakket gasolie |
295-411-7 |
92045-29-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-445-00-8 |
rester (råolie), hydrogeneret dampkrakket naphtha; krakket gasolie; [en sammensat blanding af carbonhydrider opnået som en restfraktion fra destillation en af hydrogenbehandlet dampkrakket naphtha. Den består overvejende af carbonhydrider med kogeinterval omtrent fra 200 oC til 350 oC.] |
295-514-7 |
92062-00-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-446-00-3 |
rester (råolie), dampkrakkede naphthadestillations- krakket gasolie; [en sammensat blanding af carbonhydrider opnået som en kolonnebundfraktion fra separationen af udløb fra dampkrakning af naphtha ved høj temperatur. Den har kogeinterval omtrent fra 147 oC til 300 oC, og danner en færdig olie med en viskositet på 18cSt ved 50 oC.] |
295-517-3 |
92062-04-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-447-00-9 |
destillater (råolie), lette katalytisk krakkede, termisk nedbrudte; krakket gasolie; [en sammensat blanding af carbonhydrider fremstillet ved destillation af produkterne fra en katalytisk krakningsproces, der har været brugt som en varmeoverførselsvæske. Den består overvejende af carbonhydrider med kogeinterval omtrent fra 190 oC til 340 oC. Denne strøm indeholder sandsynligvis organiske svovlforbindelser.] |
295-991-1 |
92201-60-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-448-00-4 |
rester (råolie), dampkrakket varmeudblødt naphtha; krakket gasolie; [en sammensat blanding af carbonhydrider, opnået som rest fra destillationen af dampkrakket varmeudblødt naphtha, med koge-interval omtrent fra 150 oC til 350 oC.] |
297-905-8 |
93763-85-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-449-00-X |
carbonhydrider, C16-20, solvent-afvokset hydrokrakket paraffindestillationsrest krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved solventafvoksning af en destillationsrest fra et hydrokrakket paraffindestillat. Den består overvejende af carbonhydrider, overvejende fra C16 til og med C20, med kogeinterval omtrent fra 360 oC til 500 oC. Den danner en færdig olie med en viskositet på 4,5 cSt ved omtrent 100 oC.] |
307-662-2 |
97675-88-2 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
649-450-00-5 |
gasolier (råolie), lette vakuum-, termisk-krakkede hydroafsvovlede; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved katalytisk hydroafsvovling af termisk-krakket let vakuumråolie. Den består overvejende af carbonhydrider, overvejende C14 til og med C20, med kogeinterval omtrent fra 270 oC til 370 oC.] |
308-278-8 |
97926-59-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-451-00-0 |
destillater (råolie), hydroafsvovlede middeltunge coker-; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved fraktionering af hydroafsvovlede coker-destillat råstoffer. Den består overvejende af carbonhydrider, overvejende C12 til og med C21 med kogeinterval omtrent fra 200 oC til 360 oC.] |
309-865-1 |
101316-59-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-452-00-6 |
destillater (råolie), tunge dampkrakkede; krakket gasolie; [en sammensat blanding af carbonhydrider opnået ved dampkrakkede tunge rester. Den består overvejende af polyalkylerede tunge aromatiske carbonhydrider, med kogeinterval omtrent fra 250 oC til 400 oC.] |
309-939-3 |
101631-14-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
649-453-00-1 |
destillater (råolie), tunge hydrokrakkede; uspecificeret baseolie [en sammensat blanding af carbonhydrider fra destillation af produkterne fra en hydrokrakningsproces. Den består overvejende af mættede carbonhydrider, C15-C39, med kogeinterval omtrent fra 260 oC til 600 oC .] |
265-077-7 |
64741-76-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-454-00-7 |
destillater (råolie), solventraffinerede tunge paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består overvejende af mættede carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC.] |
265-090-8 |
64741-88-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-455-00-2 |
destillater (råolie), solventraffinerede lette paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstaktionsproces. Den består overvejende af mættede carbonhydrider, overvejende C15 til og med C30 og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC.] |
265-091-3 |
64741-89-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-456-00-8 |
restolier (råolie), solventafasfalterede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som den solventopløselige fraktion fra C3-C4-solventafasfaltering af en remanens. Den består af carbonhydrider, overvejende større end C25, og koger omtrent over 400 oC.] |
265-096-0 |
64741-95-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-457-00-3 |
destillater (råolie), solventraffinerede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cST ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-097-6 |
64741-96-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-458-00-9 |
destillater (råolie), solventraffinerede lette naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som raffinatet fra en solventekstraktionsproces. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-098-1 |
64741-97-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-459-00-4 |
restolier (råolie), solventraffinerede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som den solventuopløselige fraktion fra solventraffinering af en remanens, ved at anvende et polært organisk solvent, såsom phenol eller furfural. Den består af carbonhydrider, overvejende C25, og koger omtrent over 400 oC.] |
265-101-6 |
64742-01-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-460-00-X |
destillater (råolie), lerbehandlede tunge paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremkommet ved behandling af en råoliefraktion med naturligt eller modificeret ler, i enten en kontakt- eller perkoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede carbonhydrider.] |
265-137-2 |
64742-36-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-461-00-5 |
destillater (råolie), lerbehandlede lette paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremkommet ved behandling af en råoliefraktion med naturligt eller modificeret ler, i enten en kontakt- eller perkoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede carbonhydrider.] |
265-138-8 |
64742-37-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-462-00-0 |
restolier (råolie), lerbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved behandling af en restolie med naturligt eller modificeret ler, i enten en kontakt- eller prekoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende større end C25, og koger omtrent over 400 oC.] |
265-143-5 |
64742-41-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-463-00-6 |
destillater (råolie), lerbehandlede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremkommet ved behandling af en råoliefraktion med naturligt eller modificeret ler, i enten en kontakt- eller perkoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-146-1 |
64742-44-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-464-00-1 |
destillater (råolie), lerbehandlede lette naphthen-; uspecificeret baseolie; [en sammensat blanding a carbonhydrider fremkommet ved behandling af en råoliefraktion med naturligt eller modificeret ler, i enten en kontakt- eller perkoleringsproces, til fjernelse af spormængderne af polære forbindelser og tilstedeværende urenheder. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-147-7 |
64742-45-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-465-00-7 |
destillater (råolie), hydrogenbehandlede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider, opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-155-0 |
64742-52-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-466-00-2 |
destillater (råolie), hydrogenbehandlede lette naphten-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-156-6 |
64742-53-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-467-00-8 |
destillater (råolie), hydrogenbehandlede tunge paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede carbonhydrider.] |
265-157-1 |
64742-54-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-468-00-3 |
destillater (råolie), hydrogenbehandlede lette paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder en forholdsvis stor del mættede carbonhydrider.] |
265-158-7 |
64742-55-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-469-00-9 |
destillater (råolie), solventafvoksede lette paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved fjernelse af normalparaffiner fra en råoliefraktion ved solvenkrystallisation. Den består overvejende af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC.] |
265-159-2 |
64742-56-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-470-00-4 |
restolier (råolie), hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle en råoliefraktion med hydrogen i tilstedeværelse af en katalysator. Den består af carbonhydrider, overvejende større end C25, og koger omtrent over 400 oC.] |
265-160-8 |
64742-57-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-471-00-X |
restolier (råolie), solventafvoksede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved fjernelse af lange, forgrenede carbonhydrider fra en restolie ved solventkrystallisation. Den består af carbonhydrider, overvejende større end C25, og koger omtrent over 400 oC.] |
265-166-0 |
64742-62-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-472-00-5 |
destillater (råolie), solventafvoksede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved fjernelse af normalparaffiner fra en råoliefraktion ved solventkrystallisation. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet ikke mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-167-6 |
64742-63-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-473-00-0 |
destillater (råolie), solventafvoksede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved fjernelse af normalparaffiner fra en råoliefraktion ved solventkrystallisation. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-168-1 |
64742-64-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-474-00-6 |
destillater (råolie), solventafvoksede tunge naphthen-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved fjernelse af normalparaffiner fra en råoliefraktion ved solventkrystallisation. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet ikke mindre end 19cSt ved 40 oC.] |
265-169-7 |
64742-65-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-475-00-1 |
naphthenolier (råolie), katalytisk afvoksede tunge; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk afvoksningsproces. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-172-3 |
64742-68-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-476-00-7 |
naphthenolier (råolie), katalytisk afvoksede lette; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk afvoksningsproces. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-173-9 |
64742-69-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-477-00-2 |
paraffinolier (råolie), katalytisk afvoksede tunge; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk afvoksningsproces. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC.] |
265-174-4 |
64742-70-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-478-00-8 |
paraffinolier (råolie), katalytisk afvoksede lette; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk afvoksningsproces. Den består overvejende af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC.] |
265-176-5 |
64742-71-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-479-00-3 |
naphthenolier (råolie), sammensatte afvoksede tunge; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at fjerne ligekædede paraffincarbonhydrider som et fast stof ved behandling med et reagens, såsom urinstof. Den består af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på mindst 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
265-179-1 |
64742-75-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-480-00-9 |
naphthenolier (råolie), komplekse afvoksede lette; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en katalytisk afvoksningsproces. Den består af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder relativt få normalparaffiner.] |
265-180-7 |
64742-76-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-481-00-4 |
smøreolier (råolie), C20-50, hydrogenbehandlede olie baseret, høj viskositet; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle let vakuumgasolie, tung vakuumgasolie og solvent afasfalteret restolie med hydrogen, i tilstedeværelse af en katalysator, i en to trinsproces med afvoksning udført mellem de to trin. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på omtrent 112cSt ved 40 oC. Den indeholder en relativ stor mængde af mættede carbonhydrider.] |
276-736-3 |
72623-85-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-482-00-X |
smøreolier (råolie), C15-30, hydrogenbehandlede neutral olie baserede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider, opnået ved at behandle let vakuumgasolie, tung vakuumgasolie og solvent afasfalteret restolie med hydrogen, i tilstedeværelse af en katalysator, i en to trinsproces med afvoksning udført mellem de to trin. Den består overvejende af carbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på omtrent 15cSt ved 40 oC. Den indeholder en relativ stor mængde mættede carbonhydrider.] |
276-737-9 |
72623-86-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-483-00-5 |
smøreolier (råolie), C20-50, hydrogenbehandlede neutral olie baserede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandle let vakuumgasolie, tung vakuumgasolie og solvent afasfalteret restolie med hydrogen, i tilstedeværelse af en katalysator, i en to trinsproces med afvoksning udført mellem de to trin. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på omtrent 32cSt ved 40 oC. Den indeholder en forholdsvis stor mængde mættede carbonhydrider.] |
276-738-4 |
72623-87-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-484-00-0 |
smøreolier; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventekstraktion og afvoksningsprocesser. Den består overvejende af mættede carbonhydrider, C15 til og med C50.] |
278-012-2 |
74869-22-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-485-00-6 |
destillater (råolie), sammensatte afvoksede tunge paraffin-; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved afvoksning af et tungt paraffindestillat. Den består overvejende af carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie med en viskositet på 19cSt eller mere ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
292-613-7 |
90640-91-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-486-00-1 |
destillater (råolie), sammensatte afvoksede lette patraffin-; uspecificeret baseolie; (en sammensat blanding af carbonhydrider opnået ved afvoksning af et let paraffindestillat. Det består overvejende af carbonhydrider, overvejende C12 til og med C30, og danner en færdig olie med en viskositet på mindre end 19cSt ved 40 oC. Den indeholder forholdsvis få normalparaffiner.] |
292-614-2 |
90640-92-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-487-00-7 |
destillater (råolie), solventafvoksede tunge paraffin-, lerbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved en afvoksning af et tungt paraffindestillat med neutral eller modificeret ler i enten en kontakt- eller perkoleringsproces. Den består overvejende af cartonhydrider, overvejende C20 til og med C50.] |
292-616-3 |
90640-94-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-488-00-2 |
carbonhydrider, C20-50, solventafvoksede tunge paraffin-, hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved at behandle et afvokset tungt paraffindestillat med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende C20 til og med C50.] |
292-617-9 |
90640-95-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-489-00-8 |
destillater (råolie), solventafvoksede lette paraffin-, lerbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremkommet ved behandling af et afvokset let paraffindestillat med naturligt eller modificeret ler i enten en kontakt- eller perkoleringsproces. Den består overvejende af carbonhydrider, overvejende C15 til og med C30.] |
292-618-4 |
90640-96-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-490-00-3 |
destillater (råolie), solventafvoksede lette paraffin-, hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider fremstillet ved at behandle et afvokset let paraffindestillat med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende C15 til og med C30.] |
292-620-5 |
90640-97-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-491-00-9 |
restolier (olie), hydrogenbehandlede, solventafvoksede; uspecificeret baseolie; |
292-656-1 |
90669-74-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-492-00-4 |
restolier (råolie) katalytisk afvoksede; uspecificeret baseolie |
294-843-3 |
91770-57-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-493-00-X |
destillater (råolie), afvoksede tunge paraffin-, hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået fra en intensiv hydrogenbehandling af afvokset destillat i tilstedeværelse af en katalysator. Den består overvejende af mættede carbonhydrider, overvejende C25 til og med C39, og danner en færdig olie med en viskositet på omtrent 44 cSt ved 50 oC.] |
295-300-3 |
91995-39-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-494-00-5 |
destillater (råolie), afvoksede lette paraffin-, hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået fra en intensiv hydrogenbehandling af afvoksede destillater i tilstedeværelse af en katalysator. Den består overvejende af mættede carbonhydrider, overvejende C21 til og med C29, og danner en færdig olie med en viskositet på omtrent 13cSt ved 50 oC.] |
295-301-9 |
91995-40-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-495-00-0 |
destillater (råolie), hydrokrakkede solventraffinerede, afvoksede; uspecificeret baseolie; [en sammensat blanding af flydende carbonhydrider opnået ved rekrystallisation af afvoksede, hydrokrakkede, solventraffinerede råoliedestillater.] |
295-306-6 |
91995-45-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-496-00-6 |
destillater (råolie), solventafvoksede lette naphthen-, hydrogenbehandlede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved at behandlede en råoliefraktion med hydrogen i tilstedeværelse af en katalysator og fjerne de aromatiske carbonhydrider ved solventekstraktion. Den består overvejende af naphthencarbonhydrider, overvejende C15 til og med C30, og danner en færdig olie med en viskositet på mellem 13cSt og 15cSt ved 40 oC.] |
295-316-0 |
91995-54-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-497-00-1 |
smøreolier (råolie), C17-35-, solvent-ekstraherede, afvoksede, hydrogenbehandlede; uspecificeret baseolie |
295-423-2 |
92045-42-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-498-00-7 |
smøreolier (råolie), hydrokrakkede ikke-aromatiske solvent-afparaffinerede; uspecificeret baseolie |
295-424-8 |
92045-43-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-499-00-2 |
restolier (råolie), hydrokrakkede syrebehandlede solventafvoksede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider, fremstillet ved solventfjernelse af praffiner fra resten fra destillationen af syrebehandlede, hydrokrakkede tunge praffiner, og koger omtrent over 380 oC.] |
295-499-7 |
92061-86-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-500-00-6 |
paraffinolier (råolier), solventraffinerede afvoksede tunge; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået fra svovlholdig paraffinråolie. Den består overvejende af en solventraffineret, afparaffineret smøreolie med en viskositet på 65cSt ved 50 oC.] |
295-810-6 |
92129-09-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-501-00-1 |
smøreolier (råolie), basisolier, paraffinske; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved raffinering af råolie. Den består overvejende of aromater, naphthener og paraffiner, og danner en færdig olie med en viskositet på 23cSt ved 40 oC).] |
297-474-6 |
93572-43-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-502-00-7 |
carbonhydrider, hydrokrakkede paraffiniske destillationsrester, solventafvoksede; uspecificeret baseolie |
297-857-8 |
93763-38-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-503-00-2 |
carbonhydrider, C20-50, restolie-hydrogenerings-vakuumdestillat-; uspecificeret baseolie |
300-257-1 |
93924-61-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-504-00-8 |
destillater (råolie), solvent-raffinerede hydrogenbehandlede tunge, hydrogenerede; uspecificeret baseolie |
305-588-5 |
94733-08-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-505-00-3 |
destillater (råolie), solventraffinerede hydrokrakkede lette; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solvent afaromatisering af resten fra hydrokrakket råolie. Den består overvejende af carbonhydrider, overvejende C18 til og med C27, med kogeinterval omtrent fra 370 oC til 450 oC.] |
305-589-0 |
94733-09-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-506-00-9 |
smøreolier (råolie), C18-40, solventafvoksede hydrokrakkede destillatbaserede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventafparaffinering af destillationsresten fra hydrorakket råolie. Den består overvejende af carbonhydrider, overvejende C18 til og med C40, med kogeinterval omtrent fra 370 oC til 550 oC.] |
305-594-8 |
94733-15-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-507-00-4 |
smøreolier (råolie), C18-40, solventafvoksede hydrokrakkede raffinatbaserede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventafparaffinering af det hydrogenerede raffinat, opnået ved solventekstraktion af et hydrogenbehandlet råoliedestillat. Den består overvejende af carbonhydrider, overvejende C18 til og med C40, med kogeinterval omtrent fra 370 oC til 550 oC.] |
305-595-3 |
94733-16-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-508-00-X |
carbonhydrider, C13-30-, aromatrige, solvent-ekstraherede naphthenske destillater; uspecificeret baseolie |
305-971-7 |
95371-04-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-509-00-5 |
carbonhydrider, C16-32-, aromatrige, solvent-ekstraherede naphthenske destillater; uspecificeret baseolie |
305-972-2 |
95371-05-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-510-00-0 |
carbonhydrider, C37-68, afvoksede afasfalterede hydrogenbehandlede vakuumdestillationsrester; uspecificeret baseolie |
305-974-3 |
95371-07-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-511-00-6 |
carbonhydrider, C37-65-, hydrogenbehandlede afasfalterede vakuumdestillationsrester; uspecificeret baseolie |
305-975-9 |
95371-08-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-512-00-1 |
destillater (råolie), hydrokrakkede solventraffinerede, lette; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventbehandlingen af et destillat fra hydrokrakkede råoliedestillater. Den består overvejende af carbonhydrider, overvejende C18 til og med C27, med kogeinterval omtrent fra 370 oC til 450 oC.] |
307-010-7 |
97488-73-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-513-00-7 |
destillater (råolie), solventraffinerede hydrogenerede tunge; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved behandlingen af et hydrogeneret råoliedestillat med et solvent. Den består overvejende af carbonhydrider, overvejende C19 til og med C40, med kogeinterval omtrent fra 390 oC til 550 oC.] |
307-011-2 |
97488-74-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-514-00-2 |
smøreolier (råolie), C18-27-, hydrokrakkede solvent-afvoksede; uspecificeret baseolie |
307-034-8 |
97488-95-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-515-00-8 |
carbonhydrider, C17-30-, hydrogenbehandlet solvent-afasfalteret atmosfærisk destillationsrest, lette destillater; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som forløb fra vakuumdestillationen af udløb fra behandlingen af en solvent-afasfalteret kort rest med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende fra C17 til og med C30, med kogeinterval omtrent fra 300 oC til 400 oC. Den danner en færdig olie med en viskositet på 4cSt ved omtrent 100 oC.] |
307-661-7 |
97675-87-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-516-00-3 |
carbonhydrider, C17-40-, hydrogenbehandlet solvent-afasfalteret destillationsrest, lette vakuumdestillater; uspecificeret baseolie; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået som forløb fra vakuumdestillationen af udløb fra den katalytiske hydrogenbehandling af en solvent-afasfalteret kort rest, med en viskositet på 8cSt ved omtrent 100 oC. Den består overvejende af carbonhydrider, overvejende fra C17 til og med C40, med kogeinterval omtrent fra 300 oC til 500 oC.] |
307-755-8 |
97722-06-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-517-00-9 |
carbonhydrider, C13-27-, solvent-ekstraherede, lette, naphthenske; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved ekstraktion af aromaterne fra et let naphthendestillat med en viskositet på 9,5cSt ved 40 oC. Den består overvejende af carbonhydrider, overvejende fra C13 til og med C27, med kogeinterval omtrent fra 240 oC til 400 oC] |
307-758-4 |
97722-09-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-518-00-4 |
carbonhydrider, C14-29-, solvent-ekstraherede, lette, naphthenske; uspecificeret baseolie; [en sammensat blanding af carbonhydrider, opnået ved ekstraktion af aromaterne fra et let naphthendestillat, med en viskositet på 16cSt ved 40 oC. Den består overvejende af carbonhydrider, overvejende C14 til og med C29, med kogeinterval omtrent fra 250 oC til 425 oC.] |
307-760-5 |
97722-10-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-519-00-X |
carbonhydrider, C27-42-, dearomatiserede; uspecificeret baseolie |
308-131-8 |
97862-81-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-520-00-5 |
carbonhydrider, C17-30-, hydrogenbehandlede destillater, lette destillationsfraktioner; uspecificeret baseolie |
308-132-3 |
97862-82-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-521-00-0 |
carbonhydrider, C27-45-, naphthenske vakuumdistillations-; uspecificeret baseolie |
308-133-9 |
97862-83-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-522-00-6 |
carbonhydrider, C27-45-, dearomatiserede; uspecificeret baseolie |
308-287-7 |
97926-68-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-523-00-1 |
carbonhydrider, C20-58-, hydrogenbehandlede; uspecificeret baseolie |
308-289-8 |
97926-70-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-524-00-7 |
carbonhydrider, C27-42-, naphthenske; uspecificeret baseolie |
308-290-3 |
97926-71-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-525-00-2 |
restolier (råolie), carbonbehandlede, solventafvoksede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved behandlingen af solventafvoksede råolierestolier med aktivt kul, for at fjerne spor af polære bestanddele og urenheder.] |
309-710-8 |
100684-37-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-526-00-8 |
restolier (råolie), lerbehandlede solventafvoksede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider, opnået ved behandling af solventafvoksede råolierestolier med blegejord, for at fjerne spor af polære bestanddele og urenheder.] |
309-711-3 |
100684-38-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-527-00-3 |
smøreolier (råolie), C >25-, solventekstraherede, afasfalterede, afvoksede, hydrogenerede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventekstraktion og hydrogenering af vakuumdestillationsrester. Den består overvejende af carbonhydrider, overvejende større end C25, og danner en færdig olie med en viskositet i området 32cSt til 37cSt ved 100 oC.] |
309-874-0 |
101316-69-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-528-00-9 |
smøreolier (råolie), C17-32-, solventekstraherede, afvoksede, hydrogenerede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventekstraktion og hydrogenering af atmosfærisk destillationsrester. Den består overvejende af carbonhydrider, overvejende C17 til og med C32, og danner en færdig olie med en viskositet i området fra 17cSt til 23cSt ved 40 oC.] |
309-875-6 |
101316-70-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-529-00-4 |
smøreolier (råolie), C20-35-, solventekstraherede, afvoksede, hydrogenerede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventekstraktion of hydrogenering af atmosfærisk destillationsrester. Den består overvejende af carbonhydrider, overvejende C20 til og med C35, og danner en færdig olie med en viskositet i området fra 37cSt til 44cSt ved 40 oC.] |
309-876-1 |
101316-71-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-530-00-X |
smøreolier (råolie), C24-50-, solventekstraherede, afvoksede, hydrogenerede; uspecificeret baseolie; [en sammensat blanding af carbonhydrider opnået ved solventekstraktion of hydrogenering af atmosfærisk destillationsrester. Den består overvejende af carbonhydrider, overvejende C24 til og med C, og danner en færdig olie med en viskositet i området fra 16cSt til 75cSt ved 40 oC.] |
309-877-7 |
101316-72-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-531-00-5 |
ekstrakter (råolie), tungt naphthendestillat solvent-, aromatkoncentrat; aromatisk ekstrakt af destillat (behandlet); [et aromatkoncentrat fremstillet ved at sætte vand til solventekstrakter og ekstraktionssolvent af tungt naphthadestillat.] |
272-175-3 |
68783-00-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-532-00-0 |
ekstrakter (råolie), solventraffineret tungt paraffindestillat solvent-; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som ekstraktet fra re-ekstraktionen af solventraffineret, tungt paraffindestillat. Den består af mættede og aromatiske carbonhydrider, overvejende C20 til og med C50.] |
272-180-0 |
68783-04-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-533-00-6 |
ekstrakter (råolie), tunge paraffindestillater, solvent-afasfalterede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som ekstraktet fra en solventekstraktion af tungt paraffindestillat.] |
272-342-0 |
68814-89-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-534-00-1 |
ekstrakter (råolie), tungt naphthendestillat solvent-, hydrogenbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved behandling af et tungt naphthendestillatsolventekstrakt med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, overvejende C20 til og med C50, og danner en færdig olie på mindst 19cSt ved 40 oC.] |
292-631-5 |
90641-07-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-535-00-7 |
ekstrakter (råolie), tungt paraffindestillat solvent-, hydrogenbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider fremstillet ved at behandle et tungt paraffindestillat-solventekstrakt med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende C21 til og med C33, med kogeinterval omtrent fra 350 oC til 480 oC.] |
292-632-0 |
90641-08-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-536-00-2 |
ekstrakter (råolie), let paraffindestillat solvent-, hydrogenbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider fremstillet ved at behandle et let paraffindestillat-solventekstrakt med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af carbonhydrider, overvejende C17 til og med C26, med kogeinterval omtrent fra 280 oC til og med 400 oC.] |
292-633-6 |
90641-09-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-537-00-8 |
ekstrakter (råolie), hydrogenbehandlet let paraffindestillat solvent-; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som ekstraktet fra solventekstraktion af et intermediært paraffintopsolventdestillat, der er behandlet med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, overvejende C16 til og med C36.] |
295-335-4 |
91995-73-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-538-00-3 |
ekstrakter (råolie), let naphthendestillat solvent-, hydroafsvovlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved at behandle ekstraktet, opnået fra en solventekstraktionsproces, med hydrogen i tilstedeværelse af en katalysator under betingelser primært til fjernelse af svovlforbindelser. Den består overvejende af aromatiske carbonhydrider, overvejende C15 til og med C30. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider, bestående af 4- til 6-leddede kondenserede ringe.] |
295-338-0 |
91995-75-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-539-00-9 |
ekstrakter (råolie), let paraffindestillat solvent-, syrebehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som en fraktion fra destillationen af et ekstrakt fra solventekstraktionen af lette paraffintopfraktion-råoliedestillater, der er underkastet en svovlsyreraffinering. Den består overvejende af aromatiske carbonhydrider, overvejende C16 til og med C32.] |
295-339-6 |
91995-76-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-540-00-4 |
ekstrakter (råolie), let paraffindestillat solvent-, hydroafsvovlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved solventekstraktion af et let paraffindestillat og behandlet med hydrogen for at omdanne organisk svovl til hydrogensulfid, det fjernes. Den består overvejende af carbonhydrider, overvejende C15 til og med C40, og danner en færdig olie med viskositet på mere end 10cSt ved 40 oC.] |
295-340-1 |
91995-77-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-541-00-X |
ekstrakter (råolie), let vakuumgasolie solvent-, hydrogenbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider, opnået ved solventekstraktion af let vakuumråoliegasolier og behandlet med hydrogen i tilstedeværelse af en katalysator. Den består overvejende af aromatiske carbonhydrider, overvejende C13 til og med C30.] |
295-342-2 |
91995-79-8 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-542-00-5 |
ekstrakter (råolie), tungt paraffindestillat solvent-, lerbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået fra behandling af en råoliefraktion med naturligt eller modificeret ler i enten en kontakt- eller perkolationsproces for at fjerne spormængderne af polære forbindelser eller tilstedeværende urenheder. Den består overvejende af aromatiske carbonhydrider, overvejende C20 til og med C50. Denne strøm indeholder sandsynligvis 5 vægtprocent, eller mere, aromatiske carbonhydrider bestående af 4- til 6-leddede kondenserede ringe) |
296-437-1 |
92704-08-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-543-00-0 |
ekstrakter (råolie), tungt naphthendestillat solvent-, hydroafsvovlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved et råolieråstof ved behandling med hydrogen for at omdanne organisk svovl til hydrogensulfid, der fjernes. Den består overvejende af carbonhydrider, overvejende C15 til og med C50, og danner en færdig olie med en viskositet større end 19cSt ved 40 oC.] |
297-827-4 |
93763-10-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-544-00-6 |
ekstrakter (råolie), solventafvoksende tunge paraffindestillatsolvent-, hydroafsvovlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået fra et solventafvokset råolieråstof ved behandling med hydrogen for at omdanne organisk svovl til hydrogensulfid, der fjernes. Den består overvejende af carbonhydrider, overvejende C15 til og med C50, og danner en færdig olie med en viskositet større end 19cSt ved 40 oC.] |
297-829-5 |
93763-11-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-545-00-1 |
ekstrakter (råolie), let paraffindestillat solvent-, carbonbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som en fraktion fra destillation af et ekstrakt, genvundet ved solventekstraktion af let paraffin topråoliedestillat behandlet med aktivt kul, for at fjerne spor af polære bestanddele og urenheder. Den består overvejende af aromatiske carbonhydrider, overvejende C16 til og med C32.] |
309-672-2 |
100684-02-4 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-546-00-7 |
ekstrakter (råolie), let paraffindestillat solvent-, lerbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået som en fraktion fra destillation af et ekstrakt genvundet ved solventekstraktion af let paraffin-topråoliedestillat, behandlet med blegejord, for at fjerne spor af polære bestanddele og urenheder. Den består overvejende af aromatiske carbonhydrider, overvejende C16 til og med C32.] |
309-673-8 |
100684-03-5 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-547-00-2 |
ekstrakter (råolie), let vakuum, gasoliesolvent, carbonbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved solventekstraktion af let vakuumråoliegasolie behandlet med aktivt kul, for at fjerne spor af polære bestanddele og urenheder. Den består overvejende af aromatiske carbonhydrider, overvejende C13 til C30.] |
309-674-3 |
100684-04-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-548-00-8 |
ekstrakter (råolie), let vakuumgasolie solvent-, lerbehandlede; aromatisk ekstrakt af destillat (behandlet); [en sammensat blanding af carbonhydrider opnået ved solventekstraktion af lette vakuumgasolier behandlede med blegejord, for at fjerne spor af polære bestanddele og urenheder. Den består overvejende af aromatiske carbonhydrider, overvejende C13 til og med C30.] |
309-675-9 |
100684-05-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-549-00-3 |
foots olie (råolie), solventekstraherede eller afvoksede tunge restolier [en sammensat blanding af carbonhydrider opnået som oliefraktionen fra en solventafolierings-eller vokssvedningsproces. Den består overvejende af forgrenede carbonhydrider, overvejende C20 til og med C50.] |
265-171-8 |
64742-67-2 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
649-550-00-9 |
foot's oil (råolie), hydrogenbehandlet; solventekstraherede eller afvoksede tunge restolier |
295-394-6 |
92045-12-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
L |
|
650-002-00-6 |
terpentinolie |
232-350-7 |
8006-64-2 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H226 H332 H312 H302 H304 H319 H315 H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H304 H319 H315 H317 H411 |
|
|
|
|
650-003-00-1 |
fenson (ISO); 4-chlorphenyl-benzensulfonat |
201-274-6 |
80-38-6 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H302 H319 H411 |
GHS07 GHS09 Wng |
H302 H319 H411 |
|
|
|
|
650-004-00-7 |
norbormid (ISO); 5-(α-hydroxy-α-2-pyridylbenzyl)-7-(α-2-pyridylbenzyliden)bicyclo[2.2.1] hept-5-en-2,3-dicarboximid |
213-589-6 |
991-42-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
650-005-00-2 |
(2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]cromen-6-on, rotenon |
201-501-9 |
83-79-4 |
Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H335 H315 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H335 H315 H410 |
|
|
|
|
650-006-00-8 |
benquinox (ISO); p-benzoquinon-1-benzoylhy drazon-4-oxim |
207-807-9 |
495-73-8 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
650-007-00-3 |
chlordimeform (ISO); N2-(4-chlor-o-tolyl)-N1,N1-dimethylformamidin |
228-200-5 |
6164-98-3 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
|
|
|
|
650-008-00-9 |
drazoxolon (ISO); 4-(2-chlorphenylhydrazono)-3-methyl-5-isoxazolon |
227-197-8 |
5707-69-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
650-009-00-4 |
chlordimeformhydrochlorid; N'-(4-chlor-o-tolyl)-N,N-dimethylformamidinmonohydrochlorid; N2-(4-chlor-o-tolyl)-N1,N1-dimethylformamidin hydorchlorid |
243-269-1 |
19750-95-9 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
650-010-00-X |
benzyl violet 4B; α-[4-(4-dimethylamino-α-{4-[ethyl(3-natriosulfonatobenzyl)amino] phenyl}benzyliden)cyclohexa-2,5-dienyliden(ethyl)ammonio]toluen-3-sulfonat |
216-901-9 |
1694-09-3 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
650-012-00-0 |
erionit |
— |
12510-42-8 |
Carc. 1A |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
650-013-00-6 |
asbest |
— — — — — — — |
12001-28-4 132207-32-0 12172-73-5 77536-66-4 77536-68-6 77536-67-5 12001-29-5 |
Carc. 1A STOT RE 1 |
H350 H372 ** |
GHS08 Dgr |
H350 H372 ** |
|
|
|
|
650-014-00-1 |
diethyl-2,4-dihydroxycyclodisiloxan-2,4-diylbis(trimethylen)diphosphonat, tetranatriumsalt, reaktionsprodukter med dinatriummetasilicat |
401-770-4 |
— |
Skin Corr. 1B Acute Tox. 4 * |
H314 H302 |
GHS05 GHS07 Dgr |
H314 H302 |
|
|
|
|
650-015-00-7 |
terpentinfri harpiks kolophonium |
232-475-7 232-484-6 277-299-1 |
8050-09-7 8052-10-6 73138-82-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
650-016-00-2 |
mineraluld, undtagen sådan nævnt andetsteds i dette bilag; [syntetiske glasfibre (silikatfibre) uden bestemt orientering med indhold af alkalioxider og jordalkalioxider (Na2O+K2O+CaO+MgO+BaO) over 18 % (w/w)] |
— |
— |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
AQR |
|
650-017-00-8 |
ildfaste keramiske fibre, specialfibre, undtagen sådanne nævnt andetsteds i dette bilag; [syntetiske glasfibre (silikatfibre) uden bestemt orientering med indhold af alkalioxider og jordalkalioxider (Na2O+K2O+CaO+MgO+BaO) over 18 % (w/w)] |
— |
— |
Carc. 1B |
H350i |
GHS08 Dgr |
H350i |
|
|
AR |
|
650-018-00-3 |
reaktionsprodukt af acetophenon, formaldehyd, cyclohexylamin, methanol og eddikesyre |
406-230-1 |
— |
Flam. Liq. 3 Carc. 2 Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H351 H314 H332 H317 H400 H410 |
GHS02 GHS08 GHS05 GHS07 GHS09 Dgr |
H226 H351 H314 H332 H317 H410 |
|
|
|
|
650-031-00-4 |
bis(4-hydroxy-N-methylanilinium)sulfat |
200-237-1 |
55-55-0 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
650-041-00-9 |
triasulfuron (ISO); 1-[2-(2-chlorethoxy)phenylsulfonyl] -3-(4-methoxy-6-methyl- 1,3,5-triazin-2-yl)urinstof |
— |
82097-50-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
650-042-00-4 |
reaktionsprodukt af polyethylen-polyamin-(C16-C18)-alkylamider og monothio-(C2)-alkyl phosphonater |
417-450-2 |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H315 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
|
|
|
|
650-043-00-X |
reaktionsprodukt af 3,5-bis-tert-butylsalicylsyre og aluminiumsulfat |
420-310-3 |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
650-044-00-5 |
blanding af ligekædede og forgrenede C14- 15 alkoholer ethoxylerede, reaktionsprodukt med epichlorhydrin |
420-480-9 |
158570-99-1 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
650-045-00-0 |
reaktionsprodukt af 1,2,3-propantricarboxylsyre, 2-hydroxy, diethylester, 1-propanol og zirconium tetra-n-propanolat |
417-110-3 |
— |
Flam. Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H225 H315 H318 H411 |
GHS02 GHS05 GHS09 Dgr |
H225 H315 H318 H411 |
|
|
|
|
650-046-00-6 |
di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamiddisulfonat, kobber(II)kompleks, derivater |
416-180-2 |
12222-04-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
650-047-00-1 |
dibenzylphenylsulfonium hexafluorantimonat |
417-760-8 |
134164-24-2 |
STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H372 ** H302 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H372 ** H302 H318 H317 H411 |
|
|
|
|
650-048-00-7 |
reaktionsprodukt af borax, hydrogenperoxid, eddikesyreanhydrid og eddikesyre |
420-070-1 |
— |
Org. Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H242 H332 H312 H302 H314 H400 |
|
|
|
|
650-049-00-2 |
2-alkoyloxyethyl hydrogenmaleat, hvor alkoyl (vægtmæssigt) udgør 70 til 85 % umættet octadecoyl, 0.5 til 10 % mættet octadecoyl, og 2 til 18 % mættet hexadecoyl |
417-960-5 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
650-050-00-8 |
en blanding af 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamat og/eller 3-hydroxybutyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamat; 1,3-butandiol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionat] isomerer; 1,3-butandiol bis[3-(3',5'-(1,1-dimethylethyl)-4'-hydroxyphenyl)propionat] isomerer |
423-600-8 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
650-055-00-5 |
sølvnatriumzirconiumhydrogenphosphat |
422-570-3 |
155925-27-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
